diff --git a/.gitlab-ci.yml b/.gitlab-ci.yml index 1b7c03ebb..aad28a2d8 100644 --- a/.gitlab-ci.yml +++ b/.gitlab-ci.yml @@ -48,6 +48,7 @@ benchmark: unit-testing: stage: test + retry: 2 cache: &testing_cache_policy <<: *global_cache_policy policy: pull @@ -80,6 +81,7 @@ unit-testing: unit-testing-rum: stage: test + retry: 2 cache: *testing_cache_policy services: - name: minibikini/postgres-with-rum:12 diff --git a/CHANGELOG.md b/CHANGELOG.md index 15a073c64..feda41320 100644 --- a/CHANGELOG.md +++ b/CHANGELOG.md @@ -4,23 +4,127 @@ All notable changes to this project will be documented in this file. The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/). ## [unreleased] + ### Changed -- **Breaking:** BBCode and Markdown formatters will no longer return any `\n` and only use `
` for newlines +
+ API Changes +- **Breaking:** Emoji API: changed methods and renamed routes. +
### Removed - **Breaking:** removed `with_move` parameter from notifications timeline. ### Added +- Instance: Extend `/api/v1/instance` with Pleroma-specific information. - NodeInfo: `pleroma:api/v1/notifications:include_types_filter` to the `features` list. +- NodeInfo: `pleroma_emoji_reactions` to the `features` list. - Configuration: `:restrict_unauthenticated` setting, restrict access for unauthenticated users to timelines (public and federate), user profiles and statuses. +- Configuration: Add `:database_config_whitelist` setting to whitelist settings which can be configured from AdminFE. +- New HTTP adapter [gun](https://github.com/ninenines/gun). Gun adapter requires minimum OTP version of 22.2 otherwise Pleroma won’t start. For hackney OTP update is not required. +- Mix task to create trusted OAuth App. +- Notifications: Added `follow_request` notification type. +- Added `:reject_deletes` group to SimplePolicy
API Changes +- Mastodon API: Extended `/api/v1/instance`. - Mastodon API: Support for `include_types` in `/api/v1/notifications`. +- Mastodon API: Added `/api/v1/notifications/:id/dismiss` endpoint. +- Mastodon API: Add support for filtering replies in public and home timelines +- Admin API: endpoints for create/update/delete OAuth Apps. +- Admin API: endpoint for status view.
+### Fixed +- Support pagination in conversations API +- **Breaking**: SimplePolicy `:reject` and `:accept` allow deletions again +- Fix follower/blocks import when nicknames starts with @ +- Filtering of push notifications on activities from blocked domains +- Resolving Peertube accounts with Webfinger + +## [Unreleased (patch)] + +### Fixed +- Healthcheck reporting the number of memory currently used, rather than allocated in total +- `InsertSkeletonsForDeletedUsers` failing on some instances + +## [2.0.3] - 2020-05-02 + +### Security +- Disallow re-registration of previously deleted users, which allowed viewing direct messages addressed to them +- Mastodon API: Fix `POST /api/v1/follow_requests/:id/authorize` allowing to force a follow from a local user even if they didn't request to follow +- CSP: Sandbox uploads + +### Fixed +- Notifications from blocked domains +- Potential federation issues with Mastodon versions before 3.0.0 +- HTTP Basic Authentication permissions issue +- Follow/Block imports not being able to find the user if the nickname started with an `@` +- Instance stats counting internal users +- Inability to run a From Source release without git +- ObjectAgePolicy didn't filter out old messages +- `blob:` urls not being allowed by CSP + +### Added +- NodeInfo: ObjectAgePolicy settings to the `federation` list. +- Follow request notifications +
+ API Changes +- Admin API: `GET /api/pleroma/admin/need_reboot`. +
+ +### Upgrade notes + +1. Restart Pleroma +2. Run database migrations (inside Pleroma directory): + - OTP: `./bin/pleroma_ctl migrate` + - From Source: `mix ecto.migrate` + + +## [2.0.2] - 2020-04-08 +### Added +- Support for Funkwhale's `Audio` activity +- Admin API: `PATCH /api/pleroma/admin/users/:nickname/update_credentials` + +### Fixed +- Blocked/muted users still generating push notifications +- Input textbox for bio ignoring newlines +- OTP: Inability to use PostgreSQL databases with SSL +- `user delete_activities` breaking when trying to delete already deleted posts +- Incorrect URL for Funkwhale channels + +### Upgrade notes +1. Restart Pleroma + +## [2.0.1] - 2020-03-15 +### Security +- Static-FE: Fix remote posts not being sanitized + +### Fixed +- 500 errors when no `Accept` header is present if Static-FE is enabled +- Instance panel not being updated immediately due to wrong `Cache-Control` headers +- Statuses posted with BBCode/Markdown having unncessary newlines in Pleroma-FE +- OTP: Fix some settings not being migrated to in-database config properly +- No `Cache-Control` headers on attachment/media proxy requests +- Character limit enforcement being off by 1 +- Mastodon Streaming API: hashtag timelines not working + +### Changed +- BBCode and Markdown formatters will no longer return any `\n` and only use `
` for newlines +- Mastodon API: Allow registration without email if email verification is not enabled + +### Upgrade notes +#### Nginx only +1. Remove `proxy_ignore_headers Cache-Control;` and `proxy_hide_header Cache-Control;` from your config. + +#### Everyone +1. Run database migrations (inside Pleroma directory): + - OTP: `./bin/pleroma_ctl migrate` + - From Source: `mix ecto.migrate` +2. Restart Pleroma + ## [2.0.0] - 2019-03-08 ### Security -- Mastodon API: Fix being able to request enourmous amount of statuses in timelines leading to DoS. Now limited to 40 per request. +- Mastodon API: Fix being able to request enormous amount of statuses in timelines leading to DoS. Now limited to 40 per request. ### Removed - **Breaking**: Removed 1.0+ deprecated configurations `Pleroma.Upload, :strip_exif` and `:instance, :dedupe_media` @@ -64,7 +168,7 @@ The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/). - **Breaking:** Admin API: Return link alongside with token on password reset - **Breaking:** Admin API: `PUT /api/pleroma/admin/reports/:id` is now `PATCH /api/pleroma/admin/reports`, see admin_api.md for details - **Breaking:** `/api/pleroma/admin/users/invite_token` now uses `POST`, changed accepted params and returns full invite in json instead of only token string. -- **Breaking** replying to reports is now "report notes", enpoint changed from `POST /api/pleroma/admin/reports/:id/respond` to `POST /api/pleroma/admin/reports/:id/notes` +- **Breaking** replying to reports is now "report notes", endpoint changed from `POST /api/pleroma/admin/reports/:id/respond` to `POST /api/pleroma/admin/reports/:id/notes` - Mastodon API: stopped sanitizing display names, field names and subject fields since they are supposed to be treated as plaintext - Admin API: Return `total` when querying for reports - Mastodon API: Return `pleroma.direct_conversation_id` when creating a direct message (`POST /api/v1/statuses`) @@ -74,10 +178,12 @@ The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/). - Mastodon API: `pleroma.thread_muted` to the Status entity - Mastodon API: Mark the direct conversation as read for the author when they send a new direct message - Mastodon API, streaming: Add `pleroma.direct_conversation_id` to the `conversation` stream event payload. +- Mastodon API: Add `pleroma.unread_count` to the Marker entity - Admin API: Render whole status in grouped reports - Mastodon API: User timelines will now respect blocks, unless you are getting the user timeline of somebody you blocked (which would be empty otherwise). - Mastodon API: Favoriting / Repeating a post multiple times will now return the identical response every time. Before, executing that action twice would return an error ("already favorited") on the second try. - Mastodon API: Limit timeline requests to 3 per timeline per 500ms per user/ip by default. +- Admin API: `PATCH /api/pleroma/admin/users/:nickname/credentials` and `GET /api/pleroma/admin/users/:nickname/credentials` ### Added diff --git a/COPYING b/COPYING index 0aede0fba..3140c8038 100644 --- a/COPYING +++ b/COPYING @@ -1,4 +1,4 @@ -Unless otherwise stated this repository is copyright © 2017-2019 +Unless otherwise stated this repository is copyright © 2017-2020 Pleroma Authors , and is distributed under The GNU Affero General Public License Version 3, you should have received a copy of the license file as AGPL-3. @@ -23,7 +23,7 @@ priv/static/images/pleroma-fox-tan-shy.png --- -The following files are copyright © 2017-2019 Pleroma Authors +The following files are copyright © 2017-2020 Pleroma Authors , and are distributed under the Creative Commons Attribution-ShareAlike 4.0 International license, you should have received a copy of the license file as CC-BY-SA-4.0. diff --git a/Dockerfile b/Dockerfile index 4f7f12716..29931a5e3 100644 --- a/Dockerfile +++ b/Dockerfile @@ -12,7 +12,7 @@ RUN apk add git gcc g++ musl-dev make &&\ mkdir release &&\ mix release --path release -FROM alpine:3.9 +FROM alpine:3.11 ARG BUILD_DATE ARG VCS_REF @@ -33,7 +33,7 @@ ARG DATA=/var/lib/pleroma RUN echo "http://nl.alpinelinux.org/alpine/latest-stable/community" >> /etc/apk/repositories &&\ apk update &&\ - apk add ncurses postgresql-client &&\ + apk add imagemagick ncurses postgresql-client &&\ adduser --system --shell /bin/false --home ${HOME} pleroma &&\ mkdir -p ${DATA}/uploads &&\ mkdir -p ${DATA}/static &&\ diff --git a/benchmarks/load_testing/activities.ex b/benchmarks/load_testing/activities.ex new file mode 100644 index 000000000..482e42fc1 --- /dev/null +++ b/benchmarks/load_testing/activities.ex @@ -0,0 +1,557 @@ +defmodule Pleroma.LoadTesting.Activities do + @moduledoc """ + Module for generating different activities. + """ + import Ecto.Query + import Pleroma.LoadTesting.Helper, only: [to_sec: 1] + + alias Ecto.UUID + alias Pleroma.Constants + alias Pleroma.LoadTesting.Users + alias Pleroma.Repo + alias Pleroma.Web.CommonAPI + + require Constants + + @defaults [ + iterations: 170, + friends_used: 20, + non_friends_used: 20 + ] + + @max_concurrency 10 + + @visibility ~w(public private direct unlisted) + @types ~w(simple emoji mentions hell_thread attachment tag like reblog simple_thread remote) + @groups ~w(user friends non_friends) + + @spec generate(User.t(), keyword()) :: :ok + def generate(user, opts \\ []) do + {:ok, _} = + Agent.start_link(fn -> %{} end, + name: :benchmark_state + ) + + opts = Keyword.merge(@defaults, opts) + + friends = + user + |> Users.get_users(limit: opts[:friends_used], local: :local, friends?: true) + |> Enum.shuffle() + + non_friends = + user + |> Users.get_users(limit: opts[:non_friends_used], local: :local, friends?: false) + |> Enum.shuffle() + + task_data = + for visibility <- @visibility, + type <- @types, + group <- @groups, + do: {visibility, type, group} + + IO.puts("Starting generating #{opts[:iterations]} iterations of activities...") + + friends_thread = Enum.take(friends, 5) + non_friends_thread = Enum.take(friends, 5) + + public_long_thread = fn -> + generate_long_thread("public", user, friends_thread, non_friends_thread, opts) + end + + private_long_thread = fn -> + generate_long_thread("private", user, friends_thread, non_friends_thread, opts) + end + + iterations = opts[:iterations] + + {time, _} = + :timer.tc(fn -> + Enum.each( + 1..iterations, + fn + i when i == iterations - 2 -> + spawn(public_long_thread) + spawn(private_long_thread) + generate_activities(user, friends, non_friends, Enum.shuffle(task_data), opts) + + _ -> + generate_activities(user, friends, non_friends, Enum.shuffle(task_data), opts) + end + ) + end) + + IO.puts("Generating iterations of activities took #{to_sec(time)} sec.\n") + :ok + end + + def generate_power_intervals(opts \\ []) do + count = Keyword.get(opts, :count, 20) + power = Keyword.get(opts, :power, 2) + IO.puts("Generating #{count} intervals for a power #{power} series...") + counts = Enum.map(1..count, fn n -> :math.pow(n, power) end) + sum = Enum.sum(counts) + + densities = + Enum.map(counts, fn c -> + c / sum + end) + + densities + |> Enum.reduce(0, fn density, acc -> + if acc == 0 do + [{0, density}] + else + [{_, lower} | _] = acc + [{lower, lower + density} | acc] + end + end) + |> Enum.reverse() + end + + def generate_tagged_activities(opts \\ []) do + tag_count = Keyword.get(opts, :tag_count, 20) + users = Keyword.get(opts, :users, Repo.all(Pleroma.User)) + activity_count = Keyword.get(opts, :count, 200_000) + + intervals = generate_power_intervals(count: tag_count) + + IO.puts( + "Generating #{activity_count} activities using #{tag_count} different tags of format `tag_n`, starting at tag_0" + ) + + Enum.each(1..activity_count, fn _ -> + random = :rand.uniform() + i = Enum.find_index(intervals, fn {lower, upper} -> lower <= random && upper > random end) + CommonAPI.post(Enum.random(users), %{"status" => "a post with the tag #tag_#{i}"}) + end) + end + + defp generate_long_thread(visibility, user, friends, non_friends, _opts) do + group = + if visibility == "public", + do: "friends", + else: "user" + + tasks = get_reply_tasks(visibility, group) |> Stream.cycle() |> Enum.take(50) + + {:ok, activity} = + CommonAPI.post(user, %{ + "status" => "Start of #{visibility} long thread", + "visibility" => visibility + }) + + Agent.update(:benchmark_state, fn state -> + key = + if visibility == "public", + do: :public_thread, + else: :private_thread + + Map.put(state, key, activity) + end) + + acc = {activity.id, ["@" <> user.nickname, "reply to long thread"]} + insert_replies_for_long_thread(tasks, visibility, user, friends, non_friends, acc) + IO.puts("Generating #{visibility} long thread ended\n") + end + + defp insert_replies_for_long_thread(tasks, visibility, user, friends, non_friends, acc) do + Enum.reduce(tasks, acc, fn + "friend", {id, data} -> + friend = Enum.random(friends) + insert_reply(friend, List.delete(data, "@" <> friend.nickname), id, visibility) + + "non_friend", {id, data} -> + non_friend = Enum.random(non_friends) + insert_reply(non_friend, List.delete(data, "@" <> non_friend.nickname), id, visibility) + + "user", {id, data} -> + insert_reply(user, List.delete(data, "@" <> user.nickname), id, visibility) + end) + end + + defp generate_activities(user, friends, non_friends, task_data, opts) do + Task.async_stream( + task_data, + fn {visibility, type, group} -> + insert_activity(type, visibility, group, user, friends, non_friends, opts) + end, + max_concurrency: @max_concurrency, + timeout: 30_000 + ) + |> Stream.run() + end + + defp insert_activity("simple", visibility, group, user, friends, non_friends, _opts) do + {:ok, _activity} = + group + |> get_actor(user, friends, non_friends) + |> CommonAPI.post(%{"status" => "Simple status", "visibility" => visibility}) + end + + defp insert_activity("emoji", visibility, group, user, friends, non_friends, _opts) do + {:ok, _activity} = + group + |> get_actor(user, friends, non_friends) + |> CommonAPI.post(%{ + "status" => "Simple status with emoji :firefox:", + "visibility" => visibility + }) + end + + defp insert_activity("mentions", visibility, group, user, friends, non_friends, _opts) do + user_mentions = + get_random_mentions(friends, Enum.random(0..3)) ++ + get_random_mentions(non_friends, Enum.random(0..3)) + + user_mentions = + if Enum.random([true, false]), + do: ["@" <> user.nickname | user_mentions], + else: user_mentions + + {:ok, _activity} = + group + |> get_actor(user, friends, non_friends) + |> CommonAPI.post(%{ + "status" => Enum.join(user_mentions, ", ") <> " simple status with mentions", + "visibility" => visibility + }) + end + + defp insert_activity("hell_thread", visibility, group, user, friends, non_friends, _opts) do + mentions = + with {:ok, nil} <- Cachex.get(:user_cache, "hell_thread_mentions") do + cached = + ([user | Enum.take(friends, 10)] ++ Enum.take(non_friends, 10)) + |> Enum.map(&"@#{&1.nickname}") + |> Enum.join(", ") + + Cachex.put(:user_cache, "hell_thread_mentions", cached) + cached + else + {:ok, cached} -> cached + end + + {:ok, _activity} = + group + |> get_actor(user, friends, non_friends) + |> CommonAPI.post(%{ + "status" => mentions <> " hell thread status", + "visibility" => visibility + }) + end + + defp insert_activity("attachment", visibility, group, user, friends, non_friends, _opts) do + actor = get_actor(group, user, friends, non_friends) + + obj_data = %{ + "actor" => actor.ap_id, + "name" => "4467-11.jpg", + "type" => "Document", + "url" => [ + %{ + "href" => + "#{Pleroma.Web.base_url()}/media/b1b873552422a07bf53af01f3c231c841db4dfc42c35efde681abaf0f2a4eab7.jpg", + "mediaType" => "image/jpeg", + "type" => "Link" + } + ] + } + + object = Repo.insert!(%Pleroma.Object{data: obj_data}) + + {:ok, _activity} = + CommonAPI.post(actor, %{ + "status" => "Post with attachment", + "visibility" => visibility, + "media_ids" => [object.id] + }) + end + + defp insert_activity("tag", visibility, group, user, friends, non_friends, _opts) do + {:ok, _activity} = + group + |> get_actor(user, friends, non_friends) + |> CommonAPI.post(%{"status" => "Status with #tag", "visibility" => visibility}) + end + + defp insert_activity("like", visibility, group, user, friends, non_friends, opts) do + actor = get_actor(group, user, friends, non_friends) + + with activity_id when not is_nil(activity_id) <- get_random_create_activity_id(), + {:ok, _activity} <- CommonAPI.favorite(actor, activity_id) do + :ok + else + {:error, _} -> + insert_activity("like", visibility, group, user, friends, non_friends, opts) + + nil -> + Process.sleep(15) + insert_activity("like", visibility, group, user, friends, non_friends, opts) + end + end + + defp insert_activity("reblog", visibility, group, user, friends, non_friends, opts) do + actor = get_actor(group, user, friends, non_friends) + + with activity_id when not is_nil(activity_id) <- get_random_create_activity_id(), + {:ok, _activity, _object} <- CommonAPI.repeat(activity_id, actor) do + :ok + else + {:error, _} -> + insert_activity("reblog", visibility, group, user, friends, non_friends, opts) + + nil -> + Process.sleep(15) + insert_activity("reblog", visibility, group, user, friends, non_friends, opts) + end + end + + defp insert_activity("simple_thread", visibility, group, user, friends, non_friends, _opts) + when visibility in ["public", "unlisted", "private"] do + actor = get_actor(group, user, friends, non_friends) + tasks = get_reply_tasks(visibility, group) + + {:ok, activity} = + CommonAPI.post(user, %{"status" => "Simple status", "visibility" => visibility}) + + acc = {activity.id, ["@" <> actor.nickname, "reply to status"]} + insert_replies(tasks, visibility, user, friends, non_friends, acc) + end + + defp insert_activity("simple_thread", "direct", group, user, friends, non_friends, _opts) do + actor = get_actor(group, user, friends, non_friends) + tasks = get_reply_tasks("direct", group) + + list = + case group do + "non_friends" -> + Enum.take(non_friends, 3) + + _ -> + Enum.take(friends, 3) + end + + data = Enum.map(list, &("@" <> &1.nickname)) + + {:ok, activity} = + CommonAPI.post(actor, %{ + "status" => Enum.join(data, ", ") <> "simple status", + "visibility" => "direct" + }) + + acc = {activity.id, ["@" <> user.nickname | data] ++ ["reply to status"]} + insert_direct_replies(tasks, user, list, acc) + end + + defp insert_activity("remote", _, "user", _, _, _, _), do: :ok + + defp insert_activity("remote", visibility, group, user, _friends, _non_friends, opts) do + remote_friends = + Users.get_users(user, limit: opts[:friends_used], local: :external, friends?: true) + + remote_non_friends = + Users.get_users(user, limit: opts[:non_friends_used], local: :external, friends?: false) + + actor = get_actor(group, user, remote_friends, remote_non_friends) + + {act_data, obj_data} = prepare_activity_data(actor, visibility, user) + {activity_data, object_data} = other_data(actor) + + activity_data + |> Map.merge(act_data) + |> Map.put("object", Map.merge(object_data, obj_data)) + |> Pleroma.Web.ActivityPub.ActivityPub.insert(false) + end + + defp get_actor("user", user, _friends, _non_friends), do: user + defp get_actor("friends", _user, friends, _non_friends), do: Enum.random(friends) + defp get_actor("non_friends", _user, _friends, non_friends), do: Enum.random(non_friends) + + defp other_data(actor) do + %{host: host} = URI.parse(actor.ap_id) + datetime = DateTime.utc_now() + context_id = "http://#{host}:4000/contexts/#{UUID.generate()}" + activity_id = "http://#{host}:4000/activities/#{UUID.generate()}" + object_id = "http://#{host}:4000/objects/#{UUID.generate()}" + + activity_data = %{ + "actor" => actor.ap_id, + "context" => context_id, + "id" => activity_id, + "published" => datetime, + "type" => "Create", + "directMessage" => false + } + + object_data = %{ + "actor" => actor.ap_id, + "attachment" => [], + "attributedTo" => actor.ap_id, + "bcc" => [], + "bto" => [], + "content" => "Remote post", + "context" => context_id, + "conversation" => context_id, + "emoji" => %{}, + "id" => object_id, + "published" => datetime, + "sensitive" => false, + "summary" => "", + "tag" => [], + "to" => ["https://www.w3.org/ns/activitystreams#Public"], + "type" => "Note" + } + + {activity_data, object_data} + end + + defp prepare_activity_data(actor, "public", _mention) do + obj_data = %{ + "cc" => [actor.follower_address], + "to" => [Constants.as_public()] + } + + act_data = %{ + "cc" => [actor.follower_address], + "to" => [Constants.as_public()] + } + + {act_data, obj_data} + end + + defp prepare_activity_data(actor, "private", _mention) do + obj_data = %{ + "cc" => [], + "to" => [actor.follower_address] + } + + act_data = %{ + "cc" => [], + "to" => [actor.follower_address] + } + + {act_data, obj_data} + end + + defp prepare_activity_data(actor, "unlisted", _mention) do + obj_data = %{ + "cc" => [Constants.as_public()], + "to" => [actor.follower_address] + } + + act_data = %{ + "cc" => [Constants.as_public()], + "to" => [actor.follower_address] + } + + {act_data, obj_data} + end + + defp prepare_activity_data(_actor, "direct", mention) do + %{host: mentioned_host} = URI.parse(mention.ap_id) + + obj_data = %{ + "cc" => [], + "content" => + "@#{ + mention.nickname + } direct message", + "tag" => [ + %{ + "href" => mention.ap_id, + "name" => "@#{mention.nickname}@#{mentioned_host}", + "type" => "Mention" + } + ], + "to" => [mention.ap_id] + } + + act_data = %{ + "cc" => [], + "directMessage" => true, + "to" => [mention.ap_id] + } + + {act_data, obj_data} + end + + defp get_reply_tasks("public", "user"), do: ~w(friend non_friend user) + defp get_reply_tasks("public", "friends"), do: ~w(non_friend user friend) + defp get_reply_tasks("public", "non_friends"), do: ~w(user friend non_friend) + + defp get_reply_tasks(visibility, "user") when visibility in ["unlisted", "private"], + do: ~w(friend user friend) + + defp get_reply_tasks(visibility, "friends") when visibility in ["unlisted", "private"], + do: ~w(user friend user) + + defp get_reply_tasks(visibility, "non_friends") when visibility in ["unlisted", "private"], + do: [] + + defp get_reply_tasks("direct", "user"), do: ~w(friend user friend) + defp get_reply_tasks("direct", "friends"), do: ~w(user friend user) + defp get_reply_tasks("direct", "non_friends"), do: ~w(user non_friend user) + + defp insert_replies(tasks, visibility, user, friends, non_friends, acc) do + Enum.reduce(tasks, acc, fn + "friend", {id, data} -> + friend = Enum.random(friends) + insert_reply(friend, data, id, visibility) + + "non_friend", {id, data} -> + non_friend = Enum.random(non_friends) + insert_reply(non_friend, data, id, visibility) + + "user", {id, data} -> + insert_reply(user, data, id, visibility) + end) + end + + defp insert_direct_replies(tasks, user, list, acc) do + Enum.reduce(tasks, acc, fn + group, {id, data} when group in ["friend", "non_friend"] -> + actor = Enum.random(list) + + {reply_id, _} = + insert_reply(actor, List.delete(data, "@" <> actor.nickname), id, "direct") + + {reply_id, data} + + "user", {id, data} -> + {reply_id, _} = insert_reply(user, List.delete(data, "@" <> user.nickname), id, "direct") + {reply_id, data} + end) + end + + defp insert_reply(actor, data, activity_id, visibility) do + {:ok, reply} = + CommonAPI.post(actor, %{ + "status" => Enum.join(data, ", "), + "visibility" => visibility, + "in_reply_to_status_id" => activity_id + }) + + {reply.id, ["@" <> actor.nickname | data]} + end + + defp get_random_mentions(_users, count) when count == 0, do: [] + + defp get_random_mentions(users, count) do + users + |> Enum.shuffle() + |> Enum.take(count) + |> Enum.map(&"@#{&1.nickname}") + end + + defp get_random_create_activity_id do + Repo.one( + from(a in Pleroma.Activity, + where: fragment("(?)->>'type' = ?", a.data, ^"Create"), + order_by: fragment("RANDOM()"), + limit: 1, + select: a.id + ) + ) + end +end diff --git a/benchmarks/load_testing/fetcher.ex b/benchmarks/load_testing/fetcher.ex index a45a71d4a..12c30f6f5 100644 --- a/benchmarks/load_testing/fetcher.ex +++ b/benchmarks/load_testing/fetcher.ex @@ -1,260 +1,553 @@ defmodule Pleroma.LoadTesting.Fetcher do - use Pleroma.LoadTesting.Helper + alias Pleroma.Activity + alias Pleroma.Pagination + alias Pleroma.Repo + alias Pleroma.User + alias Pleroma.Web.ActivityPub.ActivityPub + alias Pleroma.Web.MastodonAPI.MastodonAPI + alias Pleroma.Web.MastodonAPI.StatusView - def fetch_user(user) do - Benchee.run(%{ - "By id" => fn -> Repo.get_by(User, id: user.id) end, - "By ap_id" => fn -> Repo.get_by(User, ap_id: user.ap_id) end, - "By email" => fn -> Repo.get_by(User, email: user.email) end, - "By nickname" => fn -> Repo.get_by(User, nickname: user.nickname) end - }) + @spec run_benchmarks(User.t()) :: any() + def run_benchmarks(user) do + fetch_user(user) + fetch_timelines(user) + render_views(user) end - def query_timelines(user) do - home_timeline_params = %{ - "count" => 20, - "with_muted" => true, - "type" => ["Create", "Announce"], + defp formatters do + [ + Benchee.Formatters.Console + ] + end + + defp fetch_user(user) do + Benchee.run( + %{ + "By id" => fn -> Repo.get_by(User, id: user.id) end, + "By ap_id" => fn -> Repo.get_by(User, ap_id: user.ap_id) end, + "By email" => fn -> Repo.get_by(User, email: user.email) end, + "By nickname" => fn -> Repo.get_by(User, nickname: user.nickname) end + }, + formatters: formatters() + ) + end + + defp fetch_timelines(user) do + fetch_home_timeline(user) + fetch_direct_timeline(user) + fetch_public_timeline(user) + fetch_public_timeline(user, :local) + fetch_public_timeline(user, :tag) + fetch_notifications(user) + fetch_favourites(user) + fetch_long_thread(user) + fetch_timelines_with_reply_filtering(user) + end + + defp render_views(user) do + render_timelines(user) + render_long_thread(user) + end + + defp opts_for_home_timeline(user) do + %{ "blocking_user" => user, + "count" => "20", "muting_user" => user, + "type" => ["Create", "Announce"], + "user" => user, + "with_muted" => "true" + } + end + + defp fetch_home_timeline(user) do + opts = opts_for_home_timeline(user) + + recipients = [user.ap_id | User.following(user)] + + first_page_last = + ActivityPub.fetch_activities(recipients, opts) |> Enum.reverse() |> List.last() + + second_page_last = + ActivityPub.fetch_activities(recipients, Map.put(opts, "max_id", first_page_last.id)) + |> Enum.reverse() + |> List.last() + + third_page_last = + ActivityPub.fetch_activities(recipients, Map.put(opts, "max_id", second_page_last.id)) + |> Enum.reverse() + |> List.last() + + forth_page_last = + ActivityPub.fetch_activities(recipients, Map.put(opts, "max_id", third_page_last.id)) + |> Enum.reverse() + |> List.last() + + Benchee.run( + %{ + "home timeline" => fn opts -> ActivityPub.fetch_activities(recipients, opts) end + }, + inputs: %{ + "1 page" => opts, + "2 page" => Map.put(opts, "max_id", first_page_last.id), + "3 page" => Map.put(opts, "max_id", second_page_last.id), + "4 page" => Map.put(opts, "max_id", third_page_last.id), + "5 page" => Map.put(opts, "max_id", forth_page_last.id), + "1 page only media" => Map.put(opts, "only_media", "true"), + "2 page only media" => + Map.put(opts, "max_id", first_page_last.id) |> Map.put("only_media", "true"), + "3 page only media" => + Map.put(opts, "max_id", second_page_last.id) |> Map.put("only_media", "true"), + "4 page only media" => + Map.put(opts, "max_id", third_page_last.id) |> Map.put("only_media", "true"), + "5 page only media" => + Map.put(opts, "max_id", forth_page_last.id) |> Map.put("only_media", "true") + }, + formatters: formatters() + ) + end + + defp opts_for_direct_timeline(user) do + %{ + :visibility => "direct", + "blocking_user" => user, + "count" => "20", + "type" => "Create", + "user" => user, + "with_muted" => "true" + } + end + + defp fetch_direct_timeline(user) do + recipients = [user.ap_id] + + opts = opts_for_direct_timeline(user) + + first_page_last = + recipients + |> ActivityPub.fetch_activities_query(opts) + |> Pagination.fetch_paginated(opts) + |> List.last() + + opts2 = Map.put(opts, "max_id", first_page_last.id) + + second_page_last = + recipients + |> ActivityPub.fetch_activities_query(opts2) + |> Pagination.fetch_paginated(opts2) + |> List.last() + + opts3 = Map.put(opts, "max_id", second_page_last.id) + + third_page_last = + recipients + |> ActivityPub.fetch_activities_query(opts3) + |> Pagination.fetch_paginated(opts3) + |> List.last() + + opts4 = Map.put(opts, "max_id", third_page_last.id) + + forth_page_last = + recipients + |> ActivityPub.fetch_activities_query(opts4) + |> Pagination.fetch_paginated(opts4) + |> List.last() + + Benchee.run( + %{ + "direct timeline" => fn opts -> + ActivityPub.fetch_activities_query(recipients, opts) |> Pagination.fetch_paginated(opts) + end + }, + inputs: %{ + "1 page" => opts, + "2 page" => opts2, + "3 page" => opts3, + "4 page" => opts4, + "5 page" => Map.put(opts4, "max_id", forth_page_last.id) + }, + formatters: formatters() + ) + end + + defp opts_for_public_timeline(user) do + %{ + "type" => ["Create", "Announce"], + "local_only" => false, + "blocking_user" => user, + "muting_user" => user + } + end + + defp opts_for_public_timeline(user, :local) do + %{ + "type" => ["Create", "Announce"], + "local_only" => true, + "blocking_user" => user, + "muting_user" => user + } + end + + defp opts_for_public_timeline(user, :tag) do + %{ + "blocking_user" => user, + "count" => "20", + "local_only" => nil, + "muting_user" => user, + "tag" => ["tag"], + "tag_all" => [], + "tag_reject" => [], + "type" => "Create", + "user" => user, + "with_muted" => "true" + } + end + + defp fetch_public_timeline(user) do + opts = opts_for_public_timeline(user) + + fetch_public_timeline(opts, "public timeline") + end + + defp fetch_public_timeline(user, :local) do + opts = opts_for_public_timeline(user, :local) + + fetch_public_timeline(opts, "public timeline only local") + end + + defp fetch_public_timeline(user, :tag) do + opts = opts_for_public_timeline(user, :tag) + + fetch_public_timeline(opts, "hashtag timeline") + end + + defp fetch_public_timeline(user, :only_media) do + opts = opts_for_public_timeline(user) |> Map.put("only_media", "true") + + fetch_public_timeline(opts, "public timeline only media") + end + + defp fetch_public_timeline(opts, title) when is_binary(title) do + first_page_last = ActivityPub.fetch_public_activities(opts) |> List.last() + + second_page_last = + ActivityPub.fetch_public_activities(Map.put(opts, "max_id", first_page_last.id)) + |> List.last() + + third_page_last = + ActivityPub.fetch_public_activities(Map.put(opts, "max_id", second_page_last.id)) + |> List.last() + + forth_page_last = + ActivityPub.fetch_public_activities(Map.put(opts, "max_id", third_page_last.id)) + |> List.last() + + Benchee.run( + %{ + title => fn opts -> + ActivityPub.fetch_public_activities(opts) + end + }, + inputs: %{ + "1 page" => opts, + "2 page" => Map.put(opts, "max_id", first_page_last.id), + "3 page" => Map.put(opts, "max_id", second_page_last.id), + "4 page" => Map.put(opts, "max_id", third_page_last.id), + "5 page" => Map.put(opts, "max_id", forth_page_last.id) + }, + formatters: formatters() + ) + end + + defp opts_for_notifications do + %{"count" => "20", "with_muted" => "true"} + end + + defp fetch_notifications(user) do + opts = opts_for_notifications() + + first_page_last = MastodonAPI.get_notifications(user, opts) |> List.last() + + second_page_last = + MastodonAPI.get_notifications(user, Map.put(opts, "max_id", first_page_last.id)) + |> List.last() + + third_page_last = + MastodonAPI.get_notifications(user, Map.put(opts, "max_id", second_page_last.id)) + |> List.last() + + forth_page_last = + MastodonAPI.get_notifications(user, Map.put(opts, "max_id", third_page_last.id)) + |> List.last() + + Benchee.run( + %{ + "Notifications" => fn opts -> + MastodonAPI.get_notifications(user, opts) + end + }, + inputs: %{ + "1 page" => opts, + "2 page" => Map.put(opts, "max_id", first_page_last.id), + "3 page" => Map.put(opts, "max_id", second_page_last.id), + "4 page" => Map.put(opts, "max_id", third_page_last.id), + "5 page" => Map.put(opts, "max_id", forth_page_last.id) + }, + formatters: formatters() + ) + end + + defp fetch_favourites(user) do + first_page_last = ActivityPub.fetch_favourites(user) |> List.last() + + second_page_last = + ActivityPub.fetch_favourites(user, %{"max_id" => first_page_last.id}) |> List.last() + + third_page_last = + ActivityPub.fetch_favourites(user, %{"max_id" => second_page_last.id}) |> List.last() + + forth_page_last = + ActivityPub.fetch_favourites(user, %{"max_id" => third_page_last.id}) |> List.last() + + Benchee.run( + %{ + "Favourites" => fn opts -> + ActivityPub.fetch_favourites(user, opts) + end + }, + inputs: %{ + "1 page" => %{}, + "2 page" => %{"max_id" => first_page_last.id}, + "3 page" => %{"max_id" => second_page_last.id}, + "4 page" => %{"max_id" => third_page_last.id}, + "5 page" => %{"max_id" => forth_page_last.id} + }, + formatters: formatters() + ) + end + + defp opts_for_long_thread(user) do + %{ + "blocking_user" => user, "user" => user } + end - mastodon_public_timeline_params = %{ - "count" => 20, - "local_only" => true, - "only_media" => "false", - "type" => ["Create", "Announce"], - "with_muted" => "true", - "blocking_user" => user, - "muting_user" => user - } + defp fetch_long_thread(user) do + %{public_thread: public, private_thread: private} = + Agent.get(:benchmark_state, fn state -> state end) - mastodon_federated_timeline_params = %{ - "count" => 20, - "only_media" => "false", - "type" => ["Create", "Announce"], - "with_muted" => "true", - "blocking_user" => user, - "muting_user" => user - } + opts = opts_for_long_thread(user) - following = User.following(user) + private_input = {private.data["context"], Map.put(opts, "exclude_id", private.id)} - Benchee.run(%{ - "User home timeline" => fn -> - Pleroma.Web.ActivityPub.ActivityPub.fetch_activities( - following, - home_timeline_params - ) - end, - "User mastodon public timeline" => fn -> - Pleroma.Web.ActivityPub.ActivityPub.fetch_public_activities( - mastodon_public_timeline_params - ) - end, - "User mastodon federated public timeline" => fn -> - Pleroma.Web.ActivityPub.ActivityPub.fetch_public_activities( - mastodon_federated_timeline_params - ) - end - }) + public_input = {public.data["context"], Map.put(opts, "exclude_id", public.id)} - home_activities = - Pleroma.Web.ActivityPub.ActivityPub.fetch_activities( - following, - home_timeline_params + Benchee.run( + %{ + "fetch context" => fn {context, opts} -> + ActivityPub.fetch_activities_for_context(context, opts) + end + }, + inputs: %{ + "Private long thread" => private_input, + "Public long thread" => public_input + }, + formatters: formatters() + ) + end + + defp render_timelines(user) do + opts = opts_for_home_timeline(user) + + recipients = [user.ap_id | User.following(user)] + + home_activities = ActivityPub.fetch_activities(recipients, opts) |> Enum.reverse() + + recipients = [user.ap_id] + + opts = opts_for_direct_timeline(user) + + direct_activities = + recipients + |> ActivityPub.fetch_activities_query(opts) + |> Pagination.fetch_paginated(opts) + + opts = opts_for_public_timeline(user) + + public_activities = ActivityPub.fetch_public_activities(opts) + + opts = opts_for_public_timeline(user, :tag) + + tag_activities = ActivityPub.fetch_public_activities(opts) + + opts = opts_for_notifications() + + notifications = MastodonAPI.get_notifications(user, opts) + + favourites = ActivityPub.fetch_favourites(user) + + output_relationships = + !!Pleroma.Config.get([:extensions, :output_relationships_in_statuses_by_default]) + + Benchee.run( + %{ + "Rendering home timeline" => fn -> + StatusView.render("index.json", %{ + activities: home_activities, + for: user, + as: :activity, + skip_relationships: !output_relationships + }) + end, + "Rendering direct timeline" => fn -> + StatusView.render("index.json", %{ + activities: direct_activities, + for: user, + as: :activity, + skip_relationships: !output_relationships + }) + end, + "Rendering public timeline" => fn -> + StatusView.render("index.json", %{ + activities: public_activities, + for: user, + as: :activity, + skip_relationships: !output_relationships + }) + end, + "Rendering tag timeline" => fn -> + StatusView.render("index.json", %{ + activities: tag_activities, + for: user, + as: :activity, + skip_relationships: !output_relationships + }) + end, + "Rendering notifications" => fn -> + Pleroma.Web.MastodonAPI.NotificationView.render("index.json", %{ + notifications: notifications, + for: user, + skip_relationships: !output_relationships + }) + end, + "Rendering favourites timeline" => fn -> + StatusView.render("index.json", %{ + activities: favourites, + for: user, + as: :activity, + skip_relationships: !output_relationships + }) + end + }, + formatters: formatters() + ) + end + + defp render_long_thread(user) do + %{public_thread: public, private_thread: private} = + Agent.get(:benchmark_state, fn state -> state end) + + opts = %{for: user} + public_activity = Activity.get_by_id_with_object(public.id) + private_activity = Activity.get_by_id_with_object(private.id) + + Benchee.run( + %{ + "render" => fn opts -> + StatusView.render("show.json", opts) + end + }, + inputs: %{ + "Public root" => Map.put(opts, :activity, public_activity), + "Private root" => Map.put(opts, :activity, private_activity) + }, + formatters: formatters() + ) + + fetch_opts = opts_for_long_thread(user) + + public_context = + ActivityPub.fetch_activities_for_context( + public.data["context"], + Map.put(fetch_opts, "exclude_id", public.id) ) - public_activities = - Pleroma.Web.ActivityPub.ActivityPub.fetch_public_activities(mastodon_public_timeline_params) - - public_federated_activities = - Pleroma.Web.ActivityPub.ActivityPub.fetch_public_activities( - mastodon_federated_timeline_params + private_context = + ActivityPub.fetch_activities_for_context( + private.data["context"], + Map.put(fetch_opts, "exclude_id", private.id) ) - Benchee.run(%{ - "Rendering home timeline" => fn -> - Pleroma.Web.MastodonAPI.StatusView.render("index.json", %{ - activities: home_activities, - for: user, - as: :activity - }) - end, - "Rendering public timeline" => fn -> - Pleroma.Web.MastodonAPI.StatusView.render("index.json", %{ - activities: public_activities, - for: user, - as: :activity - }) - end, - "Rendering public federated timeline" => fn -> - Pleroma.Web.MastodonAPI.StatusView.render("index.json", %{ - activities: public_federated_activities, - for: user, - as: :activity - }) - end, - "Rendering favorites timeline" => fn -> - conn = Phoenix.ConnTest.build_conn(:get, "http://localhost:4001/api/v1/favourites", nil) - Pleroma.Web.MastodonAPI.StatusController.favourites( - %Plug.Conn{conn | - assigns: %{user: user}, - query_params: %{"limit" => "0"}, - body_params: %{}, - cookies: %{}, - params: %{}, - path_params: %{}, - private: %{ - Pleroma.Web.Router => {[], %{}}, - phoenix_router: Pleroma.Web.Router, - phoenix_action: :favourites, - phoenix_controller: Pleroma.Web.MastodonAPI.StatusController, - phoenix_endpoint: Pleroma.Web.Endpoint, - phoenix_format: "json", - phoenix_layout: {Pleroma.Web.LayoutView, "app.html"}, - phoenix_recycled: true, - - phoenix_view: Pleroma.Web.MastodonAPI.StatusView, - plug_session: %{"user_id" => user.id}, - plug_session_fetch: :done, - plug_session_info: :write, - plug_skip_csrf_protection: true - } - }, - %{}) - end, - }) - end - - def query_notifications(user) do - without_muted_params = %{"count" => "20", "with_muted" => "false"} - with_muted_params = %{"count" => "20", "with_muted" => "true"} - - Benchee.run(%{ - "Notifications without muted" => fn -> - Pleroma.Web.MastodonAPI.MastodonAPI.get_notifications(user, without_muted_params) - end, - "Notifications with muted" => fn -> - Pleroma.Web.MastodonAPI.MastodonAPI.get_notifications(user, with_muted_params) - end - }) - - without_muted_notifications = - Pleroma.Web.MastodonAPI.MastodonAPI.get_notifications(user, without_muted_params) - - with_muted_notifications = - Pleroma.Web.MastodonAPI.MastodonAPI.get_notifications(user, with_muted_params) - - Benchee.run(%{ - "Render notifications without muted" => fn -> - Pleroma.Web.MastodonAPI.NotificationView.render("index.json", %{ - notifications: without_muted_notifications, - for: user - }) - end, - "Render notifications with muted" => fn -> - Pleroma.Web.MastodonAPI.NotificationView.render("index.json", %{ - notifications: with_muted_notifications, - for: user - }) - end - }) - end - - def query_dms(user) do - params = %{ - "count" => "20", - "with_muted" => "true", - "type" => "Create", - "blocking_user" => user, - "user" => user, - visibility: "direct" - } - - Benchee.run(%{ - "Direct messages with muted" => fn -> - Pleroma.Web.ActivityPub.ActivityPub.fetch_activities_query([user.ap_id], params) - |> Pleroma.Pagination.fetch_paginated(params) - end, - "Direct messages without muted" => fn -> - Pleroma.Web.ActivityPub.ActivityPub.fetch_activities_query([user.ap_id], params) - |> Pleroma.Pagination.fetch_paginated(Map.put(params, "with_muted", false)) - end - }) - - dms_with_muted = - Pleroma.Web.ActivityPub.ActivityPub.fetch_activities_query([user.ap_id], params) - |> Pleroma.Pagination.fetch_paginated(params) - - dms_without_muted = - Pleroma.Web.ActivityPub.ActivityPub.fetch_activities_query([user.ap_id], params) - |> Pleroma.Pagination.fetch_paginated(Map.put(params, "with_muted", false)) - - Benchee.run(%{ - "Rendering dms with muted" => fn -> - Pleroma.Web.MastodonAPI.StatusView.render("index.json", %{ - activities: dms_with_muted, - for: user, - as: :activity - }) - end, - "Rendering dms without muted" => fn -> - Pleroma.Web.MastodonAPI.StatusView.render("index.json", %{ - activities: dms_without_muted, - for: user, - as: :activity - }) - end - }) - end - - def query_long_thread(user, activity) do - Benchee.run(%{ - "Fetch main post" => fn -> - Pleroma.Activity.get_by_id_with_object(activity.id) - end, - "Fetch context of main post" => fn -> - Pleroma.Web.ActivityPub.ActivityPub.fetch_activities_for_context( - activity.data["context"], - %{ - "blocking_user" => user, - "user" => user, - "exclude_id" => activity.id - } - ) - end - }) - - activity = Pleroma.Activity.get_by_id_with_object(activity.id) - - context = - Pleroma.Web.ActivityPub.ActivityPub.fetch_activities_for_context( - activity.data["context"], - %{ - "blocking_user" => user, - "user" => user, - "exclude_id" => activity.id + Benchee.run( + %{ + "render" => fn opts -> + StatusView.render("context.json", opts) + end + }, + inputs: %{ + "Public context" => %{user: user, activity: public_activity, activities: public_context}, + "Private context" => %{ + user: user, + activity: private_activity, + activities: private_context } - ) + }, + formatters: formatters() + ) + end - Benchee.run(%{ - "Render status" => fn -> - Pleroma.Web.MastodonAPI.StatusView.render("show.json", %{ - activity: activity, - for: user - }) - end, - "Render context" => fn -> - Pleroma.Web.MastodonAPI.StatusView.render( - "index.json", - for: user, - activities: context, - as: :activity - ) - |> Enum.reverse() - end - }) + defp fetch_timelines_with_reply_filtering(user) do + public_params = opts_for_public_timeline(user) + + Benchee.run( + %{ + "Public timeline without reply filtering" => fn -> + ActivityPub.fetch_public_activities(public_params) + end, + "Public timeline with reply filtering - following" => fn -> + public_params + |> Map.put("reply_visibility", "following") + |> Map.put("reply_filtering_user", user) + |> ActivityPub.fetch_public_activities() + end, + "Public timeline with reply filtering - self" => fn -> + public_params + |> Map.put("reply_visibility", "self") + |> Map.put("reply_filtering_user", user) + |> ActivityPub.fetch_public_activities() + end + }, + formatters: formatters() + ) + + private_params = opts_for_home_timeline(user) + + recipients = [user.ap_id | User.following(user)] + + Benchee.run( + %{ + "Home timeline without reply filtering" => fn -> + ActivityPub.fetch_activities(recipients, private_params) + end, + "Home timeline with reply filtering - following" => fn -> + private_params = + private_params + |> Map.put("reply_filtering_user", user) + |> Map.put("reply_visibility", "following") + + ActivityPub.fetch_activities(recipients, private_params) + end, + "Home timeline with reply filtering - self" => fn -> + private_params = + private_params + |> Map.put("reply_filtering_user", user) + |> Map.put("reply_visibility", "self") + + ActivityPub.fetch_activities(recipients, private_params) + end + }, + formatters: formatters() + ) end end diff --git a/benchmarks/load_testing/generator.ex b/benchmarks/load_testing/generator.ex deleted file mode 100644 index 3f88fefd7..000000000 --- a/benchmarks/load_testing/generator.ex +++ /dev/null @@ -1,409 +0,0 @@ -defmodule Pleroma.LoadTesting.Generator do - use Pleroma.LoadTesting.Helper - alias Pleroma.Web.CommonAPI - - def generate_like_activities(user, posts) do - count_likes = Kernel.trunc(length(posts) / 4) - IO.puts("Starting generating #{count_likes} like activities...") - - {time, _} = - :timer.tc(fn -> - Task.async_stream( - Enum.take_random(posts, count_likes), - fn post -> {:ok, _, _} = CommonAPI.favorite(post.id, user) end, - max_concurrency: 10, - timeout: 30_000 - ) - |> Stream.run() - end) - - IO.puts("Inserting like activities take #{to_sec(time)} sec.\n") - end - - def generate_users(opts) do - IO.puts("Starting generating #{opts[:users_max]} users...") - {time, _} = :timer.tc(fn -> do_generate_users(opts) end) - - IO.puts("Inserting users take #{to_sec(time)} sec.\n") - end - - defp do_generate_users(opts) do - max = Keyword.get(opts, :users_max) - - Task.async_stream( - 1..max, - &generate_user_data(&1), - max_concurrency: 10, - timeout: 30_000 - ) - |> Enum.to_list() - end - - defp generate_user_data(i) do - remote = Enum.random([true, false]) - - user = %User{ - name: "Test テスト User #{i}", - email: "user#{i}@example.com", - nickname: "nick#{i}", - password_hash: - "$pbkdf2-sha512$160000$bU.OSFI7H/yqWb5DPEqyjw$uKp/2rmXw12QqnRRTqTtuk2DTwZfF8VR4MYW2xMeIlqPR/UX1nT1CEKVUx2CowFMZ5JON8aDvURrZpJjSgqXrg", - bio: "Tester Number #{i}", - local: remote - } - - user_urls = - if remote do - base_url = - Enum.random(["https://domain1.com", "https://domain2.com", "https://domain3.com"]) - - ap_id = "#{base_url}/users/#{user.nickname}" - - %{ - ap_id: ap_id, - follower_address: ap_id <> "/followers", - following_address: ap_id <> "/following" - } - else - %{ - ap_id: User.ap_id(user), - follower_address: User.ap_followers(user), - following_address: User.ap_following(user) - } - end - - user = Map.merge(user, user_urls) - - Repo.insert!(user) - end - - def generate_activities(user, users) do - do_generate_activities(user, users) - end - - defp do_generate_activities(user, users) do - IO.puts("Starting generating 20000 common activities...") - - {time, _} = - :timer.tc(fn -> - Task.async_stream( - 1..20_000, - fn _ -> - do_generate_activity([user | users]) - end, - max_concurrency: 10, - timeout: 30_000 - ) - |> Stream.run() - end) - - IO.puts("Inserting common activities take #{to_sec(time)} sec.\n") - - IO.puts("Starting generating 20000 activities with mentions...") - - {time, _} = - :timer.tc(fn -> - Task.async_stream( - 1..20_000, - fn _ -> - do_generate_activity_with_mention(user, users) - end, - max_concurrency: 10, - timeout: 30_000 - ) - |> Stream.run() - end) - - IO.puts("Inserting activities with menthions take #{to_sec(time)} sec.\n") - - IO.puts("Starting generating 10000 activities with threads...") - - {time, _} = - :timer.tc(fn -> - Task.async_stream( - 1..10_000, - fn _ -> - do_generate_threads([user | users]) - end, - max_concurrency: 10, - timeout: 30_000 - ) - |> Stream.run() - end) - - IO.puts("Inserting activities with threads take #{to_sec(time)} sec.\n") - end - - defp do_generate_activity(users) do - post = %{ - "status" => "Some status without mention with random user" - } - - CommonAPI.post(Enum.random(users), post) - end - - def generate_power_intervals(opts \\ []) do - count = Keyword.get(opts, :count, 20) - power = Keyword.get(opts, :power, 2) - IO.puts("Generating #{count} intervals for a power #{power} series...") - counts = Enum.map(1..count, fn n -> :math.pow(n, power) end) - sum = Enum.sum(counts) - - densities = - Enum.map(counts, fn c -> - c / sum - end) - - densities - |> Enum.reduce(0, fn density, acc -> - if acc == 0 do - [{0, density}] - else - [{_, lower} | _] = acc - [{lower, lower + density} | acc] - end - end) - |> Enum.reverse() - end - - def generate_tagged_activities(opts \\ []) do - tag_count = Keyword.get(opts, :tag_count, 20) - users = Keyword.get(opts, :users, Repo.all(User)) - activity_count = Keyword.get(opts, :count, 200_000) - - intervals = generate_power_intervals(count: tag_count) - - IO.puts( - "Generating #{activity_count} activities using #{tag_count} different tags of format `tag_n`, starting at tag_0" - ) - - Enum.each(1..activity_count, fn _ -> - random = :rand.uniform() - i = Enum.find_index(intervals, fn {lower, upper} -> lower <= random && upper > random end) - CommonAPI.post(Enum.random(users), %{"status" => "a post with the tag #tag_#{i}"}) - end) - end - - defp do_generate_activity_with_mention(user, users) do - mentions_cnt = Enum.random([2, 3, 4, 5]) - with_user = Enum.random([true, false]) - users = Enum.shuffle(users) - mentions_users = Enum.take(users, mentions_cnt) - mentions_users = if with_user, do: [user | mentions_users], else: mentions_users - - mentions_str = - Enum.map(mentions_users, fn user -> "@" <> user.nickname end) |> Enum.join(", ") - - post = %{ - "status" => mentions_str <> "some status with mentions random users" - } - - CommonAPI.post(Enum.random(users), post) - end - - defp do_generate_threads(users) do - thread_length = Enum.random([2, 3, 4, 5]) - actor = Enum.random(users) - - post = %{ - "status" => "Start of the thread" - } - - {:ok, activity} = CommonAPI.post(actor, post) - - Enum.each(1..thread_length, fn _ -> - user = Enum.random(users) - - post = %{ - "status" => "@#{actor.nickname} reply to thread", - "in_reply_to_status_id" => activity.id - } - - CommonAPI.post(user, post) - end) - end - - def generate_remote_activities(user, users) do - do_generate_remote_activities(user, users) - end - - defp do_generate_remote_activities(user, users) do - IO.puts("Starting generating 10000 remote activities...") - - {time, _} = - :timer.tc(fn -> - Task.async_stream( - 1..10_000, - fn i -> - do_generate_remote_activity(i, user, users) - end, - max_concurrency: 10, - timeout: 30_000 - ) - |> Stream.run() - end) - - IO.puts("Inserting remote activities take #{to_sec(time)} sec.\n") - end - - defp do_generate_remote_activity(i, user, users) do - actor = Enum.random(users) - %{host: host} = URI.parse(actor.ap_id) - date = Date.utc_today() - datetime = DateTime.utc_now() - - map = %{ - "actor" => actor.ap_id, - "cc" => [actor.follower_address, user.ap_id], - "context" => "tag:mastodon.example.org,#{date}:objectId=#{i}:objectType=Conversation", - "id" => actor.ap_id <> "/statuses/#{i}/activity", - "object" => %{ - "actor" => actor.ap_id, - "atomUri" => actor.ap_id <> "/statuses/#{i}", - "attachment" => [], - "attributedTo" => actor.ap_id, - "bcc" => [], - "bto" => [], - "cc" => [actor.follower_address, user.ap_id], - "content" => - "

- user.ap_id <> - "\" class=\"u-url mention\">@" <> user.nickname <> "

", - "context" => "tag:mastodon.example.org,#{date}:objectId=#{i}:objectType=Conversation", - "conversation" => - "tag:mastodon.example.org,#{date}:objectId=#{i}:objectType=Conversation", - "emoji" => %{}, - "id" => actor.ap_id <> "/statuses/#{i}", - "inReplyTo" => nil, - "inReplyToAtomUri" => nil, - "published" => datetime, - "sensitive" => true, - "summary" => "cw", - "tag" => [ - %{ - "href" => user.ap_id, - "name" => "@#{user.nickname}@#{host}", - "type" => "Mention" - } - ], - "to" => ["https://www.w3.org/ns/activitystreams#Public"], - "type" => "Note", - "url" => "http://#{host}/@#{actor.nickname}/#{i}" - }, - "published" => datetime, - "to" => ["https://www.w3.org/ns/activitystreams#Public"], - "type" => "Create" - } - - Pleroma.Web.ActivityPub.ActivityPub.insert(map, false) - end - - def generate_dms(user, users, opts) do - IO.puts("Starting generating #{opts[:dms_max]} DMs") - {time, _} = :timer.tc(fn -> do_generate_dms(user, users, opts) end) - IO.puts("Inserting dms take #{to_sec(time)} sec.\n") - end - - defp do_generate_dms(user, users, opts) do - Task.async_stream( - 1..opts[:dms_max], - fn _ -> - do_generate_dm(user, users) - end, - max_concurrency: 10, - timeout: 30_000 - ) - |> Stream.run() - end - - defp do_generate_dm(user, users) do - post = %{ - "status" => "@#{user.nickname} some direct message", - "visibility" => "direct" - } - - CommonAPI.post(Enum.random(users), post) - end - - def generate_long_thread(user, users, opts) do - IO.puts("Starting generating long thread with #{opts[:thread_length]} replies") - {time, activity} = :timer.tc(fn -> do_generate_long_thread(user, users, opts) end) - IO.puts("Inserting long thread replies take #{to_sec(time)} sec.\n") - {:ok, activity} - end - - defp do_generate_long_thread(user, users, opts) do - {:ok, %{id: id} = activity} = CommonAPI.post(user, %{"status" => "Start of long thread"}) - - Task.async_stream( - 1..opts[:thread_length], - fn _ -> do_generate_thread(users, id) end, - max_concurrency: 10, - timeout: 30_000 - ) - |> Stream.run() - - activity - end - - defp do_generate_thread(users, activity_id) do - CommonAPI.post(Enum.random(users), %{ - "status" => "reply to main post", - "in_reply_to_status_id" => activity_id - }) - end - - def generate_non_visible_message(user, users) do - IO.puts("Starting generating 1000 non visible posts") - - {time, _} = - :timer.tc(fn -> - do_generate_non_visible_posts(user, users) - end) - - IO.puts("Inserting non visible posts take #{to_sec(time)} sec.\n") - end - - defp do_generate_non_visible_posts(user, users) do - [not_friend | users] = users - - make_friends(user, users) - - Task.async_stream(1..1000, fn _ -> do_generate_non_visible_post(not_friend, users) end, - max_concurrency: 10, - timeout: 30_000 - ) - |> Stream.run() - end - - defp make_friends(_user, []), do: nil - - defp make_friends(user, [friend | users]) do - {:ok, _} = User.follow(user, friend) - {:ok, _} = User.follow(friend, user) - make_friends(user, users) - end - - defp do_generate_non_visible_post(not_friend, users) do - post = %{ - "status" => "some non visible post", - "visibility" => "private" - } - - {:ok, activity} = CommonAPI.post(not_friend, post) - - thread_length = Enum.random([2, 3, 4, 5]) - - Enum.each(1..thread_length, fn _ -> - user = Enum.random(users) - - post = %{ - "status" => "@#{not_friend.nickname} reply to non visible post", - "in_reply_to_status_id" => activity.id, - "visibility" => "private" - } - - CommonAPI.post(user, post) - end) - end -end diff --git a/benchmarks/load_testing/helper.ex b/benchmarks/load_testing/helper.ex index 47b25c65f..cab60acb4 100644 --- a/benchmarks/load_testing/helper.ex +++ b/benchmarks/load_testing/helper.ex @@ -1,11 +1,14 @@ defmodule Pleroma.LoadTesting.Helper do - defmacro __using__(_) do - quote do - import Ecto.Query - alias Pleroma.Repo - alias Pleroma.User + alias Ecto.Adapters.SQL + alias Pleroma.Repo - defp to_sec(microseconds), do: microseconds / 1_000_000 - end + def to_sec(microseconds), do: microseconds / 1_000_000 + + def clean_tables do + IO.puts("Deleting old data...\n") + SQL.query!(Repo, "TRUNCATE users CASCADE;") + SQL.query!(Repo, "TRUNCATE activities CASCADE;") + SQL.query!(Repo, "TRUNCATE objects CASCADE;") + SQL.query!(Repo, "TRUNCATE oban_jobs CASCADE;") end end diff --git a/benchmarks/load_testing/users.ex b/benchmarks/load_testing/users.ex new file mode 100644 index 000000000..e4d0b22ff --- /dev/null +++ b/benchmarks/load_testing/users.ex @@ -0,0 +1,169 @@ +defmodule Pleroma.LoadTesting.Users do + @moduledoc """ + Module for generating users with friends. + """ + import Ecto.Query + import Pleroma.LoadTesting.Helper, only: [to_sec: 1] + + alias Pleroma.Repo + alias Pleroma.User + alias Pleroma.User.Query + + @defaults [ + users: 20_000, + friends: 100 + ] + + @max_concurrency 10 + + @spec generate(keyword()) :: User.t() + def generate(opts \\ []) do + opts = Keyword.merge(@defaults, opts) + + generate_users(opts[:users]) + + main_user = + Repo.one(from(u in User, where: u.local == true, order_by: fragment("RANDOM()"), limit: 1)) + + make_friends(main_user, opts[:friends]) + + Repo.get(User, main_user.id) + end + + def generate_users(max) do + IO.puts("Starting generating #{max} users...") + + {time, users} = + :timer.tc(fn -> + Task.async_stream( + 1..max, + &generate_user(&1), + max_concurrency: @max_concurrency, + timeout: 30_000 + ) + |> Enum.to_list() + end) + + IO.puts("Generating users took #{to_sec(time)} sec.\n") + users + end + + defp generate_user(i) do + remote = Enum.random([true, false]) + + %User{ + name: "Test テスト User #{i}", + email: "user#{i}@example.com", + nickname: "nick#{i}", + password_hash: Pbkdf2.hash_pwd_salt("test"), + bio: "Tester Number #{i}", + local: !remote + } + |> user_urls() + |> Repo.insert!() + end + + defp user_urls(%{local: true} = user) do + urls = %{ + ap_id: User.ap_id(user), + follower_address: User.ap_followers(user), + following_address: User.ap_following(user) + } + + Map.merge(user, urls) + end + + defp user_urls(%{local: false} = user) do + base_domain = Enum.random(["domain1.com", "domain2.com", "domain3.com"]) + + ap_id = "https://#{base_domain}/users/#{user.nickname}" + + urls = %{ + ap_id: ap_id, + follower_address: ap_id <> "/followers", + following_address: ap_id <> "/following" + } + + Map.merge(user, urls) + end + + def make_friends(main_user, max) when is_integer(max) do + IO.puts("Starting making friends for #{max} users...") + + {time, _} = + :timer.tc(fn -> + number_of_users = + (max / 2) + |> Kernel.trunc() + + main_user + |> get_users(%{limit: number_of_users, local: :local}) + |> run_stream(main_user) + + main_user + |> get_users(%{limit: number_of_users, local: :external}) + |> run_stream(main_user) + end) + + IO.puts("Making friends took #{to_sec(time)} sec.\n") + end + + def make_friends(%User{} = main_user, %User{} = user) do + {:ok, _} = User.follow(main_user, user) + {:ok, _} = User.follow(user, main_user) + end + + @spec get_users(User.t(), keyword()) :: [User.t()] + def get_users(user, opts) do + criteria = %{limit: opts[:limit]} + + criteria = + if opts[:local] do + Map.put(criteria, opts[:local], true) + else + criteria + end + + criteria = + if opts[:friends?] do + Map.put(criteria, :friends, user) + else + criteria + end + + query = + criteria + |> Query.build() + |> random_without_user(user) + + query = + if opts[:friends?] == false do + friends_ids = + %{friends: user} + |> Query.build() + |> Repo.all() + |> Enum.map(& &1.id) + + from(u in query, where: u.id not in ^friends_ids) + else + query + end + + Repo.all(query) + end + + defp random_without_user(query, user) do + from(u in query, + where: u.id != ^user.id, + order_by: fragment("RANDOM()") + ) + end + + defp run_stream(users, main_user) do + Task.async_stream(users, &make_friends(main_user, &1), + max_concurrency: @max_concurrency, + timeout: 30_000 + ) + |> Stream.run() + end +end diff --git a/benchmarks/mix/tasks/pleroma/benchmarks/tags.ex b/benchmarks/mix/tasks/pleroma/benchmarks/tags.ex index fd1506907..657403202 100644 --- a/benchmarks/mix/tasks/pleroma/benchmarks/tags.ex +++ b/benchmarks/mix/tasks/pleroma/benchmarks/tags.ex @@ -1,9 +1,12 @@ defmodule Mix.Tasks.Pleroma.Benchmarks.Tags do use Mix.Task - alias Pleroma.Repo - alias Pleroma.LoadTesting.Generator + + import Pleroma.LoadTesting.Helper, only: [clean_tables: 0] import Ecto.Query + alias Pleroma.Repo + alias Pleroma.Web.MastodonAPI.TimelineController + def run(_args) do Mix.Pleroma.start_pleroma() activities_count = Repo.aggregate(from(a in Pleroma.Activity), :count, :id) @@ -11,8 +14,8 @@ def run(_args) do if activities_count == 0 do IO.puts("Did not find any activities, cleaning and generating") clean_tables() - Generator.generate_users(users_max: 10) - Generator.generate_tagged_activities() + Pleroma.LoadTesting.Users.generate_users(10) + Pleroma.LoadTesting.Activities.generate_tagged_activities() else IO.puts("Found #{activities_count} activities, won't generate new ones") end @@ -34,7 +37,7 @@ def run(_args) do Benchee.run( %{ "Hashtag fetching, any" => fn tags -> - Pleroma.Web.MastodonAPI.TimelineController.hashtag_fetching( + TimelineController.hashtag_fetching( %{ "any" => tags }, @@ -44,7 +47,7 @@ def run(_args) do end, # Will always return zero results because no overlapping hashtags are generated. "Hashtag fetching, all" => fn tags -> - Pleroma.Web.MastodonAPI.TimelineController.hashtag_fetching( + TimelineController.hashtag_fetching( %{ "all" => tags }, @@ -64,7 +67,7 @@ def run(_args) do Benchee.run( %{ "Hashtag fetching" => fn tag -> - Pleroma.Web.MastodonAPI.TimelineController.hashtag_fetching( + TimelineController.hashtag_fetching( %{ "tag" => tag }, @@ -77,11 +80,4 @@ def run(_args) do time: 5 ) end - - defp clean_tables do - IO.puts("Deleting old data...\n") - Ecto.Adapters.SQL.query!(Repo, "TRUNCATE users CASCADE;") - Ecto.Adapters.SQL.query!(Repo, "TRUNCATE activities CASCADE;") - Ecto.Adapters.SQL.query!(Repo, "TRUNCATE objects CASCADE;") - end end diff --git a/benchmarks/mix/tasks/pleroma/benchmarks/timelines.ex b/benchmarks/mix/tasks/pleroma/benchmarks/timelines.ex new file mode 100644 index 000000000..9b7ac6111 --- /dev/null +++ b/benchmarks/mix/tasks/pleroma/benchmarks/timelines.ex @@ -0,0 +1,70 @@ +defmodule Mix.Tasks.Pleroma.Benchmarks.Timelines do + use Mix.Task + + import Pleroma.LoadTesting.Helper, only: [clean_tables: 0] + + alias Pleroma.Web.CommonAPI + alias Plug.Conn + + def run(_args) do + Mix.Pleroma.start_pleroma() + + # Cleaning tables + clean_tables() + + [{:ok, user} | users] = Pleroma.LoadTesting.Users.generate_users(1000) + + # Let the user make 100 posts + + 1..100 + |> Enum.each(fn i -> CommonAPI.post(user, %{"status" => to_string(i)}) end) + + # Let 10 random users post + posts = + users + |> Enum.take_random(10) + |> Enum.map(fn {:ok, random_user} -> + {:ok, activity} = CommonAPI.post(random_user, %{"status" => "."}) + activity + end) + + # let our user repeat them + posts + |> Enum.each(fn activity -> + CommonAPI.repeat(activity.id, user) + end) + + Benchee.run( + %{ + "user timeline, no followers" => fn reading_user -> + conn = + Phoenix.ConnTest.build_conn() + |> Conn.assign(:user, reading_user) + |> Conn.assign(:skip_link_headers, true) + + Pleroma.Web.MastodonAPI.AccountController.statuses(conn, %{"id" => user.id}) + end + }, + inputs: %{"user" => user, "no user" => nil}, + time: 60 + ) + + users + |> Enum.each(fn {:ok, follower} -> Pleroma.User.follow(follower, user) end) + + Benchee.run( + %{ + "user timeline, all following" => fn reading_user -> + conn = + Phoenix.ConnTest.build_conn() + |> Conn.assign(:user, reading_user) + |> Conn.assign(:skip_link_headers, true) + + Pleroma.Web.MastodonAPI.AccountController.statuses(conn, %{"id" => user.id}) + end + }, + inputs: %{"user" => user, "no user" => nil}, + time: 60 + ) + end +end diff --git a/benchmarks/mix/tasks/pleroma/load_testing.ex b/benchmarks/mix/tasks/pleroma/load_testing.ex index 0a751adac..388883240 100644 --- a/benchmarks/mix/tasks/pleroma/load_testing.ex +++ b/benchmarks/mix/tasks/pleroma/load_testing.ex @@ -1,114 +1,56 @@ defmodule Mix.Tasks.Pleroma.LoadTesting do use Mix.Task - use Pleroma.LoadTesting.Helper - import Mix.Pleroma - import Pleroma.LoadTesting.Generator - import Pleroma.LoadTesting.Fetcher + import Ecto.Query + import Pleroma.LoadTesting.Helper, only: [clean_tables: 0] + + alias Pleroma.Repo + alias Pleroma.User @shortdoc "Factory for generation data" @moduledoc """ Generates data like: - local/remote users - - local/remote activities with notifications - - direct messages - - long thread - - non visible posts + - local/remote activities with differrent visibility: + - simple activiities + - with emoji + - with mentions + - hellthreads + - with attachments + - with tags + - likes + - reblogs + - simple threads + - long threads ## Generate data - MIX_ENV=benchmark mix pleroma.load_testing --users 20000 --dms 20000 --thread_length 2000 - MIX_ENV=benchmark mix pleroma.load_testing -u 20000 -d 20000 -t 2000 + MIX_ENV=benchmark mix pleroma.load_testing --users 20000 --friends 1000 --iterations 170 --friends_used 20 --non_friends_used 20 + MIX_ENV=benchmark mix pleroma.load_testing -u 20000 -f 1000 -i 170 -fu 20 -nfu 20 Options: - `--users NUMBER` - number of users to generate. Defaults to: 20000. Alias: `-u` - - `--dms NUMBER` - number of direct messages to generate. Defaults to: 20000. Alias `-d` - - `--thread_length` - number of messages in thread. Defaults to: 2000. ALias `-t` + - `--friends NUMBER` - number of friends for main user. Defaults to: 1000. Alias: `-f` + - `--iterations NUMBER` - number of iterations to generate activities. For each iteration in database is inserted about 120+ activities with different visibility, actors and types.Defaults to: 170. Alias: `-i` + - `--friends_used NUMBER` - number of main user friends used in activity generation. Defaults to: 20. Alias: `-fu` + - `--non_friends_used NUMBER` - number of non friends used in activity generation. Defaults to: 20. Alias: `-nfu` """ - @aliases [u: :users, d: :dms, t: :thread_length] + @aliases [u: :users, f: :friends, i: :iterations, fu: :friends_used, nfu: :non_friends_used] @switches [ users: :integer, - dms: :integer, - thread_length: :integer + friends: :integer, + iterations: :integer, + friends_used: :integer, + non_friends_used: :integer ] - @users_default 20_000 - @dms_default 1_000 - @thread_length_default 2_000 def run(args) do - start_pleroma() - Pleroma.Config.put([:instance, :skip_thread_containment], true) + Logger.configure(level: :error) + Mix.Pleroma.start_pleroma() + clean_tables() {opts, _} = OptionParser.parse!(args, strict: @switches, aliases: @aliases) - users_max = Keyword.get(opts, :users, @users_default) - dms_max = Keyword.get(opts, :dms, @dms_default) - thread_length = Keyword.get(opts, :thread_length, @thread_length_default) - - clean_tables() - - opts = - Keyword.put(opts, :users_max, users_max) - |> Keyword.put(:dms_max, dms_max) - |> Keyword.put(:thread_length, thread_length) - - generate_users(opts) - - # main user for queries - IO.puts("Fetching local main user...") - - {time, user} = - :timer.tc(fn -> - Repo.one( - from(u in User, where: u.local == true, order_by: fragment("RANDOM()"), limit: 1) - ) - end) - - IO.puts("Fetching main user take #{to_sec(time)} sec.\n") - - IO.puts("Fetching local users...") - - {time, users} = - :timer.tc(fn -> - Repo.all( - from(u in User, - where: u.id != ^user.id, - where: u.local == true, - order_by: fragment("RANDOM()"), - limit: 10 - ) - ) - end) - - IO.puts("Fetching local users take #{to_sec(time)} sec.\n") - - IO.puts("Fetching remote users...") - - {time, remote_users} = - :timer.tc(fn -> - Repo.all( - from(u in User, - where: u.id != ^user.id, - where: u.local == false, - order_by: fragment("RANDOM()"), - limit: 10 - ) - ) - end) - - IO.puts("Fetching remote users take #{to_sec(time)} sec.\n") - - generate_activities(user, users) - - generate_remote_activities(user, remote_users) - - generate_like_activities( - user, Pleroma.Repo.all(Pleroma.Activity.Queries.by_type("Create")) - ) - - generate_dms(user, users, opts) - - {:ok, activity} = generate_long_thread(user, users, opts) - - generate_non_visible_message(user, users) + user = Pleroma.LoadTesting.Users.generate(opts) + Pleroma.LoadTesting.Activities.generate(user, opts) IO.puts("Users in DB: #{Repo.aggregate(from(u in User), :count, :id)}") @@ -120,19 +62,6 @@ def run(args) do "Notifications in DB: #{Repo.aggregate(from(n in Pleroma.Notification), :count, :id)}" ) - fetch_user(user) - query_timelines(user) - query_notifications(user) - query_dms(user) - query_long_thread(user, activity) - Pleroma.Config.put([:instance, :skip_thread_containment], false) - query_timelines(user) - end - - defp clean_tables do - IO.puts("Deleting old data...\n") - Ecto.Adapters.SQL.query!(Repo, "TRUNCATE users CASCADE;") - Ecto.Adapters.SQL.query!(Repo, "TRUNCATE activities CASCADE;") - Ecto.Adapters.SQL.query!(Repo, "TRUNCATE objects CASCADE;") + Pleroma.LoadTesting.Fetcher.run_benchmarks(user) end end diff --git a/config/benchmark.exs b/config/benchmark.exs index ff59395cf..e867253eb 100644 --- a/config/benchmark.exs +++ b/config/benchmark.exs @@ -39,7 +39,7 @@ adapter: Ecto.Adapters.Postgres, username: "postgres", password: "postgres", - database: "pleroma_test", + database: "pleroma_benchmark", hostname: System.get_env("DB_HOST") || "localhost", pool_size: 10 diff --git a/config/config.exs b/config/config.exs index 2ab939107..e703c1632 100644 --- a/config/config.exs +++ b/config/config.exs @@ -58,20 +58,6 @@ config :pleroma, Pleroma.Captcha.Kocaptcha, endpoint: "https://captcha.kotobank.ch" -config :pleroma, :hackney_pools, - federation: [ - max_connections: 50, - timeout: 150_000 - ], - media: [ - max_connections: 50, - timeout: 150_000 - ], - upload: [ - max_connections: 25, - timeout: 300_000 - ] - # Upload configuration config :pleroma, Pleroma.Upload, uploader: Pleroma.Uploaders.Local, @@ -184,21 +170,13 @@ "application/ld+json" => ["activity+json"] } -config :tesla, adapter: Tesla.Adapter.Hackney - +config :tesla, adapter: Tesla.Adapter.Gun # Configures http settings, upstream proxy etc. config :pleroma, :http, proxy_url: nil, send_user_agent: true, user_agent: :default, - adapter: [ - ssl_options: [ - # Workaround for remote server certificate chain issues - partial_chain: &:hackney_connect.partial_chain/1, - # We don't support TLS v1.3 yet - versions: [:tlsv1, :"tlsv1.1", :"tlsv1.2"] - ] - ] + adapter: [] config :pleroma, :instance, name: "Pleroma", @@ -260,7 +238,20 @@ account_field_value_length: 2048, external_user_synchronization: true, extended_nickname_format: true, - cleanup_attachments: false + cleanup_attachments: false, + multi_factor_authentication: [ + totp: [ + # digits 6 or 8 + digits: 6, + period: 30 + ], + backup_codes: [ + number: 5, + length: 16 + ] + ] + +config :pleroma, :extensions, output_relationships_in_statuses_by_default: true config :pleroma, :feed, post_title: %{ @@ -356,7 +347,8 @@ reject: [], accept: [], avatar_removal: [], - banner_removal: [] + banner_removal: [], + reject_deletes: [] config :pleroma, :mrf_keyword, reject: [], @@ -624,11 +616,56 @@ parameters: [gin_fuzzy_search_limit: "500"], prepare: :unnamed +config :pleroma, :connections_pool, + checkin_timeout: 250, + max_connections: 250, + retry: 1, + retry_timeout: 1000, + await_up_timeout: 5_000 + +config :pleroma, :pools, + federation: [ + size: 50, + max_overflow: 10, + timeout: 150_000 + ], + media: [ + size: 50, + max_overflow: 10, + timeout: 150_000 + ], + upload: [ + size: 25, + max_overflow: 5, + timeout: 300_000 + ], + default: [ + size: 10, + max_overflow: 2, + timeout: 10_000 + ] + +config :pleroma, :hackney_pools, + federation: [ + max_connections: 50, + timeout: 150_000 + ], + media: [ + max_connections: 50, + timeout: 150_000 + ], + upload: [ + max_connections: 25, + timeout: 300_000 + ] + config :pleroma, :restrict_unauthenticated, timelines: %{local: false, federated: false}, profiles: %{local: false, remote: false}, activities: %{local: false, remote: false} +config :pleroma, Pleroma.Web.ApiSpec.CastAndValidate, strict: false + # Import environment specific config. This must remain at the bottom # of this file so it overrides the configuration defined above. import_config "#{Mix.env()}.exs" diff --git a/config/description.exs b/config/description.exs index 3781fb9cb..a800d7823 100644 --- a/config/description.exs +++ b/config/description.exs @@ -28,7 +28,8 @@ %{ key: :filters, type: {:list, :module}, - description: "List of filter modules for uploads", + description: + "List of filter modules for uploads. Module names are shortened (removed leading `Pleroma.Upload.Filter.` part), but on adding custom module you need to use full name.", suggestions: Generator.list_modules_in_dir( "lib/pleroma/upload/filter", @@ -681,7 +682,8 @@ %{ key: :federation_publisher_modules, type: {:list, :module}, - description: "List of modules for federation publishing", + description: + "List of modules for federation publishing. Module names are shortened (removed leading `Pleroma.Web.` part), but on adding custom module you need to use full name.", suggestions: [ Pleroma.Web.ActivityPub.Publisher ] @@ -694,7 +696,8 @@ %{ key: :rewrite_policy, type: [:module, {:list, :module}], - description: "A list of MRF policies enabled", + description: + "A list of enabled MRF policies. Module names are shortened (removed leading `Pleroma.Web.ActivityPub.MRF.` part), but on adding custom module you need to use full name.", suggestions: Generator.list_modules_in_dir( "lib/pleroma/web/activity_pub/mrf", @@ -712,7 +715,7 @@ key: :quarantined_instances, type: {:list, :string}, description: - "List of ActivityPub instances where private (DMs, followers-only) activities will not be send", + "List of ActivityPub instances where private (DMs, followers-only) activities will not be sent", suggestions: [ "quarantined.com", "*.quarantined.com" @@ -919,6 +922,62 @@ key: :external_user_synchronization, type: :boolean, description: "Enabling following/followers counters synchronization for external users" + }, + %{ + key: :multi_factor_authentication, + type: :keyword, + description: "Multi-factor authentication settings", + suggestions: [ + [ + totp: [digits: 6, period: 30], + backup_codes: [number: 5, length: 16] + ] + ], + children: [ + %{ + key: :totp, + type: :keyword, + description: "TOTP settings", + suggestions: [digits: 6, period: 30], + children: [ + %{ + key: :digits, + type: :integer, + suggestions: [6], + description: + "Determines the length of a one-time pass-code, in characters. Defaults to 6 characters." + }, + %{ + key: :period, + type: :integer, + suggestions: [30], + description: + "a period for which the TOTP code will be valid, in seconds. Defaults to 30 seconds." + } + ] + }, + %{ + key: :backup_codes, + type: :keyword, + description: "MFA backup codes settings", + suggestions: [number: 5, length: 16], + children: [ + %{ + key: :number, + type: :integer, + suggestions: [5], + description: "number of backup codes to generate." + }, + %{ + key: :length, + type: :integer, + suggestions: [16], + description: + "Determines the length of backup one-time pass-codes, in characters. Defaults to 16 characters." + } + ] + } + ] } ] }, @@ -1046,32 +1105,97 @@ description: "Settings for Pleroma FE", suggestions: [ %{ - theme: "pleroma-dark", - logo: "/static/logo.png", - background: "/images/city.jpg", - redirectRootNoLogin: "/main/all", - redirectRootLogin: "/main/friends", - showInstanceSpecificPanel: true, - scopeOptionsEnabled: false, - formattingOptionsEnabled: false, - collapseMessageWithSubject: false, - hidePostStats: false, - hideUserStats: false, - scopeCopy: true, - subjectLineBehavior: "email", alwaysShowSubjectInput: true, - logoMask: false, + background: "/static/aurora_borealis.jpg", + collapseMessageWithSubject: false, + disableChat: false, + greentext: false, + hideFilteredStatuses: false, + hideMutedPosts: false, + hidePostStats: false, + hideSitename: false, + hideUserStats: false, + loginMethod: "password", + logo: "/static/logo.png", logoMargin: ".1em", - stickers: false, - enableEmojiPicker: false + logoMask: true, + minimalScopesMode: false, + noAttachmentLinks: false, + nsfwCensorImage: "", + postContentType: "text/plain", + redirectRootLogin: "/main/friends", + redirectRootNoLogin: "/main/all", + scopeCopy: true, + showFeaturesPanel: true, + showInstanceSpecificPanel: false, + subjectLineBehavior: "email", + theme: "pleroma-dark", + webPushNotifications: false } ], children: [ %{ - key: :theme, + key: :alwaysShowSubjectInput, + label: "Always show subject input", + type: :boolean, + description: "When disabled, auto-hide the subject field if it's empty" + }, + %{ + key: :background, type: :string, - description: "Which theme to use, they are defined in styles.json", - suggestions: ["pleroma-dark"] + description: + "URL of the background, unless viewing a user profile with a background that is set", + suggestions: ["/images/city.jpg"] + }, + %{ + key: :collapseMessageWithSubject, + label: "Collapse message with subject", + type: :boolean, + description: + "When a message has a subject (aka Content Warning), collapse it by default" + }, + %{ + key: :disableChat, + label: "PleromaFE Chat", + type: :boolean, + description: "Disables PleromaFE Chat component" + }, + %{ + key: :greentext, + label: "Greentext", + type: :boolean, + description: "Enables green text on lines prefixed with the > character." + }, + %{ + key: :hideFilteredStatuses, + label: "Hide Filtered Statuses", + type: :boolean, + description: "Hides filtered statuses from timelines." + }, + %{ + key: :hideMutedPosts, + label: "Hide Muted Posts", + type: :boolean, + description: "Hides muted statuses from timelines." + }, + %{ + key: :hidePostStats, + label: "Hide post stats", + type: :boolean, + description: "Hide notices statistics (repeats, favorites, ...)" + }, + %{ + key: :hideSitename, + label: "Hide Sitename", + type: :boolean, + description: "Hides instance name from PleromaFE banner." + }, + %{ + key: :hideUserStats, + label: "Hide user stats", + type: :boolean, + description: + "Hide profile statistics (posts, posts per day, followers, followings, ...)" }, %{ key: :logo, @@ -1080,11 +1204,44 @@ suggestions: ["/static/logo.png"] }, %{ - key: :background, + key: :logoMargin, + label: "Logo margin", type: :string, description: - "URL of the background, unless viewing a user profile with a background that is set", - suggestions: ["/images/city.jpg"] + "Allows you to adjust vertical margins between logo boundary and navbar borders. " <> + "The idea is that to have logo's image without any extra margins and instead adjust them to your need in layout.", + suggestions: [".1em"] + }, + %{ + key: :logoMask, + label: "Logo mask", + type: :boolean, + description: + "By default it assumes logo used will be monochrome with alpha channel to be compatible with both light and dark themes. " <> + "If you want a colorful logo you must disable logoMask." + }, + %{ + key: :minimalScopesMode, + label: "Minimal scopes mode", + type: :boolean, + description: + "Limit scope selection to Direct, User default, and Scope of post replying to. " <> + "Also prevents replying to a DM with a public post from PleromaFE." + }, + %{ + key: :nsfwCensorImage, + label: "NSFW Censor Image", + type: :string, + description: + "URL of the image to use for hiding NSFW media attachments in the timeline.", + suggestions: ["/static/img/nsfw.png"] + }, + %{ + key: :postContentType, + label: "Post Content Type", + type: {:dropdown, :atom}, + description: "Default post formatting option.", + suggestions: ["text/plain", "text/html", "text/markdown", "text/bbcode"] }, %{ key: :redirectRootNoLogin, @@ -1102,51 +1259,25 @@ "Relative URL which indicates where to redirect when a user is logged in", suggestions: ["/main/friends"] }, - %{ - key: :showInstanceSpecificPanel, - label: "Show instance specific panel", - type: :boolean, - description: "Whenether to show the instance's specific panel" - }, - %{ - key: :scopeOptionsEnabled, - label: "Scope options enabled", - type: :boolean, - description: "Enable setting a notice visibility and subject/CW when posting" - }, - %{ - key: :formattingOptionsEnabled, - label: "Formatting options enabled", - type: :boolean, - description: - "Enable setting a formatting different than plain-text (ie. HTML, Markdown) when posting, relates to `:instance`, `allowed_post_formats`" - }, - %{ - key: :collapseMessageWithSubject, - label: "Collapse message with subject", - type: :boolean, - description: - "When a message has a subject (aka Content Warning), collapse it by default" - }, - %{ - key: :hidePostStats, - label: "Hide post stats", - type: :boolean, - description: "Hide notices statistics (repeats, favorites, ...)" - }, - %{ - key: :hideUserStats, - label: "Hide user stats", - type: :boolean, - description: - "Hide profile statistics (posts, posts per day, followers, followings, ...)" - }, %{ key: :scopeCopy, label: "Scope copy", type: :boolean, description: "Copy the scope (private/unlisted/public) in replies to posts by default" }, + %{ + key: :showFeaturesPanel, + label: "Show instance features panel", + type: :boolean, + description: + "Enables panel displaying functionality of the instance on the About page." + }, + %{ + key: :showInstanceSpecificPanel, + label: "Show instance specific panel", + type: :boolean, + description: "Whether to show the instance's custom panel" + }, %{ key: :subjectLineBehavior, label: "Subject line behavior", @@ -1158,38 +1289,10 @@ suggestions: ["email", "masto", "noop"] }, %{ - key: :alwaysShowSubjectInput, - label: "Always show subject input", - type: :boolean, - description: "When disabled, auto-hide the subject field if it's empty" - }, - %{ - key: :logoMask, - label: "Logo mask", - type: :boolean, - description: - "By default it assumes logo used will be monochrome with alpha channel to be compatible with both light and dark themes. " <> - "If you want a colorful logo you must disable logoMask." - }, - %{ - key: :logoMargin, - label: "Logo margin", + key: :theme, type: :string, - description: - "Allows you to adjust vertical margins between logo boundary and navbar borders. " <> - "The idea is that to have logo's image without any extra margins and instead adjust them to your need in layout.", - suggestions: [".1em"] - }, - %{ - key: :stickers, - type: :boolean, - description: "Enables stickers." - }, - %{ - key: :enableEmojiPicker, - label: "Emoji picker", - type: :boolean, - description: "Enables emoji picker." + description: "Which theme to use. Available themes are defined in styles.json", + suggestions: ["pleroma-dark"] } ] }, @@ -1317,13 +1420,13 @@ %{ key: :reject, type: {:list, :string}, - description: "List of instances to reject any activities from", + description: "List of instances to reject activities from (except deletes)", suggestions: ["example.com", "*.example.com"] }, %{ key: :accept, type: {:list, :string}, - description: "List of instances to accept any activities from", + description: "List of instances to only accept activities from (except deletes)", suggestions: ["example.com", "*.example.com"] }, %{ @@ -1343,6 +1446,12 @@ type: {:list, :string}, description: "List of instances to strip banners from", suggestions: ["example.com", "*.example.com"] + }, + %{ + key: :reject_deletes, + type: {:list, :string}, + description: "List of instances to reject deletions from", + suggestions: ["example.com", "*.example.com"] } ] }, @@ -1969,7 +2078,8 @@ %{ key: :parsers, type: {:list, :module}, - description: "List of Rich Media parsers.", + description: + "List of Rich Media parsers. Module names are shortened (removed leading `Pleroma.Web.RichMedia.Parsers.` part), but on adding custom module you need to use full name.", suggestions: [ Pleroma.Web.RichMedia.Parsers.MetaTagsParser, Pleroma.Web.RichMedia.Parsers.OEmbed, @@ -1981,7 +2091,8 @@ key: :ttl_setters, label: "TTL setters", type: {:list, :module}, - description: "List of rich media TTL setters.", + description: + "List of rich media TTL setters. Module names are shortened (removed leading `Pleroma.Web.RichMedia.Parser.` part), but on adding custom module you need to use full name.", suggestions: [ Pleroma.Web.RichMedia.Parser.TTL.AwsSignedUrl ] @@ -2241,6 +2352,7 @@ children: [ %{ key: :active, + label: "Enabled", type: :boolean, description: "Globally enable or disable digest emails" }, @@ -2442,7 +2554,7 @@ %{ key: :relations_actions, type: [:tuple, {:list, :tuple}], - description: "For actions on relations with all users (follow, unfollow)", + description: "For actions on relationships with all users (follow, unfollow)", suggestions: [{1000, 10}, [{10_000, 10}, {10_000, 50}]] }, %{ @@ -2654,6 +2766,8 @@ %{ key: :scrub_policy, type: {:list, :module}, + description: + "Module names are shortened (removed leading `Pleroma.HTML.` part), but on adding custom module you need to use full name.", suggestions: [Pleroma.HTML.Transform.MediaProxy, Pleroma.HTML.Scrubber.Default] } ] @@ -2916,6 +3030,219 @@ } ] }, + %{ + group: :pleroma, + key: :connections_pool, + type: :group, + description: "Advanced settings for `gun` connections pool", + children: [ + %{ + key: :checkin_timeout, + type: :integer, + description: "Timeout to checkin connection from pool. Default: 250ms.", + suggestions: [250] + }, + %{ + key: :max_connections, + type: :integer, + description: "Maximum number of connections in the pool. Default: 250 connections.", + suggestions: [250] + }, + %{ + key: :retry, + type: :integer, + description: + "Number of retries, while `gun` will try to reconnect if connection goes down. Default: 1.", + suggestions: [1] + }, + %{ + key: :retry_timeout, + type: :integer, + description: + "Time between retries when `gun` will try to reconnect in milliseconds. Default: 1000ms.", + suggestions: [1000] + }, + %{ + key: :await_up_timeout, + type: :integer, + description: "Timeout while `gun` will wait until connection is up. Default: 5000ms.", + suggestions: [5000] + } + ] + }, + %{ + group: :pleroma, + key: :pools, + type: :group, + description: "Advanced settings for `gun` workers pools", + children: [ + %{ + key: :federation, + type: :keyword, + description: "Settings for federation pool.", + children: [ + %{ + key: :size, + type: :integer, + description: "Number workers in the pool.", + suggestions: [50] + }, + %{ + key: :max_overflow, + type: :integer, + description: "Number of additional workers if pool is under load.", + suggestions: [10] + }, + %{ + key: :timeout, + type: :integer, + description: "Timeout while `gun` will wait for response.", + suggestions: [150_000] + } + ] + }, + %{ + key: :media, + type: :keyword, + description: "Settings for media pool.", + children: [ + %{ + key: :size, + type: :integer, + description: "Number workers in the pool.", + suggestions: [50] + }, + %{ + key: :max_overflow, + type: :integer, + description: "Number of additional workers if pool is under load.", + suggestions: [10] + }, + %{ + key: :timeout, + type: :integer, + description: "Timeout while `gun` will wait for response.", + suggestions: [150_000] + } + ] + }, + %{ + key: :upload, + type: :keyword, + description: "Settings for upload pool.", + children: [ + %{ + key: :size, + type: :integer, + description: "Number workers in the pool.", + suggestions: [25] + }, + %{ + key: :max_overflow, + type: :integer, + description: "Number of additional workers if pool is under load.", + suggestions: [5] + }, + %{ + key: :timeout, + type: :integer, + description: "Timeout while `gun` will wait for response.", + suggestions: [300_000] + } + ] + }, + %{ + key: :default, + type: :keyword, + description: "Settings for default pool.", + children: [ + %{ + key: :size, + type: :integer, + description: "Number workers in the pool.", + suggestions: [10] + }, + %{ + key: :max_overflow, + type: :integer, + description: "Number of additional workers if pool is under load.", + suggestions: [2] + }, + %{ + key: :timeout, + type: :integer, + description: "Timeout while `gun` will wait for response.", + suggestions: [10_000] + } + ] + } + ] + }, + %{ + group: :pleroma, + key: :hackney_pools, + type: :group, + description: "Advanced settings for `hackney` connections pools", + children: [ + %{ + key: :federation, + type: :keyword, + description: "Settings for federation pool.", + children: [ + %{ + key: :max_connections, + type: :integer, + description: "Number workers in the pool.", + suggestions: [50] + }, + %{ + key: :timeout, + type: :integer, + description: "Timeout while `hackney` will wait for response.", + suggestions: [150_000] + } + ] + }, + %{ + key: :media, + type: :keyword, + description: "Settings for media pool.", + children: [ + %{ + key: :max_connections, + type: :integer, + description: "Number workers in the pool.", + suggestions: [50] + }, + %{ + key: :timeout, + type: :integer, + description: "Timeout while `hackney` will wait for response.", + suggestions: [150_000] + } + ] + }, + %{ + key: :upload, + type: :keyword, + description: "Settings for upload pool.", + children: [ + %{ + key: :max_connections, + type: :integer, + description: "Number workers in the pool.", + suggestions: [25] + }, + %{ + key: :timeout, + type: :integer, + description: "Timeout while `hackney` will wait for response.", + suggestions: [300_000] + } + ] + } + ] + }, %{ group: :pleroma, key: :restrict_unauthenticated, @@ -2975,5 +3302,19 @@ ] } ] + }, + %{ + group: :pleroma, + key: Pleroma.Web.ApiSpec.CastAndValidate, + type: :group, + children: [ + %{ + key: :strict, + type: :boolean, + description: + "Enables strict input validation (useful in development, not recommended in production)", + suggestions: [false] + } + ] } ] diff --git a/config/dev.exs b/config/dev.exs index 7e1e3b4be..4faaeff5b 100644 --- a/config/dev.exs +++ b/config/dev.exs @@ -52,6 +52,8 @@ hostname: "localhost", pool_size: 10 +config :pleroma, Pleroma.Web.ApiSpec.CastAndValidate, strict: true + if File.exists?("./config/dev.secret.exs") do import_config "dev.secret.exs" else diff --git a/config/test.exs b/config/test.exs index b8ea63c94..e38b9967d 100644 --- a/config/test.exs +++ b/config/test.exs @@ -56,6 +56,19 @@ ignore_hosts: [], ignore_tld: ["local", "localdomain", "lan"] +config :pleroma, :instance, + multi_factor_authentication: [ + totp: [ + # digits 6 or 8 + digits: 6, + period: 30 + ], + backup_codes: [ + number: 2, + length: 6 + ] + ] + config :web_push_encryption, :vapid_details, subject: "mailto:administrator@example.com", public_key: @@ -90,10 +103,14 @@ config :pleroma, :modules, runtime_dir: "test/fixtures/modules" +config :pleroma, Pleroma.Gun, Pleroma.GunMock + config :pleroma, Pleroma.Emails.NewUsersDigestEmail, enabled: true config :pleroma, Pleroma.Plugs.RemoteIp, enabled: false +config :pleroma, Pleroma.Web.ApiSpec.CastAndValidate, strict: true + if File.exists?("./config/test.secret.exs") do import_config "test.secret.exs" else diff --git a/coveralls.json b/coveralls.json new file mode 100644 index 000000000..75e845ade --- /dev/null +++ b/coveralls.json @@ -0,0 +1,6 @@ +{ + "skip_files": [ + "test/support", + "lib/mix/tasks/pleroma/benchmark.ex" + ] +} \ No newline at end of file diff --git a/docs/API/admin_api.md b/docs/API/admin_api.md index 47afdfba5..c455047cc 100644 --- a/docs/API/admin_api.md +++ b/docs/API/admin_api.md @@ -392,10 +392,24 @@ Note: Available `:permission_group` is currently moderator and admin. 404 is ret - `email` - `name`, optional +- Response: + - On success: `204`, empty response + - On failure: + - 400 Bad Request, JSON: + + ```json + [ + { + "error": "Appropriate error message here" + } + ] + ``` + ## `GET /api/pleroma/admin/users/:nickname/password_reset` ### Get a password reset token for a given nickname + - Params: none - Response: @@ -414,6 +428,91 @@ Note: Available `:permission_group` is currently moderator and admin. 404 is ret - `nicknames` - Response: none (code `204`) +## PUT `/api/pleroma/admin/users/disable_mfa` + +### Disable mfa for user's account. + +- Params: + - `nickname` +- Response: User’s nickname + +## `GET /api/pleroma/admin/users/:nickname/credentials` + +### Get the user's email, password, display and settings-related fields + +- Params: + - `nickname` + +- Response: + +```json +{ + "actor_type": "Person", + "allow_following_move": true, + "avatar": "https://pleroma.social/media/7e8e7508fd545ef580549b6881d80ec0ff2c81ed9ad37b9bdbbdf0e0d030159d.jpg", + "background": "https://pleroma.social/media/4de34c0bd10970d02cbdef8972bef0ebbf55f43cadc449554d4396156162fe9a.jpg", + "banner": "https://pleroma.social/media/8d92ba2bd244b613520abf557dd448adcd30f5587022813ee9dd068945986946.jpg", + "bio": "bio", + "default_scope": "public", + "discoverable": false, + "email": "user@example.com", + "fields": [ + { + "name": "example", + "value": "https://example.com" + } + ], + "hide_favorites": false, + "hide_followers": false, + "hide_followers_count": false, + "hide_follows": false, + "hide_follows_count": false, + "id": "9oouHaEEUR54hls968", + "locked": true, + "name": "user", + "no_rich_text": true, + "pleroma_settings_store": {}, + "raw_fields": [ + { + "id": 1, + "name": "example", + "value": "https://example.com" + }, + ], + "show_role": true, + "skip_thread_containment": false +} +``` + +## `PATCH /api/pleroma/admin/users/:nickname/credentials` + +### Change the user's email, password, display and settings-related fields + +- Params: + - `email` + - `password` + - `name` + - `bio` + - `avatar` + - `locked` + - `no_rich_text` + - `default_scope` + - `banner` + - `hide_follows` + - `hide_followers` + - `hide_followers_count` + - `hide_follows_count` + - `hide_favorites` + - `allow_following_move` + - `background` + - `show_role` + - `skip_thread_containment` + - `fields` + - `discoverable` + - `actor_type` + +- Response: none (code `200`) + ## `GET /api/pleroma/admin/reports` ### Get a list of reports @@ -665,6 +764,17 @@ Note: Available `:permission_group` is currently moderator and admin. 404 is ret - 400 Bad Request `"Invalid parameters"` when `status` is missing - On success: `204`, empty response +## `GET /api/pleroma/admin/statuses/:id` + +### Show status by id + +- Params: + - `id`: required, status id +- Response: + - On failure: + - 404 Not Found `"Not Found"` + - On success: JSON, Mastodon Status entity + ## `PUT /api/pleroma/admin/statuses/:id` ### Change the scope of an individual reported status @@ -696,6 +806,8 @@ Note: Available `:permission_group` is currently moderator and admin. 404 is ret ### Restarts pleroma application +**Only works when configuration from database is enabled.** + - Params: none - Response: - On failure: @@ -705,11 +817,24 @@ Note: Available `:permission_group` is currently moderator and admin. 404 is ret {} ``` +## `GET /api/pleroma/admin/need_reboot` + +### Returns the flag whether the pleroma should be restarted + +- Params: none +- Response: + - `need_reboot` - boolean +```json +{ + "need_reboot": false +} +``` + ## `GET /api/pleroma/admin/config` ### Get list of merged default settings with saved in database. -*If `need_reboot` flag exists in response, instance must be restarted, so reboot time settings can take effect.* +*If `need_reboot` is `true`, instance must be restarted, so reboot time settings can take effect.* **Only works when configuration from database is enabled.** @@ -731,13 +856,12 @@ Note: Available `:permission_group` is currently moderator and admin. 404 is ret "need_reboot": true } ``` - need_reboot - *optional*, if were changed reboot time settings. ## `POST /api/pleroma/admin/config` ### Update config settings -*If `need_reboot` flag exists in response, instance must be restarted, so reboot time settings can take effect.* +*If `need_reboot` is `true`, instance must be restarted, so reboot time settings can take effect.* **Only works when configuration from database is enabled.** @@ -764,6 +888,8 @@ Some modifications are necessary to save the config settings correctly: Most of the settings will be applied in `runtime`, this means that you don't need to restart the instance. But some settings are applied in `compile time` and require a reboot of the instance, such as: - all settings inside these keys: - `:hackney_pools` + - `:connections_pool` + - `:pools` - `:chat` - partially settings inside these keys: - `:seconds_valid` in `Pleroma.Captcha` @@ -879,7 +1005,6 @@ config :quack, "need_reboot": true } ``` -need_reboot - *optional*, if were changed reboot time settings. ## ` GET /api/pleroma/admin/config/descriptions` @@ -983,3 +1108,104 @@ Loads json generated from `config/descriptions.exs`. } } ``` + +## `GET /api/pleroma/admin/oauth_app` + +### List OAuth app + +- Params: + - *optional* `name` + - *optional* `client_id` + - *optional* `page` + - *optional* `page_size` + - *optional* `trusted` + +- Response: + +```json +{ + "apps": [ + { + "id": 1, + "name": "App name", + "client_id": "yHoDSiWYp5mPV6AfsaVOWjdOyt5PhWRiafi6MRd1lSk", + "client_secret": "nLmis486Vqrv2o65eM9mLQx_m_4gH-Q6PcDpGIMl6FY", + "redirect_uri": "https://example.com/oauth-callback", + "website": "https://example.com", + "trusted": true + } + ], + "count": 17, + "page_size": 50 +} +``` + + +## `POST /api/pleroma/admin/oauth_app` + +### Create OAuth App + +- Params: + - `name` + - `redirect_uris` + - `scopes` + - *optional* `website` + - *optional* `trusted` + +- Response: + +```json +{ + "id": 1, + "name": "App name", + "client_id": "yHoDSiWYp5mPV6AfsaVOWjdOyt5PhWRiafi6MRd1lSk", + "client_secret": "nLmis486Vqrv2o65eM9mLQx_m_4gH-Q6PcDpGIMl6FY", + "redirect_uri": "https://example.com/oauth-callback", + "website": "https://example.com", + "trusted": true +} +``` + +- On failure: +```json +{ + "redirect_uris": "can't be blank", + "name": "can't be blank" +} +``` + +## `PATCH /api/pleroma/admin/oauth_app/:id` + +### Update OAuth App + +- Params: + - *optional* `name` + - *optional* `redirect_uris` + - *optional* `scopes` + - *optional* `website` + - *optional* `trusted` + +- Response: + +```json +{ + "id": 1, + "name": "App name", + "client_id": "yHoDSiWYp5mPV6AfsaVOWjdOyt5PhWRiafi6MRd1lSk", + "client_secret": "nLmis486Vqrv2o65eM9mLQx_m_4gH-Q6PcDpGIMl6FY", + "redirect_uri": "https://example.com/oauth-callback", + "website": "https://example.com", + "trusted": true +} +``` + +## `DELETE /api/pleroma/admin/oauth_app/:id` + +### Delete OAuth App + +- Params: None + +- Response: + - On success: `204`, empty response + - On failure: + - 400 Bad Request `"Invalid parameters"` when `status` is missing \ No newline at end of file diff --git a/docs/API/differences_in_mastoapi_responses.md b/docs/API/differences_in_mastoapi_responses.md index dc8f54d2a..6d37d9008 100644 --- a/docs/API/differences_in_mastoapi_responses.md +++ b/docs/API/differences_in_mastoapi_responses.md @@ -4,7 +4,7 @@ A Pleroma instance can be identified by " (compatible; Pleroma ## Flake IDs -Pleroma uses 128-bit ids as opposed to Mastodon's 64 bits. However just like Mastodon's ids they are sortable strings +Pleroma uses 128-bit ids as opposed to Mastodon's 64 bits. However just like Mastodon's ids they are lexically sortable strings ## Attachment cap @@ -14,6 +14,7 @@ Some apps operate under the assumption that no more than 4 attachments can be re Adding the parameter `with_muted=true` to the timeline queries will also return activities by muted (not by blocked!) users. Adding the parameter `exclude_visibilities` to the timeline queries will exclude the statuses with the given visibilities. The parameter accepts an array of visibility types (`public`, `unlisted`, `private`, `direct`), e.g., `exclude_visibilities[]=direct&exclude_visibilities[]=private`. +Adding the parameter `reply_visibility` to the public and home timelines queries will filter replies. Possible values: without parameter (default) shows all replies, `following` - replies directed to you or users you follow, `self` - replies directed to you. ## Statuses @@ -60,6 +61,7 @@ Has these additional fields under the `pleroma` object: - `deactivated`: boolean, true when the user is deactivated - `allow_following_move`: boolean, true when the user allows automatically follow moved following accounts - `unread_conversation_count`: The count of unread conversations. Only returned to the account owner. +- `unread_notifications_count`: The count of unread notifications. Only returned to the account owner. ### Source @@ -119,6 +121,18 @@ Accepts additional parameters: - `exclude_visibilities`: will exclude the notifications for activities with the given visibilities. The parameter accepts an array of visibility types (`public`, `unlisted`, `private`, `direct`). Usage example: `GET /api/v1/notifications?exclude_visibilities[]=direct&exclude_visibilities[]=private`. - `include_types`: will include the notifications for activities with the given types. The parameter accepts an array of types (`mention`, `follow`, `reblog`, `favourite`, `move`, `pleroma:emoji_reaction`). Usage example: `GET /api/v1/notifications?include_types[]=mention&include_types[]=reblog`. +## DELETE `/api/v1/notifications/destroy_multiple` + +An endpoint to delete multiple statuses by IDs. + +Required parameters: + +- `ids`: array of activity ids + +Usage example: `DELETE /api/v1/notifications/destroy_multiple/?ids[]=1&ids[]=2`. + +Returns on success: 200 OK `{}` + ## POST `/api/v1/statuses` Additional parameters can be added to the JSON body/Form data: @@ -164,6 +178,7 @@ Additional parameters can be added to the JSON body/Form data: - `actor_type` - the type of this account. ### Pleroma Settings Store + Pleroma has mechanism that allows frontends to save blobs of json for each user on the backend. This can be used to save frontend-specific settings for a user that the backend does not need to know about. The parameter should have a form of `{frontend_name: {...}}`, with `frontend_name` identifying your type of client, e.g. `pleroma_fe`. It will overwrite everything under this property, but will not overwrite other frontend's settings. @@ -172,17 +187,41 @@ This information is returned in the `verify_credentials` endpoint. ## Authentication -*Pleroma supports refreshing tokens. +*Pleroma supports refreshing tokens.* `POST /oauth/token` -Post here request with grant_type=refresh_token to obtain new access token. Returns an access token. + +Post here request with `grant_type=refresh_token` to obtain new access token. Returns an access token. ## Account Registration + `POST /api/v1/accounts` Has theses additional parameters (which are the same as in Pleroma-API): - * `fullname`: optional - * `bio`: optional - * `captcha_solution`: optional, contains provider-specific captcha solution, - * `captcha_token`: optional, contains provider-specific captcha token - * `token`: invite token required when the registerations aren't public. + +- `fullname`: optional +- `bio`: optional +- `captcha_solution`: optional, contains provider-specific captcha solution, +- `captcha_token`: optional, contains provider-specific captcha token +- `captcha_answer_data`: optional, contains provider-specific captcha data +- `token`: invite token required when the registrations aren't public. + +## Instance + +`GET /api/v1/instance` has additional fields + +- `max_toot_chars`: The maximum characters per post +- `poll_limits`: The limits of polls +- `upload_limit`: The maximum upload file size +- `avatar_upload_limit`: The same for avatars +- `background_upload_limit`: The same for backgrounds +- `banner_upload_limit`: The same for banners +- `pleroma.metadata.features`: A list of supported features +- `pleroma.metadata.federation`: The federation restrictions of this instance +- `vapid_public_key`: The public key needed for push messages + +## Markers + +Has these additional fields under the `pleroma` object: + +- `unread_count`: contains number unread notifications diff --git a/docs/API/pleroma_api.md b/docs/API/pleroma_api.md index 12e63ef9f..5895613a3 100644 --- a/docs/API/pleroma_api.md +++ b/docs/API/pleroma_api.md @@ -70,7 +70,49 @@ Request parameters can be passed via [query strings](https://en.wikipedia.org/wi * Response: JSON. Returns `{"status": "success"}` if the account was successfully disabled, `{"error": "[error message]"}` otherwise * Example response: `{"error": "Invalid password."}` -## `/api/pleroma/admin/`… +## `/api/pleroma/accounts/mfa` +#### Gets current MFA settings +* method: `GET` +* Authentication: required +* OAuth scope: `read:security` +* Response: JSON. Returns `{"enabled": "false", "totp": false }` + +## `/api/pleroma/accounts/mfa/setup/totp` +#### Pre-setup the MFA/TOTP method +* method: `GET` +* Authentication: required +* OAuth scope: `write:security` +* Response: JSON. Returns `{"key": [secret_key], "provisioning_uri": "[qr code uri]" }` when successful, otherwise returns HTTP 422 `{"error": "error_msg"}` + +## `/api/pleroma/accounts/mfa/confirm/totp` +#### Confirms & enables MFA/TOTP support for user account. +* method: `POST` +* Authentication: required +* OAuth scope: `write:security` +* Params: + * `password`: user's password + * `code`: token from TOTP App +* Response: JSON. Returns `{}` if the enable was successful, HTTP 422 `{"error": "[error message]"}` otherwise + + +## `/api/pleroma/accounts/mfa/totp` +#### Disables MFA/TOTP method for user account. +* method: `DELETE` +* Authentication: required +* OAuth scope: `write:security` +* Params: + * `password`: user's password +* Response: JSON. Returns `{}` if the disable was successful, HTTP 422 `{"error": "[error message]"}` otherwise +* Example response: `{"error": "Invalid password."}` + +## `/api/pleroma/accounts/mfa/backup_codes` +#### Generstes backup codes MFA for user account. +* method: `GET` +* Authentication: required +* OAuth scope: `write:security` +* Response: JSON. Returns `{"codes": codes}`when successful, otherwise HTTP 422 `{"error": "[error message]"}` + +## `/api/pleroma/admin/` See [Admin-API](admin_api.md) ## `/api/v1/pleroma/notifications/read` @@ -323,20 +365,54 @@ The status posting endpoint takes an additional parameter, `in_reply_to_conversa * Params: None * Response: JSON, returns a list of Mastodon Conversation entities that were marked as read (200 - healthy, 503 unhealthy). -## `GET /api/pleroma/emoji/packs` -### Lists the custom emoji packs on the server +## `GET /api/pleroma/emoji/packs/import` +### Imports packs from filesystem * Method `GET` -* Authentication: not required +* Authentication: required * Params: None -* Response: JSON, "ok" and 200 status and the JSON hashmap of "pack name" to "pack contents" +* Response: JSON, returns a list of imported packs. -## `PUT /api/pleroma/emoji/packs/:name` -### Creates an empty custom emoji pack -* Method `PUT` +## `GET /api/pleroma/emoji/packs/remote` +### Make request to another instance for packs list +* Method `GET` +* Authentication: required +* Params: + * `url`: url of the instance to get packs from +* Response: JSON with the pack list, hashmap with pack name and pack contents + +## `POST /api/pleroma/emoji/packs/download` +### Download pack from another instance +* Method `POST` +* Authentication: required +* Params: + * `url`: url of the instance to download from + * `name`: pack to download from that instance + * `as`: (*optional*) name how to save pack +* Response: JSON, "ok" with 200 status if the pack was downloaded, or 500 if there were + errors downloading the pack + +## `POST /api/pleroma/emoji/packs/:name` +### Creates an empty pack +* Method `POST` * Authentication: required * Params: None * Response: JSON, "ok" and 200 status or 409 if the pack with that name already exists +## `PATCH /api/pleroma/emoji/packs/:name` +### Updates (replaces) pack metadata +* Method `PATCH` +* Authentication: required +* Params: + * `metadata`: metadata to replace the old one + * `license`: Pack license + * `homepage`: Pack home page url + * `description`: Pack description + * `fallback-src`: Fallback url to download pack from + * `fallback-src-sha256`: SHA256 encoded for fallback pack archive + * `share-files`: is pack allowed for sharing (boolean) +* Response: JSON, updated "metadata" section of the pack and 200 status or 400 if there was a + problem with the new metadata (the error is specified in the "error" part of the response JSON) + ## `DELETE /api/pleroma/emoji/packs/:name` ### Delete a custom emoji pack * Method `DELETE` @@ -344,53 +420,51 @@ The status posting endpoint takes an additional parameter, `in_reply_to_conversa * Params: None * Response: JSON, "ok" and 200 status or 500 if there was an error deleting the pack -## `POST /api/pleroma/emoji/packs/:name/update_file` -### Update a file in a custom emoji pack +## `POST /api/pleroma/emoji/packs/:name/files` +### Add new file to the pack * Method `POST` * Authentication: required * Params: - * if the `action` is `add`, adds an emoji named `shortcode` to the pack `pack_name`, - that means that the emoji file needs to be uploaded with the request - (thus requiring it to be a multipart request) and be named `file`. - There can also be an optional `filename` that will be the new emoji file name - (if it's not there, the name will be taken from the uploaded file). - * if the `action` is `update`, changes emoji shortcode - (from `shortcode` to `new_shortcode` or moves the file (from the current filename to `new_filename`) - * if the `action` is `remove`, removes the emoji named `shortcode` and it's associated file -* Response: JSON, updated "files" section of the pack and 200 status, 409 if the trying to use a shortcode - that is already taken, 400 if there was an error with the shortcode, filename or file (additional info - in the "error" part of the response JSON) + * `file`: file needs to be uploaded with the multipart request or link to remote file. + * `shortcode`: (*optional*) shortcode for new emoji, must be uniq for all emoji. If not sended, shortcode will be taken from original filename. + * `filename`: (*optional*) new emoji file name. If not specified will be taken from original filename. +* Response: JSON, list of files for updated pack (hashmap -> shortcode => filename) with status 200, either error status with error message. -## `POST /api/pleroma/emoji/packs/:name/update_metadata` -### Updates (replaces) pack metadata -* Method `POST` +## `PATCH /api/pleroma/emoji/packs/:name/files` +### Update emoji file from pack +* Method `PATCH` * Authentication: required * Params: - * `new_data`: new metadata to replace the old one -* Response: JSON, updated "metadata" section of the pack and 200 status or 400 if there was a - problem with the new metadata (the error is specified in the "error" part of the response JSON) + * `shortcode`: emoji file shortcode + * `new_shortcode`: new emoji file shortcode + * `new_filename`: new filename for emoji file + * `force`: (*optional*) with true value to overwrite existing emoji with new shortcode +* Response: JSON, list with updated files for updated pack (hashmap -> shortcode => filename) with status 200, either error status with error message. -## `POST /api/pleroma/emoji/packs/download_from` -### Requests the instance to download the pack from another instance -* Method `POST` +## `DELETE /api/pleroma/emoji/packs/:name/files` +### Delete emoji file from pack +* Method `DELETE` * Authentication: required * Params: - * `instance_address`: the address of the instance to download from - * `pack_name`: the pack to download from that instance -* Response: JSON, "ok" and 200 status if the pack was downloaded, or 500 if there were - errors downloading the pack + * `shortcode`: emoji file shortcode +* Response: JSON, list with updated files for updated pack (hashmap -> shortcode => filename) with status 200, either error status with error message. -## `POST /api/pleroma/emoji/packs/list_from` -### Requests the instance to list the packs from another instance -* Method `POST` -* Authentication: required -* Params: - * `instance_address`: the address of the instance to download from -* Response: JSON with the pack list, same as if the request was made to that instance's - list endpoint directly + 200 status +## `GET /api/pleroma/emoji/packs` +### Lists local custom emoji packs +* Method `GET` +* Authentication: not required +* Params: None +* Response: JSON, "ok" and 200 status and the JSON hashmap of pack name to pack contents -## `GET /api/pleroma/emoji/packs/:name/download_shared` -### Requests a local pack from the instance +## `GET /api/pleroma/emoji/packs/:name` +### Get pack.json for the pack +* Method `GET` +* Authentication: not required +* Params: None +* Response: JSON, pack json with `files` and `pack` keys with 200 status or 404 if the pack does not exist + +## `GET /api/pleroma/emoji/packs/:name/archive` +### Requests a local pack archive from the instance * Method `GET` * Authentication: not required * Params: None @@ -431,7 +505,7 @@ The status posting endpoint takes an additional parameter, `in_reply_to_conversa # Emoji Reactions -Emoji reactions work a lot like favourites do. They make it possible to react to a post with a single emoji character. +Emoji reactions work a lot like favourites do. They make it possible to react to a post with a single emoji character. To detect the presence of this feature, you can check `pleroma_emoji_reactions` entry in the features list of nodeinfo. ## `PUT /api/v1/pleroma/statuses/:id/reactions/:emoji` ### React to a post with a unicode emoji diff --git a/docs/administration/CLI_tasks/emoji.md b/docs/administration/CLI_tasks/emoji.md index efec8222c..3d524a52b 100644 --- a/docs/administration/CLI_tasks/emoji.md +++ b/docs/administration/CLI_tasks/emoji.md @@ -39,8 +39,8 @@ mix pleroma.emoji get-packs [option ...] mix pleroma.emoji gen-pack PACK-URL ``` -Currently, only .zip archives are recognized as remote pack files and packs are therefore assumed to be zip archives. This command is intended to run interactively and will first ask you some basic questions about the pack, then download the remote file and generate an SHA256 checksum for it, then generate an emoji file list for you. +Currently, only .zip archives are recognized as remote pack files and packs are therefore assumed to be zip archives. This command is intended to run interactively and will first ask you some basic questions about the pack, then download the remote file and generate an SHA256 checksum for it, then generate an emoji file list for you. - The manifest entry will either be written to a newly created `index.json` file or appended to the existing one, *replacing* the old pack with the same name if it was in the file previously. + The manifest entry will either be written to a newly created `pack_name.json` file (pack name is asked in questions) or appended to the existing one, *replacing* the old pack with the same name if it was in the file previously. The file list will be written to the file specified previously, *replacing* that file. You _should_ check that the file list doesn't contain anything you don't need in the pack, that is, anything that is not an emoji (the whole pack is downloaded, but only emoji files are extracted). diff --git a/docs/administration/CLI_tasks/oauth_app.md b/docs/administration/CLI_tasks/oauth_app.md new file mode 100644 index 000000000..4d6bfc25a --- /dev/null +++ b/docs/administration/CLI_tasks/oauth_app.md @@ -0,0 +1,16 @@ +# Creating trusted OAuth App + +{! backend/administration/CLI_tasks/general_cli_task_info.include !} + +## Create trusted OAuth App. + +Optional params: + * `-s SCOPES` - scopes for app, e.g. `read,write,follow,push`. + +```sh tab="OTP" + ./bin/pleroma_ctl app create -n APP_NAME -r REDIRECT_URI +``` + +```sh tab="From Source" +mix pleroma.app create -n APP_NAME -r REDIRECT_URI +``` \ No newline at end of file diff --git a/docs/clients.md b/docs/clients.md index 1eae0f0c6..7f98dc7b1 100644 --- a/docs/clients.md +++ b/docs/clients.md @@ -49,11 +49,11 @@ Feel free to contact us to be added to this list! - Platforms: Android - Features: Streaming Ready -### Roma -- Homepage: -- Source Code: [iOS](https://github.com/roma-apps/roma-ios), [Android](https://github.com/roma-apps/roma-android) +### Fedi +- Homepage: +- Source Code: Proprietary, but free - Platforms: iOS, Android -- Features: No Streaming +- Features: Pleroma-specific features like Reactions ### Tusky - Homepage: diff --git a/docs/configuration/cheatsheet.md b/docs/configuration/cheatsheet.md index d16435e11..1078c4e87 100644 --- a/docs/configuration/cheatsheet.md +++ b/docs/configuration/cheatsheet.md @@ -8,6 +8,10 @@ For from source installations Pleroma configuration works by first importing the To add configuration to your config file, you can copy it from the base config. The latest version of it can be viewed [here](https://git.pleroma.social/pleroma/pleroma/blob/develop/config/config.exs). You can also use this file if you don't know how an option is supposed to be formatted. +## :chat + +* `enabled` - Enables the backend chat. Defaults to `true`. + ## :instance * `name`: The instance’s name. * `email`: Email used to reach an Administrator/Moderator of the instance. @@ -369,8 +373,7 @@ Available caches: * `proxy_url`: an upstream proxy to fetch posts and/or media with, (default: `nil`) * `send_user_agent`: should we include a user agent with HTTP requests? (default: `true`) * `user_agent`: what user agent should we use? (default: `:default`), must be string or `:default` -* `adapter`: array of hackney options - +* `adapter`: array of adapter options ### :hackney_pools @@ -389,6 +392,42 @@ For each pool, the options are: * `timeout` - retention duration for connections +### :connections_pool + +*For `gun` adapter* + +Advanced settings for connections pool. Pool with opened connections. These connections can be reused in worker pools. + +For big instances it's recommended to increase `config :pleroma, :connections_pool, max_connections: 500` up to 500-1000. +It will increase memory usage, but federation would work faster. + +* `:checkin_timeout` - timeout to checkin connection from pool. Default: 250ms. +* `:max_connections` - maximum number of connections in the pool. Default: 250 connections. +* `:retry` - number of retries, while `gun` will try to reconnect if connection goes down. Default: 1. +* `:retry_timeout` - time between retries when `gun` will try to reconnect in milliseconds. Default: 1000ms. +* `:await_up_timeout` - timeout while `gun` will wait until connection is up. Default: 5000ms. + +### :pools + +*For `gun` adapter* + +Advanced settings for workers pools. + +There are four pools used: + +* `:federation` for the federation jobs. + You may want this pool max_connections to be at least equal to the number of federator jobs + retry queue jobs. +* `:media` for rich media, media proxy +* `:upload` for uploaded media (if using a remote uploader and `proxy_remote: true`) +* `:default` for other requests + +For each pool, the options are: + +* `:size` - how much workers the pool can hold +* `:timeout` - timeout while `gun` will wait for response +* `:max_overflow` - additional workers if pool is under load + + ## Captcha ### Pleroma.Captcha @@ -868,12 +907,33 @@ config :auto_linker, * `runtime_dir`: A path to custom Elixir modules (such as MRF policies). - ## :configurable_from_database Boolean, enables/disables in-database configuration. Read [Transfering the config to/from the database](../administration/CLI_tasks/config.md) for more information. +## :database_config_whitelist +List of valid configuration sections which are allowed to be configured from the +database. Settings stored in the database before the whitelist is configured are +still applied, so it is suggested to only use the whitelist on instances that +have not migrated the config to the database. + +Example: +```elixir +config :pleroma, :database_config_whitelist, [ + {:pleroma, :instance}, + {:pleroma, Pleroma.Web.Metadata}, + {:auto_linker} +] +``` + +### Multi-factor authentication - :two_factor_authentication +* `totp` - a list containing TOTP configuration + - `digits` - Determines the length of a one-time pass-code in characters. Defaults to 6 characters. + - `period` - a period for which the TOTP code will be valid in seconds. Defaults to 30 seconds. +* `backup_codes` - a list containing backup codes configuration + - `number` - number of backup codes to generate. + - `length` - backup code length. Defaults to 16 characters. ## Restrict entities access for unauthenticated users @@ -889,4 +949,9 @@ Restrict access for unauthenticated users to timelines (public and federate), us * `remote` * `activities` - statuses * `local` - * `remote` \ No newline at end of file + * `remote` + + +## Pleroma.Web.ApiSpec.CastAndValidate + +* `:strict` a boolean, enables strict input validation (useful in development, not recommended in production). Defaults to `false`. diff --git a/docs/configuration/hardening.md b/docs/configuration/hardening.md index b54c28850..d3bfc4e4a 100644 --- a/docs/configuration/hardening.md +++ b/docs/configuration/hardening.md @@ -36,7 +36,7 @@ content-security-policy: default-src 'none'; base-uri 'self'; frame-ancestors 'none'; - img-src 'self' data: https:; + img-src 'self' data: blob: https:; media-src 'self' https:; style-src 'self' 'unsafe-inline'; font-src 'self'; diff --git a/docs/configuration/mrf.md b/docs/configuration/mrf.md index c3957c255..d48d0cc99 100644 --- a/docs/configuration/mrf.md +++ b/docs/configuration/mrf.md @@ -41,11 +41,15 @@ config :pleroma, :instance, Once `SimplePolicy` is enabled, you can configure various groups in the `:mrf_simple` config object. These groups are: -* `media_removal`: Servers in this group will have media stripped from incoming messages. -* `media_nsfw`: Servers in this group will have the #nsfw tag and sensitive setting injected into incoming messages which contain media. * `reject`: Servers in this group will have their messages rejected. -* `federated_timeline_removal`: Servers in this group will have their messages unlisted from the public timelines by flipping the `to` and `cc` fields. +* `accept`: If not empty, only messages from these instances will be accepted (whitelist federation). +* `media_nsfw`: Servers in this group will have the #nsfw tag and sensitive setting injected into incoming messages which contain media. +* `media_removal`: Servers in this group will have media stripped from incoming messages. +* `avatar_removal`: Avatars from these servers will be stripped from incoming messages. +* `banner_removal`: Banner images from these servers will be stripped from incoming messages. * `report_removal`: Servers in this group will have their reports (flags) rejected. +* `federated_timeline_removal`: Servers in this group will have their messages unlisted from the public timelines by flipping the `to` and `cc` fields. +* `reject_deletes`: Deletion requests will be rejected from these servers. Servers should be configured as lists. @@ -113,7 +117,7 @@ defmodule Pleroma.Web.ActivityPub.MRF.RewritePolicy do @impl true def describe do - {:ok, %{mrf_sample: %{content: "new message content"}}}` + {:ok, %{mrf_sample: %{content: "new message content"}}} end end ``` diff --git a/docs/dev.md b/docs/dev.md new file mode 100644 index 000000000..f1b4cbf8b --- /dev/null +++ b/docs/dev.md @@ -0,0 +1,23 @@ +This document contains notes and guidelines for Pleroma developers. + +# Authentication & Authorization + +## OAuth token-based authentication & authorization + +* Pleroma supports hierarchical OAuth scopes, just like Mastodon but with added granularity of admin scopes. For a reference, see [Mastodon OAuth scopes](https://docs.joinmastodon.org/api/oauth-scopes/). + +* It is important to either define OAuth scope restrictions or explicitly mark OAuth scope check as skipped, for every controller action. To define scopes, call `plug(Pleroma.Plugs.OAuthScopesPlug, %{scopes: [...]})`. To explicitly set OAuth scopes check skipped, call `plug(:skip_plug, Pleroma.Plugs.OAuthScopesPlug )`. + +* In controllers, `use Pleroma.Web, :controller` will result in `action/2` (see `Pleroma.Web.controller/0` for definition) be called prior to actual controller action, and it'll perform security / privacy checks before passing control to actual controller action. + + For routes with `:authenticated_api` pipeline, authentication & authorization are expected, thus `OAuthScopesPlug` will be run unless explicitly skipped (also `EnsureAuthenticatedPlug` will be executed immediately before action even if there was an early run to give an early error, since `OAuthScopesPlug` supports `:proceed_unauthenticated` option, and other plugs may support similar options as well). + + For `:api` pipeline routes, it'll be verified whether `OAuthScopesPlug` was called or explicitly skipped, and if it was not then auth information will be dropped for request. Then `EnsurePublicOrAuthenticatedPlug` will be called to ensure that either the instance is not private or user is authenticated (unless explicitly skipped). Such automated checks help to prevent human errors and result in higher security / privacy for users. + +## [HTTP Basic Authentication](https://developer.mozilla.org/en-US/docs/Web/HTTP/Headers/Authorization) + +* With HTTP Basic Auth, OAuth scopes check is _not_ performed for any action (since password is provided during the auth, requester is able to obtain a token with full permissions anyways). `Pleroma.Plugs.AuthenticationPlug` and `Pleroma.Plugs.LegacyAuthenticationPlug` both call `Pleroma.Plugs.OAuthScopesPlug.skip_plug(conn)` when password is provided. + +## Auth-related configuration, OAuth consumer mode etc. + +See `Authentication` section of [`docs/configuration/cheatsheet.md`](docs/configuration/cheatsheet.md#authentication). diff --git a/docs/installation/debian_based_en.md b/docs/installation/debian_based_en.md index fe2dbb92d..62d8733f7 100644 --- a/docs/installation/debian_based_en.md +++ b/docs/installation/debian_based_en.md @@ -7,13 +7,9 @@ This guide will assume you are on Debian Stretch. This guide should also work wi * `postgresql` (9.6+, Ubuntu 16.04 comes with 9.5, you can get a newer version from [here](https://www.postgresql.org/download/linux/ubuntu/)) * `postgresql-contrib` (9.6+, same situtation as above) -* `elixir` (1.5+, [install from here, Debian and Ubuntu ship older versions](https://elixir-lang.org/install.html#unix-and-unix-like) or use [asdf](https://github.com/asdf-vm/asdf) as the pleroma user) +* `elixir` (1.8+, Follow the guide to install from the Erlang Solutions repo or use [asdf](https://github.com/asdf-vm/asdf) as the pleroma user) * `erlang-dev` -* `erlang-tools` -* `erlang-parsetools` -* `erlang-eldap`, if you want to enable ldap authenticator -* `erlang-ssh` -* `erlang-xmerl` +* `erlang-nox` * `git` * `build-essential` @@ -50,7 +46,7 @@ sudo dpkg -i /tmp/erlang-solutions_1.0_all.deb ```shell sudo apt update -sudo apt install elixir erlang-dev erlang-parsetools erlang-xmerl erlang-tools erlang-ssh +sudo apt install elixir erlang-dev erlang-nox ``` ### Install PleromaBE diff --git a/docs/installation/debian_based_jp.md b/docs/installation/debian_based_jp.md index 7aa0bcc24..a3c4621d8 100644 --- a/docs/installation/debian_based_jp.md +++ b/docs/installation/debian_based_jp.md @@ -10,21 +10,17 @@ ### 必要なソフトウェア - PostgreSQL 9.6以上 (Ubuntu16.04では9.5しか提供されていないので，[](https://www.postgresql.org/download/linux/ubuntu/)こちらから新しいバージョンを入手してください) -- postgresql-contrib 9.6以上 (同上) -- Elixir 1.5 以上 ([Debianのリポジトリからインストールしないこと！！！ ここからインストールすること！](https://elixir-lang.org/install.html#unix-and-unix-like)。または [asdf](https://github.com/asdf-vm/asdf) をpleromaユーザーでインストールしてください) - - erlang-dev -- erlang-tools -- erlang-parsetools -- erlang-eldap (LDAP認証を有効化するときのみ必要) -- erlang-ssh -- erlang-xmerl -- git -- build-essential +- `postgresql-contrib` 9.6以上 (同上) +- Elixir 1.8 以上 ([Debianのリポジトリからインストールしないこと！！！ ここからインストールすること！](https://elixir-lang.org/install.html#unix-and-unix-like)。または [asdf](https://github.com/asdf-vm/asdf) をpleromaユーザーでインストールしてください) +- `erlang-dev` +- `erlang-nox` +- `git` +- `build-essential` #### このガイドで利用している追加パッケージ -- nginx (おすすめです。他のリバースプロキシを使う場合は、参考となる設定をこのリポジトリから探してください) -- certbot (または何らかのLet's Encrypt向けACMEクライアント) +- `nginx` (おすすめです。他のリバースプロキシを使う場合は、参考となる設定をこのリポジトリから探してください) +- `certbot` (または何らかのLet's Encrypt向けACMEクライアント) ### システムを準備する @@ -51,7 +47,7 @@ sudo dpkg -i /tmp/erlang-solutions_1.0_all.deb * ElixirとErlangをインストールします、 ``` sudo apt update -sudo apt install elixir erlang-dev erlang-parsetools erlang-xmerl erlang-tools erlang-ssh +sudo apt install elixir erlang-dev erlang-nox ``` ### Pleroma BE (バックエンド) をインストールします diff --git a/installation/init.d/pleroma b/installation/init.d/pleroma index ed50bb551..384536f7e 100755 --- a/installation/init.d/pleroma +++ b/installation/init.d/pleroma @@ -1,21 +1,45 @@ #!/sbin/openrc-run - -# Requires OpenRC >= 0.35 -directory=/opt/pleroma - -command=/usr/bin/mix -command_args="phx.server" +supervisor=supervise-daemon command_user=pleroma:pleroma command_background=1 - -export PORT=4000 -export MIX_ENV=prod - # Ask process to terminate within 30 seconds, otherwise kill it retry="SIGTERM/30/SIGKILL/5" - pidfile="/var/run/pleroma.pid" +directory=/opt/pleroma +healthcheck_delay=60 +healthcheck_timer=30 + +: ${pleroma_port:-4000} + +# Needs OpenRC >= 0.42 +#respawn_max=0 +#respawn_delay=5 + +# put pleroma_console=YES in /etc/conf.d/pleroma if you want to be able to +# connect to pleroma via an elixir console +if yesno "${pleroma_console}"; then + command=elixir + command_args="--name pleroma@127.0.0.1 --erl '-kernel inet_dist_listen_min 9001 inet_dist_listen_max 9001 inet_dist_use_interface {127,0,0,1}' -S mix phx.server" + + start_post() { + einfo "You can get a console by using this command as pleroma's user:" + einfo "iex --name console@127.0.0.1 --remsh pleroma@127.0.0.1" + } +else + command=/usr/bin/mix + command_args="phx.server" +fi + +export MIX_ENV=prod depend() { - need nginx postgresql + need nginx postgresql +} + +healthcheck() { + # put pleroma_health=YES in /etc/conf.d/pleroma if you want healthchecking + # and make sure you have curl installed + yesno "$pleroma_health" || return 0 + + curl -q "localhost:${pleroma_port}/api/pleroma/healthcheck" } diff --git a/installation/pleroma-apache.conf b/installation/pleroma-apache.conf index b5640ac3d..0d627f2d7 100644 --- a/installation/pleroma-apache.conf +++ b/installation/pleroma-apache.conf @@ -32,9 +32,8 @@ CustomLog ${APACHE_LOG_DIR}/access.log combined SSLEngine on - SSLCertificateFile /etc/letsencrypt/live/${servername}/cert.pem + SSLCertificateFile /etc/letsencrypt/live/${servername}/fullchain.pem SSLCertificateKeyFile /etc/letsencrypt/live/${servername}/privkey.pem - SSLCertificateChainFile /etc/letsencrypt/live/${servername}/fullchain.pem # Mozilla modern configuration, tweak to your needs SSLProtocol all -SSLv3 -TLSv1 -TLSv1.1 diff --git a/lib/mix/tasks/pleroma/app.ex b/lib/mix/tasks/pleroma/app.ex new file mode 100644 index 000000000..463e2449f --- /dev/null +++ b/lib/mix/tasks/pleroma/app.ex @@ -0,0 +1,49 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Mix.Tasks.Pleroma.App do + @moduledoc File.read!("docs/administration/CLI_tasks/oauth_app.md") + use Mix.Task + + import Mix.Pleroma + + @shortdoc "Creates trusted OAuth App" + + def run(["create" | options]) do + start_pleroma() + + {opts, _} = + OptionParser.parse!(options, + strict: [name: :string, redirect_uri: :string, scopes: :string], + aliases: [n: :name, r: :redirect_uri, s: :scopes] + ) + + scopes = + if opts[:scopes] do + String.split(opts[:scopes], ",") + else + ["read", "write", "follow", "push"] + end + + params = %{ + client_name: opts[:name], + redirect_uris: opts[:redirect_uri], + trusted: true, + scopes: scopes + } + + with {:ok, app} <- Pleroma.Web.OAuth.App.create(params) do + shell_info("#{app.client_name} successfully created:") + shell_info("App client_id: " <> app.client_id) + shell_info("App client_secret: " <> app.client_secret) + else + {:error, changeset} -> + shell_error("Creating failed:") + + Enum.each(Pleroma.Web.OAuth.App.errors(changeset), fn {key, error} -> + shell_error("#{key}: #{error}") + end) + end + end +end diff --git a/lib/mix/tasks/pleroma/benchmark.ex b/lib/mix/tasks/pleroma/benchmark.ex index a4885b70c..6ab7fe8ef 100644 --- a/lib/mix/tasks/pleroma/benchmark.ex +++ b/lib/mix/tasks/pleroma/benchmark.ex @@ -67,11 +67,51 @@ def run(["render_timeline", nickname | _] = args) do Pleroma.Web.MastodonAPI.StatusView.render("index.json", %{ activities: activities, for: user, - as: :activity + as: :activity, + skip_relationships: true }) end }, inputs: inputs ) end + + def run(["adapters"]) do + start_pleroma() + + :ok = + Pleroma.Gun.Conn.open( + "https://httpbin.org/stream-bytes/1500", + :gun_connections + ) + + Process.sleep(1_500) + + Benchee.run( + %{ + "Without conn and without pool" => fn -> + {:ok, %Tesla.Env{}} = + Pleroma.HTTP.get("https://httpbin.org/stream-bytes/1500", [], + adapter: [pool: :no_pool, receive_conn: false] + ) + end, + "Without conn and with pool" => fn -> + {:ok, %Tesla.Env{}} = + Pleroma.HTTP.get("https://httpbin.org/stream-bytes/1500", [], + adapter: [receive_conn: false] + ) + end, + "With reused conn and without pool" => fn -> + {:ok, %Tesla.Env{}} = + Pleroma.HTTP.get("https://httpbin.org/stream-bytes/1500", [], + adapter: [pool: :no_pool] + ) + end, + "With reused conn and with pool" => fn -> + {:ok, %Tesla.Env{}} = Pleroma.HTTP.get("https://httpbin.org/stream-bytes/1500") + end + }, + parallel: 10 + ) + end end diff --git a/lib/mix/tasks/pleroma/digest.ex b/lib/mix/tasks/pleroma/digest.ex index 7d09e70c5..3595f912d 100644 --- a/lib/mix/tasks/pleroma/digest.ex +++ b/lib/mix/tasks/pleroma/digest.ex @@ -1,5 +1,6 @@ defmodule Mix.Tasks.Pleroma.Digest do use Mix.Task + import Mix.Pleroma @shortdoc "Manages digest emails" @moduledoc File.read!("docs/administration/CLI_tasks/digest.md") @@ -22,12 +23,10 @@ def run(["test", nickname | opts]) do with %Swoosh.Email{} = email <- Pleroma.Emails.UserEmail.digest_email(patched_user) do {:ok, _} = Pleroma.Emails.Mailer.deliver(email) - Mix.shell().info("Digest email have been sent to #{nickname} (#{user.email})") + shell_info("Digest email have been sent to #{nickname} (#{user.email})") else _ -> - Mix.shell().info( - "Cound't find any mentions for #{nickname} since #{last_digest_emailed_at}" - ) + shell_info("Cound't find any mentions for #{nickname} since #{last_digest_emailed_at}") end end end diff --git a/lib/mix/tasks/pleroma/emoji.ex b/lib/mix/tasks/pleroma/emoji.ex index 2b03a3009..cdffa88b2 100644 --- a/lib/mix/tasks/pleroma/emoji.ex +++ b/lib/mix/tasks/pleroma/emoji.ex @@ -4,18 +4,18 @@ defmodule Mix.Tasks.Pleroma.Emoji do use Mix.Task + import Mix.Pleroma @shortdoc "Manages emoji packs" @moduledoc File.read!("docs/administration/CLI_tasks/emoji.md") def run(["ls-packs" | args]) do - Mix.Pleroma.start_pleroma() - Application.ensure_all_started(:hackney) + start_pleroma() {options, [], []} = parse_global_opts(args) - manifest = - fetch_manifest(if options[:manifest], do: options[:manifest], else: default_manifest()) + url_or_path = options[:manifest] || default_manifest() + manifest = fetch_manifest(url_or_path) Enum.each(manifest, fn {name, info} -> to_print = [ @@ -36,14 +36,13 @@ def run(["ls-packs" | args]) do end def run(["get-packs" | args]) do - Mix.Pleroma.start_pleroma() - Application.ensure_all_started(:hackney) + start_pleroma() {options, pack_names, []} = parse_global_opts(args) - manifest_url = if options[:manifest], do: options[:manifest], else: default_manifest() + url_or_path = options[:manifest] || default_manifest() - manifest = fetch_manifest(manifest_url) + manifest = fetch_manifest(url_or_path) for pack_name <- pack_names do if Map.has_key?(manifest, pack_name) do @@ -76,7 +75,10 @@ def run(["get-packs" | args]) do end # The url specified in files should be in the same directory - files_url = Path.join(Path.dirname(manifest_url), pack["files"]) + files_url = + url_or_path + |> Path.dirname() + |> Path.join(pack["files"]) IO.puts( IO.ANSI.format([ @@ -134,38 +136,51 @@ def run(["get-packs" | args]) do end end - def run(["gen-pack", src]) do - Application.ensure_all_started(:hackney) + def run(["gen-pack" | args]) do + start_pleroma() - proposed_name = Path.basename(src) |> Path.rootname() - name = String.trim(IO.gets("Pack name [#{proposed_name}]: ")) - # If there's no name, use the default one - name = if String.length(name) > 0, do: name, else: proposed_name - - license = String.trim(IO.gets("License: ")) - homepage = String.trim(IO.gets("Homepage: ")) - description = String.trim(IO.gets("Description: ")) - - proposed_files_name = "#{name}.json" - files_name = String.trim(IO.gets("Save file list to [#{proposed_files_name}]: ")) - files_name = if String.length(files_name) > 0, do: files_name, else: proposed_files_name - - default_exts = [".png", ".gif"] - default_exts_str = Enum.join(default_exts, " ") - - exts = - String.trim( - IO.gets("Emoji file extensions (separated with spaces) [#{default_exts_str}]: ") + {opts, [src], []} = + OptionParser.parse( + args, + strict: [ + name: :string, + license: :string, + homepage: :string, + description: :string, + files: :string, + extensions: :string + ] ) + proposed_name = Path.basename(src) |> Path.rootname() + name = get_option(opts, :name, "Pack name:", proposed_name) + license = get_option(opts, :license, "License:") + homepage = get_option(opts, :homepage, "Homepage:") + description = get_option(opts, :description, "Description:") + + proposed_files_name = "#{name}_files.json" + files_name = get_option(opts, :files, "Save file list to:", proposed_files_name) + + default_exts = [".png", ".gif"] + + custom_exts = + get_option( + opts, + :extensions, + "Emoji file extensions (separated with spaces):", + Enum.join(default_exts, " ") + ) + |> String.split(" ", trim: true) + exts = - if String.length(exts) > 0 do - String.split(exts, " ") - |> Enum.filter(fn e -> e |> String.trim() |> String.length() > 0 end) - else + if MapSet.equal?(MapSet.new(default_exts), MapSet.new(custom_exts)) do default_exts + else + custom_exts end + IO.puts("Using #{Enum.join(exts, " ")} extensions") + IO.puts("Downloading the pack and generating SHA256") binary_archive = Tesla.get!(client(), src).body @@ -195,14 +210,16 @@ def run(["gen-pack", src]) do IO.puts(""" #{files_name} has been created and contains the list of all found emojis in the pack. - Please review the files in the remove those not needed. + Please review the files in the pack and remove those not needed. """) - if File.exists?("index.json") do - existing_data = File.read!("index.json") |> Jason.decode!() + pack_file = "#{name}.json" + + if File.exists?(pack_file) do + existing_data = File.read!(pack_file) |> Jason.decode!() File.write!( - "index.json", + pack_file, Jason.encode!( Map.merge( existing_data, @@ -212,11 +229,11 @@ def run(["gen-pack", src]) do ) ) - IO.puts("index.json file has been update with the #{name} pack") + IO.puts("#{pack_file} has been updated with the #{name} pack") else - File.write!("index.json", Jason.encode!(pack_json, pretty: true)) + File.write!(pack_file, Jason.encode!(pack_json, pretty: true)) - IO.puts("index.json has been created with the #{name} pack") + IO.puts("#{pack_file} has been created with the #{name} pack") end end diff --git a/lib/mix/tasks/pleroma/user.ex b/lib/mix/tasks/pleroma/user.ex index 40dd9bdc0..da140ac86 100644 --- a/lib/mix/tasks/pleroma/user.ex +++ b/lib/mix/tasks/pleroma/user.ex @@ -8,6 +8,8 @@ defmodule Mix.Tasks.Pleroma.User do alias Ecto.Changeset alias Pleroma.User alias Pleroma.UserInviteToken + alias Pleroma.Web.ActivityPub.Builder + alias Pleroma.Web.ActivityPub.Pipeline @shortdoc "Manages Pleroma users" @moduledoc File.read!("docs/administration/CLI_tasks/user.md") @@ -96,8 +98,9 @@ def run(["new", nickname, email | rest]) do def run(["rm", nickname]) do start_pleroma() - with %User{local: true} = user <- User.get_cached_by_nickname(nickname) do - User.perform(:delete, user) + with %User{local: true} = user <- User.get_cached_by_nickname(nickname), + {:ok, delete_data, _} <- Builder.delete(user, user.ap_id), + {:ok, _delete, _} <- Pipeline.common_pipeline(delete_data, local: true) do shell_info("User #{nickname} deleted.") else _ -> shell_error("No local user #{nickname}") diff --git a/lib/pleroma/activity.ex b/lib/pleroma/activity.ex index 6ca05f74e..6213d0eb7 100644 --- a/lib/pleroma/activity.ex +++ b/lib/pleroma/activity.ex @@ -27,17 +27,13 @@ defmodule Pleroma.Activity do # https://github.com/tootsuite/mastodon/blob/master/app/models/notification.rb#L19 @mastodon_notification_types %{ "Create" => "mention", - "Follow" => "follow", + "Follow" => ["follow", "follow_request"], "Announce" => "reblog", "Like" => "favourite", "Move" => "move", "EmojiReact" => "pleroma:emoji_reaction" } - @mastodon_to_ap_notification_types for {k, v} <- @mastodon_notification_types, - into: %{}, - do: {v, k} - schema "activities" do field(:data, :map) field(:local, :boolean, default: true) @@ -95,6 +91,17 @@ def with_preloaded_object(query, join_type \\ :inner) do |> preload([activity, object: object], object: object) end + # Note: applies to fake activities (ActivityPub.Utils.get_notified_from_object/1 etc.) + def user_actor(%Activity{actor: nil}), do: nil + + def user_actor(%Activity{} = activity) do + with %User{} <- activity.user_actor do + activity.user_actor + else + _ -> User.get_cached_by_ap_id(activity.actor) + end + end + def with_joined_user_actor(query, join_type \\ :inner) do join(query, join_type, [activity], u in User, on: u.ap_id == activity.actor, @@ -280,15 +287,43 @@ defp purge_web_resp_cache(%Activity{} = activity) do defp purge_web_resp_cache(nil), do: nil - for {ap_type, type} <- @mastodon_notification_types do + def follow_accepted?( + %Activity{data: %{"type" => "Follow", "object" => followed_ap_id}} = activity + ) do + with %User{} = follower <- Activity.user_actor(activity), + %User{} = followed <- User.get_cached_by_ap_id(followed_ap_id) do + Pleroma.FollowingRelationship.following?(follower, followed) + else + _ -> false + end + end + + def follow_accepted?(_), do: false + + @spec mastodon_notification_type(Activity.t()) :: String.t() | nil + + for {ap_type, type} <- @mastodon_notification_types, not is_list(type) do def mastodon_notification_type(%Activity{data: %{"type" => unquote(ap_type)}}), do: unquote(type) end + def mastodon_notification_type(%Activity{data: %{"type" => "Follow"}} = activity) do + if follow_accepted?(activity) do + "follow" + else + "follow_request" + end + end + def mastodon_notification_type(%Activity{}), do: nil + @spec from_mastodon_notification_type(String.t()) :: String.t() | nil + @doc "Converts Mastodon notification type to AR activity type" def from_mastodon_notification_type(type) do - Map.get(@mastodon_to_ap_notification_types, type) + with {k, _v} <- + Enum.find(@mastodon_notification_types, fn {_k, v} -> type in List.wrap(v) end) do + k + end end def all_by_actor_and_id(actor, status_ids \\ []) diff --git a/lib/pleroma/activity/queries.ex b/lib/pleroma/activity/queries.ex index 04593b9fb..a34c20343 100644 --- a/lib/pleroma/activity/queries.ex +++ b/lib/pleroma/activity/queries.ex @@ -35,6 +35,13 @@ def by_author(query \\ Activity, %User{ap_id: ap_id}) do from(a in query, where: a.actor == ^ap_id) end + def find_by_object_ap_id(activities, object_ap_id) do + Enum.find( + activities, + &(object_ap_id in [is_map(&1.data["object"]) && &1.data["object"]["id"], &1.data["object"]]) + ) + end + @spec by_object_id(query, String.t() | [String.t()]) :: query def by_object_id(query \\ Activity, object_id) diff --git a/lib/pleroma/application.ex b/lib/pleroma/application.ex index 33f1705df..9d3d92b38 100644 --- a/lib/pleroma/application.ex +++ b/lib/pleroma/application.ex @@ -3,8 +3,12 @@ # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.Application do - import Cachex.Spec use Application + + import Cachex.Spec + + alias Pleroma.Config + require Logger @name Mix.Project.config()[:name] @@ -18,9 +22,9 @@ def named_version, do: @name <> " " <> @version def repository, do: @repository def user_agent do - case Pleroma.Config.get([:http, :user_agent], :default) do + case Config.get([:http, :user_agent], :default) do :default -> - info = "#{Pleroma.Web.base_url()} <#{Pleroma.Config.get([:instance, :email], "")}>" + info = "#{Pleroma.Web.base_url()} <#{Config.get([:instance, :email], "")}>" named_version() <> "; " <> info custom -> @@ -33,27 +37,50 @@ def user_agent do def start(_type, _args) do Pleroma.Config.Holder.save_default() Pleroma.HTML.compile_scrubbers() - Pleroma.Config.DeprecationWarnings.warn() + Config.DeprecationWarnings.warn() Pleroma.Plugs.HTTPSecurityPlug.warn_if_disabled() Pleroma.Repo.check_migrations_applied!() setup_instrumenters() load_custom_modules() + adapter = Application.get_env(:tesla, :adapter) + + if adapter == Tesla.Adapter.Gun do + if version = Pleroma.OTPVersion.version() do + [major, minor] = + version + |> String.split(".") + |> Enum.map(&String.to_integer/1) + |> Enum.take(2) + + if (major == 22 and minor < 2) or major < 22 do + raise " + !!!OTP VERSION WARNING!!! + You are using gun adapter with OTP version #{version}, which doesn't support correct handling of unordered certificates chains. Please update your Erlang/OTP to at least 22.2. + " + end + else + raise " + !!!OTP VERSION WARNING!!! + To support correct handling of unordered certificates chains - OTP version must be > 22.2. + " + end + end + # Define workers and child supervisors to be supervised children = [ Pleroma.Repo, - Pleroma.Config.TransferTask, + Config.TransferTask, Pleroma.Emoji, - Pleroma.Captcha, Pleroma.Plugs.RateLimiter.Supervisor ] ++ cachex_children() ++ - hackney_pool_children() ++ + http_children(adapter, @env) ++ [ Pleroma.Stats, Pleroma.JobQueueMonitor, - {Oban, Pleroma.Config.get(Oban)} + {Oban, Config.get(Oban)} ] ++ task_children(@env) ++ streamer_child(@env) ++ @@ -70,7 +97,7 @@ def start(_type, _args) do end def load_custom_modules do - dir = Pleroma.Config.get([:modules, :runtime_dir]) + dir = Config.get([:modules, :runtime_dir]) if dir && File.exists?(dir) do dir @@ -111,20 +138,6 @@ defp setup_instrumenters do Pleroma.Web.Endpoint.Instrumenter.setup() end - def enabled_hackney_pools do - [:media] ++ - if Application.get_env(:tesla, :adapter) == Tesla.Adapter.Hackney do - [:federation] - else - [] - end ++ - if Pleroma.Config.get([Pleroma.Upload, :proxy_remote]) do - [:upload] - else - [] - end - end - defp cachex_children do [ build_cachex("used_captcha", ttl_interval: seconds_valid_interval()), @@ -146,7 +159,7 @@ defp idempotency_expiration, do: expiration(default: :timer.seconds(6 * 60 * 60), interval: :timer.seconds(60)) defp seconds_valid_interval, - do: :timer.seconds(Pleroma.Config.get!([Pleroma.Captcha, :seconds_valid])) + do: :timer.seconds(Config.get!([Pleroma.Captcha, :seconds_valid])) defp build_cachex(type, opts), do: %{ @@ -155,12 +168,19 @@ defp build_cachex(type, opts), type: :worker } - defp chat_enabled?, do: Pleroma.Config.get([:chat, :enabled]) + defp chat_enabled?, do: Config.get([:chat, :enabled]) - defp streamer_child(:test), do: [] + defp streamer_child(env) when env in [:test, :benchmark], do: [] defp streamer_child(_) do - [Pleroma.Web.Streamer.supervisor()] + [ + {Registry, + [ + name: Pleroma.Web.Streamer.registry(), + keys: :duplicate, + partitions: System.schedulers_online() + ]} + ] end defp chat_child(_env, true) do @@ -169,13 +189,6 @@ defp chat_child(_env, true) do defp chat_child(_, _), do: [] - defp hackney_pool_children do - for pool <- enabled_hackney_pools() do - options = Pleroma.Config.get([:hackney_pools, pool]) - :hackney_pool.child_spec(pool, options) - end - end - defp task_children(:test) do [ %{ @@ -200,4 +213,31 @@ defp task_children(_) do } ] end + + # start hackney and gun pools in tests + defp http_children(_, :test) do + hackney_options = Config.get([:hackney_pools, :federation]) + hackney_pool = :hackney_pool.child_spec(:federation, hackney_options) + [hackney_pool, Pleroma.Pool.Supervisor] + end + + defp http_children(Tesla.Adapter.Hackney, _) do + pools = [:federation, :media] + + pools = + if Config.get([Pleroma.Upload, :proxy_remote]) do + [:upload | pools] + else + pools + end + + for pool <- pools do + options = Config.get([:hackney_pools, pool]) + :hackney_pool.child_spec(pool, options) + end + end + + defp http_children(Tesla.Adapter.Gun, _), do: [Pleroma.Pool.Supervisor] + + defp http_children(_, _), do: [] end diff --git a/lib/pleroma/bbs/authenticator.ex b/lib/pleroma/bbs/authenticator.ex index e5b37f33e..815de7002 100644 --- a/lib/pleroma/bbs/authenticator.ex +++ b/lib/pleroma/bbs/authenticator.ex @@ -4,7 +4,7 @@ defmodule Pleroma.BBS.Authenticator do use Sshd.PasswordAuthenticator - alias Comeonin.Pbkdf2 + alias Pleroma.Plugs.AuthenticationPlug alias Pleroma.User def authenticate(username, password) do @@ -12,7 +12,7 @@ def authenticate(username, password) do password = to_string(password) with %User{} = user <- User.get_by_nickname(username) do - Pbkdf2.checkpw(password, user.password_hash) + AuthenticationPlug.checkpw(password, user.password_hash) else _e -> false end diff --git a/lib/pleroma/bbs/handler.ex b/lib/pleroma/bbs/handler.ex index c7bc8ef6c..12d64c2fe 100644 --- a/lib/pleroma/bbs/handler.ex +++ b/lib/pleroma/bbs/handler.ex @@ -66,7 +66,7 @@ def handle_command(%{user: user} = state, "r " <> text) do with %Activity{} <- Activity.get_by_id(activity_id), {:ok, _activity} <- - CommonAPI.post(user, %{"status" => rest, "in_reply_to_status_id" => activity_id}) do + CommonAPI.post(user, %{status: rest, in_reply_to_status_id: activity_id}) do IO.puts("Replied!") else _e -> IO.puts("Could not reply...") @@ -78,7 +78,7 @@ def handle_command(%{user: user} = state, "r " <> text) do def handle_command(%{user: user} = state, "p " <> text) do text = String.trim(text) - with {:ok, _activity} <- CommonAPI.post(user, %{"status" => text}) do + with {:ok, _activity} <- CommonAPI.post(user, %{status: text}) do IO.puts("Posted!") else _e -> IO.puts("Could not post...") diff --git a/lib/pleroma/captcha/captcha.ex b/lib/pleroma/captcha/captcha.ex index cf75c3adc..6ab754b6f 100644 --- a/lib/pleroma/captcha/captcha.ex +++ b/lib/pleroma/captcha/captcha.ex @@ -3,53 +3,22 @@ # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.Captcha do - import Pleroma.Web.Gettext - alias Calendar.DateTime alias Plug.Crypto.KeyGenerator alias Plug.Crypto.MessageEncryptor - use GenServer - - @doc false - def start_link(_) do - GenServer.start_link(__MODULE__, [], name: __MODULE__) - end - - @doc false - def init(_) do - {:ok, nil} - end - @doc """ Ask the configured captcha service for a new captcha """ def new do - GenServer.call(__MODULE__, :new) - end - - @doc """ - Ask the configured captcha service to validate the captcha - """ - def validate(token, captcha, answer_data) do - GenServer.call(__MODULE__, {:validate, token, captcha, answer_data}) - end - - @doc false - def handle_call(:new, _from, state) do - enabled = Pleroma.Config.get([__MODULE__, :enabled]) - - if !enabled do - {:reply, %{type: :none}, state} + if not enabled?() do + %{type: :none} else new_captcha = method().new() - secret_key_base = Pleroma.Config.get!([Pleroma.Web.Endpoint, :secret_key_base]) - # This make salt a little different for two keys - token = new_captcha[:token] - secret = KeyGenerator.generate(secret_key_base, token <> "_encrypt") - sign_secret = KeyGenerator.generate(secret_key_base, token <> "_sign") + {secret, sign_secret} = secret_pair(new_captcha[:token]) + # Basically copy what Phoenix.Token does here, add the time to # the actual data and make it a binary to then encrypt it encrypted_captcha_answer = @@ -60,55 +29,73 @@ def handle_call(:new, _from, state) do |> :erlang.term_to_binary() |> MessageEncryptor.encrypt(secret, sign_secret) - { - :reply, - # Replace the answer with the encrypted answer - %{new_captcha | answer_data: encrypted_captcha_answer}, - state - } + # Replace the answer with the encrypted answer + %{new_captcha | answer_data: encrypted_captcha_answer} end end - @doc false - def handle_call({:validate, token, captcha, answer_data}, _from, state) do + @doc """ + Ask the configured captcha service to validate the captcha + """ + def validate(token, captcha, answer_data) do + with {:ok, %{at: at, answer_data: answer_md5}} <- validate_answer_data(token, answer_data), + :ok <- validate_expiration(at), + :ok <- validate_usage(token), + :ok <- method().validate(token, captcha, answer_md5), + {:ok, _} <- mark_captcha_as_used(token) do + :ok + end + end + + def enabled?, do: Pleroma.Config.get([__MODULE__, :enabled], false) + + defp seconds_valid, do: Pleroma.Config.get!([__MODULE__, :seconds_valid]) + + defp secret_pair(token) do secret_key_base = Pleroma.Config.get!([Pleroma.Web.Endpoint, :secret_key_base]) secret = KeyGenerator.generate(secret_key_base, token <> "_encrypt") sign_secret = KeyGenerator.generate(secret_key_base, token <> "_sign") + {secret, sign_secret} + end + + defp validate_answer_data(token, answer_data) do + {secret, sign_secret} = secret_pair(token) + + with false <- is_nil(answer_data), + {:ok, data} <- MessageEncryptor.decrypt(answer_data, secret, sign_secret), + %{at: at, answer_data: answer_md5} <- :erlang.binary_to_term(data) do + {:ok, %{at: at, answer_data: answer_md5}} + else + _ -> {:error, :invalid_answer_data} + end + end + + defp validate_expiration(created_at) do # If the time found is less than (current_time-seconds_valid) then the time has already passed # Later we check that the time found is more than the presumed invalidatation time, that means # that the data is still valid and the captcha can be checked - seconds_valid = Pleroma.Config.get!([Pleroma.Captcha, :seconds_valid]) - valid_if_after = DateTime.subtract!(DateTime.now_utc(), seconds_valid) - result = - with false <- is_nil(answer_data), - {:ok, data} <- MessageEncryptor.decrypt(answer_data, secret, sign_secret), - %{at: at, answer_data: answer_md5} <- :erlang.binary_to_term(data) do - try do - if DateTime.before?(at, valid_if_after), - do: throw({:error, dgettext("errors", "CAPTCHA expired")}) + valid_if_after = DateTime.subtract!(DateTime.now_utc(), seconds_valid()) - if not is_nil(Cachex.get!(:used_captcha_cache, token)), - do: throw({:error, dgettext("errors", "CAPTCHA already used")}) + if DateTime.before?(created_at, valid_if_after) do + {:error, :expired} + else + :ok + end + end - res = method().validate(token, captcha, answer_md5) - # Throw if an error occurs - if res != :ok, do: throw(res) + defp validate_usage(token) do + if is_nil(Cachex.get!(:used_captcha_cache, token)) do + :ok + else + {:error, :already_used} + end + end - # Mark this captcha as used - {:ok, _} = - Cachex.put(:used_captcha_cache, token, true, ttl: :timer.seconds(seconds_valid)) - - :ok - catch - :throw, e -> e - end - else - _ -> {:error, dgettext("errors", "Invalid answer data")} - end - - {:reply, result, state} + defp mark_captcha_as_used(token) do + ttl = seconds_valid() |> :timer.seconds() + Cachex.put(:used_captcha_cache, token, true, ttl: ttl) end defp method, do: Pleroma.Config.get!([__MODULE__, :method]) diff --git a/lib/pleroma/captcha/kocaptcha.ex b/lib/pleroma/captcha/kocaptcha.ex index 06ceb20b6..6bc2fa158 100644 --- a/lib/pleroma/captcha/kocaptcha.ex +++ b/lib/pleroma/captcha/kocaptcha.ex @@ -3,7 +3,6 @@ # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.Captcha.Kocaptcha do - import Pleroma.Web.Gettext alias Pleroma.Captcha.Service @behaviour Service @@ -13,7 +12,7 @@ def new do case Tesla.get(endpoint <> "/new") do {:error, _} -> - %{error: dgettext("errors", "Kocaptcha service unavailable")} + %{error: :kocaptcha_service_unavailable} {:ok, res} -> json_resp = Jason.decode!(res.body) @@ -33,6 +32,6 @@ def validate(_token, captcha, answer_data) do if not is_nil(captcha) and :crypto.hash(:md5, captcha) |> Base.encode16() == String.upcase(answer_data), do: :ok, - else: {:error, dgettext("errors", "Invalid CAPTCHA")} + else: {:error, :invalid} end end diff --git a/lib/pleroma/captcha/native.ex b/lib/pleroma/captcha/native.ex index 06c479ca9..a90631d61 100644 --- a/lib/pleroma/captcha/native.ex +++ b/lib/pleroma/captcha/native.ex @@ -3,7 +3,6 @@ # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.Captcha.Native do - import Pleroma.Web.Gettext alias Pleroma.Captcha.Service @behaviour Service @@ -11,7 +10,7 @@ defmodule Pleroma.Captcha.Native do def new do case Captcha.get() do :error -> - %{error: dgettext("errors", "Captcha error")} + %{error: :captcha_error} {:ok, answer_data, img_binary} -> %{ @@ -25,7 +24,7 @@ def new do @impl Service def validate(_token, captcha, captcha) when not is_nil(captcha), do: :ok - def validate(_token, _captcha, _answer), do: {:error, dgettext("errors", "Invalid CAPTCHA")} + def validate(_token, _captcha, _answer), do: {:error, :invalid} defp token do 10 diff --git a/lib/pleroma/config/loader.ex b/lib/pleroma/config/loader.ex index 6ca6550bd..0f3ecf1ed 100644 --- a/lib/pleroma/config/loader.ex +++ b/lib/pleroma/config/loader.ex @@ -47,7 +47,7 @@ defp filter(configs) do @spec filter_group(atom(), keyword()) :: keyword() def filter_group(group, configs) do Enum.reject(configs[group], fn {key, _v} -> - key in @reject_keys or (group == :phoenix and key == :serve_endpoints) + key in @reject_keys or (group == :phoenix and key == :serve_endpoints) or group == :postgrex end) end end diff --git a/lib/pleroma/config/transfer_task.ex b/lib/pleroma/config/transfer_task.ex index 7c3449b5e..c02b70e96 100644 --- a/lib/pleroma/config/transfer_task.ex +++ b/lib/pleroma/config/transfer_task.ex @@ -5,6 +5,7 @@ defmodule Pleroma.Config.TransferTask do use Task + alias Pleroma.Config alias Pleroma.ConfigDB alias Pleroma.Repo @@ -18,7 +19,9 @@ defmodule Pleroma.Config.TransferTask do {:pleroma, Oban}, {:pleroma, :rate_limit}, {:pleroma, :markup}, - {:plerome, :streamer} + {:pleroma, :streamer}, + {:pleroma, :pools}, + {:pleroma, :connections_pool} ] @reboot_time_subkeys [ @@ -32,45 +35,44 @@ defmodule Pleroma.Config.TransferTask do {:pleroma, :gopher, [:enabled]} ] - @reject [nil, :prometheus] - def start_link(_) do load_and_update_env() - if Pleroma.Config.get(:env) == :test, do: Ecto.Adapters.SQL.Sandbox.checkin(Repo) + if Config.get(:env) == :test, do: Ecto.Adapters.SQL.Sandbox.checkin(Repo) :ignore end - @spec load_and_update_env([ConfigDB.t()]) :: :ok | false - def load_and_update_env(deleted \\ [], restart_pleroma? \\ true) do - with {:configurable, true} <- - {:configurable, Pleroma.Config.get(:configurable_from_database)}, - true <- Ecto.Adapters.SQL.table_exists?(Repo, "config"), - started_applications <- Application.started_applications() do + @spec load_and_update_env([ConfigDB.t()], boolean()) :: :ok + def load_and_update_env(deleted_settings \\ [], restart_pleroma? \\ true) do + with {_, true} <- {:configurable, Config.get(:configurable_from_database)} do # We need to restart applications for loaded settings take effect - in_db = Repo.all(ConfigDB) + {logger, other} = + (Repo.all(ConfigDB) ++ deleted_settings) + |> Enum.map(&transform_and_merge/1) + |> Enum.split_with(fn {group, _, _, _} -> group in [:logger, :quack] end) - with_deleted = in_db ++ deleted + logger + |> Enum.sort() + |> Enum.each(&configure/1) - reject_for_restart = if restart_pleroma?, do: @reject, else: [:pleroma | @reject] + started_applications = Application.started_applications() - applications = - with_deleted - |> Enum.map(&merge_and_update(&1)) - |> Enum.uniq() - # TODO: some problem with prometheus after restart! - |> Enum.reject(&(&1 in reject_for_restart)) + # TODO: some problem with prometheus after restart! + reject = [nil, :prometheus, :postgrex] - # to be ensured that pleroma will be restarted last - applications = - if :pleroma in applications do - List.delete(applications, :pleroma) ++ [:pleroma] + reject = + if restart_pleroma? do + reject else - Restarter.Pleroma.rebooted() - applications + [:pleroma | reject] end - Enum.each(applications, &restart(started_applications, &1, Pleroma.Config.get(:env))) + other + |> Enum.map(&update/1) + |> Enum.uniq() + |> Enum.reject(&(&1 in reject)) + |> maybe_set_pleroma_last() + |> Enum.each(&restart(started_applications, &1, Config.get(:env))) :ok else @@ -78,51 +80,83 @@ def load_and_update_env(deleted \\ [], restart_pleroma? \\ true) do end end - defp merge_and_update(setting) do - try do - key = ConfigDB.from_string(setting.key) - group = ConfigDB.from_string(setting.group) + defp maybe_set_pleroma_last(apps) do + # to be ensured that pleroma will be restarted last + if :pleroma in apps do + apps + |> List.delete(:pleroma) + |> List.insert_at(-1, :pleroma) + else + Restarter.Pleroma.rebooted() + apps + end + end - default = Pleroma.Config.Holder.default_config(group, key) - value = ConfigDB.from_binary(setting.value) + defp transform_and_merge(%{group: group, key: key, value: value} = setting) do + group = ConfigDB.from_string(group) + key = ConfigDB.from_string(key) + value = ConfigDB.from_binary(value) - merged_value = - if Ecto.get_meta(setting, :state) == :deleted do - default - else - if can_be_merged?(default, value) do - ConfigDB.merge_group(group, key, default, value) - else - value - end - end + default = Config.Holder.default_config(group, key) - :ok = update_env(group, key, merged_value) - - if group != :logger do - if group != :pleroma or pleroma_need_restart?(group, key, value) do - group - end - else - # change logger configuration in runtime, without restart - if Keyword.keyword?(merged_value) and - key not in [:compile_time_application, :backends, :compile_time_purge_matching] do - Logger.configure_backend(key, merged_value) - else - Logger.configure([{key, merged_value}]) - end - - nil + merged = + cond do + Ecto.get_meta(setting, :state) == :deleted -> default + can_be_merged?(default, value) -> ConfigDB.merge_group(group, key, default, value) + true -> value end + + {group, key, value, merged} + end + + # change logger configuration in runtime, without restart + defp configure({:quack, key, _, merged}) do + Logger.configure_backend(Quack.Logger, [{key, merged}]) + :ok = update_env(:quack, key, merged) + end + + defp configure({_, :backends, _, merged}) do + # removing current backends + Enum.each(Application.get_env(:logger, :backends), &Logger.remove_backend/1) + + Enum.each(merged, &Logger.add_backend/1) + + :ok = update_env(:logger, :backends, merged) + end + + defp configure({_, key, _, merged}) when key in [:console, :ex_syslogger] do + merged = + if key == :console do + put_in(merged[:format], merged[:format] <> "\n") + else + merged + end + + backend = + if key == :ex_syslogger, + do: {ExSyslogger, :ex_syslogger}, + else: key + + Logger.configure_backend(backend, merged) + :ok = update_env(:logger, key, merged) + end + + defp configure({_, key, _, merged}) do + Logger.configure([{key, merged}]) + :ok = update_env(:logger, key, merged) + end + + defp update({group, key, value, merged}) do + try do + :ok = update_env(group, key, merged) + + if group != :pleroma or pleroma_need_restart?(group, key, value), do: group rescue error -> error_msg = - "updating env causes error, group: " <> - inspect(setting.group) <> - " key: " <> - inspect(setting.key) <> - " value: " <> - inspect(ConfigDB.from_binary(setting.value)) <> " error: " <> inspect(error) + "updating env causes error, group: #{inspect(group)}, key: #{inspect(key)}, value: #{ + inspect(value) + } error: #{inspect(error)}" Logger.warn(error_msg) @@ -130,6 +164,9 @@ defp merge_and_update(setting) do end end + defp update_env(group, key, nil), do: Application.delete_env(group, key) + defp update_env(group, key, value), do: Application.put_env(group, key, value) + @spec pleroma_need_restart?(atom(), atom(), any()) :: boolean() def pleroma_need_restart?(group, key, value) do group_and_key_need_reboot?(group, key) or group_and_subkey_need_reboot?(group, key, value) @@ -147,9 +184,6 @@ defp group_and_subkey_need_reboot?(group, key, value) do end) end - defp update_env(group, key, nil), do: Application.delete_env(group, key) - defp update_env(group, key, value), do: Application.put_env(group, key, value) - defp restart(_, :pleroma, env), do: Restarter.Pleroma.restart_after_boot(env) defp restart(started_applications, app, _) do diff --git a/lib/pleroma/constants.ex b/lib/pleroma/constants.ex index 4ba39b53f..06174f624 100644 --- a/lib/pleroma/constants.ex +++ b/lib/pleroma/constants.ex @@ -17,7 +17,13 @@ defmodule Pleroma.Constants do "announcement_count", "emoji", "context_id", - "deleted_activity_id" + "deleted_activity_id", + "pleroma_internal" ] ) + + const(static_only_files, + do: + ~w(index.html robots.txt static static-fe finmoji emoji packs sounds images instance sw.js sw-pleroma.js favicon.png schemas doc) + ) end diff --git a/lib/pleroma/conversation/participation.ex b/lib/pleroma/conversation/participation.ex index 693825cf5..51bb1bda9 100644 --- a/lib/pleroma/conversation/participation.ex +++ b/lib/pleroma/conversation/participation.ex @@ -128,22 +128,19 @@ def for_user(user, params \\ %{}) do |> Pleroma.Pagination.fetch_paginated(params) end - def restrict_recipients(query, user, %{"recipients" => user_ids}) do - user_ids = + def restrict_recipients(query, user, %{recipients: user_ids}) do + user_binary_ids = [user.id | user_ids] |> Enum.uniq() - |> Enum.reduce([], fn user_id, acc -> - {:ok, user_id} = FlakeId.Ecto.CompatType.dump(user_id) - [user_id | acc] - end) + |> User.binary_id() conversation_subquery = __MODULE__ |> group_by([p], p.conversation_id) |> having( [p], - count(p.user_id) == ^length(user_ids) and - fragment("array_agg(?) @> ?", p.user_id, ^user_ids) + count(p.user_id) == ^length(user_binary_ids) and + fragment("array_agg(?) @> ?", p.user_id, ^user_binary_ids) ) |> select([p], %{id: p.conversation_id}) @@ -175,7 +172,7 @@ def for_user_with_last_activity_id(user, params \\ %{}) do | last_activity_id: activity_id } end) - |> Enum.filter(& &1.last_activity_id) + |> Enum.reject(&is_nil(&1.last_activity_id)) end def get(_, _ \\ []) diff --git a/lib/pleroma/docs/json.ex b/lib/pleroma/docs/json.ex index 74f8b2615..d1cf1f487 100644 --- a/lib/pleroma/docs/json.ex +++ b/lib/pleroma/docs/json.ex @@ -18,7 +18,6 @@ def compile do with config <- Pleroma.Config.Loader.read("config/description.exs") do config[:pleroma][:config_description] |> Pleroma.Docs.Generator.convert_to_strings() - |> Jason.encode!() end end end diff --git a/lib/pleroma/ecto_enums.ex b/lib/pleroma/ecto_enums.ex index d9b601223..6fc47620c 100644 --- a/lib/pleroma/ecto_enums.ex +++ b/lib/pleroma/ecto_enums.ex @@ -4,10 +4,16 @@ import EctoEnum -defenum(UserRelationshipTypeEnum, +defenum(Pleroma.UserRelationship.Type, block: 1, mute: 2, reblog_mute: 3, notification_mute: 4, inverse_subscription: 5 ) + +defenum(Pleroma.FollowingRelationship.State, + follow_pending: 1, + follow_accept: 2, + follow_reject: 3 +) diff --git a/lib/pleroma/emoji/formatter.ex b/lib/pleroma/emoji/formatter.ex index 59ff2cac3..dc45b8a38 100644 --- a/lib/pleroma/emoji/formatter.ex +++ b/lib/pleroma/emoji/formatter.ex @@ -38,22 +38,14 @@ def demojify(text) do def demojify(text, nil), do: text - @doc "Outputs a list of the emoji-shortcodes in a text" - def get_emoji(text) when is_binary(text) do - Enum.filter(Emoji.get_all(), fn {emoji, %Emoji{}} -> - String.contains?(text, ":#{emoji}:") - end) - end - - def get_emoji(_), do: [] - @doc "Outputs a list of the emoji-Maps in a text" def get_emoji_map(text) when is_binary(text) do - get_emoji(text) + Emoji.get_all() + |> Enum.filter(fn {emoji, %Emoji{}} -> String.contains?(text, ":#{emoji}:") end) |> Enum.reduce(%{}, fn {name, %Emoji{file: file}}, acc -> Map.put(acc, name, "#{Pleroma.Web.Endpoint.static_url()}#{file}") end) end - def get_emoji_map(_), do: [] + def get_emoji_map(_), do: %{} end diff --git a/lib/pleroma/emoji/pack.ex b/lib/pleroma/emoji/pack.ex new file mode 100644 index 000000000..242344374 --- /dev/null +++ b/lib/pleroma/emoji/pack.ex @@ -0,0 +1,507 @@ +defmodule Pleroma.Emoji.Pack do + @derive {Jason.Encoder, only: [:files, :pack]} + defstruct files: %{}, + pack_file: nil, + path: nil, + pack: %{}, + name: nil + + @type t() :: %__MODULE__{ + files: %{String.t() => Path.t()}, + pack_file: Path.t(), + path: Path.t(), + pack: map(), + name: String.t() + } + + alias Pleroma.Emoji + + @spec emoji_path() :: Path.t() + def emoji_path do + static = Pleroma.Config.get!([:instance, :static_dir]) + Path.join(static, "emoji") + end + + @spec create(String.t()) :: :ok | {:error, File.posix()} | {:error, :empty_values} + def create(name) when byte_size(name) > 0 do + dir = Path.join(emoji_path(), name) + + with :ok <- File.mkdir(dir) do + %__MODULE__{ + pack_file: Path.join(dir, "pack.json") + } + |> save_pack() + end + end + + def create(_), do: {:error, :empty_values} + + @spec show(String.t()) :: {:ok, t()} | {:loaded, nil} | {:error, :empty_values} + def show(name) when byte_size(name) > 0 do + with {_, %__MODULE__{} = pack} <- {:loaded, load_pack(name)}, + {_, pack} <- validate_pack(pack) do + {:ok, pack} + end + end + + def show(_), do: {:error, :empty_values} + + @spec delete(String.t()) :: + {:ok, [binary()]} | {:error, File.posix(), binary()} | {:error, :empty_values} + def delete(name) when byte_size(name) > 0 do + emoji_path() + |> Path.join(name) + |> File.rm_rf() + end + + def delete(_), do: {:error, :empty_values} + + @spec add_file(String.t(), String.t(), Path.t(), Plug.Upload.t() | String.t()) :: + {:ok, t()} | {:error, File.posix()} | {:error, :empty_values} + def add_file(name, shortcode, filename, file) + when byte_size(name) > 0 and byte_size(shortcode) > 0 and byte_size(filename) > 0 do + with {_, nil} <- {:exists, Emoji.get(shortcode)}, + {_, %__MODULE__{} = pack} <- {:loaded, load_pack(name)} do + file_path = Path.join(pack.path, filename) + + create_subdirs(file_path) + + case file do + %Plug.Upload{path: upload_path} -> + # Copy the uploaded file from the temporary directory + File.copy!(upload_path, file_path) + + url when is_binary(url) -> + # Download and write the file + file_contents = Tesla.get!(url).body + File.write!(file_path, file_contents) + end + + files = Map.put(pack.files, shortcode, filename) + + updated_pack = %{pack | files: files} + + case save_pack(updated_pack) do + :ok -> + Emoji.reload() + {:ok, updated_pack} + + e -> + e + end + end + end + + def add_file(_, _, _, _), do: {:error, :empty_values} + + defp create_subdirs(file_path) do + if String.contains?(file_path, "/") do + file_path + |> Path.dirname() + |> File.mkdir_p!() + end + end + + @spec delete_file(String.t(), String.t()) :: + {:ok, t()} | {:error, File.posix()} | {:error, :empty_values} + def delete_file(name, shortcode) when byte_size(name) > 0 and byte_size(shortcode) > 0 do + with {_, %__MODULE__{} = pack} <- {:loaded, load_pack(name)}, + {_, {filename, files}} when not is_nil(filename) <- + {:exists, Map.pop(pack.files, shortcode)}, + emoji <- Path.join(pack.path, filename), + {_, true} <- {:exists, File.exists?(emoji)} do + emoji_dir = Path.dirname(emoji) + + File.rm!(emoji) + + if String.contains?(filename, "/") and File.ls!(emoji_dir) == [] do + File.rmdir!(emoji_dir) + end + + updated_pack = %{pack | files: files} + + case save_pack(updated_pack) do + :ok -> + Emoji.reload() + {:ok, updated_pack} + + e -> + e + end + end + end + + def delete_file(_, _), do: {:error, :empty_values} + + @spec update_file(String.t(), String.t(), String.t(), String.t(), boolean()) :: + {:ok, t()} | {:error, File.posix()} | {:error, :empty_values} + def update_file(name, shortcode, new_shortcode, new_filename, force) + when byte_size(name) > 0 and byte_size(shortcode) > 0 and byte_size(new_shortcode) > 0 and + byte_size(new_filename) > 0 do + with {_, %__MODULE__{} = pack} <- {:loaded, load_pack(name)}, + {_, {filename, files}} when not is_nil(filename) <- + {:exists, Map.pop(pack.files, shortcode)}, + {_, true} <- {:not_used, force or is_nil(Emoji.get(new_shortcode))} do + old_path = Path.join(pack.path, filename) + old_dir = Path.dirname(old_path) + new_path = Path.join(pack.path, new_filename) + + create_subdirs(new_path) + + :ok = File.rename(old_path, new_path) + + if String.contains?(filename, "/") and File.ls!(old_dir) == [] do + File.rmdir!(old_dir) + end + + files = Map.put(files, new_shortcode, new_filename) + + updated_pack = %{pack | files: files} + + case save_pack(updated_pack) do + :ok -> + Emoji.reload() + {:ok, updated_pack} + + e -> + e + end + end + end + + def update_file(_, _, _, _, _), do: {:error, :empty_values} + + @spec import_from_filesystem() :: {:ok, [String.t()]} | {:error, atom()} + def import_from_filesystem do + emoji_path = emoji_path() + + with {:ok, %{access: :read_write}} <- File.stat(emoji_path), + {:ok, results} <- File.ls(emoji_path) do + names = + results + |> Enum.map(&Path.join(emoji_path, &1)) + |> Enum.reject(fn path -> + File.dir?(path) and File.exists?(Path.join(path, "pack.json")) + end) + |> Enum.map(&write_pack_contents/1) + |> Enum.filter(& &1) + + {:ok, names} + else + {:ok, %{access: _}} -> {:error, :no_read_write} + e -> e + end + end + + defp write_pack_contents(path) do + pack = %__MODULE__{ + files: files_from_path(path), + path: path, + pack_file: Path.join(path, "pack.json") + } + + case save_pack(pack) do + :ok -> Path.basename(path) + _ -> nil + end + end + + defp files_from_path(path) do + txt_path = Path.join(path, "emoji.txt") + + if File.exists?(txt_path) do + # There's an emoji.txt file, it's likely from a pack installed by the pack manager. + # Make a pack.json file from the contents of that emoji.txt file + + # FIXME: Copy-pasted from Pleroma.Emoji/load_from_file_stream/2 + + # Create a map of shortcodes to filenames from emoji.txt + File.read!(txt_path) + |> String.split("\n") + |> Enum.map(&String.trim/1) + |> Enum.map(fn line -> + case String.split(line, ~r/,\s*/) do + # This matches both strings with and without tags + # and we don't care about tags here + [name, file | _] -> + file_dir_name = Path.dirname(file) + + file = + if String.ends_with?(path, file_dir_name) do + Path.basename(file) + else + file + end + + {name, file} + + _ -> + nil + end + end) + |> Enum.filter(& &1) + |> Enum.into(%{}) + else + # If there's no emoji.txt, assume all files + # that are of certain extensions from the config are emojis and import them all + pack_extensions = Pleroma.Config.get!([:emoji, :pack_extensions]) + Emoji.Loader.make_shortcode_to_file_map(path, pack_extensions) + end + end + + @spec list_remote(String.t()) :: {:ok, map()} + def list_remote(url) do + uri = + url + |> String.trim() + |> URI.parse() + + with {_, true} <- {:shareable, shareable_packs_available?(uri)} do + packs = + uri + |> URI.merge("/api/pleroma/emoji/packs") + |> to_string() + |> Tesla.get!() + |> Map.get(:body) + |> Jason.decode!() + + {:ok, packs} + end + end + + @spec list_local() :: {:ok, map()} + def list_local do + emoji_path = emoji_path() + + # Create the directory first if it does not exist. This is probably the first request made + # with the API so it should be sufficient + with {:create_dir, :ok} <- {:create_dir, File.mkdir_p(emoji_path)}, + {:ls, {:ok, results}} <- {:ls, File.ls(emoji_path)} do + packs = + results + |> Enum.map(&load_pack/1) + |> Enum.filter(& &1) + |> Enum.map(&validate_pack/1) + |> Map.new() + + {:ok, packs} + end + end + + defp validate_pack(pack) do + if downloadable?(pack) do + archive = fetch_archive(pack) + archive_sha = :crypto.hash(:sha256, archive) |> Base.encode16() + + info = + pack.pack + |> Map.put("can-download", true) + |> Map.put("download-sha256", archive_sha) + + {pack.name, Map.put(pack, :pack, info)} + else + info = Map.put(pack.pack, "can-download", false) + {pack.name, Map.put(pack, :pack, info)} + end + end + + defp downloadable?(pack) do + # If the pack is set as shared, check if it can be downloaded + # That means that when asked, the pack can be packed and sent to the remote + # Otherwise, they'd have to download it from external-src + pack.pack["share-files"] && + Enum.all?(pack.files, fn {_, file} -> + File.exists?(Path.join(pack.path, file)) + end) + end + + @spec get_archive(String.t()) :: {:ok, binary()} + def get_archive(name) do + with {_, %__MODULE__{} = pack} <- {:exists?, load_pack(name)}, + {_, true} <- {:can_download?, downloadable?(pack)} do + {:ok, fetch_archive(pack)} + end + end + + defp fetch_archive(pack) do + hash = :crypto.hash(:md5, File.read!(pack.pack_file)) + + case Cachex.get!(:emoji_packs_cache, pack.name) do + %{hash: ^hash, pack_data: archive} -> + archive + + _ -> + create_archive_and_cache(pack, hash) + end + end + + defp create_archive_and_cache(pack, hash) do + files = ['pack.json' | Enum.map(pack.files, fn {_, file} -> to_charlist(file) end)] + + {:ok, {_, result}} = + :zip.zip('#{pack.name}.zip', files, [:memory, cwd: to_charlist(pack.path)]) + + ttl_per_file = Pleroma.Config.get!([:emoji, :shared_pack_cache_seconds_per_file]) + overall_ttl = :timer.seconds(ttl_per_file * Enum.count(files)) + + Cachex.put!( + :emoji_packs_cache, + pack.name, + # if pack.json MD5 changes, the cache is not valid anymore + %{hash: hash, pack_data: result}, + # Add a minute to cache time for every file in the pack + ttl: overall_ttl + ) + + result + end + + @spec download(String.t(), String.t(), String.t()) :: :ok + def download(name, url, as) do + uri = + url + |> String.trim() + |> URI.parse() + + with {_, true} <- {:shareable, shareable_packs_available?(uri)} do + remote_pack = + uri + |> URI.merge("/api/pleroma/emoji/packs/#{name}") + |> to_string() + |> Tesla.get!() + |> Map.get(:body) + |> Jason.decode!() + + result = + case remote_pack["pack"] do + %{"share-files" => true, "can-download" => true, "download-sha256" => sha} -> + {:ok, + %{ + sha: sha, + url: URI.merge(uri, "/api/pleroma/emoji/packs/#{name}/archive") |> to_string() + }} + + %{"fallback-src" => src, "fallback-src-sha256" => sha} when is_binary(src) -> + {:ok, + %{ + sha: sha, + url: src, + fallback: true + }} + + _ -> + {:error, + "The pack was not set as shared and there is no fallback src to download from"} + end + + with {:ok, %{sha: sha, url: url} = pinfo} <- result, + %{body: archive} <- Tesla.get!(url), + {_, true} <- {:checksum, Base.decode16!(sha) == :crypto.hash(:sha256, archive)} do + local_name = as || name + + path = Path.join(emoji_path(), local_name) + + pack = %__MODULE__{ + name: local_name, + path: path, + files: remote_pack["files"], + pack_file: Path.join(path, "pack.json") + } + + File.mkdir_p!(pack.path) + + files = Enum.map(remote_pack["files"], fn {_, path} -> to_charlist(path) end) + # Fallback cannot contain a pack.json file + files = if pinfo[:fallback], do: files, else: ['pack.json' | files] + + {:ok, _} = :zip.unzip(archive, cwd: to_charlist(pack.path), file_list: files) + + # Fallback can't contain a pack.json file, since that would cause the fallback-src-sha256 + # in it to depend on itself + if pinfo[:fallback] do + save_pack(pack) + end + + :ok + end + end + end + + defp save_pack(pack), do: File.write(pack.pack_file, Jason.encode!(pack, pretty: true)) + + @spec save_metadata(map(), t()) :: {:ok, t()} | {:error, File.posix()} + def save_metadata(metadata, %__MODULE__{} = pack) do + pack = Map.put(pack, :pack, metadata) + + with :ok <- save_pack(pack) do + {:ok, pack} + end + end + + @spec update_metadata(String.t(), map()) :: {:ok, t()} | {:error, File.posix()} + def update_metadata(name, data) do + pack = load_pack(name) + + fb_sha_changed? = + not is_nil(data["fallback-src"]) and data["fallback-src"] != pack.pack["fallback-src"] + + with {_, true} <- {:update?, fb_sha_changed?}, + {:ok, %{body: zip}} <- Tesla.get(data["fallback-src"]), + {:ok, f_list} <- :zip.unzip(zip, [:memory]), + {_, true} <- {:has_all_files?, has_all_files?(pack.files, f_list)} do + fallback_sha = :crypto.hash(:sha256, zip) |> Base.encode16() + + data + |> Map.put("fallback-src-sha256", fallback_sha) + |> save_metadata(pack) + else + {:update?, _} -> save_metadata(data, pack) + e -> e + end + end + + # Check if all files from the pack.json are in the archive + defp has_all_files?(files, f_list) do + Enum.all?(files, fn {_, from_manifest} -> + List.keyfind(f_list, to_charlist(from_manifest), 0) + end) + end + + @spec load_pack(String.t()) :: t() | nil + def load_pack(name) do + pack_file = Path.join([emoji_path(), name, "pack.json"]) + + if File.exists?(pack_file) do + pack_file + |> File.read!() + |> from_json() + |> Map.put(:pack_file, pack_file) + |> Map.put(:path, Path.dirname(pack_file)) + |> Map.put(:name, name) + end + end + + defp from_json(json) do + map = Jason.decode!(json) + + struct(__MODULE__, %{files: map["files"], pack: map["pack"]}) + end + + defp shareable_packs_available?(uri) do + uri + |> URI.merge("/.well-known/nodeinfo") + |> to_string() + |> Tesla.get!() + |> Map.get(:body) + |> Jason.decode!() + |> Map.get("links") + |> List.last() + |> Map.get("href") + # Get the actual nodeinfo address and fetch it + |> Tesla.get!() + |> Map.get(:body) + |> Jason.decode!() + |> get_in(["metadata", "features"]) + |> Enum.member?("shareable_emoji_packs") + end +end diff --git a/lib/pleroma/filter.ex b/lib/pleroma/filter.ex index 7cb49360f..4d61b3650 100644 --- a/lib/pleroma/filter.ex +++ b/lib/pleroma/filter.ex @@ -89,11 +89,10 @@ def delete(%Pleroma.Filter{id: filter_key} = filter) when is_nil(filter_key) do |> Repo.delete() end - def update(%Pleroma.Filter{} = filter) do - destination = Map.from_struct(filter) - - Pleroma.Filter.get(filter.filter_id, %{id: filter.user_id}) - |> cast(destination, [:phrase, :context, :hide, :expires_at, :whole_word]) + def update(%Pleroma.Filter{} = filter, params) do + filter + |> cast(params, [:phrase, :context, :hide, :expires_at, :whole_word]) + |> validate_required([:phrase, :context]) |> Repo.update() end end diff --git a/lib/pleroma/following_relationship.ex b/lib/pleroma/following_relationship.ex index a6d281151..3a3082e72 100644 --- a/lib/pleroma/following_relationship.ex +++ b/lib/pleroma/following_relationship.ex @@ -8,12 +8,14 @@ defmodule Pleroma.FollowingRelationship do import Ecto.Changeset import Ecto.Query + alias Ecto.Changeset alias FlakeId.Ecto.CompatType + alias Pleroma.FollowingRelationship.State alias Pleroma.Repo alias Pleroma.User schema "following_relationships" do - field(:state, :string, default: "accept") + field(:state, State, default: :follow_pending) belongs_to(:follower, User, type: CompatType) belongs_to(:following, User, type: CompatType) @@ -21,12 +23,29 @@ defmodule Pleroma.FollowingRelationship do timestamps() end + @doc "Returns underlying integer code for state atom" + def state_int_code(state_atom), do: State.__enum_map__() |> Keyword.fetch!(state_atom) + + def accept_state_code, do: state_int_code(:follow_accept) + def changeset(%__MODULE__{} = following_relationship, attrs) do following_relationship |> cast(attrs, [:state]) |> put_assoc(:follower, attrs.follower) |> put_assoc(:following, attrs.following) |> validate_required([:state, :follower, :following]) + |> unique_constraint(:follower_id, + name: :following_relationships_follower_id_following_id_index + ) + |> validate_not_self_relationship() + end + + def state_to_enum(state) when state in ["pending", "accept", "reject"] do + String.to_existing_atom("follow_#{state}") + end + + def state_to_enum(state) do + raise "State is not convertible to Pleroma.FollowingRelationship.State: #{state}" end def get(%User{} = follower, %User{} = following) do @@ -35,7 +54,7 @@ def get(%User{} = follower, %User{} = following) do |> Repo.one() end - def update(follower, following, "reject"), do: unfollow(follower, following) + def update(follower, following, :follow_reject), do: unfollow(follower, following) def update(%User{} = follower, %User{} = following, state) do case get(follower, following) do @@ -50,7 +69,7 @@ def update(%User{} = follower, %User{} = following, state) do end end - def follow(%User{} = follower, %User{} = following, state \\ "accept") do + def follow(%User{} = follower, %User{} = following, state \\ :follow_accept) do %__MODULE__{} |> changeset(%{follower: follower, following: following, state: state}) |> Repo.insert(on_conflict: :nothing) @@ -69,6 +88,29 @@ def follower_count(%User{} = user) do |> Repo.aggregate(:count, :id) end + def followers_query(%User{} = user) do + __MODULE__ + |> join(:inner, [r], u in User, on: r.follower_id == u.id) + |> where([r], r.following_id == ^user.id) + |> where([r], r.state == ^:follow_accept) + end + + def followers_ap_ids(%User{} = user, from_ap_ids \\ nil) do + query = + user + |> followers_query() + |> select([r, u], u.ap_id) + + query = + if from_ap_ids do + where(query, [r, u], u.ap_id in ^from_ap_ids) + else + query + end + + Repo.all(query) + end + def following_count(%User{id: nil}), do: 0 def following_count(%User{} = user) do @@ -80,7 +122,7 @@ def following_count(%User{} = user) do def get_follow_requests(%User{id: id}) do __MODULE__ |> join(:inner, [r], f in assoc(r, :follower)) - |> where([r], r.state == "pending") + |> where([r], r.state == ^:follow_pending) |> where([r], r.following_id == ^id) |> select([r, f], f) |> Repo.all() @@ -88,16 +130,20 @@ def get_follow_requests(%User{id: id}) do def following?(%User{id: follower_id}, %User{id: followed_id}) do __MODULE__ - |> where(follower_id: ^follower_id, following_id: ^followed_id, state: "accept") + |> where(follower_id: ^follower_id, following_id: ^followed_id, state: ^:follow_accept) |> Repo.exists?() end + def following_query(%User{} = user) do + __MODULE__ + |> join(:inner, [r], u in User, on: r.following_id == u.id) + |> where([r], r.follower_id == ^user.id) + |> where([r], r.state == ^:follow_accept) + end + def following(%User{} = user) do following = - __MODULE__ - |> join(:inner, [r], u in User, on: r.following_id == u.id) - |> where([r], r.follower_id == ^user.id) - |> where([r], r.state == "accept") + following_query(user) |> select([r, u], u.follower_address) |> Repo.all() @@ -129,4 +175,82 @@ def move_following(origin, target) do move_following(origin, target) end end + + def all_between_user_sets( + source_users, + target_users + ) + when is_list(source_users) and is_list(target_users) do + source_user_ids = User.binary_id(source_users) + target_user_ids = User.binary_id(target_users) + + __MODULE__ + |> where( + fragment( + "(follower_id = ANY(?) AND following_id = ANY(?)) OR \ + (follower_id = ANY(?) AND following_id = ANY(?))", + ^source_user_ids, + ^target_user_ids, + ^target_user_ids, + ^source_user_ids + ) + ) + |> Repo.all() + end + + def find(following_relationships, follower, following) do + Enum.find(following_relationships, fn + fr -> fr.follower_id == follower.id and fr.following_id == following.id + end) + end + + @doc """ + For a query with joined activity, + keeps rows where activity's actor is followed by user -or- is NOT domain-blocked by user. + """ + def keep_following_or_not_domain_blocked(query, user) do + where( + query, + [_, activity], + fragment( + # "(actor's domain NOT in domain_blocks) OR (actor IS in followed AP IDs)" + """ + NOT (substring(? from '.*://([^/]*)') = ANY(?)) OR + ? = ANY(SELECT ap_id FROM users AS u INNER JOIN following_relationships AS fr + ON u.id = fr.following_id WHERE fr.follower_id = ? AND fr.state = ?) + """, + activity.actor, + ^user.domain_blocks, + activity.actor, + ^User.binary_id(user.id), + ^accept_state_code() + ) + ) + end + + defp validate_not_self_relationship(%Changeset{} = changeset) do + changeset + |> validate_follower_id_following_id_inequality() + |> validate_following_id_follower_id_inequality() + end + + defp validate_follower_id_following_id_inequality(%Changeset{} = changeset) do + validate_change(changeset, :follower_id, fn _, follower_id -> + if follower_id == get_field(changeset, :following_id) do + [source_id: "can't be equal to following_id"] + else + [] + end + end) + end + + defp validate_following_id_follower_id_inequality(%Changeset{} = changeset) do + validate_change(changeset, :following_id, fn _, following_id -> + if following_id == get_field(changeset, :follower_id) do + [target_id: "can't be equal to follower_id"] + else + [] + end + end) + end end diff --git a/lib/pleroma/formatter.ex b/lib/pleroma/formatter.ex index e2a658cb3..02a93a8dc 100644 --- a/lib/pleroma/formatter.ex +++ b/lib/pleroma/formatter.ex @@ -31,13 +31,23 @@ def escape_mention_handler("@" <> nickname = mention, buffer, _, _) do def mention_handler("@" <> nickname, buffer, opts, acc) do case User.get_cached_by_nickname(nickname) do %User{id: id} = user -> - ap_id = get_ap_id(user) + user_url = user.uri || user.ap_id nickname_text = get_nickname_text(nickname, opts) link = - ~s(@#{ - nickname_text - }) + Phoenix.HTML.Tag.content_tag( + :span, + Phoenix.HTML.Tag.content_tag( + :a, + ["@", Phoenix.HTML.Tag.content_tag(:span, nickname_text)], + "data-user": id, + class: "u-url mention", + href: user_url, + rel: "ugc" + ), + class: "h-card" + ) + |> Phoenix.HTML.safe_to_string() {link, %{acc | mentions: MapSet.put(acc.mentions, {"@" <> nickname, user})}} @@ -49,7 +59,15 @@ def mention_handler("@" <> nickname, buffer, opts, acc) do def hashtag_handler("#" <> tag = tag_text, _buffer, _opts, acc) do tag = String.downcase(tag) url = "#{Pleroma.Web.base_url()}/tag/#{tag}" - link = ~s(#{tag_text}) + + link = + Phoenix.HTML.Tag.content_tag(:a, tag_text, + class: "hashtag", + "data-tag": tag, + href: url, + rel: "tag ugc" + ) + |> Phoenix.HTML.safe_to_string() {link, %{acc | tags: MapSet.put(acc.tags, {tag_text, tag})}} end @@ -128,9 +146,6 @@ def truncate(text, max_length \\ 200, omission \\ "...") do end end - defp get_ap_id(%User{source_data: %{"url" => url}}) when is_binary(url), do: url - defp get_ap_id(%User{ap_id: ap_id}), do: ap_id - defp get_nickname_text(nickname, %{mentions_format: :full}), do: User.full_nickname(nickname) defp get_nickname_text(nickname, _), do: User.local_nickname(nickname) end diff --git a/lib/pleroma/gun/api.ex b/lib/pleroma/gun/api.ex new file mode 100644 index 000000000..f51cd7db8 --- /dev/null +++ b/lib/pleroma/gun/api.ex @@ -0,0 +1,45 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Gun.API do + @behaviour Pleroma.Gun + + alias Pleroma.Gun + + @gun_keys [ + :connect_timeout, + :http_opts, + :http2_opts, + :protocols, + :retry, + :retry_timeout, + :trace, + :transport, + :tls_opts, + :tcp_opts, + :socks_opts, + :ws_opts + ] + + @impl Gun + def open(host, port, opts \\ %{}), do: :gun.open(host, port, Map.take(opts, @gun_keys)) + + @impl Gun + defdelegate info(pid), to: :gun + + @impl Gun + defdelegate close(pid), to: :gun + + @impl Gun + defdelegate await_up(pid, timeout \\ 5_000), to: :gun + + @impl Gun + defdelegate connect(pid, opts), to: :gun + + @impl Gun + defdelegate await(pid, ref), to: :gun + + @impl Gun + defdelegate set_owner(pid, owner), to: :gun +end diff --git a/lib/pleroma/gun/conn.ex b/lib/pleroma/gun/conn.ex new file mode 100644 index 000000000..cd25a2e74 --- /dev/null +++ b/lib/pleroma/gun/conn.ex @@ -0,0 +1,198 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Gun.Conn do + @moduledoc """ + Struct for gun connection data + """ + alias Pleroma.Gun + alias Pleroma.Pool.Connections + + require Logger + + @type gun_state :: :up | :down + @type conn_state :: :active | :idle + + @type t :: %__MODULE__{ + conn: pid(), + gun_state: gun_state(), + conn_state: conn_state(), + used_by: [pid()], + last_reference: pos_integer(), + crf: float(), + retries: pos_integer() + } + + defstruct conn: nil, + gun_state: :open, + conn_state: :init, + used_by: [], + last_reference: 0, + crf: 1, + retries: 0 + + @spec open(String.t() | URI.t(), atom(), keyword()) :: :ok | nil + def open(url, name, opts \\ []) + def open(url, name, opts) when is_binary(url), do: open(URI.parse(url), name, opts) + + def open(%URI{} = uri, name, opts) do + pool_opts = Pleroma.Config.get([:connections_pool], []) + + opts = + opts + |> Enum.into(%{}) + |> Map.put_new(:retry, pool_opts[:retry] || 1) + |> Map.put_new(:retry_timeout, pool_opts[:retry_timeout] || 1000) + |> Map.put_new(:await_up_timeout, pool_opts[:await_up_timeout] || 5_000) + |> maybe_add_tls_opts(uri) + + key = "#{uri.scheme}:#{uri.host}:#{uri.port}" + + max_connections = pool_opts[:max_connections] || 250 + + conn_pid = + if Connections.count(name) < max_connections do + do_open(uri, opts) + else + close_least_used_and_do_open(name, uri, opts) + end + + if is_pid(conn_pid) do + conn = %Pleroma.Gun.Conn{ + conn: conn_pid, + gun_state: :up, + conn_state: :active, + last_reference: :os.system_time(:second) + } + + :ok = Gun.set_owner(conn_pid, Process.whereis(name)) + Connections.add_conn(name, key, conn) + end + end + + defp maybe_add_tls_opts(opts, %URI{scheme: "http"}), do: opts + + defp maybe_add_tls_opts(opts, %URI{scheme: "https", host: host}) do + tls_opts = [ + verify: :verify_peer, + cacertfile: CAStore.file_path(), + depth: 20, + reuse_sessions: false, + verify_fun: + {&:ssl_verify_hostname.verify_fun/3, + [check_hostname: Pleroma.HTTP.Connection.format_host(host)]} + ] + + tls_opts = + if Keyword.keyword?(opts[:tls_opts]) do + Keyword.merge(tls_opts, opts[:tls_opts]) + else + tls_opts + end + + Map.put(opts, :tls_opts, tls_opts) + end + + defp do_open(uri, %{proxy: {proxy_host, proxy_port}} = opts) do + connect_opts = + uri + |> destination_opts() + |> add_http2_opts(uri.scheme, Map.get(opts, :tls_opts, [])) + + with open_opts <- Map.delete(opts, :tls_opts), + {:ok, conn} <- Gun.open(proxy_host, proxy_port, open_opts), + {:ok, _} <- Gun.await_up(conn, opts[:await_up_timeout]), + stream <- Gun.connect(conn, connect_opts), + {:response, :fin, 200, _} <- Gun.await(conn, stream) do + conn + else + error -> + Logger.warn( + "Opening proxied connection to #{compose_uri_log(uri)} failed with error #{ + inspect(error) + }" + ) + + error + end + end + + defp do_open(uri, %{proxy: {proxy_type, proxy_host, proxy_port}} = opts) do + version = + proxy_type + |> to_string() + |> String.last() + |> case do + "4" -> 4 + _ -> 5 + end + + socks_opts = + uri + |> destination_opts() + |> add_http2_opts(uri.scheme, Map.get(opts, :tls_opts, [])) + |> Map.put(:version, version) + + opts = + opts + |> Map.put(:protocols, [:socks]) + |> Map.put(:socks_opts, socks_opts) + + with {:ok, conn} <- Gun.open(proxy_host, proxy_port, opts), + {:ok, _} <- Gun.await_up(conn, opts[:await_up_timeout]) do + conn + else + error -> + Logger.warn( + "Opening socks proxied connection to #{compose_uri_log(uri)} failed with error #{ + inspect(error) + }" + ) + + error + end + end + + defp do_open(%URI{host: host, port: port} = uri, opts) do + host = Pleroma.HTTP.Connection.parse_host(host) + + with {:ok, conn} <- Gun.open(host, port, opts), + {:ok, _} <- Gun.await_up(conn, opts[:await_up_timeout]) do + conn + else + error -> + Logger.warn( + "Opening connection to #{compose_uri_log(uri)} failed with error #{inspect(error)}" + ) + + error + end + end + + defp destination_opts(%URI{host: host, port: port}) do + host = Pleroma.HTTP.Connection.parse_host(host) + %{host: host, port: port} + end + + defp add_http2_opts(opts, "https", tls_opts) do + Map.merge(opts, %{protocols: [:http2], transport: :tls, tls_opts: tls_opts}) + end + + defp add_http2_opts(opts, _, _), do: opts + + defp close_least_used_and_do_open(name, uri, opts) do + with [{key, conn} | _conns] <- Connections.get_unused_conns(name), + :ok <- Gun.close(conn.conn) do + Connections.remove_conn(name, key) + + do_open(uri, opts) + else + [] -> {:error, :pool_overflowed} + end + end + + def compose_uri_log(%URI{scheme: scheme, host: host, path: path}) do + "#{scheme}://#{host}#{path}" + end +end diff --git a/lib/pleroma/gun/gun.ex b/lib/pleroma/gun/gun.ex new file mode 100644 index 000000000..4043e4880 --- /dev/null +++ b/lib/pleroma/gun/gun.ex @@ -0,0 +1,31 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Gun do + @callback open(charlist(), pos_integer(), map()) :: {:ok, pid()} + @callback info(pid()) :: map() + @callback close(pid()) :: :ok + @callback await_up(pid, pos_integer()) :: {:ok, atom()} | {:error, atom()} + @callback connect(pid(), map()) :: reference() + @callback await(pid(), reference()) :: {:response, :fin, 200, []} + @callback set_owner(pid(), pid()) :: :ok + + @api Pleroma.Config.get([Pleroma.Gun], Pleroma.Gun.API) + + defp api, do: @api + + def open(host, port, opts), do: api().open(host, port, opts) + + def info(pid), do: api().info(pid) + + def close(pid), do: api().close(pid) + + def await_up(pid, timeout \\ 5_000), do: api().await_up(pid, timeout) + + def connect(pid, opts), do: api().connect(pid, opts) + + def await(pid, ref), do: api().await(pid, ref) + + def set_owner(pid, owner), do: api().set_owner(pid, owner) +end diff --git a/lib/pleroma/healthcheck.ex b/lib/pleroma/healthcheck.ex index 8f7f43ec2..92ce83cb7 100644 --- a/lib/pleroma/healthcheck.ex +++ b/lib/pleroma/healthcheck.ex @@ -29,7 +29,7 @@ defmodule Pleroma.Healthcheck do @spec system_info() :: t() def system_info do %Healthcheck{ - memory_used: Float.round(:erlang.memory(:total) / 1024 / 1024, 2) + memory_used: Float.round(:recon_alloc.memory(:allocated) / 1024 / 1024, 2) } |> assign_db_info() |> assign_job_queue_stats() diff --git a/lib/pleroma/http/adapter_helper.ex b/lib/pleroma/http/adapter_helper.ex new file mode 100644 index 000000000..510722ff9 --- /dev/null +++ b/lib/pleroma/http/adapter_helper.ex @@ -0,0 +1,41 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.HTTP.AdapterHelper do + alias Pleroma.HTTP.Connection + + @type proxy :: + {Connection.host(), pos_integer()} + | {Connection.proxy_type(), Connection.host(), pos_integer()} + + @callback options(keyword(), URI.t()) :: keyword() + @callback after_request(keyword()) :: :ok + + @spec options(keyword(), URI.t()) :: keyword() + def options(opts, _uri) do + proxy = Pleroma.Config.get([:http, :proxy_url], nil) + maybe_add_proxy(opts, format_proxy(proxy)) + end + + @spec maybe_get_conn(URI.t(), keyword()) :: keyword() + def maybe_get_conn(_uri, opts), do: opts + + @spec after_request(keyword()) :: :ok + def after_request(_opts), do: :ok + + @spec format_proxy(String.t() | tuple() | nil) :: proxy() | nil + def format_proxy(nil), do: nil + + def format_proxy(proxy_url) do + case Connection.parse_proxy(proxy_url) do + {:ok, host, port} -> {host, port} + {:ok, type, host, port} -> {type, host, port} + _ -> nil + end + end + + @spec maybe_add_proxy(keyword(), proxy() | nil) :: keyword() + def maybe_add_proxy(opts, nil), do: opts + def maybe_add_proxy(opts, proxy), do: Keyword.put_new(opts, :proxy, proxy) +end diff --git a/lib/pleroma/http/adapter_helper/gun.ex b/lib/pleroma/http/adapter_helper/gun.ex new file mode 100644 index 000000000..ead7cdc6b --- /dev/null +++ b/lib/pleroma/http/adapter_helper/gun.ex @@ -0,0 +1,77 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.HTTP.AdapterHelper.Gun do + @behaviour Pleroma.HTTP.AdapterHelper + + alias Pleroma.HTTP.AdapterHelper + alias Pleroma.Pool.Connections + + require Logger + + @defaults [ + connect_timeout: 5_000, + domain_lookup_timeout: 5_000, + tls_handshake_timeout: 5_000, + retry: 1, + retry_timeout: 1000, + await_up_timeout: 5_000 + ] + + @spec options(keyword(), URI.t()) :: keyword() + def options(incoming_opts \\ [], %URI{} = uri) do + proxy = + Pleroma.Config.get([:http, :proxy_url]) + |> AdapterHelper.format_proxy() + + config_opts = Pleroma.Config.get([:http, :adapter], []) + + @defaults + |> Keyword.merge(config_opts) + |> add_scheme_opts(uri) + |> AdapterHelper.maybe_add_proxy(proxy) + |> maybe_get_conn(uri, incoming_opts) + end + + @spec after_request(keyword()) :: :ok + def after_request(opts) do + if opts[:conn] && opts[:body_as] != :chunks do + Connections.checkout(opts[:conn], self(), :gun_connections) + end + + :ok + end + + defp add_scheme_opts(opts, %{scheme: "http"}), do: opts + + defp add_scheme_opts(opts, %{scheme: "https"}) do + opts + |> Keyword.put(:certificates_verification, true) + |> Keyword.put(:tls_opts, log_level: :warning) + end + + defp maybe_get_conn(adapter_opts, uri, incoming_opts) do + {receive_conn?, opts} = + adapter_opts + |> Keyword.merge(incoming_opts) + |> Keyword.pop(:receive_conn, true) + + if Connections.alive?(:gun_connections) and receive_conn? do + checkin_conn(uri, opts) + else + opts + end + end + + defp checkin_conn(uri, opts) do + case Connections.checkin(uri, :gun_connections) do + nil -> + Task.start(Pleroma.Gun.Conn, :open, [uri, :gun_connections, opts]) + opts + + conn when is_pid(conn) -> + Keyword.merge(opts, conn: conn, close_conn: false) + end + end +end diff --git a/lib/pleroma/http/adapter_helper/hackney.ex b/lib/pleroma/http/adapter_helper/hackney.ex new file mode 100644 index 000000000..dcb4cac71 --- /dev/null +++ b/lib/pleroma/http/adapter_helper/hackney.ex @@ -0,0 +1,43 @@ +defmodule Pleroma.HTTP.AdapterHelper.Hackney do + @behaviour Pleroma.HTTP.AdapterHelper + + @defaults [ + connect_timeout: 10_000, + recv_timeout: 20_000, + follow_redirect: true, + force_redirect: true, + pool: :federation + ] + + @spec options(keyword(), URI.t()) :: keyword() + def options(connection_opts \\ [], %URI{} = uri) do + proxy = Pleroma.Config.get([:http, :proxy_url]) + + config_opts = Pleroma.Config.get([:http, :adapter], []) + + @defaults + |> Keyword.merge(config_opts) + |> Keyword.merge(connection_opts) + |> add_scheme_opts(uri) + |> Pleroma.HTTP.AdapterHelper.maybe_add_proxy(proxy) + end + + defp add_scheme_opts(opts, %URI{scheme: "http"}), do: opts + + defp add_scheme_opts(opts, %URI{scheme: "https", host: host}) do + ssl_opts = [ + ssl_options: [ + # Workaround for remote server certificate chain issues + partial_chain: &:hackney_connect.partial_chain/1, + + # We don't support TLS v1.3 yet + versions: [:tlsv1, :"tlsv1.1", :"tlsv1.2"], + server_name_indication: to_charlist(host) + ] + ] + + Keyword.merge(opts, ssl_opts) + end + + def after_request(_), do: :ok +end diff --git a/lib/pleroma/http/connection.ex b/lib/pleroma/http/connection.ex index 80e6c30d6..ebacf7902 100644 --- a/lib/pleroma/http/connection.ex +++ b/lib/pleroma/http/connection.ex @@ -4,40 +4,121 @@ defmodule Pleroma.HTTP.Connection do @moduledoc """ - Connection for http-requests. + Configure Tesla.Client with default and customized adapter options. """ - @hackney_options [ - connect_timeout: 10_000, - recv_timeout: 20_000, - follow_redirect: true, - force_redirect: true, - pool: :federation - ] - @adapter Application.get_env(:tesla, :adapter) + alias Pleroma.Config + alias Pleroma.HTTP.AdapterHelper + + require Logger + + @defaults [pool: :federation] + + @type ip_address :: ipv4_address() | ipv6_address() + @type ipv4_address :: {0..255, 0..255, 0..255, 0..255} + @type ipv6_address :: + {0..65_535, 0..65_535, 0..65_535, 0..65_535, 0..65_535, 0..65_535, 0..65_535, 0..65_535} + @type proxy_type() :: :socks4 | :socks5 + @type host() :: charlist() | ip_address() @doc """ - Configure a client connection - - # Returns - - Tesla.Env.client + Merge default connection & adapter options with received ones. """ - @spec new(Keyword.t()) :: Tesla.Env.client() - def new(opts \\ []) do - Tesla.client([], {@adapter, hackney_options(opts)}) + + @spec options(URI.t(), keyword()) :: keyword() + def options(%URI{} = uri, opts \\ []) do + @defaults + |> pool_timeout() + |> Keyword.merge(opts) + |> adapter_helper().options(uri) end - # fetch Hackney options - # - def hackney_options(opts) do - options = Keyword.get(opts, :adapter, []) - adapter_options = Pleroma.Config.get([:http, :adapter], []) - proxy_url = Pleroma.Config.get([:http, :proxy_url], nil) + defp pool_timeout(opts) do + {config_key, default} = + if adapter() == Tesla.Adapter.Gun do + {:pools, Config.get([:pools, :default, :timeout])} + else + {:hackney_pools, 10_000} + end - @hackney_options - |> Keyword.merge(adapter_options) - |> Keyword.merge(options) - |> Keyword.merge(proxy: proxy_url) + timeout = Config.get([config_key, opts[:pool], :timeout], default) + + Keyword.merge(opts, timeout: timeout) + end + + @spec after_request(keyword()) :: :ok + def after_request(opts), do: adapter_helper().after_request(opts) + + defp adapter, do: Application.get_env(:tesla, :adapter) + + defp adapter_helper do + case adapter() do + Tesla.Adapter.Gun -> AdapterHelper.Gun + Tesla.Adapter.Hackney -> AdapterHelper.Hackney + _ -> AdapterHelper + end + end + + @spec parse_proxy(String.t() | tuple() | nil) :: + {:ok, host(), pos_integer()} + | {:ok, proxy_type(), host(), pos_integer()} + | {:error, atom()} + | nil + + def parse_proxy(nil), do: nil + + def parse_proxy(proxy) when is_binary(proxy) do + with [host, port] <- String.split(proxy, ":"), + {port, ""} <- Integer.parse(port) do + {:ok, parse_host(host), port} + else + {_, _} -> + Logger.warn("Parsing port failed #{inspect(proxy)}") + {:error, :invalid_proxy_port} + + :error -> + Logger.warn("Parsing port failed #{inspect(proxy)}") + {:error, :invalid_proxy_port} + + _ -> + Logger.warn("Parsing proxy failed #{inspect(proxy)}") + {:error, :invalid_proxy} + end + end + + def parse_proxy(proxy) when is_tuple(proxy) do + with {type, host, port} <- proxy do + {:ok, type, parse_host(host), port} + else + _ -> + Logger.warn("Parsing proxy failed #{inspect(proxy)}") + {:error, :invalid_proxy} + end + end + + @spec parse_host(String.t() | atom() | charlist()) :: charlist() | ip_address() + def parse_host(host) when is_list(host), do: host + def parse_host(host) when is_atom(host), do: to_charlist(host) + + def parse_host(host) when is_binary(host) do + host = to_charlist(host) + + case :inet.parse_address(host) do + {:error, :einval} -> host + {:ok, ip} -> ip + end + end + + @spec format_host(String.t()) :: charlist() + def format_host(host) do + host_charlist = to_charlist(host) + + case :inet.parse_address(host_charlist) do + {:error, :einval} -> + :idna.encode(host_charlist) + + {:ok, _ip} -> + host_charlist + end end end diff --git a/lib/pleroma/http/http.ex b/lib/pleroma/http/http.ex index ee5b5e127..583b56484 100644 --- a/lib/pleroma/http/http.ex +++ b/lib/pleroma/http/http.ex @@ -4,21 +4,47 @@ defmodule Pleroma.HTTP do @moduledoc """ - + Wrapper for `Tesla.request/2`. """ alias Pleroma.HTTP.Connection + alias Pleroma.HTTP.Request alias Pleroma.HTTP.RequestBuilder, as: Builder + alias Tesla.Client + alias Tesla.Env + + require Logger @type t :: __MODULE__ @doc """ - Builds and perform http request. + Performs GET request. + + See `Pleroma.HTTP.request/5` + """ + @spec get(Request.url() | nil, Request.headers(), keyword()) :: + nil | {:ok, Env.t()} | {:error, any()} + def get(url, headers \\ [], options \\ []) + def get(nil, _, _), do: nil + def get(url, headers, options), do: request(:get, url, "", headers, options) + + @doc """ + Performs POST request. + + See `Pleroma.HTTP.request/5` + """ + @spec post(Request.url(), String.t(), Request.headers(), keyword()) :: + {:ok, Env.t()} | {:error, any()} + def post(url, body, headers \\ [], options \\ []), + do: request(:post, url, body, headers, options) + + @doc """ + Builds and performs http request. # Arguments: `method` - :get, :post, :put, :delete - `url` - `body` + `url` - full url + `body` - request body `headers` - a keyworld list of headers, e.g. `[{"content-type", "text/plain"}]` `options` - custom, per-request middleware or adapter options @@ -26,61 +52,66 @@ defmodule Pleroma.HTTP do `{:ok, %Tesla.Env{}}` or `{:error, error}` """ - def request(method, url, body \\ "", headers \\ [], options \\ []) do - try do - options = - process_request_options(options) - |> process_sni_options(url) - - params = Keyword.get(options, :params, []) - - %{} - |> Builder.method(method) - |> Builder.headers(headers) - |> Builder.opts(options) - |> Builder.url(url) - |> Builder.add_param(:body, :body, body) - |> Builder.add_param(:query, :query, params) - |> Enum.into([]) - |> (&Tesla.request(Connection.new(options), &1)).() - rescue - e -> - {:error, e} - catch - :exit, e -> - {:error, e} - end - end - - defp process_sni_options(options, nil), do: options - - defp process_sni_options(options, url) do + @spec request(atom(), Request.url(), String.t(), Request.headers(), keyword()) :: + {:ok, Env.t()} | {:error, any()} + def request(method, url, body, headers, options) when is_binary(url) do uri = URI.parse(url) - host = uri.host |> to_charlist() + adapter_opts = Connection.options(uri, options[:adapter] || []) + options = put_in(options[:adapter], adapter_opts) + params = options[:params] || [] + request = build_request(method, headers, options, url, body, params) - case uri.scheme do - "https" -> options ++ [ssl: [server_name_indication: host]] - _ -> options - end + adapter = Application.get_env(:tesla, :adapter) + client = Tesla.client([Tesla.Middleware.FollowRedirects], adapter) + + pid = Process.whereis(adapter_opts[:pool]) + + pool_alive? = + if adapter == Tesla.Adapter.Gun && pid do + Process.alive?(pid) + else + false + end + + request_opts = + adapter_opts + |> Enum.into(%{}) + |> Map.put(:env, Pleroma.Config.get([:env])) + |> Map.put(:pool_alive?, pool_alive?) + + response = request(client, request, request_opts) + + Connection.after_request(adapter_opts) + + response end - def process_request_options(options) do - Keyword.merge(Pleroma.HTTP.Connection.hackney_options([]), options) + @spec request(Client.t(), keyword(), map()) :: {:ok, Env.t()} | {:error, any()} + def request(%Client{} = client, request, %{env: :test}), do: request(client, request) + + def request(%Client{} = client, request, %{body_as: :chunks}), do: request(client, request) + + def request(%Client{} = client, request, %{pool_alive?: false}), do: request(client, request) + + def request(%Client{} = client, request, %{pool: pool, timeout: timeout}) do + :poolboy.transaction( + pool, + &Pleroma.Pool.Request.execute(&1, client, request, timeout), + timeout + ) end - @doc """ - Performs GET request. + @spec request(Client.t(), keyword()) :: {:ok, Env.t()} | {:error, any()} + def request(client, request), do: Tesla.request(client, request) - See `Pleroma.HTTP.request/5` - """ - def get(url, headers \\ [], options \\ []), - do: request(:get, url, "", headers, options) - - @doc """ - Performs POST request. - - See `Pleroma.HTTP.request/5` - """ - def post(url, body, headers \\ [], options \\ []), - do: request(:post, url, body, headers, options) + defp build_request(method, headers, options, url, body, params) do + Builder.new() + |> Builder.method(method) + |> Builder.headers(headers) + |> Builder.opts(options) + |> Builder.url(url) + |> Builder.add_param(:body, :body, body) + |> Builder.add_param(:query, :query, params) + |> Builder.convert_to_keyword() + end end diff --git a/lib/pleroma/http/request.ex b/lib/pleroma/http/request.ex new file mode 100644 index 000000000..761bd6ccf --- /dev/null +++ b/lib/pleroma/http/request.ex @@ -0,0 +1,23 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.HTTP.Request do + @moduledoc """ + Request struct. + """ + defstruct method: :get, url: "", query: [], headers: [], body: "", opts: [] + + @type method :: :head | :get | :delete | :trace | :options | :post | :put | :patch + @type url :: String.t() + @type headers :: [{String.t(), String.t()}] + + @type t :: %__MODULE__{ + method: method(), + url: url(), + query: keyword(), + headers: headers(), + body: String.t(), + opts: keyword() + } +end diff --git a/lib/pleroma/http/request_builder.ex b/lib/pleroma/http/request_builder.ex index 77ef4bfd8..2fc876d92 100644 --- a/lib/pleroma/http/request_builder.ex +++ b/lib/pleroma/http/request_builder.ex @@ -7,136 +7,87 @@ defmodule Pleroma.HTTP.RequestBuilder do Helper functions for building Tesla requests """ + alias Pleroma.HTTP.Request + alias Tesla.Multipart + @doc """ - Specify the request method when building a request - - ## Parameters - - - request (Map) - Collected request options - - m (atom) - Request method - - ## Returns - - Map + Creates new request """ - @spec method(map(), atom) :: map() - def method(request, m) do - Map.put_new(request, :method, m) - end + @spec new(Request.t()) :: Request.t() + def new(%Request{} = request \\ %Request{}), do: request @doc """ Specify the request method when building a request - - ## Parameters - - - request (Map) - Collected request options - - u (String) - Request URL - - ## Returns - - Map """ - @spec url(map(), String.t()) :: map() - def url(request, u) do - Map.put_new(request, :url, u) - end + @spec method(Request.t(), Request.method()) :: Request.t() + def method(request, m), do: %{request | method: m} + + @doc """ + Specify the request method when building a request + """ + @spec url(Request.t(), Request.url()) :: Request.t() + def url(request, u), do: %{request | url: u} @doc """ Add headers to the request """ - @spec headers(map(), list(tuple)) :: map() - def headers(request, header_list) do - header_list = + @spec headers(Request.t(), Request.headers()) :: Request.t() + def headers(request, headers) do + headers_list = if Pleroma.Config.get([:http, :send_user_agent]) do - header_list ++ [{"User-Agent", Pleroma.Application.user_agent()}] + [{"user-agent", Pleroma.Application.user_agent()} | headers] else - header_list + headers end - Map.put_new(request, :headers, header_list) + %{request | headers: headers_list} end @doc """ Add custom, per-request middleware or adapter options to the request """ - @spec opts(map(), Keyword.t()) :: map() - def opts(request, options) do - Map.put_new(request, :opts, options) - end + @spec opts(Request.t(), keyword()) :: Request.t() + def opts(request, options), do: %{request | opts: options} @doc """ Add optional parameters to the request - - ## Parameters - - - request (Map) - Collected request options - - definitions (Map) - Map of parameter name to parameter location. - - options (KeywordList) - The provided optional parameters - - ## Returns - - Map """ - @spec add_optional_params(map(), %{optional(atom) => atom}, keyword()) :: map() - def add_optional_params(request, _, []), do: request + @spec add_param(Request.t(), atom(), atom(), any()) :: Request.t() + def add_param(request, :query, :query, values), do: %{request | query: values} - def add_optional_params(request, definitions, [{key, value} | tail]) do - case definitions do - %{^key => location} -> - request - |> add_param(location, key, value) - |> add_optional_params(definitions, tail) - - _ -> - add_optional_params(request, definitions, tail) - end - end - - @doc """ - Add optional parameters to the request - - ## Parameters - - - request (Map) - Collected request options - - location (atom) - Where to put the parameter - - key (atom) - The name of the parameter - - value (any) - The value of the parameter - - ## Returns - - Map - """ - @spec add_param(map(), atom, atom, any()) :: map() - def add_param(request, :query, :query, values), do: Map.put(request, :query, values) - - def add_param(request, :body, :body, value), do: Map.put(request, :body, value) + def add_param(request, :body, :body, value), do: %{request | body: value} def add_param(request, :body, key, value) do request - |> Map.put_new_lazy(:body, &Tesla.Multipart.new/0) + |> Map.put(:body, Multipart.new()) |> Map.update!( :body, - &Tesla.Multipart.add_field( + &Multipart.add_field( &1, key, Jason.encode!(value), - headers: [{:"Content-Type", "application/json"}] + headers: [{"content-type", "application/json"}] ) ) end def add_param(request, :file, name, path) do request - |> Map.put_new_lazy(:body, &Tesla.Multipart.new/0) - |> Map.update!(:body, &Tesla.Multipart.add_file(&1, path, name: name)) + |> Map.put(:body, Multipart.new()) + |> Map.update!(:body, &Multipart.add_file(&1, path, name: name)) end def add_param(request, :form, name, value) do - request - |> Map.update(:body, %{name => value}, &Map.put(&1, name, value)) + Map.update(request, :body, %{name => value}, &Map.put(&1, name, value)) end def add_param(request, location, key, value) do Map.update(request, location, [{key, value}], &(&1 ++ [{key, value}])) end + + def convert_to_keyword(request) do + request + |> Map.from_struct() + |> Enum.into([]) + end end diff --git a/lib/pleroma/marker.ex b/lib/pleroma/marker.ex index 443927392..4d82860f5 100644 --- a/lib/pleroma/marker.ex +++ b/lib/pleroma/marker.ex @@ -9,24 +9,34 @@ defmodule Pleroma.Marker do import Ecto.Query alias Ecto.Multi + alias Pleroma.Notification alias Pleroma.Repo alias Pleroma.User + alias __MODULE__ @timelines ["notifications"] + @type t :: %__MODULE__{} schema "markers" do field(:last_read_id, :string, default: "") field(:timeline, :string, default: "") field(:lock_version, :integer, default: 0) + field(:unread_count, :integer, default: 0, virtual: true) belongs_to(:user, User, type: FlakeId.Ecto.CompatType) timestamps() end + @doc "Gets markers by user and timeline." + @spec get_markers(User.t(), list(String)) :: list(t()) def get_markers(user, timelines \\ []) do - Repo.all(get_query(user, timelines)) + user + |> get_query(timelines) + |> unread_count_query() + |> Repo.all() end + @spec upsert(User.t(), map()) :: {:ok | :error, any()} def upsert(%User{} = user, attrs) do attrs |> Map.take(@timelines) @@ -45,6 +55,27 @@ def upsert(%User{} = user, attrs) do |> Repo.transaction() end + @spec multi_set_last_read_id(Multi.t(), User.t(), String.t()) :: Multi.t() + def multi_set_last_read_id(multi, %User{} = user, "notifications") do + multi + |> Multi.run(:counters, fn _repo, _changes -> + {:ok, %{last_read_id: Repo.one(Notification.last_read_query(user))}} + end) + |> Multi.insert( + :marker, + fn %{counters: attrs} -> + %Marker{timeline: "notifications", user_id: user.id} + |> struct(attrs) + |> Ecto.Changeset.change() + end, + returning: true, + on_conflict: {:replace, [:last_read_id]}, + conflict_target: [:user_id, :timeline] + ) + end + + def multi_set_last_read_id(multi, _, _), do: multi + defp get_marker(user, timeline) do case Repo.find_resource(get_query(user, timeline)) do {:ok, marker} -> %__MODULE__{marker | user: user} @@ -71,4 +102,16 @@ defp get_query(user, timelines) do |> by_user_id(user.id) |> by_timeline(timelines) end + + defp unread_count_query(query) do + from( + q in query, + left_join: n in "notifications", + on: n.user_id == q.user_id and n.seen == false, + group_by: [:id], + select_merge: %{ + unread_count: fragment("count(?)", n.id) + } + ) + end end diff --git a/lib/pleroma/mfa.ex b/lib/pleroma/mfa.ex new file mode 100644 index 000000000..2b77f5426 --- /dev/null +++ b/lib/pleroma/mfa.ex @@ -0,0 +1,155 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2019 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.MFA do + @moduledoc """ + The MFA context. + """ + + alias Pleroma.User + + alias Pleroma.MFA.BackupCodes + alias Pleroma.MFA.Changeset + alias Pleroma.MFA.Settings + alias Pleroma.MFA.TOTP + + @doc """ + Returns MFA methods the user has enabled. + + ## Examples + + iex> Pleroma.MFA.supported_method(User) + "totp, u2f" + """ + @spec supported_methods(User.t()) :: String.t() + def supported_methods(user) do + settings = fetch_settings(user) + + Settings.mfa_methods() + |> Enum.reduce([], fn m, acc -> + if method_enabled?(m, settings) do + acc ++ [m] + else + acc + end + end) + |> Enum.join(",") + end + + @doc "Checks that user enabled MFA" + def require?(user) do + fetch_settings(user).enabled + end + + @doc """ + Display MFA settings of user + """ + def mfa_settings(user) do + settings = fetch_settings(user) + + Settings.mfa_methods() + |> Enum.map(fn m -> [m, method_enabled?(m, settings)] end) + |> Enum.into(%{enabled: settings.enabled}, fn [a, b] -> {a, b} end) + end + + @doc false + def fetch_settings(%User{} = user) do + user.multi_factor_authentication_settings || %Settings{} + end + + @doc "clears backup codes" + def invalidate_backup_code(%User{} = user, hash_code) do + %{backup_codes: codes} = fetch_settings(user) + + user + |> Changeset.cast_backup_codes(codes -- [hash_code]) + |> User.update_and_set_cache() + end + + @doc "generates backup codes" + @spec generate_backup_codes(User.t()) :: {:ok, list(binary)} | {:error, String.t()} + def generate_backup_codes(%User{} = user) do + with codes <- BackupCodes.generate(), + hashed_codes <- Enum.map(codes, &Pbkdf2.hash_pwd_salt/1), + changeset <- Changeset.cast_backup_codes(user, hashed_codes), + {:ok, _} <- User.update_and_set_cache(changeset) do + {:ok, codes} + else + {:error, msg} -> + %{error: msg} + end + end + + @doc """ + Generates secret key and set delivery_type to 'app' for TOTP method. + """ + @spec setup_totp(User.t()) :: {:ok, User.t()} | {:error, Ecto.Changeset.t()} + def setup_totp(user) do + user + |> Changeset.setup_totp(%{secret: TOTP.generate_secret(), delivery_type: "app"}) + |> User.update_and_set_cache() + end + + @doc """ + Confirms the TOTP method for user. + + `attrs`: + `password` - current user password + `code` - TOTP token + """ + @spec confirm_totp(User.t(), map()) :: {:ok, User.t()} | {:error, Ecto.Changeset.t() | atom()} + def confirm_totp(%User{} = user, attrs) do + with settings <- user.multi_factor_authentication_settings.totp, + {:ok, :pass} <- TOTP.validate_token(settings.secret, attrs["code"]) do + user + |> Changeset.confirm_totp() + |> User.update_and_set_cache() + end + end + + @doc """ + Disables the TOTP method for user. + + `attrs`: + `password` - current user password + """ + @spec disable_totp(User.t()) :: {:ok, User.t()} | {:error, Ecto.Changeset.t()} + def disable_totp(%User{} = user) do + user + |> Changeset.disable_totp() + |> Changeset.disable() + |> User.update_and_set_cache() + end + + @doc """ + Force disables all MFA methods for user. + """ + @spec disable(User.t()) :: {:ok, User.t()} | {:error, Ecto.Changeset.t()} + def disable(%User{} = user) do + user + |> Changeset.disable_totp() + |> Changeset.disable(true) + |> User.update_and_set_cache() + end + + @doc """ + Checks if the user has MFA method enabled. + """ + def method_enabled?(method, settings) do + with {:ok, %{confirmed: true} = _} <- Map.fetch(settings, method) do + true + else + _ -> false + end + end + + @doc """ + Checks if the user has enabled at least one MFA method. + """ + def enabled?(settings) do + Settings.mfa_methods() + |> Enum.map(fn m -> method_enabled?(m, settings) end) + |> Enum.any?() + end +end diff --git a/lib/pleroma/mfa/backup_codes.ex b/lib/pleroma/mfa/backup_codes.ex new file mode 100644 index 000000000..2b5ec34f8 --- /dev/null +++ b/lib/pleroma/mfa/backup_codes.ex @@ -0,0 +1,31 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2019 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.MFA.BackupCodes do + @moduledoc """ + This module contains functions for generating backup codes. + """ + alias Pleroma.Config + + @config_ns [:instance, :multi_factor_authentication, :backup_codes] + + @doc """ + Generates backup codes. + """ + @spec generate(Keyword.t()) :: list(String.t()) + def generate(opts \\ []) do + number_of_codes = Keyword.get(opts, :number_of_codes, default_backup_codes_number()) + code_length = Keyword.get(opts, :length, default_backup_codes_code_length()) + + Enum.map(1..number_of_codes, fn _ -> + :crypto.strong_rand_bytes(div(code_length, 2)) + |> Base.encode16(case: :lower) + end) + end + + defp default_backup_codes_number, do: Config.get(@config_ns ++ [:number], 5) + + defp default_backup_codes_code_length, + do: Config.get(@config_ns ++ [:length], 16) +end diff --git a/lib/pleroma/mfa/changeset.ex b/lib/pleroma/mfa/changeset.ex new file mode 100644 index 000000000..9b020aa8e --- /dev/null +++ b/lib/pleroma/mfa/changeset.ex @@ -0,0 +1,64 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2019 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.MFA.Changeset do + alias Pleroma.MFA + alias Pleroma.MFA.Settings + alias Pleroma.User + + def disable(%Ecto.Changeset{} = changeset, force \\ false) do + settings = + changeset + |> Ecto.Changeset.apply_changes() + |> MFA.fetch_settings() + + if force || not MFA.enabled?(settings) do + put_change(changeset, %Settings{settings | enabled: false}) + else + changeset + end + end + + def disable_totp(%User{multi_factor_authentication_settings: settings} = user) do + user + |> put_change(%Settings{settings | totp: %Settings.TOTP{}}) + end + + def confirm_totp(%User{multi_factor_authentication_settings: settings} = user) do + totp_settings = %Settings.TOTP{settings.totp | confirmed: true} + + user + |> put_change(%Settings{settings | totp: totp_settings, enabled: true}) + end + + def setup_totp(%User{} = user, attrs) do + mfa_settings = MFA.fetch_settings(user) + + totp_settings = + %Settings.TOTP{} + |> Ecto.Changeset.cast(attrs, [:secret, :delivery_type]) + + user + |> put_change(%Settings{mfa_settings | totp: Ecto.Changeset.apply_changes(totp_settings)}) + end + + def cast_backup_codes(%User{} = user, codes) do + user + |> put_change(%Settings{ + user.multi_factor_authentication_settings + | backup_codes: codes + }) + end + + defp put_change(%User{} = user, settings) do + user + |> Ecto.Changeset.change() + |> put_change(settings) + end + + defp put_change(%Ecto.Changeset{} = changeset, settings) do + changeset + |> Ecto.Changeset.put_change(:multi_factor_authentication_settings, settings) + end +end diff --git a/lib/pleroma/mfa/settings.ex b/lib/pleroma/mfa/settings.ex new file mode 100644 index 000000000..2764b889c --- /dev/null +++ b/lib/pleroma/mfa/settings.ex @@ -0,0 +1,24 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2019 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.MFA.Settings do + use Ecto.Schema + + @primary_key false + + @mfa_methods [:totp] + embedded_schema do + field(:enabled, :boolean, default: false) + field(:backup_codes, {:array, :string}, default: []) + + embeds_one :totp, TOTP, on_replace: :delete, primary_key: false do + field(:secret, :string) + # app | sms + field(:delivery_type, :string, default: "app") + field(:confirmed, :boolean, default: false) + end + end + + def mfa_methods, do: @mfa_methods +end diff --git a/lib/pleroma/mfa/token.ex b/lib/pleroma/mfa/token.ex new file mode 100644 index 000000000..25ff7fb29 --- /dev/null +++ b/lib/pleroma/mfa/token.ex @@ -0,0 +1,106 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2019 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.MFA.Token do + use Ecto.Schema + import Ecto.Query + import Ecto.Changeset + + alias Pleroma.Repo + alias Pleroma.User + alias Pleroma.Web.OAuth.Authorization + alias Pleroma.Web.OAuth.Token, as: OAuthToken + + @expires 300 + + schema "mfa_tokens" do + field(:token, :string) + field(:valid_until, :naive_datetime_usec) + + belongs_to(:user, User, type: FlakeId.Ecto.CompatType) + belongs_to(:authorization, Authorization) + + timestamps() + end + + def get_by_token(token) do + from( + t in __MODULE__, + where: t.token == ^token, + preload: [:user, :authorization] + ) + |> Repo.find_resource() + end + + def validate(token) do + with {:fetch_token, {:ok, token}} <- {:fetch_token, get_by_token(token)}, + {:expired, false} <- {:expired, is_expired?(token)} do + {:ok, token} + else + {:expired, _} -> {:error, :expired_token} + {:fetch_token, _} -> {:error, :not_found} + error -> {:error, error} + end + end + + def create_token(%User{} = user) do + %__MODULE__{} + |> change + |> assign_user(user) + |> put_token + |> put_valid_until + |> Repo.insert() + end + + def create_token(user, authorization) do + %__MODULE__{} + |> change + |> assign_user(user) + |> assign_authorization(authorization) + |> put_token + |> put_valid_until + |> Repo.insert() + end + + defp assign_user(changeset, user) do + changeset + |> put_assoc(:user, user) + |> validate_required([:user]) + end + + defp assign_authorization(changeset, authorization) do + changeset + |> put_assoc(:authorization, authorization) + |> validate_required([:authorization]) + end + + defp put_token(changeset) do + changeset + |> change(%{token: OAuthToken.Utils.generate_token()}) + |> validate_required([:token]) + |> unique_constraint(:token) + end + + defp put_valid_until(changeset) do + expires_in = NaiveDateTime.add(NaiveDateTime.utc_now(), @expires) + + changeset + |> change(%{valid_until: expires_in}) + |> validate_required([:valid_until]) + end + + def is_expired?(%__MODULE__{valid_until: valid_until}) do + NaiveDateTime.diff(NaiveDateTime.utc_now(), valid_until) > 0 + end + + def is_expired?(_), do: false + + def delete_expired_tokens do + from( + q in __MODULE__, + where: fragment("?", q.valid_until) < ^Timex.now() + ) + |> Repo.delete_all() + end +end diff --git a/lib/pleroma/mfa/totp.ex b/lib/pleroma/mfa/totp.ex new file mode 100644 index 000000000..1407afc57 --- /dev/null +++ b/lib/pleroma/mfa/totp.ex @@ -0,0 +1,86 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2019 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.MFA.TOTP do + @moduledoc """ + This module represents functions to create secrets for + TOTP Application as well as validate them with a time based token. + """ + alias Pleroma.Config + + @config_ns [:instance, :multi_factor_authentication, :totp] + + @doc """ + https://github.com/google/google-authenticator/wiki/Key-Uri-Format + """ + def provisioning_uri(secret, label, opts \\ []) do + query = + %{ + secret: secret, + issuer: Keyword.get(opts, :issuer, default_issuer()), + digits: Keyword.get(opts, :digits, default_digits()), + period: Keyword.get(opts, :period, default_period()) + } + |> Enum.filter(fn {_, v} -> not is_nil(v) end) + |> Enum.into(%{}) + |> URI.encode_query() + + %URI{scheme: "otpauth", host: "totp", path: "/" <> label, query: query} + |> URI.to_string() + end + + defp default_period, do: Config.get(@config_ns ++ [:period]) + defp default_digits, do: Config.get(@config_ns ++ [:digits]) + + defp default_issuer, + do: Config.get(@config_ns ++ [:issuer], Config.get([:instance, :name])) + + @doc "Creates a random Base 32 encoded string" + def generate_secret do + Base.encode32(:crypto.strong_rand_bytes(10)) + end + + @doc "Generates a valid token based on a secret" + def generate_token(secret) do + :pot.totp(secret) + end + + @doc """ + Validates a given token based on a secret. + + optional parameters: + `token_length` default `6` + `interval_length` default `30` + `window` default 0 + + Returns {:ok, :pass} if the token is valid and + {:error, :invalid_token} if it is not. + """ + @spec validate_token(String.t(), String.t()) :: + {:ok, :pass} | {:error, :invalid_token | :invalid_secret_and_token} + def validate_token(secret, token) + when is_binary(secret) and is_binary(token) do + opts = [ + token_length: default_digits(), + interval_length: default_period() + ] + + validate_token(secret, token, opts) + end + + def validate_token(_, _), do: {:error, :invalid_secret_and_token} + + @doc "See `validate_token/2`" + @spec validate_token(String.t(), String.t(), Keyword.t()) :: + {:ok, :pass} | {:error, :invalid_token | :invalid_secret_and_token} + def validate_token(secret, token, options) + when is_binary(secret) and is_binary(token) do + case :pot.valid_totp(token, secret, options) do + true -> {:ok, :pass} + false -> {:error, :invalid_token} + end + end + + def validate_token(_, _, _), do: {:error, :invalid_secret_and_token} +end diff --git a/lib/pleroma/moderation_log.ex b/lib/pleroma/moderation_log.ex index e32895f70..7aacd9d80 100644 --- a/lib/pleroma/moderation_log.ex +++ b/lib/pleroma/moderation_log.ex @@ -605,6 +605,17 @@ def get_log_entry_message(%ModerationLog{ }" end + @spec get_log_entry_message(ModerationLog) :: String.t() + def get_log_entry_message(%ModerationLog{ + data: %{ + "actor" => %{"nickname" => actor_nickname}, + "action" => "updated_users", + "subject" => subjects + } + }) do + "@#{actor_nickname} updated users: #{users_to_nicknames_string(subjects)}" + end + defp nicknames_to_string(nicknames) do nicknames |> Enum.map(&"@#{&1}") diff --git a/lib/pleroma/notification.ex b/lib/pleroma/notification.ex index 3ef3b3f58..8aa9ed2d4 100644 --- a/lib/pleroma/notification.ex +++ b/lib/pleroma/notification.ex @@ -5,11 +5,15 @@ defmodule Pleroma.Notification do use Ecto.Schema + alias Ecto.Multi alias Pleroma.Activity + alias Pleroma.FollowingRelationship + alias Pleroma.Marker alias Pleroma.Notification alias Pleroma.Object alias Pleroma.Pagination alias Pleroma.Repo + alias Pleroma.ThreadMute alias Pleroma.User alias Pleroma.Web.CommonAPI.Utils alias Pleroma.Web.Push @@ -17,6 +21,7 @@ defmodule Pleroma.Notification do import Ecto.Query import Ecto.Changeset + require Logger @type t :: %__MODULE__{} @@ -31,17 +36,36 @@ defmodule Pleroma.Notification do timestamps() end + @spec unread_notifications_count(User.t()) :: integer() + def unread_notifications_count(%User{id: user_id}) do + from(q in __MODULE__, + where: q.user_id == ^user_id and q.seen == false + ) + |> Repo.aggregate(:count, :id) + end + def changeset(%Notification{} = notification, attrs) do notification |> cast(attrs, [:seen]) end + @spec last_read_query(User.t()) :: Ecto.Queryable.t() + def last_read_query(user) do + from(q in Pleroma.Notification, + where: q.user_id == ^user.id, + where: q.seen == true, + select: type(q.id, :string), + limit: 1, + order_by: [desc: :id] + ) + end + defp for_user_query_ap_id_opts(user, opts) do - ap_id_relations = + ap_id_relationships = [:block] ++ if opts[@include_muted_option], do: [], else: [:notification_mute] - preloaded_ap_ids = User.outgoing_relations_ap_ids(user, ap_id_relations) + preloaded_ap_ids = User.outgoing_relationships_ap_ids(user, ap_id_relationships) exclude_blocked_opts = Map.merge(%{blocked_users_ap_ids: preloaded_ap_ids[:block]}, opts) @@ -79,15 +103,13 @@ def for_user_query(user, opts \\ %{}) do |> exclude_visibility(opts) end + # Excludes blocked users and non-followed domain-blocked users defp exclude_blocked(query, user, opts) do blocked_ap_ids = opts[:blocked_users_ap_ids] || User.blocked_users_ap_ids(user) query |> where([n, a], a.actor not in ^blocked_ap_ids) - |> where( - [n, a], - fragment("substring(? from '.*://([^/]*)')", a.actor) not in ^user.domain_blocks - ) + |> FollowingRelationship.keep_following_or_not_domain_blocked(user) end defp exclude_notification_muted(query, _, %{@include_muted_option => true}) do @@ -100,7 +122,7 @@ defp exclude_notification_muted(query, user, opts) do query |> where([n, a], a.actor not in ^notification_muted_ap_ids) - |> join(:left, [n, a], tm in Pleroma.ThreadMute, + |> join(:left, [n, a], tm in ThreadMute, on: tm.user_id == ^user.id and tm.context == fragment("?->>'context'", a.data) ) |> where([n, a, o, tm], is_nil(tm.user_id)) @@ -184,25 +206,23 @@ def for_user_since(user, date) do |> Repo.all() end - def set_read_up_to(%{id: user_id} = _user, id) do + def set_read_up_to(%{id: user_id} = user, id) do query = from( n in Notification, where: n.user_id == ^user_id, where: n.id <= ^id, where: n.seen == false, - update: [ - set: [ - seen: true, - updated_at: ^NaiveDateTime.utc_now() - ] - ], # Ideally we would preload object and activities here # but Ecto does not support preloads in update_all select: n.id ) - {_, notification_ids} = Repo.update_all(query, []) + {:ok, %{ids: {_, notification_ids}}} = + Multi.new() + |> Multi.update_all(:ids, query, set: [seen: true, updated_at: NaiveDateTime.utc_now()]) + |> Marker.multi_set_last_read_id(user, "notifications") + |> Repo.transaction() Notification |> where([n], n.id in ^notification_ids) @@ -219,11 +239,18 @@ def set_read_up_to(%{id: user_id} = _user, id) do |> Repo.all() end + @spec read_one(User.t(), String.t()) :: + {:ok, Notification.t()} | {:error, Ecto.Changeset.t()} | nil def read_one(%User{} = user, notification_id) do with {:ok, %Notification{} = notification} <- get(user, notification_id) do - notification - |> changeset(%{seen: true}) - |> Repo.update() + Multi.new() + |> Multi.update(:update, changeset(notification, %{seen: true})) + |> Marker.multi_set_last_read_id(user, "notifications") + |> Repo.transaction() + |> case do + {:ok, %{update: notification}} -> {:ok, notification} + {:error, :update, changeset, _} -> {:error, changeset} + end end end @@ -260,6 +287,16 @@ def destroy_multiple(%{id: user_id} = _user, ids) do |> Repo.delete_all() end + def dismiss(%Pleroma.Activity{} = activity) do + Notification + |> where([n], n.activity_id == ^activity.id) + |> Repo.delete_all() + |> case do + {_, notifications} -> {:ok, notifications} + _ -> {:error, "Cannot dismiss notification"} + end + end + def dismiss(%{id: user_id} = _user, id) do notification = Repo.get(Notification, id) @@ -275,58 +312,159 @@ def dismiss(%{id: user_id} = _user, id) do def create_notifications(%Activity{data: %{"to" => _, "type" => "Create"}} = activity) do object = Object.normalize(activity) - unless object && object.data["type"] == "Answer" do - users = get_notified_from_activity(activity) - notifications = Enum.map(users, fn user -> create_notification(activity, user) end) - {:ok, notifications} - else + if object && object.data["type"] == "Answer" do {:ok, []} + else + do_create_notifications(activity) end end def create_notifications(%Activity{data: %{"type" => type}} = activity) - when type in ["Like", "Announce", "Follow", "Move", "EmojiReact"] do - notifications = - activity - |> get_notified_from_activity() - |> Enum.map(&create_notification(activity, &1)) - - {:ok, notifications} + when type in ["Follow", "Like", "Announce", "Move", "EmojiReact"] do + do_create_notifications(activity) end def create_notifications(_), do: {:ok, []} + defp do_create_notifications(%Activity{} = activity) do + {enabled_receivers, disabled_receivers} = get_notified_from_activity(activity) + potential_receivers = enabled_receivers ++ disabled_receivers + + notifications = + Enum.map(potential_receivers, fn user -> + do_send = user in enabled_receivers + create_notification(activity, user, do_send) + end) + + {:ok, notifications} + end + # TODO move to sql, too. - def create_notification(%Activity{} = activity, %User{} = user) do + def create_notification(%Activity{} = activity, %User{} = user, do_send \\ true) do unless skip?(activity, user) do - notification = %Notification{user_id: user.id, activity: activity} - {:ok, notification} = Repo.insert(notification) + {:ok, %{notification: notification}} = + Multi.new() + |> Multi.insert(:notification, %Notification{user_id: user.id, activity: activity}) + |> Marker.multi_set_last_read_id(user, "notifications") + |> Repo.transaction() - ["user", "user:notification"] - |> Streamer.stream(notification) + if do_send do + Streamer.stream(["user", "user:notification"], notification) + Push.send(notification) + end - Push.send(notification) notification end end + @doc """ + Returns a tuple with 2 elements: + {notification-enabled receivers, currently disabled receivers (blocking / [thread] muting)} + + NOTE: might be called for FAKE Activities, see ActivityPub.Utils.get_notified_from_object/1 + """ + @spec get_notified_from_activity(Activity.t(), boolean()) :: {list(User.t()), list(User.t())} def get_notified_from_activity(activity, local_only \\ true) def get_notified_from_activity(%Activity{data: %{"type" => type}} = activity, local_only) when type in ["Create", "Like", "Announce", "Follow", "Move", "EmojiReact"] do + potential_receiver_ap_ids = get_potential_receiver_ap_ids(activity) + + potential_receivers = User.get_users_from_set(potential_receiver_ap_ids, local_only) + + notification_enabled_ap_ids = + potential_receiver_ap_ids + |> exclude_domain_blocker_ap_ids(activity, potential_receivers) + |> exclude_relationship_restricted_ap_ids(activity) + |> exclude_thread_muter_ap_ids(activity) + + notification_enabled_users = + Enum.filter(potential_receivers, fn u -> u.ap_id in notification_enabled_ap_ids end) + + {notification_enabled_users, potential_receivers -- notification_enabled_users} + end + + def get_notified_from_activity(_, _local_only), do: {[], []} + + # For some activities, only notify the author of the object + def get_potential_receiver_ap_ids(%{data: %{"type" => type, "object" => object_id}}) + when type in ~w{Like Announce EmojiReact} do + case Object.get_cached_by_ap_id(object_id) do + %Object{data: %{"actor" => actor}} -> + [actor] + + _ -> + [] + end + end + + def get_potential_receiver_ap_ids(activity) do [] |> Utils.maybe_notify_to_recipients(activity) |> Utils.maybe_notify_mentioned_recipients(activity) |> Utils.maybe_notify_subscribers(activity) |> Utils.maybe_notify_followers(activity) |> Enum.uniq() - |> User.get_users_from_set(local_only) end - def get_notified_from_activity(_, _local_only), do: [] + @doc "Filters out AP IDs domain-blocking and not following the activity's actor" + def exclude_domain_blocker_ap_ids(ap_ids, activity, preloaded_users \\ []) + + def exclude_domain_blocker_ap_ids([], _activity, _preloaded_users), do: [] + + def exclude_domain_blocker_ap_ids(ap_ids, %Activity{} = activity, preloaded_users) do + activity_actor_domain = activity.actor && URI.parse(activity.actor).host + + users = + ap_ids + |> Enum.map(fn ap_id -> + Enum.find(preloaded_users, &(&1.ap_id == ap_id)) || + User.get_cached_by_ap_id(ap_id) + end) + |> Enum.filter(& &1) + + domain_blocker_ap_ids = for u <- users, activity_actor_domain in u.domain_blocks, do: u.ap_id + + domain_blocker_follower_ap_ids = + if Enum.any?(domain_blocker_ap_ids) do + activity + |> Activity.user_actor() + |> FollowingRelationship.followers_ap_ids(domain_blocker_ap_ids) + else + [] + end + + ap_ids + |> Kernel.--(domain_blocker_ap_ids) + |> Kernel.++(domain_blocker_follower_ap_ids) + end + + @doc "Filters out AP IDs of users basing on their relationships with activity actor user" + def exclude_relationship_restricted_ap_ids([], _activity), do: [] + + def exclude_relationship_restricted_ap_ids(ap_ids, %Activity{} = activity) do + relationship_restricted_ap_ids = + activity + |> Activity.user_actor() + |> User.incoming_relationships_ungrouped_ap_ids([ + :block, + :notification_mute + ]) + + Enum.uniq(ap_ids) -- relationship_restricted_ap_ids + end + + @doc "Filters out AP IDs of users who mute activity thread" + def exclude_thread_muter_ap_ids([], _activity), do: [] + + def exclude_thread_muter_ap_ids(ap_ids, %Activity{} = activity) do + thread_muter_ap_ids = ThreadMute.muter_ap_ids(activity.data["context"]) + + Enum.uniq(ap_ids) -- thread_muter_ap_ids + end @spec skip?(Activity.t(), User.t()) :: boolean() - def skip?(activity, user) do + def skip?(%Activity{} = activity, %User{} = user) do [ :self, :followers, @@ -335,18 +473,20 @@ def skip?(activity, user) do :non_follows, :recently_followed ] - |> Enum.any?(&skip?(&1, activity, user)) + |> Enum.find(&skip?(&1, activity, user)) end + def skip?(_, _), do: false + @spec skip?(atom(), Activity.t(), User.t()) :: boolean() - def skip?(:self, activity, user) do + def skip?(:self, %Activity{} = activity, %User{} = user) do activity.data["actor"] == user.ap_id end def skip?( :followers, - activity, - %{notification_settings: %{followers: false}} = user + %Activity{} = activity, + %User{notification_settings: %{followers: false}} = user ) do actor = activity.data["actor"] follower = User.get_cached_by_ap_id(actor) @@ -355,15 +495,19 @@ def skip?( def skip?( :non_followers, - activity, - %{notification_settings: %{non_followers: false}} = user + %Activity{} = activity, + %User{notification_settings: %{non_followers: false}} = user ) do actor = activity.data["actor"] follower = User.get_cached_by_ap_id(actor) !User.following?(follower, user) end - def skip?(:follows, activity, %{notification_settings: %{follows: false}} = user) do + def skip?( + :follows, + %Activity{} = activity, + %User{notification_settings: %{follows: false}} = user + ) do actor = activity.data["actor"] followed = User.get_cached_by_ap_id(actor) User.following?(user, followed) @@ -371,15 +515,16 @@ def skip?(:follows, activity, %{notification_settings: %{follows: false}} = user def skip?( :non_follows, - activity, - %{notification_settings: %{non_follows: false}} = user + %Activity{} = activity, + %User{notification_settings: %{non_follows: false}} = user ) do actor = activity.data["actor"] followed = User.get_cached_by_ap_id(actor) !User.following?(user, followed) end - def skip?(:recently_followed, %{data: %{"type" => "Follow"}} = activity, user) do + # To do: consider defining recency in hours and checking FollowingRelationship with a single SQL + def skip?(:recently_followed, %Activity{data: %{"type" => "Follow"}} = activity, %User{} = user) do actor = activity.data["actor"] Notification.for_user(user) diff --git a/lib/pleroma/object.ex b/lib/pleroma/object.ex index 9574432f0..e678fd415 100644 --- a/lib/pleroma/object.ex +++ b/lib/pleroma/object.ex @@ -261,7 +261,7 @@ def decrease_replies_count(ap_id) do end end - def increase_vote_count(ap_id, name) do + def increase_vote_count(ap_id, name, actor) do with %Object{} = object <- Object.normalize(ap_id), "Question" <- object.data["type"] do multiple = Map.has_key?(object.data, "anyOf") @@ -276,12 +276,15 @@ def increase_vote_count(ap_id, name) do option end) + voters = [actor | object.data["voters"] || []] |> Enum.uniq() + data = if multiple do Map.put(object.data, "anyOf", options) else Map.put(object.data, "oneOf", options) end + |> Map.put("voters", voters) object |> Object.change(%{data: data}) diff --git a/lib/pleroma/object/containment.ex b/lib/pleroma/object/containment.ex index 9ae6a5600..99608b8a5 100644 --- a/lib/pleroma/object/containment.ex +++ b/lib/pleroma/object/containment.ex @@ -32,6 +32,18 @@ def get_actor(%{"actor" => nil, "attributedTo" => actor}) when not is_nil(actor) get_actor(%{"actor" => actor}) end + def get_object(%{"object" => id}) when is_binary(id) do + id + end + + def get_object(%{"object" => %{"id" => id}}) when is_binary(id) do + id + end + + def get_object(_) do + nil + end + # TODO: We explicitly allow 'tag' URIs through, due to references to legacy OStatus # objects being present in the test suite environment. Once these objects are # removed, please also remove this. diff --git a/lib/pleroma/object/fetcher.ex b/lib/pleroma/object/fetcher.ex index eaa13d1e7..263ded5dd 100644 --- a/lib/pleroma/object/fetcher.ex +++ b/lib/pleroma/object/fetcher.ex @@ -141,7 +141,7 @@ defp make_signature(id, date) do date: date }) - [{:Signature, signature}] + [{"signature", signature}] end defp sign_fetch(headers, id, date) do @@ -154,7 +154,7 @@ defp sign_fetch(headers, id, date) do defp maybe_date_fetch(headers, date) do if Pleroma.Config.get([:activitypub, :sign_object_fetches]) do - headers ++ [{:Date, date}] + headers ++ [{"date", date}] else headers end @@ -166,7 +166,7 @@ def fetch_and_contain_remote_object_from_id(id) when is_binary(id) do date = Pleroma.Signature.signed_date() headers = - [{:Accept, "application/activity+json"}] + [{"accept", "application/activity+json"}] |> maybe_date_fetch(date) |> sign_fetch(id, date) diff --git a/lib/pleroma/otp_version.ex b/lib/pleroma/otp_version.ex new file mode 100644 index 000000000..114d0054f --- /dev/null +++ b/lib/pleroma/otp_version.ex @@ -0,0 +1,28 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.OTPVersion do + @spec version() :: String.t() | nil + def version do + # OTP Version https://erlang.org/doc/system_principles/versions.html#otp-version + [ + Path.join(:code.root_dir(), "OTP_VERSION"), + Path.join([:code.root_dir(), "releases", :erlang.system_info(:otp_release), "OTP_VERSION"]) + ] + |> get_version_from_files() + end + + @spec get_version_from_files([Path.t()]) :: String.t() | nil + def get_version_from_files([]), do: nil + + def get_version_from_files([path | paths]) do + if File.exists?(path) do + path + |> File.read!() + |> String.replace(~r/\r|\n|\s/, "") + else + get_version_from_files(paths) + end + end +end diff --git a/lib/pleroma/plugs/authentication_plug.ex b/lib/pleroma/plugs/authentication_plug.ex index 089028d77..2cdf6c951 100644 --- a/lib/pleroma/plugs/authentication_plug.ex +++ b/lib/pleroma/plugs/authentication_plug.ex @@ -3,9 +3,11 @@ # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.Plugs.AuthenticationPlug do - alias Comeonin.Pbkdf2 - import Plug.Conn + alias Pleroma.Plugs.OAuthScopesPlug alias Pleroma.User + + import Plug.Conn + require Logger def init(options), do: options @@ -14,8 +16,13 @@ def checkpw(password, "$6" <> _ = password_hash) do :crypt.crypt(password, password_hash) == password_hash end + def checkpw(password, "$2" <> _ = password_hash) do + # Handle bcrypt passwords for Mastodon migration + Bcrypt.verify_pass(password, password_hash) + end + def checkpw(password, "$pbkdf2" <> _ = password_hash) do - Pbkdf2.checkpw(password, password_hash) + Pbkdf2.verify_pass(password, password_hash) end def checkpw(_password, _password_hash) do @@ -34,16 +41,17 @@ def call( } = conn, _ ) do - if Pbkdf2.checkpw(password, password_hash) do + if checkpw(password, password_hash) do conn |> assign(:user, auth_user) + |> OAuthScopesPlug.skip_plug() else conn end end def call(%{assigns: %{auth_credentials: %{password: _}}} = conn, _) do - Pbkdf2.dummy_checkpw() + Pbkdf2.no_user_verify() conn end diff --git a/lib/pleroma/plugs/ensure_authenticated_plug.ex b/lib/pleroma/plugs/ensure_authenticated_plug.ex index 054d2297f..3fe550806 100644 --- a/lib/pleroma/plugs/ensure_authenticated_plug.ex +++ b/lib/pleroma/plugs/ensure_authenticated_plug.ex @@ -5,32 +5,35 @@ defmodule Pleroma.Plugs.EnsureAuthenticatedPlug do import Plug.Conn import Pleroma.Web.TranslationHelpers + alias Pleroma.User + use Pleroma.Web, :plug + def init(options) do options end - def call(%{assigns: %{user: %User{}}} = conn, _) do + @impl true + def perform( + %{ + assigns: %{ + auth_credentials: %{password: _}, + user: %User{multi_factor_authentication_settings: %{enabled: true}} + } + } = conn, + _ + ) do + conn + |> render_error(:forbidden, "Two-factor authentication enabled, you must use a access token.") + |> halt() + end + + def perform(%{assigns: %{user: %User{}}} = conn, _) do conn end - def call(conn, options) do - perform = - cond do - options[:if_func] -> options[:if_func].() - options[:unless_func] -> !options[:unless_func].() - true -> true - end - - if perform do - fail(conn) - else - conn - end - end - - def fail(conn) do + def perform(conn, _) do conn |> render_error(:forbidden, "Invalid credentials.") |> halt() diff --git a/lib/pleroma/plugs/ensure_public_or_authenticated_plug.ex b/lib/pleroma/plugs/ensure_public_or_authenticated_plug.ex index d980ff13d..7265bb87a 100644 --- a/lib/pleroma/plugs/ensure_public_or_authenticated_plug.ex +++ b/lib/pleroma/plugs/ensure_public_or_authenticated_plug.ex @@ -5,14 +5,18 @@ defmodule Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug do import Pleroma.Web.TranslationHelpers import Plug.Conn + alias Pleroma.Config alias Pleroma.User + use Pleroma.Web, :plug + def init(options) do options end - def call(conn, _) do + @impl true + def perform(conn, _) do public? = Config.get!([:instance, :public]) case {public?, conn} do diff --git a/lib/pleroma/plugs/expect_authenticated_check_plug.ex b/lib/pleroma/plugs/expect_authenticated_check_plug.ex new file mode 100644 index 000000000..66b8d5de5 --- /dev/null +++ b/lib/pleroma/plugs/expect_authenticated_check_plug.ex @@ -0,0 +1,20 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Plugs.ExpectAuthenticatedCheckPlug do + @moduledoc """ + Marks `Pleroma.Plugs.EnsureAuthenticatedPlug` as expected to be executed later in plug chain. + + No-op plug which affects `Pleroma.Web` operation (is checked with `PlugHelper.plug_called?/2`). + """ + + use Pleroma.Web, :plug + + def init(options), do: options + + @impl true + def perform(conn, _) do + conn + end +end diff --git a/lib/pleroma/plugs/expect_public_or_authenticated_check_plug.ex b/lib/pleroma/plugs/expect_public_or_authenticated_check_plug.ex new file mode 100644 index 000000000..ba0ef76bd --- /dev/null +++ b/lib/pleroma/plugs/expect_public_or_authenticated_check_plug.ex @@ -0,0 +1,21 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Plugs.ExpectPublicOrAuthenticatedCheckPlug do + @moduledoc """ + Marks `Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug` as expected to be executed later in plug + chain. + + No-op plug which affects `Pleroma.Web` operation (is checked with `PlugHelper.plug_called?/2`). + """ + + use Pleroma.Web, :plug + + def init(options), do: options + + @impl true + def perform(conn, _) do + conn + end +end diff --git a/lib/pleroma/plugs/federating_plug.ex b/lib/pleroma/plugs/federating_plug.ex index 7d947339f..09038f3c6 100644 --- a/lib/pleroma/plugs/federating_plug.ex +++ b/lib/pleroma/plugs/federating_plug.ex @@ -19,6 +19,9 @@ def call(conn, _opts) do def federating?, do: Pleroma.Config.get([:instance, :federating]) + # Definition for the use in :if_func / :unless_func plug options + def federating?(_conn), do: federating?() + defp fail(conn) do conn |> put_status(404) diff --git a/lib/pleroma/plugs/http_security_plug.ex b/lib/pleroma/plugs/http_security_plug.ex index 81e6b4f2a..6462797b6 100644 --- a/lib/pleroma/plugs/http_security_plug.ex +++ b/lib/pleroma/plugs/http_security_plug.ex @@ -75,7 +75,7 @@ defp csp_string do "default-src 'none'", "base-uri 'self'", "frame-ancestors 'none'", - "img-src 'self' data: https:", + "img-src 'self' data: blob: https:", "media-src 'self' https:", "style-src 'self' 'unsafe-inline'", "font-src 'self'", diff --git a/lib/pleroma/plugs/instance_static.ex b/lib/pleroma/plugs/instance_static.ex index 927fa2663..7516f75c3 100644 --- a/lib/pleroma/plugs/instance_static.ex +++ b/lib/pleroma/plugs/instance_static.ex @@ -3,6 +3,8 @@ # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.Plugs.InstanceStatic do + require Pleroma.Constants + @moduledoc """ This is a shim to call `Plug.Static` but with runtime `from` configuration. @@ -21,9 +23,6 @@ def file_path(path) do end end - @only ~w(index.html robots.txt static emoji packs sounds images instance favicon.png sw.js - sw-pleroma.js) - def init(opts) do opts |> Keyword.put(:from, "__unconfigured_instance_static_plug") @@ -31,7 +30,7 @@ def init(opts) do |> Plug.Static.init() end - for only <- @only do + for only <- Pleroma.Constants.static_only_files() do at = Plug.Router.Utils.split("/") def call(%{request_path: "/" <> unquote(only) <> _} = conn, opts) do diff --git a/lib/pleroma/plugs/legacy_authentication_plug.ex b/lib/pleroma/plugs/legacy_authentication_plug.ex index 5c5c36c56..d346e01a6 100644 --- a/lib/pleroma/plugs/legacy_authentication_plug.ex +++ b/lib/pleroma/plugs/legacy_authentication_plug.ex @@ -4,6 +4,8 @@ defmodule Pleroma.Plugs.LegacyAuthenticationPlug do import Plug.Conn + + alias Pleroma.Plugs.OAuthScopesPlug alias Pleroma.User def init(options) do @@ -27,6 +29,7 @@ def call( conn |> assign(:auth_user, user) |> assign(:user, user) + |> OAuthScopesPlug.skip_plug() else _ -> conn diff --git a/lib/pleroma/plugs/mapped_signature_to_identity_plug.ex b/lib/pleroma/plugs/mapped_signature_to_identity_plug.ex index 4f124ed4d..f44d4dee5 100644 --- a/lib/pleroma/plugs/mapped_signature_to_identity_plug.ex +++ b/lib/pleroma/plugs/mapped_signature_to_identity_plug.ex @@ -13,8 +13,9 @@ defmodule Pleroma.Web.Plugs.MappedSignatureToIdentityPlug do def init(options), do: options defp key_id_from_conn(conn) do - with %{"keyId" => key_id} <- HTTPSignatures.signature_for_conn(conn) do - Signature.key_id_to_actor_id(key_id) + with %{"keyId" => key_id} <- HTTPSignatures.signature_for_conn(conn), + {:ok, ap_id} <- Signature.key_id_to_actor_id(key_id) do + ap_id else _ -> nil @@ -42,13 +43,13 @@ def call(%{assigns: %{valid_signature: true}, params: %{"actor" => actor}} = con else {:user_match, false} -> Logger.debug("Failed to map identity from signature (payload actor mismatch)") - Logger.debug("key_id=#{key_id_from_conn(conn)}, actor=#{actor}") + Logger.debug("key_id=#{inspect(key_id_from_conn(conn))}, actor=#{inspect(actor)}") assign(conn, :valid_signature, false) # remove me once testsuite uses mapped capabilities instead of what we do now {:user, nil} -> Logger.debug("Failed to map identity from signature (lookup failure)") - Logger.debug("key_id=#{key_id_from_conn(conn)}, actor=#{actor}") + Logger.debug("key_id=#{inspect(key_id_from_conn(conn))}, actor=#{actor}") conn end end @@ -60,7 +61,7 @@ def call(%{assigns: %{valid_signature: true}} = conn, _opts) do else _ -> Logger.debug("Failed to map identity from signature (no payload actor mismatch)") - Logger.debug("key_id=#{key_id_from_conn(conn)}") + Logger.debug("key_id=#{inspect(key_id_from_conn(conn))}") assign(conn, :valid_signature, false) end end diff --git a/lib/pleroma/plugs/oauth_scopes_plug.ex b/lib/pleroma/plugs/oauth_scopes_plug.ex index 38df074ad..efc25b79f 100644 --- a/lib/pleroma/plugs/oauth_scopes_plug.ex +++ b/lib/pleroma/plugs/oauth_scopes_plug.ex @@ -7,13 +7,13 @@ defmodule Pleroma.Plugs.OAuthScopesPlug do import Pleroma.Web.Gettext alias Pleroma.Config - alias Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug - @behaviour Plug + use Pleroma.Web, :plug def init(%{scopes: _} = options), do: options - def call(%Plug.Conn{assigns: assigns} = conn, %{scopes: scopes} = options) do + @impl true + def perform(%Plug.Conn{assigns: assigns} = conn, %{scopes: scopes} = options) do op = options[:op] || :| token = assigns[:token] @@ -28,10 +28,7 @@ def call(%Plug.Conn{assigns: assigns} = conn, %{scopes: scopes} = options) do conn options[:fallback] == :proceed_unauthenticated -> - conn - |> assign(:user, nil) - |> assign(:token, nil) - |> maybe_perform_instance_privacy_check(options) + drop_auth_info(conn) true -> missing_scopes = scopes -- matched_scopes @@ -47,6 +44,15 @@ def call(%Plug.Conn{assigns: assigns} = conn, %{scopes: scopes} = options) do end end + @doc "Drops authentication info from connection" + def drop_auth_info(conn) do + # To simplify debugging, setting a private variable on `conn` if auth info is dropped + conn + |> put_private(:authentication_ignored, true) + |> assign(:user, nil) + |> assign(:token, nil) + end + @doc "Filters descendants of supported scopes" def filter_descendants(scopes, supported_scopes) do Enum.filter( @@ -68,12 +74,4 @@ def transform_scopes(scopes, options) do scopes end end - - defp maybe_perform_instance_privacy_check(%Plug.Conn{} = conn, options) do - if options[:skip_instance_privacy_check] do - conn - else - EnsurePublicOrAuthenticatedPlug.call(conn, []) - end - end end diff --git a/lib/pleroma/plugs/plug_helper.ex b/lib/pleroma/plugs/plug_helper.ex new file mode 100644 index 000000000..9c67be8ef --- /dev/null +++ b/lib/pleroma/plugs/plug_helper.ex @@ -0,0 +1,40 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Plugs.PlugHelper do + @moduledoc "Pleroma Plug helper" + + @called_plugs_list_id :called_plugs + def called_plugs_list_id, do: @called_plugs_list_id + + @skipped_plugs_list_id :skipped_plugs + def skipped_plugs_list_id, do: @skipped_plugs_list_id + + @doc "Returns `true` if specified plug was called." + def plug_called?(conn, plug_module) do + contained_in_private_list?(conn, @called_plugs_list_id, plug_module) + end + + @doc "Returns `true` if specified plug was explicitly marked as skipped." + def plug_skipped?(conn, plug_module) do + contained_in_private_list?(conn, @skipped_plugs_list_id, plug_module) + end + + @doc "Returns `true` if specified plug was either called or explicitly marked as skipped." + def plug_called_or_skipped?(conn, plug_module) do + plug_called?(conn, plug_module) || plug_skipped?(conn, plug_module) + end + + # Appends plug to known list (skipped, called). Intended to be used from within plug code only. + def append_to_private_list(conn, list_id, value) do + list = conn.private[list_id] || [] + modified_list = Enum.uniq(list ++ [value]) + Plug.Conn.put_private(conn, list_id, modified_list) + end + + defp contained_in_private_list?(conn, private_variable, value) do + list = conn.private[private_variable] || [] + value in list + end +end diff --git a/lib/pleroma/plugs/rate_limiter/rate_limiter.ex b/lib/pleroma/plugs/rate_limiter/rate_limiter.ex index 1529da717..c51e2c634 100644 --- a/lib/pleroma/plugs/rate_limiter/rate_limiter.ex +++ b/lib/pleroma/plugs/rate_limiter/rate_limiter.ex @@ -110,20 +110,9 @@ defp handle(conn, action_settings) do end def disabled?(conn) do - localhost_or_socket = - case Config.get([Pleroma.Web.Endpoint, :http, :ip]) do - {127, 0, 0, 1} -> true - {0, 0, 0, 0, 0, 0, 0, 1} -> true - {:local, _} -> true - _ -> false - end - - remote_ip_not_found = - if Map.has_key?(conn.assigns, :remote_ip_found), - do: !conn.assigns.remote_ip_found, - else: false - - localhost_or_socket and remote_ip_not_found + if Map.has_key?(conn.assigns, :remote_ip_found), + do: !conn.assigns.remote_ip_found, + else: false end @inspect_bucket_not_found {:error, :not_found} diff --git a/lib/pleroma/plugs/remote_ip.ex b/lib/pleroma/plugs/remote_ip.ex index 0ac9050d0..2eca4f8f6 100644 --- a/lib/pleroma/plugs/remote_ip.ex +++ b/lib/pleroma/plugs/remote_ip.ex @@ -7,8 +7,6 @@ defmodule Pleroma.Plugs.RemoteIp do This is a shim to call [`RemoteIp`](https://git.pleroma.social/pleroma/remote_ip) but with runtime configuration. """ - import Plug.Conn - @behaviour Plug @headers ~w[ @@ -28,12 +26,11 @@ defmodule Pleroma.Plugs.RemoteIp do def init(_), do: nil - def call(%{remote_ip: original_remote_ip} = conn, _) do + def call(conn, _) do config = Pleroma.Config.get(__MODULE__, []) if Keyword.get(config, :enabled, false) do - %{remote_ip: new_remote_ip} = conn = RemoteIp.call(conn, remote_ip_opts(config)) - assign(conn, :remote_ip_found, original_remote_ip != new_remote_ip) + RemoteIp.call(conn, remote_ip_opts(config)) else conn end diff --git a/lib/pleroma/plugs/uploaded_media.ex b/lib/pleroma/plugs/uploaded_media.ex index 36ff024a7..94147e0c4 100644 --- a/lib/pleroma/plugs/uploaded_media.ex +++ b/lib/pleroma/plugs/uploaded_media.ex @@ -41,6 +41,7 @@ def call(%{request_path: <<"/", @path, "/", file::binary>>} = conn, opts) do conn -> conn end + |> merge_resp_headers([{"content-security-policy", "sandbox"}]) config = Pleroma.Config.get(Pleroma.Upload) diff --git a/lib/pleroma/pool/connections.ex b/lib/pleroma/pool/connections.ex new file mode 100644 index 000000000..acafe1bea --- /dev/null +++ b/lib/pleroma/pool/connections.ex @@ -0,0 +1,283 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Pool.Connections do + use GenServer + + alias Pleroma.Config + alias Pleroma.Gun + + require Logger + + @type domain :: String.t() + @type conn :: Pleroma.Gun.Conn.t() + + @type t :: %__MODULE__{ + conns: %{domain() => conn()}, + opts: keyword() + } + + defstruct conns: %{}, opts: [] + + @spec start_link({atom(), keyword()}) :: {:ok, pid()} + def start_link({name, opts}) do + GenServer.start_link(__MODULE__, opts, name: name) + end + + @impl true + def init(opts), do: {:ok, %__MODULE__{conns: %{}, opts: opts}} + + @spec checkin(String.t() | URI.t(), atom()) :: pid() | nil + def checkin(url, name) + def checkin(url, name) when is_binary(url), do: checkin(URI.parse(url), name) + + def checkin(%URI{} = uri, name) do + timeout = Config.get([:connections_pool, :checkin_timeout], 250) + + GenServer.call(name, {:checkin, uri}, timeout) + end + + @spec alive?(atom()) :: boolean() + def alive?(name) do + if pid = Process.whereis(name) do + Process.alive?(pid) + else + false + end + end + + @spec get_state(atom()) :: t() + def get_state(name) do + GenServer.call(name, :state) + end + + @spec count(atom()) :: pos_integer() + def count(name) do + GenServer.call(name, :count) + end + + @spec get_unused_conns(atom()) :: [{domain(), conn()}] + def get_unused_conns(name) do + GenServer.call(name, :unused_conns) + end + + @spec checkout(pid(), pid(), atom()) :: :ok + def checkout(conn, pid, name) do + GenServer.cast(name, {:checkout, conn, pid}) + end + + @spec add_conn(atom(), String.t(), Pleroma.Gun.Conn.t()) :: :ok + def add_conn(name, key, conn) do + GenServer.cast(name, {:add_conn, key, conn}) + end + + @spec remove_conn(atom(), String.t()) :: :ok + def remove_conn(name, key) do + GenServer.cast(name, {:remove_conn, key}) + end + + @impl true + def handle_cast({:add_conn, key, conn}, state) do + state = put_in(state.conns[key], conn) + + Process.monitor(conn.conn) + {:noreply, state} + end + + @impl true + def handle_cast({:checkout, conn_pid, pid}, state) do + state = + with true <- Process.alive?(conn_pid), + {key, conn} <- find_conn(state.conns, conn_pid), + used_by <- List.keydelete(conn.used_by, pid, 0) do + conn_state = if used_by == [], do: :idle, else: conn.conn_state + + put_in(state.conns[key], %{conn | conn_state: conn_state, used_by: used_by}) + else + false -> + Logger.debug("checkout for closed conn #{inspect(conn_pid)}") + state + + nil -> + Logger.debug("checkout for alive conn #{inspect(conn_pid)}, but is not in state") + state + end + + {:noreply, state} + end + + @impl true + def handle_cast({:remove_conn, key}, state) do + state = put_in(state.conns, Map.delete(state.conns, key)) + {:noreply, state} + end + + @impl true + def handle_call({:checkin, uri}, from, state) do + key = "#{uri.scheme}:#{uri.host}:#{uri.port}" + + case state.conns[key] do + %{conn: pid, gun_state: :up} = conn -> + time = :os.system_time(:second) + last_reference = time - conn.last_reference + crf = crf(last_reference, 100, conn.crf) + + state = + put_in(state.conns[key], %{ + conn + | last_reference: time, + crf: crf, + conn_state: :active, + used_by: [from | conn.used_by] + }) + + {:reply, pid, state} + + %{gun_state: :down} -> + {:reply, nil, state} + + nil -> + {:reply, nil, state} + end + end + + @impl true + def handle_call(:state, _from, state), do: {:reply, state, state} + + @impl true + def handle_call(:count, _from, state) do + {:reply, Enum.count(state.conns), state} + end + + @impl true + def handle_call(:unused_conns, _from, state) do + unused_conns = + state.conns + |> Enum.filter(&filter_conns/1) + |> Enum.sort(&sort_conns/2) + + {:reply, unused_conns, state} + end + + defp filter_conns({_, %{conn_state: :idle, used_by: []}}), do: true + defp filter_conns(_), do: false + + defp sort_conns({_, c1}, {_, c2}) do + c1.crf <= c2.crf and c1.last_reference <= c2.last_reference + end + + @impl true + def handle_info({:gun_up, conn_pid, _protocol}, state) do + %{origin_host: host, origin_scheme: scheme, origin_port: port} = Gun.info(conn_pid) + + host = + case :inet.ntoa(host) do + {:error, :einval} -> host + ip -> ip + end + + key = "#{scheme}:#{host}:#{port}" + + state = + with {key, conn} <- find_conn(state.conns, conn_pid, key), + {true, key} <- {Process.alive?(conn_pid), key} do + put_in(state.conns[key], %{ + conn + | gun_state: :up, + conn_state: :active, + retries: 0 + }) + else + {false, key} -> + put_in( + state.conns, + Map.delete(state.conns, key) + ) + + nil -> + :ok = Gun.close(conn_pid) + + state + end + + {:noreply, state} + end + + @impl true + def handle_info({:gun_down, conn_pid, _protocol, _reason, _killed}, state) do + retries = Config.get([:connections_pool, :retry], 1) + # we can't get info on this pid, because pid is dead + state = + with {key, conn} <- find_conn(state.conns, conn_pid), + {true, key} <- {Process.alive?(conn_pid), key} do + if conn.retries == retries do + :ok = Gun.close(conn.conn) + + put_in( + state.conns, + Map.delete(state.conns, key) + ) + else + put_in(state.conns[key], %{ + conn + | gun_state: :down, + retries: conn.retries + 1 + }) + end + else + {false, key} -> + put_in( + state.conns, + Map.delete(state.conns, key) + ) + + nil -> + Logger.debug(":gun_down for conn which isn't found in state") + + state + end + + {:noreply, state} + end + + @impl true + def handle_info({:DOWN, _ref, :process, conn_pid, reason}, state) do + Logger.debug("received DOWN message for #{inspect(conn_pid)} reason -> #{inspect(reason)}") + + state = + with {key, conn} <- find_conn(state.conns, conn_pid) do + Enum.each(conn.used_by, fn {pid, _ref} -> + Process.exit(pid, reason) + end) + + put_in( + state.conns, + Map.delete(state.conns, key) + ) + else + nil -> + Logger.debug(":DOWN for conn which isn't found in state") + + state + end + + {:noreply, state} + end + + defp find_conn(conns, conn_pid) do + Enum.find(conns, fn {_key, conn} -> + conn.conn == conn_pid + end) + end + + defp find_conn(conns, conn_pid, conn_key) do + Enum.find(conns, fn {key, conn} -> + key == conn_key and conn.conn == conn_pid + end) + end + + def crf(current, steps, crf) do + 1 + :math.pow(0.5, current / steps) * crf + end +end diff --git a/lib/pleroma/pool/pool.ex b/lib/pleroma/pool/pool.ex new file mode 100644 index 000000000..21a6fbbc5 --- /dev/null +++ b/lib/pleroma/pool/pool.ex @@ -0,0 +1,22 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Pool do + def child_spec(opts) do + poolboy_opts = + opts + |> Keyword.put(:worker_module, Pleroma.Pool.Request) + |> Keyword.put(:name, {:local, opts[:name]}) + |> Keyword.put(:size, opts[:size]) + |> Keyword.put(:max_overflow, opts[:max_overflow]) + + %{ + id: opts[:id] || {__MODULE__, make_ref()}, + start: {:poolboy, :start_link, [poolboy_opts, [name: opts[:name]]]}, + restart: :permanent, + shutdown: 5000, + type: :worker + } + end +end diff --git a/lib/pleroma/pool/request.ex b/lib/pleroma/pool/request.ex new file mode 100644 index 000000000..3fb930db7 --- /dev/null +++ b/lib/pleroma/pool/request.ex @@ -0,0 +1,65 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Pool.Request do + use GenServer + + require Logger + + def start_link(args) do + GenServer.start_link(__MODULE__, args) + end + + @impl true + def init(_), do: {:ok, []} + + @spec execute(pid() | atom(), Tesla.Client.t(), keyword(), pos_integer()) :: + {:ok, Tesla.Env.t()} | {:error, any()} + def execute(pid, client, request, timeout) do + GenServer.call(pid, {:execute, client, request}, timeout) + end + + @impl true + def handle_call({:execute, client, request}, _from, state) do + response = Pleroma.HTTP.request(client, request) + + {:reply, response, state} + end + + @impl true + def handle_info({:gun_data, _conn, _stream, _, _}, state) do + {:noreply, state} + end + + @impl true + def handle_info({:gun_up, _conn, _protocol}, state) do + {:noreply, state} + end + + @impl true + def handle_info({:gun_down, _conn, _protocol, _reason, _killed}, state) do + {:noreply, state} + end + + @impl true + def handle_info({:gun_error, _conn, _stream, _error}, state) do + {:noreply, state} + end + + @impl true + def handle_info({:gun_push, _conn, _stream, _new_stream, _method, _uri, _headers}, state) do + {:noreply, state} + end + + @impl true + def handle_info({:gun_response, _conn, _stream, _, _status, _headers}, state) do + {:noreply, state} + end + + @impl true + def handle_info(msg, state) do + Logger.warn("Received unexpected message #{inspect(__MODULE__)} #{inspect(msg)}") + {:noreply, state} + end +end diff --git a/lib/pleroma/pool/supervisor.ex b/lib/pleroma/pool/supervisor.ex new file mode 100644 index 000000000..faf646cb2 --- /dev/null +++ b/lib/pleroma/pool/supervisor.ex @@ -0,0 +1,42 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Pool.Supervisor do + use Supervisor + + alias Pleroma.Config + alias Pleroma.Pool + + def start_link(args) do + Supervisor.start_link(__MODULE__, args, name: __MODULE__) + end + + def init(_) do + conns_child = %{ + id: Pool.Connections, + start: + {Pool.Connections, :start_link, [{:gun_connections, Config.get([:connections_pool])}]} + } + + Supervisor.init([conns_child | pools()], strategy: :one_for_one) + end + + defp pools do + pools = Config.get(:pools) + + pools = + if Config.get([Pleroma.Upload, :proxy_remote]) == false do + Keyword.delete(pools, :upload) + else + pools + end + + for {pool_name, pool_opts} <- pools do + pool_opts + |> Keyword.put(:id, {Pool, pool_name}) + |> Keyword.put(:name, pool_name) + |> Pool.child_spec() + end + end +end diff --git a/lib/pleroma/reverse_proxy/client.ex b/lib/pleroma/reverse_proxy/client.ex index 26d14fabd..0d13ff174 100644 --- a/lib/pleroma/reverse_proxy/client.ex +++ b/lib/pleroma/reverse_proxy/client.ex @@ -3,19 +3,23 @@ # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.ReverseProxy.Client do - @callback request(atom(), String.t(), [tuple()], String.t(), list()) :: - {:ok, pos_integer(), [tuple()], reference() | map()} - | {:ok, pos_integer(), [tuple()]} + @type status :: pos_integer() + @type header_name :: String.t() + @type header_value :: String.t() + @type headers :: [{header_name(), header_value()}] + + @callback request(atom(), String.t(), headers(), String.t(), list()) :: + {:ok, status(), headers(), reference() | map()} + | {:ok, status(), headers()} | {:ok, reference()} | {:error, term()} - @callback stream_body(reference() | pid() | map()) :: - {:ok, binary()} | :done | {:error, String.t()} + @callback stream_body(map()) :: {:ok, binary(), map()} | :done | {:error, atom() | String.t()} @callback close(reference() | pid() | map()) :: :ok - def request(method, url, headers, "", opts \\ []) do - client().request(method, url, headers, "", opts) + def request(method, url, headers, body \\ "", opts \\ []) do + client().request(method, url, headers, body, opts) end def stream_body(ref), do: client().stream_body(ref) @@ -23,6 +27,12 @@ def stream_body(ref), do: client().stream_body(ref) def close(ref), do: client().close(ref) defp client do - Pleroma.Config.get([Pleroma.ReverseProxy.Client], :hackney) + :tesla + |> Application.get_env(:adapter) + |> client() end + + defp client(Tesla.Adapter.Hackney), do: Pleroma.ReverseProxy.Client.Hackney + defp client(Tesla.Adapter.Gun), do: Pleroma.ReverseProxy.Client.Tesla + defp client(_), do: Pleroma.Config.get!(Pleroma.ReverseProxy.Client) end diff --git a/lib/pleroma/reverse_proxy/client/hackney.ex b/lib/pleroma/reverse_proxy/client/hackney.ex new file mode 100644 index 000000000..e84118a90 --- /dev/null +++ b/lib/pleroma/reverse_proxy/client/hackney.ex @@ -0,0 +1,24 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.ReverseProxy.Client.Hackney do + @behaviour Pleroma.ReverseProxy.Client + + @impl true + def request(method, url, headers, body, opts \\ []) do + :hackney.request(method, url, headers, body, opts) + end + + @impl true + def stream_body(ref) do + case :hackney.stream_body(ref) do + :done -> :done + {:ok, data} -> {:ok, data, ref} + {:error, error} -> {:error, error} + end + end + + @impl true + def close(ref), do: :hackney.close(ref) +end diff --git a/lib/pleroma/reverse_proxy/client/tesla.ex b/lib/pleroma/reverse_proxy/client/tesla.ex new file mode 100644 index 000000000..e81ea8bde --- /dev/null +++ b/lib/pleroma/reverse_proxy/client/tesla.ex @@ -0,0 +1,90 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.ReverseProxy.Client.Tesla do + @behaviour Pleroma.ReverseProxy.Client + + @type headers() :: [{String.t(), String.t()}] + @type status() :: pos_integer() + + @spec request(atom(), String.t(), headers(), String.t(), keyword()) :: + {:ok, status(), headers} + | {:ok, status(), headers, map()} + | {:error, atom() | String.t()} + | no_return() + + @impl true + def request(method, url, headers, body, opts \\ []) do + check_adapter() + + opts = Keyword.put(opts, :body_as, :chunks) + + with {:ok, response} <- + Pleroma.HTTP.request( + method, + url, + body, + headers, + Keyword.put(opts, :adapter, opts) + ) do + if is_map(response.body) and method != :head do + {:ok, response.status, response.headers, response.body} + else + {:ok, response.status, response.headers} + end + else + {:error, error} -> {:error, error} + end + end + + @impl true + @spec stream_body(map()) :: + {:ok, binary(), map()} | {:error, atom() | String.t()} | :done | no_return() + def stream_body(%{pid: pid, opts: opts, fin: true}) do + # if connection was reused, but in tesla were redirects, + # tesla returns new opened connection, which must be closed manually + if opts[:old_conn], do: Tesla.Adapter.Gun.close(pid) + # if there were redirects we need to checkout old conn + conn = opts[:old_conn] || opts[:conn] + + if conn, do: :ok = Pleroma.Pool.Connections.checkout(conn, self(), :gun_connections) + + :done + end + + def stream_body(client) do + case read_chunk!(client) do + {:fin, body} -> + {:ok, body, Map.put(client, :fin, true)} + + {:nofin, part} -> + {:ok, part, client} + + {:error, error} -> + {:error, error} + end + end + + defp read_chunk!(%{pid: pid, stream: stream, opts: opts}) do + adapter = check_adapter() + adapter.read_chunk(pid, stream, opts) + end + + @impl true + @spec close(map) :: :ok | no_return() + def close(%{pid: pid}) do + adapter = check_adapter() + adapter.close(pid) + end + + defp check_adapter do + adapter = Application.get_env(:tesla, :adapter) + + unless adapter == Tesla.Adapter.Gun do + raise "#{adapter} doesn't support reading body in chunks" + end + + adapter + end +end diff --git a/lib/pleroma/reverse_proxy/reverse_proxy.ex b/lib/pleroma/reverse_proxy/reverse_proxy.ex index 8b713b8f4..4bbeb493c 100644 --- a/lib/pleroma/reverse_proxy/reverse_proxy.ex +++ b/lib/pleroma/reverse_proxy/reverse_proxy.ex @@ -3,8 +3,6 @@ # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.ReverseProxy do - alias Pleroma.HTTP - @keep_req_headers ~w(accept user-agent accept-encoding cache-control if-modified-since) ++ ~w(if-unmodified-since if-none-match if-range range) @resp_cache_headers ~w(etag date last-modified) @@ -58,10 +56,10 @@ defmodule Pleroma.ReverseProxy do * `req_headers`, `resp_headers` additional headers. - * `http`: options for [hackney](https://github.com/benoitc/hackney). + * `http`: options for [hackney](https://github.com/benoitc/hackney) or [gun](https://github.com/ninenines/gun). """ - @default_hackney_options [pool: :media] + @default_options [pool: :media] @inline_content_types [ "image/gif", @@ -94,11 +92,7 @@ defmodule Pleroma.ReverseProxy do def call(_conn, _url, _opts \\ []) def call(conn = %{method: method}, url, opts) when method in @methods do - hackney_opts = - Pleroma.HTTP.Connection.hackney_options([]) - |> Keyword.merge(@default_hackney_options) - |> Keyword.merge(Keyword.get(opts, :http, [])) - |> HTTP.process_request_options() + client_opts = Keyword.merge(@default_options, Keyword.get(opts, :http, [])) req_headers = build_req_headers(conn.req_headers, opts) @@ -110,7 +104,7 @@ def call(conn = %{method: method}, url, opts) when method in @methods do end with {:ok, nil} <- Cachex.get(:failed_proxy_url_cache, url), - {:ok, code, headers, client} <- request(method, url, req_headers, hackney_opts), + {:ok, code, headers, client} <- request(method, url, req_headers, client_opts), :ok <- header_length_constraint( headers, @@ -156,11 +150,11 @@ def call(conn, _, _) do |> halt() end - defp request(method, url, headers, hackney_opts) do + defp request(method, url, headers, opts) do Logger.debug("#{__MODULE__} #{method} #{url} #{inspect(headers)}") method = method |> String.downcase() |> String.to_existing_atom() - case client().request(method, url, headers, "", hackney_opts) do + case client().request(method, url, headers, "", opts) do {:ok, code, headers, client} when code in @valid_resp_codes -> {:ok, code, downcase_headers(headers), client} @@ -210,7 +204,7 @@ defp chunk_reply(conn, client, opts, sent_so_far, duration) do duration, Keyword.get(opts, :max_read_duration, @max_read_duration) ), - {:ok, data} <- client().stream_body(client), + {:ok, data, client} <- client().stream_body(client), {:ok, duration} <- increase_read_duration(duration), sent_so_far = sent_so_far + byte_size(data), :ok <- diff --git a/lib/pleroma/scheduled_activity.ex b/lib/pleroma/scheduled_activity.ex index 8ff06a462..0937cb7db 100644 --- a/lib/pleroma/scheduled_activity.ex +++ b/lib/pleroma/scheduled_activity.ex @@ -40,7 +40,7 @@ defp with_media_attachments( %{changes: %{params: %{"media_ids" => media_ids} = params}} = changeset ) when is_list(media_ids) do - media_attachments = Utils.attachments_from_ids(%{"media_ids" => media_ids}) + media_attachments = Utils.attachments_from_ids(%{media_ids: media_ids}) params = params diff --git a/lib/pleroma/signature.ex b/lib/pleroma/signature.ex index 6b0b2c969..d01728361 100644 --- a/lib/pleroma/signature.ex +++ b/lib/pleroma/signature.ex @@ -8,6 +8,7 @@ defmodule Pleroma.Signature do alias Pleroma.Keys alias Pleroma.User alias Pleroma.Web.ActivityPub.ActivityPub + alias Pleroma.Web.ActivityPub.ObjectValidators.Types def key_id_to_actor_id(key_id) do uri = @@ -21,12 +22,23 @@ def key_id_to_actor_id(key_id) do uri end - URI.to_string(uri) + maybe_ap_id = URI.to_string(uri) + + case Types.ObjectID.cast(maybe_ap_id) do + {:ok, ap_id} -> + {:ok, ap_id} + + _ -> + case Pleroma.Web.WebFinger.finger(maybe_ap_id) do + %{"ap_id" => ap_id} -> {:ok, ap_id} + _ -> {:error, maybe_ap_id} + end + end end def fetch_public_key(conn) do with %{"keyId" => kid} <- HTTPSignatures.signature_for_conn(conn), - actor_id <- key_id_to_actor_id(kid), + {:ok, actor_id} <- key_id_to_actor_id(kid), {:ok, public_key} <- User.get_public_key_for_ap_id(actor_id) do {:ok, public_key} else @@ -37,7 +49,7 @@ def fetch_public_key(conn) do def refetch_public_key(conn) do with %{"keyId" => kid} <- HTTPSignatures.signature_for_conn(conn), - actor_id <- key_id_to_actor_id(kid), + {:ok, actor_id} <- key_id_to_actor_id(kid), {:ok, _user} <- ActivityPub.make_user_from_ap_id(actor_id), {:ok, public_key} <- User.get_public_key_for_ap_id(actor_id) do {:ok, public_key} diff --git a/lib/pleroma/stats.ex b/lib/pleroma/stats.ex index 4446562ac..6b3a8a41f 100644 --- a/lib/pleroma/stats.ex +++ b/lib/pleroma/stats.ex @@ -45,11 +45,11 @@ def get_peers do end def init(_args) do - {:ok, get_stat_data()} + {:ok, calculate_stat_data()} end def handle_call(:force_update, _from, _state) do - new_stats = get_stat_data() + new_stats = calculate_stat_data() {:reply, new_stats, new_stats} end @@ -58,12 +58,12 @@ def handle_call(:get_state, _from, state) do end def handle_cast(:run_update, _state) do - new_stats = get_stat_data() + new_stats = calculate_stat_data() {:noreply, new_stats} end - defp get_stat_data do + def calculate_stat_data do peers = from( u in User, @@ -77,13 +77,21 @@ defp get_stat_data do status_count = Repo.aggregate(User.Query.build(%{local: true}), :sum, :note_count) - user_count = Repo.aggregate(User.Query.build(%{local: true, active: true}), :count, :id) + users_query = + from(u in User, + where: u.deactivated != true, + where: u.local == true, + where: not is_nil(u.nickname), + where: not u.invisible + ) + + user_count = Repo.aggregate(users_query, :count, :id) %{ peers: peers, stats: %{ domain_count: domain_count, - status_count: status_count, + status_count: status_count || 0, user_count: user_count } } diff --git a/lib/pleroma/tests/auth_test_controller.ex b/lib/pleroma/tests/auth_test_controller.ex new file mode 100644 index 000000000..fb04411d9 --- /dev/null +++ b/lib/pleroma/tests/auth_test_controller.ex @@ -0,0 +1,93 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +# A test controller reachable only in :test env. +defmodule Pleroma.Tests.AuthTestController do + @moduledoc false + + use Pleroma.Web, :controller + + alias Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug + alias Pleroma.Plugs.OAuthScopesPlug + alias Pleroma.User + + # Serves only with proper OAuth token (:api and :authenticated_api) + # Skipping EnsurePublicOrAuthenticatedPlug has no effect in this case + # + # Suggested use case: all :authenticated_api endpoints (makes no sense for :api endpoints) + plug(OAuthScopesPlug, %{scopes: ["read"]} when action == :do_oauth_check) + + # Via :api, keeps :user if token has requested scopes (if :user is dropped, serves if public) + # Via :authenticated_api, serves if token is present and has requested scopes + # + # Suggested use case: vast majority of :api endpoints (no sense for :authenticated_api ones) + plug( + OAuthScopesPlug, + %{scopes: ["read"], fallback: :proceed_unauthenticated} + when action == :fallback_oauth_check + ) + + # Keeps :user if present, executes regardless of token / token scopes + # Fails with no :user for :authenticated_api / no user for :api on private instance + # Note: EnsurePublicOrAuthenticatedPlug is not skipped (private instance fails on no :user) + # Note: Basic Auth processing results in :skip_plug call for OAuthScopesPlug + # + # Suggested use: suppressing OAuth checks for other auth mechanisms (like Basic Auth) + # For controller-level use, see :skip_oauth_skip_publicity_check instead + plug( + :skip_plug, + OAuthScopesPlug when action == :skip_oauth_check + ) + + # (Shouldn't be executed since the plug is skipped) + plug(OAuthScopesPlug, %{scopes: ["admin"]} when action == :skip_oauth_check) + + # Via :api, keeps :user if token has requested scopes, and continues with nil :user otherwise + # Via :authenticated_api, serves if token is present and has requested scopes + # + # Suggested use: as :fallback_oauth_check but open with nil :user for :api on private instances + plug( + :skip_plug, + EnsurePublicOrAuthenticatedPlug when action == :fallback_oauth_skip_publicity_check + ) + + plug( + OAuthScopesPlug, + %{scopes: ["read"], fallback: :proceed_unauthenticated} + when action == :fallback_oauth_skip_publicity_check + ) + + # Via :api, keeps :user if present, serves regardless of token presence / scopes / :user presence + # Via :authenticated_api, serves if :user is set (regardless of token presence and its scopes) + # + # Suggested use: making an :api endpoint always accessible (e.g. email confirmation endpoint) + plug( + :skip_plug, + [OAuthScopesPlug, EnsurePublicOrAuthenticatedPlug] + when action == :skip_oauth_skip_publicity_check + ) + + # Via :authenticated_api, always fails with 403 (endpoint is insecure) + # Via :api, drops :user if present and serves if public (private instance rejects on no user) + # + # Suggested use: none; please define OAuth rules for all :api / :authenticated_api endpoints + plug(:skip_plug, [] when action == :missing_oauth_check_definition) + + def do_oauth_check(conn, _params), do: conn_state(conn) + + def fallback_oauth_check(conn, _params), do: conn_state(conn) + + def skip_oauth_check(conn, _params), do: conn_state(conn) + + def fallback_oauth_skip_publicity_check(conn, _params), do: conn_state(conn) + + def skip_oauth_skip_publicity_check(conn, _params), do: conn_state(conn) + + def missing_oauth_check_definition(conn, _params), do: conn_state(conn) + + defp conn_state(%{assigns: %{user: %User{} = user}} = conn), + do: json(conn, %{user_id: user.id}) + + defp conn_state(conn), do: json(conn, %{user_id: nil}) +end diff --git a/lib/pleroma/thread_mute.ex b/lib/pleroma/thread_mute.ex index cc815430a..be01d541d 100644 --- a/lib/pleroma/thread_mute.ex +++ b/lib/pleroma/thread_mute.ex @@ -9,7 +9,8 @@ defmodule Pleroma.ThreadMute do alias Pleroma.ThreadMute alias Pleroma.User - require Ecto.Query + import Ecto.Changeset + import Ecto.Query schema "thread_mutes" do belongs_to(:user, User, type: FlakeId.Ecto.CompatType) @@ -18,19 +19,44 @@ defmodule Pleroma.ThreadMute do def changeset(mute, params \\ %{}) do mute - |> Ecto.Changeset.cast(params, [:user_id, :context]) - |> Ecto.Changeset.foreign_key_constraint(:user_id) - |> Ecto.Changeset.unique_constraint(:user_id, name: :unique_index) + |> cast(params, [:user_id, :context]) + |> foreign_key_constraint(:user_id) + |> unique_constraint(:user_id, name: :unique_index) end def query(user_id, context) do - {:ok, user_id} = FlakeId.Ecto.CompatType.dump(user_id) + user_binary_id = User.binary_id(user_id) ThreadMute - |> Ecto.Query.where(user_id: ^user_id) - |> Ecto.Query.where(context: ^context) + |> where(user_id: ^user_binary_id) + |> where(context: ^context) end + def muters_query(context) do + ThreadMute + |> join(:inner, [tm], u in assoc(tm, :user)) + |> where([tm], tm.context == ^context) + |> select([tm, u], u.ap_id) + end + + def muter_ap_ids(context, ap_ids \\ nil) + + # Note: applies to fake activities (ActivityPub.Utils.get_notified_from_object/1 etc.) + def muter_ap_ids(context, _ap_ids) when is_nil(context), do: [] + + def muter_ap_ids(context, ap_ids) do + context + |> muters_query() + |> maybe_filter_on_ap_id(ap_ids) + |> Repo.all() + end + + defp maybe_filter_on_ap_id(query, ap_ids) when is_list(ap_ids) do + where(query, [tm, u], u.ap_id in ^ap_ids) + end + + defp maybe_filter_on_ap_id(query, _ap_ids), do: query + def add_mute(user_id, context) do %ThreadMute{} |> changeset(%{user_id: user_id, context: context}) @@ -42,8 +68,8 @@ def remove_mute(user_id, context) do |> Repo.delete_all() end - def check_muted(user_id, context) do + def exists?(user_id, context) do query(user_id, context) - |> Repo.all() + |> Repo.exists?() end end diff --git a/lib/pleroma/upload.ex b/lib/pleroma/upload.ex index 762d813d9..1be1a3a5b 100644 --- a/lib/pleroma/upload.ex +++ b/lib/pleroma/upload.ex @@ -134,7 +134,7 @@ defp prepare_upload(%Plug.Upload{} = file, opts) do end end - defp prepare_upload(%{"img" => "data:image/" <> image_data}, opts) do + defp prepare_upload(%{img: "data:image/" <> image_data}, opts) do parsed = Regex.named_captures(~r/(?jpeg|png|gif);base64,(?.*)/, image_data) data = Base.decode64!(parsed["data"], ignore: :whitespace) hash = String.downcase(Base.encode16(:crypto.hash(:sha256, data))) diff --git a/lib/pleroma/user.ex b/lib/pleroma/user.ex index 12c2ad815..cba391072 100644 --- a/lib/pleroma/user.ex +++ b/lib/pleroma/user.ex @@ -9,15 +9,17 @@ defmodule Pleroma.User do import Ecto.Query import Ecto, only: [assoc: 2] - alias Comeonin.Pbkdf2 alias Ecto.Multi alias Pleroma.Activity alias Pleroma.Config alias Pleroma.Conversation.Participation alias Pleroma.Delivery + alias Pleroma.Emoji alias Pleroma.FollowingRelationship + alias Pleroma.Formatter alias Pleroma.HTML alias Pleroma.Keys + alias Pleroma.MFA alias Pleroma.Notification alias Pleroma.Object alias Pleroma.Registration @@ -27,6 +29,9 @@ defmodule Pleroma.User do alias Pleroma.UserRelationship alias Pleroma.Web alias Pleroma.Web.ActivityPub.ActivityPub + alias Pleroma.Web.ActivityPub.Builder + alias Pleroma.Web.ActivityPub.ObjectValidators.Types + alias Pleroma.Web.ActivityPub.Pipeline alias Pleroma.Web.ActivityPub.Utils alias Pleroma.Web.CommonAPI alias Pleroma.Web.CommonAPI.Utils, as: CommonUtils @@ -81,6 +86,7 @@ defmodule Pleroma.User do field(:password, :string, virtual: true) field(:password_confirmation, :string, virtual: true) field(:keys, :string) + field(:public_key, :string) field(:ap_id, :string) field(:avatar, :map) field(:local, :boolean, default: true) @@ -93,7 +99,6 @@ defmodule Pleroma.User do field(:last_digest_emailed_at, :naive_datetime) field(:banner, :map, default: %{}) field(:background, :map, default: %{}) - field(:source_data, :map, default: %{}) field(:note_count, :integer, default: 0) field(:follower_count, :integer, default: 0) field(:following_count, :integer, default: 0) @@ -110,8 +115,7 @@ defmodule Pleroma.User do field(:is_admin, :boolean, default: false) field(:show_role, :boolean, default: true) field(:settings, :map, default: nil) - field(:magic_key, :string, default: nil) - field(:uri, :string, default: nil) + field(:uri, Types.Uri, default: nil) field(:hide_followers_count, :boolean, default: false) field(:hide_follows_count, :boolean, default: false) field(:hide_followers, :boolean, default: false) @@ -121,7 +125,7 @@ defmodule Pleroma.User do field(:pinned_activities, {:array, :string}, default: []) field(:email_notifications, :map, default: %{"digest" => false}) field(:mascot, :map, default: nil) - field(:emoji, {:array, :map}, default: []) + field(:emoji, :map, default: %{}) field(:pleroma_settings_store, :map, default: %{}) field(:fields, {:array, :map}, default: []) field(:raw_fields, {:array, :map}, default: []) @@ -131,6 +135,8 @@ defmodule Pleroma.User do field(:skip_thread_containment, :boolean, default: false) field(:actor_type, :string, default: "Person") field(:also_known_as, {:array, :string}, default: []) + field(:inbox, :string) + field(:shared_inbox, :string) embeds_one( :notification_settings, @@ -150,22 +156,26 @@ defmodule Pleroma.User do {outgoing_relation, outgoing_relation_target}, {incoming_relation, incoming_relation_source} ]} <- @user_relationships_config do - # Definitions of `has_many :blocker_blocks`, `has_many :muter_mutes` etc. + # Definitions of `has_many` relations: :blocker_blocks, :muter_mutes, :reblog_muter_mutes, + # :notification_muter_mutes, :subscribee_subscriptions has_many(outgoing_relation, UserRelationship, foreign_key: :source_id, where: [relationship_type: relationship_type] ) - # Definitions of `has_many :blockee_blocks`, `has_many :mutee_mutes` etc. + # Definitions of `has_many` relations: :blockee_blocks, :mutee_mutes, :reblog_mutee_mutes, + # :notification_mutee_mutes, :subscriber_subscriptions has_many(incoming_relation, UserRelationship, foreign_key: :target_id, where: [relationship_type: relationship_type] ) - # Definitions of `has_many :blocked_users`, `has_many :muted_users` etc. + # Definitions of `has_many` relations: :blocked_users, :muted_users, :reblog_muted_users, + # :notification_muted_users, :subscriber_users has_many(outgoing_relation_target, through: [outgoing_relation, :target]) - # Definitions of `has_many :blocker_users`, `has_many :muter_users` etc. + # Definitions of `has_many` relations: :blocker_users, :muter_users, :reblog_muter_users, + # :notification_muter_users, :subscribee_users has_many(incoming_relation_source, through: [incoming_relation, :source]) end @@ -180,12 +190,20 @@ defmodule Pleroma.User do # `:subscribers` is deprecated (replaced with `subscriber_users` relation) field(:subscribers, {:array, :string}, default: []) + embeds_one( + :multi_factor_authentication_settings, + MFA.Settings, + on_replace: :delete + ) + timestamps() end for {_relationship_type, [{_outgoing_relation, outgoing_relation_target}, _]} <- @user_relationships_config do - # Definitions of `blocked_users_relation/1`, `muted_users_relation/1`, etc. + # `def blocked_users_relation/2`, `def muted_users_relation/2`, + # `def reblog_muted_users_relation/2`, `def notification_muted_users/2`, + # `def subscriber_users/2` def unquote(:"#{outgoing_relation_target}_relation")(user, restrict_deactivated? \\ false) do target_users_query = assoc(user, unquote(outgoing_relation_target)) @@ -196,7 +214,8 @@ def unquote(:"#{outgoing_relation_target}_relation")(user, restrict_deactivated? end end - # Definitions of `blocked_users/1`, `muted_users/1`, etc. + # `def blocked_users/2`, `def muted_users/2`, `def reblog_muted_users/2`, + # `def notification_muted_users/2`, `def subscriber_users/2` def unquote(outgoing_relation_target)(user, restrict_deactivated? \\ false) do __MODULE__ |> apply(unquote(:"#{outgoing_relation_target}_relation"), [ @@ -206,7 +225,8 @@ def unquote(outgoing_relation_target)(user, restrict_deactivated? \\ false) do |> Repo.all() end - # Definitions of `blocked_users_ap_ids/1`, `muted_users_ap_ids/1`, etc. + # `def blocked_users_ap_ids/2`, `def muted_users_ap_ids/2`, `def reblog_muted_users_ap_ids/2`, + # `def notification_muted_users_ap_ids/2`, `def subscriber_users_ap_ids/2` def unquote(:"#{outgoing_relation_target}_ap_ids")(user, restrict_deactivated? \\ false) do __MODULE__ |> apply(unquote(:"#{outgoing_relation_target}_relation"), [ @@ -218,6 +238,24 @@ def unquote(:"#{outgoing_relation_target}_ap_ids")(user, restrict_deactivated? \ end end + @doc """ + Dumps Flake Id to SQL-compatible format (16-byte UUID). + E.g. "9pQtDGXuq4p3VlcJEm" -> <<0, 0, 1, 110, 179, 218, 42, 92, 213, 41, 44, 227, 95, 213, 0, 0>> + """ + def binary_id(source_id) when is_binary(source_id) do + with {:ok, dumped_id} <- FlakeId.Ecto.CompatType.dump(source_id) do + dumped_id + else + _ -> source_id + end + end + + def binary_id(source_ids) when is_list(source_ids) do + Enum.map(source_ids, &binary_id/1) + end + + def binary_id(%User{} = user), do: binary_id(user.id) + @doc "Returns status account" @spec account_status(User.t()) :: account_status() def account_status(%User{deactivated: true}), do: :deactivated @@ -279,16 +317,13 @@ def banner_url(user, options \\ []) do end end - def profile_url(%User{source_data: %{"url" => url}}), do: url - def profile_url(%User{ap_id: ap_id}), do: ap_id - def profile_url(_), do: nil - + # Should probably be renamed or removed def ap_id(%User{nickname: nickname}), do: "#{Web.base_url()}/users/#{nickname}" def ap_followers(%User{follower_address: fa}) when is_binary(fa), do: fa def ap_followers(%User{} = user), do: "#{ap_id(user)}/followers" - @spec ap_following(User.t()) :: Sring.t() + @spec ap_following(User.t()) :: String.t() def ap_following(%User{following_address: fa}) when is_binary(fa), do: fa def ap_following(%User{} = user), do: "#{ap_id(user)}/following" @@ -316,62 +351,71 @@ defp truncate_if_exists(params, key, max_length) do end end - def remote_user_creation(params) do + defp fix_follower_address(%{follower_address: _, following_address: _} = params), do: params + + defp fix_follower_address(%{nickname: nickname} = params), + do: Map.put(params, :follower_address, ap_followers(%User{nickname: nickname})) + + defp fix_follower_address(params), do: params + + def remote_user_changeset(struct \\ %User{local: false}, params) do bio_limit = Pleroma.Config.get([:instance, :user_bio_length], 5000) name_limit = Pleroma.Config.get([:instance, :user_name_length], 100) + name = + case params[:name] do + name when is_binary(name) and byte_size(name) > 0 -> name + _ -> params[:nickname] + end + params = params + |> Map.put(:name, name) + |> Map.put_new(:last_refreshed_at, NaiveDateTime.utc_now()) |> truncate_if_exists(:name, name_limit) |> truncate_if_exists(:bio, bio_limit) |> truncate_fields_param() + |> fix_follower_address() - changeset = - %User{local: false} - |> cast( - params, - [ - :bio, - :name, - :ap_id, - :nickname, - :avatar, - :ap_enabled, - :source_data, - :banner, - :locked, - :magic_key, - :uri, - :hide_followers, - :hide_follows, - :hide_followers_count, - :hide_follows_count, - :follower_count, - :fields, - :following_count, - :discoverable, - :invisible, - :actor_type, - :also_known_as - ] - ) - |> validate_required([:name, :ap_id]) - |> unique_constraint(:nickname) - |> validate_format(:nickname, @email_regex) - |> validate_length(:bio, max: bio_limit) - |> validate_length(:name, max: name_limit) - |> validate_fields(true) - - case params[:source_data] do - %{"followers" => followers, "following" => following} -> - changeset - |> put_change(:follower_address, followers) - |> put_change(:following_address, following) - - _ -> - followers = ap_followers(%User{nickname: get_field(changeset, :nickname)}) - put_change(changeset, :follower_address, followers) - end + struct + |> cast( + params, + [ + :bio, + :name, + :emoji, + :ap_id, + :inbox, + :shared_inbox, + :nickname, + :public_key, + :avatar, + :ap_enabled, + :banner, + :locked, + :last_refreshed_at, + :uri, + :follower_address, + :following_address, + :hide_followers, + :hide_follows, + :hide_followers_count, + :hide_follows_count, + :follower_count, + :fields, + :following_count, + :discoverable, + :invisible, + :actor_type, + :also_known_as + ] + ) + |> validate_required([:name, :ap_id]) + |> unique_constraint(:nickname) + |> validate_format(:nickname, @email_regex) + |> validate_length(:bio, max: bio_limit) + |> validate_length(:name, max: name_limit) + |> validate_fields(true) end def update_changeset(struct, params \\ %{}) do @@ -384,7 +428,11 @@ def update_changeset(struct, params \\ %{}) do [ :bio, :name, + :emoji, :avatar, + :public_key, + :inbox, + :shared_inbox, :locked, :no_rich_text, :default_scope, @@ -410,50 +458,93 @@ def update_changeset(struct, params \\ %{}) do |> validate_format(:nickname, local_nickname_regex()) |> validate_length(:bio, max: bio_limit) |> validate_length(:name, min: 1, max: name_limit) + |> put_fields() + |> put_emoji() + |> put_change_if_present(:bio, &{:ok, parse_bio(&1, struct)}) + |> put_change_if_present(:avatar, &put_upload(&1, :avatar)) + |> put_change_if_present(:banner, &put_upload(&1, :banner)) + |> put_change_if_present(:background, &put_upload(&1, :background)) + |> put_change_if_present( + :pleroma_settings_store, + &{:ok, Map.merge(struct.pleroma_settings_store, &1)} + ) |> validate_fields(false) end - def upgrade_changeset(struct, params \\ %{}, remote? \\ false) do - bio_limit = Pleroma.Config.get([:instance, :user_bio_length], 5000) - name_limit = Pleroma.Config.get([:instance, :user_name_length], 100) + defp put_fields(changeset) do + if raw_fields = get_change(changeset, :raw_fields) do + raw_fields = + raw_fields + |> Enum.filter(fn %{"name" => n} -> n != "" end) - params = Map.put(params, :last_refreshed_at, NaiveDateTime.utc_now()) + fields = + raw_fields + |> Enum.map(fn f -> Map.update!(f, "value", &parse_fields(&1)) end) - params = if remote?, do: truncate_fields_param(params), else: params + changeset + |> put_change(:raw_fields, raw_fields) + |> put_change(:fields, fields) + else + changeset + end + end + defp parse_fields(value) do + value + |> Formatter.linkify(mentions_format: :full) + |> elem(0) + end + + defp put_emoji(changeset) do + bio = get_change(changeset, :bio) + name = get_change(changeset, :name) + + if bio || name do + emoji = Map.merge(Emoji.Formatter.get_emoji_map(bio), Emoji.Formatter.get_emoji_map(name)) + put_change(changeset, :emoji, emoji) + else + changeset + end + end + + defp put_change_if_present(changeset, map_field, value_function) do + if value = get_change(changeset, map_field) do + with {:ok, new_value} <- value_function.(value) do + put_change(changeset, map_field, new_value) + else + _ -> changeset + end + else + changeset + end + end + + defp put_upload(value, type) do + with %Plug.Upload{} <- value, + {:ok, object} <- ActivityPub.upload(value, type: type) do + {:ok, object.data} + end + end + + def update_as_admin_changeset(struct, params) do struct - |> cast( - params, - [ - :bio, - :name, - :follower_address, - :following_address, - :avatar, - :last_refreshed_at, - :ap_enabled, - :source_data, - :banner, - :locked, - :magic_key, - :follower_count, - :following_count, - :hide_follows, - :fields, - :hide_followers, - :allow_following_move, - :discoverable, - :hide_followers_count, - :hide_follows_count, - :actor_type, - :also_known_as - ] - ) - |> unique_constraint(:nickname) - |> validate_format(:nickname, local_nickname_regex()) - |> validate_length(:bio, max: bio_limit) - |> validate_length(:name, max: name_limit) - |> validate_fields(remote?) + |> update_changeset(params) + |> cast(params, [:email]) + |> delete_change(:also_known_as) + |> unique_constraint(:email) + |> validate_format(:email, @email_regex) + end + + @spec update_as_admin(%User{}, map) :: {:ok, User.t()} | {:error, Ecto.Changeset.t()} + def update_as_admin(user, params) do + params = Map.put(params, "password_confirmation", params["password"]) + changeset = update_as_admin_changeset(user, params) + + if params["password"] do + reset_password(user, changeset, params) + else + User.update_and_set_cache(changeset) + end end def password_update_changeset(struct, params) do @@ -466,10 +557,14 @@ def password_update_changeset(struct, params) do end @spec reset_password(User.t(), map) :: {:ok, User.t()} | {:error, Ecto.Changeset.t()} - def reset_password(%User{id: user_id} = user, data) do + def reset_password(%User{} = user, params) do + reset_password(user, user, params) + end + + def reset_password(%User{id: user_id} = user, struct, params) do multi = Multi.new() - |> Multi.update(:user, password_update_changeset(user, data)) + |> Multi.update(:user, password_update_changeset(struct, params)) |> Multi.delete_all(:tokens, OAuth.Token.Query.get_by_user(user_id)) |> Multi.delete_all(:auth, OAuth.Authorization.delete_by_user_query(user)) @@ -506,7 +601,7 @@ def register_changeset(struct, params \\ %{}, opts \\ []) do struct |> confirmation_changeset(need_confirmation: need_confirmation?) - |> cast(params, [:bio, :email, :name, :nickname, :password, :password_confirmation]) + |> cast(params, [:bio, :email, :name, :nickname, :password, :password_confirmation, :emoji]) |> validate_required([:name, :nickname, :password, :password_confirmation]) |> validate_confirmation(:password) |> unique_constraint(:email) @@ -599,8 +694,10 @@ def needs_update?(%User{local: false} = user) do def needs_update?(_), do: true @spec maybe_direct_follow(User.t(), User.t()) :: {:ok, User.t()} | {:error, String.t()} + + # "Locked" (self-locked) users demand explicit authorization of follow requests def maybe_direct_follow(%User{} = follower, %User{local: true, locked: true} = followed) do - follow(follower, followed, "pending") + follow(follower, followed, :follow_pending) end def maybe_direct_follow(%User{} = follower, %User{local: true} = followed) do @@ -620,14 +717,14 @@ def maybe_direct_follow(%User{} = follower, %User{} = followed) do def follow_all(follower, followeds) do followeds |> Enum.reject(fn followed -> blocks?(follower, followed) || blocks?(followed, follower) end) - |> Enum.each(&follow(follower, &1, "accept")) + |> Enum.each(&follow(follower, &1, :follow_accept)) set_cache(follower) end defdelegate following(user), to: FollowingRelationship - def follow(%User{} = follower, %User{} = followed, state \\ "accept") do + def follow(%User{} = follower, %User{} = followed, state \\ :follow_accept) do deny_follow_blocked = Pleroma.Config.get([:user, :deny_follow_blocked]) cond do @@ -654,7 +751,7 @@ def unfollow(%User{ap_id: ap_id}, %User{ap_id: ap_id}) do def unfollow(%User{} = follower, %User{} = followed) do case get_follow_state(follower, followed) do - state when state in ["accept", "pending"] -> + state when state in [:follow_pending, :follow_accept] -> FollowingRelationship.unfollow(follower, followed) {:ok, followed} = update_follower_count(followed) @@ -672,14 +769,25 @@ def unfollow(%User{} = follower, %User{} = followed) do defdelegate following?(follower, followed), to: FollowingRelationship + @doc "Returns follow state as Pleroma.FollowingRelationship.State value" def get_follow_state(%User{} = follower, %User{} = following) do following_relationship = FollowingRelationship.get(follower, following) + get_follow_state(follower, following, following_relationship) + end + def get_follow_state( + %User{} = follower, + %User{} = following, + following_relationship + ) do case {following_relationship, following.local} do {nil, false} -> case Utils.fetch_latest_follow(follower, following) do - %{data: %{"state" => state}} when state in ["pending", "accept"] -> state - _ -> nil + %Activity{data: %{"state" => state}} when state in ["pending", "accept"] -> + FollowingRelationship.state_to_enum(state) + + _ -> + nil end {%{state: state}, _} -> @@ -730,6 +838,7 @@ def set_cache({:error, err}), do: {:error, err} def set_cache(%User{} = user) do Cachex.put(:user_cache, "ap_id:#{user.ap_id}", user) Cachex.put(:user_cache, "nickname:#{user.nickname}", user) + Cachex.put(:user_cache, "friends_ap_ids:#{user.nickname}", get_user_friends_ap_ids(user)) {:ok, user} end @@ -745,9 +854,22 @@ def update_and_set_cache(changeset) do end end + def get_user_friends_ap_ids(user) do + from(u in User.get_friends_query(user), select: u.ap_id) + |> Repo.all() + end + + @spec get_cached_user_friends_ap_ids(User.t()) :: [String.t()] + def get_cached_user_friends_ap_ids(user) do + Cachex.fetch!(:user_cache, "friends_ap_ids:#{user.ap_id}", fn _ -> + get_user_friends_ap_ids(user) + end) + end + def invalidate_cache(user) do Cachex.del(:user_cache, "ap_id:#{user.ap_id}") Cachex.del(:user_cache, "nickname:#{user.nickname}") + Cachex.del(:user_cache, "friends_ap_ids:#{user.ap_id}") end @spec get_cached_by_ap_id(String.t()) :: User.t() | nil @@ -811,6 +933,7 @@ def get_cached_by_nickname_or_id(nickname_or_id, opts \\ []) do end end + @spec get_by_nickname(String.t()) :: User.t() | nil def get_by_nickname(nickname) do Repo.get_by(User, nickname: nickname) || if Regex.match?(~r(@#{Pleroma.Web.Endpoint.host()})i, nickname) do @@ -1078,7 +1201,9 @@ def get_users_from_set(ap_ids, local_only \\ true) do end @spec get_recipients_from_activity(Activity.t()) :: [User.t()] - def get_recipients_from_activity(%Activity{recipients: to}) do + def get_recipients_from_activity(%Activity{recipients: to, actor: actor}) do + to = [actor | to] + User.Query.build(%{recipients_from_activity: to, local: true, deactivated: false}) |> Repo.all() end @@ -1178,7 +1303,7 @@ def blocks?(nil, _), do: false def blocks?(%User{} = user, %User{} = target) do blocks_user?(user, target) || - (!User.following?(user, target) && blocks_domain?(user, target)) + (blocks_domain?(user, target) and not User.following?(user, target)) end def blocks_user?(%User{} = user, %User{} = target) do @@ -1207,13 +1332,15 @@ def subscribed_to?(%User{} = user, %{ap_id: ap_id}) do end @doc """ - Returns map of outgoing (blocked, muted etc.) relations' user AP IDs by relation type. - E.g. `outgoing_relations_ap_ids(user, [:block])` -> `%{block: ["https://some.site/users/userapid"]}` + Returns map of outgoing (blocked, muted etc.) relationships' user AP IDs by relation type. + E.g. `outgoing_relationships_ap_ids(user, [:block])` -> `%{block: ["https://some.site/users/userapid"]}` """ - @spec outgoing_relations_ap_ids(User.t(), list(atom())) :: %{atom() => list(String.t())} - def outgoing_relations_ap_ids(_, []), do: %{} + @spec outgoing_relationships_ap_ids(User.t(), list(atom())) :: %{atom() => list(String.t())} + def outgoing_relationships_ap_ids(_user, []), do: %{} - def outgoing_relations_ap_ids(%User{} = user, relationship_types) + def outgoing_relationships_ap_ids(nil, _relationship_types), do: %{} + + def outgoing_relationships_ap_ids(%User{} = user, relationship_types) when is_list(relationship_types) do db_result = user @@ -1232,6 +1359,30 @@ def outgoing_relations_ap_ids(%User{} = user, relationship_types) ) end + def incoming_relationships_ungrouped_ap_ids(user, relationship_types, ap_ids \\ nil) + + def incoming_relationships_ungrouped_ap_ids(_user, [], _ap_ids), do: [] + + def incoming_relationships_ungrouped_ap_ids(nil, _relationship_types, _ap_ids), do: [] + + def incoming_relationships_ungrouped_ap_ids(%User{} = user, relationship_types, ap_ids) + when is_list(relationship_types) do + user + |> assoc(:incoming_relationships) + |> join(:inner, [user_rel], u in assoc(user_rel, :source)) + |> where([user_rel, u], user_rel.relationship_type in ^relationship_types) + |> maybe_filter_on_ap_id(ap_ids) + |> select([user_rel, u], u.ap_id) + |> distinct(true) + |> Repo.all() + end + + defp maybe_filter_on_ap_id(query, ap_ids) when is_list(ap_ids) do + where(query, [user_rel, u], u.ap_id in ^ap_ids) + end + + defp maybe_filter_on_ap_id(query, _ap_ids), do: query + def deactivate_async(user, status \\ true) do BackgroundWorker.enqueue("deactivate_user", %{"user_id" => user.id, "status" => status}) end @@ -1283,8 +1434,6 @@ def perform(:force_password_reset, user), do: force_password_reset(user) @spec perform(atom(), User.t()) :: {:ok, User.t()} def perform(:delete, %User{} = user) do - {:ok, _user} = ActivityPub.delete(user) - # Remove all relationships user |> get_followers() @@ -1301,8 +1450,15 @@ def perform(:delete, %User{} = user) do end) delete_user_activities(user) - invalidate_cache(user) - Repo.delete(user) + + if user.local do + user + |> change(%{deactivated: true, email: nil}) + |> update_and_set_cache() + else + invalidate_cache(user) + Repo.delete(user) + end end def perform(:deactivate_async, user, status), do: deactivate(user, status) @@ -1387,37 +1543,42 @@ def follow_import(%User{} = follower, followed_identifiers) }) end - def delete_user_activities(%User{ap_id: ap_id}) do + def delete_user_activities(%User{ap_id: ap_id} = user) do ap_id |> Activity.Queries.by_actor() |> RepoStreamer.chunk_stream(50) - |> Stream.each(fn activities -> Enum.each(activities, &delete_activity/1) end) + |> Stream.each(fn activities -> + Enum.each(activities, fn activity -> delete_activity(activity, user) end) + end) |> Stream.run() end - defp delete_activity(%{data: %{"type" => "Create"}} = activity) do - activity - |> Object.normalize() - |> ActivityPub.delete() + defp delete_activity(%{data: %{"type" => "Create", "object" => object}} = activity, user) do + with {_, %Object{}} <- {:find_object, Object.get_by_ap_id(object)}, + {:ok, delete_data, _} <- Builder.delete(user, object) do + Pipeline.common_pipeline(delete_data, local: user.local) + else + {:find_object, nil} -> + # We have the create activity, but not the object, it was probably pruned. + # Insert a tombstone and try again + with {:ok, tombstone_data, _} <- Builder.tombstone(user.ap_id, object), + {:ok, _tombstone} <- Object.create(tombstone_data) do + delete_activity(activity, user) + end + + e -> + Logger.error("Could not delete #{object} created by #{activity.data["ap_id"]}") + Logger.error("Error: #{inspect(e)}") + end end - defp delete_activity(%{data: %{"type" => "Like"}} = activity) do - object = Object.normalize(activity) - - activity.actor - |> get_cached_by_ap_id() - |> ActivityPub.unlike(object) + defp delete_activity(%{data: %{"type" => type}} = activity, user) + when type in ["Like", "Announce"] do + {:ok, undo, _} = Builder.undo(user, activity) + Pipeline.common_pipeline(undo, local: user.local) end - defp delete_activity(%{data: %{"type" => "Announce"}} = activity) do - object = Object.normalize(activity) - - activity.actor - |> get_cached_by_ap_id() - |> ActivityPub.unannounce(object) - end - - defp delete_activity(_activity), do: "Doing nothing" + defp delete_activity(_activity, _user), do: "Doing nothing" def html_filter_policy(%User{no_rich_text: true}) do Pleroma.HTML.Scrubber.TwitterText @@ -1484,8 +1645,7 @@ defp create_service_actor(uri, nickname) do |> set_cache() end - # AP style - def public_key(%{source_data: %{"publicKey" => %{"publicKeyPem" => public_key_pem}}}) do + def public_key(%{public_key: public_key_pem}) when is_binary(public_key_pem) do key = public_key_pem |> :public_key.pem_decode() @@ -1495,7 +1655,7 @@ def public_key(%{source_data: %{"publicKey" => %{"publicKeyPem" => public_key_pe {:ok, key} end - def public_key(_), do: {:error, "not found key"} + def public_key(_), do: {:error, "key not found"} def get_public_key_for_ap_id(ap_id) do with {:ok, %User{} = user} <- get_or_fetch_by_ap_id(ap_id), @@ -1506,17 +1666,6 @@ def get_public_key_for_ap_id(ap_id) do end end - defp blank?(""), do: nil - defp blank?(n), do: n - - def insert_or_update_user(data) do - data - |> Map.put(:name, blank?(data[:name]) || data[:nickname]) - |> remote_user_creation() - |> Repo.insert(on_conflict: {:replace_all_except, [:id]}, conflict_target: :nickname) - |> set_cache() - end - def ap_enabled?(%User{local: true}), do: true def ap_enabled?(%User{ap_enabled: ap_enabled}), do: ap_enabled def ap_enabled?(_), do: false @@ -1642,8 +1791,12 @@ def all_superusers do |> Repo.all() end + def muting_reblogs?(%User{} = user, %User{} = target) do + UserRelationship.reblog_mute_exists?(user, target) + end + def showing_reblogs?(%User{} = user, %User{} = target) do - not UserRelationship.reblog_mute_exists?(user, target) + not muting_reblogs?(user, target) end @doc """ @@ -1772,7 +1925,7 @@ def get_ap_ids_by_nicknames(nicknames) do defp put_password_hash( %Ecto.Changeset{valid?: true, changes: %{password: password}} = changeset ) do - change(changeset, password_hash: Pbkdf2.hashpwsalt(password)) + change(changeset, password_hash: Pbkdf2.hash_pwd_salt(password)) end defp put_password_hash(changeset), do: changeset @@ -1821,12 +1974,6 @@ def update_background(user, background) do |> update_and_set_cache() end - def update_source_data(user, source_data) do - user - |> cast(%{source_data: source_data}, [:source_data]) - |> update_and_set_cache() - end - def roles(%{is_moderator: is_moderator, is_admin: is_admin}) do %{ admin: is_admin, @@ -1834,21 +1981,6 @@ def roles(%{is_moderator: is_moderator, is_admin: is_admin}) do } end - # ``fields`` is an array of mastodon profile field, containing ``{"name": "…", "value": "…"}``. - # For example: [{"name": "Pronoun", "value": "she/her"}, …] - def fields(%{fields: nil, source_data: %{"attachment" => attachment}}) do - limit = Pleroma.Config.get([:instance, :max_remote_account_fields], 0) - - attachment - |> Enum.filter(fn %{"type" => t} -> t == "PropertyValue" end) - |> Enum.map(fn fields -> Map.take(fields, ["name", "value"]) end) - |> Enum.take(limit) - end - - def fields(%{fields: nil}), do: [] - - def fields(%{fields: fields}), do: fields - def validate_fields(changeset, remote? \\ false) do limit_name = if remote?, do: :max_remote_account_fields, else: :max_account_fields limit = Pleroma.Config.get([:instance, limit_name], 0) @@ -2036,9 +2168,7 @@ def sanitize_html(%User{} = user) do # - display name def sanitize_html(%User{} = user, filter) do fields = - user - |> User.fields() - |> Enum.map(fn %{"name" => name, "value" => value} -> + Enum.map(user.fields, fn %{"name" => name, "value" => value} -> %{ "name" => name, "value" => HTML.filter_tags(value, Pleroma.HTML.Scrubber.LinksOnly) diff --git a/lib/pleroma/user/query.ex b/lib/pleroma/user/query.ex index 884e33039..3a3b04793 100644 --- a/lib/pleroma/user/query.ex +++ b/lib/pleroma/user/query.ex @@ -45,6 +45,7 @@ defmodule Pleroma.User.Query do is_admin: boolean(), is_moderator: boolean(), super_users: boolean(), + exclude_service_users: boolean(), followers: User.t(), friends: User.t(), recipients_from_activity: [String.t()], @@ -54,13 +55,13 @@ defmodule Pleroma.User.Query do select: term(), limit: pos_integer() } - | %{} + | map() @ilike_criteria [:nickname, :name, :query] @equal_criteria [:email] @contains_criteria [:ap_id, :nickname] - @spec build(criteria()) :: Query.t() + @spec build(Query.t(), criteria()) :: Query.t() def build(query \\ base_query(), criteria) do prepare_query(query, criteria) end @@ -88,6 +89,10 @@ defp compose_query({key, value}, query) where(query, [u], ilike(field(u, ^key), ^"%#{value}%")) end + defp compose_query({:exclude_service_users, _}, query) do + where(query, [u], not like(u.ap_id, "%/relay") and not like(u.ap_id, "%/internal/fetch")) + end + defp compose_query({key, value}, query) when key in @equal_criteria and not_empty_string(value) do where(query, [u], ^[{key, value}]) @@ -98,7 +103,7 @@ defp compose_query({key, values}, query) when key in @contains_criteria and is_l end defp compose_query({:tags, tags}, query) when is_list(tags) and length(tags) > 0 do - Enum.reduce(tags, query, &prepare_tag_criteria/2) + where(query, [u], fragment("? && ?", u.tags, ^tags)) end defp compose_query({:is_admin, _}, query) do @@ -148,7 +153,7 @@ defp compose_query({:followers, %User{id: id}}, query) do as: :relationships, on: r.following_id == ^id and r.follower_id == u.id ) - |> where([relationships: r], r.state == "accept") + |> where([relationships: r], r.state == ^:follow_accept) end defp compose_query({:friends, %User{id: id}}, query) do @@ -158,7 +163,7 @@ defp compose_query({:friends, %User{id: id}}, query) do as: :relationships, on: r.following_id == u.id and r.follower_id == ^id ) - |> where([relationships: r], r.state == "accept") + |> where([relationships: r], r.state == ^:follow_accept) end defp compose_query({:recipients_from_activity, to}, query) do @@ -173,7 +178,7 @@ defp compose_query({:recipients_from_activity, to}, query) do ) |> where( [u, following: f, relationships: r], - u.ap_id in ^to or (f.follower_address in ^to and r.state == "accept") + u.ap_id in ^to or (f.follower_address in ^to and r.state == ^:follow_accept) ) |> distinct(true) end @@ -192,10 +197,6 @@ defp compose_query({:limit, limit}, query) do defp compose_query(_unsupported_param, query), do: query - defp prepare_tag_criteria(tag, query) do - or_where(query, [u], fragment("? = any(?)", ^tag, u.tags)) - end - defp location_query(query, local) do where(query, [u], u.local == ^local) |> where([u], not is_nil(u.nickname)) diff --git a/lib/pleroma/user/welcome_message.ex b/lib/pleroma/user/welcome_message.ex index f0ac8ebae..f8f520285 100644 --- a/lib/pleroma/user/welcome_message.ex +++ b/lib/pleroma/user/welcome_message.ex @@ -10,8 +10,8 @@ def post_welcome_message_to_user(user) do with %User{} = sender_user <- welcome_user(), message when is_binary(message) <- welcome_message() do CommonAPI.post(sender_user, %{ - "visibility" => "direct", - "status" => "@#{user.nickname}\n#{message}" + visibility: "direct", + status: "@#{user.nickname}\n#{message}" }) else _ -> {:ok, nil} diff --git a/lib/pleroma/user_relationship.ex b/lib/pleroma/user_relationship.ex index 393947942..235ad427c 100644 --- a/lib/pleroma/user_relationship.ex +++ b/lib/pleroma/user_relationship.ex @@ -8,6 +8,8 @@ defmodule Pleroma.UserRelationship do import Ecto.Changeset import Ecto.Query + alias Ecto.Changeset + alias Pleroma.FollowingRelationship alias Pleroma.Repo alias Pleroma.User alias Pleroma.UserRelationship @@ -15,25 +17,32 @@ defmodule Pleroma.UserRelationship do schema "user_relationships" do belongs_to(:source, User, type: FlakeId.Ecto.CompatType) belongs_to(:target, User, type: FlakeId.Ecto.CompatType) - field(:relationship_type, UserRelationshipTypeEnum) + field(:relationship_type, Pleroma.UserRelationship.Type) timestamps(updated_at: false) end - for relationship_type <- Keyword.keys(UserRelationshipTypeEnum.__enum_map__()) do - # Definitions of `create_block/2`, `create_mute/2` etc. + for relationship_type <- Keyword.keys(Pleroma.UserRelationship.Type.__enum_map__()) do + # `def create_block/2`, `def create_mute/2`, `def create_reblog_mute/2`, + # `def create_notification_mute/2`, `def create_inverse_subscription/2` def unquote(:"create_#{relationship_type}")(source, target), do: create(unquote(relationship_type), source, target) - # Definitions of `delete_block/2`, `delete_mute/2` etc. + # `def delete_block/2`, `def delete_mute/2`, `def delete_reblog_mute/2`, + # `def delete_notification_mute/2`, `def delete_inverse_subscription/2` def unquote(:"delete_#{relationship_type}")(source, target), do: delete(unquote(relationship_type), source, target) - # Definitions of `block_exists?/2`, `mute_exists?/2` etc. + # `def block_exists?/2`, `def mute_exists?/2`, `def reblog_mute_exists?/2`, + # `def notification_mute_exists?/2`, `def inverse_subscription_exists?/2` def unquote(:"#{relationship_type}_exists?")(source, target), do: exists?(unquote(relationship_type), source, target) end + def user_relationship_types, do: Keyword.keys(user_relationship_mappings()) + + def user_relationship_mappings, do: Pleroma.UserRelationship.Type.__enum_map__() + def changeset(%UserRelationship{} = user_relationship, params \\ %{}) do user_relationship |> cast(params, [:relationship_type, :source_id, :target_id]) @@ -72,16 +81,91 @@ def delete(relationship_type, %User{} = source, %User{} = target) do end end - defp validate_not_self_relationship(%Ecto.Changeset{} = changeset) do - changeset - |> validate_change(:target_id, fn _, target_id -> - if target_id == get_field(changeset, :source_id) do - [target_id: "can't be equal to source_id"] + def dictionary( + source_users, + target_users, + source_to_target_rel_types \\ nil, + target_to_source_rel_types \\ nil + ) + when is_list(source_users) and is_list(target_users) do + source_user_ids = User.binary_id(source_users) + target_user_ids = User.binary_id(target_users) + + get_rel_type_codes = fn rel_type -> user_relationship_mappings()[rel_type] end + + source_to_target_rel_types = + Enum.map(source_to_target_rel_types || user_relationship_types(), &get_rel_type_codes.(&1)) + + target_to_source_rel_types = + Enum.map(target_to_source_rel_types || user_relationship_types(), &get_rel_type_codes.(&1)) + + __MODULE__ + |> where( + fragment( + "(source_id = ANY(?) AND target_id = ANY(?) AND relationship_type = ANY(?)) OR \ + (source_id = ANY(?) AND target_id = ANY(?) AND relationship_type = ANY(?))", + ^source_user_ids, + ^target_user_ids, + ^source_to_target_rel_types, + ^target_user_ids, + ^source_user_ids, + ^target_to_source_rel_types + ) + ) + |> select([ur], [ur.relationship_type, ur.source_id, ur.target_id]) + |> Repo.all() + end + + def exists?(dictionary, rel_type, source, target, func) do + cond do + is_nil(source) or is_nil(target) -> + false + + dictionary -> + [rel_type, source.id, target.id] in dictionary + + true -> + func.(source, target) + end + end + + @doc ":relationships option for StatusView / AccountView / NotificationView" + def view_relationships_option(reading_user, actors, opts \\ []) + + def view_relationships_option(nil = _reading_user, _actors, _opts) do + %{user_relationships: [], following_relationships: []} + end + + def view_relationships_option(%User{} = reading_user, actors, opts) do + {source_to_target_rel_types, target_to_source_rel_types} = + if opts[:source_mutes_only] do + # This option is used for rendering statuses (FE needs `muted` flag for each one anyways) + {[:mute], []} else - [] + {[:block, :mute, :notification_mute, :reblog_mute], [:block, :inverse_subscription]} end - end) - |> validate_change(:source_id, fn _, source_id -> + + user_relationships = + UserRelationship.dictionary( + [reading_user], + actors, + source_to_target_rel_types, + target_to_source_rel_types + ) + + following_relationships = FollowingRelationship.all_between_user_sets([reading_user], actors) + + %{user_relationships: user_relationships, following_relationships: following_relationships} + end + + defp validate_not_self_relationship(%Changeset{} = changeset) do + changeset + |> validate_source_id_target_id_inequality() + |> validate_target_id_source_id_inequality() + end + + defp validate_source_id_target_id_inequality(%Changeset{} = changeset) do + validate_change(changeset, :source_id, fn _, source_id -> if source_id == get_field(changeset, :target_id) do [source_id: "can't be equal to target_id"] else @@ -89,4 +173,14 @@ defp validate_not_self_relationship(%Ecto.Changeset{} = changeset) do end end) end + + defp validate_target_id_source_id_inequality(%Changeset{} = changeset) do + validate_change(changeset, :target_id, fn _, target_id -> + if target_id == get_field(changeset, :source_id) do + [target_id: "can't be equal to source_id"] + else + [] + end + end) + end end diff --git a/lib/pleroma/web/activity_pub/activity_pub.ex b/lib/pleroma/web/activity_pub/activity_pub.ex index 30e282840..d752f4f04 100644 --- a/lib/pleroma/web/activity_pub/activity_pub.ex +++ b/lib/pleroma/web/activity_pub/activity_pub.ex @@ -118,13 +118,29 @@ def decrease_replies_count_if_reply(_object), do: :noop def increase_poll_votes_if_vote(%{ "object" => %{"inReplyTo" => reply_ap_id, "name" => name}, - "type" => "Create" + "type" => "Create", + "actor" => actor }) do - Object.increase_vote_count(reply_ap_id, name) + Object.increase_vote_count(reply_ap_id, name, actor) end def increase_poll_votes_if_vote(_create_data), do: :noop + @spec persist(map(), keyword()) :: {:ok, Activity.t() | Object.t()} + def persist(object, meta) do + with local <- Keyword.fetch!(meta, :local), + {recipients, _, _} <- get_recipients(object), + {:ok, activity} <- + Repo.insert(%Activity{ + data: object, + local: local, + recipients: recipients, + actor: object["actor"] + }) do + {:ok, activity, meta} + end + end + @spec insert(map(), boolean(), boolean(), boolean()) :: {:ok, Activity.t()} | {:error, any()} def insert(map, local \\ true, fake \\ false, bypass_actor_check \\ false) when is_map(map) do with nil <- Activity.normalize(map), @@ -154,12 +170,6 @@ def insert(map, local \\ true, fake \\ false, bypass_actor_check \\ false) when BackgroundWorker.enqueue("fetch_data_for_activity", %{"activity_id" => activity.id}) - Notification.create_notifications(activity) - - conversation = create_or_bump_conversation(activity, map["actor"]) - participations = get_participations(conversation) - stream_out(activity) - stream_out_participations(participations) {:ok, activity} else %Activity{} = activity -> @@ -182,6 +192,15 @@ def insert(map, local \\ true, fake \\ false, bypass_actor_check \\ false) when end end + def notify_and_stream(activity) do + Notification.create_notifications(activity) + + conversation = create_or_bump_conversation(activity, activity.actor) + participations = get_participations(conversation) + stream_out(activity) + stream_out_participations(participations) + end + defp create_or_bump_conversation(activity, actor) do with {:ok, conversation} <- Conversation.create_or_bump_for(activity), %User{} = user <- User.get_cached_by_ap_id(actor), @@ -258,6 +277,7 @@ defp do_create(%{to: to, actor: actor, context: context, object: object} = param _ <- increase_poll_votes_if_vote(create_data), {:quick_insert, false, activity} <- {:quick_insert, quick_insert?, activity}, {:ok, _actor} <- increase_note_count_if_public(actor, activity), + _ <- notify_and_stream(activity), :ok <- maybe_federate(activity) do {:ok, activity} else @@ -285,6 +305,7 @@ def listen(%{to: to, actor: actor, context: context, object: object} = params) d additional ), {:ok, activity} <- insert(listen_data, local), + _ <- notify_and_stream(activity), :ok <- maybe_federate(activity) do {:ok, activity} end @@ -309,6 +330,7 @@ def accept_or_reject(type, %{to: to, actor: actor, object: object} = params) do %{"to" => to, "type" => type, "actor" => actor.ap_id, "object" => object} |> Utils.maybe_put("id", activity_id), {:ok, activity} <- insert(data, local), + _ <- notify_and_stream(activity), :ok <- maybe_federate(activity) do {:ok, activity} end @@ -328,113 +350,12 @@ def update(%{to: to, cc: cc, actor: actor, object: object} = params) do }, data <- Utils.maybe_put(data, "id", activity_id), {:ok, activity} <- insert(data, local), + _ <- notify_and_stream(activity), :ok <- maybe_federate(activity) do {:ok, activity} end end - @spec react_with_emoji(User.t(), Object.t(), String.t(), keyword()) :: - {:ok, Activity.t(), Object.t()} | {:error, any()} - def react_with_emoji(user, object, emoji, options \\ []) do - with {:ok, result} <- - Repo.transaction(fn -> do_react_with_emoji(user, object, emoji, options) end) do - result - end - end - - defp do_react_with_emoji(user, object, emoji, options) do - with local <- Keyword.get(options, :local, true), - activity_id <- Keyword.get(options, :activity_id, nil), - true <- Pleroma.Emoji.is_unicode_emoji?(emoji), - reaction_data <- make_emoji_reaction_data(user, object, emoji, activity_id), - {:ok, activity} <- insert(reaction_data, local), - {:ok, object} <- add_emoji_reaction_to_object(activity, object), - :ok <- maybe_federate(activity) do - {:ok, activity, object} - else - false -> {:error, false} - {:error, error} -> Repo.rollback(error) - end - end - - @spec unreact_with_emoji(User.t(), String.t(), keyword()) :: - {:ok, Activity.t(), Object.t()} | {:error, any()} - def unreact_with_emoji(user, reaction_id, options \\ []) do - with {:ok, result} <- - Repo.transaction(fn -> do_unreact_with_emoji(user, reaction_id, options) end) do - result - end - end - - defp do_unreact_with_emoji(user, reaction_id, options) do - with local <- Keyword.get(options, :local, true), - activity_id <- Keyword.get(options, :activity_id, nil), - user_ap_id <- user.ap_id, - %Activity{actor: ^user_ap_id} = reaction_activity <- Activity.get_by_ap_id(reaction_id), - object <- Object.normalize(reaction_activity), - unreact_data <- make_undo_data(user, reaction_activity, activity_id), - {:ok, activity} <- insert(unreact_data, local), - {:ok, object} <- remove_emoji_reaction_from_object(reaction_activity, object), - :ok <- maybe_federate(activity) do - {:ok, activity, object} - else - {:error, error} -> Repo.rollback(error) - end - end - - # TODO: This is weird, maybe we shouldn't check here if we can make the activity. - @spec like(User.t(), Object.t(), String.t() | nil, boolean()) :: - {:ok, Activity.t(), Object.t()} | {:error, any()} - def like(user, object, activity_id \\ nil, local \\ true) do - with {:ok, result} <- Repo.transaction(fn -> do_like(user, object, activity_id, local) end) do - result - end - end - - defp do_like( - %User{ap_id: ap_id} = user, - %Object{data: %{"id" => _}} = object, - activity_id, - local - ) do - with nil <- get_existing_like(ap_id, object), - like_data <- make_like_data(user, object, activity_id), - {:ok, activity} <- insert(like_data, local), - {:ok, object} <- add_like_to_object(activity, object), - :ok <- maybe_federate(activity) do - {:ok, activity, object} - else - %Activity{} = activity -> - {:ok, activity, object} - - {:error, error} -> - Repo.rollback(error) - end - end - - @spec unlike(User.t(), Object.t(), String.t() | nil, boolean()) :: - {:ok, Activity.t(), Activity.t(), Object.t()} | {:ok, Object.t()} | {:error, any()} - def unlike(%User{} = actor, %Object{} = object, activity_id \\ nil, local \\ true) do - with {:ok, result} <- - Repo.transaction(fn -> do_unlike(actor, object, activity_id, local) end) do - result - end - end - - defp do_unlike(actor, object, activity_id, local) do - with %Activity{} = like_activity <- get_existing_like(actor.ap_id, object), - unlike_data <- make_unlike_data(actor, like_activity, activity_id), - {:ok, unlike_activity} <- insert(unlike_data, local), - {:ok, _activity} <- Repo.delete(like_activity), - {:ok, object} <- remove_like_from_object(like_activity, object), - :ok <- maybe_federate(unlike_activity) do - {:ok, unlike_activity, like_activity, object} - else - nil -> {:ok, object} - {:error, error} -> Repo.rollback(error) - end - end - @spec announce(User.t(), Object.t(), String.t() | nil, boolean(), boolean()) :: {:ok, Activity.t(), Object.t()} | {:error, any()} def announce( @@ -452,9 +373,11 @@ def announce( defp do_announce(user, object, activity_id, local, public) do with true <- is_announceable?(object, user, public), + object <- Object.get_by_id(object.id), announce_data <- make_announce_data(user, object, activity_id, public), {:ok, activity} <- insert(announce_data, local), {:ok, object} <- add_announce_to_object(activity, object), + _ <- notify_and_stream(activity), :ok <- maybe_federate(activity) do {:ok, activity, object} else @@ -463,34 +386,6 @@ defp do_announce(user, object, activity_id, local, public) do end end - @spec unannounce(User.t(), Object.t(), String.t() | nil, boolean()) :: - {:ok, Activity.t(), Object.t()} | {:ok, Object.t()} | {:error, any()} - def unannounce( - %User{} = actor, - %Object{} = object, - activity_id \\ nil, - local \\ true - ) do - with {:ok, result} <- - Repo.transaction(fn -> do_unannounce(actor, object, activity_id, local) end) do - result - end - end - - defp do_unannounce(actor, object, activity_id, local) do - with %Activity{} = announce_activity <- get_existing_announce(actor.ap_id, object), - unannounce_data <- make_unannounce_data(actor, announce_activity, activity_id), - {:ok, unannounce_activity} <- insert(unannounce_data, local), - :ok <- maybe_federate(unannounce_activity), - {:ok, _activity} <- Repo.delete(announce_activity), - {:ok, object} <- remove_announce_from_object(announce_activity, object) do - {:ok, unannounce_activity, object} - else - nil -> {:ok, object} - {:error, error} -> Repo.rollback(error) - end - end - @spec follow(User.t(), User.t(), String.t() | nil, boolean()) :: {:ok, Activity.t()} | {:error, any()} def follow(follower, followed, activity_id \\ nil, local \\ true) do @@ -503,6 +398,7 @@ def follow(follower, followed, activity_id \\ nil, local \\ true) do defp do_follow(follower, followed, activity_id, local) do with data <- make_follow_data(follower, followed, activity_id), {:ok, activity} <- insert(data, local), + _ <- notify_and_stream(activity), :ok <- maybe_federate(activity) do {:ok, activity} else @@ -524,6 +420,7 @@ defp do_unfollow(follower, followed, activity_id, local) do {:ok, follow_activity} <- update_follow_state(follow_activity, "cancelled"), unfollow_data <- make_unfollow_data(follower, followed, follow_activity, activity_id), {:ok, activity} <- insert(unfollow_data, local), + _ <- notify_and_stream(activity), :ok <- maybe_federate(activity) do {:ok, activity} else @@ -532,57 +429,6 @@ defp do_unfollow(follower, followed, activity_id, local) do end end - @spec delete(User.t() | Object.t(), keyword()) :: {:ok, User.t() | Object.t()} | {:error, any()} - def delete(entity, options \\ []) do - with {:ok, result} <- Repo.transaction(fn -> do_delete(entity, options) end) do - result - end - end - - defp do_delete(%User{ap_id: ap_id, follower_address: follower_address} = user, _) do - with data <- %{ - "to" => [follower_address], - "type" => "Delete", - "actor" => ap_id, - "object" => %{"type" => "Person", "id" => ap_id} - }, - {:ok, activity} <- insert(data, true, true, true), - :ok <- maybe_federate(activity) do - {:ok, user} - end - end - - defp do_delete(%Object{data: %{"id" => id, "actor" => actor}} = object, options) do - local = Keyword.get(options, :local, true) - activity_id = Keyword.get(options, :activity_id, nil) - actor = Keyword.get(options, :actor, actor) - - user = User.get_cached_by_ap_id(actor) - to = (object.data["to"] || []) ++ (object.data["cc"] || []) - - with create_activity <- Activity.get_create_by_object_ap_id(id), - data <- - %{ - "type" => "Delete", - "actor" => actor, - "object" => id, - "to" => to, - "deleted_activity_id" => create_activity && create_activity.id - } - |> maybe_put("id", activity_id), - {:ok, activity} <- insert(data, local, false), - {:ok, object, _create_activity} <- Object.delete(object), - stream_out_participations(object, user), - _ <- decrease_replies_count_if_reply(object), - {:ok, _actor} <- decrease_note_count_if_public(user, object), - :ok <- maybe_federate(activity) do - {:ok, activity} - else - {:error, error} -> - Repo.rollback(error) - end - end - @spec block(User.t(), User.t(), String.t() | nil, boolean()) :: {:ok, Activity.t()} | {:error, any()} def block(blocker, blocked, activity_id \\ nil, local \\ true) do @@ -593,7 +439,6 @@ def block(blocker, blocked, activity_id \\ nil, local \\ true) do end defp do_block(blocker, blocked, activity_id, local) do - outgoing_blocks = Config.get([:activitypub, :outgoing_blocks]) unfollow_blocked = Config.get([:activitypub, :unfollow_blocked]) if unfollow_blocked do @@ -601,9 +446,9 @@ defp do_block(blocker, blocked, activity_id, local) do if follow_activity, do: unfollow(blocker, blocked, nil, local) end - with true <- outgoing_blocks, - block_data <- make_block_data(blocker, blocked, activity_id), + with block_data <- make_block_data(blocker, blocked, activity_id), {:ok, activity} <- insert(block_data, local), + _ <- notify_and_stream(activity), :ok <- maybe_federate(activity) do {:ok, activity} else @@ -611,27 +456,6 @@ defp do_block(blocker, blocked, activity_id, local) do end end - @spec unblock(User.t(), User.t(), String.t() | nil, boolean()) :: - {:ok, Activity.t()} | {:error, any()} | nil - def unblock(blocker, blocked, activity_id \\ nil, local \\ true) do - with {:ok, result} <- - Repo.transaction(fn -> do_unblock(blocker, blocked, activity_id, local) end) do - result - end - end - - defp do_unblock(blocker, blocked, activity_id, local) do - with %Activity{} = block_activity <- fetch_latest_block(blocker, blocked), - unblock_data <- make_unblock_data(blocker, blocked, block_activity, activity_id), - {:ok, activity} <- insert(unblock_data, local), - :ok <- maybe_federate(activity) do - {:ok, activity} - else - nil -> nil - {:error, error} -> Repo.rollback(error) - end - end - @spec flag(map()) :: {:ok, Activity.t()} | {:error, any()} def flag( %{ @@ -658,6 +482,7 @@ def flag( with flag_data <- make_flag_data(params, additional), {:ok, activity} <- insert(flag_data, local), {:ok, stripped_activity} <- strip_report_status_data(activity), + _ <- notify_and_stream(activity), :ok <- maybe_federate(stripped_activity) do User.all_superusers() |> Enum.filter(fn user -> not is_nil(user.email) end) @@ -681,7 +506,8 @@ def move(%User{} = origin, %User{} = target, local \\ true) do } with true <- origin.ap_id in target.also_known_as, - {:ok, activity} <- insert(params, local) do + {:ok, activity} <- insert(params, local), + _ <- notify_and_stream(activity) do maybe_federate(activity) BackgroundWorker.enqueue("move_following", %{ @@ -696,7 +522,7 @@ def move(%User{} = origin, %User{} = target, local \\ true) do end end - defp fetch_activities_for_context_query(context, opts) do + def fetch_activities_for_context_query(context, opts) do public = [Constants.as_public()] recipients = @@ -828,7 +654,7 @@ defp exclude_visibility(query, %{"exclude_visibilities" => visibility}) end defp exclude_visibility(query, %{"exclude_visibilities" => visibility}) - when visibility not in @valid_visibilities do + when visibility not in [nil | @valid_visibilities] do Logger.error("Could not exclude visibility to #{visibility}") query end @@ -1035,7 +861,7 @@ defp restrict_media(_query, %{"only_media" => _val, "skip_preload" => true}) do raise "Can't use the child object without preloading!" end - defp restrict_media(query, %{"only_media" => val}) when val == "true" or val == "1" do + defp restrict_media(query, %{"only_media" => val}) when val in [true, "true", "1"] do from( [_activity, object] in query, where: fragment("not (?)->'attachment' = (?)", object.data, ^[]) @@ -1044,16 +870,51 @@ defp restrict_media(query, %{"only_media" => val}) when val == "true" or val == defp restrict_media(query, _), do: query - defp restrict_replies(query, %{"exclude_replies" => val}) when val == "true" or val == "1" do + defp restrict_replies(query, %{"exclude_replies" => val}) when val in [true, "true", "1"] do from( [_activity, object] in query, where: fragment("?->>'inReplyTo' is null", object.data) ) end + defp restrict_replies(query, %{ + "reply_filtering_user" => user, + "reply_visibility" => "self" + }) do + from( + [activity, object] in query, + where: + fragment( + "?->>'inReplyTo' is null OR ? = ANY(?)", + object.data, + ^user.ap_id, + activity.recipients + ) + ) + end + + defp restrict_replies(query, %{ + "reply_filtering_user" => user, + "reply_visibility" => "following" + }) do + from( + [activity, object] in query, + where: + fragment( + "?->>'inReplyTo' is null OR ? && array_remove(?, ?) OR ? = ?", + object.data, + ^[user.ap_id | User.get_cached_user_friends_ap_ids(user)], + activity.recipients, + activity.actor, + activity.actor, + ^user.ap_id + ) + ) + end + defp restrict_replies(query, _), do: query - defp restrict_reblogs(query, %{"exclude_reblogs" => val}) when val == "true" or val == "1" do + defp restrict_reblogs(query, %{"exclude_reblogs" => val}) when val in [true, "true", "1"] do from(activity in query, where: fragment("?->>'type' != 'Announce'", activity.data)) end @@ -1132,7 +993,12 @@ defp restrict_unlisted(query) do ) end - defp restrict_pinned(query, %{"pinned" => "true", "pinned_activity_ids" => ids}) do + # TODO: when all endpoints migrated to OpenAPI compare `pinned` with `true` (boolean) only, + # the same for `restrict_media/2`, `restrict_replies/2`, 'restrict_reblogs/2' + # and `restrict_muted/2` + + defp restrict_pinned(query, %{"pinned" => pinned, "pinned_activity_ids" => ids}) + when pinned in [true, "true", "1"] do from(activity in query, where: activity.id in ^ids) end @@ -1229,17 +1095,17 @@ defp maybe_order(query, _), do: query defp fetch_activities_query_ap_ids_ops(opts) do source_user = opts["muting_user"] - ap_id_relations = if source_user, do: [:mute, :reblog_mute], else: [] + ap_id_relationships = if source_user, do: [:mute, :reblog_mute], else: [] - ap_id_relations = - ap_id_relations ++ + ap_id_relationships = + ap_id_relationships ++ if opts["blocking_user"] && opts["blocking_user"] == source_user do [:block] else [] end - preloaded_ap_ids = User.outgoing_relations_ap_ids(source_user, ap_id_relations) + preloaded_ap_ids = User.outgoing_relationships_ap_ids(source_user, ap_id_relationships) restrict_blocked_opts = Map.merge(%{"blocked_users_ap_ids" => preloaded_ap_ids[:block]}, opts) restrict_muted_opts = Map.merge(%{"muted_users_ap_ids" => preloaded_ap_ids[:mute]}, opts) @@ -1265,6 +1131,7 @@ def fetch_activities_query(recipients, opts \\ %{}) do |> maybe_set_thread_muted_field(opts) |> maybe_order(opts) |> restrict_recipients(recipients, opts["user"]) + |> restrict_replies(opts) |> restrict_tag(opts) |> restrict_tag_reject(opts) |> restrict_tag_all(opts) @@ -1279,7 +1146,6 @@ def fetch_activities_query(recipients, opts \\ %{}) do |> restrict_media(opts) |> restrict_visibility(opts) |> restrict_thread_visibility(opts, config) - |> restrict_replies(opts) |> restrict_reblogs(opts) |> restrict_pinned(opts) |> restrict_muted_reblogs(restrict_muted_reblogs_opts) @@ -1369,6 +1235,18 @@ def upload(file, opts \\ []) do end end + @spec get_actor_url(any()) :: binary() | nil + defp get_actor_url(url) when is_binary(url), do: url + defp get_actor_url(%{"href" => href}) when is_binary(href), do: href + + defp get_actor_url(url) when is_list(url) do + url + |> List.first() + |> get_actor_url() + end + + defp get_actor_url(_url), do: nil + defp object_to_user_data(data) do avatar = data["icon"]["url"] && @@ -1390,18 +1268,44 @@ defp object_to_user_data(data) do |> Enum.filter(fn %{"type" => t} -> t == "PropertyValue" end) |> Enum.map(fn fields -> Map.take(fields, ["name", "value"]) end) + emojis = + data + |> Map.get("tag", []) + |> Enum.filter(fn + %{"type" => "Emoji"} -> true + _ -> false + end) + |> Enum.reduce(%{}, fn %{"icon" => %{"url" => url}, "name" => name}, acc -> + Map.put(acc, String.trim(name, ":"), url) + end) + locked = data["manuallyApprovesFollowers"] || false data = Transmogrifier.maybe_fix_user_object(data) discoverable = data["discoverable"] || false invisible = data["invisible"] || false actor_type = data["type"] || "Person" + public_key = + if is_map(data["publicKey"]) && is_binary(data["publicKey"]["publicKeyPem"]) do + data["publicKey"]["publicKeyPem"] + else + nil + end + + shared_inbox = + if is_map(data["endpoints"]) && is_binary(data["endpoints"]["sharedInbox"]) do + data["endpoints"]["sharedInbox"] + else + nil + end + user_data = %{ ap_id: data["id"], + uri: get_actor_url(data["url"]), ap_enabled: true, - source_data: data, banner: banner, fields: fields, + emoji: emojis, locked: locked, discoverable: discoverable, invisible: invisible, @@ -1411,7 +1315,10 @@ defp object_to_user_data(data) do following_address: data["following"], bio: data["summary"], actor_type: actor_type, - also_known_as: Map.get(data, "alsoKnownAs", []) + also_known_as: Map.get(data, "alsoKnownAs", []), + public_key: public_key, + inbox: data["inbox"], + shared_inbox: shared_inbox } # nickname can be nil because of virtual actors @@ -1452,21 +1359,34 @@ def fetch_follow_information_for_user(user) do defp normalize_counter(counter) when is_integer(counter), do: counter defp normalize_counter(_), do: 0 - defp maybe_update_follow_information(data) do + def maybe_update_follow_information(user_data) do with {:enabled, true} <- {:enabled, Config.get([:instance, :external_user_synchronization])}, - {:ok, info} <- fetch_follow_information_for_user(data) do - info = Map.merge(data[:info] || %{}, info) - Map.put(data, :info, info) + {_, true} <- {:user_type_check, user_data[:type] in ["Person", "Service"]}, + {_, true} <- + {:collections_available, + !!(user_data[:following_address] && user_data[:follower_address])}, + {:ok, info} <- + fetch_follow_information_for_user(user_data) do + info = Map.merge(user_data[:info] || %{}, info) + + user_data + |> Map.put(:info, info) else + {:user_type_check, false} -> + user_data + + {:collections_available, false} -> + user_data + {:enabled, false} -> - data + user_data e -> Logger.error( - "Follower/Following counter update for #{data.ap_id} failed.\n" <> inspect(e) + "Follower/Following counter update for #{user_data.ap_id} failed.\n" <> inspect(e) ) - data + user_data end end @@ -1513,11 +1433,22 @@ def fetch_and_prepare_user_from_ap_id(ap_id) do end def make_user_from_ap_id(ap_id) do - if _user = User.get_cached_by_ap_id(ap_id) do + user = User.get_cached_by_ap_id(ap_id) + + if user && !User.ap_enabled?(user) do Transmogrifier.upgrade_user_from_ap_id(ap_id) else with {:ok, data} <- fetch_and_prepare_user_from_ap_id(ap_id) do - User.insert_or_update_user(data) + if user do + user + |> User.remote_user_changeset(data) + |> User.update_and_set_cache() + else + data + |> User.remote_user_changeset() + |> Repo.insert() + |> User.set_cache() + end else e -> {:error, e} end diff --git a/lib/pleroma/web/activity_pub/activity_pub_controller.ex b/lib/pleroma/web/activity_pub/activity_pub_controller.ex index 8b9eb4a2c..62ad15d85 100644 --- a/lib/pleroma/web/activity_pub/activity_pub_controller.ex +++ b/lib/pleroma/web/activity_pub/activity_pub_controller.ex @@ -12,8 +12,10 @@ defmodule Pleroma.Web.ActivityPub.ActivityPubController do alias Pleroma.Plugs.EnsureAuthenticatedPlug alias Pleroma.User alias Pleroma.Web.ActivityPub.ActivityPub + alias Pleroma.Web.ActivityPub.Builder alias Pleroma.Web.ActivityPub.InternalFetchActor alias Pleroma.Web.ActivityPub.ObjectView + alias Pleroma.Web.ActivityPub.Pipeline alias Pleroma.Web.ActivityPub.Relay alias Pleroma.Web.ActivityPub.Transmogrifier alias Pleroma.Web.ActivityPub.UserView @@ -32,12 +34,13 @@ defmodule Pleroma.Web.ActivityPub.ActivityPubController do plug( EnsureAuthenticatedPlug, - [unless_func: &FederatingPlug.federating?/0] when action not in @federating_only_actions + [unless_func: &FederatingPlug.federating?/1] when action not in @federating_only_actions ) + # Note: :following and :followers must be served even without authentication (as via :api) plug( EnsureAuthenticatedPlug - when action in [:read_inbox, :update_outbox, :whoami, :upload_media, :following, :followers] + when action in [:read_inbox, :update_outbox, :whoami, :upload_media] ) plug( @@ -393,7 +396,10 @@ def read_inbox(%{assigns: %{user: %User{nickname: as_nickname}}} = conn, %{ |> json(err) end - defp handle_user_activity(%User{} = user, %{"type" => "Create"} = params) do + defp handle_user_activity( + %User{} = user, + %{"type" => "Create", "object" => %{"type" => "Note"}} = params + ) do object = params["object"] |> Map.merge(Map.take(params, ["to", "cc"])) @@ -412,7 +418,8 @@ defp handle_user_activity(%User{} = user, %{"type" => "Create"} = params) do defp handle_user_activity(%User{} = user, %{"type" => "Delete"} = params) do with %Object{} = object <- Object.normalize(params["object"]), true <- user.is_moderator || user.ap_id == object.data["actor"], - {:ok, delete} <- ActivityPub.delete(object) do + {:ok, delete_data, _} <- Builder.delete(user, object.data["id"]), + {:ok, delete, _} <- Pipeline.common_pipeline(delete_data, local: true) do {:ok, delete} else _ -> {:error, dgettext("errors", "Can't delete object")} @@ -421,7 +428,10 @@ defp handle_user_activity(%User{} = user, %{"type" => "Delete"} = params) do defp handle_user_activity(%User{} = user, %{"type" => "Like"} = params) do with %Object{} = object <- Object.normalize(params["object"]), - {:ok, activity, _object} <- ActivityPub.like(user, object) do + {_, {:ok, like_object, meta}} <- {:build_object, Builder.like(user, object)}, + {_, {:ok, %Activity{} = activity, _meta}} <- + {:common_pipeline, + Pipeline.common_pipeline(like_object, Keyword.put(meta, :local, true))} do {:ok, activity} else _ -> {:error, dgettext("errors", "Can't like object")} diff --git a/lib/pleroma/web/activity_pub/builder.ex b/lib/pleroma/web/activity_pub/builder.ex new file mode 100644 index 000000000..4a247ad0c --- /dev/null +++ b/lib/pleroma/web/activity_pub/builder.ex @@ -0,0 +1,115 @@ +defmodule Pleroma.Web.ActivityPub.Builder do + @moduledoc """ + This module builds the objects. Meant to be used for creating local objects. + + This module encodes our addressing policies and general shape of our objects. + """ + + alias Pleroma.Object + alias Pleroma.User + alias Pleroma.Web.ActivityPub.Utils + alias Pleroma.Web.ActivityPub.Visibility + + @spec emoji_react(User.t(), Object.t(), String.t()) :: {:ok, map(), keyword()} + def emoji_react(actor, object, emoji) do + with {:ok, data, meta} <- object_action(actor, object) do + data = + data + |> Map.put("content", emoji) + |> Map.put("type", "EmojiReact") + + {:ok, data, meta} + end + end + + @spec undo(User.t(), Activity.t()) :: {:ok, map(), keyword()} + def undo(actor, object) do + {:ok, + %{ + "id" => Utils.generate_activity_id(), + "actor" => actor.ap_id, + "type" => "Undo", + "object" => object.data["id"], + "to" => object.data["to"] || [], + "cc" => object.data["cc"] || [] + }, []} + end + + @spec delete(User.t(), String.t()) :: {:ok, map(), keyword()} + def delete(actor, object_id) do + object = Object.normalize(object_id, false) + + user = !object && User.get_cached_by_ap_id(object_id) + + to = + case {object, user} do + {%Object{}, _} -> + # We are deleting an object, address everyone who was originally mentioned + (object.data["to"] || []) ++ (object.data["cc"] || []) + + {_, %User{follower_address: follower_address}} -> + # We are deleting a user, address the followers of that user + [follower_address] + end + + {:ok, + %{ + "id" => Utils.generate_activity_id(), + "actor" => actor.ap_id, + "object" => object_id, + "to" => to, + "type" => "Delete" + }, []} + end + + @spec tombstone(String.t(), String.t()) :: {:ok, map(), keyword()} + def tombstone(actor, id) do + {:ok, + %{ + "id" => id, + "actor" => actor, + "type" => "Tombstone" + }, []} + end + + @spec like(User.t(), Object.t()) :: {:ok, map(), keyword()} + def like(actor, object) do + with {:ok, data, meta} <- object_action(actor, object) do + data = + data + |> Map.put("type", "Like") + + {:ok, data, meta} + end + end + + @spec object_action(User.t(), Object.t()) :: {:ok, map(), keyword()} + defp object_action(actor, object) do + object_actor = User.get_cached_by_ap_id(object.data["actor"]) + + # Address the actor of the object, and our actor's follower collection if the post is public. + to = + if Visibility.is_public?(object) do + [actor.follower_address, object.data["actor"]] + else + [object.data["actor"]] + end + + # CC everyone who's been addressed in the object, except ourself and the object actor's + # follower collection + cc = + (object.data["to"] ++ (object.data["cc"] || [])) + |> List.delete(actor.ap_id) + |> List.delete(object_actor.follower_address) + + {:ok, + %{ + "id" => Utils.generate_activity_id(), + "actor" => actor.ap_id, + "object" => object.data["id"], + "to" => to, + "cc" => cc, + "context" => object.data["context"] + }, []} + end +end diff --git a/lib/pleroma/web/activity_pub/mrf/anti_followbot_policy.ex b/lib/pleroma/web/activity_pub/mrf/anti_followbot_policy.ex index b3547ecd4..0270b96ae 100644 --- a/lib/pleroma/web/activity_pub/mrf/anti_followbot_policy.ex +++ b/lib/pleroma/web/activity_pub/mrf/anti_followbot_policy.ex @@ -1,5 +1,5 @@ # Pleroma: A lightweight social networking server -# Copyright © 2019 Pleroma Authors +# Copyright © 2017-2020 Pleroma Authors # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.Web.ActivityPub.MRF.AntiFollowbotPolicy do diff --git a/lib/pleroma/web/activity_pub/mrf/media_proxy_warming_policy.ex b/lib/pleroma/web/activity_pub/mrf/media_proxy_warming_policy.ex index d9a0acfd3..dfab105a3 100644 --- a/lib/pleroma/web/activity_pub/mrf/media_proxy_warming_policy.ex +++ b/lib/pleroma/web/activity_pub/mrf/media_proxy_warming_policy.ex @@ -12,17 +12,23 @@ defmodule Pleroma.Web.ActivityPub.MRF.MediaProxyWarmingPolicy do require Logger - @hackney_options [ - pool: :media, - recv_timeout: 10_000 + @options [ + pool: :media ] def perform(:prefetch, url) do Logger.debug("Prefetching #{inspect(url)}") + opts = + if Application.get_env(:tesla, :adapter) == Tesla.Adapter.Hackney do + Keyword.put(@options, :recv_timeout, 10_000) + else + @options + end + url |> MediaProxy.url() - |> HTTP.get([], adapter: @hackney_options) + |> HTTP.get([], adapter: opts) end def perform(:preload, %{"object" => %{"attachment" => attachments}} = _message) do diff --git a/lib/pleroma/web/activity_pub/mrf/no_placeholder_text_policy.ex b/lib/pleroma/web/activity_pub/mrf/no_placeholder_text_policy.ex index f67f48ab6..fc3475048 100644 --- a/lib/pleroma/web/activity_pub/mrf/no_placeholder_text_policy.ex +++ b/lib/pleroma/web/activity_pub/mrf/no_placeholder_text_policy.ex @@ -1,5 +1,5 @@ # Pleroma: A lightweight social networking server -# Copyright © 2019 Pleroma Authors +# Copyright © 2017-2020 Pleroma Authors # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.Web.ActivityPub.MRF.NoPlaceholderTextPolicy do diff --git a/lib/pleroma/web/activity_pub/mrf/object_age_policy.ex b/lib/pleroma/web/activity_pub/mrf/object_age_policy.ex index 4a8bc91ae..b0ccb63c8 100644 --- a/lib/pleroma/web/activity_pub/mrf/object_age_policy.ex +++ b/lib/pleroma/web/activity_pub/mrf/object_age_policy.ex @@ -11,7 +11,7 @@ defmodule Pleroma.Web.ActivityPub.MRF.ObjectAgePolicy do @moduledoc "Filter activities depending on their age" @behaviour Pleroma.Web.ActivityPub.MRF - defp check_date(%{"published" => published} = message) do + defp check_date(%{"object" => %{"published" => published}} = message) do with %DateTime{} = now <- DateTime.utc_now(), {:ok, %DateTime{} = then, _} <- DateTime.from_iso8601(published), max_ttl <- Config.get([:mrf_object_age, :threshold]), @@ -96,5 +96,11 @@ def filter(%{"type" => "Create", "published" => _} = message) do def filter(message), do: {:ok, message} @impl true - def describe, do: {:ok, %{}} + def describe do + mrf_object_age = + Pleroma.Config.get(:mrf_object_age) + |> Enum.into(%{}) + + {:ok, %{mrf_object_age: mrf_object_age}} + end end diff --git a/lib/pleroma/web/activity_pub/mrf/simple_policy.ex b/lib/pleroma/web/activity_pub/mrf/simple_policy.ex index 4edc007fd..b7dcb1b86 100644 --- a/lib/pleroma/web/activity_pub/mrf/simple_policy.ex +++ b/lib/pleroma/web/activity_pub/mrf/simple_policy.ex @@ -148,6 +148,21 @@ defp check_banner_removal(%{host: actor_host} = _actor_info, %{"image" => _image defp check_banner_removal(_actor_info, object), do: {:ok, object} + @impl true + def filter(%{"type" => "Delete", "actor" => actor} = object) do + %{host: actor_host} = URI.parse(actor) + + reject_deletes = + Pleroma.Config.get([:mrf_simple, :reject_deletes]) + |> MRF.subdomains_regex() + + if MRF.subdomain_match?(reject_deletes, actor_host) do + {:reject, nil} + else + {:ok, object} + end + end + @impl true def filter(%{"actor" => actor} = object) do actor_info = URI.parse(actor) diff --git a/lib/pleroma/web/activity_pub/object_validator.ex b/lib/pleroma/web/activity_pub/object_validator.ex new file mode 100644 index 000000000..549e5e761 --- /dev/null +++ b/lib/pleroma/web/activity_pub/object_validator.ex @@ -0,0 +1,83 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.ObjectValidator do + @moduledoc """ + This module is responsible for validating an object (which can be an activity) + and checking if it is both well formed and also compatible with our view of + the system. + """ + + alias Pleroma.Object + alias Pleroma.User + alias Pleroma.Web.ActivityPub.ObjectValidators.DeleteValidator + alias Pleroma.Web.ActivityPub.ObjectValidators.EmojiReactValidator + alias Pleroma.Web.ActivityPub.ObjectValidators.LikeValidator + alias Pleroma.Web.ActivityPub.ObjectValidators.Types + alias Pleroma.Web.ActivityPub.ObjectValidators.UndoValidator + + @spec validate(map(), keyword()) :: {:ok, map(), keyword()} | {:error, any()} + def validate(object, meta) + + def validate(%{"type" => "Undo"} = object, meta) do + with {:ok, object} <- + object + |> UndoValidator.cast_and_validate() + |> Ecto.Changeset.apply_action(:insert) do + object = stringify_keys(object) + {:ok, object, meta} + end + end + + def validate(%{"type" => "Delete"} = object, meta) do + with cng <- DeleteValidator.cast_and_validate(object), + do_not_federate <- DeleteValidator.do_not_federate?(cng), + {:ok, object} <- Ecto.Changeset.apply_action(cng, :insert) do + object = stringify_keys(object) + meta = Keyword.put(meta, :do_not_federate, do_not_federate) + {:ok, object, meta} + end + end + + def validate(%{"type" => "Like"} = object, meta) do + with {:ok, object} <- + object |> LikeValidator.cast_and_validate() |> Ecto.Changeset.apply_action(:insert) do + object = stringify_keys(object |> Map.from_struct()) + {:ok, object, meta} + end + end + + def validate(%{"type" => "EmojiReact"} = object, meta) do + with {:ok, object} <- + object + |> EmojiReactValidator.cast_and_validate() + |> Ecto.Changeset.apply_action(:insert) do + object = stringify_keys(object |> Map.from_struct()) + {:ok, object, meta} + end + end + + def stringify_keys(%{__struct__: _} = object) do + object + |> Map.from_struct() + |> stringify_keys + end + + def stringify_keys(object) do + object + |> Map.new(fn {key, val} -> {to_string(key), val} end) + end + + def fetch_actor(object) do + with {:ok, actor} <- Types.ObjectID.cast(object["actor"]) do + User.get_or_fetch_by_ap_id(actor) + end + end + + def fetch_actor_and_object(object) do + fetch_actor(object) + Object.normalize(object["object"]) + :ok + end +end diff --git a/lib/pleroma/web/activity_pub/object_validators/common_validations.ex b/lib/pleroma/web/activity_pub/object_validators/common_validations.ex new file mode 100644 index 000000000..aeef31945 --- /dev/null +++ b/lib/pleroma/web/activity_pub/object_validators/common_validations.ex @@ -0,0 +1,80 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.ObjectValidators.CommonValidations do + import Ecto.Changeset + + alias Pleroma.Activity + alias Pleroma.Object + alias Pleroma.User + + def validate_recipients_presence(cng, fields \\ [:to, :cc]) do + non_empty = + fields + |> Enum.map(fn field -> get_field(cng, field) end) + |> Enum.any?(fn + [] -> false + _ -> true + end) + + if non_empty do + cng + else + fields + |> Enum.reduce(cng, fn field, cng -> + cng + |> add_error(field, "no recipients in any field") + end) + end + end + + def validate_actor_presence(cng, options \\ []) do + field_name = Keyword.get(options, :field_name, :actor) + + cng + |> validate_change(field_name, fn field_name, actor -> + if User.get_cached_by_ap_id(actor) do + [] + else + [{field_name, "can't find user"}] + end + end) + end + + def validate_object_presence(cng, options \\ []) do + field_name = Keyword.get(options, :field_name, :object) + allowed_types = Keyword.get(options, :allowed_types, false) + + cng + |> validate_change(field_name, fn field_name, object_id -> + object = Object.get_cached_by_ap_id(object_id) || Activity.get_by_ap_id(object_id) + + cond do + !object -> + [{field_name, "can't find object"}] + + object && allowed_types && object.data["type"] not in allowed_types -> + [{field_name, "object not in allowed types"}] + + true -> + [] + end + end) + end + + def validate_object_or_user_presence(cng, options \\ []) do + field_name = Keyword.get(options, :field_name, :object) + options = Keyword.put(options, :field_name, field_name) + + actor_cng = + cng + |> validate_actor_presence(options) + + object_cng = + cng + |> validate_object_presence(options) + + if actor_cng.valid?, do: actor_cng, else: object_cng + end +end diff --git a/lib/pleroma/web/activity_pub/object_validators/create_validator.ex b/lib/pleroma/web/activity_pub/object_validators/create_validator.ex new file mode 100644 index 000000000..926804ce7 --- /dev/null +++ b/lib/pleroma/web/activity_pub/object_validators/create_validator.ex @@ -0,0 +1,30 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.ObjectValidators.CreateNoteValidator do + use Ecto.Schema + + alias Pleroma.Web.ActivityPub.ObjectValidators.NoteValidator + alias Pleroma.Web.ActivityPub.ObjectValidators.Types + + import Ecto.Changeset + + @primary_key false + + embedded_schema do + field(:id, Types.ObjectID, primary_key: true) + field(:actor, Types.ObjectID) + field(:type, :string) + field(:to, {:array, :string}) + field(:cc, {:array, :string}) + field(:bto, {:array, :string}, default: []) + field(:bcc, {:array, :string}, default: []) + + embeds_one(:object, NoteValidator) + end + + def cast_data(data) do + cast(%__MODULE__{}, data, __schema__(:fields)) + end +end diff --git a/lib/pleroma/web/activity_pub/object_validators/delete_validator.ex b/lib/pleroma/web/activity_pub/object_validators/delete_validator.ex new file mode 100644 index 000000000..f42c03510 --- /dev/null +++ b/lib/pleroma/web/activity_pub/object_validators/delete_validator.ex @@ -0,0 +1,100 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.ObjectValidators.DeleteValidator do + use Ecto.Schema + + alias Pleroma.Activity + alias Pleroma.User + alias Pleroma.Web.ActivityPub.ObjectValidators.Types + + import Ecto.Changeset + import Pleroma.Web.ActivityPub.ObjectValidators.CommonValidations + + @primary_key false + + embedded_schema do + field(:id, Types.ObjectID, primary_key: true) + field(:type, :string) + field(:actor, Types.ObjectID) + field(:to, Types.Recipients, default: []) + field(:cc, Types.Recipients, default: []) + field(:deleted_activity_id, Types.ObjectID) + field(:object, Types.ObjectID) + end + + def cast_data(data) do + %__MODULE__{} + |> cast(data, __schema__(:fields)) + end + + def add_deleted_activity_id(cng) do + object = + cng + |> get_field(:object) + + with %Activity{id: id} <- Activity.get_create_by_object_ap_id(object) do + cng + |> put_change(:deleted_activity_id, id) + else + _ -> cng + end + end + + @deletable_types ~w{ + Answer + Article + Audio + Event + Note + Page + Question + Video + Tombstone + } + def validate_data(cng) do + cng + |> validate_required([:id, :type, :actor, :to, :cc, :object]) + |> validate_inclusion(:type, ["Delete"]) + |> validate_actor_presence() + |> validate_deletion_rights() + |> validate_object_or_user_presence(allowed_types: @deletable_types) + |> add_deleted_activity_id() + end + + def do_not_federate?(cng) do + !same_domain?(cng) + end + + defp same_domain?(cng) do + actor_uri = + cng + |> get_field(:actor) + |> URI.parse() + + object_uri = + cng + |> get_field(:object) + |> URI.parse() + + object_uri.host == actor_uri.host + end + + def validate_deletion_rights(cng) do + actor = User.get_cached_by_ap_id(get_field(cng, :actor)) + + if User.superuser?(actor) || same_domain?(cng) do + cng + else + cng + |> add_error(:actor, "is not allowed to delete object") + end + end + + def cast_and_validate(data) do + data + |> cast_data + |> validate_data + end +end diff --git a/lib/pleroma/web/activity_pub/object_validators/emoji_react_validator.ex b/lib/pleroma/web/activity_pub/object_validators/emoji_react_validator.ex new file mode 100644 index 000000000..e87519c59 --- /dev/null +++ b/lib/pleroma/web/activity_pub/object_validators/emoji_react_validator.ex @@ -0,0 +1,81 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.ObjectValidators.EmojiReactValidator do + use Ecto.Schema + + alias Pleroma.Object + alias Pleroma.Web.ActivityPub.ObjectValidators.Types + + import Ecto.Changeset + import Pleroma.Web.ActivityPub.ObjectValidators.CommonValidations + + @primary_key false + + embedded_schema do + field(:id, Types.ObjectID, primary_key: true) + field(:type, :string) + field(:object, Types.ObjectID) + field(:actor, Types.ObjectID) + field(:context, :string) + field(:content, :string) + field(:to, {:array, :string}, default: []) + field(:cc, {:array, :string}, default: []) + end + + def cast_and_validate(data) do + data + |> cast_data() + |> validate_data() + end + + def cast_data(data) do + %__MODULE__{} + |> changeset(data) + end + + def changeset(struct, data) do + struct + |> cast(data, __schema__(:fields)) + |> fix_after_cast() + end + + def fix_after_cast(cng) do + cng + |> fix_context() + end + + def fix_context(cng) do + object = get_field(cng, :object) + + with nil <- get_field(cng, :context), + %Object{data: %{"context" => context}} <- Object.get_cached_by_ap_id(object) do + cng + |> put_change(:context, context) + else + _ -> + cng + end + end + + def validate_emoji(cng) do + content = get_field(cng, :content) + + if Pleroma.Emoji.is_unicode_emoji?(content) do + cng + else + cng + |> add_error(:content, "must be a single character emoji") + end + end + + def validate_data(data_cng) do + data_cng + |> validate_inclusion(:type, ["EmojiReact"]) + |> validate_required([:id, :type, :object, :actor, :context, :to, :cc, :content]) + |> validate_actor_presence() + |> validate_object_presence() + |> validate_emoji() + end +end diff --git a/lib/pleroma/web/activity_pub/object_validators/like_validator.ex b/lib/pleroma/web/activity_pub/object_validators/like_validator.ex new file mode 100644 index 000000000..034f25492 --- /dev/null +++ b/lib/pleroma/web/activity_pub/object_validators/like_validator.ex @@ -0,0 +1,99 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.ObjectValidators.LikeValidator do + use Ecto.Schema + + alias Pleroma.Object + alias Pleroma.Web.ActivityPub.ObjectValidators.Types + alias Pleroma.Web.ActivityPub.Utils + + import Ecto.Changeset + import Pleroma.Web.ActivityPub.ObjectValidators.CommonValidations + + @primary_key false + + embedded_schema do + field(:id, Types.ObjectID, primary_key: true) + field(:type, :string) + field(:object, Types.ObjectID) + field(:actor, Types.ObjectID) + field(:context, :string) + field(:to, Types.Recipients, default: []) + field(:cc, Types.Recipients, default: []) + end + + def cast_and_validate(data) do + data + |> cast_data() + |> validate_data() + end + + def cast_data(data) do + %__MODULE__{} + |> changeset(data) + end + + def changeset(struct, data) do + struct + |> cast(data, __schema__(:fields)) + |> fix_after_cast() + end + + def fix_after_cast(cng) do + cng + |> fix_recipients() + |> fix_context() + end + + def fix_context(cng) do + object = get_field(cng, :object) + + with nil <- get_field(cng, :context), + %Object{data: %{"context" => context}} <- Object.get_cached_by_ap_id(object) do + cng + |> put_change(:context, context) + else + _ -> + cng + end + end + + def fix_recipients(cng) do + to = get_field(cng, :to) + cc = get_field(cng, :cc) + object = get_field(cng, :object) + + with {[], []} <- {to, cc}, + %Object{data: %{"actor" => actor}} <- Object.get_cached_by_ap_id(object), + {:ok, actor} <- Types.ObjectID.cast(actor) do + cng + |> put_change(:to, [actor]) + else + _ -> + cng + end + end + + def validate_data(data_cng) do + data_cng + |> validate_inclusion(:type, ["Like"]) + |> validate_required([:id, :type, :object, :actor, :context, :to, :cc]) + |> validate_actor_presence() + |> validate_object_presence() + |> validate_existing_like() + end + + def validate_existing_like(%{changes: %{actor: actor, object: object}} = cng) do + if Utils.get_existing_like(actor, %{data: %{"id" => object}}) do + cng + |> add_error(:actor, "already liked this object") + |> add_error(:object, "already liked by this actor") + else + cng + end + end + + def validate_existing_like(cng), do: cng +end diff --git a/lib/pleroma/web/activity_pub/object_validators/note_validator.ex b/lib/pleroma/web/activity_pub/object_validators/note_validator.ex new file mode 100644 index 000000000..462a5620a --- /dev/null +++ b/lib/pleroma/web/activity_pub/object_validators/note_validator.ex @@ -0,0 +1,64 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.ObjectValidators.NoteValidator do + use Ecto.Schema + + alias Pleroma.Web.ActivityPub.ObjectValidators.Types + + import Ecto.Changeset + + @primary_key false + + embedded_schema do + field(:id, Types.ObjectID, primary_key: true) + field(:to, {:array, :string}, default: []) + field(:cc, {:array, :string}, default: []) + field(:bto, {:array, :string}, default: []) + field(:bcc, {:array, :string}, default: []) + # TODO: Write type + field(:tag, {:array, :map}, default: []) + field(:type, :string) + field(:content, :string) + field(:context, :string) + field(:actor, Types.ObjectID) + field(:attributedTo, Types.ObjectID) + field(:summary, :string) + field(:published, Types.DateTime) + # TODO: Write type + field(:emoji, :map, default: %{}) + field(:sensitive, :boolean, default: false) + # TODO: Write type + field(:attachment, {:array, :map}, default: []) + field(:replies_count, :integer, default: 0) + field(:like_count, :integer, default: 0) + field(:announcement_count, :integer, default: 0) + field(:inRepyTo, :string) + field(:uri, Types.Uri) + + field(:likes, {:array, :string}, default: []) + field(:announcements, {:array, :string}, default: []) + + # see if needed + field(:conversation, :string) + field(:context_id, :string) + end + + def cast_and_validate(data) do + data + |> cast_data() + |> validate_data() + end + + def cast_data(data) do + %__MODULE__{} + |> cast(data, __schema__(:fields)) + end + + def validate_data(data_cng) do + data_cng + |> validate_inclusion(:type, ["Note"]) + |> validate_required([:id, :actor, :to, :cc, :type, :content, :context]) + end +end diff --git a/lib/pleroma/web/activity_pub/object_validators/types/date_time.ex b/lib/pleroma/web/activity_pub/object_validators/types/date_time.ex new file mode 100644 index 000000000..4f412fcde --- /dev/null +++ b/lib/pleroma/web/activity_pub/object_validators/types/date_time.ex @@ -0,0 +1,34 @@ +defmodule Pleroma.Web.ActivityPub.ObjectValidators.Types.DateTime do + @moduledoc """ + The AP standard defines the date fields in AP as xsd:DateTime. Elixir's + DateTime can't parse this, but it can parse the related iso8601. This + module punches the date until it looks like iso8601 and normalizes to + it. + + DateTimes without a timezone offset are treated as UTC. + + Reference: https://www.w3.org/TR/activitystreams-vocabulary/#dfn-published + """ + use Ecto.Type + + def type, do: :string + + def cast(datetime) when is_binary(datetime) do + with {:ok, datetime, _} <- DateTime.from_iso8601(datetime) do + {:ok, DateTime.to_iso8601(datetime)} + else + {:error, :missing_offset} -> cast("#{datetime}Z") + _e -> :error + end + end + + def cast(_), do: :error + + def dump(data) do + {:ok, data} + end + + def load(data) do + {:ok, data} + end +end diff --git a/lib/pleroma/web/activity_pub/object_validators/types/object_id.ex b/lib/pleroma/web/activity_pub/object_validators/types/object_id.ex new file mode 100644 index 000000000..f71f76370 --- /dev/null +++ b/lib/pleroma/web/activity_pub/object_validators/types/object_id.ex @@ -0,0 +1,23 @@ +defmodule Pleroma.Web.ActivityPub.ObjectValidators.Types.ObjectID do + use Ecto.Type + + def type, do: :string + + def cast(object) when is_binary(object) do + # Host has to be present and scheme has to be an http scheme (for now) + case URI.parse(object) do + %URI{host: nil} -> :error + %URI{host: ""} -> :error + %URI{scheme: scheme} when scheme in ["https", "http"] -> {:ok, object} + _ -> :error + end + end + + def cast(%{"id" => object}), do: cast(object) + + def cast(_), do: :error + + def dump(data), do: {:ok, data} + + def load(data), do: {:ok, data} +end diff --git a/lib/pleroma/web/activity_pub/object_validators/types/recipients.ex b/lib/pleroma/web/activity_pub/object_validators/types/recipients.ex new file mode 100644 index 000000000..48fe61e1a --- /dev/null +++ b/lib/pleroma/web/activity_pub/object_validators/types/recipients.ex @@ -0,0 +1,34 @@ +defmodule Pleroma.Web.ActivityPub.ObjectValidators.Types.Recipients do + use Ecto.Type + + alias Pleroma.Web.ActivityPub.ObjectValidators.Types.ObjectID + + def type, do: {:array, ObjectID} + + def cast(object) when is_binary(object) do + cast([object]) + end + + def cast(data) when is_list(data) do + data + |> Enum.reduce({:ok, []}, fn element, acc -> + case {acc, ObjectID.cast(element)} do + {:error, _} -> :error + {_, :error} -> :error + {{:ok, list}, {:ok, id}} -> {:ok, [id | list]} + end + end) + end + + def cast(_) do + :error + end + + def dump(data) do + {:ok, data} + end + + def load(data) do + {:ok, data} + end +end diff --git a/lib/pleroma/web/activity_pub/object_validators/types/uri.ex b/lib/pleroma/web/activity_pub/object_validators/types/uri.ex new file mode 100644 index 000000000..24845bcc0 --- /dev/null +++ b/lib/pleroma/web/activity_pub/object_validators/types/uri.ex @@ -0,0 +1,20 @@ +defmodule Pleroma.Web.ActivityPub.ObjectValidators.Types.Uri do + use Ecto.Type + + def type, do: :string + + def cast(uri) when is_binary(uri) do + case URI.parse(uri) do + %URI{host: nil} -> :error + %URI{host: ""} -> :error + %URI{scheme: scheme} when scheme in ["https", "http"] -> {:ok, uri} + _ -> :error + end + end + + def cast(_), do: :error + + def dump(data), do: {:ok, data} + + def load(data), do: {:ok, data} +end diff --git a/lib/pleroma/web/activity_pub/object_validators/undo_validator.ex b/lib/pleroma/web/activity_pub/object_validators/undo_validator.ex new file mode 100644 index 000000000..d0ba418e8 --- /dev/null +++ b/lib/pleroma/web/activity_pub/object_validators/undo_validator.ex @@ -0,0 +1,62 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.ObjectValidators.UndoValidator do + use Ecto.Schema + + alias Pleroma.Activity + alias Pleroma.Web.ActivityPub.ObjectValidators.Types + + import Ecto.Changeset + import Pleroma.Web.ActivityPub.ObjectValidators.CommonValidations + + @primary_key false + + embedded_schema do + field(:id, Types.ObjectID, primary_key: true) + field(:type, :string) + field(:object, Types.ObjectID) + field(:actor, Types.ObjectID) + field(:to, {:array, :string}, default: []) + field(:cc, {:array, :string}, default: []) + end + + def cast_and_validate(data) do + data + |> cast_data() + |> validate_data() + end + + def cast_data(data) do + %__MODULE__{} + |> changeset(data) + end + + def changeset(struct, data) do + struct + |> cast(data, __schema__(:fields)) + end + + def validate_data(data_cng) do + data_cng + |> validate_inclusion(:type, ["Undo"]) + |> validate_required([:id, :type, :object, :actor, :to, :cc]) + |> validate_actor_presence() + |> validate_object_presence() + |> validate_undo_rights() + end + + def validate_undo_rights(cng) do + actor = get_field(cng, :actor) + object = get_field(cng, :object) + + with %Activity{data: %{"actor" => object_actor}} <- Activity.get_by_ap_id(object), + true <- object_actor != actor do + cng + |> add_error(:actor, "not the same as object actor") + else + _ -> cng + end + end +end diff --git a/lib/pleroma/web/activity_pub/pipeline.ex b/lib/pleroma/web/activity_pub/pipeline.ex new file mode 100644 index 000000000..657cdfdb1 --- /dev/null +++ b/lib/pleroma/web/activity_pub/pipeline.ex @@ -0,0 +1,59 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.Pipeline do + alias Pleroma.Activity + alias Pleroma.Object + alias Pleroma.Repo + alias Pleroma.Web.ActivityPub.ActivityPub + alias Pleroma.Web.ActivityPub.MRF + alias Pleroma.Web.ActivityPub.ObjectValidator + alias Pleroma.Web.ActivityPub.SideEffects + alias Pleroma.Web.Federator + + @spec common_pipeline(map(), keyword()) :: + {:ok, Activity.t() | Object.t(), keyword()} | {:error, any()} + def common_pipeline(object, meta) do + case Repo.transaction(fn -> do_common_pipeline(object, meta) end) do + {:ok, value} -> + value + + {:error, e} -> + {:error, e} + end + end + + def do_common_pipeline(object, meta) do + with {_, {:ok, validated_object, meta}} <- + {:validate_object, ObjectValidator.validate(object, meta)}, + {_, {:ok, mrfd_object}} <- {:mrf_object, MRF.filter(validated_object)}, + {_, {:ok, activity, meta}} <- + {:persist_object, ActivityPub.persist(mrfd_object, meta)}, + {_, {:ok, activity, meta}} <- + {:execute_side_effects, SideEffects.handle(activity, meta)}, + {_, {:ok, _}} <- {:federation, maybe_federate(activity, meta)} do + {:ok, activity, meta} + else + {:mrf_object, {:reject, _}} -> {:ok, nil, meta} + e -> {:error, e} + end + end + + defp maybe_federate(%Object{}, _), do: {:ok, :not_federated} + + defp maybe_federate(%Activity{} = activity, meta) do + with {:ok, local} <- Keyword.fetch(meta, :local) do + do_not_federate = meta[:do_not_federate] + + if !do_not_federate && local do + Federator.publish(activity) + {:ok, :federated} + else + {:ok, :not_federated} + end + else + _e -> {:error, :badarg} + end + end +end diff --git a/lib/pleroma/web/activity_pub/publisher.ex b/lib/pleroma/web/activity_pub/publisher.ex index 6c558e7f0..b70cbd043 100644 --- a/lib/pleroma/web/activity_pub/publisher.ex +++ b/lib/pleroma/web/activity_pub/publisher.ex @@ -141,8 +141,8 @@ defp get_cc_ap_ids(ap_id, recipients) do |> Enum.map(& &1.ap_id) end - defp maybe_use_sharedinbox(%User{source_data: data}), - do: (is_map(data["endpoints"]) && Map.get(data["endpoints"], "sharedInbox")) || data["inbox"] + defp maybe_use_sharedinbox(%User{shared_inbox: nil, inbox: inbox}), do: inbox + defp maybe_use_sharedinbox(%User{shared_inbox: shared_inbox}), do: shared_inbox @doc """ Determine a user inbox to use based on heuristics. These heuristics @@ -157,7 +157,7 @@ defp maybe_use_sharedinbox(%User{source_data: data}), """ def determine_inbox( %Activity{data: activity_data}, - %User{source_data: data} = user + %User{inbox: inbox} = user ) do to = activity_data["to"] || [] cc = activity_data["cc"] || [] @@ -174,7 +174,7 @@ def determine_inbox( maybe_use_sharedinbox(user) true -> - data["inbox"] + inbox end end @@ -192,14 +192,13 @@ def publish(%User{} = actor, %{data: %{"bcc" => bcc}} = activity) inboxes = recipients |> Enum.filter(&User.ap_enabled?/1) - |> Enum.map(fn %{source_data: data} -> data["inbox"] end) + |> Enum.map(fn actor -> actor.inbox end) |> Enum.filter(fn inbox -> should_federate?(inbox, public) end) |> Instances.filter_reachable() Repo.checkout(fn -> Enum.each(inboxes, fn {inbox, unreachable_since} -> - %User{ap_id: ap_id} = - Enum.find(recipients, fn %{source_data: data} -> data["inbox"] == inbox end) + %User{ap_id: ap_id} = Enum.find(recipients, fn actor -> actor.inbox == inbox end) # Get all the recipients on the same host and add them to cc. Otherwise, a remote # instance would only accept a first message for the first recipient and ignore the rest. diff --git a/lib/pleroma/web/activity_pub/side_effects.ex b/lib/pleroma/web/activity_pub/side_effects.ex new file mode 100644 index 000000000..bfc2ab845 --- /dev/null +++ b/lib/pleroma/web/activity_pub/side_effects.ex @@ -0,0 +1,133 @@ +defmodule Pleroma.Web.ActivityPub.SideEffects do + @moduledoc """ + This module looks at an inserted object and executes the side effects that it + implies. For example, a `Like` activity will increase the like count on the + liked object, a `Follow` activity will add the user to the follower + collection, and so on. + """ + alias Pleroma.Activity + alias Pleroma.Notification + alias Pleroma.Object + alias Pleroma.Repo + alias Pleroma.User + alias Pleroma.Web.ActivityPub.ActivityPub + alias Pleroma.Web.ActivityPub.Utils + + def handle(object, meta \\ []) + + # Tasks this handles: + # - Add like to object + # - Set up notification + def handle(%{data: %{"type" => "Like"}} = object, meta) do + liked_object = Object.get_by_ap_id(object.data["object"]) + Utils.add_like_to_object(object, liked_object) + + Notification.create_notifications(object) + + {:ok, object, meta} + end + + def handle(%{data: %{"type" => "Undo", "object" => undone_object}} = object, meta) do + with undone_object <- Activity.get_by_ap_id(undone_object), + :ok <- handle_undoing(undone_object) do + {:ok, object, meta} + end + end + + # Tasks this handles: + # - Add reaction to object + # - Set up notification + def handle(%{data: %{"type" => "EmojiReact"}} = object, meta) do + reacted_object = Object.get_by_ap_id(object.data["object"]) + Utils.add_emoji_reaction_to_object(object, reacted_object) + + Notification.create_notifications(object) + + {:ok, object, meta} + end + + # Tasks this handles: + # - Delete and unpins the create activity + # - Replace object with Tombstone + # - Set up notification + # - Reduce the user note count + # - Reduce the reply count + # - Stream out the activity + def handle(%{data: %{"type" => "Delete", "object" => deleted_object}} = object, meta) do + deleted_object = + Object.normalize(deleted_object, false) || User.get_cached_by_ap_id(deleted_object) + + result = + case deleted_object do + %Object{} -> + with {:ok, deleted_object, activity} <- Object.delete(deleted_object), + %User{} = user <- User.get_cached_by_ap_id(deleted_object.data["actor"]) do + User.remove_pinnned_activity(user, activity) + + {:ok, user} = ActivityPub.decrease_note_count_if_public(user, deleted_object) + + if in_reply_to = deleted_object.data["inReplyTo"] do + Object.decrease_replies_count(in_reply_to) + end + + ActivityPub.stream_out(object) + ActivityPub.stream_out_participations(deleted_object, user) + :ok + end + + %User{} -> + with {:ok, _} <- User.delete(deleted_object) do + :ok + end + end + + if result == :ok do + Notification.create_notifications(object) + {:ok, object, meta} + else + {:error, result} + end + end + + # Nothing to do + def handle(object, meta) do + {:ok, object, meta} + end + + def handle_undoing(%{data: %{"type" => "Like"}} = object) do + with %Object{} = liked_object <- Object.get_by_ap_id(object.data["object"]), + {:ok, _} <- Utils.remove_like_from_object(object, liked_object), + {:ok, _} <- Repo.delete(object) do + :ok + end + end + + def handle_undoing(%{data: %{"type" => "EmojiReact"}} = object) do + with %Object{} = reacted_object <- Object.get_by_ap_id(object.data["object"]), + {:ok, _} <- Utils.remove_emoji_reaction_from_object(object, reacted_object), + {:ok, _} <- Repo.delete(object) do + :ok + end + end + + def handle_undoing(%{data: %{"type" => "Announce"}} = object) do + with %Object{} = liked_object <- Object.get_by_ap_id(object.data["object"]), + {:ok, _} <- Utils.remove_announce_from_object(object, liked_object), + {:ok, _} <- Repo.delete(object) do + :ok + end + end + + def handle_undoing( + %{data: %{"type" => "Block", "actor" => blocker, "object" => blocked}} = object + ) do + with %User{} = blocker <- User.get_cached_by_ap_id(blocker), + %User{} = blocked <- User.get_cached_by_ap_id(blocked), + {:ok, _} <- User.unblock(blocker, blocked), + {:ok, _} <- Repo.delete(object) do + :ok + end + end + + def handle_undoing(object), do: {:error, ["don't know how to handle", object]} +end diff --git a/lib/pleroma/web/activity_pub/transmogrifier.ex b/lib/pleroma/web/activity_pub/transmogrifier.ex index 9cd3de705..80701bb63 100644 --- a/lib/pleroma/web/activity_pub/transmogrifier.ex +++ b/lib/pleroma/web/activity_pub/transmogrifier.ex @@ -7,12 +7,17 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do A module to handle coding from internal to wire ActivityPub and back. """ alias Pleroma.Activity + alias Pleroma.EarmarkRenderer alias Pleroma.FollowingRelationship alias Pleroma.Object alias Pleroma.Object.Containment alias Pleroma.Repo alias Pleroma.User alias Pleroma.Web.ActivityPub.ActivityPub + alias Pleroma.Web.ActivityPub.Builder + alias Pleroma.Web.ActivityPub.ObjectValidator + alias Pleroma.Web.ActivityPub.ObjectValidators.Types + alias Pleroma.Web.ActivityPub.Pipeline alias Pleroma.Web.ActivityPub.Utils alias Pleroma.Web.ActivityPub.Visibility alias Pleroma.Web.Federator @@ -40,6 +45,7 @@ def fix_object(object, options \\ []) do |> fix_addressing |> fix_summary |> fix_type(options) + |> fix_content end def fix_summary(%{"summary" => nil} = object) do @@ -202,16 +208,46 @@ def fix_context(object) do |> Map.put("conversation", context) end + defp add_if_present(map, _key, nil), do: map + + defp add_if_present(map, key, value) do + Map.put(map, key, value) + end + def fix_attachments(%{"attachment" => attachment} = object) when is_list(attachment) do attachments = Enum.map(attachment, fn data -> - media_type = data["mediaType"] || data["mimeType"] - href = data["url"] || data["href"] - url = [%{"type" => "Link", "mediaType" => media_type, "href" => href}] + url = + cond do + is_list(data["url"]) -> List.first(data["url"]) + is_map(data["url"]) -> data["url"] + true -> nil + end - data - |> Map.put("mediaType", media_type) - |> Map.put("url", url) + media_type = + cond do + is_map(url) && is_binary(url["mediaType"]) -> url["mediaType"] + is_binary(data["mediaType"]) -> data["mediaType"] + is_binary(data["mimeType"]) -> data["mimeType"] + true -> nil + end + + href = + cond do + is_map(url) && is_binary(url["href"]) -> url["href"] + is_binary(data["url"]) -> data["url"] + is_binary(data["href"]) -> data["href"] + end + + attachment_url = + %{"href" => href} + |> add_if_present("mediaType", media_type) + |> add_if_present("type", Map.get(url || %{}, "type")) + + %{"url" => [attachment_url]} + |> add_if_present("mediaType", media_type) + |> add_if_present("type", data["type"]) + |> add_if_present("name", data["name"]) end) Map.put(object, "attachment", attachments) @@ -229,7 +265,8 @@ def fix_url(%{"url" => url} = object) when is_map(url) do Map.put(object, "url", url["href"]) end - def fix_url(%{"type" => "Video", "url" => url} = object) when is_list(url) do + def fix_url(%{"type" => object_type, "url" => url} = object) + when object_type in ["Video", "Audio"] and is_list(url) do first_element = Enum.at(url, 0) link_element = Enum.find(url, fn x -> is_map(x) and x["mimeType"] == "text/html" end) @@ -323,6 +360,18 @@ def fix_type(%{"inReplyTo" => reply_id, "name" => _} = object, options) def fix_type(object, _), do: object + defp fix_content(%{"mediaType" => "text/markdown", "content" => content} = object) + when is_binary(content) do + html_content = + content + |> Earmark.as_html!(%Earmark.Options{renderer: EarmarkRenderer}) + |> Pleroma.HTML.filter_tags() + + Map.merge(object, %{"content" => html_content, "mediaType" => "text/html"}) + end + + defp fix_content(object), do: object + defp mastodon_follow_hack(%{"id" => id, "actor" => follower_id}, followed) do with true <- id =~ "follows", %User{local: true} = follower <- User.get_cached_by_ap_id(follower_id), @@ -398,7 +447,7 @@ def handle_incoming( %{"type" => "Create", "object" => %{"type" => objtype} = object} = data, options ) - when objtype in ["Article", "Event", "Note", "Video", "Page", "Question", "Answer"] do + when objtype in ["Article", "Event", "Note", "Video", "Page", "Question", "Answer", "Audio"] do actor = Containment.get_actor(data) data = @@ -490,7 +539,8 @@ def handle_incoming( {_, {:ok, follower}} <- {:follow, User.follow(follower, followed)}, {_, {:ok, _}} <- {:follow_state_update, Utils.update_follow_state_for_all(activity, "accept")}, - {:ok, _relationship} <- FollowingRelationship.update(follower, followed, "accept") do + {:ok, _relationship} <- + FollowingRelationship.update(follower, followed, :follow_accept) do ActivityPub.accept(%{ to: [follower.ap_id], actor: followed, @@ -500,7 +550,7 @@ def handle_incoming( else {:user_blocked, true} -> {:ok, _} = Utils.update_follow_state_for_all(activity, "reject") - {:ok, _relationship} = FollowingRelationship.update(follower, followed, "reject") + {:ok, _relationship} = FollowingRelationship.update(follower, followed, :follow_reject) ActivityPub.reject(%{ to: [follower.ap_id], @@ -511,7 +561,7 @@ def handle_incoming( {:follow, {:error, _}} -> {:ok, _} = Utils.update_follow_state_for_all(activity, "reject") - {:ok, _relationship} = FollowingRelationship.update(follower, followed, "reject") + {:ok, _relationship} = FollowingRelationship.update(follower, followed, :follow_reject) ActivityPub.reject(%{ to: [follower.ap_id], @@ -521,7 +571,7 @@ def handle_incoming( }) {:user_locked, true} -> - {:ok, _relationship} = FollowingRelationship.update(follower, followed, "pending") + {:ok, _relationship} = FollowingRelationship.update(follower, followed, :follow_pending) :noop end @@ -541,7 +591,10 @@ def handle_incoming( {:ok, follow_activity} <- get_follow_activity(follow_object, followed), {:ok, follow_activity} <- Utils.update_follow_state_for_all(follow_activity, "accept"), %User{local: true} = follower <- User.get_cached_by_ap_id(follow_activity.data["actor"]), - {:ok, _relationship} <- FollowingRelationship.update(follower, followed, "accept") do + {:ok, _relationship} <- FollowingRelationship.update(follower, followed, :follow_accept) do + User.update_follower_count(followed) + User.update_following_count(follower) + ActivityPub.accept(%{ to: follow_activity.data["to"], type: "Accept", @@ -551,7 +604,8 @@ def handle_incoming( activity_id: id }) else - _e -> :error + _e -> + :error end end @@ -564,7 +618,7 @@ def handle_incoming( {:ok, follow_activity} <- get_follow_activity(follow_object, followed), {:ok, follow_activity} <- Utils.update_follow_state_for_all(follow_activity, "reject"), %User{local: true} = follower <- User.get_cached_by_ap_id(follow_activity.data["actor"]), - {:ok, _relationship} <- FollowingRelationship.update(follower, followed, "reject"), + {:ok, _relationship} <- FollowingRelationship.update(follower, followed, :follow_reject), {:ok, activity} <- ActivityPub.reject(%{ to: follow_activity.data["to"], @@ -608,38 +662,13 @@ def handle_incoming( |> handle_incoming(options) end - def handle_incoming( - %{"type" => "Like", "object" => object_id, "actor" => _actor, "id" => id} = data, - _options - ) do - with actor <- Containment.get_actor(data), - {:ok, %User{} = actor} <- User.get_or_fetch_by_ap_id(actor), - {:ok, object} <- get_obj_helper(object_id), - {:ok, activity, _object} <- ActivityPub.like(actor, object, id, false) do + def handle_incoming(%{"type" => type} = data, _options) when type in ["Like", "EmojiReact"] do + with :ok <- ObjectValidator.fetch_actor_and_object(data), + {:ok, activity, _meta} <- + Pipeline.common_pipeline(data, local: false) do {:ok, activity} else - _e -> :error - end - end - - def handle_incoming( - %{ - "type" => "EmojiReact", - "object" => object_id, - "actor" => _actor, - "id" => id, - "content" => emoji - } = data, - _options - ) do - with actor <- Containment.get_actor(data), - {:ok, %User{} = actor} <- User.get_or_fetch_by_ap_id(actor), - {:ok, object} <- get_obj_helper(object_id), - {:ok, activity, _object} <- - ActivityPub.react_with_emoji(actor, object, emoji, activity_id: id, local: false) do - {:ok, activity} - else - _e -> :error + e -> {:error, e} end end @@ -673,7 +702,7 @@ def handle_incoming( {:ok, new_user_data} = ActivityPub.user_data_from_user_object(object) actor - |> User.upgrade_changeset(new_user_data, true) + |> User.remote_user_changeset(new_user_data) |> User.update_and_set_cache() ActivityPub.update(%{ @@ -691,55 +720,25 @@ def handle_incoming( end end - # TODO: We presently assume that any actor on the same origin domain as the object being - # deleted has the rights to delete that object. A better way to validate whether or not - # the object should be deleted is to refetch the object URI, which should return either - # an error or a tombstone. This would allow us to verify that a deletion actually took - # place. def handle_incoming( - %{"type" => "Delete", "object" => object_id, "actor" => actor, "id" => id} = data, + %{"type" => "Delete"} = data, _options ) do - object_id = Utils.get_ap_id(object_id) - - with actor <- Containment.get_actor(data), - {:ok, %User{} = actor} <- User.get_or_fetch_by_ap_id(actor), - {:ok, object} <- get_obj_helper(object_id), - :ok <- Containment.contain_origin(actor.ap_id, object.data), - {:ok, activity} <- - ActivityPub.delete(object, local: false, activity_id: id, actor: actor.ap_id) do + with {:ok, activity, _} <- Pipeline.common_pipeline(data, local: false) do {:ok, activity} else - nil -> - case User.get_cached_by_ap_id(object_id) do - %User{ap_id: ^actor} = user -> - User.delete(user) - - nil -> - :error + {:error, {:validate_object, _}} = e -> + # Check if we have a create activity for this + with {:ok, object_id} <- Types.ObjectID.cast(data["object"]), + %Activity{data: %{"actor" => actor}} <- + Activity.create_by_object_ap_id(object_id) |> Repo.one(), + # We have one, insert a tombstone and retry + {:ok, tombstone_data, _} <- Builder.tombstone(actor, object_id), + {:ok, _tombstone} <- Object.create(tombstone_data) do + handle_incoming(data) + else + _ -> e end - - _e -> - :error - end - end - - def handle_incoming( - %{ - "type" => "Undo", - "object" => %{"type" => "Announce", "object" => object_id}, - "actor" => _actor, - "id" => id - } = data, - _options - ) do - with actor <- Containment.get_actor(data), - {:ok, %User{} = actor} <- User.get_or_fetch_by_ap_id(actor), - {:ok, object} <- get_obj_helper(object_id), - {:ok, activity, _} <- ActivityPub.unannounce(actor, object, id, false) do - {:ok, activity} - else - _e -> :error end end @@ -765,75 +764,13 @@ def handle_incoming( def handle_incoming( %{ "type" => "Undo", - "object" => %{"type" => "EmojiReact", "id" => reaction_activity_id}, - "actor" => _actor, - "id" => id + "object" => %{"type" => type} } = data, _options - ) do - with actor <- Containment.get_actor(data), - {:ok, %User{} = actor} <- User.get_or_fetch_by_ap_id(actor), - {:ok, activity, _} <- - ActivityPub.unreact_with_emoji(actor, reaction_activity_id, - activity_id: id, - local: false - ) do + ) + when type in ["Like", "EmojiReact", "Announce", "Block"] do + with {:ok, activity, _} <- Pipeline.common_pipeline(data, local: false) do {:ok, activity} - else - _e -> :error - end - end - - def handle_incoming( - %{ - "type" => "Undo", - "object" => %{"type" => "Block", "object" => blocked}, - "actor" => blocker, - "id" => id - } = _data, - _options - ) do - with %User{local: true} = blocked <- User.get_cached_by_ap_id(blocked), - {:ok, %User{} = blocker} <- User.get_or_fetch_by_ap_id(blocker), - {:ok, activity} <- ActivityPub.unblock(blocker, blocked, id, false) do - User.unblock(blocker, blocked) - {:ok, activity} - else - _e -> :error - end - end - - def handle_incoming( - %{"type" => "Block", "object" => blocked, "actor" => blocker, "id" => id} = _data, - _options - ) do - with %User{local: true} = blocked = User.get_cached_by_ap_id(blocked), - {:ok, %User{} = blocker} = User.get_or_fetch_by_ap_id(blocker), - {:ok, activity} <- ActivityPub.block(blocker, blocked, id, false) do - User.unfollow(blocker, blocked) - User.block(blocker, blocked) - {:ok, activity} - else - _e -> :error - end - end - - def handle_incoming( - %{ - "type" => "Undo", - "object" => %{"type" => "Like", "object" => object_id}, - "actor" => _actor, - "id" => id - } = data, - _options - ) do - with actor <- Containment.get_actor(data), - {:ok, %User{} = actor} <- User.get_or_fetch_by_ap_id(actor), - {:ok, object} <- get_obj_helper(object_id), - {:ok, activity, _, _} <- ActivityPub.unlike(actor, object, id, false) do - {:ok, activity} - else - _e -> :error end end @@ -855,6 +792,21 @@ def handle_incoming( end end + def handle_incoming( + %{"type" => "Block", "object" => blocked, "actor" => blocker, "id" => id} = _data, + _options + ) do + with %User{local: true} = blocked = User.get_cached_by_ap_id(blocked), + {:ok, %User{} = blocker} = User.get_or_fetch_by_ap_id(blocker), + {:ok, activity} <- ActivityPub.block(blocker, blocked, id, false) do + User.unfollow(blocker, blocked) + User.block(blocker, blocked) + {:ok, activity} + else + _e -> :error + end + end + def handle_incoming( %{ "type" => "Move", @@ -1108,13 +1060,11 @@ def add_hashtags(object) do end def add_mention_tags(object) do - mentions = - object - |> Utils.get_notified_from_object() - |> Enum.map(&build_mention_tag/1) + {enabled_receivers, disabled_receivers} = Utils.get_notified_from_object(object) + potential_receivers = enabled_receivers ++ disabled_receivers + mentions = Enum.map(potential_receivers, &build_mention_tag/1) tags = object["tag"] || [] - Map.put(object, "tag", tags ++ mentions) end @@ -1124,7 +1074,7 @@ defp build_mention_tag(%{ap_id: ap_id, nickname: nickname} = _) do def take_emoji_tags(%User{emoji: emoji}) do emoji - |> Enum.flat_map(&Map.to_list/1) + |> Map.to_list() |> Enum.map(&build_emoji_tag/1) end @@ -1153,6 +1103,10 @@ def set_conversation(object) do Map.put(object, "conversation", object["context"]) end + def set_sensitive(%{"sensitive" => true} = object) do + object + end + def set_sensitive(object) do tags = object["tag"] || [] Map.put(object, "sensitive", "nsfw" in tags) @@ -1171,18 +1125,24 @@ def add_attributed_to(object) do def prepare_attachments(object) do attachments = - (object["attachment"] || []) + object + |> Map.get("attachment", []) |> Enum.map(fn data -> [%{"mediaType" => media_type, "href" => href} | _] = data["url"] - %{"url" => href, "mediaType" => media_type, "name" => data["name"], "type" => "Document"} + + %{ + "url" => href, + "mediaType" => media_type, + "name" => data["name"], + "type" => "Document" + } end) Map.put(object, "attachment", attachments) end def strip_internal_fields(object) do - object - |> Map.drop(Pleroma.Constants.object_internal_fields()) + Map.drop(object, Pleroma.Constants.object_internal_fields()) end defp strip_internal_tags(%{"tag" => tags} = object) do @@ -1218,12 +1178,8 @@ def perform(:user_upgrade, user) do def upgrade_user_from_ap_id(ap_id) do with %User{local: false} = user <- User.get_cached_by_ap_id(ap_id), {:ok, data} <- ActivityPub.fetch_and_prepare_user_from_ap_id(ap_id), - already_ap <- User.ap_enabled?(user), - {:ok, user} <- upgrade_user(user, data) do - if not already_ap do - TransmogrifierWorker.enqueue("user_upgrade", %{"user_id" => user.id}) - end - + {:ok, user} <- update_user(user, data) do + TransmogrifierWorker.enqueue("user_upgrade", %{"user_id" => user.id}) {:ok, user} else %User{} = user -> {:ok, user} @@ -1231,9 +1187,9 @@ def upgrade_user_from_ap_id(ap_id) do end end - defp upgrade_user(user, data) do + defp update_user(user, data) do user - |> User.upgrade_changeset(data, true) + |> User.remote_user_changeset(data) |> User.update_and_set_cache() end diff --git a/lib/pleroma/web/activity_pub/utils.ex b/lib/pleroma/web/activity_pub/utils.ex index c65bbed67..f2375bcc4 100644 --- a/lib/pleroma/web/activity_pub/utils.ex +++ b/lib/pleroma/web/activity_pub/utils.ex @@ -6,6 +6,7 @@ defmodule Pleroma.Web.ActivityPub.Utils do alias Ecto.Changeset alias Ecto.UUID alias Pleroma.Activity + alias Pleroma.Config alias Pleroma.Notification alias Pleroma.Object alias Pleroma.Repo @@ -169,8 +170,11 @@ def create_context(context) do Enqueues an activity for federation if it's local """ @spec maybe_federate(any()) :: :ok - def maybe_federate(%Activity{local: true} = activity) do - if Pleroma.Config.get!([:instance, :federating]) do + def maybe_federate(%Activity{local: true, data: %{"type" => type}} = activity) do + outgoing_blocks = Config.get([:activitypub, :outgoing_blocks]) + + with true <- Config.get!([:instance, :federating]), + true <- type != "Block" || outgoing_blocks do Pleroma.Web.Federator.publish(activity) end @@ -512,7 +516,7 @@ def get_latest_reaction(internal_activity_id, %{ap_id: ap_id}, emoji) do #### Announce-related helpers @doc """ - Retruns an existing announce activity if the notice has already been announced + Returns an existing announce activity if the notice has already been announced """ @spec get_existing_announce(String.t(), map()) :: Activity.t() | nil def get_existing_announce(actor, %{data: %{"id" => ap_id}}) do @@ -562,45 +566,6 @@ def make_announce_data( |> maybe_put("id", activity_id) end - @doc """ - Make unannounce activity data for the given actor and object - """ - def make_unannounce_data( - %User{ap_id: ap_id} = user, - %Activity{data: %{"context" => context, "object" => object}} = activity, - activity_id - ) do - object = Object.normalize(object) - - %{ - "type" => "Undo", - "actor" => ap_id, - "object" => activity.data, - "to" => [user.follower_address, object.data["actor"]], - "cc" => [Pleroma.Constants.as_public()], - "context" => context - } - |> maybe_put("id", activity_id) - end - - def make_unlike_data( - %User{ap_id: ap_id} = user, - %Activity{data: %{"context" => context, "object" => object}} = activity, - activity_id - ) do - object = Object.normalize(object) - - %{ - "type" => "Undo", - "actor" => ap_id, - "object" => activity.data, - "to" => [user.follower_address, object.data["actor"]], - "cc" => [Pleroma.Constants.as_public()], - "context" => context - } - |> maybe_put("id", activity_id) - end - def make_undo_data( %User{ap_id: actor, follower_address: follower_address}, %Activity{ @@ -688,16 +653,6 @@ def make_block_data(blocker, blocked, activity_id) do |> maybe_put("id", activity_id) end - def make_unblock_data(blocker, blocked, block_activity, activity_id) do - %{ - "type" => "Undo", - "actor" => blocker.ap_id, - "to" => [blocked.ap_id], - "object" => block_activity.data - } - |> maybe_put("id", activity_id) - end - #### Create-related helpers def make_create_data(params, additional) do @@ -795,102 +750,6 @@ def get_reports(params, page, page_size) do ActivityPub.fetch_activities([], params, :offset) end - def parse_report_group(activity) do - reports = get_reports_by_status_id(activity["id"]) - max_date = Enum.max_by(reports, &NaiveDateTime.from_iso8601!(&1.data["published"])) - actors = Enum.map(reports, & &1.user_actor) - [%{data: %{"object" => [account_id | _]}} | _] = reports - - account = - AccountView.render("show.json", %{ - user: User.get_by_ap_id(account_id) - }) - - status = get_status_data(activity) - - %{ - date: max_date.data["published"], - account: account, - status: status, - actors: Enum.uniq(actors), - reports: reports - } - end - - defp get_status_data(status) do - case status["deleted"] do - true -> - %{ - "id" => status["id"], - "deleted" => true - } - - _ -> - Activity.get_by_ap_id(status["id"]) - end - end - - def get_reports_by_status_id(ap_id) do - from(a in Activity, - where: fragment("(?)->>'type' = 'Flag'", a.data), - where: fragment("(?)->'object' @> ?", a.data, ^[%{id: ap_id}]), - or_where: fragment("(?)->'object' @> ?", a.data, ^[ap_id]) - ) - |> Activity.with_preloaded_user_actor() - |> Repo.all() - end - - @spec get_reports_grouped_by_status([String.t()]) :: %{ - required(:groups) => [ - %{ - required(:date) => String.t(), - required(:account) => %{}, - required(:status) => %{}, - required(:actors) => [%User{}], - required(:reports) => [%Activity{}] - } - ] - } - def get_reports_grouped_by_status(activity_ids) do - parsed_groups = - activity_ids - |> Enum.map(fn id -> - id - |> build_flag_object() - |> parse_report_group() - end) - - %{ - groups: parsed_groups - } - end - - @spec get_reported_activities() :: [ - %{ - required(:activity) => String.t(), - required(:date) => String.t() - } - ] - def get_reported_activities do - reported_activities_query = - from(a in Activity, - where: fragment("(?)->>'type' = 'Flag'", a.data), - select: %{ - activity: fragment("jsonb_array_elements((? #- '{object,0}')->'object')", a.data) - }, - group_by: fragment("activity") - ) - - from(a in subquery(reported_activities_query), - distinct: true, - select: %{ - id: fragment("COALESCE(?->>'id'::text, ? #>> '{}')", a.activity, a.activity) - } - ) - |> Repo.all() - |> Enum.map(& &1.id) - end - def update_report_state(%Activity{} = activity, state) when state in @strip_status_report_states do {:ok, stripped_activity} = strip_report_status_data(activity) diff --git a/lib/pleroma/web/activity_pub/views/user_view.ex b/lib/pleroma/web/activity_pub/views/user_view.ex index bc21ac6c7..34590b16d 100644 --- a/lib/pleroma/web/activity_pub/views/user_view.ex +++ b/lib/pleroma/web/activity_pub/views/user_view.ex @@ -79,10 +79,7 @@ def render("user.json", %{user: user}) do emoji_tags = Transmogrifier.take_emoji_tags(user) - fields = - user - |> User.fields() - |> Enum.map(&Map.put(&1, "type", "PropertyValue")) + fields = Enum.map(user.fields, &Map.put(&1, "type", "PropertyValue")) %{ "id" => user.ap_id, @@ -103,7 +100,7 @@ def render("user.json", %{user: user}) do }, "endpoints" => endpoints, "attachment" => fields, - "tag" => (user.source_data["tag"] || []) ++ emoji_tags, + "tag" => emoji_tags, "discoverable" => user.discoverable } |> Map.merge(maybe_make_image(&User.avatar_url/2, "icon", user)) diff --git a/lib/pleroma/web/admin_api/admin_api_controller.ex b/lib/pleroma/web/admin_api/admin_api_controller.ex index 175260bc2..451dc92d6 100644 --- a/lib/pleroma/web/admin_api/admin_api_controller.ex +++ b/lib/pleroma/web/admin_api/admin_api_controller.ex @@ -10,6 +10,7 @@ defmodule Pleroma.Web.AdminAPI.AdminAPIController do alias Pleroma.Activity alias Pleroma.Config alias Pleroma.ConfigDB + alias Pleroma.MFA alias Pleroma.ModerationLog alias Pleroma.Plugs.OAuthScopesPlug alias Pleroma.ReportNote @@ -17,6 +18,8 @@ defmodule Pleroma.Web.AdminAPI.AdminAPIController do alias Pleroma.User alias Pleroma.UserInviteToken alias Pleroma.Web.ActivityPub.ActivityPub + alias Pleroma.Web.ActivityPub.Builder + alias Pleroma.Web.ActivityPub.Pipeline alias Pleroma.Web.ActivityPub.Relay alias Pleroma.Web.ActivityPub.Utils alias Pleroma.Web.AdminAPI.AccountView @@ -27,18 +30,20 @@ defmodule Pleroma.Web.AdminAPI.AdminAPIController do alias Pleroma.Web.AdminAPI.Search alias Pleroma.Web.CommonAPI alias Pleroma.Web.Endpoint + alias Pleroma.Web.MastodonAPI.AppView alias Pleroma.Web.MastodonAPI.StatusView + alias Pleroma.Web.OAuth.App alias Pleroma.Web.Router require Logger - @descriptions_json Pleroma.Docs.JSON.compile() + @descriptions Pleroma.Docs.JSON.compile() @users_page_size 50 plug( OAuthScopesPlug, %{scopes: ["read:accounts"], admin: true} - when action in [:list_users, :user_show, :right_get] + when action in [:list_users, :user_show, :right_get, :show_user_credentials] ) plug( @@ -46,6 +51,7 @@ defmodule Pleroma.Web.AdminAPI.AdminAPIController do %{scopes: ["write:accounts"], admin: true} when action in [ :get_password_reset, + :force_password_reset, :user_delete, :users_create, :user_toggle_activation, @@ -54,7 +60,11 @@ defmodule Pleroma.Web.AdminAPI.AdminAPIController do :tag_users, :untag_users, :right_add, - :right_delete + :right_add_multiple, + :right_delete, + :disable_mfa, + :right_delete_multiple, + :update_user_credentials ] ) @@ -81,13 +91,13 @@ defmodule Pleroma.Web.AdminAPI.AdminAPIController do plug( OAuthScopesPlug, %{scopes: ["write:reports"], admin: true} - when action in [:reports_update] + when action in [:reports_update, :report_notes_create, :report_notes_delete] ) plug( OAuthScopesPlug, %{scopes: ["read:statuses"], admin: true} - when action == :list_user_statuses + when action in [:list_statuses, :list_user_statuses, :list_instance_statuses, :status_show] ) plug( @@ -99,34 +109,48 @@ defmodule Pleroma.Web.AdminAPI.AdminAPIController do plug( OAuthScopesPlug, %{scopes: ["read"], admin: true} - when action in [:config_show, :list_log, :stats] + when action in [ + :config_show, + :list_log, + :stats, + :relay_list, + :config_descriptions, + :need_reboot + ] ) plug( OAuthScopesPlug, %{scopes: ["write"], admin: true} - when action == :config_update + when action in [ + :restart, + :config_update, + :resend_confirmation_email, + :confirm_email, + :oauth_app_create, + :oauth_app_list, + :oauth_app_update, + :oauth_app_delete, + :reload_emoji + ] ) action_fallback(:errors) - def user_delete(%{assigns: %{user: admin}} = conn, %{"nickname" => nickname}) do - user = User.get_cached_by_nickname(nickname) - User.delete(user) - - ModerationLog.insert_log(%{ - actor: admin, - subject: [user], - action: "delete" - }) - - conn - |> json(nickname) + def user_delete(conn, %{"nickname" => nickname}) do + user_delete(conn, %{"nicknames" => [nickname]}) end def user_delete(%{assigns: %{user: admin}} = conn, %{"nicknames" => nicknames}) do - users = nicknames |> Enum.map(&User.get_cached_by_nickname/1) - User.delete(users) + users = + nicknames + |> Enum.map(&User.get_cached_by_nickname/1) + + users + |> Enum.each(fn user -> + {:ok, delete_data, _} = Builder.delete(admin, user.ap_id) + Pipeline.common_pipeline(delete_data, local: true) + end) ModerationLog.insert_log(%{ actor: admin, @@ -257,7 +281,7 @@ def list_instance_statuses(conn, %{"instance" => instance} = params) do conn |> put_view(Pleroma.Web.AdminAPI.StatusView) - |> render("index.json", %{activities: activities, as: :activity}) + |> render("index.json", %{activities: activities, as: :activity, skip_relationships: false}) end def list_user_statuses(conn, %{"nickname" => nickname} = params) do @@ -276,7 +300,7 @@ def list_user_statuses(conn, %{"nickname" => nickname} = params) do conn |> put_view(StatusView) - |> render("index.json", %{activities: activities, as: :activity}) + |> render("index.json", %{activities: activities, as: :activity, skip_relationships: false}) else _ -> {:error, :not_found} end @@ -369,29 +393,12 @@ def list_users(conn, params) do email: params["email"] } - with {:ok, users, count} <- Search.user(Map.merge(search_params, filters)), - {:ok, users, count} <- filter_service_users(users, count), - do: - conn - |> json( - AccountView.render("index.json", - users: users, - count: count, - page_size: page_size - ) - ) - end - - defp filter_service_users(users, count) do - filtered_users = Enum.reject(users, &service_user?/1) - count = if Enum.any?(users, &service_user?/1), do: length(filtered_users), else: count - - {:ok, filtered_users, count} - end - - defp service_user?(user) do - String.match?(user.ap_id, ~r/.*\/relay$/) or - String.match?(user.ap_id, ~r/.*\/internal\/fetch$/) + with {:ok, users, count} <- Search.user(Map.merge(search_params, filters)) do + json( + conn, + AccountView.render("index.json", users: users, count: count, page_size: page_size) + ) + end end @filters ~w(local external active deactivated is_admin is_moderator) @@ -575,9 +582,8 @@ def relay_unfollow(%{assigns: %{user: admin}} = conn, %{"relay_url" => target}) @doc "Sends registration invite via email" def email_invite(%{assigns: %{user: user}} = conn, %{"email" => email} = params) do - with true <- - Config.get([:instance, :invites_enabled]) && - !Config.get([:instance, :registrations_open]), + with {_, false} <- {:registrations_open, Config.get([:instance, :registrations_open])}, + {_, true} <- {:invites_enabled, Config.get([:instance, :invites_enabled])}, {:ok, invite_token} <- UserInviteToken.create_invite(), email <- Pleroma.Emails.UserEmail.user_invitation_email( @@ -588,6 +594,18 @@ def email_invite(%{assigns: %{user: user}} = conn, %{"email" => email} = params) ), {:ok, _} <- Pleroma.Emails.Mailer.deliver(email) do json_response(conn, :no_content, "") + else + {:registrations_open, _} -> + errors( + conn, + {:error, "To send invites you need to set the `registrations_open` option to false."} + ) + + {:invites_enabled, _} -> + errors( + conn, + {:error, "To send invites you need to set the `invites_enabled` option to true."} + ) end end @@ -658,6 +676,64 @@ def force_password_reset(%{assigns: %{user: admin}} = conn, %{"nicknames" => nic json_response(conn, :no_content, "") end + @doc "Disable mfa for user's account." + def disable_mfa(conn, %{"nickname" => nickname}) do + case User.get_by_nickname(nickname) do + %User{} = user -> + MFA.disable(user) + json(conn, nickname) + + _ -> + {:error, :not_found} + end + end + + @doc "Show a given user's credentials" + def show_user_credentials(%{assigns: %{user: admin}} = conn, %{"nickname" => nickname}) do + with %User{} = user <- User.get_cached_by_nickname_or_id(nickname) do + conn + |> put_view(AccountView) + |> render("credentials.json", %{user: user, for: admin}) + else + _ -> {:error, :not_found} + end + end + + @doc "Updates a given user" + def update_user_credentials( + %{assigns: %{user: admin}} = conn, + %{"nickname" => nickname} = params + ) do + with {_, user} <- {:user, User.get_cached_by_nickname(nickname)}, + {:ok, _user} <- + User.update_as_admin(user, params) do + ModerationLog.insert_log(%{ + actor: admin, + subject: [user], + action: "updated_users" + }) + + if params["password"] do + User.force_password_reset_async(user) + end + + ModerationLog.insert_log(%{ + actor: admin, + subject: [user], + action: "force_password_reset" + }) + + json(conn, %{status: "success"}) + else + {:error, changeset} -> + {_, {error, _}} = Enum.at(changeset.errors, 0) + json(conn, %{error: "New password #{error}."}) + + _ -> + json(conn, %{error: "Unable to change password."}) + end + end + def list_reports(conn, params) do {page, page_size} = page_params(params) @@ -668,14 +744,6 @@ def list_reports(conn, params) do |> render("index.json", %{reports: reports}) end - def list_grouped_reports(conn, _params) do - statuses = Utils.get_reported_activities() - - conn - |> put_view(ReportView) - |> render("index_grouped.json", Utils.get_reports_grouped_by_status(statuses)) - end - def report_show(conn, %{"id" => id}) do with %Activity{} = report <- Activity.get_by_id(id) do conn @@ -762,19 +830,34 @@ def list_statuses(%{assigns: %{user: _admin}} = conn, params) do conn |> put_view(Pleroma.Web.AdminAPI.StatusView) - |> render("index.json", %{activities: activities, as: :activity}) + |> render("index.json", %{activities: activities, as: :activity, skip_relationships: false}) + end + + def status_show(conn, %{"id" => id}) do + with %Activity{} = activity <- Activity.get_by_id(id) do + conn + |> put_view(StatusView) + |> render("show.json", %{activity: activity}) + else + _ -> errors(conn, {:error, :not_found}) + end end def status_update(%{assigns: %{user: admin}} = conn, %{"id" => id} = params) do + params = + params + |> Map.take(["sensitive", "visibility"]) + |> Map.new(fn {key, value} -> {String.to_existing_atom(key), value} end) + with {:ok, activity} <- CommonAPI.update_activity_scope(id, params) do - {:ok, sensitive} = Ecto.Type.cast(:boolean, params["sensitive"]) + {:ok, sensitive} = Ecto.Type.cast(:boolean, params[:sensitive]) ModerationLog.insert_log(%{ action: "status_update", actor: admin, subject: activity, sensitive: sensitive, - visibility: params["visibility"] + visibility: params[:visibility] }) conn @@ -814,9 +897,9 @@ def list_log(conn, params) do end def config_descriptions(conn, _params) do - conn - |> Plug.Conn.put_resp_content_type("application/json") - |> Plug.Conn.send_resp(200, @descriptions_json) + descriptions = Enum.filter(@descriptions, &whitelisted_config?/1) + + json(conn, descriptions) end def config_show(conn, %{"only_db" => true}) do @@ -864,23 +947,16 @@ def config_show(conn, _params) do end) |> List.flatten() - response = %{configs: merged} - - response = - if Restarter.Pleroma.need_reboot?() do - Map.put(response, :need_reboot, true) - else - response - end - - json(conn, response) + json(conn, %{configs: merged, need_reboot: Restarter.Pleroma.need_reboot?()}) end end def config_update(conn, %{"configs" => configs}) do with :ok <- configurable_from_database(conn) do {_errors, results} = - Enum.map(configs, fn + configs + |> Enum.filter(&whitelisted_config?/1) + |> Enum.map(fn %{"group" => group, "key" => key, "delete" => true} = params -> ConfigDB.delete(%{group: group, key: key, subkeys: params["subkeys"]}) @@ -900,28 +976,22 @@ def config_update(conn, %{"configs" => configs}) do Config.TransferTask.load_and_update_env(deleted, false) - need_reboot? = - Restarter.Pleroma.need_reboot?() || - Enum.any?(updated, fn config -> + if !Restarter.Pleroma.need_reboot?() do + changed_reboot_settings? = + (updated ++ deleted) + |> Enum.any?(fn config -> group = ConfigDB.from_string(config.group) key = ConfigDB.from_string(config.key) value = ConfigDB.from_binary(config.value) Config.TransferTask.pleroma_need_restart?(group, key, value) end) - response = %{configs: updated} - - response = - if need_reboot? do - Restarter.Pleroma.need_reboot() - Map.put(response, :need_reboot, need_reboot?) - else - response - end + if changed_reboot_settings?, do: Restarter.Pleroma.need_reboot() + end conn |> put_view(ConfigView) - |> render("index.json", response) + |> render("index.json", %{configs: updated, need_reboot: Restarter.Pleroma.need_reboot?()}) end end @@ -933,6 +1003,10 @@ def restart(conn, _params) do end end + def need_reboot(conn, _params) do + json(conn, %{need_reboot: Restarter.Pleroma.need_reboot?()}) + end + defp configurable_from_database(conn) do if Config.get(:configurable_from_database) do :ok @@ -944,6 +1018,28 @@ defp configurable_from_database(conn) do end end + defp whitelisted_config?(group, key) do + if whitelisted_configs = Config.get(:database_config_whitelist) do + Enum.any?(whitelisted_configs, fn + {whitelisted_group} -> + group == inspect(whitelisted_group) + + {whitelisted_group, whitelisted_key} -> + group == inspect(whitelisted_group) && key == inspect(whitelisted_key) + end) + else + true + end + end + + defp whitelisted_config?(%{"group" => group, "key" => key}) do + whitelisted_config?(group, key) + end + + defp whitelisted_config?(%{:group => group} = config) do + whitelisted_config?(group, config[:key]) + end + def reload_emoji(conn, _params) do Pleroma.Emoji.reload() @@ -978,6 +1074,83 @@ def resend_confirmation_email(%{assigns: %{user: admin}} = conn, %{"nicknames" = conn |> json("") end + def oauth_app_create(conn, params) do + params = + if params["name"] do + Map.put(params, "client_name", params["name"]) + else + params + end + + result = + case App.create(params) do + {:ok, app} -> + AppView.render("show.json", %{app: app, admin: true}) + + {:error, changeset} -> + App.errors(changeset) + end + + json(conn, result) + end + + def oauth_app_update(conn, params) do + params = + if params["name"] do + Map.put(params, "client_name", params["name"]) + else + params + end + + with {:ok, app} <- App.update(params) do + json(conn, AppView.render("show.json", %{app: app, admin: true})) + else + {:error, changeset} -> + json(conn, App.errors(changeset)) + + nil -> + json_response(conn, :bad_request, "") + end + end + + def oauth_app_list(conn, params) do + {page, page_size} = page_params(params) + + search_params = %{ + client_name: params["name"], + client_id: params["client_id"], + page: page, + page_size: page_size + } + + search_params = + if Map.has_key?(params, "trusted") do + Map.put(search_params, :trusted, params["trusted"]) + else + search_params + end + + with {:ok, apps, count} <- App.search(search_params) do + json( + conn, + AppView.render("index.json", + apps: apps, + count: count, + page_size: page_size, + admin: true + ) + ) + end + end + + def oauth_app_delete(conn, params) do + with {:ok, _app} <- App.destroy(params["id"]) do + json_response(conn, :no_content, "") + else + _ -> json_response(conn, :bad_request, "") + end + end + def stats(conn, _) do count = Stats.get_status_visibility_count() @@ -985,25 +1158,25 @@ def stats(conn, _) do |> json(%{"status_visibility" => count}) end - def errors(conn, {:error, :not_found}) do + defp errors(conn, {:error, :not_found}) do conn |> put_status(:not_found) |> json(dgettext("errors", "Not found")) end - def errors(conn, {:error, reason}) do + defp errors(conn, {:error, reason}) do conn |> put_status(:bad_request) |> json(reason) end - def errors(conn, {:param_cast, _}) do + defp errors(conn, {:param_cast, _}) do conn |> put_status(:bad_request) |> json(dgettext("errors", "Invalid parameters")) end - def errors(conn, _) do + defp errors(conn, _) do conn |> put_status(:internal_server_error) |> json(dgettext("errors", "Something went wrong")) diff --git a/lib/pleroma/web/admin_api/search.ex b/lib/pleroma/web/admin_api/search.ex index 29cea1f44..c28efadd5 100644 --- a/lib/pleroma/web/admin_api/search.ex +++ b/lib/pleroma/web/admin_api/search.ex @@ -21,6 +21,7 @@ def user(params \\ %{}) do query = params |> Map.drop([:page, :page_size]) + |> Map.put(:exclude_service_users, true) |> User.Query.build() |> order_by([u], u.nickname) diff --git a/lib/pleroma/web/admin_api/views/account_view.ex b/lib/pleroma/web/admin_api/views/account_view.ex index 1e03849de..a16a3ebf0 100644 --- a/lib/pleroma/web/admin_api/views/account_view.ex +++ b/lib/pleroma/web/admin_api/views/account_view.ex @@ -23,6 +23,43 @@ def render("index.json", %{users: users}) do } end + def render("credentials.json", %{user: user, for: for_user}) do + user = User.sanitize_html(user, User.html_filter_policy(for_user)) + avatar = User.avatar_url(user) |> MediaProxy.url() + banner = User.banner_url(user) |> MediaProxy.url() + background = image_url(user.background) |> MediaProxy.url() + + user + |> Map.take([ + :id, + :bio, + :email, + :fields, + :name, + :nickname, + :locked, + :no_rich_text, + :default_scope, + :hide_follows, + :hide_followers_count, + :hide_follows_count, + :hide_followers, + :hide_favorites, + :allow_following_move, + :show_role, + :skip_thread_containment, + :pleroma_settings_store, + :raw_fields, + :discoverable, + :actor_type + ]) + |> Map.merge(%{ + "avatar" => avatar, + "banner" => banner, + "background" => background + }) + end + def render("show.json", %{user: user}) do avatar = User.avatar_url(user) |> MediaProxy.url() display_name = Pleroma.HTML.strip_tags(user.name || user.nickname) @@ -104,4 +141,7 @@ defp parse_error(errors) do "" end end + + defp image_url(%{"url" => [%{"href" => href} | _]}), do: href + defp image_url(_), do: nil end diff --git a/lib/pleroma/web/admin_api/views/report_view.ex b/lib/pleroma/web/admin_api/views/report_view.ex index fc8733ce8..d50969b2a 100644 --- a/lib/pleroma/web/admin_api/views/report_view.ex +++ b/lib/pleroma/web/admin_api/views/report_view.ex @@ -4,7 +4,7 @@ defmodule Pleroma.Web.AdminAPI.ReportView do use Pleroma.Web, :view - alias Pleroma.Activity + alias Pleroma.HTML alias Pleroma.User alias Pleroma.Web.AdminAPI.Report @@ -38,38 +38,17 @@ def render("show.json", %{report: report, user: user, account: account, statuses actor: merge_account_views(user), content: content, created_at: created_at, - statuses: StatusView.render("index.json", %{activities: statuses, as: :activity}), + statuses: + StatusView.render("index.json", %{ + activities: statuses, + as: :activity, + skip_relationships: false + }), state: report.data["state"], notes: render(__MODULE__, "index_notes.json", %{notes: report.report_notes}) } end - def render("index_grouped.json", %{groups: groups}) do - reports = - Enum.map(groups, fn group -> - status = - case group.status do - %Activity{} = activity -> StatusView.render("show.json", %{activity: activity}) - _ -> group.status - end - - %{ - date: group[:date], - account: group[:account], - status: Map.put_new(status, "deleted", false), - actors: Enum.map(group[:actors], &merge_account_views/1), - reports: - group[:reports] - |> Enum.map(&Report.extract_report_info(&1)) - |> Enum.map(&render(__MODULE__, "show.json", &1)) - } - end) - - %{ - reports: reports - } - end - def render("index_notes.json", %{notes: notes}) when is_list(notes) do Enum.map(notes, &render(__MODULE__, "show_note.json", &1)) end diff --git a/lib/pleroma/web/admin_api/views/status_view.ex b/lib/pleroma/web/admin_api/views/status_view.ex index 360ddc22c..3637dee24 100644 --- a/lib/pleroma/web/admin_api/views/status_view.ex +++ b/lib/pleroma/web/admin_api/views/status_view.ex @@ -8,15 +8,16 @@ defmodule Pleroma.Web.AdminAPI.StatusView do require Pleroma.Constants alias Pleroma.User + alias Pleroma.Web.MastodonAPI.StatusView def render("index.json", opts) do safe_render_many(opts.activities, __MODULE__, "show.json", opts) end def render("show.json", %{activity: %{data: %{"object" => _object}} = activity} = opts) do - user = get_user(activity.data["actor"]) + user = StatusView.get_user(activity.data["actor"]) - Pleroma.Web.MastodonAPI.StatusView.render("show.json", opts) + StatusView.render("show.json", opts) |> Map.merge(%{account: merge_account_views(user)}) end @@ -26,17 +27,4 @@ defp merge_account_views(%User{} = user) do end defp merge_account_views(_), do: %{} - - defp get_user(ap_id) do - cond do - user = User.get_cached_by_ap_id(ap_id) -> - user - - user = User.get_by_guessed_nickname(ap_id) -> - user - - true -> - User.error_user(ap_id) - end - end end diff --git a/lib/pleroma/web/api_spec.ex b/lib/pleroma/web/api_spec.ex new file mode 100644 index 000000000..79fd5f871 --- /dev/null +++ b/lib/pleroma/web/api_spec.ex @@ -0,0 +1,57 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec do + alias OpenApiSpex.OpenApi + alias OpenApiSpex.Operation + alias Pleroma.Web.Endpoint + alias Pleroma.Web.Router + + @behaviour OpenApi + + @impl OpenApi + def spec do + %OpenApi{ + servers: [ + # Populate the Server info from a phoenix endpoint + OpenApiSpex.Server.from_endpoint(Endpoint) + ], + info: %OpenApiSpex.Info{ + title: "Pleroma", + description: Application.spec(:pleroma, :description) |> to_string(), + version: Application.spec(:pleroma, :vsn) |> to_string() + }, + # populate the paths from a phoenix router + paths: OpenApiSpex.Paths.from_router(Router), + components: %OpenApiSpex.Components{ + parameters: %{ + "accountIdOrNickname" => + Operation.parameter(:id, :path, :string, "Account ID or nickname", + example: "123", + required: true + ) + }, + securitySchemes: %{ + "oAuth" => %OpenApiSpex.SecurityScheme{ + type: "oauth2", + flows: %OpenApiSpex.OAuthFlows{ + password: %OpenApiSpex.OAuthFlow{ + authorizationUrl: "/oauth/authorize", + tokenUrl: "/oauth/token", + scopes: %{ + "read" => "read", + "write" => "write", + "follow" => "follow", + "push" => "push" + } + } + } + } + } + } + } + # discover request/response schemas from path specs + |> OpenApiSpex.resolve_schema_modules() + end +end diff --git a/lib/pleroma/web/api_spec/cast_and_validate.ex b/lib/pleroma/web/api_spec/cast_and_validate.ex new file mode 100644 index 000000000..bd9026237 --- /dev/null +++ b/lib/pleroma/web/api_spec/cast_and_validate.ex @@ -0,0 +1,139 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2019-2020 Moxley Stratton, Mike Buhot , MPL-2.0 +# Copyright © 2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.CastAndValidate do + @moduledoc """ + This plug is based on [`OpenApiSpex.Plug.CastAndValidate`] + (https://github.com/open-api-spex/open_api_spex/blob/master/lib/open_api_spex/plug/cast_and_validate.ex). + The main difference is ignoring unexpected query params instead of throwing + an error and a config option (`[Pleroma.Web.ApiSpec.CastAndValidate, :strict]`) + to disable this behavior. Also, the default rendering error module + is `Pleroma.Web.ApiSpec.RenderError`. + """ + + @behaviour Plug + + alias Plug.Conn + + @impl Plug + def init(opts) do + opts + |> Map.new() + |> Map.put_new(:render_error, Pleroma.Web.ApiSpec.RenderError) + end + + @impl Plug + def call(%{private: %{open_api_spex: private_data}} = conn, %{ + operation_id: operation_id, + render_error: render_error + }) do + spec = private_data.spec + operation = private_data.operation_lookup[operation_id] + + content_type = + case Conn.get_req_header(conn, "content-type") do + [header_value | _] -> + header_value + |> String.split(";") + |> List.first() + + _ -> + nil + end + + private_data = Map.put(private_data, :operation_id, operation_id) + conn = Conn.put_private(conn, :open_api_spex, private_data) + + case cast_and_validate(spec, operation, conn, content_type, strict?()) do + {:ok, conn} -> + conn + + {:error, reason} -> + opts = render_error.init(reason) + + conn + |> render_error.call(opts) + |> Plug.Conn.halt() + end + end + + def call( + %{ + private: %{ + phoenix_controller: controller, + phoenix_action: action, + open_api_spex: private_data + } + } = conn, + opts + ) do + operation = + case private_data.operation_lookup[{controller, action}] do + nil -> + operation_id = controller.open_api_operation(action).operationId + operation = private_data.operation_lookup[operation_id] + + operation_lookup = + private_data.operation_lookup + |> Map.put({controller, action}, operation) + + OpenApiSpex.Plug.Cache.adapter().put( + private_data.spec_module, + {private_data.spec, operation_lookup} + ) + + operation + + operation -> + operation + end + + if operation.operationId do + call(conn, Map.put(opts, :operation_id, operation.operationId)) + else + raise "operationId was not found in action API spec" + end + end + + def call(conn, opts), do: OpenApiSpex.Plug.CastAndValidate.call(conn, opts) + + defp cast_and_validate(spec, operation, conn, content_type, true = _strict) do + OpenApiSpex.cast_and_validate(spec, operation, conn, content_type) + end + + defp cast_and_validate(spec, operation, conn, content_type, false = _strict) do + case OpenApiSpex.cast_and_validate(spec, operation, conn, content_type) do + {:ok, conn} -> + {:ok, conn} + + # Remove unexpected query params and cast/validate again + {:error, errors} -> + query_params = + Enum.reduce(errors, conn.query_params, fn + %{reason: :unexpected_field, name: name, path: [name]}, params -> + Map.delete(params, name) + + %{reason: :invalid_enum, name: nil, path: path, value: value}, params -> + path = path |> Enum.reverse() |> tl() |> Enum.reverse() |> list_items_to_string() + update_in(params, path, &List.delete(&1, value)) + + _, params -> + params + end) + + conn = %Conn{conn | query_params: query_params} + OpenApiSpex.cast_and_validate(spec, operation, conn, content_type) + end + end + + defp list_items_to_string(list) do + Enum.map(list, fn + i when is_atom(i) -> to_string(i) + i -> i + end) + end + + defp strict?, do: Pleroma.Config.get([__MODULE__, :strict], false) +end diff --git a/lib/pleroma/web/api_spec/helpers.ex b/lib/pleroma/web/api_spec/helpers.ex new file mode 100644 index 000000000..f0b558aa5 --- /dev/null +++ b/lib/pleroma/web/api_spec/helpers.ex @@ -0,0 +1,61 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.Helpers do + alias OpenApiSpex.Operation + alias OpenApiSpex.Schema + + def request_body(description, schema_ref, opts \\ []) do + media_types = ["application/json", "multipart/form-data", "application/x-www-form-urlencoded"] + + content = + media_types + |> Enum.map(fn type -> + {type, + %OpenApiSpex.MediaType{ + schema: schema_ref, + example: opts[:example], + examples: opts[:examples] + }} + end) + |> Enum.into(%{}) + + %OpenApiSpex.RequestBody{ + description: description, + content: content, + required: opts[:required] || false + } + end + + def pagination_params do + [ + Operation.parameter(:max_id, :query, :string, "Return items older than this ID"), + Operation.parameter(:min_id, :query, :string, "Return the oldest items newer than this ID"), + Operation.parameter( + :since_id, + :query, + :string, + "Return the newest items newer than this ID" + ), + Operation.parameter( + :limit, + :query, + %Schema{type: :integer, default: 20}, + "Maximum number of items to return. Will be ignored if it's more than 40" + ) + ] + end + + def empty_object_response do + Operation.response("Empty object", "application/json", %Schema{type: :object, example: %{}}) + end + + def empty_array_response do + Operation.response("Empty array", "application/json", %Schema{type: :array, example: []}) + end + + def no_content_response do + Operation.response("No Content", "application/json", %Schema{type: :string, example: ""}) + end +end diff --git a/lib/pleroma/web/api_spec/operations/account_operation.ex b/lib/pleroma/web/api_spec/operations/account_operation.ex new file mode 100644 index 000000000..988bab882 --- /dev/null +++ b/lib/pleroma/web/api_spec/operations/account_operation.ex @@ -0,0 +1,726 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.AccountOperation do + alias OpenApiSpex.Operation + alias OpenApiSpex.Reference + alias OpenApiSpex.Schema + alias Pleroma.Web.ApiSpec.Schemas.Account + alias Pleroma.Web.ApiSpec.Schemas.AccountRelationship + alias Pleroma.Web.ApiSpec.Schemas.ActorType + alias Pleroma.Web.ApiSpec.Schemas.ApiError + alias Pleroma.Web.ApiSpec.Schemas.BooleanLike + alias Pleroma.Web.ApiSpec.Schemas.List + alias Pleroma.Web.ApiSpec.Schemas.Status + alias Pleroma.Web.ApiSpec.Schemas.VisibilityScope + + import Pleroma.Web.ApiSpec.Helpers + + @spec open_api_operation(atom) :: Operation.t() + def open_api_operation(action) do + operation = String.to_existing_atom("#{action}_operation") + apply(__MODULE__, operation, []) + end + + @spec create_operation() :: Operation.t() + def create_operation do + %Operation{ + tags: ["accounts"], + summary: "Register an account", + description: + "Creates a user and account records. Returns an account access token for the app that initiated the request. The app should save this token for later, and should wait for the user to confirm their account by clicking a link in their email inbox.", + operationId: "AccountController.create", + requestBody: request_body("Parameters", create_request(), required: true), + responses: %{ + 200 => Operation.response("Account", "application/json", create_response()), + 400 => Operation.response("Error", "application/json", ApiError), + 403 => Operation.response("Error", "application/json", ApiError), + 429 => Operation.response("Error", "application/json", ApiError) + } + } + end + + def verify_credentials_operation do + %Operation{ + tags: ["accounts"], + description: "Test to make sure that the user token works.", + summary: "Verify account credentials", + operationId: "AccountController.verify_credentials", + security: [%{"oAuth" => ["read:accounts"]}], + responses: %{ + 200 => Operation.response("Account", "application/json", Account) + } + } + end + + def update_credentials_operation do + %Operation{ + tags: ["accounts"], + summary: "Update account credentials", + description: "Update the user's display and preferences.", + operationId: "AccountController.update_credentials", + security: [%{"oAuth" => ["write:accounts"]}], + requestBody: request_body("Parameters", update_creadentials_request(), required: true), + responses: %{ + 200 => Operation.response("Account", "application/json", Account), + 403 => Operation.response("Error", "application/json", ApiError) + } + } + end + + def relationships_operation do + %Operation{ + tags: ["accounts"], + summary: "Check relationships to other accounts", + operationId: "AccountController.relationships", + description: "Find out whether a given account is followed, blocked, muted, etc.", + security: [%{"oAuth" => ["read:follows"]}], + parameters: [ + Operation.parameter( + :id, + :query, + %Schema{ + oneOf: [%Schema{type: :array, items: %Schema{type: :string}}, %Schema{type: :string}] + }, + "Account IDs", + example: "123" + ) + ], + responses: %{ + 200 => Operation.response("Account", "application/json", array_of_relationships()) + } + } + end + + def show_operation do + %Operation{ + tags: ["accounts"], + summary: "Account", + operationId: "AccountController.show", + description: "View information about a profile.", + parameters: [%Reference{"$ref": "#/components/parameters/accountIdOrNickname"}], + responses: %{ + 200 => Operation.response("Account", "application/json", Account), + 404 => Operation.response("Error", "application/json", ApiError) + } + } + end + + def statuses_operation do + %Operation{ + tags: ["accounts"], + summary: "Statuses", + operationId: "AccountController.statuses", + description: + "Statuses posted to the given account. Public (for public statuses only), or user token + `read:statuses` (for private statuses the user is authorized to see)", + parameters: + [ + %Reference{"$ref": "#/components/parameters/accountIdOrNickname"}, + Operation.parameter(:pinned, :query, BooleanLike, "Include only pinned statuses"), + Operation.parameter(:tagged, :query, :string, "With tag"), + Operation.parameter( + :only_media, + :query, + BooleanLike, + "Include only statuses with media attached" + ), + Operation.parameter( + :with_muted, + :query, + BooleanLike, + "Include statuses from muted acccounts." + ), + Operation.parameter(:exclude_reblogs, :query, BooleanLike, "Exclude reblogs"), + Operation.parameter(:exclude_replies, :query, BooleanLike, "Exclude replies"), + Operation.parameter( + :exclude_visibilities, + :query, + %Schema{type: :array, items: VisibilityScope}, + "Exclude visibilities" + ) + ] ++ pagination_params(), + responses: %{ + 200 => Operation.response("Statuses", "application/json", array_of_statuses()), + 404 => Operation.response("Error", "application/json", ApiError) + } + } + end + + def followers_operation do + %Operation{ + tags: ["accounts"], + summary: "Followers", + operationId: "AccountController.followers", + security: [%{"oAuth" => ["read:accounts"]}], + description: + "Accounts which follow the given account, if network is not hidden by the account owner.", + parameters: + [%Reference{"$ref": "#/components/parameters/accountIdOrNickname"}] ++ pagination_params(), + responses: %{ + 200 => Operation.response("Accounts", "application/json", array_of_accounts()) + } + } + end + + def following_operation do + %Operation{ + tags: ["accounts"], + summary: "Following", + operationId: "AccountController.following", + security: [%{"oAuth" => ["read:accounts"]}], + description: + "Accounts which the given account is following, if network is not hidden by the account owner.", + parameters: + [%Reference{"$ref": "#/components/parameters/accountIdOrNickname"}] ++ pagination_params(), + responses: %{200 => Operation.response("Accounts", "application/json", array_of_accounts())} + } + end + + def lists_operation do + %Operation{ + tags: ["accounts"], + summary: "Lists containing this account", + operationId: "AccountController.lists", + security: [%{"oAuth" => ["read:lists"]}], + description: "User lists that you have added this account to.", + parameters: [%Reference{"$ref": "#/components/parameters/accountIdOrNickname"}], + responses: %{200 => Operation.response("Lists", "application/json", array_of_lists())} + } + end + + def follow_operation do + %Operation{ + tags: ["accounts"], + summary: "Follow", + operationId: "AccountController.follow", + security: [%{"oAuth" => ["follow", "write:follows"]}], + description: "Follow the given account", + parameters: [ + %Reference{"$ref": "#/components/parameters/accountIdOrNickname"}, + Operation.parameter( + :reblogs, + :query, + BooleanLike, + "Receive this account's reblogs in home timeline? Defaults to true." + ) + ], + responses: %{ + 200 => Operation.response("Relationship", "application/json", AccountRelationship), + 400 => Operation.response("Error", "application/json", ApiError), + 404 => Operation.response("Error", "application/json", ApiError) + } + } + end + + def unfollow_operation do + %Operation{ + tags: ["accounts"], + summary: "Unfollow", + operationId: "AccountController.unfollow", + security: [%{"oAuth" => ["follow", "write:follows"]}], + description: "Unfollow the given account", + parameters: [%Reference{"$ref": "#/components/parameters/accountIdOrNickname"}], + responses: %{ + 200 => Operation.response("Relationship", "application/json", AccountRelationship), + 400 => Operation.response("Error", "application/json", ApiError), + 404 => Operation.response("Error", "application/json", ApiError) + } + } + end + + def mute_operation do + %Operation{ + tags: ["accounts"], + summary: "Mute", + operationId: "AccountController.mute", + security: [%{"oAuth" => ["follow", "write:mutes"]}], + requestBody: request_body("Parameters", mute_request()), + description: + "Mute the given account. Clients should filter statuses and notifications from this account, if received (e.g. due to a boost in the Home timeline).", + parameters: [ + %Reference{"$ref": "#/components/parameters/accountIdOrNickname"}, + Operation.parameter( + :notifications, + :query, + %Schema{allOf: [BooleanLike], default: true}, + "Mute notifications in addition to statuses? Defaults to `true`." + ) + ], + responses: %{ + 200 => Operation.response("Relationship", "application/json", AccountRelationship) + } + } + end + + def unmute_operation do + %Operation{ + tags: ["accounts"], + summary: "Unmute", + operationId: "AccountController.unmute", + security: [%{"oAuth" => ["follow", "write:mutes"]}], + description: "Unmute the given account.", + parameters: [%Reference{"$ref": "#/components/parameters/accountIdOrNickname"}], + responses: %{ + 200 => Operation.response("Relationship", "application/json", AccountRelationship) + } + } + end + + def block_operation do + %Operation{ + tags: ["accounts"], + summary: "Block", + operationId: "AccountController.block", + security: [%{"oAuth" => ["follow", "write:blocks"]}], + description: + "Block the given account. Clients should filter statuses from this account if received (e.g. due to a boost in the Home timeline)", + parameters: [%Reference{"$ref": "#/components/parameters/accountIdOrNickname"}], + responses: %{ + 200 => Operation.response("Relationship", "application/json", AccountRelationship) + } + } + end + + def unblock_operation do + %Operation{ + tags: ["accounts"], + summary: "Unblock", + operationId: "AccountController.unblock", + security: [%{"oAuth" => ["follow", "write:blocks"]}], + description: "Unblock the given account.", + parameters: [%Reference{"$ref": "#/components/parameters/accountIdOrNickname"}], + responses: %{ + 200 => Operation.response("Relationship", "application/json", AccountRelationship) + } + } + end + + def follow_by_uri_operation do + %Operation{ + tags: ["accounts"], + summary: "Follow by URI", + operationId: "AccountController.follows", + security: [%{"oAuth" => ["follow", "write:follows"]}], + requestBody: request_body("Parameters", follow_by_uri_request(), required: true), + responses: %{ + 200 => Operation.response("Account", "application/json", AccountRelationship), + 400 => Operation.response("Error", "application/json", ApiError), + 404 => Operation.response("Error", "application/json", ApiError) + } + } + end + + def mutes_operation do + %Operation{ + tags: ["accounts"], + summary: "Muted accounts", + operationId: "AccountController.mutes", + description: "Accounts the user has muted.", + security: [%{"oAuth" => ["follow", "read:mutes"]}], + responses: %{ + 200 => Operation.response("Accounts", "application/json", array_of_accounts()) + } + } + end + + def blocks_operation do + %Operation{ + tags: ["accounts"], + summary: "Blocked users", + operationId: "AccountController.blocks", + description: "View your blocks. See also accounts/:id/{block,unblock}", + security: [%{"oAuth" => ["read:blocks"]}], + responses: %{ + 200 => Operation.response("Accounts", "application/json", array_of_accounts()) + } + } + end + + def endorsements_operation do + %Operation{ + tags: ["accounts"], + summary: "Endorsements", + operationId: "AccountController.endorsements", + description: "Not implemented", + security: [%{"oAuth" => ["read:accounts"]}], + responses: %{ + 200 => empty_array_response() + } + } + end + + def identity_proofs_operation do + %Operation{ + tags: ["accounts"], + summary: "Identity proofs", + operationId: "AccountController.identity_proofs", + description: "Not implemented", + responses: %{ + 200 => empty_array_response() + } + } + end + + defp create_request do + %Schema{ + title: "AccountCreateRequest", + description: "POST body for creating an account", + type: :object, + required: [:username, :password, :agreement], + properties: %{ + reason: %Schema{ + type: :string, + nullable: true, + description: + "Text that will be reviewed by moderators if registrations require manual approval" + }, + username: %Schema{type: :string, description: "The desired username for the account"}, + email: %Schema{ + type: :string, + nullable: true, + description: + "The email address to be used for login. Required when `account_activation_required` is enabled.", + format: :email + }, + password: %Schema{ + type: :string, + description: "The password to be used for login", + format: :password + }, + agreement: %Schema{ + type: :boolean, + description: + "Whether the user agrees to the local rules, terms, and policies. These should be presented to the user in order to allow them to consent before setting this parameter to TRUE." + }, + locale: %Schema{ + type: :string, + nullable: true, + description: "The language of the confirmation email that will be sent" + }, + # Pleroma-specific properties: + fullname: %Schema{type: :string, nullable: true, description: "Full name"}, + bio: %Schema{type: :string, description: "Bio", nullable: true, default: ""}, + captcha_solution: %Schema{ + type: :string, + nullable: true, + description: "Provider-specific captcha solution" + }, + captcha_token: %Schema{ + type: :string, + nullable: true, + description: "Provider-specific captcha token" + }, + captcha_answer_data: %Schema{ + type: :string, + nullable: true, + description: "Provider-specific captcha data" + }, + token: %Schema{ + type: :string, + nullable: true, + description: "Invite token required when the registrations aren't public" + } + }, + example: %{ + "username" => "cofe", + "email" => "cofe@example.com", + "password" => "secret", + "agreement" => "true", + "bio" => "☕️" + } + } + end + + defp create_response do + %Schema{ + title: "AccountCreateResponse", + description: "Response schema for an account", + type: :object, + properties: %{ + token_type: %Schema{type: :string}, + access_token: %Schema{type: :string}, + scope: %Schema{type: :array, items: %Schema{type: :string}}, + created_at: %Schema{type: :integer, format: :"date-time"} + }, + example: %{ + "access_token" => "i9hAVVzGld86Pl5JtLtizKoXVvtTlSCJvwaugCxvZzk", + "created_at" => 1_585_918_714, + "scope" => ["read", "write", "follow", "push"], + "token_type" => "Bearer" + } + } + end + + defp update_creadentials_request do + %Schema{ + title: "AccountUpdateCredentialsRequest", + description: "POST body for creating an account", + type: :object, + properties: %{ + bot: %Schema{ + type: :boolean, + nullable: true, + description: "Whether the account has a bot flag." + }, + display_name: %Schema{ + type: :string, + nullable: true, + description: "The display name to use for the profile." + }, + note: %Schema{type: :string, description: "The account bio."}, + avatar: %Schema{ + type: :string, + nullable: true, + description: "Avatar image encoded using multipart/form-data", + format: :binary + }, + header: %Schema{ + type: :string, + nullable: true, + description: "Header image encoded using multipart/form-data", + format: :binary + }, + locked: %Schema{ + type: :boolean, + nullable: true, + description: "Whether manual approval of follow requests is required." + }, + fields_attributes: %Schema{ + nullable: true, + oneOf: [ + %Schema{type: :array, items: attribute_field()}, + %Schema{type: :object, additionalProperties: %Schema{type: attribute_field()}} + ] + }, + # NOTE: `source` field is not supported + # + # source: %Schema{ + # type: :object, + # properties: %{ + # privacy: %Schema{type: :string}, + # sensitive: %Schema{type: :boolean}, + # language: %Schema{type: :string} + # } + # }, + + # Pleroma-specific fields + no_rich_text: %Schema{ + type: :boolean, + nullable: true, + description: "html tags are stripped from all statuses requested from the API" + }, + hide_followers: %Schema{ + type: :boolean, + nullable: true, + description: "user's followers will be hidden" + }, + hide_follows: %Schema{ + type: :boolean, + nullable: true, + description: "user's follows will be hidden" + }, + hide_followers_count: %Schema{ + type: :boolean, + nullable: true, + description: "user's follower count will be hidden" + }, + hide_follows_count: %Schema{ + type: :boolean, + nullable: true, + description: "user's follow count will be hidden" + }, + hide_favorites: %Schema{ + type: :boolean, + nullable: true, + description: "user's favorites timeline will be hidden" + }, + show_role: %Schema{ + type: :boolean, + nullable: true, + description: "user's role (e.g admin, moderator) will be exposed to anyone in the + API" + }, + default_scope: VisibilityScope, + pleroma_settings_store: %Schema{ + type: :object, + nullable: true, + description: "Opaque user settings to be saved on the backend." + }, + skip_thread_containment: %Schema{ + type: :boolean, + nullable: true, + description: "Skip filtering out broken threads" + }, + allow_following_move: %Schema{ + type: :boolean, + nullable: true, + description: "Allows automatically follow moved following accounts" + }, + pleroma_background_image: %Schema{ + type: :string, + nullable: true, + description: "Sets the background image of the user.", + format: :binary + }, + discoverable: %Schema{ + type: :boolean, + nullable: true, + description: + "Discovery of this account in search results and other services is allowed." + }, + actor_type: ActorType + }, + example: %{ + bot: false, + display_name: "cofe", + note: "foobar", + fields_attributes: [%{name: "foo", value: "bar"}], + no_rich_text: false, + hide_followers: true, + hide_follows: false, + hide_followers_count: false, + hide_follows_count: false, + hide_favorites: false, + show_role: false, + default_scope: "private", + pleroma_settings_store: %{"pleroma-fe" => %{"key" => "val"}}, + skip_thread_containment: false, + allow_following_move: false, + discoverable: false, + actor_type: "Person" + } + } + end + + def array_of_accounts do + %Schema{ + title: "ArrayOfAccounts", + type: :array, + items: Account, + example: [Account.schema().example] + } + end + + defp array_of_relationships do + %Schema{ + title: "ArrayOfRelationships", + description: "Response schema for account relationships", + type: :array, + items: AccountRelationship, + example: [ + %{ + "id" => "1", + "following" => true, + "showing_reblogs" => true, + "followed_by" => true, + "blocking" => false, + "blocked_by" => true, + "muting" => false, + "muting_notifications" => false, + "requested" => false, + "domain_blocking" => false, + "subscribing" => false, + "endorsed" => true + }, + %{ + "id" => "2", + "following" => true, + "showing_reblogs" => true, + "followed_by" => true, + "blocking" => false, + "blocked_by" => true, + "muting" => true, + "muting_notifications" => false, + "requested" => true, + "domain_blocking" => false, + "subscribing" => false, + "endorsed" => false + }, + %{ + "id" => "3", + "following" => true, + "showing_reblogs" => true, + "followed_by" => true, + "blocking" => true, + "blocked_by" => false, + "muting" => true, + "muting_notifications" => false, + "requested" => false, + "domain_blocking" => true, + "subscribing" => true, + "endorsed" => false + } + ] + } + end + + defp follow_by_uri_request do + %Schema{ + title: "AccountFollowsRequest", + description: "POST body for muting an account", + type: :object, + properties: %{ + uri: %Schema{type: :string, nullable: true, format: :uri} + }, + required: [:uri] + } + end + + defp mute_request do + %Schema{ + title: "AccountMuteRequest", + description: "POST body for muting an account", + type: :object, + properties: %{ + notifications: %Schema{ + type: :boolean, + nullable: true, + description: "Mute notifications in addition to statuses? Defaults to true.", + default: true + } + }, + example: %{ + "notifications" => true + } + } + end + + defp array_of_lists do + %Schema{ + title: "ArrayOfLists", + description: "Response schema for lists", + type: :array, + items: List, + example: [ + %{"id" => "123", "title" => "my list"}, + %{"id" => "1337", "title" => "anotehr list"} + ] + } + end + + defp array_of_statuses do + %Schema{ + title: "ArrayOfStatuses", + type: :array, + items: Status + } + end + + defp attribute_field do + %Schema{ + title: "AccountAttributeField", + description: "Request schema for account custom fields", + type: :object, + properties: %{ + name: %Schema{type: :string}, + value: %Schema{type: :string} + }, + required: [:name, :value], + example: %{ + "name" => "Website", + "value" => "https://pleroma.com" + } + } + end +end diff --git a/lib/pleroma/web/api_spec/operations/app_operation.ex b/lib/pleroma/web/api_spec/operations/app_operation.ex new file mode 100644 index 000000000..ae01cbbec --- /dev/null +++ b/lib/pleroma/web/api_spec/operations/app_operation.ex @@ -0,0 +1,148 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.AppOperation do + alias OpenApiSpex.Operation + alias OpenApiSpex.Schema + alias Pleroma.Web.ApiSpec.Helpers + + @spec open_api_operation(atom) :: Operation.t() + def open_api_operation(action) do + operation = String.to_existing_atom("#{action}_operation") + apply(__MODULE__, operation, []) + end + + @spec create_operation() :: Operation.t() + def create_operation do + %Operation{ + tags: ["apps"], + summary: "Create an application", + description: "Create a new application to obtain OAuth2 credentials", + operationId: "AppController.create", + requestBody: Helpers.request_body("Parameters", create_request(), required: true), + responses: %{ + 200 => Operation.response("App", "application/json", create_response()), + 422 => + Operation.response( + "Unprocessable Entity", + "application/json", + %Schema{ + type: :object, + description: + "If a required parameter is missing or improperly formatted, the request will fail.", + properties: %{ + error: %Schema{type: :string} + }, + example: %{ + "error" => "Validation failed: Redirect URI must be an absolute URI." + } + } + ) + } + } + end + + def verify_credentials_operation do + %Operation{ + tags: ["apps"], + summary: "Verify your app works", + description: "Confirm that the app's OAuth2 credentials work.", + operationId: "AppController.verify_credentials", + security: [%{"oAuth" => ["read"]}], + responses: %{ + 200 => + Operation.response("App", "application/json", %Schema{ + type: :object, + description: + "If the Authorization header was provided with a valid token, you should see your app returned as an Application entity.", + properties: %{ + name: %Schema{type: :string}, + vapid_key: %Schema{type: :string}, + website: %Schema{type: :string, nullable: true} + }, + example: %{ + "name" => "My App", + "vapid_key" => + "BCk-QqERU0q-CfYZjcuB6lnyyOYfJ2AifKqfeGIm7Z-HiTU5T9eTG5GxVA0_OH5mMlI4UkkDTpaZwozy0TzdZ2M=", + "website" => "https://myapp.com/" + } + }), + 422 => + Operation.response( + "Unauthorized", + "application/json", + %Schema{ + type: :object, + description: + "If the Authorization header contains an invalid token, is malformed, or is not present, an error will be returned indicating an authorization failure.", + properties: %{ + error: %Schema{type: :string} + }, + example: %{ + "error" => "The access token is invalid." + } + } + ) + } + } + end + + defp create_request do + %Schema{ + title: "AppCreateRequest", + description: "POST body for creating an app", + type: :object, + properties: %{ + client_name: %Schema{type: :string, description: "A name for your application."}, + redirect_uris: %Schema{ + type: :string, + description: + "Where the user should be redirected after authorization. To display the authorization code to the user instead of redirecting to a web page, use `urn:ietf:wg:oauth:2.0:oob` in this parameter." + }, + scopes: %Schema{ + type: :string, + description: "Space separated list of scopes", + default: "read" + }, + website: %Schema{ + type: :string, + nullable: true, + description: "A URL to the homepage of your app" + } + }, + required: [:client_name, :redirect_uris], + example: %{ + "client_name" => "My App", + "redirect_uris" => "https://myapp.com/auth/callback", + "website" => "https://myapp.com/" + } + } + end + + defp create_response do + %Schema{ + title: "AppCreateResponse", + description: "Response schema for an app", + type: :object, + properties: %{ + id: %Schema{type: :string}, + name: %Schema{type: :string}, + client_id: %Schema{type: :string}, + client_secret: %Schema{type: :string}, + redirect_uri: %Schema{type: :string}, + vapid_key: %Schema{type: :string}, + website: %Schema{type: :string, nullable: true} + }, + example: %{ + "id" => "123", + "name" => "My App", + "client_id" => "TWhM-tNSuncnqN7DBJmoyeLnk6K3iJJ71KKXxgL1hPM", + "client_secret" => "ZEaFUFmF0umgBX1qKJDjaU99Q31lDkOU8NutzTOoliw", + "vapid_key" => + "BCk-QqERU0q-CfYZjcuB6lnyyOYfJ2AifKqfeGIm7Z-HiTU5T9eTG5GxVA0_OH5mMlI4UkkDTpaZwozy0TzdZ2M=", + "website" => "https://myapp.com/" + } + } + end +end diff --git a/lib/pleroma/web/api_spec/operations/conversation_operation.ex b/lib/pleroma/web/api_spec/operations/conversation_operation.ex new file mode 100644 index 000000000..475468893 --- /dev/null +++ b/lib/pleroma/web/api_spec/operations/conversation_operation.ex @@ -0,0 +1,61 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.ConversationOperation do + alias OpenApiSpex.Operation + alias OpenApiSpex.Schema + alias Pleroma.Web.ApiSpec.Schemas.Conversation + alias Pleroma.Web.ApiSpec.Schemas.FlakeID + + import Pleroma.Web.ApiSpec.Helpers + + def open_api_operation(action) do + operation = String.to_existing_atom("#{action}_operation") + apply(__MODULE__, operation, []) + end + + def index_operation do + %Operation{ + tags: ["Conversations"], + summary: "Show conversation", + security: [%{"oAuth" => ["read:statuses"]}], + operationId: "ConversationController.index", + parameters: [ + Operation.parameter( + :recipients, + :query, + %Schema{type: :array, items: FlakeID}, + "Only return conversations with the given recipients (a list of user ids)" + ) + | pagination_params() + ], + responses: %{ + 200 => + Operation.response("Array of Conversation", "application/json", %Schema{ + type: :array, + items: Conversation, + example: [Conversation.schema().example] + }) + } + } + end + + def mark_as_read_operation do + %Operation{ + tags: ["Conversations"], + summary: "Mark as read", + operationId: "ConversationController.mark_as_read", + parameters: [ + Operation.parameter(:id, :path, :string, "Conversation ID", + example: "123", + required: true + ) + ], + security: [%{"oAuth" => ["write:conversations"]}], + responses: %{ + 200 => Operation.response("Conversation", "application/json", Conversation) + } + } + end +end diff --git a/lib/pleroma/web/api_spec/operations/custom_emoji_operation.ex b/lib/pleroma/web/api_spec/operations/custom_emoji_operation.ex new file mode 100644 index 000000000..2f812ac77 --- /dev/null +++ b/lib/pleroma/web/api_spec/operations/custom_emoji_operation.ex @@ -0,0 +1,88 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.CustomEmojiOperation do + alias OpenApiSpex.Operation + alias OpenApiSpex.Schema + alias Pleroma.Web.ApiSpec.Schemas.Emoji + + def open_api_operation(action) do + operation = String.to_existing_atom("#{action}_operation") + apply(__MODULE__, operation, []) + end + + def index_operation do + %Operation{ + tags: ["custom_emojis"], + summary: "List custom custom emojis", + description: "Returns custom emojis that are available on the server.", + operationId: "CustomEmojiController.index", + responses: %{ + 200 => Operation.response("Custom Emojis", "application/json", resposnse()) + } + } + end + + defp resposnse do + %Schema{ + title: "CustomEmojisResponse", + description: "Response schema for custom emojis", + type: :array, + items: custom_emoji(), + example: [ + %{ + "category" => "Fun", + "shortcode" => "blank", + "static_url" => "https://lain.com/emoji/blank.png", + "tags" => ["Fun"], + "url" => "https://lain.com/emoji/blank.png", + "visible_in_picker" => false + }, + %{ + "category" => "Gif,Fun", + "shortcode" => "firefox", + "static_url" => "https://lain.com/emoji/Firefox.gif", + "tags" => ["Gif", "Fun"], + "url" => "https://lain.com/emoji/Firefox.gif", + "visible_in_picker" => true + }, + %{ + "category" => "pack:mixed", + "shortcode" => "sadcat", + "static_url" => "https://lain.com/emoji/mixed/sadcat.png", + "tags" => ["pack:mixed"], + "url" => "https://lain.com/emoji/mixed/sadcat.png", + "visible_in_picker" => true + } + ] + } + end + + defp custom_emoji do + %Schema{ + title: "CustomEmoji", + description: "Schema for a CustomEmoji", + allOf: [ + Emoji, + %Schema{ + type: :object, + properties: %{ + category: %Schema{type: :string}, + tags: %Schema{type: :array} + } + } + ], + example: %{ + "category" => "Fun", + "shortcode" => "aaaa", + "url" => + "https://files.mastodon.social/custom_emojis/images/000/007/118/original/aaaa.png", + "static_url" => + "https://files.mastodon.social/custom_emojis/images/000/007/118/static/aaaa.png", + "visible_in_picker" => true, + "tags" => ["Gif", "Fun"] + } + } + end +end diff --git a/lib/pleroma/web/api_spec/operations/domain_block_operation.ex b/lib/pleroma/web/api_spec/operations/domain_block_operation.ex new file mode 100644 index 000000000..049bcf931 --- /dev/null +++ b/lib/pleroma/web/api_spec/operations/domain_block_operation.ex @@ -0,0 +1,83 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.DomainBlockOperation do + alias OpenApiSpex.Operation + alias OpenApiSpex.Schema + import Pleroma.Web.ApiSpec.Helpers + + def open_api_operation(action) do + operation = String.to_existing_atom("#{action}_operation") + apply(__MODULE__, operation, []) + end + + def index_operation do + %Operation{ + tags: ["domain_blocks"], + summary: "Fetch domain blocks", + description: "View domains the user has blocked.", + security: [%{"oAuth" => ["follow", "read:blocks"]}], + operationId: "DomainBlockController.index", + responses: %{ + 200 => + Operation.response("Domain blocks", "application/json", %Schema{ + description: "Response schema for domain blocks", + type: :array, + items: %Schema{type: :string}, + example: ["google.com", "facebook.com"] + }) + } + } + end + + def create_operation do + %Operation{ + tags: ["domain_blocks"], + summary: "Block a domain", + description: """ + Block a domain to: + + - hide all public posts from it + - hide all notifications from it + - remove all followers from it + - prevent following new users from it (but does not remove existing follows) + """, + operationId: "DomainBlockController.create", + requestBody: domain_block_request(), + security: [%{"oAuth" => ["follow", "write:blocks"]}], + responses: %{200 => empty_object_response()} + } + end + + def delete_operation do + %Operation{ + tags: ["domain_blocks"], + summary: "Unblock a domain", + description: "Remove a domain block, if it exists in the user's array of blocked domains.", + operationId: "DomainBlockController.delete", + requestBody: domain_block_request(), + security: [%{"oAuth" => ["follow", "write:blocks"]}], + responses: %{ + 200 => Operation.response("Empty object", "application/json", %Schema{type: :object}) + } + } + end + + defp domain_block_request do + request_body( + "Parameters", + %Schema{ + type: :object, + properties: %{ + domain: %Schema{type: :string} + }, + required: [:domain] + }, + required: true, + example: %{ + "domain" => "facebook.com" + } + ) + end +end diff --git a/lib/pleroma/web/api_spec/operations/filter_operation.ex b/lib/pleroma/web/api_spec/operations/filter_operation.ex new file mode 100644 index 000000000..7310c1c4d --- /dev/null +++ b/lib/pleroma/web/api_spec/operations/filter_operation.ex @@ -0,0 +1,229 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.FilterOperation do + alias OpenApiSpex.Operation + alias OpenApiSpex.Schema + alias Pleroma.Web.ApiSpec.Helpers + + def open_api_operation(action) do + operation = String.to_existing_atom("#{action}_operation") + apply(__MODULE__, operation, []) + end + + def index_operation do + %Operation{ + tags: ["apps"], + summary: "View all filters", + operationId: "FilterController.index", + security: [%{"oAuth" => ["read:filters"]}], + responses: %{ + 200 => Operation.response("Filters", "application/json", array_of_filters()) + } + } + end + + def create_operation do + %Operation{ + tags: ["apps"], + summary: "Create a filter", + operationId: "FilterController.create", + requestBody: Helpers.request_body("Parameters", create_request(), required: true), + security: [%{"oAuth" => ["write:filters"]}], + responses: %{200 => Operation.response("Filter", "application/json", filter())} + } + end + + def show_operation do + %Operation{ + tags: ["apps"], + summary: "View all filters", + parameters: [id_param()], + operationId: "FilterController.show", + security: [%{"oAuth" => ["read:filters"]}], + responses: %{ + 200 => Operation.response("Filter", "application/json", filter()) + } + } + end + + def update_operation do + %Operation{ + tags: ["apps"], + summary: "Update a filter", + parameters: [id_param()], + operationId: "FilterController.update", + requestBody: Helpers.request_body("Parameters", update_request(), required: true), + security: [%{"oAuth" => ["write:filters"]}], + responses: %{ + 200 => Operation.response("Filter", "application/json", filter()) + } + } + end + + def delete_operation do + %Operation{ + tags: ["apps"], + summary: "Remove a filter", + parameters: [id_param()], + operationId: "FilterController.delete", + security: [%{"oAuth" => ["write:filters"]}], + responses: %{ + 200 => + Operation.response("Filter", "application/json", %Schema{ + type: :object, + description: "Empty object" + }) + } + } + end + + defp id_param do + Operation.parameter(:id, :path, :string, "Filter ID", example: "123", required: true) + end + + defp filter do + %Schema{ + title: "Filter", + type: :object, + properties: %{ + id: %Schema{type: :string}, + phrase: %Schema{type: :string, description: "The text to be filtered"}, + context: %Schema{ + type: :array, + items: %Schema{type: :string, enum: ["home", "notifications", "public", "thread"]}, + description: "The contexts in which the filter should be applied." + }, + expires_at: %Schema{ + type: :string, + format: :"date-time", + description: + "When the filter should no longer be applied. String (ISO 8601 Datetime), or null if the filter does not expire.", + nullable: true + }, + irreversible: %Schema{ + type: :boolean, + description: + "Should matching entities in home and notifications be dropped by the server?" + }, + whole_word: %Schema{ + type: :boolean, + description: "Should the filter consider word boundaries?" + } + }, + example: %{ + "id" => "5580", + "phrase" => "@twitter.com", + "context" => [ + "home", + "notifications", + "public", + "thread" + ], + "whole_word" => false, + "expires_at" => nil, + "irreversible" => true + } + } + end + + defp array_of_filters do + %Schema{ + title: "ArrayOfFilters", + description: "Array of Filters", + type: :array, + items: filter(), + example: [ + %{ + "id" => "5580", + "phrase" => "@twitter.com", + "context" => [ + "home", + "notifications", + "public", + "thread" + ], + "whole_word" => false, + "expires_at" => nil, + "irreversible" => true + }, + %{ + "id" => "6191", + "phrase" => ":eurovision2019:", + "context" => [ + "home" + ], + "whole_word" => true, + "expires_at" => "2019-05-21T13:47:31.333Z", + "irreversible" => false + } + ] + } + end + + defp create_request do + %Schema{ + title: "FilterCreateRequest", + allOf: [ + update_request(), + %Schema{ + type: :object, + properties: %{ + irreversible: %Schema{ + type: :bolean, + description: + "Should the server irreversibly drop matching entities from home and notifications?", + default: false + } + } + } + ], + example: %{ + "phrase" => "knights", + "context" => ["home"] + } + } + end + + defp update_request do + %Schema{ + title: "FilterUpdateRequest", + type: :object, + properties: %{ + phrase: %Schema{type: :string, description: "The text to be filtered"}, + context: %Schema{ + type: :array, + items: %Schema{type: :string, enum: ["home", "notifications", "public", "thread"]}, + description: + "Array of enumerable strings `home`, `notifications`, `public`, `thread`. At least one context must be specified." + }, + irreversible: %Schema{ + type: :boolean, + nullable: true, + description: + "Should the server irreversibly drop matching entities from home and notifications?" + }, + whole_word: %Schema{ + type: :boolean, + nullable: true, + description: "Consider word boundaries?", + default: true + } + # TODO: probably should implement filter expiration + # expires_in: %Schema{ + # type: :string, + # format: :"date-time", + # description: + # "ISO 8601 Datetime for when the filter expires. Otherwise, + # null for a filter that doesn't expire." + # } + }, + required: [:phrase, :context], + example: %{ + "phrase" => "knights", + "context" => ["home"] + } + } + end +end diff --git a/lib/pleroma/web/api_spec/operations/follow_request_operation.ex b/lib/pleroma/web/api_spec/operations/follow_request_operation.ex new file mode 100644 index 000000000..ac4aee6da --- /dev/null +++ b/lib/pleroma/web/api_spec/operations/follow_request_operation.ex @@ -0,0 +1,65 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.FollowRequestOperation do + alias OpenApiSpex.Operation + alias OpenApiSpex.Schema + alias Pleroma.Web.ApiSpec.Schemas.Account + alias Pleroma.Web.ApiSpec.Schemas.AccountRelationship + + def open_api_operation(action) do + operation = String.to_existing_atom("#{action}_operation") + apply(__MODULE__, operation, []) + end + + def index_operation do + %Operation{ + tags: ["Follow Requests"], + summary: "Pending Follows", + security: [%{"oAuth" => ["read:follows", "follow"]}], + operationId: "FollowRequestController.index", + responses: %{ + 200 => + Operation.response("Array of Account", "application/json", %Schema{ + type: :array, + items: Account, + example: [Account.schema().example] + }) + } + } + end + + def authorize_operation do + %Operation{ + tags: ["Follow Requests"], + summary: "Accept Follow", + operationId: "FollowRequestController.authorize", + parameters: [id_param()], + security: [%{"oAuth" => ["follow", "write:follows"]}], + responses: %{ + 200 => Operation.response("Relationship", "application/json", AccountRelationship) + } + } + end + + def reject_operation do + %Operation{ + tags: ["Follow Requests"], + summary: "Reject Follow", + operationId: "FollowRequestController.reject", + parameters: [id_param()], + security: [%{"oAuth" => ["follow", "write:follows"]}], + responses: %{ + 200 => Operation.response("Relationship", "application/json", AccountRelationship) + } + } + end + + defp id_param do + Operation.parameter(:id, :path, :string, "Conversation ID", + example: "123", + required: true + ) + end +end diff --git a/lib/pleroma/web/api_spec/operations/instance_operation.ex b/lib/pleroma/web/api_spec/operations/instance_operation.ex new file mode 100644 index 000000000..880bd3f1b --- /dev/null +++ b/lib/pleroma/web/api_spec/operations/instance_operation.ex @@ -0,0 +1,169 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.InstanceOperation do + alias OpenApiSpex.Operation + alias OpenApiSpex.Schema + + def open_api_operation(action) do + operation = String.to_existing_atom("#{action}_operation") + apply(__MODULE__, operation, []) + end + + def show_operation do + %Operation{ + tags: ["Instance"], + summary: "Fetch instance", + description: "Information about the server", + operationId: "InstanceController.show", + responses: %{ + 200 => Operation.response("Instance", "application/json", instance()) + } + } + end + + def peers_operation do + %Operation{ + tags: ["Instance"], + summary: "List of known hosts", + operationId: "InstanceController.peers", + responses: %{ + 200 => Operation.response("Array of domains", "application/json", array_of_domains()) + } + } + end + + defp instance do + %Schema{ + type: :object, + properties: %{ + uri: %Schema{type: :string, description: "The domain name of the instance"}, + title: %Schema{type: :string, description: "The title of the website"}, + description: %Schema{ + type: :string, + description: "Admin-defined description of the Pleroma site" + }, + version: %Schema{ + type: :string, + description: "The version of Pleroma installed on the instance" + }, + email: %Schema{ + type: :string, + description: "An email that may be contacted for any inquiries", + format: :email + }, + urls: %Schema{ + type: :object, + description: "URLs of interest for clients apps", + properties: %{ + streaming_api: %Schema{ + type: :string, + description: "Websockets address for push streaming" + } + } + }, + stats: %Schema{ + type: :object, + description: "Statistics about how much information the instance contains", + properties: %{ + user_count: %Schema{ + type: :integer, + description: "Users registered on this instance" + }, + status_count: %Schema{ + type: :integer, + description: "Statuses authored by users on instance" + }, + domain_count: %Schema{ + type: :integer, + description: "Domains federated with this instance" + } + } + }, + thumbnail: %Schema{ + type: :string, + description: "Banner image for the website", + nullable: true + }, + languages: %Schema{ + type: :array, + items: %Schema{type: :string}, + description: "Primary langauges of the website and its staff" + }, + registrations: %Schema{type: :boolean, description: "Whether registrations are enabled"}, + # Extra (not present in Mastodon): + max_toot_chars: %Schema{ + type: :integer, + description: ": Posts character limit (CW/Subject included in the counter)" + }, + poll_limits: %Schema{ + type: :object, + description: "A map with poll limits for local polls", + properties: %{ + max_options: %Schema{ + type: :integer, + description: "Maximum number of options." + }, + max_option_chars: %Schema{ + type: :integer, + description: "Maximum number of characters per option." + }, + min_expiration: %Schema{ + type: :integer, + description: "Minimum expiration time (in seconds)." + }, + max_expiration: %Schema{ + type: :integer, + description: "Maximum expiration time (in seconds)." + } + } + }, + upload_limit: %Schema{ + type: :integer, + description: "File size limit of uploads (except for avatar, background, banner)" + }, + avatar_upload_limit: %Schema{type: :integer, description: "The title of the website"}, + background_upload_limit: %Schema{type: :integer, description: "The title of the website"}, + banner_upload_limit: %Schema{type: :integer, description: "The title of the website"} + }, + example: %{ + "avatar_upload_limit" => 2_000_000, + "background_upload_limit" => 4_000_000, + "banner_upload_limit" => 4_000_000, + "description" => "A Pleroma instance, an alternative fediverse server", + "email" => "lain@lain.com", + "languages" => ["en"], + "max_toot_chars" => 5000, + "poll_limits" => %{ + "max_expiration" => 31_536_000, + "max_option_chars" => 200, + "max_options" => 20, + "min_expiration" => 0 + }, + "registrations" => false, + "stats" => %{ + "domain_count" => 2996, + "status_count" => 15_802, + "user_count" => 5 + }, + "thumbnail" => "https://lain.com/instance/thumbnail.jpeg", + "title" => "lain.com", + "upload_limit" => 16_000_000, + "uri" => "https://lain.com", + "urls" => %{ + "streaming_api" => "wss://lain.com" + }, + "version" => "2.7.2 (compatible; Pleroma 2.0.50-536-g25eec6d7-develop)" + } + } + end + + defp array_of_domains do + %Schema{ + type: :array, + items: %Schema{type: :string}, + example: ["pleroma.site", "lain.com", "bikeshed.party"] + } + end +end diff --git a/lib/pleroma/web/api_spec/operations/list_operation.ex b/lib/pleroma/web/api_spec/operations/list_operation.ex new file mode 100644 index 000000000..c88ed5dd0 --- /dev/null +++ b/lib/pleroma/web/api_spec/operations/list_operation.ex @@ -0,0 +1,188 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.ListOperation do + alias OpenApiSpex.Operation + alias OpenApiSpex.Schema + alias Pleroma.Web.ApiSpec.Schemas.Account + alias Pleroma.Web.ApiSpec.Schemas.ApiError + alias Pleroma.Web.ApiSpec.Schemas.FlakeID + alias Pleroma.Web.ApiSpec.Schemas.List + + import Pleroma.Web.ApiSpec.Helpers + + def open_api_operation(action) do + operation = String.to_existing_atom("#{action}_operation") + apply(__MODULE__, operation, []) + end + + def index_operation do + %Operation{ + tags: ["Lists"], + summary: "Show user's lists", + description: "Fetch all lists that the user owns", + security: [%{"oAuth" => ["read:lists"]}], + operationId: "ListController.index", + responses: %{ + 200 => Operation.response("Array of List", "application/json", array_of_lists()) + } + } + end + + def create_operation do + %Operation{ + tags: ["Lists"], + summary: "Create a list", + description: "Fetch the list with the given ID. Used for verifying the title of a list.", + operationId: "ListController.create", + requestBody: create_update_request(), + security: [%{"oAuth" => ["write:lists"]}], + responses: %{ + 200 => Operation.response("List", "application/json", List), + 400 => Operation.response("Error", "application/json", ApiError), + 404 => Operation.response("Error", "application/json", ApiError) + } + } + end + + def show_operation do + %Operation{ + tags: ["Lists"], + summary: "Show a single list", + description: "Fetch the list with the given ID. Used for verifying the title of a list.", + operationId: "ListController.show", + parameters: [id_param()], + security: [%{"oAuth" => ["read:lists"]}], + responses: %{ + 200 => Operation.response("List", "application/json", List), + 404 => Operation.response("Error", "application/json", ApiError) + } + } + end + + def update_operation do + %Operation{ + tags: ["Lists"], + summary: "Update a list", + description: "Change the title of a list", + operationId: "ListController.update", + parameters: [id_param()], + requestBody: create_update_request(), + security: [%{"oAuth" => ["write:lists"]}], + responses: %{ + 200 => Operation.response("List", "application/json", List), + 422 => Operation.response("Error", "application/json", ApiError) + } + } + end + + def delete_operation do + %Operation{ + tags: ["Lists"], + summary: "Delete a list", + operationId: "ListController.delete", + parameters: [id_param()], + security: [%{"oAuth" => ["write:lists"]}], + responses: %{ + 200 => Operation.response("Empty object", "application/json", %Schema{type: :object}) + } + } + end + + def list_accounts_operation do + %Operation{ + tags: ["Lists"], + summary: "View accounts in list", + operationId: "ListController.list_accounts", + parameters: [id_param()], + security: [%{"oAuth" => ["read:lists"]}], + responses: %{ + 200 => + Operation.response("Array of Account", "application/json", %Schema{ + type: :array, + items: Account + }) + } + } + end + + def add_to_list_operation do + %Operation{ + tags: ["Lists"], + summary: "Add accounts to list", + description: "Add accounts to the given list.", + operationId: "ListController.add_to_list", + parameters: [id_param()], + requestBody: add_remove_accounts_request(), + security: [%{"oAuth" => ["write:lists"]}], + responses: %{ + 200 => Operation.response("Empty object", "application/json", %Schema{type: :object}) + } + } + end + + def remove_from_list_operation do + %Operation{ + tags: ["Lists"], + summary: "Remove accounts from list", + operationId: "ListController.remove_from_list", + parameters: [id_param()], + requestBody: add_remove_accounts_request(), + security: [%{"oAuth" => ["write:lists"]}], + responses: %{ + 200 => Operation.response("Empty object", "application/json", %Schema{type: :object}) + } + } + end + + defp array_of_lists do + %Schema{ + title: "ArrayOfLists", + description: "Response schema for lists", + type: :array, + items: List, + example: [ + %{"id" => "123", "title" => "my list"}, + %{"id" => "1337", "title" => "another list"} + ] + } + end + + defp id_param do + Operation.parameter(:id, :path, :string, "List ID", + example: "123", + required: true + ) + end + + defp create_update_request do + request_body( + "Parameters", + %Schema{ + description: "POST body for creating or updating a List", + type: :object, + properties: %{ + title: %Schema{type: :string, description: "List title"} + }, + required: [:title] + }, + required: true + ) + end + + defp add_remove_accounts_request do + request_body( + "Parameters", + %Schema{ + description: "POST body for adding/removing accounts to/from a List", + type: :object, + properties: %{ + account_ids: %Schema{type: :array, description: "Array of account IDs", items: FlakeID} + }, + required: [:account_ids] + }, + required: true + ) + end +end diff --git a/lib/pleroma/web/api_spec/operations/marker_operation.ex b/lib/pleroma/web/api_spec/operations/marker_operation.ex new file mode 100644 index 000000000..714ef1f99 --- /dev/null +++ b/lib/pleroma/web/api_spec/operations/marker_operation.ex @@ -0,0 +1,142 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.MarkerOperation do + alias OpenApiSpex.Operation + alias OpenApiSpex.Schema + alias Pleroma.Web.ApiSpec.Helpers + + def open_api_operation(action) do + operation = String.to_existing_atom("#{action}_operation") + apply(__MODULE__, operation, []) + end + + def index_operation do + %Operation{ + tags: ["Markers"], + summary: "Get saved timeline position", + security: [%{"oAuth" => ["read:statuses"]}], + operationId: "MarkerController.index", + parameters: [ + Operation.parameter( + :timeline, + :query, + %Schema{ + type: :array, + items: %Schema{type: :string, enum: ["home", "notifications"]} + }, + "Array of markers to fetch. If not provided, an empty object will be returned." + ) + ], + responses: %{ + 200 => Operation.response("Marker", "application/json", response()), + 403 => Operation.response("Error", "application/json", api_error()) + } + } + end + + def upsert_operation do + %Operation{ + tags: ["Markers"], + summary: "Save position in timeline", + operationId: "MarkerController.upsert", + requestBody: Helpers.request_body("Parameters", upsert_request(), required: true), + security: [%{"oAuth" => ["follow", "write:blocks"]}], + responses: %{ + 200 => Operation.response("Marker", "application/json", response()), + 403 => Operation.response("Error", "application/json", api_error()) + } + } + end + + defp marker do + %Schema{ + title: "Marker", + description: "Schema for a marker", + type: :object, + properties: %{ + last_read_id: %Schema{type: :string}, + version: %Schema{type: :integer}, + updated_at: %Schema{type: :string}, + pleroma: %Schema{ + type: :object, + properties: %{ + unread_count: %Schema{type: :integer} + } + } + }, + example: %{ + "last_read_id" => "35098814", + "version" => 361, + "updated_at" => "2019-11-26T22:37:25.239Z", + "pleroma" => %{"unread_count" => 5} + } + } + end + + defp response do + %Schema{ + title: "MarkersResponse", + description: "Response schema for markers", + type: :object, + properties: %{ + notifications: %Schema{allOf: [marker()], nullable: true}, + home: %Schema{allOf: [marker()], nullable: true} + }, + items: %Schema{type: :string}, + example: %{ + "notifications" => %{ + "last_read_id" => "35098814", + "version" => 361, + "updated_at" => "2019-11-26T22:37:25.239Z", + "pleroma" => %{"unread_count" => 0} + }, + "home" => %{ + "last_read_id" => "103206604258487607", + "version" => 468, + "updated_at" => "2019-11-26T22:37:25.235Z", + "pleroma" => %{"unread_count" => 10} + } + } + } + end + + defp upsert_request do + %Schema{ + title: "MarkersUpsertRequest", + description: "Request schema for marker upsert", + type: :object, + properties: %{ + notifications: %Schema{ + type: :object, + nullable: true, + properties: %{ + last_read_id: %Schema{nullable: true, type: :string} + } + }, + home: %Schema{ + type: :object, + nullable: true, + properties: %{ + last_read_id: %Schema{nullable: true, type: :string} + } + } + }, + example: %{ + "home" => %{ + "last_read_id" => "103194548672408537", + "version" => 462, + "updated_at" => "2019-11-24T19:39:39.337Z" + } + } + } + end + + defp api_error do + %Schema{ + type: :object, + properties: %{error: %Schema{type: :string}} + } + end +end diff --git a/lib/pleroma/web/api_spec/operations/notification_operation.ex b/lib/pleroma/web/api_spec/operations/notification_operation.ex new file mode 100644 index 000000000..64adc5319 --- /dev/null +++ b/lib/pleroma/web/api_spec/operations/notification_operation.ex @@ -0,0 +1,211 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.NotificationOperation do + alias OpenApiSpex.Operation + alias OpenApiSpex.Operation + alias OpenApiSpex.Schema + alias Pleroma.Web.ApiSpec.Schemas.Account + alias Pleroma.Web.ApiSpec.Schemas.ApiError + alias Pleroma.Web.ApiSpec.Schemas.BooleanLike + alias Pleroma.Web.ApiSpec.Schemas.Status + alias Pleroma.Web.ApiSpec.Schemas.VisibilityScope + + import Pleroma.Web.ApiSpec.Helpers + + def open_api_operation(action) do + operation = String.to_existing_atom("#{action}_operation") + apply(__MODULE__, operation, []) + end + + def index_operation do + %Operation{ + tags: ["Notifications"], + summary: "Get all notifications", + description: + "Notifications concerning the user. This API returns Link headers containing links to the next/previous page. However, the links can also be constructed dynamically using query params and `id` values.", + operationId: "NotificationController.index", + security: [%{"oAuth" => ["read:notifications"]}], + parameters: + [ + Operation.parameter( + :exclude_types, + :query, + %Schema{type: :array, items: notification_type()}, + "Array of types to exclude" + ), + Operation.parameter( + :account_id, + :query, + %Schema{type: :string}, + "Return only notifications received from this account" + ), + Operation.parameter( + :exclude_visibilities, + :query, + %Schema{type: :array, items: VisibilityScope}, + "Exclude the notifications for activities with the given visibilities" + ), + Operation.parameter( + :include_types, + :query, + %Schema{type: :array, items: notification_type()}, + "Include the notifications for activities with the given types" + ), + Operation.parameter( + :with_muted, + :query, + BooleanLike, + "Include the notifications from muted users" + ) + ] ++ pagination_params(), + responses: %{ + 200 => + Operation.response("Array of notifications", "application/json", %Schema{ + type: :array, + items: notification() + }), + 404 => Operation.response("Error", "application/json", ApiError) + } + } + end + + def show_operation do + %Operation{ + tags: ["Notifications"], + summary: "Get a single notification", + description: "View information about a notification with a given ID.", + operationId: "NotificationController.show", + security: [%{"oAuth" => ["read:notifications"]}], + parameters: [id_param()], + responses: %{ + 200 => Operation.response("Notification", "application/json", notification()) + } + } + end + + def clear_operation do + %Operation{ + tags: ["Notifications"], + summary: "Dismiss all notifications", + description: "Clear all notifications from the server.", + operationId: "NotificationController.clear", + security: [%{"oAuth" => ["write:notifications"]}], + responses: %{200 => empty_object_response()} + } + end + + def dismiss_operation do + %Operation{ + tags: ["Notifications"], + summary: "Dismiss a single notification", + description: "Clear a single notification from the server.", + operationId: "NotificationController.dismiss", + parameters: [id_param()], + security: [%{"oAuth" => ["write:notifications"]}], + responses: %{200 => empty_object_response()} + } + end + + def dismiss_via_body_operation do + %Operation{ + tags: ["Notifications"], + summary: "Dismiss a single notification", + deprecated: true, + description: "Clear a single notification from the server.", + operationId: "NotificationController.dismiss_via_body", + requestBody: + request_body( + "Parameters", + %Schema{type: :object, properties: %{id: %Schema{type: :string}}}, + required: true + ), + security: [%{"oAuth" => ["write:notifications"]}], + responses: %{200 => empty_object_response()} + } + end + + def destroy_multiple_operation do + %Operation{ + tags: ["Notifications"], + summary: "Dismiss multiple notifications", + operationId: "NotificationController.destroy_multiple", + security: [%{"oAuth" => ["write:notifications"]}], + parameters: [ + Operation.parameter( + :ids, + :query, + %Schema{type: :array, items: %Schema{type: :string}}, + "Array of notification IDs to dismiss", + required: true + ) + ], + responses: %{200 => empty_object_response()} + } + end + + defp notification do + %Schema{ + title: "Notification", + description: "Response schema for a notification", + type: :object, + properties: %{ + id: %Schema{type: :string}, + type: notification_type(), + created_at: %Schema{type: :string, format: :"date-time"}, + account: %Schema{ + allOf: [Account], + description: "The account that performed the action that generated the notification." + }, + status: %Schema{ + allOf: [Status], + description: + "Status that was the object of the notification, e.g. in mentions, reblogs, favourites, or polls.", + nullable: true + } + }, + example: %{ + "id" => "34975861", + "type" => "mention", + "created_at" => "2019-11-23T07:49:02.064Z", + "account" => Account.schema().example, + "status" => Status.schema().example + } + } + end + + defp notification_type do + %Schema{ + type: :string, + enum: [ + "follow", + "favourite", + "reblog", + "mention", + "poll", + "pleroma:emoji_reaction", + "move", + "follow_request" + ], + description: """ + The type of event that resulted in the notification. + + - `follow` - Someone followed you + - `mention` - Someone mentioned you in their status + - `reblog` - Someone boosted one of your statuses + - `favourite` - Someone favourited one of your statuses + - `poll` - A poll you have voted in or created has ended + - `move` - Someone moved their account + - `pleroma:emoji_reaction` - Someone reacted with emoji to your status + """ + } + end + + defp id_param do + Operation.parameter(:id, :path, :string, "Notification ID", + example: "123", + required: true + ) + end +end diff --git a/lib/pleroma/web/api_spec/operations/pleroma_account_operation.ex b/lib/pleroma/web/api_spec/operations/pleroma_account_operation.ex new file mode 100644 index 000000000..90922c064 --- /dev/null +++ b/lib/pleroma/web/api_spec/operations/pleroma_account_operation.ex @@ -0,0 +1,187 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.PleromaAccountOperation do + alias OpenApiSpex.Operation + alias OpenApiSpex.Schema + alias Pleroma.Web.ApiSpec.Schemas.AccountRelationship + alias Pleroma.Web.ApiSpec.Schemas.ApiError + alias Pleroma.Web.ApiSpec.Schemas.FlakeID + alias Pleroma.Web.ApiSpec.StatusOperation + + import Pleroma.Web.ApiSpec.Helpers + + def open_api_operation(action) do + operation = String.to_existing_atom("#{action}_operation") + apply(__MODULE__, operation, []) + end + + def confirmation_resend_operation do + %Operation{ + tags: ["Accounts"], + summary: "Resend confirmation email. Expects `email` or `nickname`", + operationId: "PleromaAPI.AccountController.confirmation_resend", + parameters: [ + Operation.parameter(:email, :query, :string, "Email of that needs to be verified", + example: "cofe@cofe.io" + ), + Operation.parameter( + :nickname, + :query, + :string, + "Nickname of user that needs to be verified", + example: "cofefe" + ) + ], + responses: %{ + 204 => no_content_response() + } + } + end + + def update_avatar_operation do + %Operation{ + tags: ["Accounts"], + summary: "Set/clear user avatar image", + operationId: "PleromaAPI.AccountController.update_avatar", + requestBody: + request_body("Parameters", update_avatar_or_background_request(), required: true), + security: [%{"oAuth" => ["write:accounts"]}], + responses: %{ + 200 => update_response(), + 403 => Operation.response("Forbidden", "application/json", ApiError) + } + } + end + + def update_banner_operation do + %Operation{ + tags: ["Accounts"], + summary: "Set/clear user banner image", + operationId: "PleromaAPI.AccountController.update_banner", + requestBody: request_body("Parameters", update_banner_request(), required: true), + security: [%{"oAuth" => ["write:accounts"]}], + responses: %{ + 200 => update_response() + } + } + end + + def update_background_operation do + %Operation{ + tags: ["Accounts"], + summary: "Set/clear user background image", + operationId: "PleromaAPI.AccountController.update_background", + security: [%{"oAuth" => ["write:accounts"]}], + requestBody: + request_body("Parameters", update_avatar_or_background_request(), required: true), + responses: %{ + 200 => update_response() + } + } + end + + def favourites_operation do + %Operation{ + tags: ["Accounts"], + summary: "Returns favorites timeline of any user", + operationId: "PleromaAPI.AccountController.favourites", + parameters: [id_param() | pagination_params()], + security: [%{"oAuth" => ["read:favourites"]}], + responses: %{ + 200 => + Operation.response( + "Array of Statuses", + "application/json", + StatusOperation.array_of_statuses() + ), + 403 => Operation.response("Forbidden", "application/json", ApiError), + 404 => Operation.response("Not Found", "application/json", ApiError) + } + } + end + + def subscribe_operation do + %Operation{ + tags: ["Accounts"], + summary: "Subscribe to receive notifications for all statuses posted by a user", + operationId: "PleromaAPI.AccountController.subscribe", + parameters: [id_param()], + security: [%{"oAuth" => ["follow", "write:follows"]}], + responses: %{ + 200 => Operation.response("Relationship", "application/json", AccountRelationship), + 404 => Operation.response("Not Found", "application/json", ApiError) + } + } + end + + def unsubscribe_operation do + %Operation{ + tags: ["Accounts"], + summary: "Unsubscribe to stop receiving notifications from user statuses", + operationId: "PleromaAPI.AccountController.unsubscribe", + parameters: [id_param()], + security: [%{"oAuth" => ["follow", "write:follows"]}], + responses: %{ + 200 => Operation.response("Relationship", "application/json", AccountRelationship), + 404 => Operation.response("Not Found", "application/json", ApiError) + } + } + end + + defp id_param do + Operation.parameter(:id, :path, FlakeID, "Account ID", + example: "9umDrYheeY451cQnEe", + required: true + ) + end + + defp update_avatar_or_background_request do + %Schema{ + title: "PleromaAccountUpdateAvatarOrBackgroundRequest", + type: :object, + properties: %{ + img: %Schema{ + nullable: true, + type: :string, + format: :binary, + description: "Image encoded using `multipart/form-data` or an empty string to clear" + } + } + } + end + + defp update_banner_request do + %Schema{ + title: "PleromaAccountUpdateBannerRequest", + type: :object, + properties: %{ + banner: %Schema{ + type: :string, + nullable: true, + format: :binary, + description: "Image encoded using `multipart/form-data` or an empty string to clear" + } + } + } + end + + defp update_response do + Operation.response("PleromaAccountUpdateResponse", "application/json", %Schema{ + type: :object, + properties: %{ + url: %Schema{ + type: :string, + format: :uri, + nullable: true, + description: "Image URL" + } + }, + example: %{ + "url" => + "https://cofe.party/media/9d0add56-bcb6-4c0f-8225-cbbd0b6dd773/13eadb6972c9ccd3f4ffa3b8196f0e0d38b4d2f27594457c52e52946c054cd9a.gif" + } + }) + end +end diff --git a/lib/pleroma/web/api_spec/operations/poll_operation.ex b/lib/pleroma/web/api_spec/operations/poll_operation.ex new file mode 100644 index 000000000..e15c7dc95 --- /dev/null +++ b/lib/pleroma/web/api_spec/operations/poll_operation.ex @@ -0,0 +1,76 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.PollOperation do + alias OpenApiSpex.Operation + alias OpenApiSpex.Schema + alias Pleroma.Web.ApiSpec.Schemas.ApiError + alias Pleroma.Web.ApiSpec.Schemas.FlakeID + alias Pleroma.Web.ApiSpec.Schemas.Poll + + import Pleroma.Web.ApiSpec.Helpers + + def open_api_operation(action) do + operation = String.to_existing_atom("#{action}_operation") + apply(__MODULE__, operation, []) + end + + def show_operation do + %Operation{ + tags: ["Polls"], + summary: "View a poll", + security: [%{"oAuth" => ["read:statuses"]}], + parameters: [id_param()], + operationId: "PollController.show", + responses: %{ + 200 => Operation.response("Poll", "application/json", Poll), + 404 => Operation.response("Error", "application/json", ApiError) + } + } + end + + def vote_operation do + %Operation{ + tags: ["Polls"], + summary: "Vote on a poll", + parameters: [id_param()], + operationId: "PollController.vote", + requestBody: vote_request(), + security: [%{"oAuth" => ["write:statuses"]}], + responses: %{ + 200 => Operation.response("Poll", "application/json", Poll), + 422 => Operation.response("Error", "application/json", ApiError), + 404 => Operation.response("Error", "application/json", ApiError) + } + } + end + + defp id_param do + Operation.parameter(:id, :path, FlakeID, "Poll ID", + example: "123", + required: true + ) + end + + defp vote_request do + request_body( + "Parameters", + %Schema{ + type: :object, + properties: %{ + choices: %Schema{ + type: :array, + items: %Schema{type: :integer}, + description: "Array of own votes containing index for each option (starting from 0)" + } + }, + required: [:choices] + }, + required: true, + example: %{ + "choices" => [0, 1, 2] + } + ) + end +end diff --git a/lib/pleroma/web/api_spec/operations/report_operation.ex b/lib/pleroma/web/api_spec/operations/report_operation.ex new file mode 100644 index 000000000..882177c96 --- /dev/null +++ b/lib/pleroma/web/api_spec/operations/report_operation.ex @@ -0,0 +1,81 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.ReportOperation do + alias OpenApiSpex.Operation + alias OpenApiSpex.Schema + alias Pleroma.Web.ApiSpec.Helpers + alias Pleroma.Web.ApiSpec.Schemas.ApiError + + def open_api_operation(action) do + operation = String.to_existing_atom("#{action}_operation") + apply(__MODULE__, operation, []) + end + + def create_operation do + %Operation{ + tags: ["reports"], + summary: "File a report", + description: "Report problematic users to your moderators", + operationId: "ReportController.create", + security: [%{"oAuth" => ["follow", "write:reports"]}], + requestBody: Helpers.request_body("Parameters", create_request(), required: true), + responses: %{ + 200 => Operation.response("Report", "application/json", create_response()), + 400 => Operation.response("Report", "application/json", ApiError) + } + } + end + + defp create_request do + %Schema{ + title: "ReportCreateRequest", + description: "POST body for creating a report", + type: :object, + properties: %{ + account_id: %Schema{type: :string, description: "ID of the account to report"}, + status_ids: %Schema{ + type: :array, + nullable: true, + items: %Schema{type: :string}, + description: "Array of Statuses to attach to the report, for context" + }, + comment: %Schema{ + type: :string, + nullable: true, + description: "Reason for the report" + }, + forward: %Schema{ + type: :boolean, + nullable: true, + default: false, + description: + "If the account is remote, should the report be forwarded to the remote admin?" + } + }, + required: [:account_id], + example: %{ + "account_id" => "123", + "status_ids" => ["1337"], + "comment" => "bad status!", + "forward" => "false" + } + } + end + + defp create_response do + %Schema{ + title: "ReportResponse", + type: :object, + properties: %{ + id: %Schema{type: :string, description: "Report ID"}, + action_taken: %Schema{type: :boolean, description: "Is action taken?"} + }, + example: %{ + "id" => "123", + "action_taken" => false + } + } + end +end diff --git a/lib/pleroma/web/api_spec/operations/scheduled_activity_operation.ex b/lib/pleroma/web/api_spec/operations/scheduled_activity_operation.ex new file mode 100644 index 000000000..fe675a923 --- /dev/null +++ b/lib/pleroma/web/api_spec/operations/scheduled_activity_operation.ex @@ -0,0 +1,96 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.ScheduledActivityOperation do + alias OpenApiSpex.Operation + alias OpenApiSpex.Schema + alias Pleroma.Web.ApiSpec.Schemas.ApiError + alias Pleroma.Web.ApiSpec.Schemas.FlakeID + alias Pleroma.Web.ApiSpec.Schemas.ScheduledStatus + + import Pleroma.Web.ApiSpec.Helpers + + def open_api_operation(action) do + operation = String.to_existing_atom("#{action}_operation") + apply(__MODULE__, operation, []) + end + + def index_operation do + %Operation{ + tags: ["Scheduled Statuses"], + summary: "View scheduled statuses", + security: [%{"oAuth" => ["read:statuses"]}], + parameters: pagination_params(), + operationId: "ScheduledActivity.index", + responses: %{ + 200 => + Operation.response("Array of ScheduledStatus", "application/json", %Schema{ + type: :array, + items: ScheduledStatus + }) + } + } + end + + def show_operation do + %Operation{ + tags: ["Scheduled Statuses"], + summary: "View a single scheduled status", + security: [%{"oAuth" => ["read:statuses"]}], + parameters: [id_param()], + operationId: "ScheduledActivity.show", + responses: %{ + 200 => Operation.response("Scheduled Status", "application/json", ScheduledStatus), + 404 => Operation.response("Error", "application/json", ApiError) + } + } + end + + def update_operation do + %Operation{ + tags: ["Scheduled Statuses"], + summary: "Schedule a status", + operationId: "ScheduledActivity.update", + security: [%{"oAuth" => ["write:statuses"]}], + parameters: [id_param()], + requestBody: + request_body("Parameters", %Schema{ + type: :object, + properties: %{ + scheduled_at: %Schema{ + type: :string, + format: :"date-time", + description: + "ISO 8601 Datetime at which the status will be published. Must be at least 5 minutes into the future." + } + } + }), + responses: %{ + 200 => Operation.response("Scheduled Status", "application/json", ScheduledStatus), + 404 => Operation.response("Error", "application/json", ApiError) + } + } + end + + def delete_operation do + %Operation{ + tags: ["Scheduled Statuses"], + summary: "Cancel a scheduled status", + security: [%{"oAuth" => ["write:statuses"]}], + parameters: [id_param()], + operationId: "ScheduledActivity.delete", + responses: %{ + 200 => Operation.response("Empty object", "application/json", %Schema{type: :object}), + 404 => Operation.response("Error", "application/json", ApiError) + } + } + end + + defp id_param do + Operation.parameter(:id, :path, FlakeID, "Poll ID", + example: "123", + required: true + ) + end +end diff --git a/lib/pleroma/web/api_spec/operations/search_operation.ex b/lib/pleroma/web/api_spec/operations/search_operation.ex new file mode 100644 index 000000000..6ea00a9a8 --- /dev/null +++ b/lib/pleroma/web/api_spec/operations/search_operation.ex @@ -0,0 +1,207 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.SearchOperation do + alias OpenApiSpex.Operation + alias OpenApiSpex.Schema + alias Pleroma.Web.ApiSpec.AccountOperation + alias Pleroma.Web.ApiSpec.Schemas.Account + alias Pleroma.Web.ApiSpec.Schemas.BooleanLike + alias Pleroma.Web.ApiSpec.Schemas.FlakeID + alias Pleroma.Web.ApiSpec.Schemas.Status + alias Pleroma.Web.ApiSpec.Schemas.Tag + + import Pleroma.Web.ApiSpec.Helpers + + def open_api_operation(action) do + operation = String.to_existing_atom("#{action}_operation") + apply(__MODULE__, operation, []) + end + + def account_search_operation do + %Operation{ + tags: ["Search"], + summary: "Search for matching accounts by username or display name", + operationId: "SearchController.account_search", + parameters: [ + Operation.parameter(:q, :query, %Schema{type: :string}, "What to search for", + required: true + ), + Operation.parameter( + :limit, + :query, + %Schema{type: :integer, default: 40}, + "Maximum number of results" + ), + Operation.parameter( + :resolve, + :query, + %Schema{allOf: [BooleanLike], default: false}, + "Attempt WebFinger lookup. Use this when `q` is an exact address." + ), + Operation.parameter( + :following, + :query, + %Schema{allOf: [BooleanLike], default: false}, + "Only include accounts that the user is following" + ) + ], + responses: %{ + 200 => + Operation.response( + "Array of Account", + "application/json", + AccountOperation.array_of_accounts() + ) + } + } + end + + def search_operation do + %Operation{ + tags: ["Search"], + summary: "Search results", + security: [%{"oAuth" => ["read:search"]}], + operationId: "SearchController.search", + deprecated: true, + parameters: [ + Operation.parameter( + :account_id, + :query, + FlakeID, + "If provided, statuses returned will be authored only by this account" + ), + Operation.parameter( + :type, + :query, + %Schema{type: :string, enum: ["accounts", "hashtags", "statuses"]}, + "Search type" + ), + Operation.parameter(:q, :query, %Schema{type: :string}, "The search query", required: true), + Operation.parameter( + :resolve, + :query, + %Schema{allOf: [BooleanLike], default: false}, + "Attempt WebFinger lookup" + ), + Operation.parameter( + :following, + :query, + %Schema{allOf: [BooleanLike], default: false}, + "Only include accounts that the user is following" + ), + Operation.parameter( + :offset, + :query, + %Schema{type: :integer}, + "Offset" + ) + | pagination_params() + ], + responses: %{ + 200 => Operation.response("Results", "application/json", results()) + } + } + end + + def search2_operation do + %Operation{ + tags: ["Search"], + summary: "Search results", + security: [%{"oAuth" => ["read:search"]}], + operationId: "SearchController.search2", + parameters: [ + Operation.parameter( + :account_id, + :query, + FlakeID, + "If provided, statuses returned will be authored only by this account" + ), + Operation.parameter( + :type, + :query, + %Schema{type: :string, enum: ["accounts", "hashtags", "statuses"]}, + "Search type" + ), + Operation.parameter(:q, :query, %Schema{type: :string}, "What to search for", + required: true + ), + Operation.parameter( + :resolve, + :query, + %Schema{allOf: [BooleanLike], default: false}, + "Attempt WebFinger lookup" + ), + Operation.parameter( + :following, + :query, + %Schema{allOf: [BooleanLike], default: false}, + "Only include accounts that the user is following" + ) + | pagination_params() + ], + responses: %{ + 200 => Operation.response("Results", "application/json", results2()) + } + } + end + + defp results2 do + %Schema{ + title: "SearchResults", + type: :object, + properties: %{ + accounts: %Schema{ + type: :array, + items: Account, + description: "Accounts which match the given query" + }, + statuses: %Schema{ + type: :array, + items: Status, + description: "Statuses which match the given query" + }, + hashtags: %Schema{ + type: :array, + items: Tag, + description: "Hashtags which match the given query" + } + }, + example: %{ + "accounts" => [Account.schema().example], + "statuses" => [Status.schema().example], + "hashtags" => [Tag.schema().example] + } + } + end + + defp results do + %Schema{ + title: "SearchResults", + type: :object, + properties: %{ + accounts: %Schema{ + type: :array, + items: Account, + description: "Accounts which match the given query" + }, + statuses: %Schema{ + type: :array, + items: Status, + description: "Statuses which match the given query" + }, + hashtags: %Schema{ + type: :array, + items: %Schema{type: :string}, + description: "Hashtags which match the given query" + } + }, + example: %{ + "accounts" => [Account.schema().example], + "statuses" => [Status.schema().example], + "hashtags" => ["cofe"] + } + } + end +end diff --git a/lib/pleroma/web/api_spec/operations/status_operation.ex b/lib/pleroma/web/api_spec/operations/status_operation.ex new file mode 100644 index 000000000..fc2909d8c --- /dev/null +++ b/lib/pleroma/web/api_spec/operations/status_operation.ex @@ -0,0 +1,521 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.StatusOperation do + alias OpenApiSpex.Operation + alias OpenApiSpex.Schema + alias Pleroma.Web.ApiSpec.AccountOperation + alias Pleroma.Web.ApiSpec.Schemas.ApiError + alias Pleroma.Web.ApiSpec.Schemas.BooleanLike + alias Pleroma.Web.ApiSpec.Schemas.FlakeID + alias Pleroma.Web.ApiSpec.Schemas.ScheduledStatus + alias Pleroma.Web.ApiSpec.Schemas.Status + alias Pleroma.Web.ApiSpec.Schemas.VisibilityScope + + import Pleroma.Web.ApiSpec.Helpers + + def open_api_operation(action) do + operation = String.to_existing_atom("#{action}_operation") + apply(__MODULE__, operation, []) + end + + def index_operation do + %Operation{ + tags: ["Statuses"], + summary: "Get multiple statuses by IDs", + security: [%{"oAuth" => ["read:statuses"]}], + parameters: [ + Operation.parameter( + :ids, + :query, + %Schema{type: :array, items: FlakeID}, + "Array of status IDs" + ) + ], + operationId: "StatusController.index", + responses: %{ + 200 => Operation.response("Array of Status", "application/json", array_of_statuses()) + } + } + end + + def create_operation do + %Operation{ + tags: ["Statuses"], + summary: "Publish new status", + security: [%{"oAuth" => ["write:statuses"]}], + description: "Post a new status", + operationId: "StatusController.create", + requestBody: request_body("Parameters", create_request(), required: true), + responses: %{ + 200 => + Operation.response( + "Status. When `scheduled_at` is present, ScheduledStatus is returned instead", + "application/json", + %Schema{oneOf: [Status, ScheduledStatus]} + ), + 422 => Operation.response("Bad Request", "application/json", ApiError) + } + } + end + + def show_operation do + %Operation{ + tags: ["Statuses"], + summary: "View specific status", + description: "View information about a status", + operationId: "StatusController.show", + security: [%{"oAuth" => ["read:statuses"]}], + parameters: [id_param()], + responses: %{ + 200 => status_response(), + 404 => Operation.response("Not Found", "application/json", ApiError) + } + } + end + + def delete_operation do + %Operation{ + tags: ["Statuses"], + summary: "Delete status", + security: [%{"oAuth" => ["write:statuses"]}], + description: "Delete one of your own statuses", + operationId: "StatusController.delete", + parameters: [id_param()], + responses: %{ + 200 => empty_object_response(), + 403 => Operation.response("Forbidden", "application/json", ApiError), + 404 => Operation.response("Not Found", "application/json", ApiError) + } + } + end + + def reblog_operation do + %Operation{ + tags: ["Statuses"], + summary: "Boost", + security: [%{"oAuth" => ["write:statuses"]}], + description: "Share a status", + operationId: "StatusController.reblog", + parameters: [id_param()], + requestBody: + request_body("Parameters", %Schema{ + type: :object, + properties: %{ + visibility: %Schema{allOf: [VisibilityScope], default: "public"} + } + }), + responses: %{ + 200 => status_response(), + 404 => Operation.response("Not Found", "application/json", ApiError) + } + } + end + + def unreblog_operation do + %Operation{ + tags: ["Statuses"], + summary: "Undo boost", + security: [%{"oAuth" => ["write:statuses"]}], + description: "Undo a reshare of a status", + operationId: "StatusController.unreblog", + parameters: [id_param()], + responses: %{ + 200 => status_response(), + 404 => Operation.response("Not Found", "application/json", ApiError) + } + } + end + + def favourite_operation do + %Operation{ + tags: ["Statuses"], + summary: "Favourite", + security: [%{"oAuth" => ["write:favourites"]}], + description: "Add a status to your favourites list", + operationId: "StatusController.favourite", + parameters: [id_param()], + responses: %{ + 200 => status_response(), + 404 => Operation.response("Not Found", "application/json", ApiError) + } + } + end + + def unfavourite_operation do + %Operation{ + tags: ["Statuses"], + summary: "Undo favourite", + security: [%{"oAuth" => ["write:favourites"]}], + description: "Remove a status from your favourites list", + operationId: "StatusController.unfavourite", + parameters: [id_param()], + responses: %{ + 200 => status_response(), + 404 => Operation.response("Not Found", "application/json", ApiError) + } + } + end + + def pin_operation do + %Operation{ + tags: ["Statuses"], + summary: "Pin to profile", + security: [%{"oAuth" => ["write:accounts"]}], + description: "Feature one of your own public statuses at the top of your profile", + operationId: "StatusController.pin", + parameters: [id_param()], + responses: %{ + 200 => status_response(), + 400 => Operation.response("Error", "application/json", ApiError) + } + } + end + + def unpin_operation do + %Operation{ + tags: ["Statuses"], + summary: "Unpin to profile", + security: [%{"oAuth" => ["write:accounts"]}], + description: "Unfeature a status from the top of your profile", + operationId: "StatusController.unpin", + parameters: [id_param()], + responses: %{ + 200 => status_response(), + 400 => Operation.response("Error", "application/json", ApiError) + } + } + end + + def bookmark_operation do + %Operation{ + tags: ["Statuses"], + summary: "Bookmark", + security: [%{"oAuth" => ["write:bookmarks"]}], + description: "Privately bookmark a status", + operationId: "StatusController.bookmark", + parameters: [id_param()], + responses: %{ + 200 => status_response() + } + } + end + + def unbookmark_operation do + %Operation{ + tags: ["Statuses"], + summary: "Undo bookmark", + security: [%{"oAuth" => ["write:bookmarks"]}], + description: "Remove a status from your private bookmarks", + operationId: "StatusController.unbookmark", + parameters: [id_param()], + responses: %{ + 200 => status_response() + } + } + end + + def mute_conversation_operation do + %Operation{ + tags: ["Statuses"], + summary: "Mute conversation", + security: [%{"oAuth" => ["write:mutes"]}], + description: "Do not receive notifications for the thread that this status is part of.", + operationId: "StatusController.mute_conversation", + parameters: [id_param()], + responses: %{ + 200 => status_response(), + 400 => Operation.response("Error", "application/json", ApiError) + } + } + end + + def unmute_conversation_operation do + %Operation{ + tags: ["Statuses"], + summary: "Unmute conversation", + security: [%{"oAuth" => ["write:mutes"]}], + description: + "Start receiving notifications again for the thread that this status is part of", + operationId: "StatusController.unmute_conversation", + parameters: [id_param()], + responses: %{ + 200 => status_response(), + 400 => Operation.response("Error", "application/json", ApiError) + } + } + end + + def card_operation do + %Operation{ + tags: ["Statuses"], + deprecated: true, + summary: "Preview card", + description: "Deprecated in favor of card property inlined on Status entity", + operationId: "StatusController.card", + parameters: [id_param()], + security: [%{"oAuth" => ["read:statuses"]}], + responses: %{ + 200 => + Operation.response("Card", "application/json", %Schema{ + type: :object, + nullable: true, + properties: %{ + type: %Schema{type: :string, enum: ["link", "photo", "video", "rich"]}, + provider_name: %Schema{type: :string, nullable: true}, + provider_url: %Schema{type: :string, format: :uri}, + url: %Schema{type: :string, format: :uri}, + image: %Schema{type: :string, nullable: true, format: :uri}, + title: %Schema{type: :string}, + description: %Schema{type: :string} + } + }) + } + } + end + + def favourited_by_operation do + %Operation{ + tags: ["Statuses"], + summary: "Favourited by", + description: "View who favourited a given status", + operationId: "StatusController.favourited_by", + security: [%{"oAuth" => ["read:accounts"]}], + parameters: [id_param()], + responses: %{ + 200 => + Operation.response( + "Array of Accounts", + "application/json", + AccountOperation.array_of_accounts() + ), + 404 => Operation.response("Not Found", "application/json", ApiError) + } + } + end + + def reblogged_by_operation do + %Operation{ + tags: ["Statuses"], + summary: "Boosted by", + description: "View who boosted a given status", + operationId: "StatusController.reblogged_by", + security: [%{"oAuth" => ["read:accounts"]}], + parameters: [id_param()], + responses: %{ + 200 => + Operation.response( + "Array of Accounts", + "application/json", + AccountOperation.array_of_accounts() + ), + 404 => Operation.response("Not Found", "application/json", ApiError) + } + } + end + + def context_operation do + %Operation{ + tags: ["Statuses"], + summary: "Parent and child statuses", + description: "View statuses above and below this status in the thread", + operationId: "StatusController.context", + security: [%{"oAuth" => ["read:statuses"]}], + parameters: [id_param()], + responses: %{ + 200 => Operation.response("Context", "application/json", context()) + } + } + end + + def favourites_operation do + %Operation{ + tags: ["Statuses"], + summary: "Favourited statuses", + description: "Statuses the user has favourited", + operationId: "StatusController.favourites", + parameters: pagination_params(), + security: [%{"oAuth" => ["read:favourites"]}], + responses: %{ + 200 => Operation.response("Array of Statuses", "application/json", array_of_statuses()) + } + } + end + + def bookmarks_operation do + %Operation{ + tags: ["Statuses"], + summary: "Bookmarked statuses", + description: "Statuses the user has bookmarked", + operationId: "StatusController.bookmarks", + parameters: [ + Operation.parameter(:with_relationships, :query, BooleanLike, "Include relationships") + | pagination_params() + ], + security: [%{"oAuth" => ["read:bookmarks"]}], + responses: %{ + 200 => Operation.response("Array of Statuses", "application/json", array_of_statuses()) + } + } + end + + def array_of_statuses do + %Schema{type: :array, items: Status, example: [Status.schema().example]} + end + + defp create_request do + %Schema{ + title: "StatusCreateRequest", + type: :object, + properties: %{ + status: %Schema{ + type: :string, + nullable: true, + description: + "Text content of the status. If `media_ids` is provided, this becomes optional. Attaching a `poll` is optional while `status` is provided." + }, + media_ids: %Schema{ + nullable: true, + type: :array, + items: %Schema{type: :string}, + description: "Array of Attachment ids to be attached as media." + }, + poll: %Schema{ + nullable: true, + type: :object, + required: [:options], + properties: %{ + options: %Schema{ + type: :array, + items: %Schema{type: :string}, + description: "Array of possible answers. Must be provided with `poll[expires_in]`." + }, + expires_in: %Schema{ + type: :integer, + nullable: true, + description: + "Duration the poll should be open, in seconds. Must be provided with `poll[options]`" + }, + multiple: %Schema{ + type: :boolean, + nullable: true, + description: "Allow multiple choices?" + }, + hide_totals: %Schema{ + type: :boolean, + nullable: true, + description: "Hide vote counts until the poll ends?" + } + } + }, + in_reply_to_id: %Schema{ + nullable: true, + allOf: [FlakeID], + description: "ID of the status being replied to, if status is a reply" + }, + sensitive: %Schema{ + type: :boolean, + nullable: true, + description: "Mark status and attached media as sensitive?" + }, + spoiler_text: %Schema{ + type: :string, + nullable: true, + description: + "Text to be shown as a warning or subject before the actual content. Statuses are generally collapsed behind this field." + }, + scheduled_at: %Schema{ + type: :string, + format: :"date-time", + nullable: true, + description: + "ISO 8601 Datetime at which to schedule a status. Providing this paramter will cause ScheduledStatus to be returned instead of Status. Must be at least 5 minutes in the future." + }, + language: %Schema{ + type: :string, + nullable: true, + description: "ISO 639 language code for this status." + }, + # Pleroma-specific properties: + preview: %Schema{ + type: :boolean, + nullable: true, + description: + "If set to `true` the post won't be actually posted, but the status entitiy would still be rendered back. This could be useful for previewing rich text/custom emoji, for example" + }, + content_type: %Schema{ + type: :string, + nullable: true, + description: + "The MIME type of the status, it is transformed into HTML by the backend. You can get the list of the supported MIME types with the nodeinfo endpoint." + }, + to: %Schema{ + type: :array, + nullable: true, + items: %Schema{type: :string}, + description: + "A list of nicknames (like `lain@soykaf.club` or `lain` on the local server) that will be used to determine who is going to be addressed by this post. Using this will disable the implicit addressing by mentioned names in the `status` body, only the people in the `to` list will be addressed. The normal rules for for post visibility are not affected by this and will still apply" + }, + visibility: %Schema{ + nullable: true, + anyOf: [ + VisibilityScope, + %Schema{type: :string, description: "`list:LIST_ID`", example: "LIST:123"} + ], + description: + "Visibility of the posted status. Besides standard MastoAPI values (`direct`, `private`, `unlisted` or `public`) it can be used to address a List by setting it to `list:LIST_ID`" + }, + expires_in: %Schema{ + nullable: true, + type: :integer, + description: + "The number of seconds the posted activity should expire in. When a posted activity expires it will be deleted from the server, and a delete request for it will be federated. This needs to be longer than an hour." + }, + in_reply_to_conversation_id: %Schema{ + nullable: true, + type: :string, + description: + "Will reply to a given conversation, addressing only the people who are part of the recipient set of that conversation. Sets the visibility to `direct`." + } + }, + example: %{ + "status" => "What time is it?", + "sensitive" => "false", + "poll" => %{ + "options" => ["Cofe", "Adventure"], + "expires_in" => 420 + } + } + } + end + + defp id_param do + Operation.parameter(:id, :path, FlakeID, "Status ID", + example: "9umDrYheeY451cQnEe", + required: true + ) + end + + defp status_response do + Operation.response("Status", "application/json", Status) + end + + defp context do + %Schema{ + title: "StatusContext", + description: + "Represents the tree around a given status. Used for reconstructing threads of statuses.", + type: :object, + required: [:ancestors, :descendants], + properties: %{ + ancestors: array_of_statuses(), + descendants: array_of_statuses() + }, + example: %{ + "ancestors" => [Status.schema().example], + "descendants" => [Status.schema().example] + } + } + end +end diff --git a/lib/pleroma/web/api_spec/operations/subscription_operation.ex b/lib/pleroma/web/api_spec/operations/subscription_operation.ex new file mode 100644 index 000000000..cf6dcb068 --- /dev/null +++ b/lib/pleroma/web/api_spec/operations/subscription_operation.ex @@ -0,0 +1,226 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.SubscriptionOperation do + alias OpenApiSpex.Operation + alias OpenApiSpex.Schema + alias Pleroma.Web.ApiSpec.Helpers + alias Pleroma.Web.ApiSpec.Schemas.ApiError + alias Pleroma.Web.ApiSpec.Schemas.PushSubscription + + def open_api_operation(action) do + operation = String.to_existing_atom("#{action}_operation") + apply(__MODULE__, operation, []) + end + + def create_operation do + %Operation{ + tags: ["Push Subscriptions"], + summary: "Subscribe to push notifications", + description: + "Add a Web Push API subscription to receive notifications. Each access token can have one push subscription. If you create a new subscription, the old subscription is deleted.", + operationId: "SubscriptionController.create", + security: [%{"oAuth" => ["push"]}], + requestBody: Helpers.request_body("Parameters", create_request(), required: true), + responses: %{ + 200 => Operation.response("Push Subscription", "application/json", PushSubscription), + 400 => Operation.response("Error", "application/json", ApiError), + 403 => Operation.response("Error", "application/json", ApiError) + } + } + end + + def show_operation do + %Operation{ + tags: ["Push Subscriptions"], + summary: "Get current subscription", + description: "View the PushSubscription currently associated with this access token.", + operationId: "SubscriptionController.show", + security: [%{"oAuth" => ["push"]}], + responses: %{ + 200 => Operation.response("Push Subscription", "application/json", PushSubscription), + 403 => Operation.response("Error", "application/json", ApiError), + 404 => Operation.response("Error", "application/json", ApiError) + } + } + end + + def update_operation do + %Operation{ + tags: ["Push Subscriptions"], + summary: "Change types of notifications", + description: + "Updates the current push subscription. Only the data part can be updated. To change fundamentals, a new subscription must be created instead.", + operationId: "SubscriptionController.update", + security: [%{"oAuth" => ["push"]}], + requestBody: Helpers.request_body("Parameters", update_request(), required: true), + responses: %{ + 200 => Operation.response("Push Subscription", "application/json", PushSubscription), + 403 => Operation.response("Error", "application/json", ApiError) + } + } + end + + def delete_operation do + %Operation{ + tags: ["Push Subscriptions"], + summary: "Remove current subscription", + description: "Removes the current Web Push API subscription.", + operationId: "SubscriptionController.delete", + security: [%{"oAuth" => ["push"]}], + responses: %{ + 200 => Operation.response("Empty object", "application/json", %Schema{type: :object}), + 403 => Operation.response("Error", "application/json", ApiError), + 404 => Operation.response("Error", "application/json", ApiError) + } + } + end + + defp create_request do + %Schema{ + title: "SubscriptionCreateRequest", + description: "POST body for creating a push subscription", + type: :object, + properties: %{ + subscription: %Schema{ + type: :object, + properties: %{ + endpoint: %Schema{ + type: :string, + description: "Endpoint URL that is called when a notification event occurs." + }, + keys: %Schema{ + type: :object, + properties: %{ + p256dh: %Schema{ + type: :string, + description: + "User agent public key. Base64 encoded string of public key of ECDH key using `prime256v1` curve." + }, + auth: %Schema{ + type: :string, + description: "Auth secret. Base64 encoded string of 16 bytes of random data." + } + }, + required: [:p256dh, :auth] + } + }, + required: [:endpoint, :keys] + }, + data: %Schema{ + nullable: true, + type: :object, + properties: %{ + alerts: %Schema{ + nullable: true, + type: :object, + properties: %{ + follow: %Schema{ + type: :boolean, + nullable: true, + description: "Receive follow notifications?" + }, + favourite: %Schema{ + type: :boolean, + nullable: true, + description: "Receive favourite notifications?" + }, + reblog: %Schema{ + type: :boolean, + nullable: true, + description: "Receive reblog notifications?" + }, + mention: %Schema{ + type: :boolean, + nullable: true, + description: "Receive mention notifications?" + }, + poll: %Schema{ + type: :boolean, + nullable: true, + description: "Receive poll notifications?" + } + } + } + } + } + }, + required: [:subscription], + example: %{ + "subscription" => %{ + "endpoint" => "https://example.com/example/1234", + "keys" => %{ + "auth" => "8eDyX_uCN0XRhSbY5hs7Hg==", + "p256dh" => + "BCIWgsnyXDv1VkhqL2P7YRBvdeuDnlwAPT2guNhdIoW3IP7GmHh1SMKPLxRf7x8vJy6ZFK3ol2ohgn_-0yP7QQA=" + } + }, + "data" => %{ + "alerts" => %{ + "follow" => true, + "mention" => true, + "poll" => false + } + } + } + } + end + + defp update_request do + %Schema{ + title: "SubscriptionUpdateRequest", + type: :object, + properties: %{ + data: %Schema{ + nullable: true, + type: :object, + properties: %{ + alerts: %Schema{ + nullable: true, + type: :object, + properties: %{ + follow: %Schema{ + type: :boolean, + nullable: true, + description: "Receive follow notifications?" + }, + favourite: %Schema{ + type: :boolean, + nullable: true, + description: "Receive favourite notifications?" + }, + reblog: %Schema{ + type: :boolean, + nullable: true, + description: "Receive reblog notifications?" + }, + mention: %Schema{ + type: :boolean, + nullable: true, + description: "Receive mention notifications?" + }, + poll: %Schema{ + type: :boolean, + nullable: true, + description: "Receive poll notifications?" + } + } + } + } + } + }, + example: %{ + "data" => %{ + "alerts" => %{ + "follow" => true, + "favourite" => true, + "reblog" => true, + "mention" => true, + "poll" => true + } + } + } + } + end +end diff --git a/lib/pleroma/web/api_spec/operations/timeline_operation.ex b/lib/pleroma/web/api_spec/operations/timeline_operation.ex new file mode 100644 index 000000000..1b89035d4 --- /dev/null +++ b/lib/pleroma/web/api_spec/operations/timeline_operation.ex @@ -0,0 +1,199 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.TimelineOperation do + alias OpenApiSpex.Operation + alias OpenApiSpex.Schema + alias Pleroma.Web.ApiSpec.Schemas.ApiError + alias Pleroma.Web.ApiSpec.Schemas.BooleanLike + alias Pleroma.Web.ApiSpec.Schemas.Status + alias Pleroma.Web.ApiSpec.Schemas.VisibilityScope + + import Pleroma.Web.ApiSpec.Helpers + + def open_api_operation(action) do + operation = String.to_existing_atom("#{action}_operation") + apply(__MODULE__, operation, []) + end + + def home_operation do + %Operation{ + tags: ["Timelines"], + summary: "Home timeline", + description: "View statuses from followed users", + security: [%{"oAuth" => ["read:statuses"]}], + parameters: [ + local_param(), + with_muted_param(), + exclude_visibilities_param(), + reply_visibility_param(), + with_relationships_param() | pagination_params() + ], + operationId: "TimelineController.home", + responses: %{ + 200 => Operation.response("Array of Status", "application/json", array_of_statuses()) + } + } + end + + def direct_operation do + %Operation{ + tags: ["Timelines"], + summary: "Direct timeline", + description: + "View statuses with a “direct” privacy, from your account or in your notifications", + deprecated: true, + parameters: pagination_params(), + security: [%{"oAuth" => ["read:statuses"]}], + operationId: "TimelineController.direct", + responses: %{ + 200 => Operation.response("Array of Status", "application/json", array_of_statuses()) + } + } + end + + def public_operation do + %Operation{ + tags: ["Timelines"], + summary: "Public timeline", + security: [%{"oAuth" => ["read:statuses"]}], + parameters: [ + local_param(), + only_media_param(), + with_muted_param(), + exclude_visibilities_param(), + reply_visibility_param(), + with_relationships_param() | pagination_params() + ], + operationId: "TimelineController.public", + responses: %{ + 200 => Operation.response("Array of Status", "application/json", array_of_statuses()), + 401 => Operation.response("Error", "application/json", ApiError) + } + } + end + + def hashtag_operation do + %Operation{ + tags: ["Timelines"], + summary: "Hashtag timeline", + description: "View public statuses containing the given hashtag", + security: [%{"oAuth" => ["read:statuses"]}], + parameters: [ + Operation.parameter( + :tag, + :path, + %Schema{type: :string}, + "Content of a #hashtag, not including # symbol.", + required: true + ), + Operation.parameter( + :any, + :query, + %Schema{type: :array, items: %Schema{type: :string}}, + "Statuses that also includes any of these tags" + ), + Operation.parameter( + :all, + :query, + %Schema{type: :array, items: %Schema{type: :string}}, + "Statuses that also includes all of these tags" + ), + Operation.parameter( + :none, + :query, + %Schema{type: :array, items: %Schema{type: :string}}, + "Statuses that do not include these tags" + ), + local_param(), + only_media_param(), + with_muted_param(), + exclude_visibilities_param(), + with_relationships_param() | pagination_params() + ], + operationId: "TimelineController.hashtag", + responses: %{ + 200 => Operation.response("Array of Status", "application/json", array_of_statuses()) + } + } + end + + def list_operation do + %Operation{ + tags: ["Timelines"], + summary: "List timeline", + description: "View statuses in the given list timeline", + security: [%{"oAuth" => ["read:lists"]}], + parameters: [ + Operation.parameter( + :list_id, + :path, + %Schema{type: :string}, + "Local ID of the list in the database", + required: true + ), + with_muted_param(), + exclude_visibilities_param(), + with_relationships_param() | pagination_params() + ], + operationId: "TimelineController.list", + responses: %{ + 200 => Operation.response("Array of Status", "application/json", array_of_statuses()) + } + } + end + + defp array_of_statuses do + %Schema{ + title: "ArrayOfStatuses", + type: :array, + items: Status, + example: [Status.schema().example] + } + end + + defp with_relationships_param do + Operation.parameter(:with_relationships, :query, BooleanLike, "Include relationships") + end + + defp local_param do + Operation.parameter( + :local, + :query, + %Schema{allOf: [BooleanLike], default: false}, + "Show only local statuses?" + ) + end + + defp with_muted_param do + Operation.parameter(:with_muted, :query, BooleanLike, "Includeactivities by muted users") + end + + defp exclude_visibilities_param do + Operation.parameter( + :exclude_visibilities, + :query, + %Schema{type: :array, items: VisibilityScope}, + "Exclude the statuses with the given visibilities" + ) + end + + defp reply_visibility_param do + Operation.parameter( + :reply_visibility, + :query, + %Schema{type: :string, enum: ["following", "self"]}, + "Filter replies. Possible values: without parameter (default) shows all replies, `following` - replies directed to you or users you follow, `self` - replies directed to you." + ) + end + + defp only_media_param do + Operation.parameter( + :only_media, + :query, + %Schema{allOf: [BooleanLike], default: false}, + "Show only statuses with media attached?" + ) + end +end diff --git a/lib/pleroma/web/api_spec/render_error.ex b/lib/pleroma/web/api_spec/render_error.ex new file mode 100644 index 000000000..d476b8ef3 --- /dev/null +++ b/lib/pleroma/web/api_spec/render_error.ex @@ -0,0 +1,234 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.RenderError do + @behaviour Plug + + import Plug.Conn, only: [put_status: 2] + import Phoenix.Controller, only: [json: 2] + import Pleroma.Web.Gettext + + @impl Plug + def init(opts), do: opts + + @impl Plug + + def call(conn, errors) do + errors = + Enum.map(errors, fn + %{name: nil, reason: :invalid_enum} = err -> + %OpenApiSpex.Cast.Error{err | name: err.value} + + %{name: nil} = err -> + %OpenApiSpex.Cast.Error{err | name: List.last(err.path)} + + err -> + err + end) + + conn + |> put_status(:bad_request) + |> json(%{ + error: errors |> Enum.map(&message/1) |> Enum.join(" "), + errors: errors |> Enum.map(&render_error/1) + }) + end + + defp render_error(error) do + pointer = OpenApiSpex.path_to_string(error) + + %{ + title: "Invalid value", + source: %{ + pointer: pointer + }, + message: OpenApiSpex.Cast.Error.message(error) + } + end + + defp message(%{reason: :invalid_schema_type, type: type, name: name}) do + gettext("%{name} - Invalid schema.type. Got: %{type}.", + name: name, + type: inspect(type) + ) + end + + defp message(%{reason: :null_value, name: name} = error) do + case error.type do + nil -> + gettext("%{name} - null value.", name: name) + + type -> + gettext("%{name} - null value where %{type} expected.", + name: name, + type: type + ) + end + end + + defp message(%{reason: :all_of, meta: %{invalid_schema: invalid_schema}}) do + gettext( + "Failed to cast value as %{invalid_schema}. Value must be castable using `allOf` schemas listed.", + invalid_schema: invalid_schema + ) + end + + defp message(%{reason: :any_of, meta: %{failed_schemas: failed_schemas}}) do + gettext("Failed to cast value using any of: %{failed_schemas}.", + failed_schemas: failed_schemas + ) + end + + defp message(%{reason: :one_of, meta: %{failed_schemas: failed_schemas}}) do + gettext("Failed to cast value to one of: %{failed_schemas}.", failed_schemas: failed_schemas) + end + + defp message(%{reason: :min_length, length: length, name: name}) do + gettext("%{name} - String length is smaller than minLength: %{length}.", + name: name, + length: length + ) + end + + defp message(%{reason: :max_length, length: length, name: name}) do + gettext("%{name} - String length is larger than maxLength: %{length}.", + name: name, + length: length + ) + end + + defp message(%{reason: :unique_items, name: name}) do + gettext("%{name} - Array items must be unique.", name: name) + end + + defp message(%{reason: :min_items, length: min, value: array, name: name}) do + gettext("%{name} - Array length %{length} is smaller than minItems: %{min}.", + name: name, + length: length(array), + min: min + ) + end + + defp message(%{reason: :max_items, length: max, value: array, name: name}) do + gettext("%{name} - Array length %{length} is larger than maxItems: %{}.", + name: name, + length: length(array), + max: max + ) + end + + defp message(%{reason: :multiple_of, length: multiple, value: count, name: name}) do + gettext("%{name} - %{count} is not a multiple of %{multiple}.", + name: name, + count: count, + multiple: multiple + ) + end + + defp message(%{reason: :exclusive_max, length: max, value: value, name: name}) + when value >= max do + gettext("%{name} - %{value} is larger than exclusive maximum %{max}.", + name: name, + value: value, + max: max + ) + end + + defp message(%{reason: :maximum, length: max, value: value, name: name}) + when value > max do + gettext("%{name} - %{value} is larger than inclusive maximum %{max}.", + name: name, + value: value, + max: max + ) + end + + defp message(%{reason: :exclusive_multiple, length: min, value: value, name: name}) + when value <= min do + gettext("%{name} - %{value} is smaller than exclusive minimum %{min}.", + name: name, + value: value, + min: min + ) + end + + defp message(%{reason: :minimum, length: min, value: value, name: name}) + when value < min do + gettext("%{name} - %{value} is smaller than inclusive minimum %{min}.", + name: name, + value: value, + min: min + ) + end + + defp message(%{reason: :invalid_type, type: type, value: value, name: name}) do + gettext("%{name} - Invalid %{type}. Got: %{value}.", + name: name, + value: OpenApiSpex.TermType.type(value), + type: type + ) + end + + defp message(%{reason: :invalid_format, format: format, name: name}) do + gettext("%{name} - Invalid format. Expected %{format}.", name: name, format: inspect(format)) + end + + defp message(%{reason: :invalid_enum, name: name}) do + gettext("%{name} - Invalid value for enum.", name: name) + end + + defp message(%{reason: :polymorphic_failed, type: polymorphic_type}) do + gettext("Failed to cast to any schema in %{polymorphic_type}", + polymorphic_type: polymorphic_type + ) + end + + defp message(%{reason: :unexpected_field, name: name}) do + gettext("Unexpected field: %{name}.", name: safe_string(name)) + end + + defp message(%{reason: :no_value_for_discriminator, name: field}) do + gettext("Value used as discriminator for `%{field}` matches no schemas.", name: field) + end + + defp message(%{reason: :invalid_discriminator_value, name: field}) do + gettext("No value provided for required discriminator `%{field}`.", name: field) + end + + defp message(%{reason: :unknown_schema, name: name}) do + gettext("Unknown schema: %{name}.", name: name) + end + + defp message(%{reason: :missing_field, name: name}) do + gettext("Missing field: %{name}.", name: name) + end + + defp message(%{reason: :missing_header, name: name}) do + gettext("Missing header: %{name}.", name: name) + end + + defp message(%{reason: :invalid_header, name: name}) do + gettext("Invalid value for header: %{name}.", name: name) + end + + defp message(%{reason: :max_properties, meta: meta}) do + gettext( + "Object property count %{property_count} is greater than maxProperties: %{max_properties}.", + property_count: meta.property_count, + max_properties: meta.max_properties + ) + end + + defp message(%{reason: :min_properties, meta: meta}) do + gettext( + "Object property count %{property_count} is less than minProperties: %{min_properties}", + property_count: meta.property_count, + min_properties: meta.min_properties + ) + end + + defp safe_string(string) do + to_string(string) |> String.slice(0..39) + end +end diff --git a/lib/pleroma/web/api_spec/schemas/account.ex b/lib/pleroma/web/api_spec/schemas/account.ex new file mode 100644 index 000000000..d54e2158d --- /dev/null +++ b/lib/pleroma/web/api_spec/schemas/account.ex @@ -0,0 +1,167 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.Schemas.Account do + alias OpenApiSpex.Schema + alias Pleroma.Web.ApiSpec.Schemas.AccountField + alias Pleroma.Web.ApiSpec.Schemas.AccountRelationship + alias Pleroma.Web.ApiSpec.Schemas.ActorType + alias Pleroma.Web.ApiSpec.Schemas.Emoji + alias Pleroma.Web.ApiSpec.Schemas.FlakeID + alias Pleroma.Web.ApiSpec.Schemas.VisibilityScope + + require OpenApiSpex + + OpenApiSpex.schema(%{ + title: "Account", + description: "Response schema for an account", + type: :object, + properties: %{ + acct: %Schema{type: :string}, + avatar_static: %Schema{type: :string, format: :uri}, + avatar: %Schema{type: :string, format: :uri}, + bot: %Schema{type: :boolean}, + created_at: %Schema{type: :string, format: "date-time"}, + display_name: %Schema{type: :string}, + emojis: %Schema{type: :array, items: Emoji}, + fields: %Schema{type: :array, items: AccountField}, + follow_requests_count: %Schema{type: :integer}, + followers_count: %Schema{type: :integer}, + following_count: %Schema{type: :integer}, + header_static: %Schema{type: :string, format: :uri}, + header: %Schema{type: :string, format: :uri}, + id: FlakeID, + locked: %Schema{type: :boolean}, + note: %Schema{type: :string, format: :html}, + statuses_count: %Schema{type: :integer}, + url: %Schema{type: :string, format: :uri}, + username: %Schema{type: :string}, + pleroma: %Schema{ + type: :object, + properties: %{ + allow_following_move: %Schema{type: :boolean}, + background_image: %Schema{type: :string, nullable: true}, + chat_token: %Schema{type: :string}, + confirmation_pending: %Schema{type: :boolean}, + hide_favorites: %Schema{type: :boolean}, + hide_followers_count: %Schema{type: :boolean}, + hide_followers: %Schema{type: :boolean}, + hide_follows_count: %Schema{type: :boolean}, + hide_follows: %Schema{type: :boolean}, + is_admin: %Schema{type: :boolean}, + is_moderator: %Schema{type: :boolean}, + skip_thread_containment: %Schema{type: :boolean}, + tags: %Schema{type: :array, items: %Schema{type: :string}}, + unread_conversation_count: %Schema{type: :integer}, + notification_settings: %Schema{ + type: :object, + properties: %{ + followers: %Schema{type: :boolean}, + follows: %Schema{type: :boolean}, + non_followers: %Schema{type: :boolean}, + non_follows: %Schema{type: :boolean}, + privacy_option: %Schema{type: :boolean} + } + }, + relationship: AccountRelationship, + settings_store: %Schema{ + type: :object + } + } + }, + source: %Schema{ + type: :object, + properties: %{ + fields: %Schema{type: :array, items: AccountField}, + note: %Schema{type: :string}, + privacy: VisibilityScope, + sensitive: %Schema{type: :boolean}, + pleroma: %Schema{ + type: :object, + properties: %{ + actor_type: ActorType, + discoverable: %Schema{type: :boolean}, + no_rich_text: %Schema{type: :boolean}, + show_role: %Schema{type: :boolean} + } + } + } + } + }, + example: %{ + "acct" => "foobar", + "avatar" => "https://mypleroma.com/images/avi.png", + "avatar_static" => "https://mypleroma.com/images/avi.png", + "bot" => false, + "created_at" => "2020-03-24T13:05:58.000Z", + "display_name" => "foobar", + "emojis" => [], + "fields" => [], + "follow_requests_count" => 0, + "followers_count" => 0, + "following_count" => 1, + "header" => "https://mypleroma.com/images/banner.png", + "header_static" => "https://mypleroma.com/images/banner.png", + "id" => "9tKi3esbG7OQgZ2920", + "locked" => false, + "note" => "cofe", + "pleroma" => %{ + "allow_following_move" => true, + "background_image" => nil, + "confirmation_pending" => true, + "hide_favorites" => true, + "hide_followers" => false, + "hide_followers_count" => false, + "hide_follows" => false, + "hide_follows_count" => false, + "is_admin" => false, + "is_moderator" => false, + "skip_thread_containment" => false, + "chat_token" => + "SFMyNTY.g3QAAAACZAAEZGF0YW0AAAASOXRLaTNlc2JHN09RZ1oyOTIwZAAGc2lnbmVkbgYARNplS3EB.Mb_Iaqew2bN1I1o79B_iP7encmVCpTKC4OtHZRxdjKc", + "unread_conversation_count" => 0, + "tags" => [], + "notification_settings" => %{ + "followers" => true, + "follows" => true, + "non_followers" => true, + "non_follows" => true, + "privacy_option" => false + }, + "relationship" => %{ + "blocked_by" => false, + "blocking" => false, + "domain_blocking" => false, + "endorsed" => false, + "followed_by" => false, + "following" => false, + "id" => "9tKi3esbG7OQgZ2920", + "muting" => false, + "muting_notifications" => false, + "requested" => false, + "showing_reblogs" => true, + "subscribing" => false + }, + "settings_store" => %{ + "pleroma-fe" => %{} + } + }, + "source" => %{ + "fields" => [], + "note" => "foobar", + "pleroma" => %{ + "actor_type" => "Person", + "discoverable" => false, + "no_rich_text" => false, + "show_role" => true + }, + "privacy" => "public", + "sensitive" => false + }, + "statuses_count" => 0, + "url" => "https://mypleroma.com/users/foobar", + "username" => "foobar" + } + }) +end diff --git a/lib/pleroma/web/api_spec/schemas/account_field.ex b/lib/pleroma/web/api_spec/schemas/account_field.ex new file mode 100644 index 000000000..fa97073a0 --- /dev/null +++ b/lib/pleroma/web/api_spec/schemas/account_field.ex @@ -0,0 +1,26 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.Schemas.AccountField do + alias OpenApiSpex.Schema + + require OpenApiSpex + + OpenApiSpex.schema(%{ + title: "AccountField", + description: "Response schema for account custom fields", + type: :object, + properties: %{ + name: %Schema{type: :string}, + value: %Schema{type: :string, format: :html}, + verified_at: %Schema{type: :string, format: :"date-time", nullable: true} + }, + example: %{ + "name" => "Website", + "value" => + "https://pleroma.com", + "verified_at" => "2019-08-29T04:14:55.571+00:00" + } + }) +end diff --git a/lib/pleroma/web/api_spec/schemas/account_relationship.ex b/lib/pleroma/web/api_spec/schemas/account_relationship.ex new file mode 100644 index 000000000..8b982669e --- /dev/null +++ b/lib/pleroma/web/api_spec/schemas/account_relationship.ex @@ -0,0 +1,44 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.Schemas.AccountRelationship do + alias OpenApiSpex.Schema + alias Pleroma.Web.ApiSpec.Schemas.FlakeID + + require OpenApiSpex + + OpenApiSpex.schema(%{ + title: "AccountRelationship", + description: "Response schema for relationship", + type: :object, + properties: %{ + blocked_by: %Schema{type: :boolean}, + blocking: %Schema{type: :boolean}, + domain_blocking: %Schema{type: :boolean}, + endorsed: %Schema{type: :boolean}, + followed_by: %Schema{type: :boolean}, + following: %Schema{type: :boolean}, + id: FlakeID, + muting: %Schema{type: :boolean}, + muting_notifications: %Schema{type: :boolean}, + requested: %Schema{type: :boolean}, + showing_reblogs: %Schema{type: :boolean}, + subscribing: %Schema{type: :boolean} + }, + example: %{ + "blocked_by" => false, + "blocking" => false, + "domain_blocking" => false, + "endorsed" => false, + "followed_by" => false, + "following" => false, + "id" => "9tKi3esbG7OQgZ2920", + "muting" => false, + "muting_notifications" => false, + "requested" => false, + "showing_reblogs" => true, + "subscribing" => false + } + }) +end diff --git a/lib/pleroma/web/api_spec/schemas/actor_type.ex b/lib/pleroma/web/api_spec/schemas/actor_type.ex new file mode 100644 index 000000000..ac9b46678 --- /dev/null +++ b/lib/pleroma/web/api_spec/schemas/actor_type.ex @@ -0,0 +1,13 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.Schemas.ActorType do + require OpenApiSpex + + OpenApiSpex.schema(%{ + title: "ActorType", + type: :string, + enum: ["Application", "Group", "Organization", "Person", "Service"] + }) +end diff --git a/lib/pleroma/web/api_spec/schemas/api_error.ex b/lib/pleroma/web/api_spec/schemas/api_error.ex new file mode 100644 index 000000000..5815df94c --- /dev/null +++ b/lib/pleroma/web/api_spec/schemas/api_error.ex @@ -0,0 +1,19 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.Schemas.ApiError do + alias OpenApiSpex.Schema + + require OpenApiSpex + + OpenApiSpex.schema(%{ + title: "ApiError", + description: "Response schema for API error", + type: :object, + properties: %{error: %Schema{type: :string}}, + example: %{ + "error" => "Something went wrong" + } + }) +end diff --git a/lib/pleroma/web/api_spec/schemas/attachment.ex b/lib/pleroma/web/api_spec/schemas/attachment.ex new file mode 100644 index 000000000..c146c416e --- /dev/null +++ b/lib/pleroma/web/api_spec/schemas/attachment.ex @@ -0,0 +1,68 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.Schemas.Attachment do + alias OpenApiSpex.Schema + + require OpenApiSpex + + OpenApiSpex.schema(%{ + title: "Attachment", + description: "Represents a file or media attachment that can be added to a status.", + type: :object, + requried: [:id, :url, :preview_url], + properties: %{ + id: %Schema{type: :string}, + url: %Schema{ + type: :string, + format: :uri, + description: "The location of the original full-size attachment" + }, + remote_url: %Schema{ + type: :string, + format: :uri, + description: + "The location of the full-size original attachment on the remote website. String (URL), or null if the attachment is local", + nullable: true + }, + preview_url: %Schema{ + type: :string, + format: :uri, + description: "The location of a scaled-down preview of the attachment" + }, + text_url: %Schema{ + type: :string, + format: :uri, + description: "A shorter URL for the attachment" + }, + description: %Schema{ + type: :string, + nullable: true, + description: + "Alternate text that describes what is in the media attachment, to be used for the visually impaired or when media attachments do not load" + }, + type: %Schema{ + type: :string, + enum: ["image", "video", "audio", "unknown"], + description: "The type of the attachment" + }, + pleroma: %Schema{ + type: :object, + properties: %{ + mime_type: %Schema{type: :string, description: "mime type of the attachment"} + } + } + }, + example: %{ + id: "1638338801", + type: "image", + url: "someurl", + remote_url: "someurl", + preview_url: "someurl", + text_url: "someurl", + description: nil, + pleroma: %{mime_type: "image/png"} + } + }) +end diff --git a/lib/pleroma/web/api_spec/schemas/boolean_like.ex b/lib/pleroma/web/api_spec/schemas/boolean_like.ex new file mode 100644 index 000000000..f3bfb74da --- /dev/null +++ b/lib/pleroma/web/api_spec/schemas/boolean_like.ex @@ -0,0 +1,36 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.Schemas.BooleanLike do + alias OpenApiSpex.Schema + + require OpenApiSpex + + OpenApiSpex.schema(%{ + title: "BooleanLike", + description: """ + The following values will be treated as `false`: + - false + - 0 + - "0", + - "f", + - "F", + - "false", + - "FALSE", + - "off", + - "OFF" + + All other non-null values will be treated as `true` + """, + anyOf: [ + %Schema{type: :boolean}, + %Schema{type: :string}, + %Schema{type: :integer} + ] + }) + + def after_cast(value, _schmea) do + {:ok, Pleroma.Web.ControllerHelper.truthy_param?(value)} + end +end diff --git a/lib/pleroma/web/api_spec/schemas/conversation.ex b/lib/pleroma/web/api_spec/schemas/conversation.ex new file mode 100644 index 000000000..d8ff5ba26 --- /dev/null +++ b/lib/pleroma/web/api_spec/schemas/conversation.ex @@ -0,0 +1,41 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.Schemas.Conversation do + alias OpenApiSpex.Schema + alias Pleroma.Web.ApiSpec.Schemas.Account + alias Pleroma.Web.ApiSpec.Schemas.Status + + require OpenApiSpex + + OpenApiSpex.schema(%{ + title: "Conversation", + description: "Represents a conversation with \"direct message\" visibility.", + type: :object, + required: [:id, :accounts, :unread], + properties: %{ + id: %Schema{type: :string}, + accounts: %Schema{ + type: :array, + items: Account, + description: "Participants in the conversation" + }, + unread: %Schema{ + type: :boolean, + description: "Is the conversation currently marked as unread?" + }, + # last_status: Status + last_status: %Schema{ + allOf: [Status], + description: "The last status in the conversation, to be used for optional display" + } + }, + example: %{ + "id" => "418450", + "unread" => true, + "accounts" => [Account.schema().example], + "last_status" => Status.schema().example + } + }) +end diff --git a/lib/pleroma/web/api_spec/schemas/emoji.ex b/lib/pleroma/web/api_spec/schemas/emoji.ex new file mode 100644 index 000000000..26f35e648 --- /dev/null +++ b/lib/pleroma/web/api_spec/schemas/emoji.ex @@ -0,0 +1,29 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.Schemas.Emoji do + alias OpenApiSpex.Schema + + require OpenApiSpex + + OpenApiSpex.schema(%{ + title: "Emoji", + description: "Response schema for an emoji", + type: :object, + properties: %{ + shortcode: %Schema{type: :string}, + url: %Schema{type: :string, format: :uri}, + static_url: %Schema{type: :string, format: :uri}, + visible_in_picker: %Schema{type: :boolean} + }, + example: %{ + "shortcode" => "fatyoshi", + "url" => + "https://files.mastodon.social/custom_emojis/images/000/023/920/original/e57ecb623faa0dc9.png", + "static_url" => + "https://files.mastodon.social/custom_emojis/images/000/023/920/static/e57ecb623faa0dc9.png", + "visible_in_picker" => true + } + }) +end diff --git a/lib/pleroma/web/api_spec/schemas/flake_id.ex b/lib/pleroma/web/api_spec/schemas/flake_id.ex new file mode 100644 index 000000000..3b5f6477a --- /dev/null +++ b/lib/pleroma/web/api_spec/schemas/flake_id.ex @@ -0,0 +1,14 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.Schemas.FlakeID do + require OpenApiSpex + + OpenApiSpex.schema(%{ + title: "FlakeID", + description: + "Pleroma uses 128-bit ids as opposed to Mastodon's 64 bits. However just like Mastodon's ids they are lexically sortable strings", + type: :string + }) +end diff --git a/lib/pleroma/web/api_spec/schemas/list.ex b/lib/pleroma/web/api_spec/schemas/list.ex new file mode 100644 index 000000000..b7d1685c9 --- /dev/null +++ b/lib/pleroma/web/api_spec/schemas/list.ex @@ -0,0 +1,23 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.Schemas.List do + alias OpenApiSpex.Schema + + require OpenApiSpex + + OpenApiSpex.schema(%{ + title: "List", + description: "Represents a list of users", + type: :object, + properties: %{ + id: %Schema{type: :string, description: "The internal database ID of the list"}, + title: %Schema{type: :string, description: "The user-defined title of the list"} + }, + example: %{ + "id" => "12249", + "title" => "Friends" + } + }) +end diff --git a/lib/pleroma/web/api_spec/schemas/poll.ex b/lib/pleroma/web/api_spec/schemas/poll.ex new file mode 100644 index 000000000..c62096db0 --- /dev/null +++ b/lib/pleroma/web/api_spec/schemas/poll.ex @@ -0,0 +1,82 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.Schemas.Poll do + alias OpenApiSpex.Schema + alias Pleroma.Web.ApiSpec.Schemas.Emoji + alias Pleroma.Web.ApiSpec.Schemas.FlakeID + + require OpenApiSpex + + OpenApiSpex.schema(%{ + title: "Poll", + description: "Represents a poll attached to a status", + type: :object, + properties: %{ + id: FlakeID, + expires_at: %Schema{ + type: :string, + format: :"date-time", + nullable: true, + description: "When the poll ends" + }, + expired: %Schema{type: :boolean, description: "Is the poll currently expired?"}, + multiple: %Schema{ + type: :boolean, + description: "Does the poll allow multiple-choice answers?" + }, + votes_count: %Schema{ + type: :integer, + nullable: true, + description: "How many votes have been received. Number, or null if `multiple` is false." + }, + voted: %Schema{ + type: :boolean, + nullable: true, + description: + "When called with a user token, has the authorized user voted? Boolean, or null if no current user." + }, + emojis: %Schema{ + type: :array, + items: Emoji, + description: "Custom emoji to be used for rendering poll options." + }, + options: %Schema{ + type: :array, + items: %Schema{ + title: "PollOption", + type: :object, + properties: %{ + title: %Schema{type: :string}, + votes_count: %Schema{type: :integer} + } + }, + description: "Possible answers for the poll." + } + }, + example: %{ + id: "34830", + expires_at: "2019-12-05T04:05:08.302Z", + expired: true, + multiple: false, + votes_count: 10, + voters_count: nil, + voted: true, + own_votes: [ + 1 + ], + options: [ + %{ + title: "accept", + votes_count: 6 + }, + %{ + title: "deny", + votes_count: 4 + } + ], + emojis: [] + } + }) +end diff --git a/lib/pleroma/web/api_spec/schemas/push_subscription.ex b/lib/pleroma/web/api_spec/schemas/push_subscription.ex new file mode 100644 index 000000000..cc91b95b8 --- /dev/null +++ b/lib/pleroma/web/api_spec/schemas/push_subscription.ex @@ -0,0 +1,66 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.Schemas.PushSubscription do + alias OpenApiSpex.Schema + + require OpenApiSpex + + OpenApiSpex.schema(%{ + title: "PushSubscription", + description: "Response schema for a push subscription", + type: :object, + properties: %{ + id: %Schema{ + anyOf: [%Schema{type: :string}, %Schema{type: :integer}], + description: "The id of the push subscription in the database." + }, + endpoint: %Schema{type: :string, description: "Where push alerts will be sent to."}, + server_key: %Schema{type: :string, description: "The streaming server's VAPID key."}, + alerts: %Schema{ + type: :object, + description: "Which alerts should be delivered to the endpoint.", + properties: %{ + follow: %Schema{ + type: :boolean, + description: "Receive a push notification when someone has followed you?" + }, + favourite: %Schema{ + type: :boolean, + description: + "Receive a push notification when a status you created has been favourited by someone else?" + }, + reblog: %Schema{ + type: :boolean, + description: + "Receive a push notification when a status you created has been boosted by someone else?" + }, + mention: %Schema{ + type: :boolean, + description: + "Receive a push notification when someone else has mentioned you in a status?" + }, + poll: %Schema{ + type: :boolean, + description: + "Receive a push notification when a poll you voted in or created has ended? " + } + } + } + }, + example: %{ + "id" => "328_183", + "endpoint" => "https://yourdomain.example/listener", + "alerts" => %{ + "follow" => true, + "favourite" => true, + "reblog" => true, + "mention" => true, + "poll" => true + }, + "server_key" => + "BCk-QqERU0q-CfYZjcuB6lnyyOYfJ2AifKqfeGIm7Z-HiTU5T9eTG5GxVA0_OH5mMlI4UkkDTpaZwozy0TzdZ2M=" + } + }) +end diff --git a/lib/pleroma/web/api_spec/schemas/scheduled_status.ex b/lib/pleroma/web/api_spec/schemas/scheduled_status.ex new file mode 100644 index 000000000..0520d0848 --- /dev/null +++ b/lib/pleroma/web/api_spec/schemas/scheduled_status.ex @@ -0,0 +1,54 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.Schemas.ScheduledStatus do + alias OpenApiSpex.Schema + alias Pleroma.Web.ApiSpec.Schemas.Attachment + alias Pleroma.Web.ApiSpec.Schemas.Poll + alias Pleroma.Web.ApiSpec.Schemas.VisibilityScope + + require OpenApiSpex + + OpenApiSpex.schema(%{ + title: "ScheduledStatus", + description: "Represents a status that will be published at a future scheduled date.", + type: :object, + required: [:id, :scheduled_at, :params], + properties: %{ + id: %Schema{type: :string}, + scheduled_at: %Schema{type: :string, format: :"date-time"}, + media_attachments: %Schema{type: :array, items: Attachment}, + params: %Schema{ + type: :object, + required: [:text, :visibility], + properties: %{ + text: %Schema{type: :string, nullable: true}, + media_ids: %Schema{type: :array, nullable: true, items: %Schema{type: :string}}, + sensitive: %Schema{type: :boolean, nullable: true}, + spoiler_text: %Schema{type: :string, nullable: true}, + visibility: %Schema{type: VisibilityScope, nullable: true}, + scheduled_at: %Schema{type: :string, format: :"date-time", nullable: true}, + poll: %Schema{type: Poll, nullable: true}, + in_reply_to_id: %Schema{type: :string, nullable: true} + } + } + }, + example: %{ + id: "3221", + scheduled_at: "2019-12-05T12:33:01.000Z", + params: %{ + text: "test content", + media_ids: nil, + sensitive: nil, + spoiler_text: nil, + visibility: nil, + scheduled_at: nil, + poll: nil, + idempotency: nil, + in_reply_to_id: nil + }, + media_attachments: [Attachment.schema().example] + } + }) +end diff --git a/lib/pleroma/web/api_spec/schemas/status.ex b/lib/pleroma/web/api_spec/schemas/status.ex new file mode 100644 index 000000000..8b87cb25b --- /dev/null +++ b/lib/pleroma/web/api_spec/schemas/status.ex @@ -0,0 +1,325 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.Schemas.Status do + alias OpenApiSpex.Schema + alias Pleroma.Web.ApiSpec.Schemas.Account + alias Pleroma.Web.ApiSpec.Schemas.Attachment + alias Pleroma.Web.ApiSpec.Schemas.Emoji + alias Pleroma.Web.ApiSpec.Schemas.FlakeID + alias Pleroma.Web.ApiSpec.Schemas.Poll + alias Pleroma.Web.ApiSpec.Schemas.Tag + alias Pleroma.Web.ApiSpec.Schemas.VisibilityScope + + require OpenApiSpex + + OpenApiSpex.schema(%{ + title: "Status", + description: "Response schema for a status", + type: :object, + properties: %{ + account: %Schema{allOf: [Account], description: "The account that authored this status"}, + application: %Schema{ + description: "The application used to post this status", + type: :object, + properties: %{ + name: %Schema{type: :string}, + website: %Schema{type: :string, nullable: true, format: :uri} + } + }, + bookmarked: %Schema{type: :boolean, description: "Have you bookmarked this status?"}, + card: %Schema{ + type: :object, + nullable: true, + description: "Preview card for links included within status content", + required: [:url, :title, :description, :type], + properties: %{ + type: %Schema{ + type: :string, + enum: ["link", "photo", "video", "rich"], + description: "The type of the preview card" + }, + provider_name: %Schema{ + type: :string, + nullable: true, + description: "The provider of the original resource" + }, + provider_url: %Schema{ + type: :string, + format: :uri, + description: "A link to the provider of the original resource" + }, + url: %Schema{type: :string, format: :uri, description: "Location of linked resource"}, + image: %Schema{ + type: :string, + nullable: true, + format: :uri, + description: "Preview thumbnail" + }, + title: %Schema{type: :string, description: "Title of linked resource"}, + description: %Schema{type: :string, description: "Description of preview"} + } + }, + content: %Schema{type: :string, format: :html, description: "HTML-encoded status content"}, + created_at: %Schema{ + type: :string, + format: "date-time", + description: "The date when this status was created" + }, + emojis: %Schema{ + type: :array, + items: Emoji, + description: "Custom emoji to be used when rendering status content" + }, + favourited: %Schema{type: :boolean, description: "Have you favourited this status?"}, + favourites_count: %Schema{ + type: :integer, + description: "How many favourites this status has received" + }, + id: FlakeID, + in_reply_to_account_id: %Schema{ + allOf: [FlakeID], + nullable: true, + description: "ID of the account being replied to" + }, + in_reply_to_id: %Schema{ + allOf: [FlakeID], + nullable: true, + description: "ID of the status being replied" + }, + language: %Schema{ + type: :string, + nullable: true, + description: "Primary language of this status" + }, + media_attachments: %Schema{ + type: :array, + items: Attachment, + description: "Media that is attached to this status" + }, + mentions: %Schema{ + type: :array, + description: "Mentions of users within the status content", + items: %Schema{ + type: :object, + properties: %{ + id: %Schema{allOf: [FlakeID], description: "The account id of the mentioned user"}, + acct: %Schema{ + type: :string, + description: + "The webfinger acct: URI of the mentioned user. Equivalent to `username` for local users, or `username@domain` for remote users." + }, + username: %Schema{type: :string, description: "The username of the mentioned user"}, + url: %Schema{ + type: :string, + format: :uri, + description: "The location of the mentioned user's profile" + } + } + } + }, + muted: %Schema{ + type: :boolean, + description: "Have you muted notifications for this status's conversation?" + }, + pinned: %Schema{ + type: :boolean, + description: "Have you pinned this status? Only appears if the status is pinnable." + }, + pleroma: %Schema{ + type: :object, + properties: %{ + content: %Schema{ + type: :object, + additionalProperties: %Schema{type: :string}, + description: + "A map consisting of alternate representations of the `content` property with the key being it's mimetype. Currently the only alternate representation supported is `text/plain`" + }, + conversation_id: %Schema{ + type: :integer, + description: "The ID of the AP context the status is associated with (if any)" + }, + direct_conversation_id: %Schema{ + type: :integer, + nullable: true, + description: + "The ID of the Mastodon direct message conversation the status is associated with (if any)" + }, + emoji_reactions: %Schema{ + type: :array, + description: + "A list with emoji / reaction maps. Contains no information about the reacting users, for that use the /statuses/:id/reactions endpoint.", + items: %Schema{ + type: :object, + properties: %{ + name: %Schema{type: :string}, + count: %Schema{type: :integer}, + me: %Schema{type: :boolean} + } + } + }, + expires_at: %Schema{ + type: :string, + format: "date-time", + nullable: true, + description: + "A datetime (ISO 8601) that states when the post will expire (be deleted automatically), or empty if the post won't expire" + }, + in_reply_to_account_acct: %Schema{ + type: :string, + nullable: true, + description: "The `acct` property of User entity for replied user (if any)" + }, + local: %Schema{ + type: :boolean, + description: "`true` if the post was made on the local instance" + }, + spoiler_text: %Schema{ + type: :object, + additionalProperties: %Schema{type: :string}, + description: + "A map consisting of alternate representations of the `spoiler_text` property with the key being it's mimetype. Currently the only alternate representation supported is `text/plain`." + }, + thread_muted: %Schema{ + type: :boolean, + description: "`true` if the thread the post belongs to is muted" + } + } + }, + poll: %Schema{allOf: [Poll], nullable: true, description: "The poll attached to the status"}, + reblog: %Schema{ + allOf: [%OpenApiSpex.Reference{"$ref": "#/components/schemas/Status"}], + nullable: true, + description: "The status being reblogged" + }, + reblogged: %Schema{type: :boolean, description: "Have you boosted this status?"}, + reblogs_count: %Schema{ + type: :integer, + description: "How many boosts this status has received" + }, + replies_count: %Schema{ + type: :integer, + description: "How many replies this status has received" + }, + sensitive: %Schema{ + type: :boolean, + description: "Is this status marked as sensitive content?" + }, + spoiler_text: %Schema{ + type: :string, + description: + "Subject or summary line, below which status content is collapsed until expanded" + }, + tags: %Schema{type: :array, items: Tag}, + uri: %Schema{ + type: :string, + format: :uri, + description: "URI of the status used for federation" + }, + url: %Schema{ + type: :string, + nullable: true, + format: :uri, + description: "A link to the status's HTML representation" + }, + visibility: %Schema{ + allOf: [VisibilityScope], + description: "Visibility of this status" + } + }, + example: %{ + "account" => %{ + "acct" => "nick6", + "avatar" => "http://localhost:4001/images/avi.png", + "avatar_static" => "http://localhost:4001/images/avi.png", + "bot" => false, + "created_at" => "2020-04-07T19:48:51.000Z", + "display_name" => "Test テスト User 6", + "emojis" => [], + "fields" => [], + "followers_count" => 1, + "following_count" => 0, + "header" => "http://localhost:4001/images/banner.png", + "header_static" => "http://localhost:4001/images/banner.png", + "id" => "9toJCsKN7SmSf3aj5c", + "locked" => false, + "note" => "Tester Number 6", + "pleroma" => %{ + "background_image" => nil, + "confirmation_pending" => false, + "hide_favorites" => true, + "hide_followers" => false, + "hide_followers_count" => false, + "hide_follows" => false, + "hide_follows_count" => false, + "is_admin" => false, + "is_moderator" => false, + "relationship" => %{ + "blocked_by" => false, + "blocking" => false, + "domain_blocking" => false, + "endorsed" => false, + "followed_by" => false, + "following" => true, + "id" => "9toJCsKN7SmSf3aj5c", + "muting" => false, + "muting_notifications" => false, + "requested" => false, + "showing_reblogs" => true, + "subscribing" => false + }, + "skip_thread_containment" => false, + "tags" => [] + }, + "source" => %{ + "fields" => [], + "note" => "Tester Number 6", + "pleroma" => %{"actor_type" => "Person", "discoverable" => false}, + "sensitive" => false + }, + "statuses_count" => 1, + "url" => "http://localhost:4001/users/nick6", + "username" => "nick6" + }, + "application" => %{"name" => "Web", "website" => nil}, + "bookmarked" => false, + "card" => nil, + "content" => "foobar", + "created_at" => "2020-04-07T19:48:51.000Z", + "emojis" => [], + "favourited" => false, + "favourites_count" => 0, + "id" => "9toJCu5YZW7O7gfvH6", + "in_reply_to_account_id" => nil, + "in_reply_to_id" => nil, + "language" => nil, + "media_attachments" => [], + "mentions" => [], + "muted" => false, + "pinned" => false, + "pleroma" => %{ + "content" => %{"text/plain" => "foobar"}, + "conversation_id" => 345_972, + "direct_conversation_id" => nil, + "emoji_reactions" => [], + "expires_at" => nil, + "in_reply_to_account_acct" => nil, + "local" => true, + "spoiler_text" => %{"text/plain" => ""}, + "thread_muted" => false + }, + "poll" => nil, + "reblog" => nil, + "reblogged" => false, + "reblogs_count" => 0, + "replies_count" => 0, + "sensitive" => false, + "spoiler_text" => "", + "tags" => [], + "uri" => "http://localhost:4001/objects/0f5dad44-0e9e-4610-b377-a2631e499190", + "url" => "http://localhost:4001/notice/9toJCu5YZW7O7gfvH6", + "visibility" => "private" + } + }) +end diff --git a/lib/pleroma/web/api_spec/schemas/tag.ex b/lib/pleroma/web/api_spec/schemas/tag.ex new file mode 100644 index 000000000..e693fb83e --- /dev/null +++ b/lib/pleroma/web/api_spec/schemas/tag.ex @@ -0,0 +1,27 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.Schemas.Tag do + alias OpenApiSpex.Schema + + require OpenApiSpex + + OpenApiSpex.schema(%{ + title: "Tag", + description: "Represents a hashtag used within the content of a status", + type: :object, + properties: %{ + name: %Schema{type: :string, description: "The value of the hashtag after the # sign"}, + url: %Schema{ + type: :string, + format: :uri, + description: "A link to the hashtag on the instance" + } + }, + example: %{ + name: "cofe", + url: "https://lain.com/tag/cofe" + } + }) +end diff --git a/lib/pleroma/web/api_spec/schemas/visibility_scope.ex b/lib/pleroma/web/api_spec/schemas/visibility_scope.ex new file mode 100644 index 000000000..831734e27 --- /dev/null +++ b/lib/pleroma/web/api_spec/schemas/visibility_scope.ex @@ -0,0 +1,14 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.Schemas.VisibilityScope do + require OpenApiSpex + + OpenApiSpex.schema(%{ + title: "VisibilityScope", + description: "Status visibility", + type: :string, + enum: ["public", "unlisted", "private", "direct", "list"] + }) +end diff --git a/lib/pleroma/web/auth/pleroma_authenticator.ex b/lib/pleroma/web/auth/pleroma_authenticator.ex index cb09664ce..a8f554aa3 100644 --- a/lib/pleroma/web/auth/pleroma_authenticator.ex +++ b/lib/pleroma/web/auth/pleroma_authenticator.ex @@ -19,8 +19,8 @@ def get_user(%Plug.Conn{} = conn) do {_, true} <- {:checkpw, AuthenticationPlug.checkpw(password, user.password_hash)} do {:ok, user} else - error -> - {:error, error} + {:error, _reason} = error -> error + error -> {:error, error} end end diff --git a/lib/pleroma/web/auth/totp_authenticator.ex b/lib/pleroma/web/auth/totp_authenticator.ex new file mode 100644 index 000000000..ce8a76219 --- /dev/null +++ b/lib/pleroma/web/auth/totp_authenticator.ex @@ -0,0 +1,45 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2019 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.Auth.TOTPAuthenticator do + alias Pleroma.MFA + alias Pleroma.MFA.TOTP + alias Pleroma.Plugs.AuthenticationPlug + alias Pleroma.User + + @doc "Verify code or check backup code." + @spec verify(String.t(), User.t()) :: + {:ok, :pass} | {:error, :invalid_token | :invalid_secret_and_token} + def verify( + token, + %User{ + multi_factor_authentication_settings: + %{enabled: true, totp: %{secret: secret, confirmed: true}} = _ + } = _user + ) + when is_binary(token) and byte_size(token) > 0 do + TOTP.validate_token(secret, token) + end + + def verify(_, _), do: {:error, :invalid_token} + + @spec verify_recovery_code(User.t(), String.t()) :: + {:ok, :pass} | {:error, :invalid_token} + def verify_recovery_code( + %User{multi_factor_authentication_settings: %{enabled: true, backup_codes: codes}} = user, + code + ) + when is_list(codes) and is_binary(code) do + hash_code = Enum.find(codes, fn hash -> AuthenticationPlug.checkpw(code, hash) end) + + if hash_code do + MFA.invalidate_backup_code(user, hash_code) + {:ok, :pass} + else + {:error, :invalid_token} + end + end + + def verify_recovery_code(_, _), do: {:error, :invalid_token} +end diff --git a/lib/pleroma/web/common_api/activity_draft.ex b/lib/pleroma/web/common_api/activity_draft.ex index c4356f93b..3f1a50b96 100644 --- a/lib/pleroma/web/common_api/activity_draft.ex +++ b/lib/pleroma/web/common_api/activity_draft.ex @@ -58,16 +58,16 @@ def create(user, params) do end defp put_params(draft, params) do - params = Map.put_new(params, "in_reply_to_status_id", params["in_reply_to_id"]) + params = Map.put_new(params, :in_reply_to_status_id, params[:in_reply_to_id]) %__MODULE__{draft | params: params} end - defp status(%{params: %{"status" => status}} = draft) do + defp status(%{params: %{status: status}} = draft) do %__MODULE__{draft | status: String.trim(status)} end defp summary(%{params: params} = draft) do - %__MODULE__{draft | summary: Map.get(params, "spoiler_text", "")} + %__MODULE__{draft | summary: Map.get(params, :spoiler_text, "")} end defp full_payload(%{status: status, summary: summary} = draft) do @@ -84,16 +84,20 @@ defp attachments(%{params: params} = draft) do %__MODULE__{draft | attachments: attachments} end - defp in_reply_to(draft) do - case Map.get(draft.params, "in_reply_to_status_id") do - "" -> draft - nil -> draft - id -> %__MODULE__{draft | in_reply_to: Activity.get_by_id(id)} - end + defp in_reply_to(%{params: %{in_reply_to_status_id: ""}} = draft), do: draft + + defp in_reply_to(%{params: %{in_reply_to_status_id: id}} = draft) when is_binary(id) do + %__MODULE__{draft | in_reply_to: Activity.get_by_id(id)} end + defp in_reply_to(%{params: %{in_reply_to_status_id: %Activity{} = in_reply_to}} = draft) do + %__MODULE__{draft | in_reply_to: in_reply_to} + end + + defp in_reply_to(draft), do: draft + defp in_reply_to_conversation(draft) do - in_reply_to_conversation = Participation.get(draft.params["in_reply_to_conversation_id"]) + in_reply_to_conversation = Participation.get(draft.params[:in_reply_to_conversation_id]) %__MODULE__{draft | in_reply_to_conversation: in_reply_to_conversation} end @@ -108,7 +112,7 @@ defp visibility(%{params: params} = draft) do end defp expires_at(draft) do - case CommonAPI.check_expiry_date(draft.params["expires_in"]) do + case CommonAPI.check_expiry_date(draft.params[:expires_in]) do {:ok, expires_at} -> %__MODULE__{draft | expires_at: expires_at} {:error, message} -> add_error(draft, message) end @@ -140,7 +144,7 @@ defp to_and_cc(draft) do addressed_users = draft.mentions |> Enum.map(fn {_, mentioned_user} -> mentioned_user.ap_id end) - |> Utils.get_addressed_users(draft.params["to"]) + |> Utils.get_addressed_users(draft.params[:to]) {to, cc} = Utils.get_to_and_cc( @@ -160,7 +164,7 @@ defp context(draft) do end defp sensitive(draft) do - sensitive = draft.params["sensitive"] || Enum.member?(draft.tags, {"#nsfw", "nsfw"}) + sensitive = draft.params[:sensitive] || Enum.member?(draft.tags, {"#nsfw", "nsfw"}) %__MODULE__{draft | sensitive: sensitive} end @@ -187,7 +191,7 @@ defp object(draft) do end defp preview?(draft) do - preview? = Pleroma.Web.ControllerHelper.truthy_param?(draft.params["preview"]) || false + preview? = Pleroma.Web.ControllerHelper.truthy_param?(draft.params[:preview]) %__MODULE__{draft | preview?: preview?} end diff --git a/lib/pleroma/web/common_api/common_api.ex b/lib/pleroma/web/common_api/common_api.ex index 091011c6b..7c94f16b6 100644 --- a/lib/pleroma/web/common_api/common_api.ex +++ b/lib/pleroma/web/common_api/common_api.ex @@ -7,11 +7,14 @@ defmodule Pleroma.Web.CommonAPI do alias Pleroma.ActivityExpiration alias Pleroma.Conversation.Participation alias Pleroma.FollowingRelationship + alias Pleroma.Notification alias Pleroma.Object alias Pleroma.ThreadMute alias Pleroma.User alias Pleroma.UserRelationship alias Pleroma.Web.ActivityPub.ActivityPub + alias Pleroma.Web.ActivityPub.Builder + alias Pleroma.Web.ActivityPub.Pipeline alias Pleroma.Web.ActivityPub.Utils alias Pleroma.Web.ActivityPub.Visibility @@ -19,6 +22,26 @@ defmodule Pleroma.Web.CommonAPI do import Pleroma.Web.CommonAPI.Utils require Pleroma.Constants + require Logger + + def unblock(blocker, blocked) do + with {_, %Activity{} = block} <- {:fetch_block, Utils.fetch_latest_block(blocker, blocked)}, + {:ok, unblock_data, _} <- Builder.undo(blocker, block), + {:ok, unblock, _} <- Pipeline.common_pipeline(unblock_data, local: true) do + {:ok, unblock} + else + {:fetch_block, nil} -> + if User.blocks?(blocker, blocked) do + User.unblock(blocker, blocked) + {:ok, :no_activity} + else + {:error, :not_blocking} + end + + e -> + e + end + end def follow(follower, followed) do timeout = Pleroma.Config.get([:activitypub, :follow_handshake_timeout]) @@ -39,10 +62,10 @@ def unfollow(follower, unfollowed) do end def accept_follow_request(follower, followed) do - with {:ok, follower} <- User.follow(follower, followed), - %Activity{} = follow_activity <- Utils.fetch_latest_follow(follower, followed), + with %Activity{} = follow_activity <- Utils.fetch_latest_follow(follower, followed), + {:ok, follower} <- User.follow(follower, followed), {:ok, follow_activity} <- Utils.update_follow_state_for_all(follow_activity, "accept"), - {:ok, _relationship} <- FollowingRelationship.update(follower, followed, "accept"), + {:ok, _relationship} <- FollowingRelationship.update(follower, followed, :follow_accept), {:ok, _activity} <- ActivityPub.accept(%{ to: [follower.ap_id], @@ -57,7 +80,8 @@ def accept_follow_request(follower, followed) do def reject_follow_request(follower, followed) do with %Activity{} = follow_activity <- Utils.fetch_latest_follow(follower, followed), {:ok, follow_activity} <- Utils.update_follow_state_for_all(follow_activity, "reject"), - {:ok, _relationship} <- FollowingRelationship.update(follower, followed, "reject"), + {:ok, _relationship} <- FollowingRelationship.update(follower, followed, :follow_reject), + {:ok, _notifications} <- Notification.dismiss(follow_activity), {:ok, _activity} <- ActivityPub.reject(%{ to: [follower.ap_id], @@ -70,64 +94,124 @@ def reject_follow_request(follower, followed) do end def delete(activity_id, user) do - with {_, %Activity{data: %{"object" => _}} = activity} <- - {:find_activity, Activity.get_by_id_with_object(activity_id)}, - %Object{} = object <- Object.normalize(activity), + with {_, %Activity{data: %{"object" => _, "type" => "Create"}} = activity} <- + {:find_activity, Activity.get_by_id(activity_id)}, + {_, %Object{} = object, _} <- + {:find_object, Object.normalize(activity, false), activity}, true <- User.superuser?(user) || user.ap_id == object.data["actor"], - {:ok, _} <- unpin(activity_id, user), - {:ok, delete} <- ActivityPub.delete(object) do + {:ok, delete_data, _} <- Builder.delete(user, object.data["id"]), + {:ok, delete, _} <- Pipeline.common_pipeline(delete_data, local: true) do {:ok, delete} else - {:find_activity, _} -> {:error, :not_found} - _ -> {:error, dgettext("errors", "Could not delete")} + {:find_activity, _} -> + {:error, :not_found} + + {:find_object, nil, %Activity{data: %{"actor" => actor, "object" => object}}} -> + # We have the create activity, but not the object, it was probably pruned. + # Insert a tombstone and try again + with {:ok, tombstone_data, _} <- Builder.tombstone(actor, object), + {:ok, _tombstone} <- Object.create(tombstone_data) do + delete(activity_id, user) + else + _ -> + Logger.error( + "Could not insert tombstone for missing object on deletion. Object is #{object}." + ) + + {:error, dgettext("errors", "Could not delete")} + end + + _ -> + {:error, dgettext("errors", "Could not delete")} end end - def repeat(id_or_ap_id, user, params \\ %{}) do - with {_, %Activity{} = activity} <- {:find_activity, get_by_id_or_ap_id(id_or_ap_id)}, - object <- Object.normalize(activity), - announce_activity <- Utils.get_existing_announce(user.ap_id, object), - public <- public_announce?(object, params) do + def repeat(id, user, params \\ %{}) do + with %Activity{data: %{"type" => "Create"}} = activity <- Activity.get_by_id(id) do + object = Object.normalize(activity) + announce_activity = Utils.get_existing_announce(user.ap_id, object) + public = public_announce?(object, params) + if announce_activity do {:ok, announce_activity, object} else ActivityPub.announce(user, object, nil, true, public) end else - {:find_activity, _} -> {:error, :not_found} - _ -> {:error, dgettext("errors", "Could not repeat")} + _ -> {:error, :not_found} end end - def unrepeat(id_or_ap_id, user) do - with {_, %Activity{} = activity} <- {:find_activity, get_by_id_or_ap_id(id_or_ap_id)} do - object = Object.normalize(activity) - ActivityPub.unannounce(user, object) + def unrepeat(id, user) do + with {_, %Activity{data: %{"type" => "Create"}} = activity} <- + {:find_activity, Activity.get_by_id(id)}, + %Object{} = note <- Object.normalize(activity, false), + %Activity{} = announce <- Utils.get_existing_announce(user.ap_id, note), + {:ok, undo, _} <- Builder.undo(user, announce), + {:ok, activity, _} <- Pipeline.common_pipeline(undo, local: true) do + {:ok, activity} else {:find_activity, _} -> {:error, :not_found} _ -> {:error, dgettext("errors", "Could not unrepeat")} end end - def favorite(id_or_ap_id, user) do - with {_, %Activity{} = activity} <- {:find_activity, get_by_id_or_ap_id(id_or_ap_id)}, - object <- Object.normalize(activity), - like_activity <- Utils.get_existing_like(user.ap_id, object) do - if like_activity do - {:ok, like_activity, object} - else - ActivityPub.like(user, object) - end - else - {:find_activity, _} -> {:error, :not_found} - _ -> {:error, dgettext("errors", "Could not favorite")} + @spec favorite(User.t(), binary()) :: {:ok, Activity.t() | :already_liked} | {:error, any()} + def favorite(%User{} = user, id) do + case favorite_helper(user, id) do + {:ok, _} = res -> + res + + {:error, :not_found} = res -> + res + + {:error, e} -> + Logger.error("Could not favorite #{id}. Error: #{inspect(e, pretty: true)}") + {:error, dgettext("errors", "Could not favorite")} end end - def unfavorite(id_or_ap_id, user) do - with {_, %Activity{} = activity} <- {:find_activity, get_by_id_or_ap_id(id_or_ap_id)} do - object = Object.normalize(activity) - ActivityPub.unlike(user, object) + def favorite_helper(user, id) do + with {_, %Activity{object: object}} <- {:find_object, Activity.get_by_id_with_object(id)}, + {_, {:ok, like_object, meta}} <- {:build_object, Builder.like(user, object)}, + {_, {:ok, %Activity{} = activity, _meta}} <- + {:common_pipeline, + Pipeline.common_pipeline(like_object, Keyword.put(meta, :local, true))} do + {:ok, activity} + else + {:find_object, _} -> + {:error, :not_found} + + {:common_pipeline, + { + :error, + { + :validate_object, + { + :error, + changeset + } + } + }} = e -> + if {:object, {"already liked by this actor", []}} in changeset.errors do + {:ok, :already_liked} + else + {:error, e} + end + + e -> + {:error, e} + end + end + + def unfavorite(id, user) do + with {_, %Activity{data: %{"type" => "Create"}} = activity} <- + {:find_activity, Activity.get_by_id(id)}, + %Object{} = note <- Object.normalize(activity, false), + %Activity{} = like <- Utils.get_existing_like(user.ap_id, note), + {:ok, undo, _} <- Builder.undo(user, like), + {:ok, activity, _} <- Pipeline.common_pipeline(undo, local: true) do + {:ok, activity} else {:find_activity, _} -> {:error, :not_found} _ -> {:error, dgettext("errors", "Could not unfavorite")} @@ -136,8 +220,10 @@ def unfavorite(id_or_ap_id, user) do def react_with_emoji(id, user, emoji) do with %Activity{} = activity <- Activity.get_by_id(id), - object <- Object.normalize(activity) do - ActivityPub.react_with_emoji(user, object, emoji) + object <- Object.normalize(activity), + {:ok, emoji_react, _} <- Builder.emoji_react(user, object, emoji), + {:ok, activity, _} <- Pipeline.common_pipeline(emoji_react, local: true) do + {:ok, activity} else _ -> {:error, dgettext("errors", "Could not add reaction emoji")} @@ -145,8 +231,10 @@ def react_with_emoji(id, user, emoji) do end def unreact_with_emoji(id, user, emoji) do - with %Activity{} = reaction_activity <- Utils.get_latest_reaction(id, user, emoji) do - ActivityPub.unreact_with_emoji(user, reaction_activity.data["id"]) + with %Activity{} = reaction_activity <- Utils.get_latest_reaction(id, user, emoji), + {:ok, undo, _} <- Builder.undo(user, reaction_activity), + {:ok, activity, _} <- Pipeline.common_pipeline(undo, local: true) do + {:ok, activity} else _ -> {:error, dgettext("errors", "Could not remove reaction emoji")} @@ -208,7 +296,7 @@ defp normalize_and_validate_choices(choices, object) do end end - def public_announce?(_, %{"visibility" => visibility}) + def public_announce?(_, %{visibility: visibility}) when visibility in ~w{public unlisted private direct}, do: visibility in ~w(public unlisted) @@ -218,11 +306,11 @@ def public_announce?(object, _) do def get_visibility(_, _, %Participation{}), do: {"direct", "direct"} - def get_visibility(%{"visibility" => visibility}, in_reply_to, _) + def get_visibility(%{visibility: visibility}, in_reply_to, _) when visibility in ~w{public unlisted private direct}, do: {visibility, get_replied_to_visibility(in_reply_to)} - def get_visibility(%{"visibility" => "list:" <> list_id}, in_reply_to, _) do + def get_visibility(%{visibility: "list:" <> list_id}, in_reply_to, _) do visibility = {:list, String.to_integer(list_id)} {visibility, get_replied_to_visibility(in_reply_to)} end @@ -280,7 +368,7 @@ def listen(user, %{"title" => _} = data) do end end - def post(user, %{"status" => _} = data) do + def post(user, %{status: _} = data) do with {:ok, draft} <- Pleroma.Web.CommonAPI.ActivityDraft.create(user, data) do draft.changes |> ActivityPub.create(draft.preview?) @@ -296,32 +384,12 @@ defp maybe_create_activity_expiration({:ok, activity}, %NaiveDateTime{} = expire defp maybe_create_activity_expiration(result, _), do: result - # Updates the emojis for a user based on their profile - def update(user) do - emoji = emoji_from_profile(user) - source_data = Map.put(user.source_data, "tag", emoji) - - user = - case User.update_source_data(user, source_data) do - {:ok, user} -> user - _ -> user - end - - ActivityPub.update(%{ - local: true, - to: [Pleroma.Constants.as_public(), user.follower_address], - cc: [], - actor: user.ap_id, - object: Pleroma.Web.ActivityPub.UserView.render("user.json", %{user: user}) - }) - end - - def pin(id_or_ap_id, %{ap_id: user_ap_id} = user) do + def pin(id, %{ap_id: user_ap_id} = user) do with %Activity{ actor: ^user_ap_id, data: %{"type" => "Create"}, object: %Object{data: %{"type" => object_type}} - } = activity <- get_by_id_or_ap_id(id_or_ap_id), + } = activity <- Activity.get_by_id_with_object(id), true <- object_type in ["Note", "Article", "Question"], true <- Visibility.is_public?(activity), {:ok, _user} <- User.add_pinnned_activity(user, activity) do @@ -332,8 +400,8 @@ def pin(id_or_ap_id, %{ap_id: user_ap_id} = user) do end end - def unpin(id_or_ap_id, user) do - with %Activity{} = activity <- get_by_id_or_ap_id(id_or_ap_id), + def unpin(id, user) do + with %Activity{data: %{"type" => "Create"}} = activity <- Activity.get_by_id(id), {:ok, _user} <- User.remove_pinnned_activity(user, activity) do {:ok, activity} else @@ -358,12 +426,12 @@ def remove_mute(user, activity) do def thread_muted?(%{id: nil} = _user, _activity), do: false def thread_muted?(user, activity) do - ThreadMute.check_muted(user.id, activity.data["context"]) != [] + ThreadMute.exists?(user.id, activity.data["context"]) end - def report(user, %{"account_id" => account_id} = data) do - with {:ok, account} <- get_reported_account(account_id), - {:ok, {content_html, _, _}} <- make_report_content_html(data["comment"]), + def report(user, data) do + with {:ok, account} <- get_reported_account(data.account_id), + {:ok, {content_html, _, _}} <- make_report_content_html(data[:comment]), {:ok, statuses} <- get_report_statuses(account, data) do ActivityPub.flag(%{ context: Utils.generate_context_id(), @@ -371,13 +439,11 @@ def report(user, %{"account_id" => account_id} = data) do account: account, statuses: statuses, content: content_html, - forward: data["forward"] || false + forward: Map.get(data, :forward, false) }) end end - def report(_user, _params), do: {:error, dgettext("errors", "Valid `account_id` required")} - defp get_reported_account(account_id) do case User.get_cached_by_id(account_id) do %User{} = account -> {:ok, account} @@ -411,11 +477,11 @@ def update_activity_scope(activity_id, opts \\ %{}) do end end - defp toggle_sensitive(activity, %{"sensitive" => sensitive}) when sensitive in ~w(true false) do - toggle_sensitive(activity, %{"sensitive" => String.to_existing_atom(sensitive)}) + defp toggle_sensitive(activity, %{sensitive: sensitive}) when sensitive in ~w(true false) do + toggle_sensitive(activity, %{sensitive: String.to_existing_atom(sensitive)}) end - defp toggle_sensitive(%Activity{object: object} = activity, %{"sensitive" => sensitive}) + defp toggle_sensitive(%Activity{object: object} = activity, %{sensitive: sensitive}) when is_boolean(sensitive) do new_data = Map.put(object.data, "sensitive", sensitive) @@ -429,7 +495,7 @@ defp toggle_sensitive(%Activity{object: object} = activity, %{"sensitive" => sen defp toggle_sensitive(activity, _), do: {:ok, activity} - defp set_visibility(activity, %{"visibility" => visibility}) do + defp set_visibility(activity, %{visibility: visibility}) do Utils.update_activity_visibility(activity, visibility) end diff --git a/lib/pleroma/web/common_api/utils.ex b/lib/pleroma/web/common_api/utils.ex index 635e7cd38..e8deee223 100644 --- a/lib/pleroma/web/common_api/utils.ex +++ b/lib/pleroma/web/common_api/utils.ex @@ -10,7 +10,6 @@ defmodule Pleroma.Web.CommonAPI.Utils do alias Pleroma.Activity alias Pleroma.Config alias Pleroma.Conversation.Participation - alias Pleroma.Emoji alias Pleroma.Formatter alias Pleroma.Object alias Pleroma.Plugs.AuthenticationPlug @@ -18,35 +17,16 @@ defmodule Pleroma.Web.CommonAPI.Utils do alias Pleroma.User alias Pleroma.Web.ActivityPub.Utils alias Pleroma.Web.ActivityPub.Visibility - alias Pleroma.Web.Endpoint alias Pleroma.Web.MediaProxy require Logger require Pleroma.Constants - # This is a hack for twidere. - def get_by_id_or_ap_id(id) do - activity = - with true <- FlakeId.flake_id?(id), - %Activity{} = activity <- Activity.get_by_id_with_object(id) do - activity - else - _ -> Activity.get_create_by_object_ap_id_with_object(id) - end - - activity && - if activity.data["type"] == "Create" do - activity - else - Activity.get_create_by_object_ap_id_with_object(activity.data["object"]) - end - end - - def attachments_from_ids(%{"media_ids" => ids, "descriptions" => desc} = _) do + def attachments_from_ids(%{media_ids: ids, descriptions: desc}) do attachments_from_ids_descs(ids, desc) end - def attachments_from_ids(%{"media_ids" => ids} = _) do + def attachments_from_ids(%{media_ids: ids}) do attachments_from_ids_no_descs(ids) end @@ -57,11 +37,11 @@ def attachments_from_ids_no_descs([]), do: [] def attachments_from_ids_no_descs(ids) do Enum.map(ids, fn media_id -> case Repo.get(Object, media_id) do - %Object{data: data} = _ -> data + %Object{data: data} -> data _ -> nil end end) - |> Enum.filter(& &1) + |> Enum.reject(&is_nil/1) end def attachments_from_ids_descs([], _), do: [] @@ -71,14 +51,14 @@ def attachments_from_ids_descs(ids, descs_str) do Enum.map(ids, fn media_id -> case Repo.get(Object, media_id) do - %Object{data: data} = _ -> + %Object{data: data} -> Map.put(data, "name", descs[media_id]) _ -> nil end end) - |> Enum.filter(& &1) + |> Enum.reject(&is_nil/1) end @spec get_to_and_cc( @@ -160,7 +140,7 @@ def make_poll_data(%{"poll" => %{"expires_in" => expires_in}} = data) |> make_poll_data() end - def make_poll_data(%{"poll" => %{"options" => options, "expires_in" => expires_in}} = data) + def make_poll_data(%{poll: %{options: options, expires_in: expires_in}} = data) when is_list(options) do limits = Pleroma.Config.get([:instance, :poll_limits]) @@ -175,7 +155,7 @@ def make_poll_data(%{"poll" => %{"options" => options, "expires_in" => expires_i "replies" => %{"type" => "Collection", "totalItems" => 0} } - {note, Map.merge(emoji, Emoji.Formatter.get_emoji_map(option))} + {note, Map.merge(emoji, Pleroma.Emoji.Formatter.get_emoji_map(option))} end) end_time = @@ -183,7 +163,7 @@ def make_poll_data(%{"poll" => %{"options" => options, "expires_in" => expires_i |> DateTime.add(expires_in) |> DateTime.to_iso8601() - key = if truthy_param?(data["poll"]["multiple"]), do: "anyOf", else: "oneOf" + key = if truthy_param?(data.poll[:multiple]), do: "anyOf", else: "oneOf" poll = %{"type" => "Question", key => option_notes, "closed" => end_time} {:ok, {poll, emoji}} @@ -233,7 +213,7 @@ def make_content_html( |> Map.get("attachment_links", Config.get([:instance, :attachment_links])) |> truthy_param?() - content_type = get_content_type(data["content_type"]) + content_type = get_content_type(data[:content_type]) options = if visibility == "direct" && Config.get([:instance, :safe_dm_mentions]) do @@ -422,6 +402,7 @@ defp shortname(name) do end end + @spec confirm_current_password(User.t(), String.t()) :: {:ok, User.t()} | {:error, String.t()} def confirm_current_password(user, password) do with %User{local: true} = db_user <- User.get_cached_by_id(user.id), true <- AuthenticationPlug.checkpw(password, db_user.password_hash) do @@ -431,19 +412,6 @@ def confirm_current_password(user, password) do end end - def emoji_from_profile(%User{bio: bio, name: name}) do - [bio, name] - |> Enum.map(&Emoji.Formatter.get_emoji/1) - |> Enum.concat() - |> Enum.map(fn {shortcode, %Emoji{file: path}} -> - %{ - "type" => "Emoji", - "icon" => %{"type" => "Image", "url" => "#{Endpoint.url()}#{path}"}, - "name" => ":#{shortcode}:" - } - end) - end - def maybe_notify_to_recipients( recipients, %Activity{data: %{"to" => to, "type" => _type}} = _activity @@ -537,7 +505,8 @@ def make_report_content_html(comment) do end end - def get_report_statuses(%User{ap_id: actor}, %{"status_ids" => status_ids}) do + def get_report_statuses(%User{ap_id: actor}, %{status_ids: status_ids}) + when is_list(status_ids) do {:ok, Activity.all_by_actor_and_id(actor, status_ids)} end diff --git a/lib/pleroma/web/controller_helper.ex b/lib/pleroma/web/controller_helper.ex index ad293cda9..eb97ae975 100644 --- a/lib/pleroma/web/controller_helper.ex +++ b/lib/pleroma/web/controller_helper.ex @@ -5,10 +5,18 @@ defmodule Pleroma.Web.ControllerHelper do use Pleroma.Web, :controller - # As in MastoAPI, per https://api.rubyonrails.org/classes/ActiveModel/Type/Boolean.html + alias Pleroma.Config + + # As in Mastodon API, per https://api.rubyonrails.org/classes/ActiveModel/Type/Boolean.html @falsy_param_values [false, 0, "0", "f", "F", "false", "False", "FALSE", "off", "OFF"] - def truthy_param?(blank_value) when blank_value in [nil, ""], do: nil - def truthy_param?(value), do: value not in @falsy_param_values + + def explicitly_falsy_param?(value), do: value in @falsy_param_values + + # Note: `nil` and `""` are considered falsy values in Pleroma + def falsy_param?(value), + do: explicitly_falsy_param?(value) or value in [nil, ""] + + def truthy_param?(value), do: not falsy_param?(value) def json_response(conn, status, json) do conn @@ -34,7 +42,12 @@ defp param_to_integer(val, default) when is_binary(val) do defp param_to_integer(_, default), do: default - def add_link_headers(conn, activities, extra_params \\ %{}) do + def add_link_headers(conn, activities, extra_params \\ %{}) + + def add_link_headers(%{assigns: %{skip_link_headers: true}} = conn, _activities, _extra_params), + do: conn + + def add_link_headers(conn, activities, extra_params) do case List.last(activities) do %{id: max_id} -> params = @@ -69,8 +82,9 @@ def add_link_headers(conn, activities, extra_params \\ %{}) do end end - def assign_account_by_id(%{params: %{"id" => id}} = conn, _) do - case Pleroma.User.get_cached_by_id(id) do + def assign_account_by_id(conn, _) do + # TODO: use `conn.params[:id]` only after moving to OpenAPI + case Pleroma.User.get_cached_by_id(conn.params[:id] || conn.params["id"]) do %Pleroma.User{} = account -> assign(conn, :account, account) nil -> Pleroma.Web.MastodonAPI.FallbackController.call(conn, {:error, :not_found}) |> halt() end @@ -91,4 +105,14 @@ def try_render(conn, _, _) do def put_if_exist(map, _key, nil), do: map def put_if_exist(map, key, value), do: Map.put(map, key, value) + + @doc "Whether to skip rendering `[:account][:pleroma][:relationship]`for statuses/notifications" + def skip_relationships?(params) do + if Config.get([:extensions, :output_relationships_in_statuses_by_default]) do + false + else + # BREAKING: older PleromaFE versions do not send this param but _do_ expect relationships. + not truthy_param?(params["with_relationships"]) + end + end end diff --git a/lib/pleroma/web/endpoint.ex b/lib/pleroma/web/endpoint.ex index 72cb3ee27..226d42c2c 100644 --- a/lib/pleroma/web/endpoint.ex +++ b/lib/pleroma/web/endpoint.ex @@ -5,6 +5,8 @@ defmodule Pleroma.Web.Endpoint do use Phoenix.Endpoint, otp_app: :pleroma + require Pleroma.Constants + socket("/socket", Pleroma.Web.UserSocket) plug(Pleroma.Plugs.SetLocalePlug) @@ -34,8 +36,7 @@ defmodule Pleroma.Web.Endpoint do Plug.Static, at: "/", from: :pleroma, - only: - ~w(index.html robots.txt static finmoji emoji packs sounds images instance sw.js sw-pleroma.js favicon.png schemas doc), + only: Pleroma.Constants.static_only_files(), # credo:disable-for-previous-line Credo.Check.Readability.MaxLineLength gzip: true, cache_control_for_etags: @static_cache_control, diff --git a/lib/pleroma/web/fallback_redirect_controller.ex b/lib/pleroma/web/fallback_redirect_controller.ex index c13518030..0d9d578fc 100644 --- a/lib/pleroma/web/fallback_redirect_controller.ex +++ b/lib/pleroma/web/fallback_redirect_controller.ex @@ -4,7 +4,9 @@ defmodule Fallback.RedirectController do use Pleroma.Web, :controller + require Logger + alias Pleroma.User alias Pleroma.Web.Metadata diff --git a/lib/pleroma/web/federator/federator.ex b/lib/pleroma/web/federator/federator.ex index fd904ef0a..f5803578d 100644 --- a/lib/pleroma/web/federator/federator.ex +++ b/lib/pleroma/web/federator/federator.ex @@ -72,19 +72,24 @@ def perform(:incoming_ap_doc, params) do # actor shouldn't be acting on objects outside their own AP server. with {:ok, _user} <- ap_enabled_actor(params["actor"]), nil <- Activity.normalize(params["id"]), - :ok <- Containment.contain_origin_from_id(params["actor"], params), + {_, :ok} <- + {:correct_origin?, Containment.contain_origin_from_id(params["actor"], params)}, {:ok, activity} <- Transmogrifier.handle_incoming(params) do {:ok, activity} else + {:correct_origin?, _} -> + Logger.debug("Origin containment failure for #{params["id"]}") + {:error, :origin_containment_failed} + %Activity{} -> Logger.debug("Already had #{params["id"]}") - :error + {:error, :already_present} - _e -> + e -> # Just drop those for now Logger.debug("Unhandled activity") Logger.debug(Jason.encode!(params, pretty: true)) - :error + {:error, e} end end diff --git a/lib/pleroma/web/feed/feed_view.ex b/lib/pleroma/web/feed/feed_view.ex index e18adaea8..1ae03e7e2 100644 --- a/lib/pleroma/web/feed/feed_view.ex +++ b/lib/pleroma/web/feed/feed_view.ex @@ -23,7 +23,7 @@ def pub_date(date) when is_binary(date) do def pub_date(%DateTime{} = date), do: Timex.format!(date, "{RFC822}") def prepare_activity(activity, opts \\ []) do - object = activity_object(activity) + object = Object.normalize(activity) actor = if opts[:actor] do @@ -33,7 +33,6 @@ def prepare_activity(activity, opts \\ []) do %{ activity: activity, data: Map.get(object, :data), - object: object, actor: actor } end @@ -68,9 +67,7 @@ def logo(user) do def last_activity(activities), do: List.last(activities) - def activity_object(activity), do: Object.normalize(activity) - - def activity_title(%{data: %{"content" => content}}, opts \\ %{}) do + def activity_title(%{"content" => content}, opts \\ %{}) do content |> Pleroma.Web.Metadata.Utils.scrub_html() |> Pleroma.Emoji.Formatter.demojify() @@ -78,7 +75,7 @@ def activity_title(%{data: %{"content" => content}}, opts \\ %{}) do |> escape() end - def activity_content(%{data: %{"content" => content}}) do + def activity_content(%{"content" => content}) do content |> String.replace(~r/[\n\r]/, "") |> escape() diff --git a/lib/pleroma/web/feed/user_controller.ex b/lib/pleroma/web/feed/user_controller.ex index e27f85929..1b72e23dc 100644 --- a/lib/pleroma/web/feed/user_controller.ex +++ b/lib/pleroma/web/feed/user_controller.ex @@ -27,7 +27,7 @@ def feed_redirect(%{assigns: %{format: format}} = conn, _params) when format in ["json", "activity+json"] do with %{halted: false} = conn <- Pleroma.Plugs.EnsureAuthenticatedPlug.call(conn, - unless_func: &Pleroma.Web.FederatingPlug.federating?/0 + unless_func: &Pleroma.Web.FederatingPlug.federating?/1 ) do ActivityPubController.call(conn, :user) end diff --git a/lib/pleroma/web/masto_fe_controller.ex b/lib/pleroma/web/masto_fe_controller.ex index 43649ad26..d0d8bc8eb 100644 --- a/lib/pleroma/web/masto_fe_controller.ex +++ b/lib/pleroma/web/masto_fe_controller.ex @@ -5,19 +5,25 @@ defmodule Pleroma.Web.MastoFEController do use Pleroma.Web, :controller + alias Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug alias Pleroma.Plugs.OAuthScopesPlug alias Pleroma.User plug(OAuthScopesPlug, %{scopes: ["write:accounts"]} when action == :put_settings) # Note: :index action handles attempt of unauthenticated access to private instance with redirect + plug(:skip_plug, EnsurePublicOrAuthenticatedPlug when action == :index) + plug( OAuthScopesPlug, - %{scopes: ["read"], fallback: :proceed_unauthenticated, skip_instance_privacy_check: true} + %{scopes: ["read"], fallback: :proceed_unauthenticated} when action == :index ) - plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug when action != :index) + plug( + :skip_plug, + [OAuthScopesPlug, EnsurePublicOrAuthenticatedPlug] when action == :manifest + ) @doc "GET /web/*path" def index(%{assigns: %{user: user, token: token}} = conn, _params) diff --git a/lib/pleroma/web/mastodon_api/controllers/account_controller.ex b/lib/pleroma/web/mastodon_api/controllers/account_controller.ex index 6dbf11ac9..b9ed2d7b2 100644 --- a/lib/pleroma/web/mastodon_api/controllers/account_controller.ex +++ b/lib/pleroma/web/mastodon_api/controllers/account_controller.ex @@ -6,9 +6,15 @@ defmodule Pleroma.Web.MastodonAPI.AccountController do use Pleroma.Web, :controller import Pleroma.Web.ControllerHelper, - only: [add_link_headers: 2, truthy_param?: 1, assign_account_by_id: 2, json_response: 3] + only: [ + add_link_headers: 2, + truthy_param?: 1, + assign_account_by_id: 2, + json_response: 3, + skip_relationships?: 1 + ] - alias Pleroma.Emoji + alias Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug alias Pleroma.Plugs.OAuthScopesPlug alias Pleroma.Plugs.RateLimiter alias Pleroma.User @@ -16,20 +22,33 @@ defmodule Pleroma.Web.MastodonAPI.AccountController do alias Pleroma.Web.CommonAPI alias Pleroma.Web.MastodonAPI.ListView alias Pleroma.Web.MastodonAPI.MastodonAPI + alias Pleroma.Web.MastodonAPI.MastodonAPIController alias Pleroma.Web.MastodonAPI.StatusView alias Pleroma.Web.OAuth.Token alias Pleroma.Web.TwitterAPI.TwitterAPI + plug(Pleroma.Web.ApiSpec.CastAndValidate) + + plug(:skip_plug, [OAuthScopesPlug, EnsurePublicOrAuthenticatedPlug] when action == :create) + + plug(:skip_plug, EnsurePublicOrAuthenticatedPlug when action in [:show, :statuses]) + plug( OAuthScopesPlug, %{fallback: :proceed_unauthenticated, scopes: ["read:accounts"]} - when action == :show + when action in [:show, :followers, :following] + ) + + plug( + OAuthScopesPlug, + %{fallback: :proceed_unauthenticated, scopes: ["read:statuses"]} + when action == :statuses ) plug( OAuthScopesPlug, %{scopes: ["read:accounts"]} - when action in [:endorsements, :verify_credentials, :followers, :following] + when action in [:verify_credentials, :endorsements, :identity_proofs] ) plug(OAuthScopesPlug, %{scopes: ["write:accounts"]} when action == :update_credentials) @@ -48,52 +67,35 @@ defmodule Pleroma.Web.MastodonAPI.AccountController do plug(OAuthScopesPlug, %{scopes: ["read:follows"]} when action == :relationships) - # Note: :follows (POST /api/v1/follows) is the same as :follow, consider removing :follows plug( OAuthScopesPlug, - %{scopes: ["follow", "write:follows"]} when action in [:follows, :follow, :unfollow] + %{scopes: ["follow", "write:follows"]} when action in [:follow_by_uri, :follow, :unfollow] ) plug(OAuthScopesPlug, %{scopes: ["follow", "read:mutes"]} when action == :mutes) plug(OAuthScopesPlug, %{scopes: ["follow", "write:mutes"]} when action in [:mute, :unmute]) - plug( - Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug - when action not in [:create, :show, :statuses] - ) - - @relations [:follow, :unfollow] + @relationship_actions [:follow, :unfollow] @needs_account ~W(followers following lists follow unfollow mute unmute block unblock)a - plug(RateLimiter, [name: :relations_id_action, params: ["id", "uri"]] when action in @relations) - plug(RateLimiter, [name: :relations_actions] when action in @relations) + plug( + RateLimiter, + [name: :relation_id_action, params: ["id", "uri"]] when action in @relationship_actions + ) + + plug(RateLimiter, [name: :relations_actions] when action in @relationship_actions) plug(RateLimiter, [name: :app_account_creation] when action == :create) plug(:assign_account_by_id when action in @needs_account) action_fallback(Pleroma.Web.MastodonAPI.FallbackController) - @doc "POST /api/v1/accounts" - def create( - %{assigns: %{app: app}} = conn, - %{"username" => nickname, "password" => _, "agreement" => true} = params - ) do - params = - params - |> Map.take([ - "email", - "captcha_solution", - "captcha_token", - "captcha_answer_data", - "token", - "password" - ]) - |> Map.put("nickname", nickname) - |> Map.put("fullname", params["fullname"] || nickname) - |> Map.put("bio", params["bio"] || "") - |> Map.put("confirm", params["password"]) + defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.AccountOperation + @doc "POST /api/v1/accounts" + def create(%{assigns: %{app: app}, body_params: params} = conn, _params) do with :ok <- validate_email_param(params), + :ok <- TwitterAPI.validate_captcha(app, params), {:ok, user} <- TwitterAPI.register_user(params, need_confirmation: true), {:ok, token} <- Token.create_token(app, user, %{scopes: app.scopes}) do json(conn, %{ @@ -103,7 +105,7 @@ def create( created_at: Token.Utils.format_created_at(token) }) else - {:error, errors} -> json_response(conn, :bad_request, errors) + {:error, error} -> json_response(conn, :bad_request, %{error: error}) end end @@ -115,11 +117,11 @@ def create(conn, _) do render_error(conn, :forbidden, "Invalid credentials") end - defp validate_email_param(%{"email" => _}), do: :ok + defp validate_email_param(%{email: email}) when not is_nil(email), do: :ok defp validate_email_param(_) do case Pleroma.Config.get([:instance, :account_activation_required]) do - true -> {:error, %{"error" => "Missing parameters"}} + true -> {:error, dgettext("errors", "Missing parameter: %{name}", name: "email")} _ -> :ok end end @@ -137,19 +139,13 @@ def verify_credentials(%{assigns: %{user: user}} = conn, _) do end @doc "PATCH /api/v1/accounts/update_credentials" - def update_credentials(%{assigns: %{user: original_user}} = conn, params) do + def update_credentials(%{assigns: %{user: original_user}, body_params: params} = conn, _params) do user = original_user params = - if Map.has_key?(params, "fields_attributes") do - Map.update!(params, "fields_attributes", fn fields -> - fields - |> normalize_fields_attributes() - |> Enum.filter(fn %{"name" => n} -> n != "" end) - end) - else - params - end + params + |> Enum.filter(fn {_, value} -> not is_nil(value) end) + |> Enum.into(%{}) user_params = [ @@ -166,54 +162,26 @@ def update_credentials(%{assigns: %{user: original_user}} = conn, params) do :discoverable ] |> Enum.reduce(%{}, fn key, acc -> - add_if_present(acc, params, to_string(key), key, &{:ok, truthy_param?(&1)}) + add_if_present(acc, params, key, key, &{:ok, truthy_param?(&1)}) end) - |> add_if_present(params, "display_name", :name) - |> add_if_present(params, "note", :bio, fn value -> {:ok, User.parse_bio(value, user)} end) - |> add_if_present(params, "avatar", :avatar, fn value -> - with %Plug.Upload{} <- value, - {:ok, object} <- ActivityPub.upload(value, type: :avatar) do - {:ok, object.data} - end - end) - |> add_if_present(params, "header", :banner, fn value -> - with %Plug.Upload{} <- value, - {:ok, object} <- ActivityPub.upload(value, type: :banner) do - {:ok, object.data} - end - end) - |> add_if_present(params, "pleroma_background_image", :background, fn value -> - with %Plug.Upload{} <- value, - {:ok, object} <- ActivityPub.upload(value, type: :background) do - {:ok, object.data} - end - end) - |> add_if_present(params, "fields_attributes", :fields, fn fields -> - fields = Enum.map(fields, fn f -> Map.update!(f, "value", &AutoLinker.link(&1)) end) + |> add_if_present(params, :display_name, :name) + |> add_if_present(params, :note, :bio) + |> add_if_present(params, :avatar, :avatar) + |> add_if_present(params, :header, :banner) + |> add_if_present(params, :pleroma_background_image, :background) + |> add_if_present( + params, + :fields_attributes, + :raw_fields, + &{:ok, normalize_fields_attributes(&1)} + ) + |> add_if_present(params, :pleroma_settings_store, :pleroma_settings_store) + |> add_if_present(params, :default_scope, :default_scope) + |> add_if_present(params, :actor_type, :actor_type) - {:ok, fields} - end) - |> add_if_present(params, "fields_attributes", :raw_fields) - |> add_if_present(params, "pleroma_settings_store", :pleroma_settings_store, fn value -> - {:ok, Map.merge(user.pleroma_settings_store, value)} - end) - |> add_if_present(params, "default_scope", :default_scope) - |> add_if_present(params, "actor_type", :actor_type) - - emojis_text = (user_params["display_name"] || "") <> (user_params["note"] || "") - - user_emojis = - user - |> Map.get(:emoji, []) - |> Enum.concat(Emoji.Formatter.get_emoji_map(emojis_text)) - |> Enum.dedup() - - user_params = Map.put(user_params, :emoji, user_emojis) changeset = User.update_changeset(user, user_params) with {:ok, user} <- User.update_and_set_cache(changeset) do - if original_user != user, do: CommonAPI.update(user) - render(conn, "show.json", user: user, for: user, with_pleroma_settings: true) else _e -> render_error(conn, :forbidden, "Invalid request") @@ -222,7 +190,7 @@ def update_credentials(%{assigns: %{user: original_user}} = conn, params) do defp add_if_present(map, params, params_field, map_field, value_function \\ &{:ok, &1}) do with true <- Map.has_key?(params, params_field), - {:ok, new_value} <- value_function.(params[params_field]) do + {:ok, new_value} <- value_function.(Map.get(params, params_field)) do Map.put(map, map_field, new_value) else _ -> map @@ -233,12 +201,15 @@ defp normalize_fields_attributes(fields) do if Enum.all?(fields, &is_tuple/1) do Enum.map(fields, fn {_, v} -> v end) else - fields + Enum.map(fields, fn + %{} = field -> %{"name" => field.name, "value" => field.value} + field -> field + end) end end @doc "GET /api/v1/accounts/relationships" - def relationships(%{assigns: %{user: user}} = conn, %{"id" => id}) do + def relationships(%{assigns: %{user: user}} = conn, %{id: id}) do targets = User.get_all_by_ids(List.wrap(id)) render(conn, "relationships.json", user: user, targets: targets) @@ -248,7 +219,7 @@ def relationships(%{assigns: %{user: user}} = conn, %{"id" => id}) do def relationships(%{assigns: %{user: _user}} = conn, _), do: json(conn, []) @doc "GET /api/v1/accounts/:id" - def show(%{assigns: %{user: for_user}} = conn, %{"id" => nickname_or_id}) do + def show(%{assigns: %{user: for_user}} = conn, %{id: nickname_or_id}) do with %User{} = user <- User.get_cached_by_nickname_or_id(nickname_or_id, for: for_user), true <- User.visible_for?(user, for_user) do render(conn, "show.json", user: user, for: for_user) @@ -259,19 +230,26 @@ def show(%{assigns: %{user: for_user}} = conn, %{"id" => nickname_or_id}) do @doc "GET /api/v1/accounts/:id/statuses" def statuses(%{assigns: %{user: reading_user}} = conn, params) do - with %User{} = user <- User.get_cached_by_nickname_or_id(params["id"], for: reading_user), + with %User{} = user <- User.get_cached_by_nickname_or_id(params.id, for: reading_user), true <- User.visible_for?(user, reading_user) do params = params - |> Map.put("tag", params["tagged"]) - |> Map.delete("godmode") + |> Map.delete(:tagged) + |> Enum.filter(&(not is_nil(&1))) + |> Map.new(fn {key, value} -> {to_string(key), value} end) + |> Map.put("tag", params[:tagged]) activities = ActivityPub.fetch_user_activities(user, reading_user, params) conn |> add_link_headers(activities) |> put_view(StatusView) - |> render("index.json", activities: activities, for: reading_user, as: :activity) + |> render("index.json", + activities: activities, + for: reading_user, + as: :activity, + skip_relationships: skip_relationships?(params) + ) else _e -> render_error(conn, :not_found, "Can't find user") end @@ -279,6 +257,11 @@ def statuses(%{assigns: %{user: reading_user}} = conn, params) do @doc "GET /api/v1/accounts/:id/followers" def followers(%{assigns: %{user: for_user, account: user}} = conn, params) do + params = + params + |> Enum.map(fn {key, value} -> {to_string(key), value} end) + |> Enum.into(%{}) + followers = cond do for_user && user.id == for_user.id -> MastodonAPI.get_followers(user, params) @@ -293,6 +276,11 @@ def followers(%{assigns: %{user: for_user, account: user}} = conn, params) do @doc "GET /api/v1/accounts/:id/following" def following(%{assigns: %{user: for_user, account: user}} = conn, params) do + params = + params + |> Enum.map(fn {key, value} -> {to_string(key), value} end) + |> Enum.into(%{}) + followers = cond do for_user && user.id == for_user.id -> MastodonAPI.get_friends(user, params) @@ -316,11 +304,11 @@ def lists(%{assigns: %{user: user, account: account}} = conn, _params) do @doc "POST /api/v1/accounts/:id/follow" def follow(%{assigns: %{user: %{id: id}, account: %{id: id}}}, _params) do - {:error, :not_found} + {:error, "Can not follow yourself"} end - def follow(%{assigns: %{user: follower, account: followed}} = conn, _params) do - with {:ok, follower} <- MastodonAPI.follow(follower, followed, conn.params) do + def follow(%{assigns: %{user: follower, account: followed}} = conn, params) do + with {:ok, follower} <- MastodonAPI.follow(follower, followed, params) do render(conn, "relationship.json", user: follower, target: followed) else {:error, message} -> json_response(conn, :forbidden, %{error: message}) @@ -329,7 +317,7 @@ def follow(%{assigns: %{user: follower, account: followed}} = conn, _params) do @doc "POST /api/v1/accounts/:id/unfollow" def unfollow(%{assigns: %{user: %{id: id}, account: %{id: id}}}, _params) do - {:error, :not_found} + {:error, "Can not unfollow yourself"} end def unfollow(%{assigns: %{user: follower, account: followed}} = conn, _params) do @@ -339,10 +327,8 @@ def unfollow(%{assigns: %{user: follower, account: followed}} = conn, _params) d end @doc "POST /api/v1/accounts/:id/mute" - def mute(%{assigns: %{user: muter, account: muted}} = conn, params) do - notifications? = params |> Map.get("notifications", true) |> truthy_param?() - - with {:ok, _user_relationships} <- User.mute(muter, muted, notifications?) do + def mute(%{assigns: %{user: muter, account: muted}, body_params: params} = conn, _params) do + with {:ok, _user_relationships} <- User.mute(muter, muted, params.notifications) do render(conn, "relationship.json", user: muter, target: muted) else {:error, message} -> json_response(conn, :forbidden, %{error: message}) @@ -370,8 +356,7 @@ def block(%{assigns: %{user: blocker, account: blocked}} = conn, _params) do @doc "POST /api/v1/accounts/:id/unblock" def unblock(%{assigns: %{user: blocker, account: blocked}} = conn, _params) do - with {:ok, _user_block} <- User.unblock(blocker, blocked), - {:ok, _activity} <- ActivityPub.unblock(blocker, blocked) do + with {:ok, _activity} <- CommonAPI.unblock(blocker, blocked) do render(conn, "relationship.json", user: blocker, target: blocked) else {:error, message} -> json_response(conn, :forbidden, %{error: message}) @@ -379,14 +364,15 @@ def unblock(%{assigns: %{user: blocker, account: blocked}} = conn, _params) do end @doc "POST /api/v1/follows" - def follows(%{assigns: %{user: follower}} = conn, %{"uri" => uri}) do - with {_, %User{} = followed} <- {:followed, User.get_cached_by_nickname(uri)}, - {_, true} <- {:followed, follower.id != followed.id}, - {:ok, follower, followed, _} <- CommonAPI.follow(follower, followed) do - render(conn, "show.json", user: followed, for: follower) - else - {:followed, _} -> {:error, :not_found} - {:error, message} -> json_response(conn, :forbidden, %{error: message}) + def follow_by_uri(%{body_params: %{uri: uri}} = conn, _) do + case User.get_cached_by_nickname(uri) do + %User{} = user -> + conn + |> assign(:account, user) + |> follow(%{}) + + nil -> + {:error, :not_found} end end @@ -403,6 +389,8 @@ def blocks(%{assigns: %{user: user}} = conn, _) do end @doc "GET /api/v1/endorsements" - def endorsements(conn, params), - do: Pleroma.Web.MastodonAPI.MastodonAPIController.empty_array(conn, params) + def endorsements(conn, params), do: MastodonAPIController.empty_array(conn, params) + + @doc "GET /api/v1/identity_proofs" + def identity_proofs(conn, params), do: MastodonAPIController.empty_array(conn, params) end diff --git a/lib/pleroma/web/mastodon_api/controllers/app_controller.ex b/lib/pleroma/web/mastodon_api/controllers/app_controller.ex index 5e2871f18..a516b6c20 100644 --- a/lib/pleroma/web/mastodon_api/controllers/app_controller.ex +++ b/lib/pleroma/web/mastodon_api/controllers/app_controller.ex @@ -5,6 +5,7 @@ defmodule Pleroma.Web.MastodonAPI.AppController do use Pleroma.Web, :controller + alias Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug alias Pleroma.Plugs.OAuthScopesPlug alias Pleroma.Repo alias Pleroma.Web.OAuth.App @@ -13,18 +14,28 @@ defmodule Pleroma.Web.MastodonAPI.AppController do action_fallback(Pleroma.Web.MastodonAPI.FallbackController) + plug( + :skip_plug, + [OAuthScopesPlug, EnsurePublicOrAuthenticatedPlug] + when action == :create + ) + plug(OAuthScopesPlug, %{scopes: ["read"]} when action == :verify_credentials) + plug(Pleroma.Web.ApiSpec.CastAndValidate) + @local_mastodon_name "Mastodon-Local" + defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.AppOperation + @doc "POST /api/v1/apps" - def create(conn, params) do + def create(%{body_params: params} = conn, _params) do scopes = Scopes.fetch_scopes(params, ["read"]) app_attrs = params - |> Map.drop(["scope", "scopes"]) - |> Map.put("scopes", scopes) + |> Map.take([:client_name, :redirect_uris, :website]) + |> Map.put(:scopes, scopes) with cs <- App.register_changeset(%App{}, app_attrs), false <- cs.changes[:client_name] == @local_mastodon_name, diff --git a/lib/pleroma/web/mastodon_api/controllers/auth_controller.ex b/lib/pleroma/web/mastodon_api/controllers/auth_controller.ex index 37b389382..753b3db3e 100644 --- a/lib/pleroma/web/mastodon_api/controllers/auth_controller.ex +++ b/lib/pleroma/web/mastodon_api/controllers/auth_controller.ex @@ -13,10 +13,10 @@ defmodule Pleroma.Web.MastodonAPI.AuthController do action_fallback(Pleroma.Web.MastodonAPI.FallbackController) - @local_mastodon_name "Mastodon-Local" - plug(Pleroma.Plugs.RateLimiter, [name: :password_reset] when action == :password_reset) + @local_mastodon_name "Mastodon-Local" + @doc "GET /web/login" def login(%{assigns: %{user: %User{}}} = conn, _params) do redirect(conn, to: local_mastodon_root_path(conn)) diff --git a/lib/pleroma/web/mastodon_api/controllers/conversation_controller.ex b/lib/pleroma/web/mastodon_api/controllers/conversation_controller.ex index 7c9b11bf1..f35ec3596 100644 --- a/lib/pleroma/web/mastodon_api/controllers/conversation_controller.ex +++ b/lib/pleroma/web/mastodon_api/controllers/conversation_controller.ex @@ -13,10 +13,11 @@ defmodule Pleroma.Web.MastodonAPI.ConversationController do action_fallback(Pleroma.Web.MastodonAPI.FallbackController) + plug(Pleroma.Web.ApiSpec.CastAndValidate) plug(OAuthScopesPlug, %{scopes: ["read:statuses"]} when action == :index) - plug(OAuthScopesPlug, %{scopes: ["write:conversations"]} when action == :read) + plug(OAuthScopesPlug, %{scopes: ["write:conversations"]} when action != :index) - plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug) + defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.ConversationOperation @doc "GET /api/v1/conversations" def index(%{assigns: %{user: user}} = conn, params) do @@ -28,7 +29,7 @@ def index(%{assigns: %{user: user}} = conn, params) do end @doc "POST /api/v1/conversations/:id/read" - def read(%{assigns: %{user: user}} = conn, %{"id" => participation_id}) do + def mark_as_read(%{assigns: %{user: user}} = conn, %{id: participation_id}) do with %Participation{} = participation <- Repo.get_by(Participation, id: participation_id, user_id: user.id), {:ok, participation} <- Participation.mark_as_read(participation) do diff --git a/lib/pleroma/web/mastodon_api/controllers/custom_emoji_controller.ex b/lib/pleroma/web/mastodon_api/controllers/custom_emoji_controller.ex index d82de1db5..c5f47c5df 100644 --- a/lib/pleroma/web/mastodon_api/controllers/custom_emoji_controller.ex +++ b/lib/pleroma/web/mastodon_api/controllers/custom_emoji_controller.ex @@ -5,6 +5,16 @@ defmodule Pleroma.Web.MastodonAPI.CustomEmojiController do use Pleroma.Web, :controller + plug(Pleroma.Web.ApiSpec.CastAndValidate) + + plug( + :skip_plug, + [Pleroma.Plugs.OAuthScopesPlug, Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug] + when action == :index + ) + + defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.CustomEmojiOperation + def index(conn, _params) do render(conn, "index.json", custom_emojis: Pleroma.Emoji.get_all()) end diff --git a/lib/pleroma/web/mastodon_api/controllers/domain_block_controller.ex b/lib/pleroma/web/mastodon_api/controllers/domain_block_controller.ex index e4156cbe6..825b231ab 100644 --- a/lib/pleroma/web/mastodon_api/controllers/domain_block_controller.ex +++ b/lib/pleroma/web/mastodon_api/controllers/domain_block_controller.ex @@ -8,6 +8,9 @@ defmodule Pleroma.Web.MastodonAPI.DomainBlockController do alias Pleroma.Plugs.OAuthScopesPlug alias Pleroma.User + plug(Pleroma.Web.ApiSpec.CastAndValidate) + defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.DomainBlockOperation + plug( OAuthScopesPlug, %{scopes: ["follow", "read:blocks"]} when action == :index @@ -18,21 +21,19 @@ defmodule Pleroma.Web.MastodonAPI.DomainBlockController do %{scopes: ["follow", "write:blocks"]} when action != :index ) - plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug) - @doc "GET /api/v1/domain_blocks" def index(%{assigns: %{user: user}} = conn, _) do json(conn, Map.get(user, :domain_blocks, [])) end @doc "POST /api/v1/domain_blocks" - def create(%{assigns: %{user: blocker}} = conn, %{"domain" => domain}) do + def create(%{assigns: %{user: blocker}, body_params: %{domain: domain}} = conn, _params) do User.block_domain(blocker, domain) json(conn, %{}) end @doc "DELETE /api/v1/domain_blocks" - def delete(%{assigns: %{user: blocker}} = conn, %{"domain" => domain}) do + def delete(%{assigns: %{user: blocker}, body_params: %{domain: domain}} = conn, _params) do User.unblock_domain(blocker, domain) json(conn, %{}) end diff --git a/lib/pleroma/web/mastodon_api/controllers/filter_controller.ex b/lib/pleroma/web/mastodon_api/controllers/filter_controller.ex index 7b0b937a2..abbf0ce02 100644 --- a/lib/pleroma/web/mastodon_api/controllers/filter_controller.ex +++ b/lib/pleroma/web/mastodon_api/controllers/filter_controller.ex @@ -10,6 +10,7 @@ defmodule Pleroma.Web.MastodonAPI.FilterController do @oauth_read_actions [:show, :index] + plug(Pleroma.Web.ApiSpec.CastAndValidate) plug(OAuthScopesPlug, %{scopes: ["read:filters"]} when action in @oauth_read_actions) plug( @@ -17,62 +18,60 @@ defmodule Pleroma.Web.MastodonAPI.FilterController do %{scopes: ["write:filters"]} when action not in @oauth_read_actions ) - plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug) + defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.FilterOperation @doc "GET /api/v1/filters" def index(%{assigns: %{user: user}} = conn, _) do filters = Filter.get_filters(user) - render(conn, "filters.json", filters: filters) + render(conn, "index.json", filters: filters) end @doc "POST /api/v1/filters" - def create( - %{assigns: %{user: user}} = conn, - %{"phrase" => phrase, "context" => context} = params - ) do + def create(%{assigns: %{user: user}, body_params: params} = conn, _) do query = %Filter{ user_id: user.id, - phrase: phrase, - context: context, - hide: Map.get(params, "irreversible", false), - whole_word: Map.get(params, "boolean", true) - # expires_at + phrase: params.phrase, + context: params.context, + hide: params.irreversible, + whole_word: params.whole_word + # TODO: support `expires_in` parameter (as in Mastodon API) } {:ok, response} = Filter.create(query) - render(conn, "filter.json", filter: response) + render(conn, "show.json", filter: response) end @doc "GET /api/v1/filters/:id" - def show(%{assigns: %{user: user}} = conn, %{"id" => filter_id}) do + def show(%{assigns: %{user: user}} = conn, %{id: filter_id}) do filter = Filter.get(filter_id, user) - render(conn, "filter.json", filter: filter) + render(conn, "show.json", filter: filter) end @doc "PUT /api/v1/filters/:id" def update( - %{assigns: %{user: user}} = conn, - %{"phrase" => phrase, "context" => context, "id" => filter_id} = params + %{assigns: %{user: user}, body_params: params} = conn, + %{id: filter_id} ) do - query = %Filter{ - user_id: user.id, - filter_id: filter_id, - phrase: phrase, - context: context, - hide: Map.get(params, "irreversible", nil), - whole_word: Map.get(params, "boolean", true) - # expires_at - } + params = + params + |> Map.delete(:irreversible) + |> Map.put(:hide, params[:irreversible]) + |> Enum.reject(fn {_key, value} -> is_nil(value) end) + |> Map.new() - {:ok, response} = Filter.update(query) - render(conn, "filter.json", filter: response) + # TODO: support `expires_in` parameter (as in Mastodon API) + + with %Filter{} = filter <- Filter.get(filter_id, user), + {:ok, %Filter{} = filter} <- Filter.update(filter, params) do + render(conn, "show.json", filter: filter) + end end @doc "DELETE /api/v1/filters/:id" - def delete(%{assigns: %{user: user}} = conn, %{"id" => filter_id}) do + def delete(%{assigns: %{user: user}} = conn, %{id: filter_id}) do query = %Filter{ user_id: user.id, filter_id: filter_id diff --git a/lib/pleroma/web/mastodon_api/controllers/follow_request_controller.ex b/lib/pleroma/web/mastodon_api/controllers/follow_request_controller.ex index 1ca86f63f..748b6b475 100644 --- a/lib/pleroma/web/mastodon_api/controllers/follow_request_controller.ex +++ b/lib/pleroma/web/mastodon_api/controllers/follow_request_controller.ex @@ -10,6 +10,7 @@ defmodule Pleroma.Web.MastodonAPI.FollowRequestController do alias Pleroma.Web.CommonAPI plug(:put_view, Pleroma.Web.MastodonAPI.AccountView) + plug(Pleroma.Web.ApiSpec.CastAndValidate) plug(:assign_follower when action != :index) action_fallback(:errors) @@ -21,7 +22,7 @@ defmodule Pleroma.Web.MastodonAPI.FollowRequestController do %{scopes: ["follow", "write:follows"]} when action != :index ) - plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug) + defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.FollowRequestOperation @doc "GET /api/v1/follow_requests" def index(%{assigns: %{user: followed}} = conn, _params) do @@ -44,7 +45,7 @@ def reject(%{assigns: %{user: followed, follower: follower}} = conn, _params) do end end - defp assign_follower(%{params: %{"id" => id}} = conn, _) do + defp assign_follower(%{params: %{id: id}} = conn, _) do case User.get_cached_by_id(id) do %User{} = follower -> assign(conn, :follower, follower) nil -> Pleroma.Web.MastodonAPI.FallbackController.call(conn, {:error, :not_found}) |> halt() diff --git a/lib/pleroma/web/mastodon_api/controllers/instance_controller.ex b/lib/pleroma/web/mastodon_api/controllers/instance_controller.ex index 27b5b1a52..d8859731d 100644 --- a/lib/pleroma/web/mastodon_api/controllers/instance_controller.ex +++ b/lib/pleroma/web/mastodon_api/controllers/instance_controller.ex @@ -5,6 +5,16 @@ defmodule Pleroma.Web.MastodonAPI.InstanceController do use Pleroma.Web, :controller + plug(OpenApiSpex.Plug.CastAndValidate) + + plug( + :skip_plug, + [Pleroma.Plugs.OAuthScopesPlug, Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug] + when action in [:show, :peers] + ) + + defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.InstanceOperation + @doc "GET /api/v1/instance" def show(conn, _params) do render(conn, "show.json") diff --git a/lib/pleroma/web/mastodon_api/controllers/list_controller.ex b/lib/pleroma/web/mastodon_api/controllers/list_controller.ex index dac4daa7b..acdc76fd2 100644 --- a/lib/pleroma/web/mastodon_api/controllers/list_controller.ex +++ b/lib/pleroma/web/mastodon_api/controllers/list_controller.ex @@ -9,20 +9,17 @@ defmodule Pleroma.Web.MastodonAPI.ListController do alias Pleroma.User alias Pleroma.Web.MastodonAPI.AccountView + @oauth_read_actions [:index, :show, :list_accounts] + + plug(Pleroma.Web.ApiSpec.CastAndValidate) plug(:list_by_id_and_user when action not in [:index, :create]) - - plug(OAuthScopesPlug, %{scopes: ["read:lists"]} when action in [:index, :show, :list_accounts]) - - plug( - OAuthScopesPlug, - %{scopes: ["write:lists"]} - when action in [:create, :update, :delete, :add_to_list, :remove_from_list] - ) - - plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug) + plug(OAuthScopesPlug, %{scopes: ["read:lists"]} when action in @oauth_read_actions) + plug(OAuthScopesPlug, %{scopes: ["write:lists"]} when action not in @oauth_read_actions) action_fallback(Pleroma.Web.MastodonAPI.FallbackController) + defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.ListOperation + # GET /api/v1/lists def index(%{assigns: %{user: user}} = conn, opts) do lists = Pleroma.List.for_user(user, opts) @@ -30,7 +27,7 @@ def index(%{assigns: %{user: user}} = conn, opts) do end # POST /api/v1/lists - def create(%{assigns: %{user: user}} = conn, %{"title" => title}) do + def create(%{assigns: %{user: user}, body_params: %{title: title}} = conn, _) do with {:ok, %Pleroma.List{} = list} <- Pleroma.List.create(title, user) do render(conn, "show.json", list: list) end @@ -42,7 +39,7 @@ def show(%{assigns: %{list: list}} = conn, _) do end # PUT /api/v1/lists/:id - def update(%{assigns: %{list: list}} = conn, %{"title" => title}) do + def update(%{assigns: %{list: list}, body_params: %{title: title}} = conn, _) do with {:ok, list} <- Pleroma.List.rename(list, title) do render(conn, "show.json", list: list) end @@ -65,7 +62,7 @@ def list_accounts(%{assigns: %{user: user, list: list}} = conn, _) do end # POST /api/v1/lists/:id/accounts - def add_to_list(%{assigns: %{list: list}} = conn, %{"account_ids" => account_ids}) do + def add_to_list(%{assigns: %{list: list}, body_params: %{account_ids: account_ids}} = conn, _) do Enum.each(account_ids, fn account_id -> with %User{} = followed <- User.get_cached_by_id(account_id) do Pleroma.List.follow(list, followed) @@ -76,7 +73,10 @@ def add_to_list(%{assigns: %{list: list}} = conn, %{"account_ids" => account_ids end # DELETE /api/v1/lists/:id/accounts - def remove_from_list(%{assigns: %{list: list}} = conn, %{"account_ids" => account_ids}) do + def remove_from_list( + %{assigns: %{list: list}, body_params: %{account_ids: account_ids}} = conn, + _ + ) do Enum.each(account_ids, fn account_id -> with %User{} = followed <- User.get_cached_by_id(account_id) do Pleroma.List.unfollow(list, followed) @@ -86,7 +86,7 @@ def remove_from_list(%{assigns: %{list: list}} = conn, %{"account_ids" => accoun json(conn, %{}) end - defp list_by_id_and_user(%{assigns: %{user: user}, params: %{"id" => id}} = conn, _) do + defp list_by_id_and_user(%{assigns: %{user: user}, params: %{id: id}} = conn, _) do case Pleroma.List.get(id, user) do %Pleroma.List{} = list -> assign(conn, :list, list) nil -> conn |> render_error(:not_found, "List not found") |> halt() diff --git a/lib/pleroma/web/mastodon_api/controllers/marker_controller.ex b/lib/pleroma/web/mastodon_api/controllers/marker_controller.ex index 58e8a30c2..85310edfa 100644 --- a/lib/pleroma/web/mastodon_api/controllers/marker_controller.ex +++ b/lib/pleroma/web/mastodon_api/controllers/marker_controller.ex @@ -6,6 +6,8 @@ defmodule Pleroma.Web.MastodonAPI.MarkerController do use Pleroma.Web, :controller alias Pleroma.Plugs.OAuthScopesPlug + plug(Pleroma.Web.ApiSpec.CastAndValidate) + plug( OAuthScopesPlug, %{scopes: ["read:statuses"]} @@ -13,17 +15,21 @@ defmodule Pleroma.Web.MastodonAPI.MarkerController do ) plug(OAuthScopesPlug, %{scopes: ["write:statuses"]} when action == :upsert) - plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug) + action_fallback(Pleroma.Web.MastodonAPI.FallbackController) + defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.MarkerOperation + # GET /api/v1/markers def index(%{assigns: %{user: user}} = conn, params) do - markers = Pleroma.Marker.get_markers(user, params["timeline"]) + markers = Pleroma.Marker.get_markers(user, params[:timeline]) render(conn, "markers.json", %{markers: markers}) end # POST /api/v1/markers - def upsert(%{assigns: %{user: user}} = conn, params) do + def upsert(%{assigns: %{user: user}, body_params: params} = conn, _) do + params = Map.new(params, fn {key, value} -> {to_string(key), value} end) + with {:ok, result} <- Pleroma.Marker.upsert(user, params), markers <- Map.values(result) do render(conn, "markers.json", %{markers: markers}) diff --git a/lib/pleroma/web/mastodon_api/controllers/mastodon_api_controller.ex b/lib/pleroma/web/mastodon_api/controllers/mastodon_api_controller.ex index 14075307d..e7767de4e 100644 --- a/lib/pleroma/web/mastodon_api/controllers/mastodon_api_controller.ex +++ b/lib/pleroma/web/mastodon_api/controllers/mastodon_api_controller.ex @@ -3,21 +3,33 @@ # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.Web.MastodonAPI.MastodonAPIController do + @moduledoc """ + Contains stubs for unimplemented Mastodon API endpoints. + + Note: instead of routing directly to this controller's action, + it's preferable to define an action in relevant (non-generic) controller, + set up OAuth rules for it and call this controller's function from it. + """ + use Pleroma.Web, :controller require Logger + plug( + :skip_plug, + [Pleroma.Plugs.OAuthScopesPlug, Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug] + when action in [:empty_array, :empty_object] + ) + action_fallback(Pleroma.Web.MastodonAPI.FallbackController) - # Stubs for unimplemented mastodon api - # def empty_array(conn, _) do - Logger.debug("Unimplemented, returning an empty array") + Logger.debug("Unimplemented, returning an empty array (list)") json(conn, []) end def empty_object(conn, _) do - Logger.debug("Unimplemented, returning an empty object") + Logger.debug("Unimplemented, returning an empty object (map)") json(conn, %{}) end end diff --git a/lib/pleroma/web/mastodon_api/controllers/media_controller.ex b/lib/pleroma/web/mastodon_api/controllers/media_controller.ex index 2b6f00952..e36751220 100644 --- a/lib/pleroma/web/mastodon_api/controllers/media_controller.ex +++ b/lib/pleroma/web/mastodon_api/controllers/media_controller.ex @@ -15,8 +15,6 @@ defmodule Pleroma.Web.MastodonAPI.MediaController do plug(OAuthScopesPlug, %{scopes: ["write:media"]}) - plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug) - @doc "POST /api/v1/media" def create(%{assigns: %{user: user}} = conn, %{"file" => file} = data) do with {:ok, object} <- diff --git a/lib/pleroma/web/mastodon_api/controllers/notification_controller.ex b/lib/pleroma/web/mastodon_api/controllers/notification_controller.ex index 0c9218454..596b85617 100644 --- a/lib/pleroma/web/mastodon_api/controllers/notification_controller.ex +++ b/lib/pleroma/web/mastodon_api/controllers/notification_controller.ex @@ -5,7 +5,7 @@ defmodule Pleroma.Web.MastodonAPI.NotificationController do use Pleroma.Web, :controller - import Pleroma.Web.ControllerHelper, only: [add_link_headers: 2] + import Pleroma.Web.ControllerHelper, only: [add_link_headers: 2, skip_relationships?: 1] alias Pleroma.Notification alias Pleroma.Plugs.OAuthScopesPlug @@ -13,6 +13,8 @@ defmodule Pleroma.Web.MastodonAPI.NotificationController do @oauth_read_actions [:show, :index] + plug(Pleroma.Web.ApiSpec.CastAndValidate) + plug( OAuthScopesPlug, %{scopes: ["read:notifications"]} when action in @oauth_read_actions @@ -20,16 +22,16 @@ defmodule Pleroma.Web.MastodonAPI.NotificationController do plug(OAuthScopesPlug, %{scopes: ["write:notifications"]} when action not in @oauth_read_actions) - plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug) + defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.NotificationOperation # GET /api/v1/notifications - def index(conn, %{"account_id" => account_id} = params) do + def index(conn, %{account_id: account_id} = params) do case Pleroma.User.get_cached_by_id(account_id) do %{ap_id: account_ap_id} -> params = params - |> Map.delete("account_id") - |> Map.put("account_ap_id", account_ap_id) + |> Map.delete(:account_id) + |> Map.put(:account_ap_id, account_ap_id) index(conn, params) @@ -41,15 +43,20 @@ def index(conn, %{"account_id" => account_id} = params) do end def index(%{assigns: %{user: user}} = conn, params) do + params = Map.new(params, fn {k, v} -> {to_string(k), v} end) notifications = MastodonAPI.get_notifications(user, params) conn |> add_link_headers(notifications) - |> render("index.json", notifications: notifications, for: user) + |> render("index.json", + notifications: notifications, + for: user, + skip_relationships: skip_relationships?(params) + ) end # GET /api/v1/notifications/:id - def show(%{assigns: %{user: user}} = conn, %{"id" => id}) do + def show(%{assigns: %{user: user}} = conn, %{id: id}) do with {:ok, notification} <- Notification.get(user, id) do render(conn, "show.json", notification: notification, for: user) else @@ -66,8 +73,9 @@ def clear(%{assigns: %{user: user}} = conn, _params) do json(conn, %{}) end - # POST /api/v1/notifications/dismiss - def dismiss(%{assigns: %{user: user}} = conn, %{"id" => id} = _params) do + # POST /api/v1/notifications/:id/dismiss + + def dismiss(%{assigns: %{user: user}} = conn, %{id: id} = _params) do with {:ok, _notif} <- Notification.dismiss(user, id) do json(conn, %{}) else @@ -78,8 +86,13 @@ def dismiss(%{assigns: %{user: user}} = conn, %{"id" => id} = _params) do end end + # POST /api/v1/notifications/dismiss (deprecated) + def dismiss_via_body(%{body_params: params} = conn, _) do + dismiss(conn, params) + end + # DELETE /api/v1/notifications/destroy_multiple - def destroy_multiple(%{assigns: %{user: user}} = conn, %{"ids" => ids} = _params) do + def destroy_multiple(%{assigns: %{user: user}} = conn, %{ids: ids} = _params) do Notification.destroy_multiple(user, ids) json(conn, %{}) end diff --git a/lib/pleroma/web/mastodon_api/controllers/poll_controller.ex b/lib/pleroma/web/mastodon_api/controllers/poll_controller.ex index d9f894118..db46ffcfc 100644 --- a/lib/pleroma/web/mastodon_api/controllers/poll_controller.ex +++ b/lib/pleroma/web/mastodon_api/controllers/poll_controller.ex @@ -15,6 +15,8 @@ defmodule Pleroma.Web.MastodonAPI.PollController do action_fallback(Pleroma.Web.MastodonAPI.FallbackController) + plug(Pleroma.Web.ApiSpec.CastAndValidate) + plug( OAuthScopesPlug, %{scopes: ["read:statuses"], fallback: :proceed_unauthenticated} when action == :show @@ -22,10 +24,10 @@ defmodule Pleroma.Web.MastodonAPI.PollController do plug(OAuthScopesPlug, %{scopes: ["write:statuses"]} when action == :vote) - plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug) + defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.PollOperation @doc "GET /api/v1/polls/:id" - def show(%{assigns: %{user: user}} = conn, %{"id" => id}) do + def show(%{assigns: %{user: user}} = conn, %{id: id}) do with %Object{} = object <- Object.get_by_id_and_maybe_refetch(id, interval: 60), %Activity{} = activity <- Activity.get_create_by_object_ap_id(object.data["id"]), true <- Visibility.visible_for_user?(activity, user) do @@ -37,7 +39,7 @@ def show(%{assigns: %{user: user}} = conn, %{"id" => id}) do end @doc "POST /api/v1/polls/:id/votes" - def vote(%{assigns: %{user: user}} = conn, %{"id" => id, "choices" => choices}) do + def vote(%{assigns: %{user: user}, body_params: %{choices: choices}} = conn, %{id: id}) do with %Object{data: %{"type" => "Question"}} = object <- Object.get_by_id(id), %Activity{} = activity <- Activity.get_create_by_object_ap_id(object.data["id"]), true <- Visibility.visible_for_user?(activity, user), diff --git a/lib/pleroma/web/mastodon_api/controllers/report_controller.ex b/lib/pleroma/web/mastodon_api/controllers/report_controller.ex index f5782be13..405167108 100644 --- a/lib/pleroma/web/mastodon_api/controllers/report_controller.ex +++ b/lib/pleroma/web/mastodon_api/controllers/report_controller.ex @@ -9,12 +9,13 @@ defmodule Pleroma.Web.MastodonAPI.ReportController do action_fallback(Pleroma.Web.MastodonAPI.FallbackController) + plug(Pleroma.Web.ApiSpec.CastAndValidate) plug(OAuthScopesPlug, %{scopes: ["write:reports"]} when action == :create) - plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug) + defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.ReportOperation @doc "POST /api/v1/reports" - def create(%{assigns: %{user: user}} = conn, params) do + def create(%{assigns: %{user: user}, body_params: params} = conn, _) do with {:ok, activity} <- Pleroma.Web.CommonAPI.report(user, params) do render(conn, "show.json", activity: activity) end diff --git a/lib/pleroma/web/mastodon_api/controllers/scheduled_activity_controller.ex b/lib/pleroma/web/mastodon_api/controllers/scheduled_activity_controller.ex index e1e6bd89b..1719c67ea 100644 --- a/lib/pleroma/web/mastodon_api/controllers/scheduled_activity_controller.ex +++ b/lib/pleroma/web/mastodon_api/controllers/scheduled_activity_controller.ex @@ -11,19 +11,21 @@ defmodule Pleroma.Web.MastodonAPI.ScheduledActivityController do alias Pleroma.ScheduledActivity alias Pleroma.Web.MastodonAPI.MastodonAPI - plug(:assign_scheduled_activity when action != :index) - @oauth_read_actions [:show, :index] + plug(Pleroma.Web.ApiSpec.CastAndValidate) plug(OAuthScopesPlug, %{scopes: ["read:statuses"]} when action in @oauth_read_actions) plug(OAuthScopesPlug, %{scopes: ["write:statuses"]} when action not in @oauth_read_actions) - - plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug) + plug(:assign_scheduled_activity when action != :index) action_fallback(Pleroma.Web.MastodonAPI.FallbackController) + defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.ScheduledActivityOperation + @doc "GET /api/v1/scheduled_statuses" def index(%{assigns: %{user: user}} = conn, params) do + params = Map.new(params, fn {key, value} -> {to_string(key), value} end) + with scheduled_activities <- MastodonAPI.get_scheduled_activities(user, params) do conn |> add_link_headers(scheduled_activities) @@ -37,7 +39,7 @@ def show(%{assigns: %{scheduled_activity: scheduled_activity}} = conn, _params) end @doc "PUT /api/v1/scheduled_statuses/:id" - def update(%{assigns: %{scheduled_activity: scheduled_activity}} = conn, params) do + def update(%{assigns: %{scheduled_activity: scheduled_activity}, body_params: params} = conn, _) do with {:ok, scheduled_activity} <- ScheduledActivity.update(scheduled_activity, params) do render(conn, "show.json", scheduled_activity: scheduled_activity) end @@ -50,7 +52,7 @@ def delete(%{assigns: %{scheduled_activity: scheduled_activity}} = conn, _params end end - defp assign_scheduled_activity(%{assigns: %{user: user}, params: %{"id" => id}} = conn, _) do + defp assign_scheduled_activity(%{assigns: %{user: user}, params: %{id: id}} = conn, _) do case ScheduledActivity.get(user, id) do %ScheduledActivity{} = activity -> assign(conn, :scheduled_activity, activity) nil -> Pleroma.Web.MastodonAPI.FallbackController.call(conn, {:error, :not_found}) |> halt() diff --git a/lib/pleroma/web/mastodon_api/controllers/search_controller.ex b/lib/pleroma/web/mastodon_api/controllers/search_controller.ex index fcab4ef63..0e0d54ba4 100644 --- a/lib/pleroma/web/mastodon_api/controllers/search_controller.ex +++ b/lib/pleroma/web/mastodon_api/controllers/search_controller.ex @@ -5,26 +5,31 @@ defmodule Pleroma.Web.MastodonAPI.SearchController do use Pleroma.Web, :controller + import Pleroma.Web.ControllerHelper, only: [skip_relationships?: 1] + alias Pleroma.Activity alias Pleroma.Plugs.OAuthScopesPlug alias Pleroma.Plugs.RateLimiter alias Pleroma.Repo alias Pleroma.User alias Pleroma.Web - alias Pleroma.Web.ControllerHelper alias Pleroma.Web.MastodonAPI.AccountView alias Pleroma.Web.MastodonAPI.StatusView require Logger + plug(Pleroma.Web.ApiSpec.CastAndValidate) + # Note: Mastodon doesn't allow unauthenticated access (requires read:accounts / read:search) plug(OAuthScopesPlug, %{scopes: ["read:search"], fallback: :proceed_unauthenticated}) - plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug) + # Note: on private instances auth is required (EnsurePublicOrAuthenticatedPlug is not skipped) plug(RateLimiter, [name: :search] when action in [:search, :search2, :account_search]) - def account_search(%{assigns: %{user: user}} = conn, %{"q" => query} = params) do + defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.SearchOperation + + def account_search(%{assigns: %{user: user}} = conn, %{q: query} = params) do accounts = User.search(query, search_options(params, user)) conn @@ -35,7 +40,7 @@ def account_search(%{assigns: %{user: user}} = conn, %{"q" => query} = params) d def search2(conn, params), do: do_search(:v2, conn, params) def search(conn, params), do: do_search(:v1, conn, params) - defp do_search(version, %{assigns: %{user: user}} = conn, %{"q" => query} = params) do + defp do_search(version, %{assigns: %{user: user}} = conn, %{q: query} = params) do options = search_options(params, user) timeout = Keyword.get(Repo.config(), :timeout, 15_000) default_values = %{"statuses" => [], "accounts" => [], "hashtags" => []} @@ -43,7 +48,7 @@ defp do_search(version, %{assigns: %{user: user}} = conn, %{"q" => query} = para result = default_values |> Enum.map(fn {resource, default_value} -> - if params["type"] in [nil, resource] do + if params[:type] in [nil, resource] do {resource, fn -> resource_search(version, resource, query, options) end} else {resource, fn -> default_value end} @@ -66,11 +71,12 @@ defp do_search(version, %{assigns: %{user: user}} = conn, %{"q" => query} = para defp search_options(params, user) do [ - resolve: params["resolve"] == "true", - following: params["following"] == "true", - limit: ControllerHelper.fetch_integer_param(params, "limit"), - offset: ControllerHelper.fetch_integer_param(params, "offset"), - type: params["type"], + skip_relationships: skip_relationships?(params), + resolve: params[:resolve], + following: params[:following], + limit: params[:limit], + offset: params[:offset], + type: params[:type], author: get_author(params), for_user: user ] @@ -79,12 +85,24 @@ defp search_options(params, user) do defp resource_search(_, "accounts", query, options) do accounts = with_fallback(fn -> User.search(query, options) end) - AccountView.render("index.json", users: accounts, for: options[:for_user], as: :user) + + AccountView.render("index.json", + users: accounts, + for: options[:for_user], + as: :user, + skip_relationships: false + ) end defp resource_search(_, "statuses", query, options) do statuses = with_fallback(fn -> Activity.search(options[:for_user], query, options) end) - StatusView.render("index.json", activities: statuses, for: options[:for_user], as: :activity) + + StatusView.render("index.json", + activities: statuses, + for: options[:for_user], + as: :activity, + skip_relationships: options[:skip_relationships] + ) end defp resource_search(:v2, "hashtags", query, _options) do @@ -121,7 +139,7 @@ defp with_fallback(f, fallback \\ []) do end end - defp get_author(%{"account_id" => account_id}) when is_binary(account_id), + defp get_author(%{account_id: account_id}) when is_binary(account_id), do: User.get_cached_by_id(account_id) defp get_author(_params), do: nil diff --git a/lib/pleroma/web/mastodon_api/controllers/status_controller.ex b/lib/pleroma/web/mastodon_api/controllers/status_controller.ex index 37afe6949..25e499a77 100644 --- a/lib/pleroma/web/mastodon_api/controllers/status_controller.ex +++ b/lib/pleroma/web/mastodon_api/controllers/status_controller.ex @@ -5,7 +5,8 @@ defmodule Pleroma.Web.MastodonAPI.StatusController do use Pleroma.Web, :controller - import Pleroma.Web.ControllerHelper, only: [try_render: 3, add_link_headers: 2] + import Pleroma.Web.ControllerHelper, + only: [try_render: 3, add_link_headers: 2, skip_relationships?: 1] require Ecto.Query @@ -23,6 +24,9 @@ defmodule Pleroma.Web.MastodonAPI.StatusController do alias Pleroma.Web.MastodonAPI.AccountView alias Pleroma.Web.MastodonAPI.ScheduledActivityView + plug(Pleroma.Web.ApiSpec.CastAndValidate) + plug(:skip_plug, Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug when action in [:index, :show]) + @unauthenticated_access %{fallback: :proceed_unauthenticated, scopes: []} plug( @@ -76,8 +80,6 @@ defmodule Pleroma.Web.MastodonAPI.StatusController do %{scopes: ["write:bookmarks"]} when action in [:bookmark, :unbookmark] ) - plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug when action not in [:index, :show]) - @rate_limited_status_actions ~w(reblog unreblog favourite unfavourite create delete)a plug( @@ -96,12 +98,14 @@ defmodule Pleroma.Web.MastodonAPI.StatusController do action_fallback(Pleroma.Web.MastodonAPI.FallbackController) + defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.StatusOperation + @doc """ GET `/api/v1/statuses?ids[]=1&ids[]=2` `ids` query param is required """ - def index(%{assigns: %{user: user}} = conn, %{"ids" => ids}) do + def index(%{assigns: %{user: user}} = conn, %{ids: ids} = params) do limit = 100 activities = @@ -110,7 +114,12 @@ def index(%{assigns: %{user: user}} = conn, %{"ids" => ids}) do |> Activity.all_by_ids_with_object() |> Enum.filter(&Visibility.visible_for_user?(&1, user)) - render(conn, "index.json", activities: activities, for: user, as: :activity) + render(conn, "index.json", + activities: activities, + for: user, + as: :activity, + skip_relationships: skip_relationships?(params) + ) end @doc """ @@ -119,20 +128,29 @@ def index(%{assigns: %{user: user}} = conn, %{"ids" => ids}) do Creates a scheduled status when `scheduled_at` param is present and it's far enough """ def create( - %{assigns: %{user: user}} = conn, - %{"status" => _, "scheduled_at" => scheduled_at} = params - ) do - params = Map.put(params, "in_reply_to_status_id", params["in_reply_to_id"]) + %{ + assigns: %{user: user}, + body_params: %{status: _, scheduled_at: scheduled_at} = params + } = conn, + _ + ) + when not is_nil(scheduled_at) do + params = Map.put(params, :in_reply_to_status_id, params[:in_reply_to_id]) + + attrs = %{ + params: Map.new(params, fn {key, value} -> {to_string(key), value} end), + scheduled_at: scheduled_at + } with {:far_enough, true} <- {:far_enough, ScheduledActivity.far_enough?(scheduled_at)}, - attrs <- %{"params" => params, "scheduled_at" => scheduled_at}, {:ok, scheduled_activity} <- ScheduledActivity.create(user, attrs) do conn |> put_view(ScheduledActivityView) |> render("show.json", scheduled_activity: scheduled_activity) else {:far_enough, _} -> - create(conn, Map.drop(params, ["scheduled_at"])) + params = Map.drop(params, [:scheduled_at]) + create(%Plug.Conn{conn | body_params: params}, %{}) error -> error @@ -144,8 +162,8 @@ def create( Creates a regular status """ - def create(%{assigns: %{user: user}} = conn, %{"status" => _} = params) do - params = Map.put(params, "in_reply_to_status_id", params["in_reply_to_id"]) + def create(%{assigns: %{user: user}, body_params: %{status: _} = params} = conn, _) do + params = Map.put(params, :in_reply_to_status_id, params[:in_reply_to_id]) with {:ok, activity} <- CommonAPI.post(user, params) do try_render(conn, "show.json", @@ -162,12 +180,13 @@ def create(%{assigns: %{user: user}} = conn, %{"status" => _} = params) do end end - def create(%{assigns: %{user: _user}} = conn, %{"media_ids" => _} = params) do - create(conn, Map.put(params, "status", "")) + def create(%{assigns: %{user: _user}, body_params: %{media_ids: _} = params} = conn, _) do + params = Map.put(params, :status, "") + create(%Plug.Conn{conn | body_params: params}, %{}) end @doc "GET /api/v1/statuses/:id" - def show(%{assigns: %{user: user}} = conn, %{"id" => id}) do + def show(%{assigns: %{user: user}} = conn, %{id: id}) do with %Activity{} = activity <- Activity.get_by_id_with_object(id), true <- Visibility.visible_for_user?(activity, user) do try_render(conn, "show.json", @@ -181,7 +200,7 @@ def show(%{assigns: %{user: user}} = conn, %{"id" => id}) do end @doc "DELETE /api/v1/statuses/:id" - def delete(%{assigns: %{user: user}} = conn, %{"id" => id}) do + def delete(%{assigns: %{user: user}} = conn, %{id: id}) do with {:ok, %Activity{}} <- CommonAPI.delete(id, user) do json(conn, %{}) else @@ -191,7 +210,7 @@ def delete(%{assigns: %{user: user}} = conn, %{"id" => id}) do end @doc "POST /api/v1/statuses/:id/reblog" - def reblog(%{assigns: %{user: user}} = conn, %{"id" => ap_id_or_id} = params) do + def reblog(%{assigns: %{user: user}, body_params: params} = conn, %{id: ap_id_or_id}) do with {:ok, announce, _activity} <- CommonAPI.repeat(ap_id_or_id, user, params), %Activity{} = announce <- Activity.normalize(announce.data) do try_render(conn, "show.json", %{activity: announce, for: user, as: :activity}) @@ -199,45 +218,45 @@ def reblog(%{assigns: %{user: user}} = conn, %{"id" => ap_id_or_id} = params) do end @doc "POST /api/v1/statuses/:id/unreblog" - def unreblog(%{assigns: %{user: user}} = conn, %{"id" => ap_id_or_id}) do - with {:ok, _unannounce, %{data: %{"id" => id}}} <- CommonAPI.unrepeat(ap_id_or_id, user), - %Activity{} = activity <- Activity.get_create_by_object_ap_id_with_object(id) do + def unreblog(%{assigns: %{user: user}} = conn, %{id: activity_id}) do + with {:ok, _unannounce} <- CommonAPI.unrepeat(activity_id, user), + %Activity{} = activity <- Activity.get_by_id(activity_id) do try_render(conn, "show.json", %{activity: activity, for: user, as: :activity}) end end @doc "POST /api/v1/statuses/:id/favourite" - def favourite(%{assigns: %{user: user}} = conn, %{"id" => ap_id_or_id}) do - with {:ok, _fav, %{data: %{"id" => id}}} <- CommonAPI.favorite(ap_id_or_id, user), - %Activity{} = activity <- Activity.get_create_by_object_ap_id(id) do + def favourite(%{assigns: %{user: user}} = conn, %{id: activity_id}) do + with {:ok, _fav} <- CommonAPI.favorite(user, activity_id), + %Activity{} = activity <- Activity.get_by_id(activity_id) do try_render(conn, "show.json", activity: activity, for: user, as: :activity) end end @doc "POST /api/v1/statuses/:id/unfavourite" - def unfavourite(%{assigns: %{user: user}} = conn, %{"id" => ap_id_or_id}) do - with {:ok, _, _, %{data: %{"id" => id}}} <- CommonAPI.unfavorite(ap_id_or_id, user), - %Activity{} = activity <- Activity.get_create_by_object_ap_id(id) do + def unfavourite(%{assigns: %{user: user}} = conn, %{id: activity_id}) do + with {:ok, _unfav} <- CommonAPI.unfavorite(activity_id, user), + %Activity{} = activity <- Activity.get_by_id(activity_id) do try_render(conn, "show.json", activity: activity, for: user, as: :activity) end end @doc "POST /api/v1/statuses/:id/pin" - def pin(%{assigns: %{user: user}} = conn, %{"id" => ap_id_or_id}) do + def pin(%{assigns: %{user: user}} = conn, %{id: ap_id_or_id}) do with {:ok, activity} <- CommonAPI.pin(ap_id_or_id, user) do try_render(conn, "show.json", activity: activity, for: user, as: :activity) end end @doc "POST /api/v1/statuses/:id/unpin" - def unpin(%{assigns: %{user: user}} = conn, %{"id" => ap_id_or_id}) do + def unpin(%{assigns: %{user: user}} = conn, %{id: ap_id_or_id}) do with {:ok, activity} <- CommonAPI.unpin(ap_id_or_id, user) do try_render(conn, "show.json", activity: activity, for: user, as: :activity) end end @doc "POST /api/v1/statuses/:id/bookmark" - def bookmark(%{assigns: %{user: user}} = conn, %{"id" => id}) do + def bookmark(%{assigns: %{user: user}} = conn, %{id: id}) do with %Activity{} = activity <- Activity.get_by_id_with_object(id), %User{} = user <- User.get_cached_by_nickname(user.nickname), true <- Visibility.visible_for_user?(activity, user), @@ -247,7 +266,7 @@ def bookmark(%{assigns: %{user: user}} = conn, %{"id" => id}) do end @doc "POST /api/v1/statuses/:id/unbookmark" - def unbookmark(%{assigns: %{user: user}} = conn, %{"id" => id}) do + def unbookmark(%{assigns: %{user: user}} = conn, %{id: id}) do with %Activity{} = activity <- Activity.get_by_id_with_object(id), %User{} = user <- User.get_cached_by_nickname(user.nickname), true <- Visibility.visible_for_user?(activity, user), @@ -257,7 +276,7 @@ def unbookmark(%{assigns: %{user: user}} = conn, %{"id" => id}) do end @doc "POST /api/v1/statuses/:id/mute" - def mute_conversation(%{assigns: %{user: user}} = conn, %{"id" => id}) do + def mute_conversation(%{assigns: %{user: user}} = conn, %{id: id}) do with %Activity{} = activity <- Activity.get_by_id(id), {:ok, activity} <- CommonAPI.add_mute(user, activity) do try_render(conn, "show.json", activity: activity, for: user, as: :activity) @@ -265,7 +284,7 @@ def mute_conversation(%{assigns: %{user: user}} = conn, %{"id" => id}) do end @doc "POST /api/v1/statuses/:id/unmute" - def unmute_conversation(%{assigns: %{user: user}} = conn, %{"id" => id}) do + def unmute_conversation(%{assigns: %{user: user}} = conn, %{id: id}) do with %Activity{} = activity <- Activity.get_by_id(id), {:ok, activity} <- CommonAPI.remove_mute(user, activity) do try_render(conn, "show.json", activity: activity, for: user, as: :activity) @@ -274,7 +293,7 @@ def unmute_conversation(%{assigns: %{user: user}} = conn, %{"id" => id}) do @doc "GET /api/v1/statuses/:id/card" @deprecated "https://github.com/tootsuite/mastodon/pull/11213" - def card(%{assigns: %{user: user}} = conn, %{"id" => status_id}) do + def card(%{assigns: %{user: user}} = conn, %{id: status_id}) do with %Activity{} = activity <- Activity.get_by_id(status_id), true <- Visibility.visible_for_user?(activity, user) do data = Pleroma.Web.RichMedia.Helpers.fetch_data_for_activity(activity) @@ -285,7 +304,7 @@ def card(%{assigns: %{user: user}} = conn, %{"id" => status_id}) do end @doc "GET /api/v1/statuses/:id/favourited_by" - def favourited_by(%{assigns: %{user: user}} = conn, %{"id" => id}) do + def favourited_by(%{assigns: %{user: user}} = conn, %{id: id}) do with %Activity{} = activity <- Activity.get_by_id_with_object(id), {:visible, true} <- {:visible, Visibility.visible_for_user?(activity, user)}, %Object{data: %{"likes" => likes}} <- Object.normalize(activity) do @@ -305,7 +324,7 @@ def favourited_by(%{assigns: %{user: user}} = conn, %{"id" => id}) do end @doc "GET /api/v1/statuses/:id/reblogged_by" - def reblogged_by(%{assigns: %{user: user}} = conn, %{"id" => id}) do + def reblogged_by(%{assigns: %{user: user}} = conn, %{id: id}) do with %Activity{} = activity <- Activity.get_by_id_with_object(id), {:visible, true} <- {:visible, Visibility.visible_for_user?(activity, user)}, %Object{data: %{"announcements" => announces, "id" => ap_id}} <- @@ -337,7 +356,7 @@ def reblogged_by(%{assigns: %{user: user}} = conn, %{"id" => id}) do end @doc "GET /api/v1/statuses/:id/context" - def context(%{assigns: %{user: user}} = conn, %{"id" => id}) do + def context(%{assigns: %{user: user}} = conn, %{id: id}) do with %Activity{} = activity <- Activity.get_by_id(id) do activities = ActivityPub.fetch_activities_for_context(activity.data["context"], %{ @@ -351,16 +370,22 @@ def context(%{assigns: %{user: user}} = conn, %{"id" => id}) do end @doc "GET /api/v1/favourites" - def favourites(%{assigns: %{user: user}} = conn, params) do - activities = - ActivityPub.fetch_favourites( - user, - Map.take(params, Pleroma.Pagination.page_keys()) - ) + def favourites(%{assigns: %{user: %User{} = user}} = conn, params) do + params = + params + |> Map.new(fn {key, value} -> {to_string(key), value} end) + |> Map.take(Pleroma.Pagination.page_keys()) + + activities = ActivityPub.fetch_favourites(user, params) conn |> add_link_headers(activities) - |> render("index.json", activities: activities, for: user, as: :activity) + |> render("index.json", + activities: activities, + for: user, + as: :activity, + skip_relationships: skip_relationships?(params) + ) end @doc "GET /api/v1/bookmarks" @@ -378,6 +403,11 @@ def bookmarks(%{assigns: %{user: user}} = conn, params) do conn |> add_link_headers(bookmarks) - |> render("index.json", %{activities: activities, for: user, as: :activity}) + |> render("index.json", + activities: activities, + for: user, + as: :activity, + skip_relationships: skip_relationships?(params) + ) end end diff --git a/lib/pleroma/web/mastodon_api/controllers/subscription_controller.ex b/lib/pleroma/web/mastodon_api/controllers/subscription_controller.ex index 11df6fc4a..34eac97c5 100644 --- a/lib/pleroma/web/mastodon_api/controllers/subscription_controller.ex +++ b/lib/pleroma/web/mastodon_api/controllers/subscription_controller.ex @@ -6,47 +6,42 @@ defmodule Pleroma.Web.MastodonAPI.SubscriptionController do @moduledoc "The module represents functions to manage user subscriptions." use Pleroma.Web, :controller - alias Pleroma.Web.MastodonAPI.PushSubscriptionView, as: View alias Pleroma.Web.Push alias Pleroma.Web.Push.Subscription action_fallback(:errors) + plug(Pleroma.Web.ApiSpec.CastAndValidate) + plug(:restrict_push_enabled) plug(Pleroma.Plugs.OAuthScopesPlug, %{scopes: ["push"]}) - plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug) + defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.SubscriptionOperation # Creates PushSubscription # POST /api/v1/push/subscription # - def create(%{assigns: %{user: user, token: token}} = conn, params) do - with true <- Push.enabled(), - {:ok, _} <- Subscription.delete_if_exists(user, token), + def create(%{assigns: %{user: user, token: token}, body_params: params} = conn, _) do + with {:ok, _} <- Subscription.delete_if_exists(user, token), {:ok, subscription} <- Subscription.create(user, token, params) do - view = View.render("push_subscription.json", subscription: subscription) - json(conn, view) + render(conn, "show.json", subscription: subscription) end end # Gets PushSubscription # GET /api/v1/push/subscription # - def get(%{assigns: %{user: user, token: token}} = conn, _params) do - with true <- Push.enabled(), - {:ok, subscription} <- Subscription.get(user, token) do - view = View.render("push_subscription.json", subscription: subscription) - json(conn, view) + def show(%{assigns: %{user: user, token: token}} = conn, _params) do + with {:ok, subscription} <- Subscription.get(user, token) do + render(conn, "show.json", subscription: subscription) end end # Updates PushSubscription # PUT /api/v1/push/subscription # - def update(%{assigns: %{user: user, token: token}} = conn, params) do - with true <- Push.enabled(), - {:ok, subscription} <- Subscription.update(user, token, params) do - view = View.render("push_subscription.json", subscription: subscription) - json(conn, view) + def update(%{assigns: %{user: user, token: token}, body_params: params} = conn, _) do + with {:ok, subscription} <- Subscription.update(user, token, params) do + render(conn, "show.json", subscription: subscription) end end @@ -54,17 +49,26 @@ def update(%{assigns: %{user: user, token: token}} = conn, params) do # DELETE /api/v1/push/subscription # def delete(%{assigns: %{user: user, token: token}} = conn, _params) do - with true <- Push.enabled(), - {:ok, _response} <- Subscription.delete(user, token), + with {:ok, _response} <- Subscription.delete(user, token), do: json(conn, %{}) end + defp restrict_push_enabled(conn, _) do + if Push.enabled() do + conn + else + conn + |> render_error(:forbidden, "Web push subscription is disabled on this Pleroma instance") + |> halt() + end + end + # fallback action # def errors(conn, {:error, :not_found}) do conn |> put_status(:not_found) - |> json(dgettext("errors", "Not found")) + |> json(%{error: dgettext("errors", "Record not found")}) end def errors(conn, _) do diff --git a/lib/pleroma/web/mastodon_api/controllers/suggestion_controller.ex b/lib/pleroma/web/mastodon_api/controllers/suggestion_controller.ex index 0cdc7bd8d..f91df9ab7 100644 --- a/lib/pleroma/web/mastodon_api/controllers/suggestion_controller.ex +++ b/lib/pleroma/web/mastodon_api/controllers/suggestion_controller.ex @@ -7,8 +7,26 @@ defmodule Pleroma.Web.MastodonAPI.SuggestionController do require Logger - @doc "GET /api/v1/suggestions" - def index(conn, _) do - json(conn, []) + plug(Pleroma.Web.ApiSpec.CastAndValidate) + plug(Pleroma.Plugs.OAuthScopesPlug, %{scopes: ["read"]} when action == :index) + + def open_api_operation(action) do + operation = String.to_existing_atom("#{action}_operation") + apply(__MODULE__, operation, []) end + + def index_operation do + %OpenApiSpex.Operation{ + tags: ["Suggestions"], + summary: "Follow suggestions (Not implemented)", + operationId: "SuggestionController.index", + responses: %{ + 200 => Pleroma.Web.ApiSpec.Helpers.empty_array_response() + } + } + end + + @doc "GET /api/v1/suggestions" + def index(conn, params), + do: Pleroma.Web.MastodonAPI.MastodonAPIController.empty_array(conn, params) end diff --git a/lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex b/lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex index 91f41416d..bbd576ffd 100644 --- a/lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex +++ b/lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex @@ -6,17 +6,20 @@ defmodule Pleroma.Web.MastodonAPI.TimelineController do use Pleroma.Web, :controller import Pleroma.Web.ControllerHelper, - only: [add_link_headers: 2, add_link_headers: 3, truthy_param?: 1] + only: [add_link_headers: 2, add_link_headers: 3, skip_relationships?: 1] alias Pleroma.Pagination + alias Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug alias Pleroma.Plugs.OAuthScopesPlug alias Pleroma.Plugs.RateLimiter alias Pleroma.User alias Pleroma.Web.ActivityPub.ActivityPub - # TODO: Replace with a macro when there is a Phoenix release with + plug(Pleroma.Web.ApiSpec.CastAndValidate) + plug(:skip_plug, EnsurePublicOrAuthenticatedPlug when action in [:public, :hashtag]) + + # TODO: Replace with a macro when there is a Phoenix release with the following commit in it: # https://github.com/phoenixframework/phoenix/commit/2e8c63c01fec4dde5467dbbbf9705ff9e780735e - # in it plug(RateLimiter, [name: :timeline, bucket_name: :direct_timeline] when action == :direct) plug(RateLimiter, [name: :timeline, bucket_name: :public_timeline] when action == :public) @@ -27,17 +30,25 @@ defmodule Pleroma.Web.MastodonAPI.TimelineController do plug(OAuthScopesPlug, %{scopes: ["read:statuses"]} when action in [:home, :direct]) plug(OAuthScopesPlug, %{scopes: ["read:lists"]} when action == :list) - plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug when action != :public) + plug( + OAuthScopesPlug, + %{scopes: ["read:statuses"], fallback: :proceed_unauthenticated} + when action in [:public, :hashtag] + ) plug(:put_view, Pleroma.Web.MastodonAPI.StatusView) + defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.TimelineOperation + # GET /api/v1/timelines/home def home(%{assigns: %{user: user}} = conn, params) do params = params + |> Map.new(fn {key, value} -> {to_string(key), value} end) |> Map.put("type", ["Create", "Announce"]) |> Map.put("blocking_user", user) |> Map.put("muting_user", user) + |> Map.put("reply_filtering_user", user) |> Map.put("user", user) recipients = [user.ap_id | User.following(user)] @@ -49,13 +60,19 @@ def home(%{assigns: %{user: user}} = conn, params) do conn |> add_link_headers(activities) - |> render("index.json", activities: activities, for: user, as: :activity) + |> render("index.json", + activities: activities, + for: user, + as: :activity, + skip_relationships: skip_relationships?(params) + ) end # GET /api/v1/timelines/direct def direct(%{assigns: %{user: user}} = conn, params) do params = params + |> Map.new(fn {key, value} -> {to_string(key), value} end) |> Map.put("type", "Create") |> Map.put("blocking_user", user) |> Map.put("user", user) @@ -68,12 +85,19 @@ def direct(%{assigns: %{user: user}} = conn, params) do conn |> add_link_headers(activities) - |> render("index.json", activities: activities, for: user, as: :activity) + |> render("index.json", + activities: activities, + for: user, + as: :activity, + skip_relationships: skip_relationships?(params) + ) end # GET /api/v1/timelines/public def public(%{assigns: %{user: user}} = conn, params) do - local_only = truthy_param?(params["local"]) + params = Map.new(params, fn {key, value} -> {to_string(key), value} end) + + local_only = params["local"] cfg_key = if local_only do @@ -84,24 +108,30 @@ def public(%{assigns: %{user: user}} = conn, params) do restrict? = Pleroma.Config.get([:restrict_unauthenticated, :timelines, cfg_key]) - if not (restrict? and is_nil(user)) do + if restrict? and is_nil(user) do + render_error(conn, :unauthorized, "authorization required for timeline view") + else activities = params |> Map.put("type", ["Create", "Announce"]) |> Map.put("local_only", local_only) |> Map.put("blocking_user", user) |> Map.put("muting_user", user) + |> Map.put("reply_filtering_user", user) |> ActivityPub.fetch_public_activities() conn |> add_link_headers(activities, %{"local" => local_only}) - |> render("index.json", activities: activities, for: user, as: :activity) - else - render_error(conn, :unauthorized, "authorization required for timeline view") + |> render("index.json", + activities: activities, + for: user, + as: :activity, + skip_relationships: skip_relationships?(params) + ) end end - def hashtag_fetching(params, user, local_only) do + defp hashtag_fetching(params, user, local_only) do tags = [params["tag"], params["any"]] |> List.flatten() @@ -134,20 +164,26 @@ def hashtag_fetching(params, user, local_only) do # GET /api/v1/timelines/tag/:tag def hashtag(%{assigns: %{user: user}} = conn, params) do - local_only = truthy_param?(params["local"]) - + params = Map.new(params, fn {key, value} -> {to_string(key), value} end) + local_only = params["local"] activities = hashtag_fetching(params, user, local_only) conn |> add_link_headers(activities, %{"local" => local_only}) - |> render("index.json", activities: activities, for: user, as: :activity) + |> render("index.json", + activities: activities, + for: user, + as: :activity, + skip_relationships: skip_relationships?(params) + ) end # GET /api/v1/timelines/list/:list_id - def list(%{assigns: %{user: user}} = conn, %{"list_id" => id} = params) do + def list(%{assigns: %{user: user}} = conn, %{list_id: id} = params) do with %Pleroma.List{title: _title, following: following} <- Pleroma.List.get(id, user) do params = params + |> Map.new(fn {key, value} -> {to_string(key), value} end) |> Map.put("type", "Create") |> Map.put("blocking_user", user) |> Map.put("user", user) @@ -164,7 +200,12 @@ def list(%{assigns: %{user: user}} = conn, %{"list_id" => id} = params) do |> ActivityPub.fetch_activities_bounded(following, params) |> Enum.reverse() - render(conn, "index.json", activities: activities, for: user, as: :activity) + render(conn, "index.json", + activities: activities, + for: user, + as: :activity, + skip_relationships: skip_relationships?(params) + ) else _e -> render_error(conn, :forbidden, "Error.") end diff --git a/lib/pleroma/web/mastodon_api/views/account_view.ex b/lib/pleroma/web/mastodon_api/views/account_view.ex index 2bf711386..835dfe9f4 100644 --- a/lib/pleroma/web/mastodon_api/views/account_view.ex +++ b/lib/pleroma/web/mastodon_api/views/account_view.ex @@ -5,21 +5,42 @@ defmodule Pleroma.Web.MastodonAPI.AccountView do use Pleroma.Web, :view + alias Pleroma.FollowingRelationship alias Pleroma.User + alias Pleroma.UserRelationship alias Pleroma.Web.CommonAPI.Utils alias Pleroma.Web.MastodonAPI.AccountView alias Pleroma.Web.MediaProxy def render("index.json", %{users: users} = opts) do + reading_user = opts[:for] + + # Note: :skip_relationships option is currently intentionally not supported for accounts + relationships_opt = + cond do + Map.has_key?(opts, :relationships) -> + opts[:relationships] + + is_nil(reading_user) -> + UserRelationship.view_relationships_option(nil, []) + + true -> + UserRelationship.view_relationships_option(reading_user, users) + end + + opts = Map.put(opts, :relationships, relationships_opt) + users |> render_many(AccountView, "show.json", opts) |> Enum.filter(&Enum.any?/1) end def render("show.json", %{user: user} = opts) do - if User.visible_for?(user, opts[:for]), - do: do_render("show.json", opts), - else: %{} + if User.visible_for?(user, opts[:for]) do + do_render("show.json", opts) + else + %{} + end end def render("mention.json", %{user: user}) do @@ -27,7 +48,7 @@ def render("mention.json", %{user: user}) do id: to_string(user.id), acct: user.nickname, username: username_from_nickname(user.nickname), - url: User.profile_url(user) + url: user.uri || user.ap_id } end @@ -35,27 +56,107 @@ def render("relationship.json", %{user: nil, target: _target}) do %{} end - def render("relationship.json", %{user: %User{} = user, target: %User{} = target}) do - follow_state = User.get_follow_state(user, target) + def render( + "relationship.json", + %{user: %User{} = reading_user, target: %User{} = target} = opts + ) do + user_relationships = get_in(opts, [:relationships, :user_relationships]) + following_relationships = get_in(opts, [:relationships, :following_relationships]) + follow_state = + if following_relationships do + user_to_target_following_relation = + FollowingRelationship.find(following_relationships, reading_user, target) + + User.get_follow_state(reading_user, target, user_to_target_following_relation) + else + User.get_follow_state(reading_user, target) + end + + followed_by = + if following_relationships do + case FollowingRelationship.find(following_relationships, target, reading_user) do + %{state: :follow_accept} -> true + _ -> false + end + else + User.following?(target, reading_user) + end + + # NOTE: adjust UserRelationship.view_relationships_option/2 on new relation-related flags %{ id: to_string(target.id), - following: follow_state == "accept", - followed_by: User.following?(target, user), - blocking: User.blocks_user?(user, target), - blocked_by: User.blocks_user?(target, user), - muting: User.mutes?(user, target), - muting_notifications: User.muted_notifications?(user, target), - subscribing: User.subscribed_to?(user, target), - requested: follow_state == "pending", - domain_blocking: User.blocks_domain?(user, target), - showing_reblogs: User.showing_reblogs?(user, target), + following: follow_state == :follow_accept, + followed_by: followed_by, + blocking: + UserRelationship.exists?( + user_relationships, + :block, + reading_user, + target, + &User.blocks_user?(&1, &2) + ), + blocked_by: + UserRelationship.exists?( + user_relationships, + :block, + target, + reading_user, + &User.blocks_user?(&1, &2) + ), + muting: + UserRelationship.exists?( + user_relationships, + :mute, + reading_user, + target, + &User.mutes?(&1, &2) + ), + muting_notifications: + UserRelationship.exists?( + user_relationships, + :notification_mute, + reading_user, + target, + &User.muted_notifications?(&1, &2) + ), + subscribing: + UserRelationship.exists?( + user_relationships, + :inverse_subscription, + target, + reading_user, + &User.subscribed_to?(&2, &1) + ), + requested: follow_state == :follow_pending, + domain_blocking: User.blocks_domain?(reading_user, target), + showing_reblogs: + not UserRelationship.exists?( + user_relationships, + :reblog_mute, + reading_user, + target, + &User.muting_reblogs?(&1, &2) + ), endorsed: false } end - def render("relationships.json", %{user: user, targets: targets}) do - render_many(targets, AccountView, "relationship.json", user: user, as: :target) + def render("relationships.json", %{user: user, targets: targets} = opts) do + relationships_opt = + cond do + Map.has_key?(opts, :relationships) -> + opts[:relationships] + + is_nil(user) -> + UserRelationship.view_relationships_option(nil, []) + + true -> + UserRelationship.view_relationships_option(user, targets) + end + + render_opts = %{as: :target, user: user, relationships: relationships_opt} + render_many(targets, AccountView, "relationship.json", render_opts) end defp do_render("show.json", %{user: user} = opts) do @@ -82,18 +183,25 @@ defp do_render("show.json", %{user: user} = opts) do bot = user.actor_type in ["Application", "Service"] emojis = - (user.source_data["tag"] || []) - |> Enum.filter(fn %{"type" => t} -> t == "Emoji" end) - |> Enum.map(fn %{"icon" => %{"url" => url}, "name" => name} -> + Enum.map(user.emoji, fn {shortcode, url} -> %{ - "shortcode" => String.trim(name, ":"), - "url" => MediaProxy.url(url), - "static_url" => MediaProxy.url(url), + "shortcode" => shortcode, + "url" => url, + "static_url" => url, "visible_in_picker" => false } end) - relationship = render("relationship.json", %{user: opts[:for], target: user}) + relationship = + if opts[:skip_relationships] do + %{} + else + render("relationship.json", %{ + user: opts[:for], + target: user, + relationships: opts[:relationships] + }) + end %{ id: to_string(user.id), @@ -106,7 +214,7 @@ defp do_render("show.json", %{user: user} = opts) do following_count: following_count, statuses_count: user.note_count, note: user.bio || "", - url: User.profile_url(user), + url: user.uri || user.ap_id, avatar: image, avatar_static: image, header: header, @@ -115,7 +223,7 @@ defp do_render("show.json", %{user: user} = opts) do fields: user.fields, bot: bot, source: %{ - note: (user.bio || "") |> String.replace(~r(
), "\n") |> Pleroma.HTML.strip_tags(), + note: prepare_user_bio(user), sensitive: false, fields: user.raw_fields, pleroma: %{ @@ -147,8 +255,20 @@ defp do_render("show.json", %{user: user} = opts) do |> maybe_put_follow_requests_count(user, opts[:for]) |> maybe_put_allow_following_move(user, opts[:for]) |> maybe_put_unread_conversation_count(user, opts[:for]) + |> maybe_put_unread_notification_count(user, opts[:for]) end + defp prepare_user_bio(%User{bio: ""}), do: "" + + defp prepare_user_bio(%User{bio: bio}) when is_binary(bio) do + bio + |> String.replace(~r(
), "\n") + |> Pleroma.HTML.strip_tags() + |> HtmlEntities.decode() + end + + defp prepare_user_bio(_), do: "" + defp username_from_nickname(string) when is_binary(string) do hd(String.split(string, "@")) end @@ -217,7 +337,11 @@ defp maybe_put_role(data, %User{id: user_id} = user, %User{id: user_id}) do defp maybe_put_role(data, _, _), do: data defp maybe_put_notification_settings(data, %User{id: user_id} = user, %User{id: user_id}) do - Kernel.put_in(data, [:pleroma, :notification_settings], user.notification_settings) + Kernel.put_in( + data, + [:pleroma, :notification_settings], + Map.from_struct(user.notification_settings) + ) end defp maybe_put_notification_settings(data, _, _), do: data @@ -244,6 +368,16 @@ defp maybe_put_unread_conversation_count(data, %User{id: user_id} = user, %User{ defp maybe_put_unread_conversation_count(data, _, _), do: data + defp maybe_put_unread_notification_count(data, %User{id: user_id}, %User{id: user_id} = user) do + Kernel.put_in( + data, + [:pleroma, :unread_notifications_count], + Pleroma.Notification.unread_notifications_count(user) + ) + end + + defp maybe_put_unread_notification_count(data, _, _), do: data + defp image_url(%{"url" => [%{"href" => href} | _]}), do: href defp image_url(_), do: nil end diff --git a/lib/pleroma/web/mastodon_api/views/app_view.ex b/lib/pleroma/web/mastodon_api/views/app_view.ex index d934e2107..36071cd25 100644 --- a/lib/pleroma/web/mastodon_api/views/app_view.ex +++ b/lib/pleroma/web/mastodon_api/views/app_view.ex @@ -7,6 +7,21 @@ defmodule Pleroma.Web.MastodonAPI.AppView do alias Pleroma.Web.OAuth.App + def render("index.json", %{apps: apps, count: count, page_size: page_size, admin: true}) do + %{ + apps: render_many(apps, Pleroma.Web.MastodonAPI.AppView, "show.json", %{admin: true}), + count: count, + page_size: page_size + } + end + + def render("show.json", %{admin: true, app: %App{} = app} = assigns) do + "show.json" + |> render(Map.delete(assigns, :admin)) + |> Map.put(:trusted, app.trusted) + |> Map.put(:id, app.id) + end + def render("show.json", %{app: %App{} = app}) do %{ id: app.id |> to_string, diff --git a/lib/pleroma/web/mastodon_api/views/filter_view.ex b/lib/pleroma/web/mastodon_api/views/filter_view.ex index 97fd1e83f..aeff646f5 100644 --- a/lib/pleroma/web/mastodon_api/views/filter_view.ex +++ b/lib/pleroma/web/mastodon_api/views/filter_view.ex @@ -7,11 +7,11 @@ defmodule Pleroma.Web.MastodonAPI.FilterView do alias Pleroma.Web.CommonAPI.Utils alias Pleroma.Web.MastodonAPI.FilterView - def render("filters.json", %{filters: filters} = opts) do - render_many(filters, FilterView, "filter.json", opts) + def render("index.json", %{filters: filters}) do + render_many(filters, FilterView, "show.json") end - def render("filter.json", %{filter: filter}) do + def render("show.json", %{filter: filter}) do expires_at = if filter.expires_at do Utils.to_masto_date(filter.expires_at) diff --git a/lib/pleroma/web/mastodon_api/views/instance_view.ex b/lib/pleroma/web/mastodon_api/views/instance_view.ex index 67214dbea..a329ffc28 100644 --- a/lib/pleroma/web/mastodon_api/views/instance_view.ex +++ b/lib/pleroma/web/mastodon_api/views/instance_view.ex @@ -5,10 +5,13 @@ defmodule Pleroma.Web.MastodonAPI.InstanceView do use Pleroma.Web, :view + alias Pleroma.Config + alias Pleroma.Web.ActivityPub.MRF + @mastodon_api_level "2.7.2" def render("show.json", _) do - instance = Pleroma.Config.get(:instance) + instance = Config.get(:instance) %{ uri: Pleroma.Web.base_url(), @@ -29,7 +32,58 @@ def render("show.json", _) do upload_limit: Keyword.get(instance, :upload_limit), avatar_upload_limit: Keyword.get(instance, :avatar_upload_limit), background_upload_limit: Keyword.get(instance, :background_upload_limit), - banner_upload_limit: Keyword.get(instance, :banner_upload_limit) + banner_upload_limit: Keyword.get(instance, :banner_upload_limit), + pleroma: %{ + metadata: %{ + features: features(), + federation: federation() + }, + vapid_public_key: Keyword.get(Pleroma.Web.Push.vapid_config(), :public_key) + } } end + + def features do + [ + "pleroma_api", + "mastodon_api", + "mastodon_api_streaming", + "polls", + "pleroma_explicit_addressing", + "shareable_emoji_packs", + "multifetch", + "pleroma:api/v1/notifications:include_types_filter", + if Config.get([:media_proxy, :enabled]) do + "media_proxy" + end, + if Config.get([:gopher, :enabled]) do + "gopher" + end, + if Config.get([:chat, :enabled]) do + "chat" + end, + if Config.get([:instance, :allow_relay]) do + "relay" + end, + if Config.get([:instance, :safe_dm_mentions]) do + "safe_dm_mentions" + end, + "pleroma_emoji_reactions" + ] + |> Enum.filter(& &1) + end + + def federation do + quarantined = Config.get([:instance, :quarantined_instances], []) + + if Config.get([:instance, :mrf_transparency]) do + {:ok, data} = MRF.describe() + + data + |> Map.merge(%{quarantined_instances: quarantined}) + else + %{} + end + |> Map.put(:enabled, Config.get([:instance, :federating])) + end end diff --git a/lib/pleroma/web/mastodon_api/views/marker_view.ex b/lib/pleroma/web/mastodon_api/views/marker_view.ex index 985368fe5..21d535d54 100644 --- a/lib/pleroma/web/mastodon_api/views/marker_view.ex +++ b/lib/pleroma/web/mastodon_api/views/marker_view.ex @@ -6,12 +6,16 @@ defmodule Pleroma.Web.MastodonAPI.MarkerView do use Pleroma.Web, :view def render("markers.json", %{markers: markers}) do - Enum.reduce(markers, %{}, fn m, acc -> - Map.put_new(acc, m.timeline, %{ - last_read_id: m.last_read_id, - version: m.lock_version, - updated_at: NaiveDateTime.to_iso8601(m.updated_at) - }) + Map.new(markers, fn m -> + {m.timeline, + %{ + last_read_id: m.last_read_id, + version: m.lock_version, + updated_at: NaiveDateTime.to_iso8601(m.updated_at), + pleroma: %{ + unread_count: m.unread_count + } + }} end) end end diff --git a/lib/pleroma/web/mastodon_api/views/notification_view.ex b/lib/pleroma/web/mastodon_api/views/notification_view.ex index 33145c484..4da1ab67f 100644 --- a/lib/pleroma/web/mastodon_api/views/notification_view.ex +++ b/lib/pleroma/web/mastodon_api/views/notification_view.ex @@ -8,24 +8,91 @@ defmodule Pleroma.Web.MastodonAPI.NotificationView do alias Pleroma.Activity alias Pleroma.Notification alias Pleroma.User + alias Pleroma.UserRelationship alias Pleroma.Web.CommonAPI alias Pleroma.Web.MastodonAPI.AccountView alias Pleroma.Web.MastodonAPI.NotificationView alias Pleroma.Web.MastodonAPI.StatusView - def render("index.json", %{notifications: notifications, for: user}) do - safe_render_many(notifications, NotificationView, "show.json", %{for: user}) + def render("index.json", %{notifications: notifications, for: reading_user} = opts) do + activities = Enum.map(notifications, & &1.activity) + + parent_activities = + activities + |> Enum.filter( + &(Activity.mastodon_notification_type(&1) in [ + "favourite", + "reblog", + "pleroma:emoji_reaction" + ]) + ) + |> Enum.map(& &1.data["object"]) + |> Activity.create_by_object_ap_id() + |> Activity.with_preloaded_object(:left) + |> Pleroma.Repo.all() + + relationships_opt = + cond do + Map.has_key?(opts, :relationships) -> + opts[:relationships] + + is_nil(reading_user) -> + UserRelationship.view_relationships_option(nil, []) + + true -> + move_activities_targets = + activities + |> Enum.filter(&(Activity.mastodon_notification_type(&1) == "move")) + |> Enum.map(&User.get_cached_by_ap_id(&1.data["target"])) + + actors = + activities + |> Enum.map(fn a -> User.get_cached_by_ap_id(a.data["actor"]) end) + |> Enum.filter(& &1) + |> Kernel.++(move_activities_targets) + + UserRelationship.view_relationships_option(reading_user, actors, + source_mutes_only: opts[:skip_relationships] + ) + end + + opts = + opts + |> Map.put(:parent_activities, parent_activities) + |> Map.put(:relationships, relationships_opt) + + safe_render_many(notifications, NotificationView, "show.json", opts) end - def render("show.json", %{ - notification: %Notification{activity: activity} = notification, - for: user - }) do + def render( + "show.json", + %{ + notification: %Notification{activity: activity} = notification, + for: reading_user + } = opts + ) do actor = User.get_cached_by_ap_id(activity.data["actor"]) - parent_activity = Activity.get_create_by_object_ap_id(activity.data["object"]) + + parent_activity_fn = fn -> + if opts[:parent_activities] do + Activity.Queries.find_by_object_ap_id(opts[:parent_activities], activity.data["object"]) + else + Activity.get_create_by_object_ap_id(activity.data["object"]) + end + end + mastodon_type = Activity.mastodon_notification_type(activity) - with %{id: _} = account <- AccountView.render("show.json", %{user: actor, for: user}) do + render_opts = %{ + relationships: opts[:relationships], + skip_relationships: opts[:skip_relationships] + } + + with %{id: _} = account <- + AccountView.render( + "show.json", + Map.merge(render_opts, %{user: actor, for: reading_user}) + ) do response = %{ id: to_string(notification.id), type: mastodon_type, @@ -38,22 +105,25 @@ def render("show.json", %{ case mastodon_type do "mention" -> - put_status(response, activity, user) + put_status(response, activity, reading_user, render_opts) "favourite" -> - put_status(response, parent_activity, user) + put_status(response, parent_activity_fn.(), reading_user, render_opts) "reblog" -> - put_status(response, parent_activity, user) + put_status(response, parent_activity_fn.(), reading_user, render_opts) "move" -> - put_target(response, activity, user) - - "follow" -> - response + # Note: :skip_relationships option being applied to _account_ rendering (here) + put_target(response, activity, reading_user, render_opts) "pleroma:emoji_reaction" -> - put_status(response, parent_activity, user) |> put_emoji(activity) + response + |> put_status(parent_activity_fn.(), reading_user, render_opts) + |> put_emoji(activity) + + type when type in ["follow", "follow_request"] -> + response _ -> nil @@ -64,16 +134,21 @@ def render("show.json", %{ end defp put_emoji(response, activity) do - response - |> Map.put(:emoji, activity.data["content"]) + Map.put(response, :emoji, activity.data["content"]) end - defp put_status(response, activity, user) do - Map.put(response, :status, StatusView.render("show.json", %{activity: activity, for: user})) + defp put_status(response, activity, reading_user, opts) do + status_render_opts = Map.merge(opts, %{activity: activity, for: reading_user}) + status_render = StatusView.render("show.json", status_render_opts) + + Map.put(response, :status, status_render) end - defp put_target(response, activity, user) do - target = User.get_cached_by_ap_id(activity.data["target"]) - Map.put(response, :target, AccountView.render("show.json", %{user: target, for: user})) + defp put_target(response, activity, reading_user, opts) do + target_user = User.get_cached_by_ap_id(activity.data["target"]) + target_render_opts = Map.merge(opts, %{user: target_user, for: reading_user}) + target_render = AccountView.render("show.json", target_render_opts) + + Map.put(response, :target, target_render) end end diff --git a/lib/pleroma/web/mastodon_api/views/poll_view.ex b/lib/pleroma/web/mastodon_api/views/poll_view.ex index 40edbb213..59a5deb28 100644 --- a/lib/pleroma/web/mastodon_api/views/poll_view.ex +++ b/lib/pleroma/web/mastodon_api/views/poll_view.ex @@ -19,6 +19,7 @@ def render("show.json", %{object: object, multiple: multiple, options: options} expired: expired, multiple: multiple, votes_count: votes_count, + voters_count: (multiple || nil) && voters_count(object), options: options, voted: voted?(params), emojis: Pleroma.Web.MastodonAPI.StatusView.build_emojis(object.data["emoji"]) @@ -62,6 +63,12 @@ defp options_and_votes_count(options) do end) end + defp voters_count(%{data: %{"voters" => [_ | _] = voters}}) do + length(voters) + end + + defp voters_count(_), do: 0 + defp voted?(%{object: object} = opts) do if opts[:for] do existing_votes = Pleroma.Web.ActivityPub.Utils.get_existing_votes(opts[:for].ap_id, object) diff --git a/lib/pleroma/web/mastodon_api/views/status_view.ex b/lib/pleroma/web/mastodon_api/views/status_view.ex index f7469cdff..24167f66f 100644 --- a/lib/pleroma/web/mastodon_api/views/status_view.ex +++ b/lib/pleroma/web/mastodon_api/views/status_view.ex @@ -13,6 +13,7 @@ defmodule Pleroma.Web.MastodonAPI.StatusView do alias Pleroma.Object alias Pleroma.Repo alias Pleroma.User + alias Pleroma.UserRelationship alias Pleroma.Web.CommonAPI alias Pleroma.Web.CommonAPI.Utils alias Pleroma.Web.MastodonAPI.AccountView @@ -44,7 +45,7 @@ defp get_replied_to_activities(activities) do end) end - defp get_user(ap_id) do + def get_user(ap_id, fake_record_fallback \\ true) do cond do user = User.get_cached_by_ap_id(ap_id) -> user @@ -52,8 +53,12 @@ defp get_user(ap_id) do user = User.get_by_guessed_nickname(ap_id) -> user - true -> + fake_record_fallback -> + # TODO: refactor (fake records is never a good idea) User.error_user(ap_id) + + true -> + nil end end @@ -71,10 +76,49 @@ defp reblogged?(activity, user) do end def render("index.json", opts) do - replied_to_activities = get_replied_to_activities(opts.activities) - opts = Map.put(opts, :replied_to_activities, replied_to_activities) + reading_user = opts[:for] - safe_render_many(opts.activities, StatusView, "show.json", opts) + # To do: check AdminAPIControllerTest on the reasons behind nil activities in the list + activities = Enum.filter(opts.activities, & &1) + replied_to_activities = get_replied_to_activities(activities) + + parent_activities = + activities + |> Enum.filter(&(&1.data["type"] == "Announce" && &1.data["object"])) + |> Enum.map(&Object.normalize(&1).data["id"]) + |> Activity.create_by_object_ap_id() + |> Activity.with_preloaded_object(:left) + |> Activity.with_preloaded_bookmark(reading_user) + |> Activity.with_set_thread_muted_field(reading_user) + |> Repo.all() + + relationships_opt = + cond do + Map.has_key?(opts, :relationships) -> + opts[:relationships] + + is_nil(reading_user) -> + UserRelationship.view_relationships_option(nil, []) + + true -> + # Note: unresolved users are filtered out + actors = + (activities ++ parent_activities) + |> Enum.map(&get_user(&1.data["actor"], false)) + |> Enum.filter(& &1) + + UserRelationship.view_relationships_option(reading_user, actors, + source_mutes_only: opts[:skip_relationships] + ) + end + + opts = + opts + |> Map.put(:replied_to_activities, replied_to_activities) + |> Map.put(:parent_activities, parent_activities) + |> Map.put(:relationships, relationships_opt) + + safe_render_many(activities, StatusView, "show.json", opts) end def render( @@ -85,17 +129,25 @@ def render( created_at = Utils.to_masto_date(activity.data["published"]) activity_object = Object.normalize(activity) - reblogged_activity = - Activity.create_by_object_ap_id(activity_object.data["id"]) - |> Activity.with_preloaded_bookmark(opts[:for]) - |> Activity.with_set_thread_muted_field(opts[:for]) - |> Repo.one() + reblogged_parent_activity = + if opts[:parent_activities] do + Activity.Queries.find_by_object_ap_id( + opts[:parent_activities], + activity_object.data["id"] + ) + else + Activity.create_by_object_ap_id(activity_object.data["id"]) + |> Activity.with_preloaded_bookmark(opts[:for]) + |> Activity.with_set_thread_muted_field(opts[:for]) + |> Repo.one() + end - reblogged = render("show.json", Map.put(opts, :activity, reblogged_activity)) + reblog_rendering_opts = Map.put(opts, :activity, reblogged_parent_activity) + reblogged = render("show.json", reblog_rendering_opts) favorited = opts[:for] && opts[:for].ap_id in (activity_object.data["likes"] || []) - bookmarked = Activity.get_bookmark(reblogged_activity, opts[:for]) != nil + bookmarked = Activity.get_bookmark(reblogged_parent_activity, opts[:for]) != nil mentions = activity.recipients @@ -107,7 +159,13 @@ def render( id: to_string(activity.id), uri: activity_object.data["id"], url: activity_object.data["id"], - account: AccountView.render("show.json", %{user: user, for: opts[:for]}), + account: + AccountView.render("show.json", %{ + user: user, + for: opts[:for], + relationships: opts[:relationships], + skip_relationships: opts[:skip_relationships] + }), in_reply_to_id: nil, in_reply_to_account_id: nil, reblog: reblogged, @@ -116,7 +174,7 @@ def render( reblogs_count: 0, replies_count: 0, favourites_count: 0, - reblogged: reblogged?(reblogged_activity, opts[:for]), + reblogged: reblogged?(reblogged_parent_activity, opts[:for]), favourited: present?(favorited), bookmarked: present?(bookmarked), muted: false, @@ -183,9 +241,10 @@ def render("show.json", %{activity: %{data: %{"object" => _object}} = activity} end thread_muted? = - case activity.thread_muted? do - thread_muted? when is_boolean(thread_muted?) -> thread_muted? - nil -> (opts[:for] && CommonAPI.thread_muted?(opts[:for], activity)) || false + cond do + is_nil(opts[:for]) -> false + is_boolean(activity.thread_muted?) -> activity.thread_muted? + true -> CommonAPI.thread_muted?(opts[:for], activity) end attachment_data = object.data["attachment"] || [] @@ -253,11 +312,28 @@ def render("show.json", %{activity: %{data: %{"object" => _object}} = activity} _ -> [] end + # Status muted state (would do 1 request per status unless user mutes are preloaded) + muted = + thread_muted? || + UserRelationship.exists?( + get_in(opts, [:relationships, :user_relationships]), + :mute, + opts[:for], + user, + fn for_user, user -> User.mutes?(for_user, user) end + ) + %{ id: to_string(activity.id), uri: object.data["id"], url: url, - account: AccountView.render("show.json", %{user: user, for: opts[:for]}), + account: + AccountView.render("show.json", %{ + user: user, + for: opts[:for], + relationships: opts[:relationships], + skip_relationships: opts[:skip_relationships] + }), in_reply_to_id: reply_to && to_string(reply_to.id), in_reply_to_account_id: reply_to_user && to_string(reply_to_user.id), reblog: nil, @@ -270,7 +346,7 @@ def render("show.json", %{activity: %{data: %{"object" => _object}} = activity} reblogged: reblogged?(activity, opts[:for]), favourited: present?(favorited), bookmarked: present?(bookmarked), - muted: thread_muted? || User.mutes?(opts[:for], user), + muted: muted, pinned: pinned?(activity, user), sensitive: sensitive, spoiler_text: summary, @@ -421,7 +497,7 @@ def get_reply_to(%{data: %{"object" => _object}} = activity, _) do end def render_content(%{data: %{"type" => object_type}} = object) - when object_type in ["Video", "Event"] do + when object_type in ["Video", "Event", "Audio"] do with name when not is_nil(name) and name != "" <- object.data["name"] do "

#{name}

#{object.data["content"]}" else @@ -453,11 +529,9 @@ def render_content(object), do: object.data["content"] || "" """ @spec build_tags(list(any())) :: list(map()) def build_tags(object_tags) when is_list(object_tags) do - object_tags = for tag when is_binary(tag) <- object_tags, do: tag - - Enum.reduce(object_tags, [], fn tag, tags -> - tags ++ [%{name: tag, url: "/tag/#{URI.encode(tag)}"}] - end) + object_tags + |> Enum.filter(&is_binary/1) + |> Enum.map(&%{name: &1, url: "/tag/#{URI.encode(&1)}"}) end def build_tags(_), do: [] diff --git a/lib/pleroma/web/mastodon_api/views/push_subscription_view.ex b/lib/pleroma/web/mastodon_api/views/subscription_view.ex similarity index 77% rename from lib/pleroma/web/mastodon_api/views/push_subscription_view.ex rename to lib/pleroma/web/mastodon_api/views/subscription_view.ex index d32cef6e2..7c67cc924 100644 --- a/lib/pleroma/web/mastodon_api/views/push_subscription_view.ex +++ b/lib/pleroma/web/mastodon_api/views/subscription_view.ex @@ -2,11 +2,11 @@ # Copyright © 2017-2020 Pleroma Authors # SPDX-License-Identifier: AGPL-3.0-only -defmodule Pleroma.Web.MastodonAPI.PushSubscriptionView do +defmodule Pleroma.Web.MastodonAPI.SubscriptionView do use Pleroma.Web, :view alias Pleroma.Web.Push - def render("push_subscription.json", %{subscription: subscription}) do + def render("show.json", %{subscription: subscription}) do %{ id: to_string(subscription.id), endpoint: subscription.endpoint, diff --git a/lib/pleroma/web/mastodon_api/websocket_handler.ex b/lib/pleroma/web/mastodon_api/websocket_handler.ex index 5652a37c1..94e4595d8 100644 --- a/lib/pleroma/web/mastodon_api/websocket_handler.ex +++ b/lib/pleroma/web/mastodon_api/websocket_handler.ex @@ -12,29 +12,19 @@ defmodule Pleroma.Web.MastodonAPI.WebsocketHandler do @behaviour :cowboy_websocket - @streams [ - "public", - "public:local", - "public:media", - "public:local:media", - "user", - "user:notification", - "direct", - "list", - "hashtag" - ] - @anonymous_streams ["public", "public:local", "hashtag"] - - # Handled by periodic keepalive in Pleroma.Web.Streamer.Ping. - @timeout :infinity + # Client ping period. + @tick :timer.seconds(30) + # Cowboy timeout period. + @timeout :timer.seconds(60) + # Hibernate every X messages + @hibernate_every 100 def init(%{qs: qs} = req, state) do - with params <- :cow_qs.parse_qs(qs), + with params <- Enum.into(:cow_qs.parse_qs(qs), %{}), sec_websocket <- :cowboy_req.header("sec-websocket-protocol", req, nil), - access_token <- List.keyfind(params, "access_token", 0), - {_, stream} <- List.keyfind(params, "stream", 0), - {:ok, user} <- allow_request(stream, [access_token, sec_websocket]), - topic when is_binary(topic) <- expand_topic(stream, params) do + access_token <- Map.get(params, "access_token"), + {:ok, user} <- authenticate_request(access_token, sec_websocket), + {:ok, topic} <- Streamer.get_topic(Map.get(params, "stream"), user, params) do req = if sec_websocket do :cowboy_req.set_resp_header("sec-websocket-protocol", sec_websocket, req) @@ -42,43 +32,70 @@ def init(%{qs: qs} = req, state) do req end - {:cowboy_websocket, req, %{user: user, topic: topic}, %{idle_timeout: @timeout}} + {:cowboy_websocket, req, %{user: user, topic: topic, count: 0, timer: nil}, + %{idle_timeout: @timeout}} else - {:error, code} -> - Logger.debug("#{__MODULE__} denied connection: #{inspect(code)} - #{inspect(req)}") - {:ok, req} = :cowboy_req.reply(code, req) + {:error, :bad_topic} -> + Logger.debug("#{__MODULE__} bad topic #{inspect(req)}") + {:ok, req} = :cowboy_req.reply(404, req) {:ok, req, state} - error -> - Logger.debug("#{__MODULE__} denied connection: #{inspect(error)} - #{inspect(req)}") - {:ok, req} = :cowboy_req.reply(400, req) + {:error, :unauthorized} -> + Logger.debug("#{__MODULE__} authentication error: #{inspect(req)}") + {:ok, req} = :cowboy_req.reply(401, req) {:ok, req, state} end end def websocket_init(state) do - send(self(), :subscribe) - {:ok, state} - end - - # We never receive messages. - def websocket_handle(_frame, state) do - {:ok, state} - end - - def websocket_info(:subscribe, state) do Logger.debug( "#{__MODULE__} accepted websocket connection for user #{ (state.user || %{id: "anonymous"}).id }, topic #{state.topic}" ) - Streamer.add_socket(state.topic, streamer_socket(state)) + Streamer.add_socket(state.topic, state.user) + {:ok, %{state | timer: timer()}} + end + + # Client's Pong frame. + def websocket_handle(:pong, state) do + if state.timer, do: Process.cancel_timer(state.timer) + {:ok, %{state | timer: timer()}} + end + + # We never receive messages. + def websocket_handle(frame, state) do + Logger.error("#{__MODULE__} received frame: #{inspect(frame)}") {:ok, state} end + def websocket_info({:render_with_user, view, template, item}, state) do + user = %User{} = User.get_cached_by_ap_id(state.user.ap_id) + + unless Streamer.filtered_by_user?(user, item) do + websocket_info({:text, view.render(template, item, user)}, %{state | user: user}) + else + {:ok, state} + end + end + def websocket_info({:text, message}, state) do - {:reply, {:text, message}, state} + # If the websocket processed X messages, force an hibernate/GC. + # We don't hibernate at every message to balance CPU usage/latency with RAM usage. + if state.count > @hibernate_every do + {:reply, {:text, message}, %{state | count: 0}, :hibernate} + else + {:reply, {:text, message}, %{state | count: state.count + 1}} + end + end + + # Ping tick. We don't re-queue a timer there, it is instead queued when :pong is received. + # As we hibernate there, reset the count to 0. + # If the client misses :pong, Cowboy will automatically timeout the connection after + # `@idle_timeout`. + def websocket_info(:tick, state) do + {:reply, :ping, %{state | timer: nil, count: 0}, :hibernate} end def terminate(reason, _req, state) do @@ -88,56 +105,29 @@ def terminate(reason, _req, state) do }, topic #{state.topic || "?"}: #{inspect(reason)}" ) - Streamer.remove_socket(state.topic, streamer_socket(state)) + Streamer.remove_socket(state.topic) :ok end # Public streams without authentication. - defp allow_request(stream, [nil, nil]) when stream in @anonymous_streams do + defp authenticate_request(nil, nil) do {:ok, nil} end # Authenticated streams. - defp allow_request(stream, [access_token, sec_websocket]) when stream in @streams do - token = - with {"access_token", token} <- access_token do - token - else - _ -> sec_websocket - end + defp authenticate_request(access_token, sec_websocket) do + token = access_token || sec_websocket with true <- is_bitstring(token), %Token{user_id: user_id} <- Repo.get_by(Token, token: token), user = %User{} <- User.get_cached_by_id(user_id) do {:ok, user} else - _ -> {:error, 403} + _ -> {:error, :unauthorized} end end - # Not authenticated. - defp allow_request(stream, _) when stream in @streams, do: {:error, 403} - - # No matching stream. - defp allow_request(_, _), do: {:error, 404} - - defp expand_topic("hashtag", params) do - case List.keyfind(params, "tag", 0) do - {_, tag} -> "hashtag:#{tag}" - _ -> nil - end - end - - defp expand_topic("list", params) do - case List.keyfind(params, "list", 0) do - {_, list} -> "list:#{list}" - _ -> nil - end - end - - defp expand_topic(topic, _), do: topic - - defp streamer_socket(state) do - %{transport_pid: self(), assigns: state} + defp timer do + Process.send_after(self(), :tick, @tick) end end diff --git a/lib/pleroma/web/media_proxy/media_proxy_controller.ex b/lib/pleroma/web/media_proxy/media_proxy_controller.ex index 1a09ac62a..4657a4383 100644 --- a/lib/pleroma/web/media_proxy/media_proxy_controller.ex +++ b/lib/pleroma/web/media_proxy/media_proxy_controller.ex @@ -4,6 +4,7 @@ defmodule Pleroma.Web.MediaProxy.MediaProxyController do use Pleroma.Web, :controller + alias Pleroma.ReverseProxy alias Pleroma.Web.MediaProxy diff --git a/lib/pleroma/web/metadata.ex b/lib/pleroma/web/metadata.ex index c9aac27dc..a9f70c43e 100644 --- a/lib/pleroma/web/metadata.ex +++ b/lib/pleroma/web/metadata.ex @@ -6,7 +6,12 @@ defmodule Pleroma.Web.Metadata do alias Phoenix.HTML def build_tags(params) do - Enum.reduce(Pleroma.Config.get([__MODULE__, :providers], []), "", fn parser, acc -> + providers = [ + Pleroma.Web.Metadata.Providers.RestrictIndexing + | Pleroma.Config.get([__MODULE__, :providers], []) + ] + + Enum.reduce(providers, "", fn parser, acc -> rendered_html = params |> parser.build_tags() diff --git a/lib/pleroma/web/metadata/opengraph.ex b/lib/pleroma/web/metadata/opengraph.ex index 21446ac77..68c871e71 100644 --- a/lib/pleroma/web/metadata/opengraph.ex +++ b/lib/pleroma/web/metadata/opengraph.ex @@ -68,7 +68,7 @@ def build_tags(%{user: user}) do property: "og:title", content: Utils.user_name_string(user) ], []}, - {:meta, [property: "og:url", content: User.profile_url(user)], []}, + {:meta, [property: "og:url", content: user.uri || user.ap_id], []}, {:meta, [property: "og:description", content: truncated_bio], []}, {:meta, [property: "og:type", content: "website"], []}, {:meta, [property: "og:image", content: Utils.attachment_url(User.avatar_url(user))], []}, diff --git a/lib/pleroma/web/metadata/restrict_indexing.ex b/lib/pleroma/web/metadata/restrict_indexing.ex new file mode 100644 index 000000000..f15607896 --- /dev/null +++ b/lib/pleroma/web/metadata/restrict_indexing.ex @@ -0,0 +1,25 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.Metadata.Providers.RestrictIndexing do + @behaviour Pleroma.Web.Metadata.Providers.Provider + + @moduledoc """ + Restricts indexing of remote users. + """ + + @impl true + def build_tags(%{user: %{local: false}}) do + [ + {:meta, + [ + name: "robots", + content: "noindex, noarchive" + ], []} + ] + end + + @impl true + def build_tags(%{user: %{local: true}}), do: [] +end diff --git a/lib/pleroma/web/mongooseim/mongoose_im_controller.ex b/lib/pleroma/web/mongooseim/mongoose_im_controller.ex index 04d823b36..6cbbe8fd8 100644 --- a/lib/pleroma/web/mongooseim/mongoose_im_controller.ex +++ b/lib/pleroma/web/mongooseim/mongoose_im_controller.ex @@ -5,7 +5,7 @@ defmodule Pleroma.Web.MongooseIM.MongooseIMController do use Pleroma.Web, :controller - alias Comeonin.Pbkdf2 + alias Pleroma.Plugs.AuthenticationPlug alias Pleroma.Plugs.RateLimiter alias Pleroma.Repo alias Pleroma.User @@ -14,7 +14,7 @@ defmodule Pleroma.Web.MongooseIM.MongooseIMController do plug(RateLimiter, [name: :authentication, params: ["user"]] when action == :check_password) def user_exists(conn, %{"user" => username}) do - with %User{} <- Repo.get_by(User, nickname: username, local: true) do + with %User{} <- Repo.get_by(User, nickname: username, local: true, deactivated: false) do conn |> json(true) else @@ -26,9 +26,9 @@ def user_exists(conn, %{"user" => username}) do end def check_password(conn, %{"user" => username, "pass" => password}) do - with %User{password_hash: password_hash} <- + with %User{password_hash: password_hash, deactivated: false} <- Repo.get_by(User, nickname: username, local: true), - true <- Pbkdf2.checkpw(password, password_hash) do + true <- AuthenticationPlug.checkpw(password, password_hash) do conn |> json(true) else diff --git a/lib/pleroma/web/nodeinfo/nodeinfo_controller.ex b/lib/pleroma/web/nodeinfo/nodeinfo_controller.ex index c90d4c009..721b599d4 100644 --- a/lib/pleroma/web/nodeinfo/nodeinfo_controller.ex +++ b/lib/pleroma/web/nodeinfo/nodeinfo_controller.ex @@ -9,8 +9,8 @@ defmodule Pleroma.Web.Nodeinfo.NodeinfoController do alias Pleroma.Stats alias Pleroma.User alias Pleroma.Web - alias Pleroma.Web.ActivityPub.MRF alias Pleroma.Web.Federator.Publisher + alias Pleroma.Web.MastodonAPI.InstanceView def schemas(conn, _params) do response = %{ @@ -34,50 +34,12 @@ def schemas(conn, _params) do def raw_nodeinfo do stats = Stats.get_stats() - quarantined = Config.get([:instance, :quarantined_instances], []) - staff_accounts = User.all_superusers() |> Enum.map(fn u -> u.ap_id end) - federation_response = - if Config.get([:instance, :mrf_transparency]) do - {:ok, data} = MRF.describe() - - data - |> Map.merge(%{quarantined_instances: quarantined}) - else - %{} - end - |> Map.put(:enabled, Config.get([:instance, :federating])) - - features = - [ - "pleroma_api", - "mastodon_api", - "mastodon_api_streaming", - "polls", - "pleroma_explicit_addressing", - "shareable_emoji_packs", - "multifetch", - "pleroma:api/v1/notifications:include_types_filter", - if Config.get([:media_proxy, :enabled]) do - "media_proxy" - end, - if Config.get([:gopher, :enabled]) do - "gopher" - end, - if Config.get([:chat, :enabled]) do - "chat" - end, - if Config.get([:instance, :allow_relay]) do - "relay" - end, - if Config.get([:instance, :safe_dm_mentions]) do - "safe_dm_mentions" - end - ] - |> Enum.filter(& &1) + features = InstanceView.features() + federation = InstanceView.federation() %{ version: "2.0", @@ -105,8 +67,7 @@ def raw_nodeinfo do enabled: false }, staffAccounts: staff_accounts, - federation: federation_response, - characterLimit: Config.get([:instance, :limit]), + federation: federation, pollLimits: Config.get([:instance, :poll_limits]), postFormats: Config.get([:instance, :allowed_post_formats]), uploadLimits: %{ diff --git a/lib/pleroma/web/oauth/app.ex b/lib/pleroma/web/oauth/app.ex index 01ed326f4..6a6d5f2e2 100644 --- a/lib/pleroma/web/oauth/app.ex +++ b/lib/pleroma/web/oauth/app.ex @@ -5,6 +5,7 @@ defmodule Pleroma.Web.OAuth.App do use Ecto.Schema import Ecto.Changeset + import Ecto.Query alias Pleroma.Repo @type t :: %__MODULE__{} @@ -16,14 +17,24 @@ defmodule Pleroma.Web.OAuth.App do field(:website, :string) field(:client_id, :string) field(:client_secret, :string) + field(:trusted, :boolean, default: false) + + has_many(:oauth_authorizations, Pleroma.Web.OAuth.Authorization, on_delete: :delete_all) + has_many(:oauth_tokens, Pleroma.Web.OAuth.Token, on_delete: :delete_all) timestamps() end + @spec changeset(App.t(), map()) :: Ecto.Changeset.t() + def changeset(struct, params) do + cast(struct, params, [:client_name, :redirect_uris, :scopes, :website, :trusted]) + end + + @spec register_changeset(App.t(), map()) :: Ecto.Changeset.t() def register_changeset(struct, params \\ %{}) do changeset = struct - |> cast(params, [:client_name, :redirect_uris, :scopes, :website]) + |> changeset(params) |> validate_required([:client_name, :redirect_uris, :scopes]) if changeset.valid? do @@ -41,6 +52,21 @@ def register_changeset(struct, params \\ %{}) do end end + @spec create(map()) :: {:ok, App.t()} | {:error, Ecto.Changeset.t()} + def create(params) do + with changeset <- __MODULE__.register_changeset(%__MODULE__{}, params) do + Repo.insert(changeset) + end + end + + @spec update(map()) :: {:ok, App.t()} | {:error, Ecto.Changeset.t()} + def update(params) do + with %__MODULE__{} = app <- Repo.get(__MODULE__, params["id"]), + changeset <- changeset(app, params) do + Repo.update(changeset) + end + end + @doc """ Gets app by attrs or create new with attrs. And updates the scopes if need. @@ -65,4 +91,58 @@ defp update_scopes(%__MODULE__{} = app, scopes) do |> change(%{scopes: scopes}) |> Repo.update() end + + @spec search(map()) :: {:ok, [App.t()], non_neg_integer()} + def search(params) do + query = from(a in __MODULE__) + + query = + if params[:client_name] do + from(a in query, where: a.client_name == ^params[:client_name]) + else + query + end + + query = + if params[:client_id] do + from(a in query, where: a.client_id == ^params[:client_id]) + else + query + end + + query = + if Map.has_key?(params, :trusted) do + from(a in query, where: a.trusted == ^params[:trusted]) + else + query + end + + query = + from(u in query, + limit: ^params[:page_size], + offset: ^((params[:page] - 1) * params[:page_size]) + ) + + count = Repo.aggregate(__MODULE__, :count, :id) + + {:ok, Repo.all(query), count} + end + + @spec destroy(pos_integer()) :: {:ok, App.t()} | {:error, Ecto.Changeset.t()} + def destroy(id) do + with %__MODULE__{} = app <- Repo.get(__MODULE__, id) do + Repo.delete(app) + end + end + + @spec errors(Ecto.Changeset.t()) :: map() + def errors(changeset) do + Enum.reduce(changeset.errors, %{}, fn + {:client_name, {error, _}}, acc -> + Map.put(acc, :name, error) + + {key, {error, _}}, acc -> + Map.put(acc, key, error) + end) + end end diff --git a/lib/pleroma/web/oauth/mfa_controller.ex b/lib/pleroma/web/oauth/mfa_controller.ex new file mode 100644 index 000000000..e52cccd85 --- /dev/null +++ b/lib/pleroma/web/oauth/mfa_controller.ex @@ -0,0 +1,97 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2019 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.OAuth.MFAController do + @moduledoc """ + The model represents api to use Multi Factor authentications. + """ + + use Pleroma.Web, :controller + + alias Pleroma.MFA + alias Pleroma.Web.Auth.TOTPAuthenticator + alias Pleroma.Web.OAuth.MFAView, as: View + alias Pleroma.Web.OAuth.OAuthController + alias Pleroma.Web.OAuth.Token + + plug(:fetch_session when action in [:show, :verify]) + plug(:fetch_flash when action in [:show, :verify]) + + @doc """ + Display form to input mfa code or recovery code. + """ + def show(conn, %{"mfa_token" => mfa_token} = params) do + template = Map.get(params, "challenge_type", "totp") + + conn + |> put_view(View) + |> render("#{template}.html", %{ + mfa_token: mfa_token, + redirect_uri: params["redirect_uri"], + state: params["state"] + }) + end + + @doc """ + Verification code and continue authorization. + """ + def verify(conn, %{"mfa" => %{"mfa_token" => mfa_token} = mfa_params} = _) do + with {:ok, %{user: user, authorization: auth}} <- MFA.Token.validate(mfa_token), + {:ok, _} <- validates_challenge(user, mfa_params) do + conn + |> OAuthController.after_create_authorization(auth, %{ + "authorization" => %{ + "redirect_uri" => mfa_params["redirect_uri"], + "state" => mfa_params["state"] + } + }) + else + _ -> + conn + |> put_flash(:error, "Two-factor authentication failed.") + |> put_status(:unauthorized) + |> show(mfa_params) + end + end + + @doc """ + Verification second step of MFA (or recovery) and returns access token. + + ## Endpoint + POST /oauth/mfa/challenge + + params: + `client_id` + `client_secret` + `mfa_token` - access token to check second step of mfa + `challenge_type` - 'totp' or 'recovery' + `code` + + """ + def challenge(conn, %{"mfa_token" => mfa_token} = params) do + with {:ok, app} <- Token.Utils.fetch_app(conn), + {:ok, %{user: user, authorization: auth}} <- MFA.Token.validate(mfa_token), + {:ok, _} <- validates_challenge(user, params), + {:ok, token} <- Token.exchange_token(app, auth) do + json(conn, Token.Response.build(user, token)) + else + _error -> + conn + |> put_status(400) + |> json(%{error: "Invalid code"}) + end + end + + # Verify TOTP Code + defp validates_challenge(user, %{"challenge_type" => "totp", "code" => code} = _) do + TOTPAuthenticator.verify(code, user) + end + + # Verify Recovery Code + defp validates_challenge(user, %{"challenge_type" => "recovery", "code" => code} = _) do + TOTPAuthenticator.verify_recovery_code(user, code) + end + + defp validates_challenge(_, _), do: {:error, :unsupported_challenge_type} +end diff --git a/lib/pleroma/web/oauth/mfa_view.ex b/lib/pleroma/web/oauth/mfa_view.ex new file mode 100644 index 000000000..e88e7066b --- /dev/null +++ b/lib/pleroma/web/oauth/mfa_view.ex @@ -0,0 +1,8 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2019 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.OAuth.MFAView do + use Pleroma.Web, :view + import Phoenix.HTML.Form +end diff --git a/lib/pleroma/web/oauth/oauth_controller.ex b/lib/pleroma/web/oauth/oauth_controller.ex index 46688db7e..7c804233c 100644 --- a/lib/pleroma/web/oauth/oauth_controller.ex +++ b/lib/pleroma/web/oauth/oauth_controller.ex @@ -6,6 +6,7 @@ defmodule Pleroma.Web.OAuth.OAuthController do use Pleroma.Web, :controller alias Pleroma.Helpers.UriHelper + alias Pleroma.MFA alias Pleroma.Plugs.RateLimiter alias Pleroma.Registration alias Pleroma.Repo @@ -14,6 +15,7 @@ defmodule Pleroma.Web.OAuth.OAuthController do alias Pleroma.Web.ControllerHelper alias Pleroma.Web.OAuth.App alias Pleroma.Web.OAuth.Authorization + alias Pleroma.Web.OAuth.MFAController alias Pleroma.Web.OAuth.Scopes alias Pleroma.Web.OAuth.Token alias Pleroma.Web.OAuth.Token.Strategy.RefreshToken @@ -25,6 +27,9 @@ defmodule Pleroma.Web.OAuth.OAuthController do plug(:fetch_session) plug(:fetch_flash) + + plug(:skip_plug, [Pleroma.Plugs.OAuthScopesPlug, Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug]) + plug(RateLimiter, [name: :authentication] when action == :create_authorization) action_fallback(Pleroma.Web.OAuth.FallbackController) @@ -118,7 +123,8 @@ def create_authorization( %{"authorization" => _} = params, opts \\ [] ) do - with {:ok, auth} <- do_create_authorization(conn, params, opts[:user]) do + with {:ok, auth, user} <- do_create_authorization(conn, params, opts[:user]), + {:mfa_required, _, _, false} <- {:mfa_required, user, auth, MFA.require?(user)} do after_create_authorization(conn, auth, params) else error -> @@ -176,6 +182,22 @@ defp handle_create_authorization_error( |> authorize(params) end + defp handle_create_authorization_error( + %Plug.Conn{} = conn, + {:mfa_required, user, auth, _}, + params + ) do + {:ok, token} = MFA.Token.create_token(user, auth) + + data = %{ + "mfa_token" => token.token, + "redirect_uri" => params["authorization"]["redirect_uri"], + "state" => params["authorization"]["state"] + } + + MFAController.show(conn, data) + end + defp handle_create_authorization_error( %Plug.Conn{} = conn, {:account_status, :password_reset_pending}, @@ -228,7 +250,8 @@ def token_exchange(%Plug.Conn{} = conn, %{"grant_type" => "authorization_code"} json(conn, Token.Response.build(user, token, response_attrs)) else - _error -> render_invalid_credentials_error(conn) + error -> + handle_token_exchange_error(conn, error) end end @@ -241,6 +264,7 @@ def token_exchange( {:account_status, :active} <- {:account_status, User.account_status(user)}, {:ok, scopes} <- validate_scopes(app, params), {:ok, auth} <- Authorization.create_authorization(app, user, scopes), + {:mfa_required, _, _, false} <- {:mfa_required, user, auth, MFA.require?(user)}, {:ok, token} <- Token.exchange_token(app, auth) do json(conn, Token.Response.build(user, token)) else @@ -267,13 +291,20 @@ def token_exchange(%Plug.Conn{} = conn, %{"grant_type" => "client_credentials"} {:ok, token} <- Token.exchange_token(app, auth) do json(conn, Token.Response.build_for_client_credentials(token)) else - _error -> render_invalid_credentials_error(conn) + _error -> + handle_token_exchange_error(conn, :invalid_credentails) end end # Bad request def token_exchange(%Plug.Conn{} = conn, params), do: bad_request(conn, params) + defp handle_token_exchange_error(%Plug.Conn{} = conn, {:mfa_required, user, auth, _}) do + conn + |> put_status(:forbidden) + |> json(build_and_response_mfa_token(user, auth)) + end + defp handle_token_exchange_error(%Plug.Conn{} = conn, {:account_status, :deactivated}) do render_error( conn, @@ -431,7 +462,8 @@ def registration_details(%Plug.Conn{} = conn, %{"authorization" => auth_attrs}) def register(%Plug.Conn{} = conn, %{"authorization" => _, "op" => "connect"} = params) do with registration_id when not is_nil(registration_id) <- get_session_registration_id(conn), %Registration{} = registration <- Repo.get(Registration, registration_id), - {_, {:ok, auth}} <- {:create_authorization, do_create_authorization(conn, params)}, + {_, {:ok, auth, _user}} <- + {:create_authorization, do_create_authorization(conn, params)}, %User{} = user <- Repo.preload(auth, :user).user, {:ok, _updated_registration} <- Registration.bind_to_user(registration, user) do conn @@ -497,8 +529,9 @@ defp do_create_authorization( %App{} = app <- Repo.get_by(App, client_id: client_id), true <- redirect_uri in String.split(app.redirect_uris), {:ok, scopes} <- validate_scopes(app, auth_attrs), - {:account_status, :active} <- {:account_status, User.account_status(user)} do - Authorization.create_authorization(app, user, scopes) + {:account_status, :active} <- {:account_status, User.account_status(user)}, + {:ok, auth} <- Authorization.create_authorization(app, user, scopes) do + {:ok, auth, user} end end @@ -512,6 +545,12 @@ defp get_session_registration_id(%Plug.Conn{} = conn), do: get_session(conn, :re defp put_session_registration_id(%Plug.Conn{} = conn, registration_id), do: put_session(conn, :registration_id, registration_id) + defp build_and_response_mfa_token(user, auth) do + with {:ok, token} <- MFA.Token.create_token(user, auth) do + Token.Response.build_for_mfa_token(user, token) + end + end + @spec validate_scopes(App.t(), map()) :: {:ok, list()} | {:error, :missing_scopes | :unsupported_scopes} defp validate_scopes(%App{} = app, params) do diff --git a/lib/pleroma/web/oauth/scopes.ex b/lib/pleroma/web/oauth/scopes.ex index 8ecf901f3..6f06f1431 100644 --- a/lib/pleroma/web/oauth/scopes.ex +++ b/lib/pleroma/web/oauth/scopes.ex @@ -15,9 +15,10 @@ defmodule Pleroma.Web.OAuth.Scopes do Note: `scopes` is used by Mastodon — supporting it but sticking to OAuth's standard `scope` wherever we control it """ - @spec fetch_scopes(map(), list()) :: list() + @spec fetch_scopes(map() | struct(), list()) :: list() + def fetch_scopes(params, default) do - parse_scopes(params["scope"] || params["scopes"], default) + parse_scopes(params["scope"] || params["scopes"] || params[:scopes], default) end def parse_scopes(scopes, _default) when is_list(scopes) do diff --git a/lib/pleroma/web/oauth/token/clean_worker.ex b/lib/pleroma/web/oauth/token/clean_worker.ex new file mode 100644 index 000000000..2c3bb9ded --- /dev/null +++ b/lib/pleroma/web/oauth/token/clean_worker.ex @@ -0,0 +1,38 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2019 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.OAuth.Token.CleanWorker do + @moduledoc """ + The module represents functions to clean an expired OAuth and MFA tokens. + """ + use GenServer + + @ten_seconds 10_000 + @one_day 86_400_000 + + alias Pleroma.MFA + alias Pleroma.Web.OAuth + alias Pleroma.Workers.BackgroundWorker + + def start_link(_), do: GenServer.start_link(__MODULE__, %{}) + + def init(_) do + Process.send_after(self(), :perform, @ten_seconds) + {:ok, nil} + end + + @doc false + def handle_info(:perform, state) do + BackgroundWorker.enqueue("clean_expired_tokens", %{}) + interval = Pleroma.Config.get([:oauth2, :clean_expired_tokens_interval], @one_day) + + Process.send_after(self(), :perform, interval) + {:noreply, state} + end + + def perform(:clean) do + OAuth.Token.delete_expired_tokens() + MFA.Token.delete_expired_tokens() + end +end diff --git a/lib/pleroma/web/oauth/token/response.ex b/lib/pleroma/web/oauth/token/response.ex index 6f4713dee..0e72c31e9 100644 --- a/lib/pleroma/web/oauth/token/response.ex +++ b/lib/pleroma/web/oauth/token/response.ex @@ -5,6 +5,7 @@ defmodule Pleroma.Web.OAuth.Token.Response do @moduledoc false + alias Pleroma.MFA alias Pleroma.User alias Pleroma.Web.OAuth.Token.Utils @@ -32,5 +33,13 @@ def build_for_client_credentials(token) do } end + def build_for_mfa_token(user, mfa_token) do + %{ + error: "mfa_required", + mfa_token: mfa_token.token, + supported_challenge_types: MFA.supported_methods(user) + } + end + defp expires_in, do: Pleroma.Config.get([:oauth2, :token_expires_in], 600) end diff --git a/lib/pleroma/web/ostatus/ostatus_controller.ex b/lib/pleroma/web/ostatus/ostatus_controller.ex index 6fd3cfce5..6971cd9f8 100644 --- a/lib/pleroma/web/ostatus/ostatus_controller.ex +++ b/lib/pleroma/web/ostatus/ostatus_controller.ex @@ -17,7 +17,7 @@ defmodule Pleroma.Web.OStatus.OStatusController do alias Pleroma.Web.Router plug(Pleroma.Plugs.EnsureAuthenticatedPlug, - unless_func: &Pleroma.Web.FederatingPlug.federating?/0 + unless_func: &Pleroma.Web.FederatingPlug.federating?/1 ) plug( diff --git a/lib/pleroma/web/pleroma_api/controllers/account_controller.ex b/lib/pleroma/web/pleroma_api/controllers/account_controller.ex index dcba67d03..07078d415 100644 --- a/lib/pleroma/web/pleroma_api/controllers/account_controller.ex +++ b/lib/pleroma/web/pleroma_api/controllers/account_controller.ex @@ -6,18 +6,30 @@ defmodule Pleroma.Web.PleromaAPI.AccountController do use Pleroma.Web, :controller import Pleroma.Web.ControllerHelper, - only: [json_response: 3, add_link_headers: 2, assign_account_by_id: 2] + only: [json_response: 3, add_link_headers: 2, assign_account_by_id: 2, skip_relationships?: 1] alias Ecto.Changeset + alias Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug alias Pleroma.Plugs.OAuthScopesPlug alias Pleroma.Plugs.RateLimiter alias Pleroma.User alias Pleroma.Web.ActivityPub.ActivityPub - alias Pleroma.Web.CommonAPI alias Pleroma.Web.MastodonAPI.StatusView require Pleroma.Constants + plug( + OpenApiSpex.Plug.PutApiSpec, + [module: Pleroma.Web.ApiSpec] when action == :confirmation_resend + ) + + plug(Pleroma.Web.ApiSpec.CastAndValidate) + + plug( + :skip_plug, + [OAuthScopesPlug, EnsurePublicOrAuthenticatedPlug] when action == :confirmation_resend + ) + plug( OAuthScopesPlug, %{scopes: ["follow", "write:follows"]} when action in [:subscribe, :unsubscribe] @@ -34,21 +46,21 @@ defmodule Pleroma.Web.PleromaAPI.AccountController do ] ) - plug(OAuthScopesPlug, %{scopes: ["read:favourites"]} when action == :favourites) - - # An extra safety measure for possible actions not guarded by OAuth permissions specification plug( - Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug - when action != :confirmation_resend + OAuthScopesPlug, + %{scopes: ["read:favourites"], fallback: :proceed_unauthenticated} when action == :favourites ) plug(RateLimiter, [name: :account_confirmation_resend] when action == :confirmation_resend) + plug(:assign_account_by_id when action in [:favourites, :subscribe, :unsubscribe]) plug(:put_view, Pleroma.Web.MastodonAPI.AccountView) + defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.PleromaAccountOperation + @doc "POST /api/v1/pleroma/accounts/confirmation_resend" def confirmation_resend(conn, params) do - nickname_or_email = params["email"] || params["nickname"] + nickname_or_email = params[:email] || params[:nickname] with %User{} = user <- User.get_by_nickname_or_email(nickname_or_email), {:ok, _} <- User.try_send_confirmation_email(user) do @@ -57,39 +69,33 @@ def confirmation_resend(conn, params) do end @doc "PATCH /api/v1/pleroma/accounts/update_avatar" - def update_avatar(%{assigns: %{user: user}} = conn, %{"img" => ""}) do - {:ok, user} = + def update_avatar(%{assigns: %{user: user}, body_params: %{img: ""}} = conn, _) do + {:ok, _user} = user |> Changeset.change(%{avatar: nil}) |> User.update_and_set_cache() - CommonAPI.update(user) - json(conn, %{url: nil}) end - def update_avatar(%{assigns: %{user: user}} = conn, params) do + def update_avatar(%{assigns: %{user: user}, body_params: params} = conn, _params) do {:ok, %{data: data}} = ActivityPub.upload(params, type: :avatar) - {:ok, user} = user |> Changeset.change(%{avatar: data}) |> User.update_and_set_cache() + {:ok, _user} = user |> Changeset.change(%{avatar: data}) |> User.update_and_set_cache() %{"url" => [%{"href" => href} | _]} = data - CommonAPI.update(user) - json(conn, %{url: href}) end @doc "PATCH /api/v1/pleroma/accounts/update_banner" - def update_banner(%{assigns: %{user: user}} = conn, %{"banner" => ""}) do - with {:ok, user} <- User.update_banner(user, %{}) do - CommonAPI.update(user) + def update_banner(%{assigns: %{user: user}, body_params: %{banner: ""}} = conn, _) do + with {:ok, _user} <- User.update_banner(user, %{}) do json(conn, %{url: nil}) end end - def update_banner(%{assigns: %{user: user}} = conn, params) do - with {:ok, object} <- ActivityPub.upload(%{"img" => params["banner"]}, type: :banner), - {:ok, user} <- User.update_banner(user, object.data) do - CommonAPI.update(user) + def update_banner(%{assigns: %{user: user}, body_params: params} = conn, _) do + with {:ok, object} <- ActivityPub.upload(%{img: params[:banner]}, type: :banner), + {:ok, _user} <- User.update_banner(user, object.data) do %{"url" => [%{"href" => href} | _]} = object.data json(conn, %{url: href}) @@ -97,13 +103,13 @@ def update_banner(%{assigns: %{user: user}} = conn, params) do end @doc "PATCH /api/v1/pleroma/accounts/update_background" - def update_background(%{assigns: %{user: user}} = conn, %{"img" => ""}) do + def update_background(%{assigns: %{user: user}, body_params: %{img: ""}} = conn, _) do with {:ok, _user} <- User.update_background(user, %{}) do json(conn, %{url: nil}) end end - def update_background(%{assigns: %{user: user}} = conn, params) do + def update_background(%{assigns: %{user: user}, body_params: params} = conn, _) do with {:ok, object} <- ActivityPub.upload(params, type: :background), {:ok, _user} <- User.update_background(user, object.data) do %{"url" => [%{"href" => href} | _]} = object.data @@ -120,6 +126,7 @@ def favourites(%{assigns: %{account: %{hide_favorites: true}}} = conn, _params) def favourites(%{assigns: %{user: for_user, account: user}} = conn, params) do params = params + |> Map.new(fn {key, value} -> {to_string(key), value} end) |> Map.put("type", "Create") |> Map.put("favorited_by", user.ap_id) |> Map.put("blocking_user", for_user) @@ -139,7 +146,12 @@ def favourites(%{assigns: %{user: for_user, account: user}} = conn, params) do conn |> add_link_headers(activities) |> put_view(StatusView) - |> render("index.json", activities: activities, for: for_user, as: :activity) + |> render("index.json", + activities: activities, + for: for_user, + as: :activity, + skip_relationships: skip_relationships?(params) + ) end @doc "POST /api/v1/pleroma/accounts/:id/subscribe" diff --git a/lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex b/lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex index 03e95e020..d276b96a4 100644 --- a/lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex +++ b/lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex @@ -1,191 +1,93 @@ defmodule Pleroma.Web.PleromaAPI.EmojiAPIController do use Pleroma.Web, :controller - alias Pleroma.Plugs.OAuthScopesPlug - - require Logger + alias Pleroma.Emoji.Pack plug( - OAuthScopesPlug, + Pleroma.Plugs.OAuthScopesPlug, %{scopes: ["write"], admin: true} when action in [ + :import_from_filesystem, + :remote, + :download, :create, + :update, :delete, - :download_from, - :list_from, - :import_from_fs, + :add_file, :update_file, - :update_metadata + :delete_file ] ) - plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug) + plug( + :skip_plug, + [Pleroma.Plugs.OAuthScopesPlug, Pleroma.Plugs.ExpectPublicOrAuthenticatedCheckPlug] + when action in [:archive, :show, :list] + ) - def emoji_dir_path do - Path.join( - Pleroma.Config.get!([:instance, :static_dir]), - "emoji" - ) - end - - @doc """ - Lists packs from the remote instance. - - Since JS cannot ask remote instances for their packs due to CPS, it has to - be done by the server - """ - def list_from(conn, %{"instance_address" => address}) do - address = String.trim(address) - - if shareable_packs_available(address) do - list_resp = - "#{address}/api/pleroma/emoji/packs" |> Tesla.get!() |> Map.get(:body) |> Jason.decode!() - - json(conn, list_resp) + def remote(conn, %{"url" => url}) do + with {:ok, packs} <- Pack.list_remote(url) do + json(conn, packs) else - conn - |> put_status(:internal_server_error) - |> json(%{error: "The requested instance does not support sharing emoji packs"}) + {:shareable, _} -> + conn + |> put_status(:internal_server_error) + |> json(%{error: "The requested instance does not support sharing emoji packs"}) end end - @doc """ - Lists the packs available on the instance as JSON. + def list(conn, _params) do + emoji_path = + Path.join( + Pleroma.Config.get!([:instance, :static_dir]), + "emoji" + ) - The information is public and does not require authentication. The format is - a map of "pack directory name" to pack.json contents. - """ - def list_packs(conn, _params) do - # Create the directory first if it does not exist. This is probably the first request made - # with the API so it should be sufficient - with {:create_dir, :ok} <- {:create_dir, File.mkdir_p(emoji_dir_path())}, - {:ls, {:ok, results}} <- {:ls, File.ls(emoji_dir_path())} do - pack_infos = - results - |> Enum.filter(&has_pack_json?/1) - |> Enum.map(&load_pack/1) - # Check if all the files are in place and can be sent - |> Enum.map(&validate_pack/1) - # Transform into a map of pack-name => pack-data - |> Enum.into(%{}) - - json(conn, pack_infos) + with {:ok, packs} <- Pack.list_local() do + json(conn, packs) else {:create_dir, {:error, e}} -> conn |> put_status(:internal_server_error) - |> json(%{error: "Failed to create the emoji pack directory at #{emoji_dir_path()}: #{e}"}) + |> json(%{error: "Failed to create the emoji pack directory at #{emoji_path}: #{e}"}) {:ls, {:error, e}} -> conn |> put_status(:internal_server_error) |> json(%{ - error: - "Failed to get the contents of the emoji pack directory at #{emoji_dir_path()}: #{e}" + error: "Failed to get the contents of the emoji pack directory at #{emoji_path}: #{e}" }) end end - defp has_pack_json?(file) do - dir_path = Path.join(emoji_dir_path(), file) - # Filter to only use the pack.json packs - File.dir?(dir_path) and File.exists?(Path.join(dir_path, "pack.json")) - end + def show(conn, %{"name" => name}) do + name = String.trim(name) - defp load_pack(pack_name) do - pack_path = Path.join(emoji_dir_path(), pack_name) - pack_file = Path.join(pack_path, "pack.json") - - {pack_name, Jason.decode!(File.read!(pack_file))} - end - - defp validate_pack({name, pack}) do - pack_path = Path.join(emoji_dir_path(), name) - - if can_download?(pack, pack_path) do - archive_for_sha = make_archive(name, pack, pack_path) - archive_sha = :crypto.hash(:sha256, archive_for_sha) |> Base.encode16() - - pack = - pack - |> put_in(["pack", "can-download"], true) - |> put_in(["pack", "download-sha256"], archive_sha) - - {name, pack} + with {:ok, pack} <- Pack.show(name) do + json(conn, pack) else - {name, put_in(pack, ["pack", "can-download"], false)} + {:loaded, _} -> + conn + |> put_status(:not_found) + |> json(%{error: "Pack #{name} does not exist"}) + + {:error, :empty_values} -> + conn + |> put_status(:bad_request) + |> json(%{error: "pack name cannot be empty"}) end end - defp can_download?(pack, pack_path) do - # If the pack is set as shared, check if it can be downloaded - # That means that when asked, the pack can be packed and sent to the remote - # Otherwise, they'd have to download it from external-src - pack["pack"]["share-files"] && - Enum.all?(pack["files"], fn {_, path} -> - File.exists?(Path.join(pack_path, path)) - end) - end - - defp create_archive_and_cache(name, pack, pack_dir, md5) do - files = - ['pack.json'] ++ - (pack["files"] |> Enum.map(fn {_, path} -> to_charlist(path) end)) - - {:ok, {_, zip_result}} = :zip.zip('#{name}.zip', files, [:memory, cwd: to_charlist(pack_dir)]) - - cache_seconds_per_file = Pleroma.Config.get!([:emoji, :shared_pack_cache_seconds_per_file]) - cache_ms = :timer.seconds(cache_seconds_per_file * Enum.count(files)) - - Cachex.put!( - :emoji_packs_cache, - name, - # if pack.json MD5 changes, the cache is not valid anymore - %{pack_json_md5: md5, pack_data: zip_result}, - # Add a minute to cache time for every file in the pack - ttl: cache_ms - ) - - Logger.debug("Created an archive for the '#{name}' emoji pack, \ -keeping it in cache for #{div(cache_ms, 1000)}s") - - zip_result - end - - defp make_archive(name, pack, pack_dir) do - # Having a different pack.json md5 invalidates cache - pack_file_md5 = :crypto.hash(:md5, File.read!(Path.join(pack_dir, "pack.json"))) - - case Cachex.get!(:emoji_packs_cache, name) do - %{pack_file_md5: ^pack_file_md5, pack_data: zip_result} -> - Logger.debug("Using cache for the '#{name}' shared emoji pack") - zip_result - - _ -> - create_archive_and_cache(name, pack, pack_dir, pack_file_md5) - end - end - - @doc """ - An endpoint for other instances (via admin UI) or users (via browser) - to download packs that the instance shares. - """ - def download_shared(conn, %{"name" => name}) do - pack_dir = Path.join(emoji_dir_path(), name) - pack_file = Path.join(pack_dir, "pack.json") - - with {_, true} <- {:exists?, File.exists?(pack_file)}, - pack = Jason.decode!(File.read!(pack_file)), - {_, true} <- {:can_download?, can_download?(pack, pack_dir)} do - zip_result = make_archive(name, pack, pack_dir) - send_download(conn, {:binary, zip_result}, filename: "#{name}.zip") + def archive(conn, %{"name" => name}) do + with {:ok, archive} <- Pack.get_archive(name) do + send_download(conn, {:binary, archive}, filename: "#{name}.zip") else {:can_download?, _} -> conn |> put_status(:forbidden) |> json(%{ - error: "Pack #{name} cannot be downloaded from this instance, either pack sharing\ - was disabled for this pack or some files are missing" + error: + "Pack #{name} cannot be downloaded from this instance, either pack sharing was disabled for this pack or some files are missing" }) {:exists?, _} -> @@ -195,133 +97,67 @@ def download_shared(conn, %{"name" => name}) do end end - defp shareable_packs_available(address) do - "#{address}/.well-known/nodeinfo" - |> Tesla.get!() - |> Map.get(:body) - |> Jason.decode!() - |> Map.get("links") - |> List.last() - |> Map.get("href") - # Get the actual nodeinfo address and fetch it - |> Tesla.get!() - |> Map.get(:body) - |> Jason.decode!() - |> get_in(["metadata", "features"]) - |> Enum.member?("shareable_emoji_packs") - end - - @doc """ - An admin endpoint to request downloading a pack named `pack_name` from the instance - `instance_address`. - - If the requested instance's admin chose to share the pack, it will be downloaded - from that instance, otherwise it will be downloaded from the fallback source, if there is one. - """ - def download_from(conn, %{"instance_address" => address, "pack_name" => name} = data) do - address = String.trim(address) - - if shareable_packs_available(address) do - full_pack = - "#{address}/api/pleroma/emoji/packs/list" - |> Tesla.get!() - |> Map.get(:body) - |> Jason.decode!() - |> Map.get(name) - - pack_info_res = - case full_pack["pack"] do - %{"share-files" => true, "can-download" => true, "download-sha256" => sha} -> - {:ok, - %{ - sha: sha, - uri: "#{address}/api/pleroma/emoji/packs/download_shared/#{name}" - }} - - %{"fallback-src" => src, "fallback-src-sha256" => sha} when is_binary(src) -> - {:ok, - %{ - sha: sha, - uri: src, - fallback: true - }} - - _ -> - {:error, - "The pack was not set as shared and there is no fallback src to download from"} - end - - with {:ok, %{sha: sha, uri: uri} = pinfo} <- pack_info_res, - %{body: emoji_archive} <- Tesla.get!(uri), - {_, true} <- {:checksum, Base.decode16!(sha) == :crypto.hash(:sha256, emoji_archive)} do - local_name = data["as"] || name - pack_dir = Path.join(emoji_dir_path(), local_name) - File.mkdir_p!(pack_dir) - - files = Enum.map(full_pack["files"], fn {_, path} -> to_charlist(path) end) - # Fallback cannot contain a pack.json file - files = if pinfo[:fallback], do: files, else: ['pack.json'] ++ files - - {:ok, _} = :zip.unzip(emoji_archive, cwd: to_charlist(pack_dir), file_list: files) - - # Fallback can't contain a pack.json file, since that would cause the fallback-src-sha256 - # in it to depend on itself - if pinfo[:fallback] do - pack_file_path = Path.join(pack_dir, "pack.json") - - File.write!(pack_file_path, Jason.encode!(full_pack, pretty: true)) - end - - json(conn, "ok") - else - {:error, e} -> - conn |> put_status(:internal_server_error) |> json(%{error: e}) - - {:checksum, _} -> - conn - |> put_status(:internal_server_error) - |> json(%{error: "SHA256 for the pack doesn't match the one sent by the server"}) - end + def download(conn, %{"url" => url, "name" => name} = params) do + with :ok <- Pack.download(name, url, params["as"]) do + json(conn, "ok") else - conn - |> put_status(:internal_server_error) - |> json(%{error: "The requested instance does not support sharing emoji packs"}) + {:shareable, _} -> + conn + |> put_status(:internal_server_error) + |> json(%{error: "The requested instance does not support sharing emoji packs"}) + + {:checksum, _} -> + conn + |> put_status(:internal_server_error) + |> json(%{error: "SHA256 for the pack doesn't match the one sent by the server"}) + + {:error, e} -> + conn + |> put_status(:internal_server_error) + |> json(%{error: e}) end end - @doc """ - Creates an empty pack named `name` which then can be updated via the admin UI. - """ def create(conn, %{"name" => name}) do - pack_dir = Path.join(emoji_dir_path(), name) + name = String.trim(name) - if not File.exists?(pack_dir) do - File.mkdir_p!(pack_dir) - - pack_file_p = Path.join(pack_dir, "pack.json") - - File.write!( - pack_file_p, - Jason.encode!(%{pack: %{}, files: %{}}, pretty: true) - ) - - conn |> json("ok") + with :ok <- Pack.create(name) do + json(conn, "ok") else - conn - |> put_status(:conflict) - |> json(%{error: "A pack named \"#{name}\" already exists"}) + {:error, :eexist} -> + conn + |> put_status(:conflict) + |> json(%{error: "A pack named \"#{name}\" already exists"}) + + {:error, :empty_values} -> + conn + |> put_status(:bad_request) + |> json(%{error: "pack name cannot be empty"}) + + {:error, _} -> + render_error( + conn, + :internal_server_error, + "Unexpected error occurred while creating pack." + ) end end - @doc """ - Deletes the pack `name` and all it's files. - """ def delete(conn, %{"name" => name}) do - pack_dir = Path.join(emoji_dir_path(), name) + name = String.trim(name) - case File.rm_rf(pack_dir) do - {:ok, _} -> - conn |> json("ok") + with {:ok, deleted} when deleted != [] <- Pack.delete(name) do + json(conn, "ok") + else + {:ok, []} -> + conn + |> put_status(:not_found) + |> json(%{error: "Pack #{name} does not exist"}) + + {:error, :empty_values} -> + conn + |> put_status(:bad_request) + |> json(%{error: "pack name cannot be empty"}) {:error, _, _} -> conn @@ -330,265 +166,128 @@ def delete(conn, %{"name" => name}) do end end - @doc """ - An endpoint to update `pack_names`'s metadata. - - `new_data` is the new metadata for the pack, that will replace the old metadata. - """ - def update_metadata(conn, %{"pack_name" => name, "new_data" => new_data}) do - pack_file_p = Path.join([emoji_dir_path(), name, "pack.json"]) - - full_pack = Jason.decode!(File.read!(pack_file_p)) - - # The new fallback-src is in the new data and it's not the same as it was in the old data - should_update_fb_sha = - not is_nil(new_data["fallback-src"]) and - new_data["fallback-src"] != full_pack["pack"]["fallback-src"] - - with {_, true} <- {:should_update?, should_update_fb_sha}, - %{body: pack_arch} <- Tesla.get!(new_data["fallback-src"]), - {:ok, flist} <- :zip.unzip(pack_arch, [:memory]), - {_, true} <- {:has_all_files?, has_all_files?(full_pack, flist)} do - fallback_sha = :crypto.hash(:sha256, pack_arch) |> Base.encode16() - - new_data = Map.put(new_data, "fallback-src-sha256", fallback_sha) - update_metadata_and_send(conn, full_pack, new_data, pack_file_p) + def update(conn, %{"name" => name, "metadata" => metadata}) do + with {:ok, pack} <- Pack.update_metadata(name, metadata) do + json(conn, pack.pack) else - {:should_update?, _} -> - update_metadata_and_send(conn, full_pack, new_data, pack_file_p) - {:has_all_files?, _} -> conn |> put_status(:bad_request) |> json(%{error: "The fallback archive does not have all files specified in pack.json"}) + + {:error, _} -> + render_error( + conn, + :internal_server_error, + "Unexpected error occurred while updating pack metadata." + ) end end - # Check if all files from the pack.json are in the archive - defp has_all_files?(%{"files" => files}, flist) do - Enum.all?(files, fn {_, from_manifest} -> - Enum.find(flist, fn {from_archive, _} -> - to_string(from_archive) == from_manifest - end) - end) - end + def add_file(conn, %{"name" => name} = params) do + filename = params["filename"] || get_filename(params["file"]) + shortcode = params["shortcode"] || Path.basename(filename, Path.extname(filename)) - defp update_metadata_and_send(conn, full_pack, new_data, pack_file_p) do - full_pack = Map.put(full_pack, "pack", new_data) - File.write!(pack_file_p, Jason.encode!(full_pack, pretty: true)) - - # Send new data back with fallback sha filled - json(conn, new_data) - end - - defp get_filename(%{"filename" => filename}), do: filename - - defp get_filename(%{"file" => file}) do - case file do - %Plug.Upload{filename: filename} -> filename - url when is_binary(url) -> Path.basename(url) - end - end - - defp empty?(str), do: String.trim(str) == "" - - defp update_file_and_send(conn, updated_full_pack, pack_file_p) do - # Write the emoji pack file - File.write!(pack_file_p, Jason.encode!(updated_full_pack, pretty: true)) - - # Return the modified file list - json(conn, updated_full_pack["files"]) - end - - @doc """ - Updates a file in a pack. - - Updating can mean three things: - - - `add` adds an emoji named `shortcode` to the pack `pack_name`, - that means that the emoji file needs to be uploaded with the request - (thus requiring it to be a multipart request) and be named `file`. - There can also be an optional `filename` that will be the new emoji file name - (if it's not there, the name will be taken from the uploaded file). - - `update` changes emoji shortcode (from `shortcode` to `new_shortcode` or moves the file - (from the current filename to `new_filename`) - - `remove` removes the emoji named `shortcode` and it's associated file - """ - - # Add - def update_file( - conn, - %{"pack_name" => pack_name, "action" => "add", "shortcode" => shortcode} = params - ) do - pack_dir = Path.join(emoji_dir_path(), pack_name) - pack_file_p = Path.join(pack_dir, "pack.json") - - full_pack = Jason.decode!(File.read!(pack_file_p)) - - with {_, false} <- {:has_shortcode, Map.has_key?(full_pack["files"], shortcode)}, - filename <- get_filename(params), - false <- empty?(shortcode), - false <- empty?(filename) do - file_path = Path.join(pack_dir, filename) - - # If the name contains directories, create them - if String.contains?(file_path, "/") do - File.mkdir_p!(Path.dirname(file_path)) - end - - case params["file"] do - %Plug.Upload{path: upload_path} -> - # Copy the uploaded file from the temporary directory - File.copy!(upload_path, file_path) - - url when is_binary(url) -> - # Download and write the file - file_contents = Tesla.get!(url).body - File.write!(file_path, file_contents) - end - - updated_full_pack = put_in(full_pack, ["files", shortcode], filename) - update_file_and_send(conn, updated_full_pack, pack_file_p) + with {:ok, pack} <- Pack.add_file(name, shortcode, filename, params["file"]) do + json(conn, pack.files) else - {:has_shortcode, _} -> + {:exists, _} -> conn |> put_status(:conflict) |> json(%{error: "An emoji with the \"#{shortcode}\" shortcode already exists"}) - true -> + {:loaded, _} -> conn |> put_status(:bad_request) - |> json(%{error: "shortcode or filename cannot be empty"}) + |> json(%{error: "pack \"#{name}\" is not found"}) + + {:error, :empty_values} -> + conn + |> put_status(:bad_request) + |> json(%{error: "pack name, shortcode or filename cannot be empty"}) + + {:error, _} -> + render_error( + conn, + :internal_server_error, + "Unexpected error occurred while adding file to pack." + ) end end - # Remove - def update_file(conn, %{ - "pack_name" => pack_name, - "action" => "remove", - "shortcode" => shortcode - }) do - pack_dir = Path.join(emoji_dir_path(), pack_name) - pack_file_p = Path.join(pack_dir, "pack.json") + def update_file(conn, %{"name" => name, "shortcode" => shortcode} = params) do + new_shortcode = params["new_shortcode"] + new_filename = params["new_filename"] + force = params["force"] == true - full_pack = Jason.decode!(File.read!(pack_file_p)) - - if Map.has_key?(full_pack["files"], shortcode) do - {emoji_file_path, updated_full_pack} = pop_in(full_pack, ["files", shortcode]) - - emoji_file_path = Path.join(pack_dir, emoji_file_path) - - # Delete the emoji file - File.rm!(emoji_file_path) - - # If the old directory has no more files, remove it - if String.contains?(emoji_file_path, "/") do - dir = Path.dirname(emoji_file_path) - - if Enum.empty?(File.ls!(dir)) do - File.rmdir!(dir) - end - end - - update_file_and_send(conn, updated_full_pack, pack_file_p) + with {:ok, pack} <- Pack.update_file(name, shortcode, new_shortcode, new_filename, force) do + json(conn, pack.files) else - conn - |> put_status(:bad_request) - |> json(%{error: "Emoji \"#{shortcode}\" does not exist"}) - end - end - - # Update - def update_file( - conn, - %{"pack_name" => pack_name, "action" => "update", "shortcode" => shortcode} = params - ) do - pack_dir = Path.join(emoji_dir_path(), pack_name) - pack_file_p = Path.join(pack_dir, "pack.json") - - full_pack = Jason.decode!(File.read!(pack_file_p)) - - with {_, true} <- {:has_shortcode, Map.has_key?(full_pack["files"], shortcode)}, - %{"new_shortcode" => new_shortcode, "new_filename" => new_filename} <- params, - false <- empty?(new_shortcode), - false <- empty?(new_filename) do - # First, remove the old shortcode, saving the old path - {old_emoji_file_path, updated_full_pack} = pop_in(full_pack, ["files", shortcode]) - old_emoji_file_path = Path.join(pack_dir, old_emoji_file_path) - new_emoji_file_path = Path.join(pack_dir, new_filename) - - # If the name contains directories, create them - if String.contains?(new_emoji_file_path, "/") do - File.mkdir_p!(Path.dirname(new_emoji_file_path)) - end - - # Move/Rename the old filename to a new filename - # These are probably on the same filesystem, so just rename should work - :ok = File.rename(old_emoji_file_path, new_emoji_file_path) - - # If the old directory has no more files, remove it - if String.contains?(old_emoji_file_path, "/") do - dir = Path.dirname(old_emoji_file_path) - - if Enum.empty?(File.ls!(dir)) do - File.rmdir!(dir) - end - end - - # Then, put in the new shortcode with the new path - updated_full_pack = put_in(updated_full_pack, ["files", new_shortcode], new_filename) - update_file_and_send(conn, updated_full_pack, pack_file_p) - else - {:has_shortcode, _} -> + {:exists, _} -> conn |> put_status(:bad_request) |> json(%{error: "Emoji \"#{shortcode}\" does not exist"}) - true -> + {:not_used, _} -> + conn + |> put_status(:conflict) + |> json(%{ + error: + "New shortcode \"#{new_shortcode}\" is already used. If you want to override emoji use 'force' option" + }) + + {:loaded, _} -> + conn + |> put_status(:bad_request) + |> json(%{error: "pack \"#{name}\" is not found"}) + + {:error, :empty_values} -> conn |> put_status(:bad_request) |> json(%{error: "new_shortcode or new_filename cannot be empty"}) - _ -> - conn - |> put_status(:bad_request) - |> json(%{error: "new_shortcode or new_file were not specified"}) + {:error, _} -> + render_error( + conn, + :internal_server_error, + "Unexpected error occurred while updating file in pack." + ) end end - def update_file(conn, %{"action" => action}) do - conn - |> put_status(:bad_request) - |> json(%{error: "Unknown action: #{action}"}) + def delete_file(conn, %{"name" => name, "shortcode" => shortcode}) do + with {:ok, pack} <- Pack.delete_file(name, shortcode) do + json(conn, pack.files) + else + {:exists, _} -> + conn + |> put_status(:bad_request) + |> json(%{error: "Emoji \"#{shortcode}\" does not exist"}) + + {:loaded, _} -> + conn + |> put_status(:bad_request) + |> json(%{error: "pack \"#{name}\" is not found"}) + + {:error, :empty_values} -> + conn + |> put_status(:bad_request) + |> json(%{error: "pack name or shortcode cannot be empty"}) + + {:error, _} -> + render_error( + conn, + :internal_server_error, + "Unexpected error occurred while removing file from pack." + ) + end end - @doc """ - Imports emoji from the filesystem. - - Importing means checking all the directories in the - `$instance_static/emoji/` for directories which do not have - `pack.json`. If one has an emoji.txt file, that file will be used - to create a `pack.json` file with it's contents. If the directory has - neither, all the files with specific configured extenstions will be - assumed to be emojis and stored in the new `pack.json` file. - """ - def import_from_fs(conn, _params) do - emoji_path = emoji_dir_path() - - with {:ok, %{access: :read_write}} <- File.stat(emoji_path), - {:ok, results} <- File.ls(emoji_path) do - imported_pack_names = - results - |> Enum.filter(fn file -> - dir_path = Path.join(emoji_path, file) - # Find the directories that do NOT have pack.json - File.dir?(dir_path) and not File.exists?(Path.join(dir_path, "pack.json")) - end) - |> Enum.map(&write_pack_json_contents/1) - - json(conn, imported_pack_names) + def import_from_filesystem(conn, _params) do + with {:ok, names} <- Pack.import_from_filesystem() do + json(conn, names) else - {:ok, %{access: _}} -> + {:error, :no_read_write} -> conn |> put_status(:internal_server_error) |> json(%{error: "Error: emoji pack directory must be writable"}) @@ -600,44 +299,6 @@ def import_from_fs(conn, _params) do end end - defp write_pack_json_contents(dir) do - dir_path = Path.join(emoji_dir_path(), dir) - emoji_txt_path = Path.join(dir_path, "emoji.txt") - - files_for_pack = files_for_pack(emoji_txt_path, dir_path) - pack_json_contents = Jason.encode!(%{pack: %{}, files: files_for_pack}) - - File.write!(Path.join(dir_path, "pack.json"), pack_json_contents) - - dir - end - - defp files_for_pack(emoji_txt_path, dir_path) do - if File.exists?(emoji_txt_path) do - # There's an emoji.txt file, it's likely from a pack installed by the pack manager. - # Make a pack.json file from the contents of that emoji.txt fileh - - # FIXME: Copy-pasted from Pleroma.Emoji/load_from_file_stream/2 - - # Create a map of shortcodes to filenames from emoji.txt - File.read!(emoji_txt_path) - |> String.split("\n") - |> Enum.map(&String.trim/1) - |> Enum.map(fn line -> - case String.split(line, ~r/,\s*/) do - # This matches both strings with and without tags - # and we don't care about tags here - [name, file | _] -> {name, file} - _ -> nil - end - end) - |> Enum.filter(fn x -> not is_nil(x) end) - |> Enum.into(%{}) - else - # If there's no emoji.txt, assume all files - # that are of certain extensions from the config are emojis and import them all - pack_extensions = Pleroma.Config.get!([:emoji, :pack_extensions]) - Pleroma.Emoji.Loader.make_shortcode_to_file_map(dir_path, pack_extensions) - end - end + defp get_filename(%Plug.Upload{filename: filename}), do: filename + defp get_filename(url) when is_binary(url), do: Path.basename(url) end diff --git a/lib/pleroma/web/pleroma_api/controllers/mascot_controller.ex b/lib/pleroma/web/pleroma_api/controllers/mascot_controller.ex index d9c1c8636..d4e0d8b7c 100644 --- a/lib/pleroma/web/pleroma_api/controllers/mascot_controller.ex +++ b/lib/pleroma/web/pleroma_api/controllers/mascot_controller.ex @@ -12,8 +12,6 @@ defmodule Pleroma.Web.PleromaAPI.MascotController do plug(OAuthScopesPlug, %{scopes: ["read:accounts"]} when action == :show) plug(OAuthScopesPlug, %{scopes: ["write:accounts"]} when action != :show) - plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug) - @doc "GET /api/v1/pleroma/mascot" def show(%{assigns: %{user: user}} = conn, _params) do json(conn, User.get_mascot(user)) diff --git a/lib/pleroma/web/pleroma_api/controllers/pleroma_api_controller.ex b/lib/pleroma/web/pleroma_api/controllers/pleroma_api_controller.ex index dae7f0f2f..8bc77b75e 100644 --- a/lib/pleroma/web/pleroma_api/controllers/pleroma_api_controller.ex +++ b/lib/pleroma/web/pleroma_api/controllers/pleroma_api_controller.ex @@ -5,7 +5,7 @@ defmodule Pleroma.Web.PleromaAPI.PleromaAPIController do use Pleroma.Web, :controller - import Pleroma.Web.ControllerHelper, only: [add_link_headers: 2] + import Pleroma.Web.ControllerHelper, only: [add_link_headers: 2, skip_relationships?: 1] alias Pleroma.Activity alias Pleroma.Conversation.Participation @@ -26,6 +26,12 @@ defmodule Pleroma.Web.PleromaAPI.PleromaAPIController do when action in [:conversation, :conversation_statuses] ) + plug( + OAuthScopesPlug, + %{scopes: ["read:statuses"], fallback: :proceed_unauthenticated} + when action == :emoji_reactions_by + ) + plug( OAuthScopesPlug, %{scopes: ["write:statuses"]} @@ -34,12 +40,14 @@ defmodule Pleroma.Web.PleromaAPI.PleromaAPIController do plug( OAuthScopesPlug, - %{scopes: ["write:conversations"]} when action == :update_conversation + %{scopes: ["write:conversations"]} + when action in [:update_conversation, :mark_conversations_as_read] ) - plug(OAuthScopesPlug, %{scopes: ["write:notifications"]} when action == :read_notification) - - plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug) + plug( + OAuthScopesPlug, + %{scopes: ["write:notifications"]} when action == :mark_notifications_as_read + ) def emoji_reactions_by(%{assigns: %{user: user}} = conn, %{"id" => activity_id} = params) do with %Activity{} = activity <- Activity.get_by_id_with_object(activity_id), @@ -53,7 +61,10 @@ def emoji_reactions_by(%{assigns: %{user: user}} = conn, %{"id" => activity_id} else users = Enum.map(user_ap_ids, &User.get_cached_by_ap_id/1) - |> Enum.filter(& &1) + |> Enum.filter(fn + %{deactivated: false} -> true + _ -> false + end) %{ name: emoji, @@ -75,7 +86,7 @@ def emoji_reactions_by(%{assigns: %{user: user}} = conn, %{"id" => activity_id} end def react_with_emoji(%{assigns: %{user: user}} = conn, %{"id" => activity_id, "emoji" => emoji}) do - with {:ok, _activity, _object} <- CommonAPI.react_with_emoji(activity_id, user, emoji), + with {:ok, _activity} <- CommonAPI.react_with_emoji(activity_id, user, emoji), activity <- Activity.get_by_id(activity_id) do conn |> put_view(StatusView) @@ -87,7 +98,8 @@ def unreact_with_emoji(%{assigns: %{user: user}} = conn, %{ "id" => activity_id, "emoji" => emoji }) do - with {:ok, _activity, _object} <- CommonAPI.unreact_with_emoji(activity_id, user, emoji), + with {:ok, _activity} <- + CommonAPI.unreact_with_emoji(activity_id, user, emoji), activity <- Activity.get_by_id(activity_id) do conn |> put_view(StatusView) @@ -110,12 +122,11 @@ def conversation(%{assigns: %{user: user}} = conn, %{"id" => participation_id}) end def conversation_statuses( - %{assigns: %{user: user}} = conn, + %{assigns: %{user: %{id: user_id} = user}} = conn, %{"id" => participation_id} = params ) do - with %Participation{} = participation <- - Participation.get(participation_id, preload: [:conversation]), - true <- user.id == participation.user_id do + with %Participation{user_id: ^user_id} = participation <- + Participation.get(participation_id, preload: [:conversation]) do params = params |> Map.put("blocking_user", user) @@ -124,13 +135,19 @@ def conversation_statuses( activities = participation.conversation.ap_id - |> ActivityPub.fetch_activities_for_context(params) + |> ActivityPub.fetch_activities_for_context_query(params) + |> Pleroma.Pagination.fetch_paginated(Map.put(params, "total", false)) |> Enum.reverse() conn |> add_link_headers(activities) |> put_view(StatusView) - |> render("index.json", %{activities: activities, for: user, as: :activity}) + |> render("index.json", + activities: activities, + for: user, + as: :activity, + skip_relationships: skip_relationships?(params) + ) else _error -> conn @@ -162,7 +179,7 @@ def update_conversation( end end - def read_conversations(%{assigns: %{user: user}} = conn, _params) do + def mark_conversations_as_read(%{assigns: %{user: user}} = conn, _params) do with {:ok, _, participations} <- Participation.mark_all_as_read(user) do conn |> add_link_headers(participations) @@ -171,7 +188,7 @@ def read_conversations(%{assigns: %{user: user}} = conn, _params) do end end - def read_notification(%{assigns: %{user: user}} = conn, %{"id" => notification_id}) do + def mark_notifications_as_read(%{assigns: %{user: user}} = conn, %{"id" => notification_id}) do with {:ok, notification} <- Notification.read_one(user, notification_id) do conn |> put_view(NotificationView) @@ -184,13 +201,17 @@ def read_notification(%{assigns: %{user: user}} = conn, %{"id" => notification_i end end - def read_notification(%{assigns: %{user: user}} = conn, %{"max_id" => max_id}) do + def mark_notifications_as_read(%{assigns: %{user: user}} = conn, %{"max_id" => max_id} = params) do with notifications <- Notification.set_read_up_to(user, max_id) do notifications = Enum.take(notifications, 80) conn |> put_view(NotificationView) - |> render("index.json", %{notifications: notifications, for: user}) + |> render("index.json", + notifications: notifications, + for: user, + skip_relationships: skip_relationships?(params) + ) end end end diff --git a/lib/pleroma/web/pleroma_api/controllers/scrobble_controller.ex b/lib/pleroma/web/pleroma_api/controllers/scrobble_controller.ex index 4463ec477..22da6c0ad 100644 --- a/lib/pleroma/web/pleroma_api/controllers/scrobble_controller.ex +++ b/lib/pleroma/web/pleroma_api/controllers/scrobble_controller.ex @@ -13,10 +13,12 @@ defmodule Pleroma.Web.PleromaAPI.ScrobbleController do alias Pleroma.Web.CommonAPI alias Pleroma.Web.MastodonAPI.StatusView - plug(OAuthScopesPlug, %{scopes: ["read"]} when action == :user_scrobbles) - plug(OAuthScopesPlug, %{scopes: ["write"]} when action != :user_scrobbles) + plug( + OAuthScopesPlug, + %{scopes: ["read"], fallback: :proceed_unauthenticated} when action == :user_scrobbles + ) - plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug) + plug(OAuthScopesPlug, %{scopes: ["write"]} when action != :user_scrobbles) def new_scrobble(%{assigns: %{user: user}} = conn, %{"title" => _} = params) do params = diff --git a/lib/pleroma/web/pleroma_api/controllers/two_factor_authentication_controller.ex b/lib/pleroma/web/pleroma_api/controllers/two_factor_authentication_controller.ex new file mode 100644 index 000000000..eb9989cdf --- /dev/null +++ b/lib/pleroma/web/pleroma_api/controllers/two_factor_authentication_controller.ex @@ -0,0 +1,133 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2019 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.PleromaAPI.TwoFactorAuthenticationController do + @moduledoc "The module represents actions to manage MFA" + use Pleroma.Web, :controller + + import Pleroma.Web.ControllerHelper, only: [json_response: 3] + + alias Pleroma.MFA + alias Pleroma.MFA.TOTP + alias Pleroma.Plugs.OAuthScopesPlug + alias Pleroma.Web.CommonAPI.Utils + + plug(OAuthScopesPlug, %{scopes: ["read:security"]} when action in [:settings]) + + plug( + OAuthScopesPlug, + %{scopes: ["write:security"]} when action in [:setup, :confirm, :disable, :backup_codes] + ) + + @doc """ + Gets user multi factor authentication settings + + ## Endpoint + GET /api/pleroma/accounts/mfa + + """ + def settings(%{assigns: %{user: user}} = conn, _params) do + json(conn, %{settings: MFA.mfa_settings(user)}) + end + + @doc """ + Prepare setup mfa method + + ## Endpoint + GET /api/pleroma/accounts/mfa/setup/[:method] + + """ + def setup(%{assigns: %{user: user}} = conn, %{"method" => "totp"} = _params) do + with {:ok, user} <- MFA.setup_totp(user), + %{secret: secret} = _ <- user.multi_factor_authentication_settings.totp do + provisioning_uri = TOTP.provisioning_uri(secret, "#{user.email}") + + json(conn, %{provisioning_uri: provisioning_uri, key: secret}) + else + {:error, message} -> + json_response(conn, :unprocessable_entity, %{error: message}) + end + end + + def setup(conn, _params) do + json_response(conn, :bad_request, %{error: "undefined method"}) + end + + @doc """ + Confirms setup and enable mfa method + + ## Endpoint + POST /api/pleroma/accounts/mfa/confirm/:method + + - params: + `code` - confirmation code + `password` - current password + """ + def confirm( + %{assigns: %{user: user}} = conn, + %{"method" => "totp", "password" => _, "code" => _} = params + ) do + with {:ok, _user} <- Utils.confirm_current_password(user, params["password"]), + {:ok, _user} <- MFA.confirm_totp(user, params) do + json(conn, %{}) + else + {:error, message} -> + json_response(conn, :unprocessable_entity, %{error: message}) + end + end + + def confirm(conn, _) do + json_response(conn, :bad_request, %{error: "undefined mfa method"}) + end + + @doc """ + Disable mfa method and disable mfa if need. + """ + def disable(%{assigns: %{user: user}} = conn, %{"method" => "totp"} = params) do + with {:ok, user} <- Utils.confirm_current_password(user, params["password"]), + {:ok, _user} <- MFA.disable_totp(user) do + json(conn, %{}) + else + {:error, message} -> + json_response(conn, :unprocessable_entity, %{error: message}) + end + end + + def disable(%{assigns: %{user: user}} = conn, %{"method" => "mfa"} = params) do + with {:ok, user} <- Utils.confirm_current_password(user, params["password"]), + {:ok, _user} <- MFA.disable(user) do + json(conn, %{}) + else + {:error, message} -> + json_response(conn, :unprocessable_entity, %{error: message}) + end + end + + def disable(conn, _) do + json_response(conn, :bad_request, %{error: "undefined mfa method"}) + end + + @doc """ + Generates backup codes. + + ## Endpoint + GET /api/pleroma/accounts/mfa/backup_codes + + ## Response + ### Success + `{codes: [codes]}` + + ### Error + `{error: [error_message]}` + + """ + def backup_codes(%{assigns: %{user: user}} = conn, _params) do + with {:ok, codes} <- MFA.generate_backup_codes(user) do + json(conn, %{codes: codes}) + else + {:error, message} -> + json_response(conn, :unprocessable_entity, %{error: message}) + end + end +end diff --git a/lib/pleroma/web/push/impl.ex b/lib/pleroma/web/push/impl.ex index afa510f08..691725702 100644 --- a/lib/pleroma/web/push/impl.ex +++ b/lib/pleroma/web/push/impl.ex @@ -16,6 +16,8 @@ defmodule Pleroma.Web.Push.Impl do require Logger import Ecto.Query + defdelegate mastodon_notification_type(activity), to: Activity + @types ["Create", "Follow", "Announce", "Like", "Move"] @doc "Performs sending notifications for user subscriptions" @@ -24,40 +26,41 @@ def perform( %{ activity: %{data: %{"type" => activity_type}} = activity, user: %User{id: user_id} - } = notif + } = notification ) when activity_type in @types do - actor = User.get_cached_by_ap_id(notif.activity.data["actor"]) + actor = User.get_cached_by_ap_id(notification.activity.data["actor"]) - type = Activity.mastodon_notification_type(notif.activity) + mastodon_type = mastodon_notification_type(notification.activity) gcm_api_key = Application.get_env(:web_push_encryption, :gcm_api_key) avatar_url = User.avatar_url(actor) object = Object.normalize(activity) user = User.get_cached_by_id(user_id) direct_conversation_id = Activity.direct_conversation_id(activity, user) - for subscription <- fetch_subsriptions(user_id), - get_in(subscription.data, ["alerts", type]) do + for subscription <- fetch_subscriptions(user_id), + Subscription.enabled?(subscription, mastodon_type) do %{ access_token: subscription.token.token, - notification_id: notif.id, - notification_type: type, + notification_id: notification.id, + notification_type: mastodon_type, icon: avatar_url, preferred_locale: "en", pleroma: %{ - activity_id: notif.activity.id, + activity_id: notification.activity.id, direct_conversation_id: direct_conversation_id } } - |> Map.merge(build_content(notif, actor, object)) + |> Map.merge(build_content(notification, actor, object, mastodon_type)) |> Jason.encode!() |> push_message(build_sub(subscription), gcm_api_key, subscription) end + |> (&{:ok, &1}).() end def perform(_) do Logger.warn("Unknown notification type") - :error + {:error, :unknown_type} end @doc "Push message to web" @@ -82,7 +85,7 @@ def push_message(body, sub, api_key, subscription) do end @doc "Gets user subscriptions" - def fetch_subsriptions(user_id) do + def fetch_subscriptions(user_id) do Subscription |> where(user_id: ^user_id) |> preload(:token) @@ -99,28 +102,35 @@ def build_sub(subscription) do } end + def build_content(notification, actor, object, mastodon_type \\ nil) + def build_content( %{ - activity: %{data: %{"directMessage" => true}}, user: %{notification_settings: %{privacy_option: true}} - }, - actor, - _ + } = notification, + _actor, + _object, + mastodon_type ) do - %{title: "New Direct Message", body: "@#{actor.nickname}"} + %{body: format_title(notification, mastodon_type)} end - def build_content(notif, actor, object) do + def build_content(notification, actor, object, mastodon_type) do + mastodon_type = mastodon_type || mastodon_notification_type(notification.activity) + %{ - title: format_title(notif), - body: format_body(notif, actor, object) + title: format_title(notification, mastodon_type), + body: format_body(notification, actor, object, mastodon_type) } end + def format_body(activity, actor, object, mastodon_type \\ nil) + def format_body( %{activity: %{data: %{"type" => "Create"}}}, actor, - %{data: %{"content" => content}} + %{data: %{"content" => content}}, + _mastodon_type ) do "@#{actor.nickname}: #{Utils.scrub_html_and_truncate(content, 80)}" end @@ -128,33 +138,44 @@ def format_body( def format_body( %{activity: %{data: %{"type" => "Announce"}}}, actor, - %{data: %{"content" => content}} + %{data: %{"content" => content}}, + _mastodon_type ) do "@#{actor.nickname} repeated: #{Utils.scrub_html_and_truncate(content, 80)}" end def format_body( - %{activity: %{data: %{"type" => type}}}, + %{activity: %{data: %{"type" => type}}} = notification, actor, - _object + _object, + mastodon_type ) when type in ["Follow", "Like"] do - case type do - "Follow" -> "@#{actor.nickname} has followed you" - "Like" -> "@#{actor.nickname} has favorited your post" + mastodon_type = mastodon_type || mastodon_notification_type(notification.activity) + + case mastodon_type do + "follow" -> "@#{actor.nickname} has followed you" + "follow_request" -> "@#{actor.nickname} has requested to follow you" + "favourite" -> "@#{actor.nickname} has favorited your post" end end - def format_title(%{activity: %{data: %{"directMessage" => true}}}) do + def format_title(activity, mastodon_type \\ nil) + + def format_title(%{activity: %{data: %{"directMessage" => true}}}, _mastodon_type) do "New Direct Message" end - def format_title(%{activity: %{data: %{"type" => type}}}) do - case type do - "Create" -> "New Mention" - "Follow" -> "New Follower" - "Announce" -> "New Repeat" - "Like" -> "New Favorite" + def format_title(%{activity: activity}, mastodon_type) do + mastodon_type = mastodon_type || mastodon_notification_type(activity) + + case mastodon_type do + "mention" -> "New Mention" + "follow" -> "New Follower" + "follow_request" -> "New Follow Request" + "reblog" -> "New Repeat" + "favourite" -> "New Favorite" + type -> "New #{String.capitalize(type || "event")}" end end end diff --git a/lib/pleroma/web/push/subscription.ex b/lib/pleroma/web/push/subscription.ex index 5c448d6c9..3e401a490 100644 --- a/lib/pleroma/web/push/subscription.ex +++ b/lib/pleroma/web/push/subscription.ex @@ -25,20 +25,28 @@ defmodule Pleroma.Web.Push.Subscription do timestamps() end - @supported_alert_types ~w[follow favourite mention reblog] + @supported_alert_types ~w[follow favourite mention reblog]a - defp alerts(%{"data" => %{"alerts" => alerts}}) do + defp alerts(%{data: %{alerts: alerts}}) do alerts = Map.take(alerts, @supported_alert_types) %{"alerts" => alerts} end + def enabled?(subscription, "follow_request") do + enabled?(subscription, "follow") + end + + def enabled?(subscription, alert_type) do + get_in(subscription.data, ["alerts", alert_type]) + end + def create( %User{} = user, %Token{} = token, %{ - "subscription" => %{ - "endpoint" => endpoint, - "keys" => %{"auth" => key_auth, "p256dh" => key_p256dh} + subscription: %{ + endpoint: endpoint, + keys: %{auth: key_auth, p256dh: key_p256dh} } } = params ) do diff --git a/lib/pleroma/web/rel_me.ex b/lib/pleroma/web/rel_me.ex index e97c398dc..8e2b51508 100644 --- a/lib/pleroma/web/rel_me.ex +++ b/lib/pleroma/web/rel_me.ex @@ -3,11 +3,9 @@ # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.Web.RelMe do - @hackney_options [ + @options [ pool: :media, - recv_timeout: 2_000, - max_body: 2_000_000, - with_body: true + max_body: 2_000_000 ] if Pleroma.Config.get(:env) == :test do @@ -25,8 +23,18 @@ def parse(url) when is_binary(url) do def parse(_), do: {:error, "No URL provided"} defp parse_url(url) do + opts = + if Application.get_env(:tesla, :adapter) == Tesla.Adapter.Hackney do + Keyword.merge(@options, + recv_timeout: 2_000, + with_body: true + ) + else + @options + end + with {:ok, %Tesla.Env{body: html, status: status}} when status in 200..299 <- - Pleroma.HTTP.get(url, [], adapter: @hackney_options), + Pleroma.HTTP.get(url, [], adapter: opts), {:ok, html_tree} <- Floki.parse_document(html), data <- Floki.attribute(html_tree, "link[rel~=me]", "href") ++ diff --git a/lib/pleroma/web/rich_media/helpers.ex b/lib/pleroma/web/rich_media/helpers.ex index 0314535d2..9d3d7f978 100644 --- a/lib/pleroma/web/rich_media/helpers.ex +++ b/lib/pleroma/web/rich_media/helpers.ex @@ -64,5 +64,8 @@ def fetch_data_for_activity(%Activity{data: %{"type" => "Create"}} = activity) d def fetch_data_for_activity(_), do: %{} - def perform(:fetch, %Activity{} = activity), do: fetch_data_for_activity(activity) + def perform(:fetch, %Activity{} = activity) do + fetch_data_for_activity(activity) + :ok + end end diff --git a/lib/pleroma/web/rich_media/parser.ex b/lib/pleroma/web/rich_media/parser.ex index 0779065ee..40980def8 100644 --- a/lib/pleroma/web/rich_media/parser.ex +++ b/lib/pleroma/web/rich_media/parser.ex @@ -3,11 +3,9 @@ # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.Web.RichMedia.Parser do - @hackney_options [ + @options [ pool: :media, - recv_timeout: 2_000, - max_body: 2_000_000, - with_body: true + max_body: 2_000_000 ] defp parsers do @@ -77,8 +75,18 @@ defp get_ttl_from_image(data, url) do end defp parse_url(url) do + opts = + if Application.get_env(:tesla, :adapter) == Tesla.Adapter.Hackney do + Keyword.merge(@options, + recv_timeout: 2_000, + with_body: true + ) + else + @options + end + try do - {:ok, %Tesla.Env{body: html}} = Pleroma.HTTP.get(url, [], adapter: @hackney_options) + {:ok, %Tesla.Env{body: html}} = Pleroma.HTTP.get(url, [], adapter: opts) html |> parse_html() diff --git a/lib/pleroma/web/router.ex b/lib/pleroma/web/router.ex index 322b074c2..82cfec7bb 100644 --- a/lib/pleroma/web/router.ex +++ b/lib/pleroma/web/router.ex @@ -16,75 +16,70 @@ defmodule Pleroma.Web.Router do plug(Pleroma.Plugs.UserEnabledPlug) end - pipeline :api do - plug(:accepts, ["json"]) - plug(:fetch_session) + pipeline :expect_authentication do + plug(Pleroma.Plugs.ExpectAuthenticatedCheckPlug) + end + + pipeline :expect_public_instance_or_authentication do + plug(Pleroma.Plugs.ExpectPublicOrAuthenticatedCheckPlug) + end + + pipeline :authenticate do plug(Pleroma.Plugs.OAuthPlug) plug(Pleroma.Plugs.BasicAuthDecoderPlug) plug(Pleroma.Plugs.UserFetcherPlug) plug(Pleroma.Plugs.SessionAuthenticationPlug) plug(Pleroma.Plugs.LegacyAuthenticationPlug) plug(Pleroma.Plugs.AuthenticationPlug) + end + + pipeline :after_auth do plug(Pleroma.Plugs.UserEnabledPlug) plug(Pleroma.Plugs.SetUserSessionIdPlug) plug(Pleroma.Plugs.EnsureUserKeyPlug) + end + + pipeline :base_api do + plug(:accepts, ["json"]) + plug(:fetch_session) + plug(:authenticate) + plug(OpenApiSpex.Plug.PutApiSpec, module: Pleroma.Web.ApiSpec) + end + + pipeline :api do + plug(:expect_public_instance_or_authentication) + plug(:base_api) + plug(:after_auth) plug(Pleroma.Plugs.IdempotencyPlug) end pipeline :authenticated_api do - plug(:accepts, ["json"]) - plug(:fetch_session) - plug(Pleroma.Plugs.OAuthPlug) - plug(Pleroma.Plugs.BasicAuthDecoderPlug) - plug(Pleroma.Plugs.UserFetcherPlug) - plug(Pleroma.Plugs.SessionAuthenticationPlug) - plug(Pleroma.Plugs.LegacyAuthenticationPlug) - plug(Pleroma.Plugs.AuthenticationPlug) - plug(Pleroma.Plugs.UserEnabledPlug) - plug(Pleroma.Plugs.SetUserSessionIdPlug) + plug(:expect_authentication) + plug(:base_api) + plug(:after_auth) plug(Pleroma.Plugs.EnsureAuthenticatedPlug) plug(Pleroma.Plugs.IdempotencyPlug) end pipeline :admin_api do - plug(:accepts, ["json"]) - plug(:fetch_session) - plug(Pleroma.Plugs.OAuthPlug) - plug(Pleroma.Plugs.BasicAuthDecoderPlug) - plug(Pleroma.Plugs.UserFetcherPlug) - plug(Pleroma.Plugs.SessionAuthenticationPlug) - plug(Pleroma.Plugs.LegacyAuthenticationPlug) - plug(Pleroma.Plugs.AuthenticationPlug) + plug(:expect_authentication) + plug(:base_api) plug(Pleroma.Plugs.AdminSecretAuthenticationPlug) - plug(Pleroma.Plugs.UserEnabledPlug) - plug(Pleroma.Plugs.SetUserSessionIdPlug) + plug(:after_auth) plug(Pleroma.Plugs.EnsureAuthenticatedPlug) plug(Pleroma.Plugs.UserIsAdminPlug) plug(Pleroma.Plugs.IdempotencyPlug) end pipeline :mastodon_html do - plug(:accepts, ["html"]) - plug(:fetch_session) - plug(Pleroma.Plugs.OAuthPlug) - plug(Pleroma.Plugs.BasicAuthDecoderPlug) - plug(Pleroma.Plugs.UserFetcherPlug) - plug(Pleroma.Plugs.SessionAuthenticationPlug) - plug(Pleroma.Plugs.LegacyAuthenticationPlug) - plug(Pleroma.Plugs.AuthenticationPlug) - plug(Pleroma.Plugs.UserEnabledPlug) - plug(Pleroma.Plugs.SetUserSessionIdPlug) - plug(Pleroma.Plugs.EnsureUserKeyPlug) + plug(:browser) + plug(:authenticate) + plug(:after_auth) end pipeline :pleroma_html do - plug(:accepts, ["html"]) - plug(:fetch_session) - plug(Pleroma.Plugs.OAuthPlug) - plug(Pleroma.Plugs.BasicAuthDecoderPlug) - plug(Pleroma.Plugs.UserFetcherPlug) - plug(Pleroma.Plugs.SessionAuthenticationPlug) - plug(Pleroma.Plugs.AuthenticationPlug) + plug(:browser) + plug(:authenticate) plug(Pleroma.Plugs.EnsureUserKeyPlug) end @@ -94,10 +89,12 @@ defmodule Pleroma.Web.Router do pipeline :config do plug(:accepts, ["json", "xml"]) + plug(OpenApiSpex.Plug.PutApiSpec, module: Pleroma.Web.ApiSpec) end pipeline :pleroma_api do plug(:accepts, ["html", "json"]) + plug(OpenApiSpex.Plug.PutApiSpec, module: Pleroma.Web.ApiSpec) end pipeline :mailbox_preview do @@ -135,6 +132,7 @@ defmodule Pleroma.Web.Router do post("/users/follow", AdminAPIController, :user_follow) post("/users/unfollow", AdminAPIController, :user_unfollow) + put("/users/disable_mfa", AdminAPIController, :disable_mfa) delete("/users", AdminAPIController, :user_delete) post("/users", AdminAPIController, :users_create) patch("/users/:nickname/toggle_activation", AdminAPIController, :user_toggle_activation) @@ -173,6 +171,8 @@ defmodule Pleroma.Web.Router do get("/users/:nickname/password_reset", AdminAPIController, :get_password_reset) patch("/users/force_password_reset", AdminAPIController, :force_password_reset) + get("/users/:nickname/credentials", AdminAPIController, :show_user_credentials) + patch("/users/:nickname/credentials", AdminAPIController, :update_user_credentials) get("/users", AdminAPIController, :list_users) get("/users/:nickname", AdminAPIController, :user_show) @@ -184,12 +184,12 @@ defmodule Pleroma.Web.Router do patch("/users/resend_confirmation_email", AdminAPIController, :resend_confirmation_email) get("/reports", AdminAPIController, :list_reports) - get("/grouped_reports", AdminAPIController, :list_grouped_reports) get("/reports/:id", AdminAPIController, :report_show) patch("/reports", AdminAPIController, :reports_update) post("/reports/:id/notes", AdminAPIController, :report_notes_create) delete("/reports/:report_id/notes/:id", AdminAPIController, :report_notes_delete) + get("/statuses/:id", AdminAPIController, :status_show) put("/statuses/:id", AdminAPIController, :status_update) delete("/statuses/:id", AdminAPIController, :status_delete) get("/statuses", AdminAPIController, :list_statuses) @@ -197,33 +197,43 @@ defmodule Pleroma.Web.Router do get("/config", AdminAPIController, :config_show) post("/config", AdminAPIController, :config_update) get("/config/descriptions", AdminAPIController, :config_descriptions) + get("/need_reboot", AdminAPIController, :need_reboot) get("/restart", AdminAPIController, :restart) get("/moderation_log", AdminAPIController, :list_log) post("/reload_emoji", AdminAPIController, :reload_emoji) get("/stats", AdminAPIController, :stats) + + get("/oauth_app", AdminAPIController, :oauth_app_list) + post("/oauth_app", AdminAPIController, :oauth_app_create) + patch("/oauth_app/:id", AdminAPIController, :oauth_app_update) + delete("/oauth_app/:id", AdminAPIController, :oauth_app_delete) end scope "/api/pleroma/emoji", Pleroma.Web.PleromaAPI do + # Modifying packs scope "/packs" do - # Modifying packs pipe_through(:admin_api) - post("/import_from_fs", EmojiAPIController, :import_from_fs) + get("/import", EmojiAPIController, :import_from_filesystem) + get("/remote", EmojiAPIController, :remote) + post("/download", EmojiAPIController, :download) - post("/:pack_name/update_file", EmojiAPIController, :update_file) - post("/:pack_name/update_metadata", EmojiAPIController, :update_metadata) - put("/:name", EmojiAPIController, :create) + post("/:name", EmojiAPIController, :create) + patch("/:name", EmojiAPIController, :update) delete("/:name", EmojiAPIController, :delete) - post("/download_from", EmojiAPIController, :download_from) - post("/list_from", EmojiAPIController, :list_from) + + post("/:name/files", EmojiAPIController, :add_file) + patch("/:name/files", EmojiAPIController, :update_file) + delete("/:name/files", EmojiAPIController, :delete_file) end + # Pack info / downloading scope "/packs" do - # Pack info / downloading - get("/", EmojiAPIController, :list_packs) - get("/:name/download_shared/", EmojiAPIController, :download_shared) + get("/", EmojiAPIController, :list) + get("/:name", EmojiAPIController, :show) + get("/:name/archive", EmojiAPIController, :archive) end end @@ -249,6 +259,16 @@ defmodule Pleroma.Web.Router do post("/follow_import", UtilController, :follow_import) end + scope "/api/pleroma", Pleroma.Web.PleromaAPI do + pipe_through(:authenticated_api) + + get("/accounts/mfa", TwoFactorAuthenticationController, :settings) + get("/accounts/mfa/backup_codes", TwoFactorAuthenticationController, :backup_codes) + get("/accounts/mfa/setup/:method", TwoFactorAuthenticationController, :setup) + post("/accounts/mfa/confirm/:method", TwoFactorAuthenticationController, :confirm) + delete("/accounts/mfa/:method", TwoFactorAuthenticationController, :disable) + end + scope "/oauth", Pleroma.Web.OAuth do scope [] do pipe_through(:oauth) @@ -260,6 +280,10 @@ defmodule Pleroma.Web.Router do post("/revoke", OAuthController, :token_revoke) get("/registration_details", OAuthController, :registration_details) + post("/mfa/challenge", MFAController, :challenge) + post("/mfa/verify", MFAController, :verify, as: :mfa_verify) + get("/mfa", MFAController, :show) + scope [] do pipe_through(:browser) @@ -283,7 +307,7 @@ defmodule Pleroma.Web.Router do get("/conversations/:id/statuses", PleromaAPIController, :conversation_statuses) get("/conversations/:id", PleromaAPIController, :conversation) - post("/conversations/read", PleromaAPIController, :read_conversations) + post("/conversations/read", PleromaAPIController, :mark_conversations_as_read) end scope [] do @@ -292,7 +316,7 @@ defmodule Pleroma.Web.Router do patch("/conversations/:id", PleromaAPIController, :update_conversation) put("/statuses/:id/reactions/:emoji", PleromaAPIController, :react_with_emoji) delete("/statuses/:id/reactions/:emoji", PleromaAPIController, :unreact_with_emoji) - post("/notifications/read", PleromaAPIController, :read_notification) + post("/notifications/read", PleromaAPIController, :mark_notifications_as_read) patch("/accounts/update_avatar", AccountController, :update_avatar) patch("/accounts/update_banner", AccountController, :update_banner) @@ -328,51 +352,84 @@ defmodule Pleroma.Web.Router do pipe_through(:authenticated_api) get("/accounts/verify_credentials", AccountController, :verify_credentials) + patch("/accounts/update_credentials", AccountController, :update_credentials) get("/accounts/relationships", AccountController, :relationships) - get("/accounts/:id/lists", AccountController, :lists) - get("/accounts/:id/identity_proofs", MastodonAPIController, :empty_array) - - get("/follow_requests", FollowRequestController, :index) + get("/accounts/:id/identity_proofs", AccountController, :identity_proofs) + get("/endorsements", AccountController, :endorsements) get("/blocks", AccountController, :blocks) get("/mutes", AccountController, :mutes) - get("/timelines/home", TimelineController, :home) - get("/timelines/direct", TimelineController, :direct) + post("/follows", AccountController, :follow_by_uri) + post("/accounts/:id/follow", AccountController, :follow) + post("/accounts/:id/unfollow", AccountController, :unfollow) + post("/accounts/:id/block", AccountController, :block) + post("/accounts/:id/unblock", AccountController, :unblock) + post("/accounts/:id/mute", AccountController, :mute) + post("/accounts/:id/unmute", AccountController, :unmute) - get("/favourites", StatusController, :favourites) - get("/bookmarks", StatusController, :bookmarks) + get("/apps/verify_credentials", AppController, :verify_credentials) - get("/notifications", NotificationController, :index) - get("/notifications/:id", NotificationController, :show) - post("/notifications/clear", NotificationController, :clear) - post("/notifications/dismiss", NotificationController, :dismiss) - delete("/notifications/destroy_multiple", NotificationController, :destroy_multiple) + get("/conversations", ConversationController, :index) + post("/conversations/:id/read", ConversationController, :mark_as_read) - get("/scheduled_statuses", ScheduledActivityController, :index) - get("/scheduled_statuses/:id", ScheduledActivityController, :show) + get("/domain_blocks", DomainBlockController, :index) + post("/domain_blocks", DomainBlockController, :create) + delete("/domain_blocks", DomainBlockController, :delete) + + get("/filters", FilterController, :index) + + post("/filters", FilterController, :create) + get("/filters/:id", FilterController, :show) + put("/filters/:id", FilterController, :update) + delete("/filters/:id", FilterController, :delete) + + get("/follow_requests", FollowRequestController, :index) + post("/follow_requests/:id/authorize", FollowRequestController, :authorize) + post("/follow_requests/:id/reject", FollowRequestController, :reject) get("/lists", ListController, :index) get("/lists/:id", ListController, :show) get("/lists/:id/accounts", ListController, :list_accounts) - get("/domain_blocks", DomainBlockController, :index) + delete("/lists/:id", ListController, :delete) + post("/lists", ListController, :create) + put("/lists/:id", ListController, :update) + post("/lists/:id/accounts", ListController, :add_to_list) + delete("/lists/:id/accounts", ListController, :remove_from_list) - get("/filters", FilterController, :index) + get("/markers", MarkerController, :index) + post("/markers", MarkerController, :upsert) - get("/suggestions", SuggestionController, :index) + post("/media", MediaController, :create) + put("/media/:id", MediaController, :update) - get("/conversations", ConversationController, :index) - post("/conversations/:id/read", ConversationController, :read) + get("/notifications", NotificationController, :index) + get("/notifications/:id", NotificationController, :show) - get("/endorsements", AccountController, :endorsements) + post("/notifications/:id/dismiss", NotificationController, :dismiss) + post("/notifications/clear", NotificationController, :clear) + delete("/notifications/destroy_multiple", NotificationController, :destroy_multiple) + # Deprecated: was removed in Mastodon v3, use `/notifications/:id/dismiss` instead + post("/notifications/dismiss", NotificationController, :dismiss_via_body) - patch("/accounts/update_credentials", AccountController, :update_credentials) + post("/polls/:id/votes", PollController, :vote) + + post("/reports", ReportController, :create) + + get("/scheduled_statuses", ScheduledActivityController, :index) + get("/scheduled_statuses/:id", ScheduledActivityController, :show) + + put("/scheduled_statuses/:id", ScheduledActivityController, :update) + delete("/scheduled_statuses/:id", ScheduledActivityController, :delete) + + # Unlike `GET /api/v1/accounts/:id/favourites`, demands authentication + get("/favourites", StatusController, :favourites) + get("/bookmarks", StatusController, :bookmarks) post("/statuses", StatusController, :create) delete("/statuses/:id", StatusController, :delete) - post("/statuses/:id/reblog", StatusController, :reblog) post("/statuses/:id/unreblog", StatusController, :unreblog) post("/statuses/:id/favourite", StatusController, :favourite) @@ -384,49 +441,16 @@ defmodule Pleroma.Web.Router do post("/statuses/:id/mute", StatusController, :mute_conversation) post("/statuses/:id/unmute", StatusController, :unmute_conversation) - put("/scheduled_statuses/:id", ScheduledActivityController, :update) - delete("/scheduled_statuses/:id", ScheduledActivityController, :delete) - - post("/polls/:id/votes", PollController, :vote) - - post("/media", MediaController, :create) - put("/media/:id", MediaController, :update) - - delete("/lists/:id", ListController, :delete) - post("/lists", ListController, :create) - put("/lists/:id", ListController, :update) - - post("/lists/:id/accounts", ListController, :add_to_list) - delete("/lists/:id/accounts", ListController, :remove_from_list) - - post("/filters", FilterController, :create) - get("/filters/:id", FilterController, :show) - put("/filters/:id", FilterController, :update) - delete("/filters/:id", FilterController, :delete) - - post("/reports", ReportController, :create) - - post("/follows", AccountController, :follows) - post("/accounts/:id/follow", AccountController, :follow) - post("/accounts/:id/unfollow", AccountController, :unfollow) - post("/accounts/:id/block", AccountController, :block) - post("/accounts/:id/unblock", AccountController, :unblock) - post("/accounts/:id/mute", AccountController, :mute) - post("/accounts/:id/unmute", AccountController, :unmute) - - post("/follow_requests/:id/authorize", FollowRequestController, :authorize) - post("/follow_requests/:id/reject", FollowRequestController, :reject) - - post("/domain_blocks", DomainBlockController, :create) - delete("/domain_blocks", DomainBlockController, :delete) - post("/push/subscription", SubscriptionController, :create) - get("/push/subscription", SubscriptionController, :get) + get("/push/subscription", SubscriptionController, :show) put("/push/subscription", SubscriptionController, :update) delete("/push/subscription", SubscriptionController, :delete) - get("/markers", MarkerController, :index) - post("/markers", MarkerController, :upsert) + get("/suggestions", SuggestionController, :index) + + get("/timelines/home", TimelineController, :home) + get("/timelines/direct", TimelineController, :direct) + get("/timelines/list/:list_id", TimelineController, :list) end scope "/api/web", Pleroma.Web do @@ -438,15 +462,24 @@ defmodule Pleroma.Web.Router do scope "/api/v1", Pleroma.Web.MastodonAPI do pipe_through(:api) - post("/accounts", AccountController, :create) get("/accounts/search", SearchController, :account_search) + get("/search", SearchController, :search) + + get("/accounts/:id/statuses", AccountController, :statuses) + get("/accounts/:id/followers", AccountController, :followers) + get("/accounts/:id/following", AccountController, :following) + get("/accounts/:id", AccountController, :show) + + post("/accounts", AccountController, :create) get("/instance", InstanceController, :show) get("/instance/peers", InstanceController, :peers) post("/apps", AppController, :create) - get("/apps/verify_credentials", AppController, :verify_credentials) + get("/statuses", StatusController, :index) + get("/statuses/:id", StatusController, :show) + get("/statuses/:id/context", StatusController, :context) get("/statuses/:id/card", StatusController, :card) get("/statuses/:id/favourited_by", StatusController, :favourited_by) get("/statuses/:id/reblogged_by", StatusController, :reblogged_by) @@ -457,20 +490,8 @@ defmodule Pleroma.Web.Router do get("/timelines/public", TimelineController, :public) get("/timelines/tag/:tag", TimelineController, :hashtag) - get("/timelines/list/:list_id", TimelineController, :list) - - get("/statuses", StatusController, :index) - get("/statuses/:id", StatusController, :show) - get("/statuses/:id/context", StatusController, :context) get("/polls/:id", PollController, :show) - - get("/accounts/:id/statuses", AccountController, :statuses) - get("/accounts/:id/followers", AccountController, :followers) - get("/accounts/:id/following", AccountController, :following) - get("/accounts/:id", AccountController, :show) - - get("/search", SearchController, :search) end scope "/api/v2", Pleroma.Web.MastodonAPI do @@ -498,17 +519,23 @@ defmodule Pleroma.Web.Router do ) end + scope "/api" do + pipe_through(:base_api) + + get("/openapi", OpenApiSpex.Plug.RenderSpec, []) + end + scope "/api", Pleroma.Web, as: :authenticated_twitter_api do pipe_through(:authenticated_api) get("/oauth_tokens", TwitterAPI.Controller, :oauth_tokens) delete("/oauth_tokens/:id", TwitterAPI.Controller, :revoke_token) - post("/qvitter/statuses/notifications/read", TwitterAPI.Controller, :notifications_read) - end - - pipeline :ap_service_actor do - plug(:accepts, ["activity+json", "json"]) + post( + "/qvitter/statuses/notifications/read", + TwitterAPI.Controller, + :mark_notifications_as_read + ) end pipeline :ostatus do @@ -521,8 +548,7 @@ defmodule Pleroma.Web.Router do end scope "/", Pleroma.Web do - pipe_through(:ostatus) - pipe_through(:http_signature) + pipe_through([:ostatus, :http_signature]) get("/objects/:uuid", OStatus.OStatusController, :object) get("/activities/:uuid", OStatus.OStatusController, :activity) @@ -540,13 +566,6 @@ defmodule Pleroma.Web.Router do get("/mailer/unsubscribe/:token", Mailer.SubscriptionController, :unsubscribe) end - # Server to Server (S2S) AP interactions - pipeline :activitypub do - plug(:accepts, ["activity+json", "json"]) - plug(Pleroma.Web.Plugs.HTTPSignaturePlug) - plug(Pleroma.Web.Plugs.MappedSignatureToIdentityPlug) - end - scope "/", Pleroma.Web.ActivityPub do # XXX: not really ostatus pipe_through(:ostatus) @@ -554,19 +573,22 @@ defmodule Pleroma.Web.Router do get("/users/:nickname/outbox", ActivityPubController, :outbox) end + pipeline :ap_service_actor do + plug(:accepts, ["activity+json", "json"]) + end + + # Server to Server (S2S) AP interactions + pipeline :activitypub do + plug(:ap_service_actor) + plug(:http_signature) + end + # Client to Server (C2S) AP interactions pipeline :activitypub_client do - plug(:accepts, ["activity+json", "json"]) + plug(:ap_service_actor) plug(:fetch_session) - plug(Pleroma.Plugs.OAuthPlug) - plug(Pleroma.Plugs.BasicAuthDecoderPlug) - plug(Pleroma.Plugs.UserFetcherPlug) - plug(Pleroma.Plugs.SessionAuthenticationPlug) - plug(Pleroma.Plugs.LegacyAuthenticationPlug) - plug(Pleroma.Plugs.AuthenticationPlug) - plug(Pleroma.Plugs.UserEnabledPlug) - plug(Pleroma.Plugs.SetUserSessionIdPlug) - plug(Pleroma.Plugs.EnsureUserKeyPlug) + plug(:authenticate) + plug(:after_auth) end scope "/", Pleroma.Web.ActivityPub do @@ -578,6 +600,7 @@ defmodule Pleroma.Web.Router do post("/users/:nickname/outbox", ActivityPubController, :update_outbox) post("/api/ap/upload_media", ActivityPubController, :upload_media) + # The following two are S2S as well, see `ActivityPub.fetch_follow_information_for_user/1`: get("/users/:nickname/followers", ActivityPubController, :followers) get("/users/:nickname/following", ActivityPubController, :following) end @@ -638,12 +661,7 @@ defmodule Pleroma.Web.Router do get("/web/*path", MastoFEController, :index) end - pipeline :remote_media do - end - scope "/proxy/", Pleroma.Web.MediaProxy do - pipe_through(:remote_media) - get("/:sig/:url", MediaProxyController, :remote) get("/:sig/:url/:filename", MediaProxyController, :remote) end @@ -656,6 +674,34 @@ defmodule Pleroma.Web.Router do end end + # Test-only routes needed to test action dispatching and plug chain execution + if Pleroma.Config.get(:env) == :test do + @test_actions [ + :do_oauth_check, + :fallback_oauth_check, + :skip_oauth_check, + :fallback_oauth_skip_publicity_check, + :skip_oauth_skip_publicity_check, + :missing_oauth_check_definition + ] + + scope "/test/api", Pleroma.Tests do + pipe_through(:api) + + for action <- @test_actions do + get("/#{action}", AuthTestController, action) + end + end + + scope "/test/authenticated_api", Pleroma.Tests do + pipe_through(:authenticated_api) + + for action <- @test_actions do + get("/#{action}", AuthTestController, action) + end + end + end + scope "/", Pleroma.Web.MongooseIM do get("/user_exists", MongooseIMController, :user_exists) get("/check_password", MongooseIMController, :check_password) diff --git a/lib/pleroma/web/static_fe/static_fe_controller.ex b/lib/pleroma/web/static_fe/static_fe_controller.ex index 7a35238d7..c3efb6651 100644 --- a/lib/pleroma/web/static_fe/static_fe_controller.ex +++ b/lib/pleroma/web/static_fe/static_fe_controller.ex @@ -18,7 +18,7 @@ defmodule Pleroma.Web.StaticFE.StaticFEController do plug(:assign_id) plug(Pleroma.Plugs.EnsureAuthenticatedPlug, - unless_func: &Pleroma.Web.FederatingPlug.federating?/0 + unless_func: &Pleroma.Web.FederatingPlug.federating?/1 ) @page_keys ["max_id", "min_id", "limit", "since_id", "order"] diff --git a/lib/pleroma/web/static_fe/static_fe_view.ex b/lib/pleroma/web/static_fe/static_fe_view.ex index 66d87620c..b3d1d1ec8 100644 --- a/lib/pleroma/web/static_fe/static_fe_view.ex +++ b/lib/pleroma/web/static_fe/static_fe_view.ex @@ -18,15 +18,6 @@ defmodule Pleroma.Web.StaticFE.StaticFEView do @media_types ["image", "audio", "video"] - def emoji_for_user(%User{} = user) do - user.source_data - |> Map.get("tag", []) - |> Enum.filter(fn %{"type" => t} -> t == "Emoji" end) - |> Enum.map(fn %{"icon" => %{"url" => url}, "name" => name} -> - {String.trim(name, ":"), url} - end) - end - def fetch_media_type(%{"mediaType" => mediaType}) do Utils.fetch_media_type(@media_types, mediaType) end diff --git a/lib/pleroma/web/streamer/ping.ex b/lib/pleroma/web/streamer/ping.ex deleted file mode 100644 index 7a08202a9..000000000 --- a/lib/pleroma/web/streamer/ping.ex +++ /dev/null @@ -1,37 +0,0 @@ -# Pleroma: A lightweight social networking server -# Copyright © 2017-2020 Pleroma Authors -# SPDX-License-Identifier: AGPL-3.0-only - -defmodule Pleroma.Web.Streamer.Ping do - use GenServer - require Logger - - alias Pleroma.Web.Streamer.State - alias Pleroma.Web.Streamer.StreamerSocket - - @keepalive_interval :timer.seconds(30) - - def start_link(opts) do - ping_interval = Keyword.get(opts, :ping_interval, @keepalive_interval) - GenServer.start_link(__MODULE__, %{ping_interval: ping_interval}, name: __MODULE__) - end - - def init(%{ping_interval: ping_interval} = args) do - Process.send_after(self(), :ping, ping_interval) - {:ok, args} - end - - def handle_info(:ping, %{ping_interval: ping_interval} = state) do - State.get_sockets() - |> Map.values() - |> List.flatten() - |> Enum.each(fn %StreamerSocket{transport_pid: transport_pid} -> - Logger.debug("Sending keepalive ping") - send(transport_pid, {:text, ""}) - end) - - Process.send_after(self(), :ping, ping_interval) - - {:noreply, state} - end -end diff --git a/lib/pleroma/web/streamer/state.ex b/lib/pleroma/web/streamer/state.ex deleted file mode 100644 index 999550b88..000000000 --- a/lib/pleroma/web/streamer/state.ex +++ /dev/null @@ -1,82 +0,0 @@ -# Pleroma: A lightweight social networking server -# Copyright © 2017-2020 Pleroma Authors -# SPDX-License-Identifier: AGPL-3.0-only - -defmodule Pleroma.Web.Streamer.State do - use GenServer - require Logger - - alias Pleroma.Web.Streamer.StreamerSocket - - @env Mix.env() - - def start_link(_) do - GenServer.start_link(__MODULE__, %{sockets: %{}}, name: __MODULE__) - end - - def add_socket(topic, socket) do - GenServer.call(__MODULE__, {:add, topic, socket}) - end - - def remove_socket(topic, socket) do - do_remove_socket(@env, topic, socket) - end - - def get_sockets do - %{sockets: stream_sockets} = GenServer.call(__MODULE__, :get_state) - stream_sockets - end - - def init(init_arg) do - {:ok, init_arg} - end - - def handle_call(:get_state, _from, state) do - {:reply, state, state} - end - - def handle_call({:add, topic, socket}, _from, %{sockets: sockets} = state) do - internal_topic = internal_topic(topic, socket) - stream_socket = StreamerSocket.from_socket(socket) - - sockets_for_topic = - sockets - |> Map.get(internal_topic, []) - |> List.insert_at(0, stream_socket) - |> Enum.uniq() - - state = put_in(state, [:sockets, internal_topic], sockets_for_topic) - Logger.debug("Got new conn for #{topic}") - {:reply, state, state} - end - - def handle_call({:remove, topic, socket}, _from, %{sockets: sockets} = state) do - internal_topic = internal_topic(topic, socket) - stream_socket = StreamerSocket.from_socket(socket) - - sockets_for_topic = - sockets - |> Map.get(internal_topic, []) - |> List.delete(stream_socket) - - state = Kernel.put_in(state, [:sockets, internal_topic], sockets_for_topic) - {:reply, state, state} - end - - defp do_remove_socket(:test, _, _) do - :ok - end - - defp do_remove_socket(_env, topic, socket) do - GenServer.call(__MODULE__, {:remove, topic, socket}) - end - - defp internal_topic(topic, socket) - when topic in ~w[user user:notification direct] do - "#{topic}:#{socket.assigns[:user].id}" - end - - defp internal_topic(topic, _) do - topic - end -end diff --git a/lib/pleroma/web/streamer/streamer.ex b/lib/pleroma/web/streamer/streamer.ex index 814d5a729..49a400df7 100644 --- a/lib/pleroma/web/streamer/streamer.ex +++ b/lib/pleroma/web/streamer/streamer.ex @@ -3,53 +3,288 @@ # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.Web.Streamer do - alias Pleroma.Web.Streamer.State - alias Pleroma.Web.Streamer.Worker + require Logger + + alias Pleroma.Activity + alias Pleroma.Config + alias Pleroma.Conversation.Participation + alias Pleroma.Notification + alias Pleroma.Object + alias Pleroma.User + alias Pleroma.Web.ActivityPub.ActivityPub + alias Pleroma.Web.ActivityPub.Visibility + alias Pleroma.Web.CommonAPI + alias Pleroma.Web.StreamerView - @timeout 60_000 @mix_env Mix.env() + @registry Pleroma.Web.StreamerRegistry - def add_socket(topic, socket) do - State.add_socket(topic, socket) + def registry, do: @registry + + @public_streams ["public", "public:local", "public:media", "public:local:media"] + @user_streams ["user", "user:notification", "direct"] + + @doc "Expands and authorizes a stream, and registers the process for streaming." + @spec get_topic_and_add_socket(stream :: String.t(), User.t() | nil, Map.t() | nil) :: + {:ok, topic :: String.t()} | {:error, :bad_topic} | {:error, :unauthorized} + def get_topic_and_add_socket(stream, user, params \\ %{}) do + case get_topic(stream, user, params) do + {:ok, topic} -> add_socket(topic, user) + error -> error + end end - def remove_socket(topic, socket) do - State.remove_socket(topic, socket) + @doc "Expand and authorizes a stream" + @spec get_topic(stream :: String.t(), User.t() | nil, Map.t()) :: + {:ok, topic :: String.t()} | {:error, :bad_topic} + def get_topic(stream, user, params \\ %{}) + + # Allow all public steams. + def get_topic(stream, _, _) when stream in @public_streams do + {:ok, stream} end - def get_sockets do - State.get_sockets() + # Allow all hashtags streams. + def get_topic("hashtag", _, %{"tag" => tag}) do + {:ok, "hashtag:" <> tag} end - def stream(topics, items) do - if should_send?() do - Task.async(fn -> - :poolboy.transaction( - :streamer_worker, - &Worker.stream(&1, topics, items), - @timeout - ) + # Expand user streams. + def get_topic(stream, %User{} = user, _) when stream in @user_streams do + {:ok, stream <> ":" <> to_string(user.id)} + end + + def get_topic(stream, _, _) when stream in @user_streams do + {:error, :unauthorized} + end + + # List streams. + def get_topic("list", %User{} = user, %{"list" => id}) do + if Pleroma.List.get(id, user) do + {:ok, "list:" <> to_string(id)} + else + {:error, :bad_topic} + end + end + + def get_topic("list", _, _) do + {:error, :unauthorized} + end + + def get_topic(_, _, _) do + {:error, :bad_topic} + end + + @doc "Registers the process for streaming. Use `get_topic/3` to get the full authorized topic." + def add_socket(topic, user) do + if should_env_send?() do + auth? = if user, do: true + Registry.register(@registry, topic, auth?) + end + + {:ok, topic} + end + + def remove_socket(topic) do + if should_env_send?(), do: Registry.unregister(@registry, topic) + end + + def stream(topics, item) when is_list(topics) do + if should_env_send?() do + Enum.each(topics, fn t -> + spawn(fn -> do_stream(t, item) end) end) end + + :ok end - def supervisor, do: Pleroma.Web.Streamer.Supervisor + def stream(topic, items) when is_list(items) do + if should_env_send?() do + Enum.each(items, fn i -> + spawn(fn -> do_stream(topic, i) end) + end) - defp should_send? do - handle_should_send(@mix_env) - end - - defp handle_should_send(:test) do - case Process.whereis(:streamer_worker) do - nil -> - false - - pid -> - Process.alive?(pid) + :ok end end - defp handle_should_send(:benchmark), do: false + def stream(topic, item) do + if should_env_send?() do + spawn(fn -> do_stream(topic, item) end) + end - defp handle_should_send(_), do: true + :ok + end + + def filtered_by_user?(%User{} = user, %Activity{} = item) do + %{block: blocked_ap_ids, mute: muted_ap_ids, reblog_mute: reblog_muted_ap_ids} = + User.outgoing_relationships_ap_ids(user, [:block, :mute, :reblog_mute]) + + recipient_blocks = MapSet.new(blocked_ap_ids ++ muted_ap_ids) + recipients = MapSet.new(item.recipients) + domain_blocks = Pleroma.Web.ActivityPub.MRF.subdomains_regex(user.domain_blocks) + + with parent <- Object.normalize(item) || item, + true <- + Enum.all?([blocked_ap_ids, muted_ap_ids], &(item.actor not in &1)), + true <- item.data["type"] != "Announce" || item.actor not in reblog_muted_ap_ids, + true <- Enum.all?([blocked_ap_ids, muted_ap_ids], &(parent.data["actor"] not in &1)), + true <- MapSet.disjoint?(recipients, recipient_blocks), + %{host: item_host} <- URI.parse(item.actor), + %{host: parent_host} <- URI.parse(parent.data["actor"]), + false <- Pleroma.Web.ActivityPub.MRF.subdomain_match?(domain_blocks, item_host), + false <- Pleroma.Web.ActivityPub.MRF.subdomain_match?(domain_blocks, parent_host), + true <- thread_containment(item, user), + false <- CommonAPI.thread_muted?(user, item) do + false + else + _ -> true + end + end + + def filtered_by_user?(%User{} = user, %Notification{activity: activity}) do + filtered_by_user?(user, activity) + end + + defp do_stream("direct", item) do + recipient_topics = + User.get_recipients_from_activity(item) + |> Enum.map(fn %{id: id} -> "direct:#{id}" end) + + Enum.each(recipient_topics, fn user_topic -> + Logger.debug("Trying to push direct message to #{user_topic}\n\n") + push_to_socket(user_topic, item) + end) + end + + defp do_stream("participation", participation) do + user_topic = "direct:#{participation.user_id}" + Logger.debug("Trying to push a conversation participation to #{user_topic}\n\n") + + push_to_socket(user_topic, participation) + end + + defp do_stream("list", item) do + # filter the recipient list if the activity is not public, see #270. + recipient_lists = + case Visibility.is_public?(item) do + true -> + Pleroma.List.get_lists_from_activity(item) + + _ -> + Pleroma.List.get_lists_from_activity(item) + |> Enum.filter(fn list -> + owner = User.get_cached_by_id(list.user_id) + + Visibility.visible_for_user?(item, owner) + end) + end + + recipient_topics = + recipient_lists + |> Enum.map(fn %{id: id} -> "list:#{id}" end) + + Enum.each(recipient_topics, fn list_topic -> + Logger.debug("Trying to push message to #{list_topic}\n\n") + push_to_socket(list_topic, item) + end) + end + + defp do_stream(topic, %Notification{} = item) + when topic in ["user", "user:notification"] do + Registry.dispatch(@registry, "#{topic}:#{item.user_id}", fn list -> + Enum.each(list, fn {pid, _auth} -> + send(pid, {:render_with_user, StreamerView, "notification.json", item}) + end) + end) + end + + defp do_stream("user", item) do + Logger.debug("Trying to push to users") + + recipient_topics = + User.get_recipients_from_activity(item) + |> Enum.map(fn %{id: id} -> "user:#{id}" end) + + Enum.each(recipient_topics, fn topic -> + push_to_socket(topic, item) + end) + end + + defp do_stream(topic, item) do + Logger.debug("Trying to push to #{topic}") + Logger.debug("Pushing item to #{topic}") + push_to_socket(topic, item) + end + + defp push_to_socket(topic, %Participation{} = participation) do + rendered = StreamerView.render("conversation.json", participation) + + Registry.dispatch(@registry, topic, fn list -> + Enum.each(list, fn {pid, _} -> + send(pid, {:text, rendered}) + end) + end) + end + + defp push_to_socket(topic, %Activity{ + data: %{"type" => "Delete", "deleted_activity_id" => deleted_activity_id} + }) do + rendered = Jason.encode!(%{event: "delete", payload: to_string(deleted_activity_id)}) + + Registry.dispatch(@registry, topic, fn list -> + Enum.each(list, fn {pid, _} -> + send(pid, {:text, rendered}) + end) + end) + end + + defp push_to_socket(_topic, %Activity{data: %{"type" => "Delete"}}), do: :noop + + defp push_to_socket(topic, item) do + anon_render = StreamerView.render("update.json", item) + + Registry.dispatch(@registry, topic, fn list -> + Enum.each(list, fn {pid, auth?} -> + if auth? do + send(pid, {:render_with_user, StreamerView, "update.json", item}) + else + send(pid, {:text, anon_render}) + end + end) + end) + end + + defp thread_containment(_activity, %User{skip_thread_containment: true}), do: true + + defp thread_containment(activity, user) do + if Config.get([:instance, :skip_thread_containment]) do + true + else + ActivityPub.contain_activity(activity, user) + end + end + + # In test environement, only return true if the registry is started. + # In benchmark environment, returns false. + # In any other environment, always returns true. + cond do + @mix_env == :test -> + def should_env_send? do + case Process.whereis(@registry) do + nil -> + false + + pid -> + Process.alive?(pid) + end + end + + @mix_env == :benchmark -> + def should_env_send?, do: false + + true -> + def should_env_send?, do: true + end end diff --git a/lib/pleroma/web/streamer/streamer_socket.ex b/lib/pleroma/web/streamer/streamer_socket.ex deleted file mode 100644 index 7d5dcd34e..000000000 --- a/lib/pleroma/web/streamer/streamer_socket.ex +++ /dev/null @@ -1,35 +0,0 @@ -# Pleroma: A lightweight social networking server -# Copyright © 2017-2020 Pleroma Authors -# SPDX-License-Identifier: AGPL-3.0-only - -defmodule Pleroma.Web.Streamer.StreamerSocket do - defstruct transport_pid: nil, user: nil - - alias Pleroma.User - alias Pleroma.Web.Streamer.StreamerSocket - - def from_socket(%{ - transport_pid: transport_pid, - assigns: %{user: nil} - }) do - %StreamerSocket{ - transport_pid: transport_pid - } - end - - def from_socket(%{ - transport_pid: transport_pid, - assigns: %{user: %User{} = user} - }) do - %StreamerSocket{ - transport_pid: transport_pid, - user: user - } - end - - def from_socket(%{transport_pid: transport_pid}) do - %StreamerSocket{ - transport_pid: transport_pid - } - end -end diff --git a/lib/pleroma/web/streamer/supervisor.ex b/lib/pleroma/web/streamer/supervisor.ex deleted file mode 100644 index bd9029bc0..000000000 --- a/lib/pleroma/web/streamer/supervisor.ex +++ /dev/null @@ -1,37 +0,0 @@ -# Pleroma: A lightweight social networking server -# Copyright © 2017-2020 Pleroma Authors -# SPDX-License-Identifier: AGPL-3.0-only - -defmodule Pleroma.Web.Streamer.Supervisor do - use Supervisor - - def start_link(opts) do - Supervisor.start_link(__MODULE__, opts, name: __MODULE__) - end - - def init(args) do - children = [ - {Pleroma.Web.Streamer.State, args}, - {Pleroma.Web.Streamer.Ping, args}, - :poolboy.child_spec(:streamer_worker, poolboy_config()) - ] - - opts = [strategy: :one_for_one, name: Pleroma.Web.Streamer.Supervisor] - Supervisor.init(children, opts) - end - - defp poolboy_config do - opts = - Pleroma.Config.get(:streamer, - workers: 3, - overflow_workers: 2 - ) - - [ - {:name, {:local, :streamer_worker}}, - {:worker_module, Pleroma.Web.Streamer.Worker}, - {:size, opts[:workers]}, - {:max_overflow, opts[:overflow_workers]} - ] - end -end diff --git a/lib/pleroma/web/streamer/worker.ex b/lib/pleroma/web/streamer/worker.ex deleted file mode 100644 index 29f992a67..000000000 --- a/lib/pleroma/web/streamer/worker.ex +++ /dev/null @@ -1,226 +0,0 @@ -# Pleroma: A lightweight social networking server -# Copyright © 2017-2020 Pleroma Authors -# SPDX-License-Identifier: AGPL-3.0-only - -defmodule Pleroma.Web.Streamer.Worker do - use GenServer - - require Logger - - alias Pleroma.Activity - alias Pleroma.Config - alias Pleroma.Conversation.Participation - alias Pleroma.Notification - alias Pleroma.Object - alias Pleroma.User - alias Pleroma.Web.ActivityPub.ActivityPub - alias Pleroma.Web.ActivityPub.Visibility - alias Pleroma.Web.CommonAPI - alias Pleroma.Web.Streamer.State - alias Pleroma.Web.Streamer.StreamerSocket - alias Pleroma.Web.StreamerView - - def start_link(_) do - GenServer.start_link(__MODULE__, %{}, []) - end - - def init(init_arg) do - {:ok, init_arg} - end - - def stream(pid, topics, items) do - GenServer.call(pid, {:stream, topics, items}) - end - - def handle_call({:stream, topics, item}, _from, state) when is_list(topics) do - Enum.each(topics, fn t -> - do_stream(%{topic: t, item: item}) - end) - - {:reply, state, state} - end - - def handle_call({:stream, topic, items}, _from, state) when is_list(items) do - Enum.each(items, fn i -> - do_stream(%{topic: topic, item: i}) - end) - - {:reply, state, state} - end - - def handle_call({:stream, topic, item}, _from, state) do - do_stream(%{topic: topic, item: item}) - - {:reply, state, state} - end - - defp do_stream(%{topic: "direct", item: item}) do - recipient_topics = - User.get_recipients_from_activity(item) - |> Enum.map(fn %{id: id} -> "direct:#{id}" end) - - Enum.each(recipient_topics, fn user_topic -> - Logger.debug("Trying to push direct message to #{user_topic}\n\n") - push_to_socket(State.get_sockets(), user_topic, item) - end) - end - - defp do_stream(%{topic: "participation", item: participation}) do - user_topic = "direct:#{participation.user_id}" - Logger.debug("Trying to push a conversation participation to #{user_topic}\n\n") - - push_to_socket(State.get_sockets(), user_topic, participation) - end - - defp do_stream(%{topic: "list", item: item}) do - # filter the recipient list if the activity is not public, see #270. - recipient_lists = - case Visibility.is_public?(item) do - true -> - Pleroma.List.get_lists_from_activity(item) - - _ -> - Pleroma.List.get_lists_from_activity(item) - |> Enum.filter(fn list -> - owner = User.get_cached_by_id(list.user_id) - - Visibility.visible_for_user?(item, owner) - end) - end - - recipient_topics = - recipient_lists - |> Enum.map(fn %{id: id} -> "list:#{id}" end) - - Enum.each(recipient_topics, fn list_topic -> - Logger.debug("Trying to push message to #{list_topic}\n\n") - push_to_socket(State.get_sockets(), list_topic, item) - end) - end - - defp do_stream(%{topic: topic, item: %Notification{} = item}) - when topic in ["user", "user:notification"] do - State.get_sockets() - |> Map.get("#{topic}:#{item.user_id}", []) - |> Enum.each(fn %StreamerSocket{transport_pid: transport_pid, user: socket_user} -> - with %User{} = user <- User.get_cached_by_ap_id(socket_user.ap_id), - true <- should_send?(user, item) do - send(transport_pid, {:text, StreamerView.render("notification.json", socket_user, item)}) - end - end) - end - - defp do_stream(%{topic: "user", item: item}) do - Logger.debug("Trying to push to users") - - recipient_topics = - User.get_recipients_from_activity(item) - |> Enum.map(fn %{id: id} -> "user:#{id}" end) - - Enum.each(recipient_topics, fn topic -> - push_to_socket(State.get_sockets(), topic, item) - end) - end - - defp do_stream(%{topic: topic, item: item}) do - Logger.debug("Trying to push to #{topic}") - Logger.debug("Pushing item to #{topic}") - push_to_socket(State.get_sockets(), topic, item) - end - - defp should_send?(%User{} = user, %Activity{} = item) do - %{block: blocked_ap_ids, mute: muted_ap_ids, reblog_mute: reblog_muted_ap_ids} = - User.outgoing_relations_ap_ids(user, [:block, :mute, :reblog_mute]) - - recipient_blocks = MapSet.new(blocked_ap_ids ++ muted_ap_ids) - recipients = MapSet.new(item.recipients) - domain_blocks = Pleroma.Web.ActivityPub.MRF.subdomains_regex(user.domain_blocks) - - with parent <- Object.normalize(item) || item, - true <- - Enum.all?([blocked_ap_ids, muted_ap_ids], &(item.actor not in &1)), - true <- item.data["type"] != "Announce" || item.actor not in reblog_muted_ap_ids, - true <- Enum.all?([blocked_ap_ids, muted_ap_ids], &(parent.data["actor"] not in &1)), - true <- MapSet.disjoint?(recipients, recipient_blocks), - %{host: item_host} <- URI.parse(item.actor), - %{host: parent_host} <- URI.parse(parent.data["actor"]), - false <- Pleroma.Web.ActivityPub.MRF.subdomain_match?(domain_blocks, item_host), - false <- Pleroma.Web.ActivityPub.MRF.subdomain_match?(domain_blocks, parent_host), - true <- thread_containment(item, user), - false <- CommonAPI.thread_muted?(user, item) do - true - else - _ -> false - end - end - - defp should_send?(%User{} = user, %Notification{activity: activity}) do - should_send?(user, activity) - end - - def push_to_socket(topics, topic, %Activity{data: %{"type" => "Announce"}} = item) do - Enum.each(topics[topic] || [], fn %StreamerSocket{ - transport_pid: transport_pid, - user: socket_user - } -> - # Get the current user so we have up-to-date blocks etc. - if socket_user do - user = User.get_cached_by_ap_id(socket_user.ap_id) - - if should_send?(user, item) do - send(transport_pid, {:text, StreamerView.render("update.json", item, user)}) - end - else - send(transport_pid, {:text, StreamerView.render("update.json", item)}) - end - end) - end - - def push_to_socket(topics, topic, %Participation{} = participation) do - Enum.each(topics[topic] || [], fn %StreamerSocket{transport_pid: transport_pid} -> - send(transport_pid, {:text, StreamerView.render("conversation.json", participation)}) - end) - end - - def push_to_socket(topics, topic, %Activity{ - data: %{"type" => "Delete", "deleted_activity_id" => deleted_activity_id} - }) do - Enum.each(topics[topic] || [], fn %StreamerSocket{transport_pid: transport_pid} -> - send( - transport_pid, - {:text, %{event: "delete", payload: to_string(deleted_activity_id)} |> Jason.encode!()} - ) - end) - end - - def push_to_socket(_topics, _topic, %Activity{data: %{"type" => "Delete"}}), do: :noop - - def push_to_socket(topics, topic, item) do - Enum.each(topics[topic] || [], fn %StreamerSocket{ - transport_pid: transport_pid, - user: socket_user - } -> - # Get the current user so we have up-to-date blocks etc. - if socket_user do - user = User.get_cached_by_ap_id(socket_user.ap_id) - - if should_send?(user, item) do - send(transport_pid, {:text, StreamerView.render("update.json", item, user)}) - end - else - send(transport_pid, {:text, StreamerView.render("update.json", item)}) - end - end) - end - - @spec thread_containment(Activity.t(), User.t()) :: boolean() - defp thread_containment(_activity, %User{skip_thread_containment: true}), do: true - - defp thread_containment(activity, user) do - if Config.get([:instance, :skip_thread_containment]) do - true - else - ActivityPub.contain_activity(activity, user) - end - end -end diff --git a/lib/pleroma/web/templates/feed/feed/_activity.atom.eex b/lib/pleroma/web/templates/feed/feed/_activity.atom.eex index ac8a75009..78350f2aa 100644 --- a/lib/pleroma/web/templates/feed/feed/_activity.atom.eex +++ b/lib/pleroma/web/templates/feed/feed/_activity.atom.eex @@ -2,10 +2,10 @@ http://activitystrea.ms/schema/1.0/note http://activitystrea.ms/schema/1.0/post <%= @data["id"] %> - <%= activity_title(@object, Keyword.get(@feed_config, :post_title, %{})) %> - <%= activity_content(@object) %> - <%= @data["published"] %> - <%= @data["published"] %> + <%= activity_title(@data, Keyword.get(@feed_config, :post_title, %{})) %> + <%= activity_content(@data) %> + <%= @activity.data["published"] %> + <%= @activity.data["published"] %> <%= activity_context(@activity) %> diff --git a/lib/pleroma/web/templates/feed/feed/_activity.rss.eex b/lib/pleroma/web/templates/feed/feed/_activity.rss.eex index a4dbed638..a304a16af 100644 --- a/lib/pleroma/web/templates/feed/feed/_activity.rss.eex +++ b/lib/pleroma/web/templates/feed/feed/_activity.rss.eex @@ -2,10 +2,10 @@ http://activitystrea.ms/schema/1.0/note http://activitystrea.ms/schema/1.0/post <%= @data["id"] %> - <%= activity_title(@object, Keyword.get(@feed_config, :post_title, %{})) %> - <%= activity_content(@object) %> - <%= @data["published"] %> - <%= @data["published"] %> + <%= activity_title(@data, Keyword.get(@feed_config, :post_title, %{})) %> + <%= activity_content(@data) %> + <%= @activity.data["published"] %> + <%= @activity.data["published"] %> <%= activity_context(@activity) %> diff --git a/lib/pleroma/web/templates/feed/feed/_tag_activity.atom.eex b/lib/pleroma/web/templates/feed/feed/_tag_activity.atom.eex index da4fa6d6c..cf5874a91 100644 --- a/lib/pleroma/web/templates/feed/feed/_tag_activity.atom.eex +++ b/lib/pleroma/web/templates/feed/feed/_tag_activity.atom.eex @@ -1,12 +1,12 @@ http://activitystrea.ms/schema/1.0/note http://activitystrea.ms/schema/1.0/post - + <%= render @view_module, "_tag_author.atom", assigns %> - + <%= @data["id"] %> - <%= activity_title(@object, Keyword.get(@feed_config, :post_title, %{})) %> - <%= activity_content(@object) %> + <%= activity_title(@data, Keyword.get(@feed_config, :post_title, %{})) %> + <%= activity_content(@data) %> <%= if @activity.local do %> @@ -15,8 +15,8 @@ <% end %> - <%= @data["published"] %> - <%= @data["published"] %> + <%= @activity.data["published"] %> + <%= @activity.data["published"] %> <%= activity_context(@activity) %> @@ -26,7 +26,7 @@ <%= if @data["summary"] do %> <%= @data["summary"] %> <% end %> - + <%= for id <- @activity.recipients do %> <%= if id == Pleroma.Constants.as_public() do %> <% end %> <% end %> - + <%= for tag <- @data["tag"] || [] do %> <% end %> diff --git a/lib/pleroma/web/templates/feed/feed/_tag_activity.xml.eex b/lib/pleroma/web/templates/feed/feed/_tag_activity.xml.eex index 295574df1..2334e24a2 100644 --- a/lib/pleroma/web/templates/feed/feed/_tag_activity.xml.eex +++ b/lib/pleroma/web/templates/feed/feed/_tag_activity.xml.eex @@ -1,15 +1,14 @@ - <%= activity_title(@object, Keyword.get(@feed_config, :post_title, %{})) %> - - + <%= activity_title(@data, Keyword.get(@feed_config, :post_title, %{})) %> + + <%= activity_context(@activity) %> <%= activity_context(@activity) %> - <%= pub_date(@data["published"]) %> - - <%= activity_content(@object) %> + <%= pub_date(@activity.data["published"]) %> + + <%= activity_content(@data) %> <%= for attachment <- @data["attachment"] || [] do %> <% end %> - - + diff --git a/lib/pleroma/web/templates/layout/static_fe.html.eex b/lib/pleroma/web/templates/layout/static_fe.html.eex index 819632cec..dc0ee2a5c 100644 --- a/lib/pleroma/web/templates/layout/static_fe.html.eex +++ b/lib/pleroma/web/templates/layout/static_fe.html.eex @@ -5,7 +5,7 @@ <%= Pleroma.Config.get([:instance, :name]) %> <%= Phoenix.HTML.raw(assigns[:meta] || "") %> - +
diff --git a/lib/pleroma/web/templates/o_auth/mfa/recovery.html.eex b/lib/pleroma/web/templates/o_auth/mfa/recovery.html.eex new file mode 100644 index 000000000..750f65386 --- /dev/null +++ b/lib/pleroma/web/templates/o_auth/mfa/recovery.html.eex @@ -0,0 +1,24 @@ +<%= if get_flash(@conn, :info) do %> + +<% end %> +<%= if get_flash(@conn, :error) do %> + +<% end %> + +

Two-factor recovery

+ +<%= form_for @conn, mfa_verify_path(@conn, :verify), [as: "mfa"], fn f -> %> +
+ <%= label f, :code, "Recovery code" %> + <%= text_input f, :code %> + <%= hidden_input f, :mfa_token, value: @mfa_token %> + <%= hidden_input f, :state, value: @state %> + <%= hidden_input f, :redirect_uri, value: @redirect_uri %> + <%= hidden_input f, :challenge_type, value: "recovery" %> +
+ +<%= submit "Verify" %> +<% end %> +"> + Enter a two-factor code + diff --git a/lib/pleroma/web/templates/o_auth/mfa/totp.html.eex b/lib/pleroma/web/templates/o_auth/mfa/totp.html.eex new file mode 100644 index 000000000..af6e546b0 --- /dev/null +++ b/lib/pleroma/web/templates/o_auth/mfa/totp.html.eex @@ -0,0 +1,24 @@ +<%= if get_flash(@conn, :info) do %> + +<% end %> +<%= if get_flash(@conn, :error) do %> + +<% end %> + +

Two-factor authentication

+ +<%= form_for @conn, mfa_verify_path(@conn, :verify), [as: "mfa"], fn f -> %> +
+ <%= label f, :code, "Authentication code" %> + <%= text_input f, :code %> + <%= hidden_input f, :mfa_token, value: @mfa_token %> + <%= hidden_input f, :state, value: @state %> + <%= hidden_input f, :redirect_uri, value: @redirect_uri %> + <%= hidden_input f, :challenge_type, value: "totp" %> +
+ +<%= submit "Verify" %> +<% end %> +"> + Enter a two-factor recovery code + diff --git a/lib/pleroma/web/templates/static_fe/static_fe/_attachment.html.eex b/lib/pleroma/web/templates/static_fe/static_fe/_attachment.html.eex index 7e04e9550..4853e7f4b 100644 --- a/lib/pleroma/web/templates/static_fe/static_fe/_attachment.html.eex +++ b/lib/pleroma/web/templates/static_fe/static_fe/_attachment.html.eex @@ -1,8 +1,8 @@ <%= case @mediaType do %> <% "audio" -> %> - + <% "video" -> %> - + <% _ -> %> -<%= @name %> +<%= @name %> <% end %> diff --git a/lib/pleroma/web/templates/static_fe/static_fe/_notice.html.eex b/lib/pleroma/web/templates/static_fe/static_fe/_notice.html.eex index df5e5eedd..df0244795 100644 --- a/lib/pleroma/web/templates/static_fe/static_fe/_notice.html.eex +++ b/lib/pleroma/web/templates/static_fe/static_fe/_notice.html.eex @@ -1,12 +1,16 @@ -
id="selected" <% end %>> +
id="selected" <% end %>>

- <%= link format_date(@published), to: @link, class: "activity-link" %> + + +

<%= render("_user_card.html", %{user: @user}) %>
<%= if @title != "" do %>
open<% end %>> - <%= raw @title %> + <%= raw @title %>
<%= raw @content %>
<% else %> diff --git a/lib/pleroma/web/templates/static_fe/static_fe/_user_card.html.eex b/lib/pleroma/web/templates/static_fe/static_fe/_user_card.html.eex index c7789f9ac..977b894d3 100644 --- a/lib/pleroma/web/templates/static_fe/static_fe/_user_card.html.eex +++ b/lib/pleroma/web/templates/static_fe/static_fe/_user_card.html.eex @@ -1,10 +1,10 @@
- +
- +
- <%= raw (@user.name |> Formatter.emojify(emoji_for_user(@user))) %> + <%= raw Formatter.emojify(@user.name, @user.emoji) %> <%= @user.nickname %> diff --git a/lib/pleroma/web/templates/static_fe/static_fe/profile.html.eex b/lib/pleroma/web/templates/static_fe/static_fe/profile.html.eex index 94063c92d..3191bf450 100644 --- a/lib/pleroma/web/templates/static_fe/static_fe/profile.html.eex +++ b/lib/pleroma/web/templates/static_fe/static_fe/profile.html.eex @@ -7,8 +7,8 @@ - <%= raw Formatter.emojify(@user.name, emoji_for_user(@user)) %> | - <%= link "@#{@user.nickname}@#{Endpoint.host()}", to: User.profile_url(@user) %> + <%= raw Formatter.emojify(@user.name, @user.emoji) %> | + <%= link "@#{@user.nickname}@#{Endpoint.host()}", to: (@user.uri || @user.ap_id) %>

<%= raw @user.bio %>

diff --git a/lib/pleroma/web/templates/twitter_api/remote_follow/follow_mfa.html.eex b/lib/pleroma/web/templates/twitter_api/remote_follow/follow_mfa.html.eex new file mode 100644 index 000000000..adc3a3e3d --- /dev/null +++ b/lib/pleroma/web/templates/twitter_api/remote_follow/follow_mfa.html.eex @@ -0,0 +1,13 @@ +<%= if @error do %> +

<%= @error %>

+<% end %> +

Two-factor authentication

+

<%= @followee.nickname %>

+ +<%= form_for @conn, remote_follow_path(@conn, :do_follow), [as: "mfa"], fn f -> %> +<%= text_input f, :code, placeholder: "Authentication code", required: true %> +
+<%= hidden_input f, :id, value: @followee.id %> +<%= hidden_input f, :token, value: @mfa_token %> +<%= submit "Authorize" %> +<% end %> diff --git a/lib/pleroma/web/twitter_api/controllers/remote_follow_controller.ex b/lib/pleroma/web/twitter_api/controllers/remote_follow_controller.ex index 89da760da..521dc9322 100644 --- a/lib/pleroma/web/twitter_api/controllers/remote_follow_controller.ex +++ b/lib/pleroma/web/twitter_api/controllers/remote_follow_controller.ex @@ -8,10 +8,12 @@ defmodule Pleroma.Web.TwitterAPI.RemoteFollowController do require Logger alias Pleroma.Activity + alias Pleroma.MFA alias Pleroma.Object.Fetcher alias Pleroma.Plugs.OAuthScopesPlug alias Pleroma.User alias Pleroma.Web.Auth.Authenticator + alias Pleroma.Web.Auth.TOTPAuthenticator alias Pleroma.Web.CommonAPI @status_types ["Article", "Event", "Note", "Video", "Page", "Question"] @@ -68,6 +70,8 @@ defp is_status?(acct) do # POST /ostatus_subscribe # + # adds a remote account in followers if user already is signed in. + # def do_follow(%{assigns: %{user: %User{} = user}} = conn, %{"user" => %{"id" => id}}) do with {:fetch_user, %User{} = followee} <- {:fetch_user, User.get_cached_by_id(id)}, {:ok, _, _, _} <- CommonAPI.follow(user, followee) do @@ -78,9 +82,33 @@ def do_follow(%{assigns: %{user: %User{} = user}} = conn, %{"user" => %{"id" => end end + # POST /ostatus_subscribe + # + # step 1. + # checks login\password and displays step 2 form of MFA if need. + # def do_follow(conn, %{"authorization" => %{"name" => _, "password" => _, "id" => id}}) do - with {:fetch_user, %User{} = followee} <- {:fetch_user, User.get_cached_by_id(id)}, + with {_, %User{} = followee} <- {:fetch_user, User.get_cached_by_id(id)}, {_, {:ok, user}, _} <- {:auth, Authenticator.get_user(conn), followee}, + {_, _, _, false} <- {:mfa_required, followee, user, MFA.require?(user)}, + {:ok, _, _, _} <- CommonAPI.follow(user, followee) do + redirect(conn, to: "/users/#{followee.id}") + else + error -> + handle_follow_error(conn, error) + end + end + + # POST /ostatus_subscribe + # + # step 2 + # checks TOTP code. otherwise displays form with errors + # + def do_follow(conn, %{"mfa" => %{"code" => code, "token" => token, "id" => id}}) do + with {_, %User{} = followee} <- {:fetch_user, User.get_cached_by_id(id)}, + {_, _, {:ok, %{user: user}}} <- {:mfa_token, followee, MFA.Token.validate(token)}, + {_, _, _, {:ok, _}} <- + {:verify_mfa_code, followee, token, TOTPAuthenticator.verify(code, user)}, {:ok, _, _, _} <- CommonAPI.follow(user, followee) do redirect(conn, to: "/users/#{followee.id}") else @@ -94,6 +122,23 @@ def do_follow(%{assigns: %{user: nil}} = conn, _) do render(conn, "followed.html", %{error: "Insufficient permissions: follow | write:follows."}) end + defp handle_follow_error(conn, {:mfa_token, followee, _} = _) do + render(conn, "follow_login.html", %{error: "Wrong username or password", followee: followee}) + end + + defp handle_follow_error(conn, {:verify_mfa_code, followee, token, _} = _) do + render(conn, "follow_mfa.html", %{ + error: "Wrong authentication code", + followee: followee, + mfa_token: token + }) + end + + defp handle_follow_error(conn, {:mfa_required, followee, user, _} = _) do + {:ok, %{token: token}} = MFA.Token.create_token(user) + render(conn, "follow_mfa.html", %{followee: followee, mfa_token: token, error: false}) + end + defp handle_follow_error(conn, {:auth, _, followee} = _) do render(conn, "follow_login.html", %{error: "Wrong username or password", followee: followee}) end diff --git a/lib/pleroma/web/twitter_api/controllers/util_controller.ex b/lib/pleroma/web/twitter_api/controllers/util_controller.ex index 2fc60da5a..76f4bb8f4 100644 --- a/lib/pleroma/web/twitter_api/controllers/util_controller.ex +++ b/lib/pleroma/web/twitter_api/controllers/util_controller.ex @@ -24,13 +24,6 @@ defmodule Pleroma.Web.TwitterAPI.UtilController do when action == :follow_import ) - # Note: follower can submit the form (with password auth) not being signed in (having no token) - plug( - OAuthScopesPlug, - %{fallback: :proceed_unauthenticated, scopes: ["follow", "write:follows"]} - when action == :do_remote_follow - ) - plug(OAuthScopesPlug, %{scopes: ["follow", "write:blocks"]} when action == :blocks_import) plug( @@ -128,15 +121,16 @@ def follow_import(conn, %{"list" => %Plug.Upload{} = listfile}) do end def follow_import(%{assigns: %{user: follower}} = conn, %{"list" => list}) do - with lines <- String.split(list, "\n"), - followed_identifiers <- - Enum.map(lines, fn line -> - String.split(line, ",") |> List.first() - end) - |> List.delete("Account address") do - User.follow_import(follower, followed_identifiers) - json(conn, "job started") - end + followed_identifiers = + list + |> String.split("\n") + |> Enum.map(&(&1 |> String.split(",") |> List.first())) + |> List.delete("Account address") + |> Enum.map(&(&1 |> String.trim() |> String.trim_leading("@"))) + |> Enum.reject(&(&1 == "")) + + User.follow_import(follower, followed_identifiers) + json(conn, "job started") end def blocks_import(conn, %{"list" => %Plug.Upload{} = listfile}) do @@ -144,10 +138,9 @@ def blocks_import(conn, %{"list" => %Plug.Upload{} = listfile}) do end def blocks_import(%{assigns: %{user: blocker}} = conn, %{"list" => list}) do - with blocked_identifiers <- String.split(list) do - User.blocks_import(blocker, blocked_identifiers) - json(conn, "job started") - end + blocked_identifiers = list |> String.split() |> Enum.map(&String.trim_leading(&1, "@")) + User.blocks_import(blocker, blocked_identifiers) + json(conn, "job started") end def change_password(%{assigns: %{user: user}} = conn, params) do diff --git a/lib/pleroma/web/twitter_api/twitter_api.ex b/lib/pleroma/web/twitter_api/twitter_api.ex index f9c0994da..5cfb385ac 100644 --- a/lib/pleroma/web/twitter_api/twitter_api.ex +++ b/lib/pleroma/web/twitter_api/twitter_api.ex @@ -3,81 +3,39 @@ # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.Web.TwitterAPI.TwitterAPI do + import Pleroma.Web.Gettext + alias Pleroma.Emails.Mailer alias Pleroma.Emails.UserEmail alias Pleroma.Repo alias Pleroma.User alias Pleroma.UserInviteToken - require Pleroma.Constants - def register_user(params, opts \\ []) do - token = params["token"] + params = + params + |> Map.take([:email, :token, :password]) + |> Map.put(:bio, params |> Map.get(:bio, "") |> User.parse_bio()) + |> Map.put(:nickname, params[:username]) + |> Map.put(:name, Map.get(params, :fullname, params[:username])) + |> Map.put(:password_confirmation, params[:password]) - params = %{ - nickname: params["nickname"], - name: params["fullname"], - bio: User.parse_bio(params["bio"]), - email: params["email"], - password: params["password"], - password_confirmation: params["confirm"], - captcha_solution: params["captcha_solution"], - captcha_token: params["captcha_token"], - captcha_answer_data: params["captcha_answer_data"] - } - - captcha_enabled = Pleroma.Config.get([Pleroma.Captcha, :enabled]) - # true if captcha is disabled or enabled and valid, false otherwise - captcha_ok = - if not captcha_enabled do - :ok - else - Pleroma.Captcha.validate( - params[:captcha_token], - params[:captcha_solution], - params[:captcha_answer_data] - ) - end - - # Captcha invalid - if captcha_ok != :ok do - {:error, error} = captcha_ok - # I have no idea how this error handling works - {:error, %{error: Jason.encode!(%{captcha: [error]})}} + if Pleroma.Config.get([:instance, :registrations_open]) do + create_user(params, opts) else - registration_process( - params, - %{ - registrations_open: Pleroma.Config.get([:instance, :registrations_open]), - token: token - }, - opts - ) + create_user_with_invite(params, opts) end end - defp registration_process(params, %{registrations_open: true}, opts) do - create_user(params, opts) - end - - defp registration_process(params, %{token: token}, opts) do - invite = - unless is_nil(token) do - Repo.get_by(UserInviteToken, %{token: token}) - end - - valid_invite? = invite && UserInviteToken.valid_invite?(invite) - - case invite do - nil -> - {:error, "Invalid token"} - - invite when valid_invite? -> - UserInviteToken.update_usage!(invite) - create_user(params, opts) - - _ -> - {:error, "Expired token"} + defp create_user_with_invite(params, opts) do + with %{token: token} when is_binary(token) <- params, + %UserInviteToken{} = invite <- Repo.get_by(UserInviteToken, %{token: token}), + true <- UserInviteToken.valid_invite?(invite) do + UserInviteToken.update_usage!(invite) + create_user(params, opts) + else + nil -> {:error, "Invalid token"} + _ -> {:error, "Expired token"} end end @@ -90,16 +48,17 @@ defp create_user(params, opts) do {:error, changeset} -> errors = - Ecto.Changeset.traverse_errors(changeset, fn {msg, _opts} -> msg end) + changeset + |> Ecto.Changeset.traverse_errors(fn {msg, _opts} -> msg end) |> Jason.encode!() - {:error, %{error: errors}} + {:error, errors} end end def password_reset(nickname_or_email) do with true <- is_binary(nickname_or_email), - %User{local: true, email: email} = user when not is_nil(email) <- + %User{local: true, email: email} = user when is_binary(email) <- User.get_by_nickname_or_email(nickname_or_email), {:ok, token_record} <- Pleroma.PasswordResetToken.create_token(user) do user @@ -121,4 +80,58 @@ def password_reset(nickname_or_email) do {:error, "unknown user"} end end + + def validate_captcha(app, params) do + if app.trusted || not Pleroma.Captcha.enabled?() do + :ok + else + do_validate_captcha(params) + end + end + + defp do_validate_captcha(params) do + with :ok <- validate_captcha_presence(params), + :ok <- + Pleroma.Captcha.validate( + params[:captcha_token], + params[:captcha_solution], + params[:captcha_answer_data] + ) do + :ok + else + {:error, :captcha_error} -> + captcha_error(dgettext("errors", "CAPTCHA Error")) + + {:error, :invalid} -> + captcha_error(dgettext("errors", "Invalid CAPTCHA")) + + {:error, :kocaptcha_service_unavailable} -> + captcha_error(dgettext("errors", "Kocaptcha service unavailable")) + + {:error, :expired} -> + captcha_error(dgettext("errors", "CAPTCHA expired")) + + {:error, :already_used} -> + captcha_error(dgettext("errors", "CAPTCHA already used")) + + {:error, :invalid_answer_data} -> + captcha_error(dgettext("errors", "Invalid answer data")) + + {:error, error} -> + captcha_error(error) + end + end + + defp validate_captcha_presence(params) do + [:captcha_solution, :captcha_token, :captcha_answer_data] + |> Enum.find_value(:ok, fn key -> + unless is_binary(params[key]) do + error = dgettext("errors", "Invalid CAPTCHA (Missing parameter: %{name})", name: key) + {:error, error} + end + end) + end + + # For some reason FE expects error message to be a serialized JSON + defp captcha_error(error), do: {:error, Jason.encode!(%{captcha: [error]})} end diff --git a/lib/pleroma/web/twitter_api/twitter_api_controller.ex b/lib/pleroma/web/twitter_api/twitter_api_controller.ex index 0229aea97..c2de26b0b 100644 --- a/lib/pleroma/web/twitter_api/twitter_api_controller.ex +++ b/lib/pleroma/web/twitter_api/twitter_api_controller.ex @@ -6,6 +6,7 @@ defmodule Pleroma.Web.TwitterAPI.Controller do use Pleroma.Web, :controller alias Pleroma.Notification + alias Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug alias Pleroma.Plugs.OAuthScopesPlug alias Pleroma.User alias Pleroma.Web.OAuth.Token @@ -13,9 +14,17 @@ defmodule Pleroma.Web.TwitterAPI.Controller do require Logger - plug(OAuthScopesPlug, %{scopes: ["write:notifications"]} when action == :notifications_read) + plug( + OAuthScopesPlug, + %{scopes: ["write:notifications"]} when action == :mark_notifications_as_read + ) - plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug) + plug( + :skip_plug, + [OAuthScopesPlug, EnsurePublicOrAuthenticatedPlug] when action == :confirm_email + ) + + plug(:skip_plug, OAuthScopesPlug when action in [:oauth_tokens, :revoke_token]) action_fallback(:errors) @@ -44,13 +53,13 @@ def revoke_token(%{assigns: %{user: user}} = conn, %{"id" => id} = _params) do json_reply(conn, 201, "") end - def errors(conn, {:param_cast, _}) do + defp errors(conn, {:param_cast, _}) do conn |> put_status(400) |> json("Invalid parameters") end - def errors(conn, _) do + defp errors(conn, _) do conn |> put_status(500) |> json("Something went wrong") @@ -62,7 +71,10 @@ defp json_reply(conn, status, json) do |> send_resp(status, json) end - def notifications_read(%{assigns: %{user: user}} = conn, %{"latest_id" => latest_id} = params) do + def mark_notifications_as_read( + %{assigns: %{user: user}} = conn, + %{"latest_id" => latest_id} = params + ) do Notification.set_read_up_to(user, latest_id) notifications = Notification.for_user(user, params) @@ -73,7 +85,7 @@ def notifications_read(%{assigns: %{user: user}} = conn, %{"latest_id" => latest |> render("index.json", %{notifications: notifications, for: user}) end - def notifications_read(%{assigns: %{user: _user}} = conn, _) do + def mark_notifications_as_read(%{assigns: %{user: _user}} = conn, _) do bad_request_reply(conn, "You need to specify latest_id") end diff --git a/lib/pleroma/web/views/streamer_view.ex b/lib/pleroma/web/views/streamer_view.ex index 443868878..237b29ded 100644 --- a/lib/pleroma/web/views/streamer_view.ex +++ b/lib/pleroma/web/views/streamer_view.ex @@ -25,7 +25,7 @@ def render("update.json", %Activity{} = activity, %User{} = user) do |> Jason.encode!() end - def render("notification.json", %User{} = user, %Notification{} = notify) do + def render("notification.json", %Notification{} = notify, %User{} = user) do %{ event: "notification", payload: diff --git a/lib/pleroma/web/web.ex b/lib/pleroma/web/web.ex index cf3ac1287..4f9281851 100644 --- a/lib/pleroma/web/web.ex +++ b/lib/pleroma/web/web.ex @@ -2,6 +2,11 @@ # Copyright © 2017-2020 Pleroma Authors # SPDX-License-Identifier: AGPL-3.0-only +defmodule Pleroma.Web.Plug do + # Substitute for `call/2` which is defined with `use Pleroma.Web, :plug` + @callback perform(Plug.Conn.t(), Plug.opts()) :: Plug.Conn.t() +end + defmodule Pleroma.Web do @moduledoc """ A module that keeps using definitions for controllers, @@ -20,11 +25,19 @@ defmodule Pleroma.Web do below. """ + alias Pleroma.Plugs.EnsureAuthenticatedPlug + alias Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug + alias Pleroma.Plugs.ExpectAuthenticatedCheckPlug + alias Pleroma.Plugs.ExpectPublicOrAuthenticatedCheckPlug + alias Pleroma.Plugs.OAuthScopesPlug + alias Pleroma.Plugs.PlugHelper + def controller do quote do use Phoenix.Controller, namespace: Pleroma.Web import Plug.Conn + import Pleroma.Web.Gettext import Pleroma.Web.Router.Helpers import Pleroma.Web.TranslationHelpers @@ -34,6 +47,79 @@ def controller do defp set_put_layout(conn, _) do put_layout(conn, Pleroma.Config.get(:app_layout, "app.html")) end + + # Marks plugs intentionally skipped and blocks their execution if present in plugs chain + defp skip_plug(conn, plug_modules) do + plug_modules + |> List.wrap() + |> Enum.reduce( + conn, + fn plug_module, conn -> + try do + plug_module.skip_plug(conn) + rescue + UndefinedFunctionError -> + raise "`#{plug_module}` is not skippable. Append `use Pleroma.Web, :plug` to its code." + end + end + ) + end + + # Executed just before actual controller action, invokes before-action hooks (callbacks) + defp action(conn, params) do + with %{halted: false} = conn <- maybe_drop_authentication_if_oauth_check_ignored(conn), + %{halted: false} = conn <- maybe_perform_public_or_authenticated_check(conn), + %{halted: false} = conn <- maybe_perform_authenticated_check(conn), + %{halted: false} = conn <- maybe_halt_on_missing_oauth_scopes_check(conn) do + super(conn, params) + end + end + + # For non-authenticated API actions, drops auth info if OAuth scopes check was ignored + # (neither performed nor explicitly skipped) + defp maybe_drop_authentication_if_oauth_check_ignored(conn) do + if PlugHelper.plug_called?(conn, ExpectPublicOrAuthenticatedCheckPlug) and + not PlugHelper.plug_called_or_skipped?(conn, OAuthScopesPlug) do + OAuthScopesPlug.drop_auth_info(conn) + else + conn + end + end + + # Ensures instance is public -or- user is authenticated if such check was scheduled + defp maybe_perform_public_or_authenticated_check(conn) do + if PlugHelper.plug_called?(conn, ExpectPublicOrAuthenticatedCheckPlug) do + EnsurePublicOrAuthenticatedPlug.call(conn, %{}) + else + conn + end + end + + # Ensures user is authenticated if such check was scheduled + # Note: runs prior to action even if it was already executed earlier in plug chain + # (since OAuthScopesPlug has option of proceeding unauthenticated) + defp maybe_perform_authenticated_check(conn) do + if PlugHelper.plug_called?(conn, ExpectAuthenticatedCheckPlug) do + EnsureAuthenticatedPlug.call(conn, %{}) + else + conn + end + end + + # Halts if authenticated API action neither performs nor explicitly skips OAuth scopes check + defp maybe_halt_on_missing_oauth_scopes_check(conn) do + if PlugHelper.plug_called?(conn, ExpectAuthenticatedCheckPlug) and + not PlugHelper.plug_called_or_skipped?(conn, OAuthScopesPlug) do + conn + |> render_error( + :forbidden, + "Security violation: OAuth scopes check was neither handled nor explicitly skipped." + ) + |> halt() + else + conn + end + end end end @@ -96,6 +182,50 @@ def channel do end end + def plug do + quote do + @behaviour Pleroma.Web.Plug + @behaviour Plug + + @doc """ + Marks a plug intentionally skipped and blocks its execution if it's present in plugs chain. + """ + def skip_plug(conn) do + PlugHelper.append_to_private_list( + conn, + PlugHelper.skipped_plugs_list_id(), + __MODULE__ + ) + end + + @impl Plug + @doc """ + Before-plug hook that + * ensures the plug is not skipped + * processes `:if_func` / `:unless_func` functional pre-run conditions + * adds plug to the list of called plugs and calls `perform/2` if checks are passed + + Note: multiple invocations of the same plug (with different or same options) are allowed. + """ + def call(%Plug.Conn{} = conn, options) do + if PlugHelper.plug_skipped?(conn, __MODULE__) || + (options[:if_func] && !options[:if_func].(conn)) || + (options[:unless_func] && options[:unless_func].(conn)) do + conn + else + conn = + PlugHelper.append_to_private_list( + conn, + PlugHelper.called_plugs_list_id(), + __MODULE__ + ) + + apply(__MODULE__, :perform, [conn, options]) + end + end + end + end + @doc """ When used, dispatch to the appropriate controller/view/etc. """ diff --git a/lib/pleroma/web/web_finger/web_finger.ex b/lib/pleroma/web/web_finger/web_finger.ex index 43a81c75d..71ccf251a 100644 --- a/lib/pleroma/web/web_finger/web_finger.ex +++ b/lib/pleroma/web/web_finger/web_finger.ex @@ -86,54 +86,24 @@ def represent_user(user, "XML") do |> XmlBuilder.to_doc() end - defp get_magic_key("data:application/magic-public-key," <> magic_key) do - {:ok, magic_key} - end - - defp get_magic_key(nil) do - Logger.debug("Undefined magic key.") - {:ok, nil} - end - - defp get_magic_key(_) do - {:error, "Missing magic key data."} - end - defp webfinger_from_xml(doc) do - with magic_key <- XML.string_from_xpath(~s{//Link[@rel="magic-public-key"]/@href}, doc), - {:ok, magic_key} <- get_magic_key(magic_key), - topic <- - XML.string_from_xpath( - ~s{//Link[@rel="http://schemas.google.com/g/2010#updates-from"]/@href}, - doc - ), - subject <- XML.string_from_xpath("//Subject", doc), - subscribe_address <- - XML.string_from_xpath( - ~s{//Link[@rel="http://ostatus.org/schema/1.0/subscribe"]/@template}, - doc - ), - ap_id <- - XML.string_from_xpath( - ~s{//Link[@rel="self" and @type="application/activity+json"]/@href}, - doc - ) do - data = %{ - "magic_key" => magic_key, - "topic" => topic, - "subject" => subject, - "subscribe_address" => subscribe_address, - "ap_id" => ap_id - } + subject = XML.string_from_xpath("//Subject", doc) - {:ok, data} - else - {:error, e} -> - {:error, e} + subscribe_address = + ~s{//Link[@rel="http://ostatus.org/schema/1.0/subscribe"]/@template} + |> XML.string_from_xpath(doc) - e -> - {:error, e} - end + ap_id = + ~s{//Link[@rel="self" and @type="application/activity+json"]/@href} + |> XML.string_from_xpath(doc) + + data = %{ + "subject" => subject, + "subscribe_address" => subscribe_address, + "ap_id" => ap_id + } + + {:ok, data} end defp webfinger_from_json(doc) do @@ -146,9 +116,6 @@ defp webfinger_from_json(doc) do {"application/ld+json; profile=\"https://www.w3.org/ns/activitystreams\"", "self"} -> Map.put(data, "ap_id", link["href"]) - {_, "http://ostatus.org/schema/1.0/subscribe"} -> - Map.put(data, "subscribe_address", link["template"]) - _ -> Logger.debug("Unhandled type: #{inspect(link["type"])}") data @@ -173,7 +140,8 @@ def find_lrdd_template(domain) do get_template_from_xml(body) else _ -> - with {:ok, %{body: body}} <- HTTP.get("https://#{domain}/.well-known/host-meta", []) do + with {:ok, %{body: body, status: status}} when status in 200..299 <- + HTTP.get("https://#{domain}/.well-known/host-meta", []) do get_template_from_xml(body) else e -> {:error, "Can't find LRDD template: #{inspect(e)}"} @@ -193,19 +161,21 @@ def finger(account) do URI.parse(account).host end + encoded_account = URI.encode("acct:#{account}") + address = case find_lrdd_template(domain) do {:ok, template} -> - String.replace(template, "{uri}", URI.encode(account)) + String.replace(template, "{uri}", encoded_account) _ -> - "https://#{domain}/.well-known/webfinger?resource=acct:#{account}" + "https://#{domain}/.well-known/webfinger?resource=#{encoded_account}" end with response <- HTTP.get( address, - Accept: "application/xrd+xml,application/jrd+json" + [{"accept", "application/xrd+xml,application/jrd+json"}] ), {:ok, %{status: status, body: body}} when status in 200..299 <- response do doc = XML.parse_document(body) diff --git a/lib/pleroma/workers/background_worker.ex b/lib/pleroma/workers/background_worker.ex index 0f8ece2c4..57c3a9c3a 100644 --- a/lib/pleroma/workers/background_worker.ex +++ b/lib/pleroma/workers/background_worker.ex @@ -35,7 +35,7 @@ def perform( _job ) do blocker = User.get_cached_by_id(blocker_id) - User.perform(:blocks_import, blocker, blocked_identifiers) + {:ok, User.perform(:blocks_import, blocker, blocked_identifiers)} end def perform( @@ -47,7 +47,7 @@ def perform( _job ) do follower = User.get_cached_by_id(follower_id) - User.perform(:follow_import, follower, followed_identifiers) + {:ok, User.perform(:follow_import, follower, followed_identifiers)} end def perform(%{"op" => "media_proxy_preload", "message" => message}, _job) do diff --git a/lib/pleroma/workers/scheduled_activity_worker.ex b/lib/pleroma/workers/scheduled_activity_worker.ex index 8905f4ad0..97d1efbfb 100644 --- a/lib/pleroma/workers/scheduled_activity_worker.ex +++ b/lib/pleroma/workers/scheduled_activity_worker.ex @@ -30,6 +30,8 @@ def perform(%{"activity_id" => activity_id}, _job) do end defp post_activity(%ScheduledActivity{user_id: user_id, params: params} = scheduled_activity) do + params = Map.new(params, fn {key, value} -> {String.to_existing_atom(key), value} end) + with {:delete, {:ok, _}} <- {:delete, ScheduledActivity.delete(scheduled_activity)}, {:user, %User{} = user} <- {:user, User.get_cached_by_id(user_id)}, {:post, {:ok, _}} <- {:post, CommonAPI.post(user, params)} do diff --git a/mix.exs b/mix.exs index 890979f8b..b8e663a03 100644 --- a/mix.exs +++ b/mix.exs @@ -36,13 +36,22 @@ def project do releases: [ pleroma: [ include_executables_for: [:unix], - applications: [ex_syslogger: :load, syslog: :load], - steps: [:assemble, ©_files/1, ©_nginx_config/1] + applications: [ex_syslogger: :load, syslog: :load, eldap: :transient], + steps: [:assemble, &put_otp_version/1, ©_files/1, ©_nginx_config/1] ] ] ] end + def put_otp_version(%{path: target_path} = release) do + File.write!( + Path.join([target_path, "OTP_VERSION"]), + Pleroma.OTPVersion.version() + ) + + release + end + def copy_files(%{path: target_path} = release) do File.cp_r!("./rel/files", target_path) release @@ -63,7 +72,14 @@ def copy_nginx_config(%{path: target_path} = release) do def application do [ mod: {Pleroma.Application, []}, - extra_applications: [:logger, :runtime_tools, :comeonin, :quack, :fast_sanitize, :ssl], + extra_applications: [ + :logger, + :runtime_tools, + :comeonin, + :quack, + :fast_sanitize, + :ssl + ], included_applications: [:ex_syslogger] ] end @@ -108,10 +124,10 @@ defp deps do {:ecto_enum, "~> 1.4"}, {:ecto_sql, "~> 3.3.2"}, {:postgrex, ">= 0.13.5"}, - {:oban, "~> 0.12.1"}, + {:oban, "~> 1.2"}, {:gettext, "~> 0.15"}, - {:comeonin, "~> 4.1.1"}, - {:pbkdf2_elixir, "~> 0.12.3"}, + {:pbkdf2_elixir, "~> 1.0"}, + {:bcrypt_elixir, "~> 2.0"}, {:trailing_format_plug, "~> 0.0.7"}, {:fast_sanitize, "~> 0.1"}, {:html_entities, "~> 0.5", override: true}, @@ -119,7 +135,15 @@ defp deps do {:calendar, "~> 0.17.4"}, {:cachex, "~> 3.2"}, {:poison, "~> 3.0", override: true}, - {:tesla, "~> 1.3", override: true}, + # {:tesla, "~> 1.3", override: true}, + {:tesla, + git: "https://git.pleroma.social/pleroma/elixir-libraries/tesla.git", + ref: "61b7503cef33f00834f78ddfafe0d5d9dec2270b", + override: true}, + {:castore, "~> 0.1"}, + {:cowlib, "~> 2.8", override: true}, + {:gun, + github: "ninenines/gun", ref: "e1a69b36b180a574c0ac314ced9613fdd52312cc", override: true}, {:jason, "~> 1.0"}, {:mogrify, "~> 0.6.1"}, {:ex_aws, "~> 2.1"}, @@ -159,6 +183,7 @@ defp deps do {:quack, "~> 0.1.1"}, {:joken, "~> 2.0"}, {:benchee, "~> 1.0"}, + {:pot, "~> 0.10.2"}, {:esshd, "~> 0.1.0", runtime: Application.get_env(:esshd, :enabled, false)}, {:ex_const, "~> 0.2"}, {:plug_static_index_html, "~> 1.0.0"}, @@ -166,12 +191,15 @@ defp deps do {:flake_id, "~> 0.1.0"}, {:remote_ip, git: "https://git.pleroma.social/pleroma/remote_ip.git", - ref: "825dc00aaba5a1b7c4202a532b696b595dd3bcb3"}, + ref: "b647d0deecaa3acb140854fe4bda5b7e1dc6d1c8"}, {:captcha, git: "https://git.pleroma.social/pleroma/elixir-libraries/elixir-captcha.git", ref: "e0f16822d578866e186a0974d65ad58cddc1e2ab"}, {:mox, "~> 0.5", only: :test}, - {:restarter, path: "./restarter"} + {:restarter, path: "./restarter"}, + {:open_api_spex, + git: "https://git.pleroma.social/pleroma/elixir-libraries/open_api_spex.git", + ref: "f296ac0924ba3cf79c7a588c4c252889df4c2edd"} ] ++ oauth_deps() end @@ -203,19 +231,26 @@ defp version(version) do identifier_filter = ~r/[^0-9a-z\-]+/i # Pre-release version, denoted from patch version with a hyphen + {tag, tag_err} = + System.cmd("git", ["describe", "--tags", "--abbrev=0"], stderr_to_stdout: true) + + {describe, describe_err} = System.cmd("git", ["describe", "--tags", "--abbrev=8"]) + {commit_hash, commit_hash_err} = System.cmd("git", ["rev-parse", "--short", "HEAD"]) + git_pre_release = - with {tag, 0} <- - System.cmd("git", ["describe", "--tags", "--abbrev=0"], stderr_to_stdout: true), - {describe, 0} <- System.cmd("git", ["describe", "--tags", "--abbrev=8"]) do - describe - |> String.trim() - |> String.replace(String.trim(tag), "") - |> String.trim_leading("-") - |> String.trim() - else - _ -> - {commit_hash, 0} = System.cmd("git", ["rev-parse", "--short", "HEAD"]) + cond do + tag_err == 0 and describe_err == 0 -> + describe + |> String.trim() + |> String.replace(String.trim(tag), "") + |> String.trim_leading("-") + |> String.trim() + + commit_hash_err == 0 -> "0-g" <> String.trim(commit_hash) + + true -> + "" end # Branch name as pre-release version component, denoted with a dot @@ -233,6 +268,8 @@ defp version(version) do |> String.replace(identifier_filter, "-") branch_name + else + _ -> "stable" end build_name = diff --git a/mix.lock b/mix.lock index 62e14924a..955b2bb37 100644 --- a/mix.lock +++ b/mix.lock @@ -5,14 +5,16 @@ "base64url": {:hex, :base64url, "0.0.1", "36a90125f5948e3afd7be97662a1504b934dd5dac78451ca6e9abf85a10286be", [:rebar], [], "hexpm"}, "bbcode": {:git, "https://git.pleroma.social/pleroma/elixir-libraries/bbcode.git", "f2d267675e9a7e1ad1ea9beb4cc23382762b66c2", [ref: "v0.2.0"]}, "bbcode_pleroma": {:hex, :bbcode_pleroma, "0.2.0", "d36f5bca6e2f62261c45be30fa9b92725c0655ad45c99025cb1c3e28e25803ef", [:mix], [{:nimble_parsec, "~> 0.5", [hex: :nimble_parsec, repo: "hexpm", optional: false]}], "hexpm", "19851074419a5fedb4ef49e1f01b30df504bb5dbb6d6adfc135238063bebd1c3"}, + "bcrypt_elixir": {:hex, :bcrypt_elixir, "2.2.0", "3df902b81ce7fa8867a2ae30d20a1da6877a2c056bfb116fd0bc8a5f0190cea4", [:make, :mix], [{:comeonin, "~> 5.3", [hex: :comeonin, repo: "hexpm", optional: false]}, {:elixir_make, "~> 0.6", [hex: :elixir_make, repo: "hexpm", optional: false]}], "hexpm", "762be3fcb779f08207531bc6612cca480a338e4b4357abb49f5ce00240a77d1e"}, "benchee": {:hex, :benchee, "1.0.1", "66b211f9bfd84bd97e6d1beaddf8fc2312aaabe192f776e8931cb0c16f53a521", [:mix], [{:deep_merge, "~> 1.0", [hex: :deep_merge, repo: "hexpm", optional: false]}], "hexpm", "3ad58ae787e9c7c94dd7ceda3b587ec2c64604563e049b2a0e8baafae832addb"}, "bunt": {:hex, :bunt, "0.2.0", "951c6e801e8b1d2cbe58ebbd3e616a869061ddadcc4863d0a2182541acae9a38", [:mix], [], "hexpm", "7af5c7e09fe1d40f76c8e4f9dd2be7cebd83909f31fee7cd0e9eadc567da8353"}, "cachex": {:hex, :cachex, "3.2.0", "a596476c781b0646e6cb5cd9751af2e2974c3e0d5498a8cab71807618b74fe2f", [:mix], [{:eternal, "~> 1.2", [hex: :eternal, repo: "hexpm", optional: false]}, {:jumper, "~> 1.0", [hex: :jumper, repo: "hexpm", optional: false]}, {:sleeplocks, "~> 1.1", [hex: :sleeplocks, repo: "hexpm", optional: false]}, {:unsafe, "~> 1.0", [hex: :unsafe, repo: "hexpm", optional: false]}], "hexpm", "aef93694067a43697ae0531727e097754a9e992a1e7946296f5969d6dd9ac986"}, "calendar": {:hex, :calendar, "0.17.6", "ec291cb2e4ba499c2e8c0ef5f4ace974e2f9d02ae9e807e711a9b0c7850b9aee", [:mix], [{:tzdata, "~> 0.5.20 or ~> 0.1.201603 or ~> 1.0", [hex: :tzdata, repo: "hexpm", optional: false]}], "hexpm", "738d0e17a93c2ccfe4ddc707bdc8e672e9074c8569498483feb1c4530fb91b2b"}, "captcha": {:git, "https://git.pleroma.social/pleroma/elixir-libraries/elixir-captcha.git", "e0f16822d578866e186a0974d65ad58cddc1e2ab", [ref: "e0f16822d578866e186a0974d65ad58cddc1e2ab"]}, + "castore": {:hex, :castore, "0.1.5", "591c763a637af2cc468a72f006878584bc6c306f8d111ef8ba1d4c10e0684010", [:mix], [], "hexpm", "6db356b2bc6cc22561e051ff545c20ad064af57647e436650aa24d7d06cd941a"}, "certifi": {:hex, :certifi, "2.5.1", "867ce347f7c7d78563450a18a6a28a8090331e77fa02380b4a21962a65d36ee5", [:rebar3], [{:parse_trans, "~>3.3", [hex: :parse_trans, repo: "hexpm", optional: false]}], "hexpm", "805abd97539caf89ec6d4732c91e62ba9da0cda51ac462380bbd28ee697a8c42"}, "combine": {:hex, :combine, "0.10.0", "eff8224eeb56498a2af13011d142c5e7997a80c8f5b97c499f84c841032e429f", [:mix], [], "hexpm", "1b1dbc1790073076580d0d1d64e42eae2366583e7aecd455d1215b0d16f2451b"}, - "comeonin": {:hex, :comeonin, "4.1.2", "3eb5620fd8e35508991664b4c2b04dd41e52f1620b36957be837c1d7784b7592", [:mix], [{:argon2_elixir, "~> 1.2", [hex: :argon2_elixir, repo: "hexpm", optional: true]}, {:bcrypt_elixir, "~> 0.12.1 or ~> 1.0", [hex: :bcrypt_elixir, repo: "hexpm", optional: true]}, {:pbkdf2_elixir, "~> 0.12", [hex: :pbkdf2_elixir, repo: "hexpm", optional: true]}], "hexpm", "d8700a0ca4dbb616c22c9b3f6dd539d88deaafec3efe66869d6370c9a559b3e9"}, + "comeonin": {:hex, :comeonin, "5.3.1", "7fe612b739c78c9c1a75186ef2d322ce4d25032d119823269d0aa1e2f1e20025", [:mix], [], "hexpm", "d6222483060c17f0977fad1b7401ef0c5863c985a64352755f366aee3799c245"}, "connection": {:hex, :connection, "1.0.4", "a1cae72211f0eef17705aaededacac3eb30e6625b04a6117c1b2db6ace7d5976", [:mix], [], "hexpm", "4a0850c9be22a43af9920a71ab17c051f5f7d45c209e40269a1938832510e4d9"}, "cors_plug": {:hex, :cors_plug, "1.5.2", "72df63c87e4f94112f458ce9d25800900cc88608c1078f0e4faddf20933eda6e", [:mix], [{:plug, "~> 1.3 or ~> 1.4 or ~> 1.5", [hex: :plug, repo: "hexpm", optional: false]}], "hexpm", "9af027d20dc12dd0c4345a6b87247e0c62965871feea0bfecf9764648b02cc69"}, "cowboy": {:hex, :cowboy, "2.7.0", "91ed100138a764355f43316b1d23d7ff6bdb0de4ea618cb5d8677c93a7a2f115", [:rebar3], [{:cowlib, "~> 2.8.0", [hex: :cowlib, repo: "hexpm", optional: false]}, {:ranch, "~> 1.7.1", [hex: :ranch, repo: "hexpm", optional: false]}], "hexpm", "04fd8c6a39edc6aaa9c26123009200fc61f92a3a94f3178c527b70b767c6e605"}, @@ -25,9 +27,10 @@ "decimal": {:hex, :decimal, "1.8.1", "a4ef3f5f3428bdbc0d35374029ffcf4ede8533536fa79896dd450168d9acdf3c", [:mix], [], "hexpm", "3cb154b00225ac687f6cbd4acc4b7960027c757a5152b369923ead9ddbca7aec"}, "deep_merge": {:hex, :deep_merge, "1.0.0", "b4aa1a0d1acac393bdf38b2291af38cb1d4a52806cf7a4906f718e1feb5ee961", [:mix], [], "hexpm", "ce708e5f094b9cd4e8f2be4f00d2f4250c4095be93f8cd6d018c753894885430"}, "earmark": {:hex, :earmark, "1.4.3", "364ca2e9710f6bff494117dbbd53880d84bebb692dafc3a78eb50aa3183f2bfd", [:mix], [], "hexpm", "8cf8a291ebf1c7b9539e3cddb19e9cef066c2441b1640f13c34c1d3cfc825fec"}, - "ecto": {:hex, :ecto, "3.3.3", "0830bf3aebcbf3d8c1a1811cd581773b6866886c012f52c0f027031fa96a0b53", [:mix], [{:decimal, "~> 1.6 or ~> 2.0", [hex: :decimal, repo: "hexpm", optional: false]}, {:jason, "~> 1.0", [hex: :jason, repo: "hexpm", optional: true]}], "hexpm", "12e368e3c2a2938d7776defaabdae40e82900fc4d8d66120ec1e01dfd8b93c3a"}, + "ecto": {:hex, :ecto, "3.4.0", "a7a83ab8359bf816ce729e5e65981ce25b9fc5adfc89c2ea3980f4fed0bfd7c1", [:mix], [{:decimal, "~> 1.6 or ~> 2.0", [hex: :decimal, repo: "hexpm", optional: false]}, {:jason, "~> 1.0", [hex: :jason, repo: "hexpm", optional: true]}], "hexpm", "5eed18252f5b5bbadec56a24112b531343507dbe046273133176b12190ce19cc"}, "ecto_enum": {:hex, :ecto_enum, "1.4.0", "d14b00e04b974afc69c251632d1e49594d899067ee2b376277efd8233027aec8", [:mix], [{:ecto, ">= 3.0.0", [hex: :ecto, repo: "hexpm", optional: false]}, {:ecto_sql, "> 3.0.0", [hex: :ecto_sql, repo: "hexpm", optional: false]}, {:mariaex, ">= 0.0.0", [hex: :mariaex, repo: "hexpm", optional: true]}, {:postgrex, ">= 0.0.0", [hex: :postgrex, repo: "hexpm", optional: true]}], "hexpm", "8fb55c087181c2b15eee406519dc22578fa60dd82c088be376d0010172764ee4"}, "ecto_sql": {:hex, :ecto_sql, "3.3.4", "aa18af12eb875fbcda2f75e608b3bd534ebf020fc4f6448e4672fcdcbb081244", [:mix], [{:db_connection, "~> 2.2", [hex: :db_connection, repo: "hexpm", optional: false]}, {:ecto, "~> 3.4 or ~> 3.3.3", [hex: :ecto, repo: "hexpm", optional: false]}, {:myxql, "~> 0.3.0", [hex: :myxql, repo: "hexpm", optional: true]}, {:postgrex, "~> 0.15.0", [hex: :postgrex, repo: "hexpm", optional: true]}, {:telemetry, "~> 0.4.0", [hex: :telemetry, repo: "hexpm", optional: false]}], "hexpm", "5eccbdbf92e3c6f213007a82d5dbba4cd9bb659d1a21331f89f408e4c0efd7a8"}, + "elixir_make": {:hex, :elixir_make, "0.6.0", "38349f3e29aff4864352084fc736fa7fa0f2995a819a737554f7ebd28b85aaab", [:mix], [], "hexpm", "d522695b93b7f0b4c0fcb2dfe73a6b905b1c301226a5a55cb42e5b14d509e050"}, "esshd": {:hex, :esshd, "0.1.1", "d4dd4c46698093a40a56afecce8a46e246eb35463c457c246dacba2e056f31b5", [:mix], [], "hexpm", "d73e341e3009d390aa36387dc8862860bf9f874c94d9fd92ade2926376f49981"}, "eternal": {:hex, :eternal, "1.2.1", "d5b6b2499ba876c57be2581b5b999ee9bdf861c647401066d3eeed111d096bc4", [:mix], [], "hexpm", "b14f1dc204321429479c569cfbe8fb287541184ed040956c8862cb7a677b8406"}, "ex2ms": {:hex, :ex2ms, "1.5.0", "19e27f9212be9a96093fed8cdfbef0a2b56c21237196d26760f11dfcfae58e97", [:mix], [], "hexpm"}, @@ -36,7 +39,7 @@ "ex_const": {:hex, :ex_const, "0.2.4", "d06e540c9d834865b012a17407761455efa71d0ce91e5831e86881b9c9d82448", [:mix], [], "hexpm", "96fd346610cc992b8f896ed26a98be82ac4efb065a0578f334a32d60a3ba9767"}, "ex_doc": {:hex, :ex_doc, "0.21.3", "857ec876b35a587c5d9148a2512e952e24c24345552259464b98bfbb883c7b42", [:mix], [{:earmark, "~> 1.4", [hex: :earmark, repo: "hexpm", optional: false]}, {:makeup_elixir, "~> 0.14", [hex: :makeup_elixir, repo: "hexpm", optional: false]}], "hexpm", "0db1ee8d1547ab4877c5b5dffc6604ef9454e189928d5ba8967d4a58a801f161"}, "ex_machina": {:hex, :ex_machina, "2.3.0", "92a5ad0a8b10ea6314b876a99c8c9e3f25f4dde71a2a835845b136b9adaf199a", [:mix], [{:ecto, "~> 2.2 or ~> 3.0", [hex: :ecto, repo: "hexpm", optional: true]}, {:ecto_sql, "~> 3.0", [hex: :ecto_sql, repo: "hexpm", optional: true]}], "hexpm", "b84f6af156264530b312a8ab98ac6088f6b77ae5fe2058305c81434aa01fbaf9"}, - "ex_syslogger": {:hex, :ex_syslogger, "1.5.0", "bc936ee3fd13d9e592cb4c3a1e8a55fccd33b05e3aa7b185f211f3ed263ff8f0", [:mix], [{:poison, ">= 1.5.0", [hex: :poison, repo: "hexpm", optional: true]}, {:syslog, "~> 1.0.5", [hex: :syslog, repo: "hexpm", optional: false]}], "hexpm", "f3b4b184dcdd5f356b7c26c6cd72ab0918ba9dfb4061ccfaf519e562942af87b"}, + "ex_syslogger": {:hex, :ex_syslogger, "1.5.2", "72b6aa2d47a236e999171f2e1ec18698740f40af0bd02c8c650bf5f1fd1bac79", [:mix], [{:poison, ">= 1.5.0", [hex: :poison, repo: "hexpm", optional: true]}, {:syslog, "~> 1.1.0", [hex: :syslog, repo: "hexpm", optional: false]}], "hexpm", "ab9fab4136dbc62651ec6f16fa4842f10cf02ab4433fa3d0976c01be99398399"}, "excoveralls": {:hex, :excoveralls, "0.12.2", "a513defac45c59e310ac42fcf2b8ae96f1f85746410f30b1ff2b710a4b6cd44b", [:mix], [{:hackney, "~> 1.0", [hex: :hackney, repo: "hexpm", optional: false]}, {:jason, "~> 1.0", [hex: :jason, repo: "hexpm", optional: false]}], "hexpm", "151c476331d49b45601ffc45f43cb3a8beb396b02a34e3777fea0ad34ae57d89"}, "fast_html": {:hex, :fast_html, "1.0.3", "2cc0d4b68496266a1530e0c852cafeaede0bd10cfdee26fda50dc696c203162f", [:make, :mix], [], "hexpm", "ab3d782b639d3c4655fbaec0f9d032c91f8cab8dd791ac7469c2381bc7c32f85"}, "fast_sanitize": {:hex, :fast_sanitize, "0.1.7", "2a7cd8734c88a2de6de55022104f8a3b87f1fdbe8bbf131d9049764b53d50d0d", [:mix], [{:fast_html, "~> 1.0", [hex: :fast_html, repo: "hexpm", optional: false]}, {:plug, "~> 1.8", [hex: :plug, repo: "hexpm", optional: false]}], "hexpm", "f39fe8ea08fbac17487c30bf09b7d9f3e12472e51fb07a88ffeb8fd17da8ab67"}, @@ -46,6 +49,7 @@ "gen_stage": {:hex, :gen_stage, "0.14.3", "d0c66f1c87faa301c1a85a809a3ee9097a4264b2edf7644bf5c123237ef732bf", [:mix], [], "hexpm"}, "gen_state_machine": {:hex, :gen_state_machine, "2.0.5", "9ac15ec6e66acac994cc442dcc2c6f9796cf380ec4b08267223014be1c728a95", [:mix], [], "hexpm"}, "gettext": {:hex, :gettext, "0.17.4", "f13088e1ec10ce01665cf25f5ff779e7df3f2dc71b37084976cf89d1aa124d5c", [:mix], [], "hexpm", "3c75b5ea8288e2ee7ea503ff9e30dfe4d07ad3c054576a6e60040e79a801e14d"}, + "gun": {:git, "https://github.com/ninenines/gun.git", "e1a69b36b180a574c0ac314ced9613fdd52312cc", [ref: "e1a69b36b180a574c0ac314ced9613fdd52312cc"]}, "hackney": {:hex, :hackney, "1.15.2", "07e33c794f8f8964ee86cebec1a8ed88db5070e52e904b8f12209773c1036085", [:rebar3], [{:certifi, "2.5.1", [hex: :certifi, repo: "hexpm", optional: false]}, {:idna, "6.0.0", [hex: :idna, repo: "hexpm", optional: false]}, {:metrics, "1.0.1", [hex: :metrics, repo: "hexpm", optional: false]}, {:mimerl, "~>1.1", [hex: :mimerl, repo: "hexpm", optional: false]}, {:ssl_verify_fun, "1.1.5", [hex: :ssl_verify_fun, repo: "hexpm", optional: false]}], "hexpm", "e0100f8ef7d1124222c11ad362c857d3df7cb5f4204054f9f0f4a728666591fc"}, "html_entities": {:hex, :html_entities, "0.5.1", "1c9715058b42c35a2ab65edc5b36d0ea66dd083767bef6e3edb57870ef556549", [:mix], [], "hexpm", "30efab070904eb897ff05cd52fa61c1025d7f8ef3a9ca250bc4e6513d16c32de"}, "html_sanitize_ex": {:hex, :html_sanitize_ex, "1.3.0", "f005ad692b717691203f940c686208aa3d8ffd9dd4bb3699240096a51fa9564e", [:mix], [{:mochiweb, "~> 2.15", [hex: :mochiweb, repo: "hexpm", optional: false]}], "hexpm"}, @@ -53,7 +57,7 @@ "httpoison": {:hex, :httpoison, "1.6.2", "ace7c8d3a361cebccbed19c283c349b3d26991eff73a1eaaa8abae2e3c8089b6", [:mix], [{:hackney, "~> 1.15 and >= 1.15.2", [hex: :hackney, repo: "hexpm", optional: false]}], "hexpm", "aa2c74bd271af34239a3948779612f87df2422c2fdcfdbcec28d9c105f0773fe"}, "idna": {:hex, :idna, "6.0.0", "689c46cbcdf3524c44d5f3dde8001f364cd7608a99556d8fbd8239a5798d4c10", [:rebar3], [{:unicode_util_compat, "0.4.1", [hex: :unicode_util_compat, repo: "hexpm", optional: false]}], "hexpm", "4bdd305eb64e18b0273864920695cb18d7a2021f31a11b9c5fbcd9a253f936e2"}, "inet_cidr": {:hex, :inet_cidr, "1.0.4", "a05744ab7c221ca8e395c926c3919a821eb512e8f36547c062f62c4ca0cf3d6e", [:mix], [], "hexpm", "64a2d30189704ae41ca7dbdd587f5291db5d1dda1414e0774c29ffc81088c1bc"}, - "jason": {:hex, :jason, "1.1.2", "b03dedea67a99223a2eaf9f1264ce37154564de899fd3d8b9a21b1a6fd64afe7", [:mix], [{:decimal, "~> 1.0", [hex: :decimal, repo: "hexpm", optional: true]}], "hexpm", "fdf843bca858203ae1de16da2ee206f53416bbda5dc8c9e78f43243de4bc3afe"}, + "jason": {:hex, :jason, "1.2.0", "10043418c42d2493d0ee212d3fddd25d7ffe484380afad769a0a38795938e448", [:mix], [{:decimal, "~> 1.0", [hex: :decimal, repo: "hexpm", optional: true]}], "hexpm", "116747dbe057794c3a3e4e143b7c8390b29f634e16c78a7f59ba75bfa6852e7f"}, "joken": {:hex, :joken, "2.2.0", "2daa1b12be05184aff7b5ace1d43ca1f81345962285fff3f88db74927c954d3a", [:mix], [{:jose, "~> 1.9", [hex: :jose, repo: "hexpm", optional: false]}], "hexpm", "b4f92e30388206f869dd25d1af628a1d99d7586e5cf0672f64d4df84c4d2f5e9"}, "jose": {:hex, :jose, "1.10.1", "16d8e460dae7203c6d1efa3f277e25b5af8b659febfc2f2eb4bacf87f128b80a", [:mix, :rebar3], [], "hexpm", "3c7ddc8a9394b92891db7c2771da94bf819834a1a4c92e30857b7d582e2f8257"}, "jumper": {:hex, :jumper, "1.0.1", "3c00542ef1a83532b72269fab9f0f0c82bf23a35e27d278bfd9ed0865cecabff", [:mix], [], "hexpm", "318c59078ac220e966d27af3646026db9b5a5e6703cb2aa3e26bcfaba65b7433"}, @@ -71,9 +75,10 @@ "myhtmlex": {:git, "https://git.pleroma.social/pleroma/myhtmlex.git", "ad0097e2f61d4953bfef20fb6abddf23b87111e6", [ref: "ad0097e2f61d4953bfef20fb6abddf23b87111e6", submodules: true]}, "nimble_parsec": {:hex, :nimble_parsec, "0.5.3", "def21c10a9ed70ce22754fdeea0810dafd53c2db3219a0cd54cf5526377af1c6", [:mix], [], "hexpm", "589b5af56f4afca65217a1f3eb3fee7e79b09c40c742fddc1c312b3ac0b3399f"}, "nodex": {:git, "https://git.pleroma.social/pleroma/nodex", "cb6730f943cfc6aad674c92161be23a8411f15d1", [ref: "cb6730f943cfc6aad674c92161be23a8411f15d1"]}, - "oban": {:hex, :oban, "0.12.1", "695e9490c6e0edfca616d80639528e448bd29b3bff7b7dd10a56c79b00a5d7fb", [:mix], [{:ecto_sql, "~> 3.1", [hex: :ecto_sql, repo: "hexpm", optional: false]}, {:jason, "~> 1.1", [hex: :jason, repo: "hexpm", optional: false]}, {:postgrex, "~> 0.14", [hex: :postgrex, repo: "hexpm", optional: false]}, {:telemetry, "~> 0.4", [hex: :telemetry, repo: "hexpm", optional: false]}], "hexpm", "c1d58d69b8b5a86e7167abbb8cc92764a66f25f12f6172052595067fc6a30a17"}, + "oban": {:hex, :oban, "1.2.0", "7cca94d341be43d220571e28f69131c4afc21095b25257397f50973d3fc59b07", [:mix], [{:ecto_sql, "~> 3.1", [hex: :ecto_sql, repo: "hexpm", optional: false]}, {:jason, "~> 1.1", [hex: :jason, repo: "hexpm", optional: false]}, {:postgrex, "~> 0.14", [hex: :postgrex, repo: "hexpm", optional: false]}, {:telemetry, "~> 0.4", [hex: :telemetry, repo: "hexpm", optional: false]}], "hexpm", "ba5f8b3f7d76967b3e23cf8014f6a13e4ccb33431e4808f036709a7f822362ee"}, + "open_api_spex": {:git, "https://git.pleroma.social/pleroma/elixir-libraries/open_api_spex.git", "f296ac0924ba3cf79c7a588c4c252889df4c2edd", [ref: "f296ac0924ba3cf79c7a588c4c252889df4c2edd"]}, "parse_trans": {:hex, :parse_trans, "3.3.0", "09765507a3c7590a784615cfd421d101aec25098d50b89d7aa1d66646bc571c1", [:rebar3], [], "hexpm", "17ef63abde837ad30680ea7f857dd9e7ced9476cdd7b0394432af4bfc241b960"}, - "pbkdf2_elixir": {:hex, :pbkdf2_elixir, "0.12.4", "8dd29ed783f2e12195d7e0a4640effc0a7c37e6537da491f1db01839eee6d053", [:mix], [], "hexpm", "595d09db74cb093b1903381c9de423276a931a2480a46a1a5dc7f932a2a6375b"}, + "pbkdf2_elixir": {:hex, :pbkdf2_elixir, "1.2.1", "9cbe354b58121075bd20eb83076900a3832324b7dd171a6895fab57b6bb2752c", [:mix], [{:comeonin, "~> 5.3", [hex: :comeonin, repo: "hexpm", optional: false]}], "hexpm", "d3b40a4a4630f0b442f19eca891fcfeeee4c40871936fed2f68e1c4faa30481f"}, "phoenix": {:hex, :phoenix, "1.4.13", "67271ad69b51f3719354604f4a3f968f83aa61c19199343656c9caee057ff3b8", [:mix], [{:jason, "~> 1.0", [hex: :jason, repo: "hexpm", optional: true]}, {:phoenix_pubsub, "~> 1.1", [hex: :phoenix_pubsub, repo: "hexpm", optional: false]}, {:plug, "~> 1.8.1 or ~> 1.9", [hex: :plug, repo: "hexpm", optional: false]}, {:plug_cowboy, "~> 1.0 or ~> 2.0", [hex: :plug_cowboy, repo: "hexpm", optional: true]}, {:telemetry, "~> 0.4", [hex: :telemetry, repo: "hexpm", optional: false]}], "hexpm", "ab765a0feddb81fc62e2116c827b5f068df85159c162bee760745276ad7ddc1b"}, "phoenix_ecto": {:hex, :phoenix_ecto, "4.1.0", "a044d0756d0464c5a541b4a0bf4bcaf89bffcaf92468862408290682c73ae50d", [:mix], [{:ecto, "~> 3.0", [hex: :ecto, repo: "hexpm", optional: false]}, {:phoenix_html, "~> 2.9", [hex: :phoenix_html, repo: "hexpm", optional: true]}, {:plug, "~> 1.0", [hex: :plug, repo: "hexpm", optional: false]}], "hexpm", "c5e666a341ff104d0399d8f0e4ff094559b2fde13a5985d4cb5023b2c2ac558b"}, "phoenix_html": {:hex, :phoenix_html, "2.14.0", "d8c6bc28acc8e65f8ea0080ee05aa13d912c8758699283b8d3427b655aabe284", [:mix], [{:plug, "~> 1.5", [hex: :plug, repo: "hexpm", optional: false]}], "hexpm", "b0bb30eda478a06dbfbe96728061a93833db3861a49ccb516f839ecb08493fbb"}, @@ -86,6 +91,7 @@ "poison": {:hex, :poison, "3.1.0", "d9eb636610e096f86f25d9a46f35a9facac35609a7591b3be3326e99a0484665", [:mix], [], "hexpm", "fec8660eb7733ee4117b85f55799fd3833eb769a6df71ccf8903e8dc5447cfce"}, "poolboy": {:hex, :poolboy, "1.5.2", "392b007a1693a64540cead79830443abf5762f5d30cf50bc95cb2c1aaafa006b", [:rebar3], [], "hexpm", "dad79704ce5440f3d5a3681c8590b9dc25d1a561e8f5a9c995281012860901e3"}, "postgrex": {:hex, :postgrex, "0.15.3", "5806baa8a19a68c4d07c7a624ccdb9b57e89cbc573f1b98099e3741214746ae4", [:mix], [{:connection, "~> 1.0", [hex: :connection, repo: "hexpm", optional: false]}, {:db_connection, "~> 2.1", [hex: :db_connection, repo: "hexpm", optional: false]}, {:decimal, "~> 1.5", [hex: :decimal, repo: "hexpm", optional: false]}, {:jason, "~> 1.0", [hex: :jason, repo: "hexpm", optional: true]}], "hexpm", "4737ce62a31747b4c63c12b20c62307e51bb4fcd730ca0c32c280991e0606c90"}, + "pot": {:hex, :pot, "0.10.2", "9895c83bcff8cd22d9f5bc79dfc88a188176b261b618ad70d93faf5c5ca36e67", [:rebar3], [], "hexpm", "ac589a8e296b7802681e93cd0a436faec117ea63e9916709c628df31e17e91e2"}, "prometheus": {:hex, :prometheus, "4.5.0", "8f4a2246fe0beb50af0f77c5e0a5bb78fe575c34a9655d7f8bc743aad1c6bf76", [:mix, :rebar3], [], "hexpm", "679b5215480fff612b8351f45c839d995a07ce403e42ff02f1c6b20960d41a4e"}, "prometheus_ecto": {:hex, :prometheus_ecto, "1.4.3", "3dd4da1812b8e0dbee81ea58bb3b62ed7588f2eae0c9e97e434c46807ff82311", [:mix], [{:ecto, "~> 2.0 or ~> 3.0", [hex: :ecto, repo: "hexpm", optional: false]}, {:prometheus_ex, "~> 1.1 or ~> 2.0 or ~> 3.0", [hex: :prometheus_ex, repo: "hexpm", optional: false]}], "hexpm", "8d66289f77f913b37eda81fd287340c17e61a447549deb28efc254532b2bed82"}, "prometheus_ex": {:hex, :prometheus_ex, "3.0.5", "fa58cfd983487fc5ead331e9a3e0aa622c67232b3ec71710ced122c4c453a02f", [:mix], [{:prometheus, "~> 4.0", [hex: :prometheus, repo: "hexpm", optional: false]}], "hexpm", "9fd13404a48437e044b288b41f76e64acd9735fb8b0e3809f494811dfa66d0fb"}, @@ -94,14 +100,14 @@ "quack": {:hex, :quack, "0.1.1", "cca7b4da1a233757fdb44b3334fce80c94785b3ad5a602053b7a002b5a8967bf", [:mix], [{:poison, ">= 1.0.0", [hex: :poison, repo: "hexpm", optional: false]}, {:tesla, "~> 1.2.0", [hex: :tesla, repo: "hexpm", optional: false]}], "hexpm", "d736bfa7444112eb840027bb887832a0e403a4a3437f48028c3b29a2dbbd2543"}, "ranch": {:hex, :ranch, "1.7.1", "6b1fab51b49196860b733a49c07604465a47bdb78aa10c1c16a3d199f7f8c881", [:rebar3], [], "hexpm", "451d8527787df716d99dc36162fca05934915db0b6141bbdac2ea8d3c7afc7d7"}, "recon": {:hex, :recon, "2.5.0", "2f7fcbec2c35034bade2f9717f77059dc54eb4e929a3049ca7ba6775c0bd66cd", [:mix, :rebar3], [], "hexpm", "72f3840fedd94f06315c523f6cecf5b4827233bed7ae3fe135b2a0ebeab5e196"}, - "remote_ip": {:git, "https://git.pleroma.social/pleroma/remote_ip.git", "825dc00aaba5a1b7c4202a532b696b595dd3bcb3", [ref: "825dc00aaba5a1b7c4202a532b696b595dd3bcb3"]}, + "remote_ip": {:git, "https://git.pleroma.social/pleroma/remote_ip.git", "b647d0deecaa3acb140854fe4bda5b7e1dc6d1c8", [ref: "b647d0deecaa3acb140854fe4bda5b7e1dc6d1c8"]}, "sleeplocks": {:hex, :sleeplocks, "1.1.1", "3d462a0639a6ef36cc75d6038b7393ae537ab394641beb59830a1b8271faeed3", [:rebar3], [], "hexpm", "84ee37aeff4d0d92b290fff986d6a95ac5eedf9b383fadfd1d88e9b84a1c02e1"}, "ssl_verify_fun": {:hex, :ssl_verify_fun, "1.1.5", "6eaf7ad16cb568bb01753dbbd7a95ff8b91c7979482b95f38443fe2c8852a79b", [:make, :mix, :rebar3], [], "hexpm", "13104d7897e38ed7f044c4de953a6c28597d1c952075eb2e328bc6d6f2bfc496"}, "sweet_xml": {:hex, :sweet_xml, "0.6.6", "fc3e91ec5dd7c787b6195757fbcf0abc670cee1e4172687b45183032221b66b8", [:mix], [], "hexpm", "2e1ec458f892ffa81f9f8386e3f35a1af6db7a7a37748a64478f13163a1f3573"}, "swoosh": {:hex, :swoosh, "0.23.5", "bfd9404bbf5069b1be2ffd317923ce57e58b332e25dbca2a35dedd7820dfee5a", [:mix], [{:cowboy, "~> 1.0.1 or ~> 1.1 or ~> 2.4", [hex: :cowboy, repo: "hexpm", optional: true]}, {:gen_smtp, "~> 0.13", [hex: :gen_smtp, repo: "hexpm", optional: true]}, {:hackney, "~> 1.9", [hex: :hackney, repo: "hexpm", optional: false]}, {:jason, "~> 1.0", [hex: :jason, repo: "hexpm", optional: false]}, {:mail, "~> 0.2", [hex: :mail, repo: "hexpm", optional: true]}, {:mime, "~> 1.1", [hex: :mime, repo: "hexpm", optional: false]}, {:plug_cowboy, ">= 1.0.0", [hex: :plug_cowboy, repo: "hexpm", optional: true]}], "hexpm", "e3928e1d2889a308aaf3e42755809ac21cffd77cb58eef01cbfdab4ce2fd1e21"}, - "syslog": {:hex, :syslog, "1.0.6", "995970c9aa7feb380ac493302138e308d6e04fd57da95b439a6df5bb3bf75076", [:rebar3], [], "hexpm", "769ddfabd0d2a16f3f9c17eb7509951e0ca4f68363fb26f2ee51a8ec4a49881a"}, + "syslog": {:hex, :syslog, "1.1.0", "6419a232bea84f07b56dc575225007ffe34d9fdc91abe6f1b2f254fd71d8efc2", [:rebar3], [], "hexpm", "4c6a41373c7e20587be33ef841d3de6f3beba08519809329ecc4d27b15b659e1"}, "telemetry": {:hex, :telemetry, "0.4.1", "ae2718484892448a24470e6aa341bc847c3277bfb8d4e9289f7474d752c09c7f", [:rebar3], [], "hexpm", "4738382e36a0a9a2b6e25d67c960e40e1a2c95560b9f936d8e29de8cd858480f"}, - "tesla": {:hex, :tesla, "1.3.2", "deb92c5c9ce35e747a395ba413ca78593a4f75bf0e1545630ee2e3d34264021e", [:mix], [{:castore, "~> 0.1", [hex: :castore, repo: "hexpm", optional: true]}, {:exjsx, ">= 3.0.0", [hex: :exjsx, repo: "hexpm", optional: true]}, {:fuse, "~> 2.4", [hex: :fuse, repo: "hexpm", optional: true]}, {:gun, "~> 1.3", [hex: :gun, repo: "hexpm", optional: true]}, {:hackney, "~> 1.6", [hex: :hackney, repo: "hexpm", optional: true]}, {:ibrowse, "~> 4.4.0", [hex: :ibrowse, repo: "hexpm", optional: true]}, {:jason, ">= 1.0.0", [hex: :jason, repo: "hexpm", optional: true]}, {:mime, "~> 1.0", [hex: :mime, repo: "hexpm", optional: false]}, {:mint, "~> 1.0", [hex: :mint, repo: "hexpm", optional: true]}, {:poison, ">= 1.0.0", [hex: :poison, repo: "hexpm", optional: true]}, {:telemetry, "~> 0.3", [hex: :telemetry, repo: "hexpm", optional: true]}], "hexpm", "7567704c4790e21bd9a961b56d0b6a988ff68cc4dacfe6b2106e258da1d5cdda"}, + "tesla": {:git, "https://git.pleroma.social/pleroma/elixir-libraries/tesla.git", "61b7503cef33f00834f78ddfafe0d5d9dec2270b", [ref: "61b7503cef33f00834f78ddfafe0d5d9dec2270b"]}, "timex": {:hex, :timex, "3.6.1", "efdf56d0e67a6b956cc57774353b0329c8ab7726766a11547e529357ffdc1d56", [:mix], [{:combine, "~> 0.10", [hex: :combine, repo: "hexpm", optional: false]}, {:gettext, "~> 0.10", [hex: :gettext, repo: "hexpm", optional: false]}, {:tzdata, "~> 0.1.8 or ~> 0.5 or ~> 1.0.0", [hex: :tzdata, repo: "hexpm", optional: false]}], "hexpm", "f354efb2400dd7a80fd9eb6c8419068c4f632da4ac47f3d8822d6e33f08bc852"}, "trailing_format_plug": {:hex, :trailing_format_plug, "0.0.7", "64b877f912cf7273bed03379936df39894149e35137ac9509117e59866e10e45", [:mix], [{:plug, "> 0.12.0", [hex: :plug, repo: "hexpm", optional: false]}], "hexpm", "bd4fde4c15f3e993a999e019d64347489b91b7a9096af68b2bdadd192afa693f"}, "tzdata": {:hex, :tzdata, "0.5.22", "f2ba9105117ee0360eae2eca389783ef7db36d533899b2e84559404dbc77ebb8", [:mix], [{:hackney, "~> 1.0", [hex: :hackney, repo: "hexpm", optional: false]}], "hexpm", "cd66c8a1e6a9e121d1f538b01bef459334bb4029a1ffb4eeeb5e4eae0337e7b6"}, diff --git a/priv/gettext/en/LC_MESSAGES/errors.po b/priv/gettext/en/LC_MESSAGES/errors.po deleted file mode 100644 index 25a2f73e4..000000000 --- a/priv/gettext/en/LC_MESSAGES/errors.po +++ /dev/null @@ -1,465 +0,0 @@ -## `msgid`s in this file come from POT (.pot) files. -## -## Do not add, change, or remove `msgid`s manually here as -## they're tied to the ones in the corresponding POT file -## (with the same domain). -## -## Use `mix gettext.extract --merge` or `mix gettext.merge` -## to merge POT files into PO files. -msgid "" -msgstr "" -"Language: en\n" - -## From Ecto.Changeset.cast/4 -msgid "can't be blank" -msgstr "" - -## From Ecto.Changeset.unique_constraint/3 -msgid "has already been taken" -msgstr "" - -## From Ecto.Changeset.put_change/3 -msgid "is invalid" -msgstr "" - -## From Ecto.Changeset.validate_format/3 -msgid "has invalid format" -msgstr "" - -## From Ecto.Changeset.validate_subset/3 -msgid "has an invalid entry" -msgstr "" - -## From Ecto.Changeset.validate_exclusion/3 -msgid "is reserved" -msgstr "" - -## From Ecto.Changeset.validate_confirmation/3 -msgid "does not match confirmation" -msgstr "" - -## From Ecto.Changeset.no_assoc_constraint/3 -msgid "is still associated with this entry" -msgstr "" - -msgid "are still associated with this entry" -msgstr "" - -## From Ecto.Changeset.validate_length/3 -msgid "should be %{count} character(s)" -msgid_plural "should be %{count} character(s)" -msgstr[0] "" -msgstr[1] "" - -msgid "should have %{count} item(s)" -msgid_plural "should have %{count} item(s)" -msgstr[0] "" -msgstr[1] "" - -msgid "should be at least %{count} character(s)" -msgid_plural "should be at least %{count} character(s)" -msgstr[0] "" -msgstr[1] "" - -msgid "should have at least %{count} item(s)" -msgid_plural "should have at least %{count} item(s)" -msgstr[0] "" -msgstr[1] "" - -msgid "should be at most %{count} character(s)" -msgid_plural "should be at most %{count} character(s)" -msgstr[0] "" -msgstr[1] "" - -msgid "should have at most %{count} item(s)" -msgid_plural "should have at most %{count} item(s)" -msgstr[0] "" -msgstr[1] "" - -## From Ecto.Changeset.validate_number/3 -msgid "must be less than %{number}" -msgstr "" - -msgid "must be greater than %{number}" -msgstr "" - -msgid "must be less than or equal to %{number}" -msgstr "" - -msgid "must be greater than or equal to %{number}" -msgstr "" - -msgid "must be equal to %{number}" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:381 -msgid "Account not found" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:153 -msgid "Already voted" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/oauth/oauth_controller.ex:263 -msgid "Bad request" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:254 -msgid "Can't delete object" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:569 -msgid "Can't delete this post" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:1731 -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:1737 -msgid "Can't display this activity" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:195 -msgid "Can't find user" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:1148 -msgid "Can't get favorites" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:263 -msgid "Can't like object" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/common_api/utils.ex:518 -msgid "Cannot post an empty status without attachments" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/common_api/utils.ex:461 -msgid "Comment must be up to %{max_size} characters" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/admin_api/config.ex:63 -msgid "Config with params %{params} not found" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:78 -msgid "Could not delete" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:110 -msgid "Could not favorite" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:310 -msgid "Could not pin" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:89 -msgid "Could not repeat" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:120 -msgid "Could not unfavorite" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:327 -msgid "Could not unpin" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:99 -msgid "Could not unrepeat" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:392 -msgid "Could not update state" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:1271 -msgid "Error." -msgstr "" - -#, elixir-format -#: lib/pleroma/captcha/kocaptcha.ex:36 -msgid "Invalid CAPTCHA" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:1700 -#: lib/pleroma/web/oauth/oauth_controller.ex:465 -msgid "Invalid credentials" -msgstr "" - -#, elixir-format -#: lib/pleroma/plugs/ensure_authenticated_plug.ex:20 -msgid "Invalid credentials." -msgstr "" - -#, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:154 -msgid "Invalid indices" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/admin_api/admin_api_controller.ex:411 -msgid "Invalid parameters" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/common_api/utils.ex:377 -msgid "Invalid password." -msgstr "" - -#, elixir-format -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:163 -msgid "Invalid request" -msgstr "" - -#, elixir-format -#: lib/pleroma/captcha/kocaptcha.ex:16 -msgid "Kocaptcha service unavailable" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:1696 -msgid "Missing parameters" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/common_api/utils.ex:496 -msgid "No such conversation" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/admin_api/admin_api_controller.ex:163 -#: lib/pleroma/web/admin_api/admin_api_controller.ex:206 -msgid "No such permission_group" -msgstr "" - -#, elixir-format -#: lib/pleroma/plugs/uploaded_media.ex:69 -#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:311 -#: lib/pleroma/web/admin_api/admin_api_controller.ex:399 -#: lib/pleroma/web/mastodon_api/subscription_controller.ex:63 -#: lib/pleroma/web/ostatus/ostatus_controller.ex:248 -msgid "Not found" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:152 -msgid "Poll's author can't vote" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:443 -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:444 -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:473 -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:476 -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:1180 -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:1564 -msgid "Record not found" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/admin_api/admin_api_controller.ex:417 -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:1570 -#: lib/pleroma/web/mastodon_api/subscription_controller.ex:69 -#: lib/pleroma/web/ostatus/ostatus_controller.ex:252 -msgid "Something went wrong" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:253 -msgid "The message visibility must be direct" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/common_api/utils.ex:521 -msgid "The status is over the character limit" -msgstr "" - -#, elixir-format -#: lib/pleroma/plugs/ensure_public_or_authenticated_plug.ex:27 -msgid "This resource requires authentication." -msgstr "" - -#, elixir-format -#: lib/pleroma/plugs/rate_limiter.ex:89 -msgid "Throttled" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:155 -msgid "Too many choices" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:268 -msgid "Unhandled activity type" -msgstr "" - -#, elixir-format -#: lib/pleroma/plugs/user_is_admin_plug.ex:20 -msgid "User is not admin." -msgstr "" - -#, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:380 -msgid "Valid `account_id` required" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/admin_api/admin_api_controller.ex:185 -msgid "You can't revoke your own admin status." -msgstr "" - -#, elixir-format -#: lib/pleroma/web/oauth/oauth_controller.ex:216 -msgid "Your account is currently disabled" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/oauth/oauth_controller.ex:158 -#: lib/pleroma/web/oauth/oauth_controller.ex:213 -msgid "Your login is missing a confirmed e-mail address" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:221 -msgid "can't read inbox of %{nickname} as %{as_nickname}" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:297 -msgid "can't update outbox of %{nickname} as %{as_nickname}" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:335 -msgid "conversation is already muted" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:192 -#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:317 -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:1196 -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:1247 -msgid "error" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:789 -msgid "mascots can only be images" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:34 -msgid "not found" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/oauth/oauth_controller.ex:298 -msgid "Bad OAuth request." -msgstr "" - -#, elixir-format -#: lib/pleroma/captcha/captcha.ex:92 -msgid "CAPTCHA already used" -msgstr "" - -#, elixir-format -#: lib/pleroma/captcha/captcha.ex:89 -msgid "CAPTCHA expired" -msgstr "" - -#, elixir-format -#: lib/pleroma/plugs/uploaded_media.ex:50 -msgid "Failed" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/oauth/oauth_controller.ex:314 -msgid "Failed to authenticate: %{message}." -msgstr "" - -#, elixir-format -#: lib/pleroma/web/oauth/oauth_controller.ex:345 -msgid "Failed to set up user account." -msgstr "" - -#, elixir-format -#: lib/pleroma/plugs/oauth_scopes_plug.ex:37 -msgid "Insufficient permissions: %{permissions}." -msgstr "" - -#, elixir-format -#: lib/pleroma/plugs/uploaded_media.ex:89 -msgid "Internal Error" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/oauth/fallback_controller.ex:22 -#: lib/pleroma/web/oauth/fallback_controller.ex:29 -msgid "Invalid Username/Password" -msgstr "" - -#, elixir-format -#: lib/pleroma/captcha/captcha.ex:107 -msgid "Invalid answer data" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/nodeinfo/nodeinfo_controller.ex:204 -msgid "Nodeinfo schema version not handled" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/oauth/oauth_controller.ex:145 -msgid "This action is outside the authorized scopes" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/oauth/fallback_controller.ex:14 -msgid "Unknown error, please check the details and try again." -msgstr "" - -#, elixir-format -#: lib/pleroma/web/oauth/oauth_controller.ex:93 -#: lib/pleroma/web/oauth/oauth_controller.ex:131 -msgid "Unlisted redirect_uri." -msgstr "" - -#, elixir-format -#: lib/pleroma/web/oauth/oauth_controller.ex:294 -msgid "Unsupported OAuth provider: %{provider}." -msgstr "" - -#, elixir-format -#: lib/pleroma/uploaders/uploader.ex:71 -msgid "Uploader callback timeout" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/uploader_controller.ex:11 -#: lib/pleroma/web/uploader_controller.ex:23 -msgid "bad request" -msgstr "" diff --git a/priv/gettext/errors.pot b/priv/gettext/errors.pot index 2fd9c42e3..0e1cf37eb 100644 --- a/priv/gettext/errors.pot +++ b/priv/gettext/errors.pot @@ -90,326 +90,312 @@ msgid "must be equal to %{number}" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:381 +#: lib/pleroma/web/common_api/common_api.ex:421 msgid "Account not found" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:153 +#: lib/pleroma/web/common_api/common_api.ex:249 msgid "Already voted" msgstr "" #, elixir-format -#: lib/pleroma/web/oauth/oauth_controller.ex:263 +#: lib/pleroma/web/oauth/oauth_controller.ex:360 msgid "Bad request" msgstr "" #, elixir-format -#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:254 +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:425 msgid "Can't delete object" msgstr "" #, elixir-format -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:569 +#: lib/pleroma/web/mastodon_api/controllers/status_controller.ex:196 msgid "Can't delete this post" msgstr "" #, elixir-format -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:1731 -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:1737 +#: lib/pleroma/web/controller_helper.ex:95 +#: lib/pleroma/web/controller_helper.ex:101 msgid "Can't display this activity" msgstr "" #, elixir-format -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:195 +#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:227 +#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:254 msgid "Can't find user" msgstr "" #, elixir-format -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:1148 +#: lib/pleroma/web/pleroma_api/controllers/account_controller.ex:114 msgid "Can't get favorites" msgstr "" #, elixir-format -#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:263 +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:437 msgid "Can't like object" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/utils.ex:518 +#: lib/pleroma/web/common_api/utils.ex:556 msgid "Cannot post an empty status without attachments" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/utils.ex:461 +#: lib/pleroma/web/common_api/utils.ex:504 msgid "Comment must be up to %{max_size} characters" msgstr "" #, elixir-format -#: lib/pleroma/web/admin_api/config.ex:63 +#: lib/pleroma/config/config_db.ex:222 msgid "Config with params %{params} not found" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:78 +#: lib/pleroma/web/common_api/common_api.ex:95 msgid "Could not delete" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:110 +#: lib/pleroma/web/common_api/common_api.ex:141 msgid "Could not favorite" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:310 +#: lib/pleroma/web/common_api/common_api.ex:370 msgid "Could not pin" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:89 +#: lib/pleroma/web/common_api/common_api.ex:112 msgid "Could not repeat" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:120 +#: lib/pleroma/web/common_api/common_api.ex:188 msgid "Could not unfavorite" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:327 +#: lib/pleroma/web/common_api/common_api.ex:380 msgid "Could not unpin" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:99 +#: lib/pleroma/web/common_api/common_api.ex:126 msgid "Could not unrepeat" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:392 +#: lib/pleroma/web/common_api/common_api.ex:428 +#: lib/pleroma/web/common_api/common_api.ex:437 msgid "Could not update state" msgstr "" #, elixir-format -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:1271 +#: lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex:202 msgid "Error." msgstr "" #, elixir-format -#: lib/pleroma/captcha/kocaptcha.ex:36 +#: lib/pleroma/web/twitter_api/twitter_api.ex:106 msgid "Invalid CAPTCHA" msgstr "" #, elixir-format -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:1700 -#: lib/pleroma/web/oauth/oauth_controller.ex:465 +#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:117 +#: lib/pleroma/web/oauth/oauth_controller.ex:569 msgid "Invalid credentials" msgstr "" #, elixir-format -#: lib/pleroma/plugs/ensure_authenticated_plug.ex:20 +#: lib/pleroma/plugs/ensure_authenticated_plug.ex:38 msgid "Invalid credentials." msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:154 +#: lib/pleroma/web/common_api/common_api.ex:265 msgid "Invalid indices" msgstr "" #, elixir-format -#: lib/pleroma/web/admin_api/admin_api_controller.ex:411 +#: lib/pleroma/web/admin_api/admin_api_controller.ex:1147 msgid "Invalid parameters" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/utils.ex:377 +#: lib/pleroma/web/common_api/utils.ex:411 msgid "Invalid password." msgstr "" #, elixir-format -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:163 +#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:187 msgid "Invalid request" msgstr "" #, elixir-format -#: lib/pleroma/captcha/kocaptcha.ex:16 +#: lib/pleroma/web/twitter_api/twitter_api.ex:109 msgid "Kocaptcha service unavailable" msgstr "" #, elixir-format -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:1696 +#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:113 msgid "Missing parameters" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/utils.ex:496 +#: lib/pleroma/web/common_api/utils.ex:540 msgid "No such conversation" msgstr "" #, elixir-format -#: lib/pleroma/web/admin_api/admin_api_controller.ex:163 -#: lib/pleroma/web/admin_api/admin_api_controller.ex:206 +#: lib/pleroma/web/admin_api/admin_api_controller.ex:439 +#: lib/pleroma/web/admin_api/admin_api_controller.ex:465 lib/pleroma/web/admin_api/admin_api_controller.ex:507 msgid "No such permission_group" msgstr "" #, elixir-format -#: lib/pleroma/plugs/uploaded_media.ex:69 -#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:311 -#: lib/pleroma/web/admin_api/admin_api_controller.ex:399 -#: lib/pleroma/web/mastodon_api/subscription_controller.ex:63 -#: lib/pleroma/web/ostatus/ostatus_controller.ex:248 +#: lib/pleroma/plugs/uploaded_media.ex:74 +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:485 lib/pleroma/web/admin_api/admin_api_controller.ex:1135 +#: lib/pleroma/web/feed/user_controller.ex:73 lib/pleroma/web/ostatus/ostatus_controller.ex:143 msgid "Not found" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:152 +#: lib/pleroma/web/common_api/common_api.ex:241 msgid "Poll's author can't vote" msgstr "" #, elixir-format -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:443 -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:444 -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:473 -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:476 -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:1180 -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:1564 +#: lib/pleroma/web/mastodon_api/controllers/fallback_controller.ex:20 +#: lib/pleroma/web/mastodon_api/controllers/poll_controller.ex:37 lib/pleroma/web/mastodon_api/controllers/poll_controller.ex:49 +#: lib/pleroma/web/mastodon_api/controllers/poll_controller.ex:50 lib/pleroma/web/mastodon_api/controllers/status_controller.ex:290 +#: lib/pleroma/web/mastodon_api/controllers/subscription_controller.ex:71 msgid "Record not found" msgstr "" #, elixir-format -#: lib/pleroma/web/admin_api/admin_api_controller.ex:417 -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:1570 -#: lib/pleroma/web/mastodon_api/subscription_controller.ex:69 -#: lib/pleroma/web/ostatus/ostatus_controller.ex:252 +#: lib/pleroma/web/admin_api/admin_api_controller.ex:1153 +#: lib/pleroma/web/feed/user_controller.ex:79 lib/pleroma/web/mastodon_api/controllers/fallback_controller.ex:32 +#: lib/pleroma/web/ostatus/ostatus_controller.ex:149 msgid "Something went wrong" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:253 +#: lib/pleroma/web/common_api/activity_draft.ex:107 msgid "The message visibility must be direct" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/utils.ex:521 +#: lib/pleroma/web/common_api/utils.ex:566 msgid "The status is over the character limit" msgstr "" #, elixir-format -#: lib/pleroma/plugs/ensure_public_or_authenticated_plug.ex:27 +#: lib/pleroma/plugs/ensure_public_or_authenticated_plug.ex:31 msgid "This resource requires authentication." msgstr "" #, elixir-format -#: lib/pleroma/plugs/rate_limiter.ex:89 +#: lib/pleroma/plugs/rate_limiter/rate_limiter.ex:206 msgid "Throttled" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:155 +#: lib/pleroma/web/common_api/common_api.ex:266 msgid "Too many choices" msgstr "" #, elixir-format -#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:268 +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:442 msgid "Unhandled activity type" msgstr "" #, elixir-format -#: lib/pleroma/plugs/user_is_admin_plug.ex:20 -msgid "User is not admin." -msgstr "" - -#, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:380 -msgid "Valid `account_id` required" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/admin_api/admin_api_controller.ex:185 +#: lib/pleroma/web/admin_api/admin_api_controller.ex:536 msgid "You can't revoke your own admin status." msgstr "" #, elixir-format -#: lib/pleroma/web/oauth/oauth_controller.ex:216 +#: lib/pleroma/web/oauth/oauth_controller.ex:218 +#: lib/pleroma/web/oauth/oauth_controller.ex:309 msgid "Your account is currently disabled" msgstr "" #, elixir-format -#: lib/pleroma/web/oauth/oauth_controller.ex:158 -#: lib/pleroma/web/oauth/oauth_controller.ex:213 +#: lib/pleroma/web/oauth/oauth_controller.ex:180 +#: lib/pleroma/web/oauth/oauth_controller.ex:332 msgid "Your login is missing a confirmed e-mail address" msgstr "" #, elixir-format -#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:221 +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:389 msgid "can't read inbox of %{nickname} as %{as_nickname}" msgstr "" #, elixir-format -#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:297 +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:472 msgid "can't update outbox of %{nickname} as %{as_nickname}" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:335 +#: lib/pleroma/web/common_api/common_api.ex:388 msgid "conversation is already muted" msgstr "" #, elixir-format -#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:192 -#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:317 -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:1196 -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:1247 +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:316 +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:491 msgid "error" msgstr "" #, elixir-format -#: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:789 +#: lib/pleroma/web/pleroma_api/controllers/mascot_controller.ex:29 msgid "mascots can only be images" msgstr "" #, elixir-format -#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:34 +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:60 msgid "not found" msgstr "" #, elixir-format -#: lib/pleroma/web/oauth/oauth_controller.ex:298 +#: lib/pleroma/web/oauth/oauth_controller.ex:395 msgid "Bad OAuth request." msgstr "" #, elixir-format -#: lib/pleroma/captcha/captcha.ex:92 +#: lib/pleroma/web/twitter_api/twitter_api.ex:115 msgid "CAPTCHA already used" msgstr "" #, elixir-format -#: lib/pleroma/captcha/captcha.ex:89 +#: lib/pleroma/web/twitter_api/twitter_api.ex:112 msgid "CAPTCHA expired" msgstr "" #, elixir-format -#: lib/pleroma/plugs/uploaded_media.ex:50 +#: lib/pleroma/plugs/uploaded_media.ex:55 msgid "Failed" msgstr "" #, elixir-format -#: lib/pleroma/web/oauth/oauth_controller.ex:314 +#: lib/pleroma/web/oauth/oauth_controller.ex:411 msgid "Failed to authenticate: %{message}." msgstr "" #, elixir-format -#: lib/pleroma/web/oauth/oauth_controller.ex:345 +#: lib/pleroma/web/oauth/oauth_controller.ex:442 msgid "Failed to set up user account." msgstr "" #, elixir-format -#: lib/pleroma/plugs/oauth_scopes_plug.ex:37 +#: lib/pleroma/plugs/oauth_scopes_plug.ex:38 msgid "Insufficient permissions: %{permissions}." msgstr "" #, elixir-format -#: lib/pleroma/plugs/uploaded_media.ex:89 +#: lib/pleroma/plugs/uploaded_media.ex:94 msgid "Internal Error" msgstr "" @@ -420,17 +406,17 @@ msgid "Invalid Username/Password" msgstr "" #, elixir-format -#: lib/pleroma/captcha/captcha.ex:107 +#: lib/pleroma/web/twitter_api/twitter_api.ex:118 msgid "Invalid answer data" msgstr "" #, elixir-format -#: lib/pleroma/web/nodeinfo/nodeinfo_controller.ex:204 +#: lib/pleroma/web/nodeinfo/nodeinfo_controller.ex:128 msgid "Nodeinfo schema version not handled" msgstr "" #, elixir-format -#: lib/pleroma/web/oauth/oauth_controller.ex:145 +#: lib/pleroma/web/oauth/oauth_controller.ex:169 msgid "This action is outside the authorized scopes" msgstr "" @@ -440,23 +426,139 @@ msgid "Unknown error, please check the details and try again." msgstr "" #, elixir-format -#: lib/pleroma/web/oauth/oauth_controller.ex:93 -#: lib/pleroma/web/oauth/oauth_controller.ex:131 +#: lib/pleroma/web/oauth/oauth_controller.ex:116 +#: lib/pleroma/web/oauth/oauth_controller.ex:155 msgid "Unlisted redirect_uri." msgstr "" #, elixir-format -#: lib/pleroma/web/oauth/oauth_controller.ex:294 +#: lib/pleroma/web/oauth/oauth_controller.ex:391 msgid "Unsupported OAuth provider: %{provider}." msgstr "" #, elixir-format -#: lib/pleroma/uploaders/uploader.ex:71 +#: lib/pleroma/uploaders/uploader.ex:72 msgid "Uploader callback timeout" msgstr "" #, elixir-format -#: lib/pleroma/web/uploader_controller.ex:11 #: lib/pleroma/web/uploader_controller.ex:23 msgid "bad request" msgstr "" + +#, elixir-format +#: lib/pleroma/web/twitter_api/twitter_api.ex:103 +msgid "CAPTCHA Error" +msgstr "" + +#, elixir-format +#: lib/pleroma/web/common_api/common_api.ex:200 +msgid "Could not add reaction emoji" +msgstr "" + +#, elixir-format +#: lib/pleroma/web/common_api/common_api.ex:211 +msgid "Could not remove reaction emoji" +msgstr "" + +#, elixir-format +#: lib/pleroma/web/twitter_api/twitter_api.ex:129 +msgid "Invalid CAPTCHA (Missing parameter: %{name})" +msgstr "" + +#, elixir-format +#: lib/pleroma/web/mastodon_api/controllers/list_controller.ex:92 +msgid "List not found" +msgstr "" + +#, elixir-format +#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:124 +msgid "Missing parameter: %{name}" +msgstr "" + +#, elixir-format +#: lib/pleroma/web/oauth/oauth_controller.ex:207 +#: lib/pleroma/web/oauth/oauth_controller.ex:322 +msgid "Password reset is required" +msgstr "" + +#, elixir-format +#: lib/pleroma/tests/auth_test_controller.ex:9 +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:6 lib/pleroma/web/admin_api/admin_api_controller.ex:6 +#: lib/pleroma/web/controller_helper.ex:6 lib/pleroma/web/fallback_redirect_controller.ex:6 +#: lib/pleroma/web/feed/tag_controller.ex:6 lib/pleroma/web/feed/user_controller.ex:6 +#: lib/pleroma/web/mailer/subscription_controller.ex:2 lib/pleroma/web/masto_fe_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/app_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/auth_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/conversation_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/custom_emoji_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/domain_block_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/fallback_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/filter_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/follow_request_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/instance_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/list_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/marker_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/mastodon_api_controller.ex:14 lib/pleroma/web/mastodon_api/controllers/media_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/notification_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/poll_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/report_controller.ex:8 lib/pleroma/web/mastodon_api/controllers/scheduled_activity_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/search_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/status_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/subscription_controller.ex:7 lib/pleroma/web/mastodon_api/controllers/suggestion_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex:6 lib/pleroma/web/media_proxy/media_proxy_controller.ex:6 +#: lib/pleroma/web/mongooseim/mongoose_im_controller.ex:6 lib/pleroma/web/nodeinfo/nodeinfo_controller.ex:6 +#: lib/pleroma/web/oauth/fallback_controller.ex:6 lib/pleroma/web/oauth/mfa_controller.ex:10 +#: lib/pleroma/web/oauth/oauth_controller.ex:6 lib/pleroma/web/ostatus/ostatus_controller.ex:6 +#: lib/pleroma/web/pleroma_api/controllers/account_controller.ex:6 lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex:2 +#: lib/pleroma/web/pleroma_api/controllers/mascot_controller.ex:6 lib/pleroma/web/pleroma_api/controllers/pleroma_api_controller.ex:6 +#: lib/pleroma/web/pleroma_api/controllers/scrobble_controller.ex:6 +#: lib/pleroma/web/pleroma_api/controllers/two_factor_authentication_controller.ex:7 lib/pleroma/web/static_fe/static_fe_controller.ex:6 +#: lib/pleroma/web/twitter_api/controllers/password_controller.ex:10 lib/pleroma/web/twitter_api/controllers/remote_follow_controller.ex:6 +#: lib/pleroma/web/twitter_api/controllers/util_controller.ex:6 lib/pleroma/web/twitter_api/twitter_api_controller.ex:6 +#: lib/pleroma/web/uploader_controller.ex:6 lib/pleroma/web/web_finger/web_finger_controller.ex:6 +msgid "Security violation: OAuth scopes check was neither handled nor explicitly skipped." +msgstr "" + +#, elixir-format +#: lib/pleroma/plugs/ensure_authenticated_plug.ex:28 +msgid "Two-factor authentication enabled, you must use a access token." +msgstr "" + +#, elixir-format +#: lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex:210 +msgid "Unexpected error occurred while adding file to pack." +msgstr "" + +#, elixir-format +#: lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex:138 +msgid "Unexpected error occurred while creating pack." +msgstr "" + +#, elixir-format +#: lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex:278 +msgid "Unexpected error occurred while removing file from pack." +msgstr "" + +#, elixir-format +#: lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex:250 +msgid "Unexpected error occurred while updating file in pack." +msgstr "" + +#, elixir-format +#: lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex:179 +msgid "Unexpected error occurred while updating pack metadata." +msgstr "" + +#, elixir-format +#: lib/pleroma/plugs/user_is_admin_plug.ex:40 +msgid "User is not an admin or OAuth admin scope is not granted." +msgstr "" + +#, elixir-format +#: lib/pleroma/web/mastodon_api/controllers/subscription_controller.ex:61 +msgid "Web push subscription is disabled on this Pleroma instance" +msgstr "" + +#, elixir-format +#: lib/pleroma/web/admin_api/admin_api_controller.ex:502 +msgid "You can't revoke your own admin/moderator status." +msgstr "" + +#, elixir-format +#: lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex:105 +msgid "authorization required for timeline view" +msgstr "" diff --git a/priv/gettext/fr/LC_MESSAGES/errors.po b/priv/gettext/fr/LC_MESSAGES/errors.po index 678b32289..406f98de9 100644 --- a/priv/gettext/fr/LC_MESSAGES/errors.po +++ b/priv/gettext/fr/LC_MESSAGES/errors.po @@ -8,8 +8,16 @@ ## to merge POT files into PO files. msgid "" msgstr "" +"PO-Revision-Date: 2020-05-12 15:52+0000\n" +"Last-Translator: Haelwenn (lanodan) Monnier " +"\n" +"Language-Team: French \n" "Language: fr\n" -"Plural-Forms: nplurals=2; plural=(n > 1);\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Plural-Forms: nplurals=2; plural=n > 1;\n" +"X-Generator: Weblate 4.0.4\n" +"Content-Transfer-Encoding: 8bit\n" msgid "can't be blank" msgstr "ne peut être vide" @@ -35,10 +43,10 @@ msgid "does not match confirmation" msgstr "ne correspondent pas" msgid "is still associated with this entry" -msgstr "" +msgstr "est toujours associé à cette entrée" msgid "are still associated with this entry" -msgstr "" +msgstr "sont toujours associés à cette entrée" msgid "should be %{count} character(s)" msgid_plural "should be %{count} character(s)" @@ -85,375 +93,375 @@ msgstr "doit être supérieur ou égal à %{number}" msgid "must be equal to %{number}" msgstr "doit égal à %{number}" -#, elixir-format #: lib/pleroma/web/common_api/common_api.ex:381 +#, elixir-format msgid "Account not found" msgstr "Compte non trouvé" -#, elixir-format #: lib/pleroma/web/common_api/common_api.ex:153 +#, elixir-format msgid "Already voted" msgstr "A déjà voté" -#, elixir-format #: lib/pleroma/web/oauth/oauth_controller.ex:263 +#, elixir-format msgid "Bad request" msgstr "Requête Invalide" -#, elixir-format #: lib/pleroma/web/activity_pub/activity_pub_controller.ex:254 +#, elixir-format msgid "Can't delete object" msgstr "Ne peut supprimer cet objet" -#, elixir-format #: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:569 +#, elixir-format msgid "Can't delete this post" msgstr "Ne peut supprimer ce message" -#, elixir-format #: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:1731 #: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:1737 +#, elixir-format msgid "Can't display this activity" msgstr "Ne peut afficher cette activitée" -#, elixir-format #: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:195 +#, elixir-format msgid "Can't find user" msgstr "Compte non trouvé" -#, elixir-format #: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:1148 +#, elixir-format msgid "Can't get favorites" msgstr "Favoris non trouvables" -#, elixir-format #: lib/pleroma/web/activity_pub/activity_pub_controller.ex:263 +#, elixir-format msgid "Can't like object" msgstr "Ne peut aimer cet objet" -#, elixir-format #: lib/pleroma/web/common_api/utils.ex:518 +#, elixir-format msgid "Cannot post an empty status without attachments" msgstr "Ne peut envoyer un status vide sans attachements" -#, elixir-format #: lib/pleroma/web/common_api/utils.ex:461 +#, elixir-format msgid "Comment must be up to %{max_size} characters" msgstr "Le commentaire ne doit faire plus de %{max_size} charactères" -#, elixir-format #: lib/pleroma/web/admin_api/config.ex:63 +#, elixir-format msgid "Config with params %{params} not found" msgstr "Configuration avec les paramètres %{params} non trouvée" -#, elixir-format #: lib/pleroma/web/common_api/common_api.ex:78 +#, elixir-format msgid "Could not delete" msgstr "Échec de la suppression" -#, elixir-format #: lib/pleroma/web/common_api/common_api.ex:110 +#, elixir-format msgid "Could not favorite" msgstr "Échec de mise en favoris" -#, elixir-format #: lib/pleroma/web/common_api/common_api.ex:310 +#, elixir-format msgid "Could not pin" msgstr "Échec de l'épinglage" -#, elixir-format #: lib/pleroma/web/common_api/common_api.ex:89 +#, elixir-format msgid "Could not repeat" msgstr "Échec de création la répétition" -#, elixir-format #: lib/pleroma/web/common_api/common_api.ex:120 +#, elixir-format msgid "Could not unfavorite" msgstr "Échec de suppression des favoris" -#, elixir-format #: lib/pleroma/web/common_api/common_api.ex:327 +#, elixir-format msgid "Could not unpin" msgstr "Échec du dépinglage" -#, elixir-format #: lib/pleroma/web/common_api/common_api.ex:99 +#, elixir-format msgid "Could not unrepeat" msgstr "Échec de suppression de la répétition" -#, elixir-format #: lib/pleroma/web/common_api/common_api.ex:392 +#, elixir-format msgid "Could not update state" msgstr "Échec de la mise à jour du status" -#, elixir-format #: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:1271 +#, elixir-format msgid "Error." msgstr "Erreur." -#, elixir-format #: lib/pleroma/captcha/kocaptcha.ex:36 +#, elixir-format msgid "Invalid CAPTCHA" msgstr "CAPTCHA invalide" -#, elixir-format #: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:1700 #: lib/pleroma/web/oauth/oauth_controller.ex:465 +#, elixir-format msgid "Invalid credentials" msgstr "Paramètres d'authentification invalides" -#, elixir-format #: lib/pleroma/plugs/ensure_authenticated_plug.ex:20 +#, elixir-format msgid "Invalid credentials." msgstr "Paramètres d'authentification invalides." -#, elixir-format #: lib/pleroma/web/common_api/common_api.ex:154 +#, elixir-format msgid "Invalid indices" msgstr "Indices invalides" -#, elixir-format #: lib/pleroma/web/admin_api/admin_api_controller.ex:411 +#, elixir-format msgid "Invalid parameters" msgstr "Paramètres invalides" -#, elixir-format #: lib/pleroma/web/common_api/utils.ex:377 +#, elixir-format msgid "Invalid password." msgstr "Mot de passe invalide." -#, elixir-format #: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:163 +#, elixir-format msgid "Invalid request" msgstr "Requête invalide" -#, elixir-format #: lib/pleroma/captcha/kocaptcha.ex:16 +#, elixir-format msgid "Kocaptcha service unavailable" msgstr "Service Kocaptcha non disponible" -#, elixir-format #: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:1696 +#, elixir-format msgid "Missing parameters" msgstr "Paramètres manquants" -#, elixir-format #: lib/pleroma/web/common_api/utils.ex:496 +#, elixir-format msgid "No such conversation" msgstr "Conversation inconnue" -#, elixir-format #: lib/pleroma/web/admin_api/admin_api_controller.ex:163 #: lib/pleroma/web/admin_api/admin_api_controller.ex:206 +#, elixir-format msgid "No such permission_group" msgstr "Groupe de permission inconnu" -#, elixir-format #: lib/pleroma/plugs/uploaded_media.ex:69 #: lib/pleroma/web/activity_pub/activity_pub_controller.ex:311 #: lib/pleroma/web/admin_api/admin_api_controller.ex:399 #: lib/pleroma/web/mastodon_api/subscription_controller.ex:63 #: lib/pleroma/web/ostatus/ostatus_controller.ex:248 +#, elixir-format msgid "Not found" msgstr "Non Trouvé" -#, elixir-format #: lib/pleroma/web/common_api/common_api.ex:152 +#, elixir-format msgid "Poll's author can't vote" msgstr "L'auteur·rice d'un sondage ne peut voter" -#, elixir-format #: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:443 #: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:444 #: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:473 #: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:476 #: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:1180 #: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:1564 +#, elixir-format msgid "Record not found" msgstr "Enregistrement non trouvé" -#, elixir-format #: lib/pleroma/web/admin_api/admin_api_controller.ex:417 #: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:1570 #: lib/pleroma/web/mastodon_api/subscription_controller.ex:69 #: lib/pleroma/web/ostatus/ostatus_controller.ex:252 +#, elixir-format msgid "Something went wrong" msgstr "Erreur inconnue" -#, elixir-format #: lib/pleroma/web/common_api/common_api.ex:253 +#, elixir-format msgid "The message visibility must be direct" msgstr "La visibilitée du message doit être « direct »" -#, elixir-format #: lib/pleroma/web/common_api/utils.ex:521 +#, elixir-format msgid "The status is over the character limit" msgstr "Le status est au-delà de la limite de charactères" -#, elixir-format #: lib/pleroma/plugs/ensure_public_or_authenticated_plug.ex:27 +#, elixir-format msgid "This resource requires authentication." msgstr "Cette resource nécessite une authentification." -#, elixir-format #: lib/pleroma/plugs/rate_limiter.ex:89 +#, elixir-format msgid "Throttled" msgstr "Limité" -#, elixir-format #: lib/pleroma/web/common_api/common_api.ex:155 +#, elixir-format msgid "Too many choices" msgstr "Trop de choix" -#, elixir-format #: lib/pleroma/web/activity_pub/activity_pub_controller.ex:268 +#, elixir-format msgid "Unhandled activity type" msgstr "Type d'activitée non-gérée" -#, elixir-format #: lib/pleroma/plugs/user_is_admin_plug.ex:20 +#, elixir-format msgid "User is not admin." msgstr "Le compte n'est pas admin." -#, elixir-format #: lib/pleroma/web/common_api/common_api.ex:380 +#, elixir-format msgid "Valid `account_id` required" msgstr "Un `account_id` valide est requis" -#, elixir-format #: lib/pleroma/web/admin_api/admin_api_controller.ex:185 +#, elixir-format msgid "You can't revoke your own admin status." msgstr "Vous ne pouvez révoquer votre propre status d'admin." -#, elixir-format #: lib/pleroma/web/oauth/oauth_controller.ex:216 +#, elixir-format msgid "Your account is currently disabled" msgstr "Votre compte est actuellement désactivé" -#, elixir-format #: lib/pleroma/web/oauth/oauth_controller.ex:158 #: lib/pleroma/web/oauth/oauth_controller.ex:213 +#, elixir-format msgid "Your login is missing a confirmed e-mail address" msgstr "Une confirmation de l'addresse de couriel est requise pour l'authentification" -#, elixir-format #: lib/pleroma/web/activity_pub/activity_pub_controller.ex:221 +#, elixir-format msgid "can't read inbox of %{nickname} as %{as_nickname}" msgstr "Ne peut lire la boite de réception de %{nickname} en tant que %{as_nickname}" -#, elixir-format #: lib/pleroma/web/activity_pub/activity_pub_controller.ex:297 +#, elixir-format msgid "can't update outbox of %{nickname} as %{as_nickname}" msgstr "Ne peut poster dans la boite d'émission de %{nickname} en tant que %{as_nickname}" -#, elixir-format #: lib/pleroma/web/common_api/common_api.ex:335 +#, elixir-format msgid "conversation is already muted" msgstr "la conversation est déjà baillonée" -#, elixir-format #: lib/pleroma/web/activity_pub/activity_pub_controller.ex:192 #: lib/pleroma/web/activity_pub/activity_pub_controller.ex:317 #: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:1196 #: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:1247 +#, elixir-format msgid "error" msgstr "erreur" -#, elixir-format #: lib/pleroma/web/mastodon_api/mastodon_api_controller.ex:789 +#, elixir-format msgid "mascots can only be images" msgstr "les mascottes ne peuvent être que des images" -#, elixir-format #: lib/pleroma/web/activity_pub/activity_pub_controller.ex:34 +#, elixir-format msgid "not found" msgstr "non trouvé" -#, elixir-format #: lib/pleroma/web/oauth/oauth_controller.ex:298 +#, elixir-format msgid "Bad OAuth request." msgstr "Requête OAuth invalide." -#, elixir-format #: lib/pleroma/captcha/captcha.ex:92 +#, elixir-format msgid "CAPTCHA already used" msgstr "CAPTCHA déjà utilisé" -#, elixir-format #: lib/pleroma/captcha/captcha.ex:89 +#, elixir-format msgid "CAPTCHA expired" msgstr "CAPTCHA expiré" -#, elixir-format #: lib/pleroma/plugs/uploaded_media.ex:50 +#, elixir-format msgid "Failed" msgstr "Échec" -#, elixir-format #: lib/pleroma/web/oauth/oauth_controller.ex:314 -msgid "Failed to authenticate: %{message}." -msgstr "Échec de l'authentification: %{message}" - #, elixir-format +msgid "Failed to authenticate: %{message}." +msgstr "Échec de l'authentification : %{message}." + #: lib/pleroma/web/oauth/oauth_controller.ex:345 +#, elixir-format msgid "Failed to set up user account." msgstr "Échec de création de votre compte." -#, elixir-format #: lib/pleroma/plugs/oauth_scopes_plug.ex:37 -msgid "Insufficient permissions: %{permissions}." -msgstr "Permissions insuffisantes: %{permissions}." - #, elixir-format +msgid "Insufficient permissions: %{permissions}." +msgstr "Permissions insuffisantes : %{permissions}." + #: lib/pleroma/plugs/uploaded_media.ex:89 +#, elixir-format msgid "Internal Error" msgstr "Erreur interne" -#, elixir-format #: lib/pleroma/web/oauth/fallback_controller.ex:22 #: lib/pleroma/web/oauth/fallback_controller.ex:29 +#, elixir-format msgid "Invalid Username/Password" msgstr "Nom d'utilisateur/mot de passe invalide" -#, elixir-format #: lib/pleroma/captcha/captcha.ex:107 +#, elixir-format msgid "Invalid answer data" msgstr "Réponse invalide" -#, elixir-format #: lib/pleroma/web/nodeinfo/nodeinfo_controller.ex:204 +#, elixir-format msgid "Nodeinfo schema version not handled" msgstr "Version du schéma nodeinfo non géré" -#, elixir-format #: lib/pleroma/web/oauth/oauth_controller.ex:145 -msgid "This action is outside the authorized scopes" -msgstr "Cette action est en dehors des authorisations" # "scopes" ? - #, elixir-format +msgid "This action is outside the authorized scopes" +msgstr "Cette action est en dehors des authorisations" # "scopes" + #: lib/pleroma/web/oauth/fallback_controller.ex:14 +#, elixir-format msgid "Unknown error, please check the details and try again." msgstr "Erreur inconnue, veuillez vérifier les détails et réessayer." -#, elixir-format #: lib/pleroma/web/oauth/oauth_controller.ex:93 #: lib/pleroma/web/oauth/oauth_controller.ex:131 +#, elixir-format msgid "Unlisted redirect_uri." msgstr "redirect_uri non listé." -#, elixir-format #: lib/pleroma/web/oauth/oauth_controller.ex:294 +#, elixir-format msgid "Unsupported OAuth provider: %{provider}." msgstr "Fournisseur OAuth non supporté : %{provider}." -#, elixir-format #: lib/pleroma/uploaders/uploader.ex:71 -msgid "Uploader callback timeout" -msgstr "" -## msgstr "Attente écoulée" - #, elixir-format +msgid "Uploader callback timeout" +msgstr "Temps d'attente du téléverseur écoulé" + +## msgstr "Attente écoulée" #: lib/pleroma/web/uploader_controller.ex:11 #: lib/pleroma/web/uploader_controller.ex:23 +#, elixir-format msgid "bad request" msgstr "requête invalide" diff --git a/priv/gettext/pl/LC_MESSAGES/errors.po b/priv/gettext/pl/LC_MESSAGES/errors.po new file mode 100644 index 000000000..af9e214c6 --- /dev/null +++ b/priv/gettext/pl/LC_MESSAGES/errors.po @@ -0,0 +1,587 @@ +msgid "" +msgstr "" +"Project-Id-Version: PACKAGE VERSION\n" +"Report-Msgid-Bugs-To: \n" +"POT-Creation-Date: 2020-05-13 16:37+0000\n" +"PO-Revision-Date: 2020-05-14 14:37+0000\n" +"Last-Translator: Michał Sidor \n" +"Language-Team: Polish \n" +"Language: pl\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Plural-Forms: nplurals=3; plural=n==1 ? 0 : n%10>=2 && n%10<=4 && (n%100<10 " +"|| n%100>=20) ? 1 : 2;\n" +"X-Generator: Weblate 4.0.4\n" + +## This file is a PO Template file. +## +## `msgid`s here are often extracted from source code. +## Add new translations manually only if they're dynamic +## translations that can't be statically extracted. +## +## Run `mix gettext.extract` to bring this file up to +## date. Leave `msgstr`s empty as changing them here as no +## effect: edit them in PO (`.po`) files instead. +## From Ecto.Changeset.cast/4 +msgid "can't be blank" +msgstr "nie może być pusty" + +## From Ecto.Changeset.unique_constraint/3 +msgid "has already been taken" +msgstr "jest już zajęty" + +## From Ecto.Changeset.put_change/3 +msgid "is invalid" +msgstr "jest nieprawidłowy" + +## From Ecto.Changeset.validate_format/3 +msgid "has invalid format" +msgstr "ma niepoprawny format" + +## From Ecto.Changeset.validate_subset/3 +msgid "has an invalid entry" +msgstr "ma niepoprawny wpis" + +## From Ecto.Changeset.validate_exclusion/3 +msgid "is reserved" +msgstr "" + +## From Ecto.Changeset.validate_confirmation/3 +msgid "does not match confirmation" +msgstr "" + +## From Ecto.Changeset.no_assoc_constraint/3 +msgid "is still associated with this entry" +msgstr "" + +msgid "are still associated with this entry" +msgstr "" + +## From Ecto.Changeset.validate_length/3 +msgid "should be %{count} character(s)" +msgid_plural "should be %{count} character(s)" +msgstr[0] "" +msgstr[1] "" +msgstr[2] "" + +msgid "should have %{count} item(s)" +msgid_plural "should have %{count} item(s)" +msgstr[0] "" +msgstr[1] "" +msgstr[2] "" + +msgid "should be at least %{count} character(s)" +msgid_plural "should be at least %{count} character(s)" +msgstr[0] "" +msgstr[1] "" +msgstr[2] "" + +msgid "should have at least %{count} item(s)" +msgid_plural "should have at least %{count} item(s)" +msgstr[0] "" +msgstr[1] "" +msgstr[2] "" + +msgid "should be at most %{count} character(s)" +msgid_plural "should be at most %{count} character(s)" +msgstr[0] "" +msgstr[1] "" +msgstr[2] "" + +msgid "should have at most %{count} item(s)" +msgid_plural "should have at most %{count} item(s)" +msgstr[0] "" +msgstr[1] "" +msgstr[2] "" + +## From Ecto.Changeset.validate_number/3 +msgid "must be less than %{number}" +msgstr "" + +msgid "must be greater than %{number}" +msgstr "" + +msgid "must be less than or equal to %{number}" +msgstr "" + +msgid "must be greater than or equal to %{number}" +msgstr "" + +msgid "must be equal to %{number}" +msgstr "" + +#: lib/pleroma/web/common_api/common_api.ex:421 +#, elixir-format +msgid "Account not found" +msgstr "Nie znaleziono konta" + +#: lib/pleroma/web/common_api/common_api.ex:249 +#, elixir-format +msgid "Already voted" +msgstr "Już zagłosowano" + +#: lib/pleroma/web/oauth/oauth_controller.ex:360 +#, elixir-format +msgid "Bad request" +msgstr "Nieprawidłowe żądanie" + +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:425 +#, elixir-format +msgid "Can't delete object" +msgstr "Nie można usunąć obiektu" + +#: lib/pleroma/web/mastodon_api/controllers/status_controller.ex:196 +#, elixir-format +msgid "Can't delete this post" +msgstr "Nie udało się usunąć tego statusu" + +#: lib/pleroma/web/controller_helper.ex:95 +#: lib/pleroma/web/controller_helper.ex:101 +#, elixir-format +msgid "Can't display this activity" +msgstr "Nie można wyświetlić tej aktywności" + +#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:227 +#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:254 +#, elixir-format +msgid "Can't find user" +msgstr "Nie znaleziono użytkownika" + +#: lib/pleroma/web/pleroma_api/controllers/account_controller.ex:114 +#, elixir-format +msgid "Can't get favorites" +msgstr "" + +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:437 +#, elixir-format +msgid "Can't like object" +msgstr "Nie udało się polubić obiektu" + +#: lib/pleroma/web/common_api/utils.ex:556 +#, elixir-format +msgid "Cannot post an empty status without attachments" +msgstr "Nie można opublikować pustego statusu bez załączników" + +#: lib/pleroma/web/common_api/utils.ex:504 +#, elixir-format +msgid "Comment must be up to %{max_size} characters" +msgstr "Komentarz może mieć co najwyżej %{max_size} znaków" + +#: lib/pleroma/config/config_db.ex:222 +#, elixir-format +msgid "Config with params %{params} not found" +msgstr "" + +#: lib/pleroma/web/common_api/common_api.ex:95 +#, elixir-format +msgid "Could not delete" +msgstr "Nie udało się usunąć" + +#: lib/pleroma/web/common_api/common_api.ex:141 +#, elixir-format +msgid "Could not favorite" +msgstr "Nie udało się dodać do ulubionych" + +#: lib/pleroma/web/common_api/common_api.ex:370 +#, elixir-format +msgid "Could not pin" +msgstr "Nie udało się przypiąć" + +#: lib/pleroma/web/common_api/common_api.ex:112 +#, elixir-format +msgid "Could not repeat" +msgstr "Nie udało się powtórzyć" + +#: lib/pleroma/web/common_api/common_api.ex:188 +#, elixir-format +msgid "Could not unfavorite" +msgstr "Nie udało się usunąć z ulubionych" + +#: lib/pleroma/web/common_api/common_api.ex:380 +#, elixir-format +msgid "Could not unpin" +msgstr "Nie udało się odpiąć" + +#: lib/pleroma/web/common_api/common_api.ex:126 +#, elixir-format +msgid "Could not unrepeat" +msgstr "Nie udało się cofnąć powtórzenia" + +#: lib/pleroma/web/common_api/common_api.ex:428 +#: lib/pleroma/web/common_api/common_api.ex:437 +#, elixir-format +msgid "Could not update state" +msgstr "" + +#: lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex:202 +#, elixir-format +msgid "Error." +msgstr "" + +#: lib/pleroma/web/twitter_api/twitter_api.ex:106 +#, elixir-format +msgid "Invalid CAPTCHA" +msgstr "" + +#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:117 +#: lib/pleroma/web/oauth/oauth_controller.ex:569 +#, elixir-format +msgid "Invalid credentials" +msgstr "" + +#: lib/pleroma/plugs/ensure_authenticated_plug.ex:38 +#, elixir-format +msgid "Invalid credentials." +msgstr "" + +#: lib/pleroma/web/common_api/common_api.ex:265 +#, elixir-format +msgid "Invalid indices" +msgstr "" + +#: lib/pleroma/web/admin_api/admin_api_controller.ex:1147 +#, elixir-format +msgid "Invalid parameters" +msgstr "" + +#: lib/pleroma/web/common_api/utils.ex:411 +#, elixir-format +msgid "Invalid password." +msgstr "Nieprawidłowe hasło." + +#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:187 +#, elixir-format +msgid "Invalid request" +msgstr "Nieprawidłowe żądanie" + +#: lib/pleroma/web/twitter_api/twitter_api.ex:109 +#, elixir-format +msgid "Kocaptcha service unavailable" +msgstr "Usługa Kocaptcha niedostępna" + +#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:113 +#, elixir-format +msgid "Missing parameters" +msgstr "Brakujące parametry" + +#: lib/pleroma/web/common_api/utils.ex:540 +#, elixir-format +msgid "No such conversation" +msgstr "Nie ma takiej rozmowy" + +#: lib/pleroma/web/admin_api/admin_api_controller.ex:439 +#: lib/pleroma/web/admin_api/admin_api_controller.ex:465 lib/pleroma/web/admin_api/admin_api_controller.ex:507 +#, elixir-format +msgid "No such permission_group" +msgstr "Nie ma takiej grupy uprawnień" + +#: lib/pleroma/plugs/uploaded_media.ex:74 +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:485 lib/pleroma/web/admin_api/admin_api_controller.ex:1135 +#: lib/pleroma/web/feed/user_controller.ex:73 lib/pleroma/web/ostatus/ostatus_controller.ex:143 +#, elixir-format +msgid "Not found" +msgstr "Nie znaleziono" + +#: lib/pleroma/web/common_api/common_api.ex:241 +#, elixir-format +msgid "Poll's author can't vote" +msgstr "Autor ankiety nie może głosować" + +#: lib/pleroma/web/mastodon_api/controllers/fallback_controller.ex:20 +#: lib/pleroma/web/mastodon_api/controllers/poll_controller.ex:37 lib/pleroma/web/mastodon_api/controllers/poll_controller.ex:49 +#: lib/pleroma/web/mastodon_api/controllers/poll_controller.ex:50 lib/pleroma/web/mastodon_api/controllers/status_controller.ex:290 +#: lib/pleroma/web/mastodon_api/controllers/subscription_controller.ex:71 +#, elixir-format +msgid "Record not found" +msgstr "Nie znaleziono rekordu" + +#: lib/pleroma/web/admin_api/admin_api_controller.ex:1153 +#: lib/pleroma/web/feed/user_controller.ex:79 lib/pleroma/web/mastodon_api/controllers/fallback_controller.ex:32 +#: lib/pleroma/web/ostatus/ostatus_controller.ex:149 +#, elixir-format +msgid "Something went wrong" +msgstr "Coś się zepsuło" + +#: lib/pleroma/web/common_api/activity_draft.ex:107 +#, elixir-format +msgid "The message visibility must be direct" +msgstr "" + +#: lib/pleroma/web/common_api/utils.ex:566 +#, elixir-format +msgid "The status is over the character limit" +msgstr "Ten status przekracza limit znaków" + +#: lib/pleroma/plugs/ensure_public_or_authenticated_plug.ex:31 +#, elixir-format +msgid "This resource requires authentication." +msgstr "" + +#: lib/pleroma/plugs/rate_limiter/rate_limiter.ex:206 +#, elixir-format +msgid "Throttled" +msgstr "" + +#: lib/pleroma/web/common_api/common_api.ex:266 +#, elixir-format +msgid "Too many choices" +msgstr "" + +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:442 +#, elixir-format +msgid "Unhandled activity type" +msgstr "Nieobsługiwany typ aktywności" + +#: lib/pleroma/web/admin_api/admin_api_controller.ex:536 +#, elixir-format +msgid "You can't revoke your own admin status." +msgstr "Nie możesz odebrać samemu sobie statusu administratora." + +#: lib/pleroma/web/oauth/oauth_controller.ex:218 +#: lib/pleroma/web/oauth/oauth_controller.ex:309 +#, elixir-format +msgid "Your account is currently disabled" +msgstr "Twoje konto jest obecnie nieaktywne" + +#: lib/pleroma/web/oauth/oauth_controller.ex:180 +#: lib/pleroma/web/oauth/oauth_controller.ex:332 +#, elixir-format +msgid "Your login is missing a confirmed e-mail address" +msgstr "" + +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:389 +#, elixir-format +msgid "can't read inbox of %{nickname} as %{as_nickname}" +msgstr "" + +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:472 +#, elixir-format +msgid "can't update outbox of %{nickname} as %{as_nickname}" +msgstr "" + +#: lib/pleroma/web/common_api/common_api.ex:388 +#, elixir-format +msgid "conversation is already muted" +msgstr "rozmowa jest już wyciszona" + +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:316 +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:491 +#, elixir-format +msgid "error" +msgstr "błąd" + +#: lib/pleroma/web/pleroma_api/controllers/mascot_controller.ex:29 +#, elixir-format +msgid "mascots can only be images" +msgstr "maskotki muszą być obrazkami" + +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:60 +#, elixir-format +msgid "not found" +msgstr "nie znaleziono" + +#: lib/pleroma/web/oauth/oauth_controller.ex:395 +#, elixir-format +msgid "Bad OAuth request." +msgstr "Niepoprawne żądanie OAuth." + +#: lib/pleroma/web/twitter_api/twitter_api.ex:115 +#, elixir-format +msgid "CAPTCHA already used" +msgstr "Zużyta CAPTCHA" + +#: lib/pleroma/web/twitter_api/twitter_api.ex:112 +#, elixir-format +msgid "CAPTCHA expired" +msgstr "CAPTCHA wygasła" + +#: lib/pleroma/plugs/uploaded_media.ex:55 +#, elixir-format +msgid "Failed" +msgstr "Nie udało się" + +#: lib/pleroma/web/oauth/oauth_controller.ex:411 +#, elixir-format +msgid "Failed to authenticate: %{message}." +msgstr "" + +#: lib/pleroma/web/oauth/oauth_controller.ex:442 +#, elixir-format +msgid "Failed to set up user account." +msgstr "" + +#: lib/pleroma/plugs/oauth_scopes_plug.ex:38 +#, elixir-format +msgid "Insufficient permissions: %{permissions}." +msgstr "Niewystarczające uprawnienia: %{permissions}." + +#: lib/pleroma/plugs/uploaded_media.ex:94 +#, elixir-format +msgid "Internal Error" +msgstr "Błąd wewnętrzny" + +#: lib/pleroma/web/oauth/fallback_controller.ex:22 +#: lib/pleroma/web/oauth/fallback_controller.ex:29 +#, elixir-format +msgid "Invalid Username/Password" +msgstr "Nieprawidłowa nazwa użytkownika lub hasło" + +#: lib/pleroma/web/twitter_api/twitter_api.ex:118 +#, elixir-format +msgid "Invalid answer data" +msgstr "" + +#: lib/pleroma/web/nodeinfo/nodeinfo_controller.ex:128 +#, elixir-format +msgid "Nodeinfo schema version not handled" +msgstr "Nieobsługiwana wersja schematu Nodeinfo" + +#: lib/pleroma/web/oauth/oauth_controller.ex:169 +#, elixir-format +msgid "This action is outside the authorized scopes" +msgstr "" + +#: lib/pleroma/web/oauth/fallback_controller.ex:14 +#, elixir-format +msgid "Unknown error, please check the details and try again." +msgstr "Nieznany błąd, sprawdź szczegóły i spróbuj ponownie." + +#: lib/pleroma/web/oauth/oauth_controller.ex:116 +#: lib/pleroma/web/oauth/oauth_controller.ex:155 +#, elixir-format +msgid "Unlisted redirect_uri." +msgstr "" + +#: lib/pleroma/web/oauth/oauth_controller.ex:391 +#, elixir-format +msgid "Unsupported OAuth provider: %{provider}." +msgstr "Nieobsługiwany dostawca OAuth: %{provider}." + +#: lib/pleroma/uploaders/uploader.ex:72 +#, elixir-format +msgid "Uploader callback timeout" +msgstr "" + +#: lib/pleroma/web/uploader_controller.ex:23 +#, elixir-format +msgid "bad request" +msgstr "nieprawidłowe żądanie" + +#: lib/pleroma/web/twitter_api/twitter_api.ex:103 +#, elixir-format +msgid "CAPTCHA Error" +msgstr "Błąd CAPTCHA" + +#: lib/pleroma/web/common_api/common_api.ex:200 +#, elixir-format +msgid "Could not add reaction emoji" +msgstr "" + +#: lib/pleroma/web/common_api/common_api.ex:211 +#, elixir-format +msgid "Could not remove reaction emoji" +msgstr "" + +#: lib/pleroma/web/twitter_api/twitter_api.ex:129 +#, elixir-format +msgid "Invalid CAPTCHA (Missing parameter: %{name})" +msgstr "Nieprawidłowa CAPTCHA (Brakujący parametr: %{name})" + +#: lib/pleroma/web/mastodon_api/controllers/list_controller.ex:92 +#, elixir-format +msgid "List not found" +msgstr "Nie znaleziono listy" + +#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:124 +#, elixir-format +msgid "Missing parameter: %{name}" +msgstr "Brakujący parametr: %{name}" + +#: lib/pleroma/web/oauth/oauth_controller.ex:207 +#: lib/pleroma/web/oauth/oauth_controller.ex:322 +#, elixir-format +msgid "Password reset is required" +msgstr "Wymagany reset hasła" + +#: lib/pleroma/tests/auth_test_controller.ex:9 +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:6 lib/pleroma/web/admin_api/admin_api_controller.ex:6 +#: lib/pleroma/web/controller_helper.ex:6 lib/pleroma/web/fallback_redirect_controller.ex:6 +#: lib/pleroma/web/feed/tag_controller.ex:6 lib/pleroma/web/feed/user_controller.ex:6 +#: lib/pleroma/web/mailer/subscription_controller.ex:2 lib/pleroma/web/masto_fe_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/app_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/auth_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/conversation_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/custom_emoji_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/domain_block_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/fallback_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/filter_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/follow_request_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/instance_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/list_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/marker_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/mastodon_api_controller.ex:14 lib/pleroma/web/mastodon_api/controllers/media_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/notification_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/poll_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/report_controller.ex:8 lib/pleroma/web/mastodon_api/controllers/scheduled_activity_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/search_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/status_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/subscription_controller.ex:7 lib/pleroma/web/mastodon_api/controllers/suggestion_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex:6 lib/pleroma/web/media_proxy/media_proxy_controller.ex:6 +#: lib/pleroma/web/mongooseim/mongoose_im_controller.ex:6 lib/pleroma/web/nodeinfo/nodeinfo_controller.ex:6 +#: lib/pleroma/web/oauth/fallback_controller.ex:6 lib/pleroma/web/oauth/mfa_controller.ex:10 +#: lib/pleroma/web/oauth/oauth_controller.ex:6 lib/pleroma/web/ostatus/ostatus_controller.ex:6 +#: lib/pleroma/web/pleroma_api/controllers/account_controller.ex:6 lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex:2 +#: lib/pleroma/web/pleroma_api/controllers/mascot_controller.ex:6 lib/pleroma/web/pleroma_api/controllers/pleroma_api_controller.ex:6 +#: lib/pleroma/web/pleroma_api/controllers/scrobble_controller.ex:6 +#: lib/pleroma/web/pleroma_api/controllers/two_factor_authentication_controller.ex:7 lib/pleroma/web/static_fe/static_fe_controller.ex:6 +#: lib/pleroma/web/twitter_api/controllers/password_controller.ex:10 lib/pleroma/web/twitter_api/controllers/remote_follow_controller.ex:6 +#: lib/pleroma/web/twitter_api/controllers/util_controller.ex:6 lib/pleroma/web/twitter_api/twitter_api_controller.ex:6 +#: lib/pleroma/web/uploader_controller.ex:6 lib/pleroma/web/web_finger/web_finger_controller.ex:6 +#, elixir-format +msgid "Security violation: OAuth scopes check was neither handled nor explicitly skipped." +msgstr "" + +#: lib/pleroma/plugs/ensure_authenticated_plug.ex:28 +#, elixir-format +msgid "Two-factor authentication enabled, you must use a access token." +msgstr "Uwierzytelnienie dwuskładnikowe jest włączone, musisz użyć tokenu." + +#: lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex:210 +#, elixir-format +msgid "Unexpected error occurred while adding file to pack." +msgstr "Nieoczekiwany błąd podczas dodawania pliku do paczki." + +#: lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex:138 +#, elixir-format +msgid "Unexpected error occurred while creating pack." +msgstr "Nieoczekiwany błąd podczas tworzenia paczki." + +#: lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex:278 +#, elixir-format +msgid "Unexpected error occurred while removing file from pack." +msgstr "Nieoczekiwany błąd podczas usuwania pliku z paczki." + +#: lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex:250 +#, elixir-format +msgid "Unexpected error occurred while updating file in pack." +msgstr "Nieoczekiwany błąd podczas zmieniania pliku w paczce." + +#: lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex:179 +#, elixir-format +msgid "Unexpected error occurred while updating pack metadata." +msgstr "Nieoczekiwany błąd podczas zmieniania metadanych paczki." + +#: lib/pleroma/plugs/user_is_admin_plug.ex:40 +#, elixir-format +msgid "User is not an admin or OAuth admin scope is not granted." +msgstr "" + +#: lib/pleroma/web/mastodon_api/controllers/subscription_controller.ex:61 +#, elixir-format +msgid "Web push subscription is disabled on this Pleroma instance" +msgstr "Powiadomienia web push są wyłączone na tej instancji Pleromy" + +#: lib/pleroma/web/admin_api/admin_api_controller.ex:502 +#, elixir-format +msgid "You can't revoke your own admin/moderator status." +msgstr "Nie możesz odebrać samemu sobie statusu administratora/moderatora." + +#: lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex:105 +#, elixir-format +msgid "authorization required for timeline view" +msgstr "logowanie wymagane do przeglądania osi czasu" diff --git a/priv/repo/migrations/20190408123347_create_conversations.exs b/priv/repo/migrations/20190408123347_create_conversations.exs index d75459e82..3eaa6136c 100644 --- a/priv/repo/migrations/20190408123347_create_conversations.exs +++ b/priv/repo/migrations/20190408123347_create_conversations.exs @@ -1,5 +1,5 @@ # Pleroma: A lightweight social networking server -# Copyright © 2017-2019 Pleroma Authors +# Copyright © 2017-2020 Pleroma Authors # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.Repo.Migrations.CreateConversations do diff --git a/priv/repo/migrations/20190414125034_migrate_old_bookmarks.exs b/priv/repo/migrations/20190414125034_migrate_old_bookmarks.exs index c618ea381..b6f0ac66b 100644 --- a/priv/repo/migrations/20190414125034_migrate_old_bookmarks.exs +++ b/priv/repo/migrations/20190414125034_migrate_old_bookmarks.exs @@ -3,7 +3,6 @@ defmodule Pleroma.Repo.Migrations.MigrateOldBookmarks do import Ecto.Query alias Pleroma.Activity alias Pleroma.Bookmark - alias Pleroma.User alias Pleroma.Repo def up do diff --git a/priv/repo/migrations/20190506054542_add_multi_factor_authentication_settings_to_user.exs b/priv/repo/migrations/20190506054542_add_multi_factor_authentication_settings_to_user.exs new file mode 100644 index 000000000..8b653c61f --- /dev/null +++ b/priv/repo/migrations/20190506054542_add_multi_factor_authentication_settings_to_user.exs @@ -0,0 +1,9 @@ +defmodule Pleroma.Repo.Migrations.AddMultiFactorAuthenticationSettingsToUser do + use Ecto.Migration + + def change do + alter table(:users) do + add(:multi_factor_authentication_settings, :map, default: %{}) + end + end +end diff --git a/priv/repo/migrations/20190508193213_create_mfa_tokens.exs b/priv/repo/migrations/20190508193213_create_mfa_tokens.exs new file mode 100644 index 000000000..da9f8fabe --- /dev/null +++ b/priv/repo/migrations/20190508193213_create_mfa_tokens.exs @@ -0,0 +1,16 @@ +defmodule Pleroma.Repo.Migrations.CreateMfaTokens do + use Ecto.Migration + + def change do + create table(:mfa_tokens) do + add(:user_id, references(:users, type: :uuid, on_delete: :delete_all)) + add(:authorization_id, references(:oauth_authorizations, on_delete: :delete_all)) + add(:token, :string) + add(:valid_until, :naive_datetime_usec) + + timestamps() + end + + create(unique_index(:mfa_tokens, :token)) + end +end diff --git a/priv/repo/migrations/20190711042021_create_safe_jsonb_set.exs b/priv/repo/migrations/20190711042021_create_safe_jsonb_set.exs index 2f336a5e8..43d616705 100644 --- a/priv/repo/migrations/20190711042021_create_safe_jsonb_set.exs +++ b/priv/repo/migrations/20190711042021_create_safe_jsonb_set.exs @@ -1,6 +1,5 @@ defmodule Pleroma.Repo.Migrations.CreateSafeJsonbSet do use Ecto.Migration - alias Pleroma.User def change do execute(""" diff --git a/priv/repo/migrations/20200227122417_add_trusted_to_apps.exs b/priv/repo/migrations/20200227122417_add_trusted_to_apps.exs new file mode 100644 index 000000000..4e2a62af0 --- /dev/null +++ b/priv/repo/migrations/20200227122417_add_trusted_to_apps.exs @@ -0,0 +1,9 @@ +defmodule Pleroma.Repo.Migrations.AddTrustedToApps do + use Ecto.Migration + + def change do + alter table(:apps) do + add(:trusted, :boolean, default: false) + end + end +end diff --git a/priv/repo/migrations/20200328124805_change_following_relationships_state_to_integer.exs b/priv/repo/migrations/20200328124805_change_following_relationships_state_to_integer.exs new file mode 100644 index 000000000..2b0820f3f --- /dev/null +++ b/priv/repo/migrations/20200328124805_change_following_relationships_state_to_integer.exs @@ -0,0 +1,29 @@ +defmodule Pleroma.Repo.Migrations.ChangeFollowingRelationshipsStateToInteger do + use Ecto.Migration + + @alter_following_relationship_state "ALTER TABLE following_relationships ALTER COLUMN state" + + def up do + execute(""" + #{@alter_following_relationship_state} TYPE integer USING + CASE + WHEN state = 'pending' THEN 1 + WHEN state = 'accept' THEN 2 + WHEN state = 'reject' THEN 3 + ELSE 0 + END; + """) + end + + def down do + execute(""" + #{@alter_following_relationship_state} TYPE varchar(255) USING + CASE + WHEN state = 1 THEN 'pending' + WHEN state = 2 THEN 'accept' + WHEN state = 3 THEN 'reject' + ELSE '' + END; + """) + end +end diff --git a/priv/repo/migrations/20200328130139_add_following_relationships_following_id_index.exs b/priv/repo/migrations/20200328130139_add_following_relationships_following_id_index.exs new file mode 100644 index 000000000..884832f84 --- /dev/null +++ b/priv/repo/migrations/20200328130139_add_following_relationships_following_id_index.exs @@ -0,0 +1,11 @@ +defmodule Pleroma.Repo.Migrations.AddFollowingRelationshipsFollowingIdIndex do + use Ecto.Migration + + # [:follower_index] index is useless because of [:follower_id, :following_id] index + # [:following_id] index makes sense because of user's followers-targeted queries + def change do + drop_if_exists(index(:following_relationships, [:follower_id])) + + create_if_not_exists(index(:following_relationships, [:following_id])) + end +end diff --git a/priv/repo/migrations/20200401030751_users_add_public_key.exs b/priv/repo/migrations/20200401030751_users_add_public_key.exs new file mode 100644 index 000000000..04e5ad1e2 --- /dev/null +++ b/priv/repo/migrations/20200401030751_users_add_public_key.exs @@ -0,0 +1,17 @@ +defmodule Pleroma.Repo.Migrations.UsersAddPublicKey do + use Ecto.Migration + + def up do + alter table(:users) do + add_if_not_exists(:public_key, :text) + end + + execute("UPDATE users SET public_key = source_data->'publicKey'->>'publicKeyPem'") + end + + def down do + alter table(:users) do + remove_if_exists(:public_key, :text) + end + end +end diff --git a/priv/repo/migrations/20200401072456_users_add_inboxes.exs b/priv/repo/migrations/20200401072456_users_add_inboxes.exs new file mode 100644 index 000000000..0947f0ab2 --- /dev/null +++ b/priv/repo/migrations/20200401072456_users_add_inboxes.exs @@ -0,0 +1,20 @@ +defmodule Pleroma.Repo.Migrations.UsersAddInboxes do + use Ecto.Migration + + def up do + alter table(:users) do + add_if_not_exists(:inbox, :text) + add_if_not_exists(:shared_inbox, :text) + end + + execute("UPDATE users SET inbox = source_data->>'inbox'") + execute("UPDATE users SET shared_inbox = source_data->'endpoints'->>'sharedInbox'") + end + + def down do + alter table(:users) do + remove_if_exists(:inbox, :text) + remove_if_exists(:shared_inbox, :text) + end + end +end diff --git a/priv/repo/migrations/20200402063221_update_oban_jobs_table.exs b/priv/repo/migrations/20200402063221_update_oban_jobs_table.exs new file mode 100644 index 000000000..e7ff04008 --- /dev/null +++ b/priv/repo/migrations/20200402063221_update_oban_jobs_table.exs @@ -0,0 +1,11 @@ +defmodule Pleroma.Repo.Migrations.UpdateObanJobsTable do + use Ecto.Migration + + def up do + Oban.Migrations.up(version: 8) + end + + def down do + Oban.Migrations.down(version: 7) + end +end diff --git a/priv/repo/migrations/20200406100225_users_add_emoji.exs b/priv/repo/migrations/20200406100225_users_add_emoji.exs new file mode 100644 index 000000000..f248108de --- /dev/null +++ b/priv/repo/migrations/20200406100225_users_add_emoji.exs @@ -0,0 +1,38 @@ +defmodule Pleroma.Repo.Migrations.UsersPopulateEmoji do + use Ecto.Migration + + import Ecto.Query + + alias Pleroma.User + alias Pleroma.Repo + + def up do + execute("ALTER TABLE users ALTER COLUMN emoji SET DEFAULT '{}'::jsonb") + execute("UPDATE users SET emoji = DEFAULT WHERE emoji = '[]'::jsonb") + + from(u in User) + |> select([u], struct(u, [:id, :ap_id, :source_data])) + |> Repo.stream() + |> Enum.each(fn user -> + emoji = + user.source_data + |> Map.get("tag", []) + |> Enum.filter(fn + %{"type" => "Emoji"} -> true + _ -> false + end) + |> Enum.reduce(%{}, fn %{"icon" => %{"url" => url}, "name" => name}, acc -> + Map.put(acc, String.trim(name, ":"), url) + end) + + user + |> Ecto.Changeset.cast(%{emoji: emoji}, [:emoji]) + |> Repo.update() + end) + end + + def down do + execute("ALTER TABLE users ALTER COLUMN emoji SET DEFAULT '[]'::jsonb") + execute("UPDATE users SET emoji = DEFAULT WHERE emoji = '{}'::jsonb") + end +end diff --git a/priv/repo/migrations/20200406105422_users_remove_source_data.exs b/priv/repo/migrations/20200406105422_users_remove_source_data.exs new file mode 100644 index 000000000..9812d480f --- /dev/null +++ b/priv/repo/migrations/20200406105422_users_remove_source_data.exs @@ -0,0 +1,15 @@ +defmodule Pleroma.Repo.Migrations.UsersRemoveSourceData do + use Ecto.Migration + + def up do + alter table(:users) do + remove_if_exists(:source_data, :map) + end + end + + def down do + alter table(:users) do + add_if_not_exists(:source_data, :map, default: %{}) + end + end +end diff --git a/priv/repo/migrations/20200415181818_update_markers.exs b/priv/repo/migrations/20200415181818_update_markers.exs new file mode 100644 index 000000000..bb9d8e860 --- /dev/null +++ b/priv/repo/migrations/20200415181818_update_markers.exs @@ -0,0 +1,44 @@ +defmodule Pleroma.Repo.Migrations.UpdateMarkers do + use Ecto.Migration + import Ecto.Query + alias Pleroma.Repo + + def up do + update_markers() + end + + def down do + :ok + end + + defp update_markers do + now = NaiveDateTime.utc_now() + + markers_attrs = + from(q in "notifications", + select: %{ + timeline: "notifications", + user_id: q.user_id, + last_read_id: + type(fragment("MAX( CASE WHEN seen = true THEN id ELSE null END )"), :string) + }, + group_by: [q.user_id] + ) + |> Repo.all() + |> Enum.map(fn %{last_read_id: last_read_id} = attrs -> + attrs + |> Map.put(:last_read_id, last_read_id || "") + |> Map.put_new(:inserted_at, now) + |> Map.put_new(:updated_at, now) + end) + + markers_attrs + |> Enum.chunk_every(1000) + |> Enum.each(fn markers_attrs_chunked -> + Repo.insert_all("markers", markers_attrs_chunked, + on_conflict: {:replace, [:last_read_id]}, + conflict_target: [:user_id, :timeline] + ) + end) + end +end diff --git a/priv/repo/migrations/20200428221338_insert_skeletons_for_deleted_users.exs b/priv/repo/migrations/20200428221338_insert_skeletons_for_deleted_users.exs new file mode 100644 index 000000000..2adc38186 --- /dev/null +++ b/priv/repo/migrations/20200428221338_insert_skeletons_for_deleted_users.exs @@ -0,0 +1,45 @@ +defmodule Pleroma.Repo.Migrations.InsertSkeletonsForDeletedUsers do + use Ecto.Migration + + alias Pleroma.User + alias Pleroma.Repo + + import Ecto.Query + + def change do + Application.ensure_all_started(:flake_id) + + local_ap_id = + User.Query.build(%{local: true}) + |> select([u], u.ap_id) + |> limit(1) + |> Repo.one() + + unless local_ap_id == nil do + # Hack to get instance base url because getting it from Phoenix + # would require starting the whole application + instance_uri = + local_ap_id + |> URI.parse() + |> Map.put(:query, nil) + |> Map.put(:path, nil) + |> URI.to_string() + + {:ok, %{rows: ap_ids}} = + Ecto.Adapters.SQL.query( + Repo, + "select distinct unnest(nonexistent_locals.recipients) from activities, lateral (select array_agg(recipient) as recipients from unnest(activities.recipients) as recipient where recipient similar to '#{ + instance_uri + }/users/[A-Za-z0-9]*' and not(recipient in (select ap_id from users))) nonexistent_locals;", + [], + timeout: :infinity + ) + + ap_ids + |> Enum.each(fn [ap_id] -> + Ecto.Changeset.change(%User{}, deactivated: true, ap_id: ap_id) + |> Repo.insert() + end) + end + end +end diff --git a/priv/repo/migrations/20200505072231_remove_magic_key_field.exs b/priv/repo/migrations/20200505072231_remove_magic_key_field.exs new file mode 100644 index 000000000..2635e671b --- /dev/null +++ b/priv/repo/migrations/20200505072231_remove_magic_key_field.exs @@ -0,0 +1,9 @@ +defmodule Pleroma.Repo.Migrations.RemoveMagicKeyField do + use Ecto.Migration + + def change do + alter table(:users) do + remove(:magic_key, :string) + end + end +end diff --git a/priv/static/adminfe/app.c836e084.css b/priv/static/adminfe/app.796ca6d4.css similarity index 68% rename from priv/static/adminfe/app.c836e084.css rename to priv/static/adminfe/app.796ca6d4.css index 473ec1b86..1b83a8a39 100644 Binary files a/priv/static/adminfe/app.c836e084.css and b/priv/static/adminfe/app.796ca6d4.css differ diff --git a/priv/static/adminfe/chunk-15fa.5a5f973d.css b/priv/static/adminfe/chunk-0558.af0d89cd.css similarity index 100% rename from priv/static/adminfe/chunk-15fa.5a5f973d.css rename to priv/static/adminfe/chunk-0558.af0d89cd.css diff --git a/priv/static/adminfe/chunk-0778.d9e7180a.css b/priv/static/adminfe/chunk-0778.d9e7180a.css new file mode 100644 index 000000000..9d730019a Binary files /dev/null and b/priv/static/adminfe/chunk-0778.d9e7180a.css differ diff --git a/priv/static/adminfe/chunk-876c.90dffac4.css b/priv/static/adminfe/chunk-0961.d3692214.css similarity index 100% rename from priv/static/adminfe/chunk-876c.90dffac4.css rename to priv/static/adminfe/chunk-0961.d3692214.css diff --git a/priv/static/adminfe/chunk-0d8f.650c8e81.css b/priv/static/adminfe/chunk-0d8f.650c8e81.css deleted file mode 100644 index 0b2a3f669..000000000 Binary files a/priv/static/adminfe/chunk-0d8f.650c8e81.css and /dev/null differ diff --git a/priv/static/adminfe/chunk-22d2.813009b9.css b/priv/static/adminfe/chunk-22d2.813009b9.css new file mode 100644 index 000000000..f0a98583e Binary files /dev/null and b/priv/static/adminfe/chunk-22d2.813009b9.css differ diff --git a/priv/static/adminfe/chunk-136a.3936457d.css b/priv/static/adminfe/chunk-3384.2278f87c.css similarity index 64% rename from priv/static/adminfe/chunk-136a.3936457d.css rename to priv/static/adminfe/chunk-3384.2278f87c.css index 2857a9d6e..96e3273eb 100644 Binary files a/priv/static/adminfe/chunk-136a.3936457d.css and b/priv/static/adminfe/chunk-3384.2278f87c.css differ diff --git a/priv/static/adminfe/chunk-4011.c4799067.css b/priv/static/adminfe/chunk-4011.c4799067.css new file mode 100644 index 000000000..1fb099c0c Binary files /dev/null and b/priv/static/adminfe/chunk-4011.c4799067.css differ diff --git a/priv/static/adminfe/chunk-46cf.a43e9415.css b/priv/static/adminfe/chunk-46cf.a43e9415.css deleted file mode 100644 index aa7160528..000000000 Binary files a/priv/static/adminfe/chunk-46cf.a43e9415.css and /dev/null differ diff --git a/priv/static/adminfe/chunk-46ef.d45db7be.css b/priv/static/adminfe/chunk-46ef.d45db7be.css deleted file mode 100644 index d6cc7d182..000000000 Binary files a/priv/static/adminfe/chunk-46ef.d45db7be.css and /dev/null differ diff --git a/priv/static/adminfe/chunk-4e7d.7aace723.css b/priv/static/adminfe/chunk-4e7d.7aace723.css deleted file mode 100644 index 9a35b64a0..000000000 Binary files a/priv/static/adminfe/chunk-4e7d.7aace723.css and /dev/null differ diff --git a/priv/static/adminfe/chunk-6b68.0cc00484.css b/priv/static/adminfe/chunk-6b68.0cc00484.css new file mode 100644 index 000000000..7061b3d03 Binary files /dev/null and b/priv/static/adminfe/chunk-6b68.0cc00484.css differ diff --git a/priv/static/adminfe/chunk-4ffb.dd09fe2e.css b/priv/static/adminfe/chunk-6e81.0e80d020.css similarity index 100% rename from priv/static/adminfe/chunk-4ffb.dd09fe2e.css rename to priv/static/adminfe/chunk-6e81.0e80d020.css diff --git a/priv/static/adminfe/chunk-7637.941c4edb.css b/priv/static/adminfe/chunk-7637.941c4edb.css new file mode 100644 index 000000000..be1d183a9 Binary files /dev/null and b/priv/static/adminfe/chunk-7637.941c4edb.css differ diff --git a/priv/static/adminfe/chunk-87b3.2affd602.css b/priv/static/adminfe/chunk-87b3.2affd602.css deleted file mode 100644 index c4fa46d3e..000000000 Binary files a/priv/static/adminfe/chunk-87b3.2affd602.css and /dev/null differ diff --git a/priv/static/adminfe/chunk-970d.f59cca8c.css b/priv/static/adminfe/chunk-970d.f59cca8c.css new file mode 100644 index 000000000..15511f12f Binary files /dev/null and b/priv/static/adminfe/chunk-970d.f59cca8c.css differ diff --git a/priv/static/adminfe/chunk-cf57.4d39576f.css b/priv/static/adminfe/chunk-cf57.4d39576f.css deleted file mode 100644 index 1190aca24..000000000 Binary files a/priv/static/adminfe/chunk-cf57.4d39576f.css and /dev/null differ diff --git a/priv/static/adminfe/chunk-d38a.cabdc22e.css b/priv/static/adminfe/chunk-d38a.cabdc22e.css new file mode 100644 index 000000000..4a2bf472b Binary files /dev/null and b/priv/static/adminfe/chunk-d38a.cabdc22e.css differ diff --git a/priv/static/adminfe/chunk-e458.f88bafea.css b/priv/static/adminfe/chunk-e458.f88bafea.css new file mode 100644 index 000000000..085bdf076 Binary files /dev/null and b/priv/static/adminfe/chunk-e458.f88bafea.css differ diff --git a/priv/static/adminfe/chunk-e5cf.cba3ae06.css b/priv/static/adminfe/chunk-e5cf.cba3ae06.css deleted file mode 100644 index a74b42d14..000000000 Binary files a/priv/static/adminfe/chunk-e5cf.cba3ae06.css and /dev/null differ diff --git a/priv/static/adminfe/index.html b/priv/static/adminfe/index.html index 717b0f32d..a236dd0f7 100644 --- a/priv/static/adminfe/index.html +++ b/priv/static/adminfe/index.html @@ -1 +1 @@ -Admin FE
\ No newline at end of file +Admin FE
\ No newline at end of file diff --git a/priv/static/adminfe/static/js/app.203f69f8.js b/priv/static/adminfe/static/js/app.203f69f8.js new file mode 100644 index 000000000..d06fdf71d Binary files /dev/null and b/priv/static/adminfe/static/js/app.203f69f8.js differ diff --git a/priv/static/adminfe/static/js/app.203f69f8.js.map b/priv/static/adminfe/static/js/app.203f69f8.js.map new file mode 100644 index 000000000..eb78cd464 Binary files /dev/null and b/priv/static/adminfe/static/js/app.203f69f8.js.map differ diff --git a/priv/static/adminfe/static/js/app.d2c3c6b3.js b/priv/static/adminfe/static/js/app.d2c3c6b3.js deleted file mode 100644 index c527207dd..000000000 Binary files a/priv/static/adminfe/static/js/app.d2c3c6b3.js and /dev/null differ diff --git a/priv/static/adminfe/static/js/app.d2c3c6b3.js.map b/priv/static/adminfe/static/js/app.d2c3c6b3.js.map deleted file mode 100644 index 7b2d4dc05..000000000 Binary files a/priv/static/adminfe/static/js/app.d2c3c6b3.js.map and /dev/null differ diff --git a/priv/static/adminfe/static/js/chunk-15fa.34070731.js b/priv/static/adminfe/static/js/chunk-0558.75954137.js similarity index 98% rename from priv/static/adminfe/static/js/chunk-15fa.34070731.js rename to priv/static/adminfe/static/js/chunk-0558.75954137.js index 937908d00..7b29707fa 100644 Binary files a/priv/static/adminfe/static/js/chunk-15fa.34070731.js and b/priv/static/adminfe/static/js/chunk-0558.75954137.js differ diff --git a/priv/static/adminfe/static/js/chunk-15fa.34070731.js.map b/priv/static/adminfe/static/js/chunk-0558.75954137.js.map similarity index 99% rename from priv/static/adminfe/static/js/chunk-15fa.34070731.js.map rename to priv/static/adminfe/static/js/chunk-0558.75954137.js.map index d3830be7c..e9e2affb6 100644 Binary files a/priv/static/adminfe/static/js/chunk-15fa.34070731.js.map and b/priv/static/adminfe/static/js/chunk-0558.75954137.js.map differ diff --git a/priv/static/adminfe/static/js/chunk-0778.b17650df.js b/priv/static/adminfe/static/js/chunk-0778.b17650df.js new file mode 100644 index 000000000..1a174cc1e Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-0778.b17650df.js differ diff --git a/priv/static/adminfe/static/js/chunk-0778.b17650df.js.map b/priv/static/adminfe/static/js/chunk-0778.b17650df.js.map new file mode 100644 index 000000000..1f96c3236 Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-0778.b17650df.js.map differ diff --git a/priv/static/adminfe/static/js/chunk-876c.e4ceccca.js b/priv/static/adminfe/static/js/chunk-0961.ef33e81b.js similarity index 97% rename from priv/static/adminfe/static/js/chunk-876c.e4ceccca.js rename to priv/static/adminfe/static/js/chunk-0961.ef33e81b.js index 841ceb9dc..e090bb93c 100644 Binary files a/priv/static/adminfe/static/js/chunk-876c.e4ceccca.js and b/priv/static/adminfe/static/js/chunk-0961.ef33e81b.js differ diff --git a/priv/static/adminfe/static/js/chunk-876c.e4ceccca.js.map b/priv/static/adminfe/static/js/chunk-0961.ef33e81b.js.map similarity index 99% rename from priv/static/adminfe/static/js/chunk-876c.e4ceccca.js.map rename to priv/static/adminfe/static/js/chunk-0961.ef33e81b.js.map index 88976a4fe..97c6a4b54 100644 Binary files a/priv/static/adminfe/static/js/chunk-876c.e4ceccca.js.map and b/priv/static/adminfe/static/js/chunk-0961.ef33e81b.js.map differ diff --git a/priv/static/adminfe/static/js/chunk-0d8f.a85e3222.js b/priv/static/adminfe/static/js/chunk-0d8f.a85e3222.js deleted file mode 100644 index e3b0ae986..000000000 Binary files a/priv/static/adminfe/static/js/chunk-0d8f.a85e3222.js and /dev/null differ diff --git a/priv/static/adminfe/static/js/chunk-0d8f.a85e3222.js.map b/priv/static/adminfe/static/js/chunk-0d8f.a85e3222.js.map deleted file mode 100644 index cf75f3243..000000000 Binary files a/priv/static/adminfe/static/js/chunk-0d8f.a85e3222.js.map and /dev/null differ diff --git a/priv/static/adminfe/static/js/chunk-136a.142aa42a.js b/priv/static/adminfe/static/js/chunk-136a.142aa42a.js deleted file mode 100644 index 812089b5f..000000000 Binary files a/priv/static/adminfe/static/js/chunk-136a.142aa42a.js and /dev/null differ diff --git a/priv/static/adminfe/static/js/chunk-136a.142aa42a.js.map b/priv/static/adminfe/static/js/chunk-136a.142aa42a.js.map deleted file mode 100644 index f6b4c84aa..000000000 Binary files a/priv/static/adminfe/static/js/chunk-136a.142aa42a.js.map and /dev/null differ diff --git a/priv/static/adminfe/static/js/chunk-22d2.a0cf7976.js b/priv/static/adminfe/static/js/chunk-22d2.a0cf7976.js new file mode 100644 index 000000000..903f553b0 Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-22d2.a0cf7976.js differ diff --git a/priv/static/adminfe/static/js/chunk-22d2.a0cf7976.js.map b/priv/static/adminfe/static/js/chunk-22d2.a0cf7976.js.map new file mode 100644 index 000000000..68735ed26 Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-22d2.a0cf7976.js.map differ diff --git a/priv/static/adminfe/static/js/chunk-3384.458ffaf1.js b/priv/static/adminfe/static/js/chunk-3384.458ffaf1.js new file mode 100644 index 000000000..eb2b55d37 Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-3384.458ffaf1.js differ diff --git a/priv/static/adminfe/static/js/chunk-3384.458ffaf1.js.map b/priv/static/adminfe/static/js/chunk-3384.458ffaf1.js.map new file mode 100644 index 000000000..0bb577aab Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-3384.458ffaf1.js.map differ diff --git a/priv/static/adminfe/static/js/chunk-4011.67fb1692.js b/priv/static/adminfe/static/js/chunk-4011.67fb1692.js new file mode 100644 index 000000000..775ed26f1 Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-4011.67fb1692.js differ diff --git a/priv/static/adminfe/static/js/chunk-4011.67fb1692.js.map b/priv/static/adminfe/static/js/chunk-4011.67fb1692.js.map new file mode 100644 index 000000000..6df398cbc Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-4011.67fb1692.js.map differ diff --git a/priv/static/adminfe/static/js/chunk-46cf.3bd3567a.js b/priv/static/adminfe/static/js/chunk-46cf.3bd3567a.js deleted file mode 100644 index 0795a46b6..000000000 Binary files a/priv/static/adminfe/static/js/chunk-46cf.3bd3567a.js and /dev/null differ diff --git a/priv/static/adminfe/static/js/chunk-46cf.3bd3567a.js.map b/priv/static/adminfe/static/js/chunk-46cf.3bd3567a.js.map deleted file mode 100644 index 9993be4aa..000000000 Binary files a/priv/static/adminfe/static/js/chunk-46cf.3bd3567a.js.map and /dev/null differ diff --git a/priv/static/adminfe/static/js/chunk-46ef.215af110.js b/priv/static/adminfe/static/js/chunk-46ef.215af110.js deleted file mode 100644 index db11c7488..000000000 Binary files a/priv/static/adminfe/static/js/chunk-46ef.215af110.js and /dev/null differ diff --git a/priv/static/adminfe/static/js/chunk-46ef.215af110.js.map b/priv/static/adminfe/static/js/chunk-46ef.215af110.js.map deleted file mode 100644 index 2da3dbec6..000000000 Binary files a/priv/static/adminfe/static/js/chunk-46ef.215af110.js.map and /dev/null differ diff --git a/priv/static/adminfe/static/js/chunk-4e7d.a40ad735.js b/priv/static/adminfe/static/js/chunk-4e7d.a40ad735.js deleted file mode 100644 index ef2379ed9..000000000 Binary files a/priv/static/adminfe/static/js/chunk-4e7d.a40ad735.js and /dev/null differ diff --git a/priv/static/adminfe/static/js/chunk-4e7d.a40ad735.js.map b/priv/static/adminfe/static/js/chunk-4e7d.a40ad735.js.map deleted file mode 100644 index b349f12eb..000000000 Binary files a/priv/static/adminfe/static/js/chunk-4e7d.a40ad735.js.map and /dev/null differ diff --git a/priv/static/adminfe/static/js/chunk-6b68.fbc0f684.js b/priv/static/adminfe/static/js/chunk-6b68.fbc0f684.js new file mode 100644 index 000000000..bfdf936f8 Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-6b68.fbc0f684.js differ diff --git a/priv/static/adminfe/static/js/chunk-6b68.fbc0f684.js.map b/priv/static/adminfe/static/js/chunk-6b68.fbc0f684.js.map new file mode 100644 index 000000000..d1d728b80 Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-6b68.fbc0f684.js.map differ diff --git a/priv/static/adminfe/static/js/chunk-4ffb.0e8f3772.js b/priv/static/adminfe/static/js/chunk-6e81.3733ace2.js similarity index 85% rename from priv/static/adminfe/static/js/chunk-4ffb.0e8f3772.js rename to priv/static/adminfe/static/js/chunk-6e81.3733ace2.js index 5a7aa9f59..c888ce03f 100644 Binary files a/priv/static/adminfe/static/js/chunk-4ffb.0e8f3772.js and b/priv/static/adminfe/static/js/chunk-6e81.3733ace2.js differ diff --git a/priv/static/adminfe/static/js/chunk-4ffb.0e8f3772.js.map b/priv/static/adminfe/static/js/chunk-6e81.3733ace2.js.map similarity index 98% rename from priv/static/adminfe/static/js/chunk-4ffb.0e8f3772.js.map rename to priv/static/adminfe/static/js/chunk-6e81.3733ace2.js.map index 7c020768c..63128dd67 100644 Binary files a/priv/static/adminfe/static/js/chunk-4ffb.0e8f3772.js.map and b/priv/static/adminfe/static/js/chunk-6e81.3733ace2.js.map differ diff --git a/priv/static/adminfe/static/js/chunk-7637.8f5fb36e.js b/priv/static/adminfe/static/js/chunk-7637.8f5fb36e.js new file mode 100644 index 000000000..b38644b98 Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-7637.8f5fb36e.js differ diff --git a/priv/static/adminfe/static/js/chunk-7637.8f5fb36e.js.map b/priv/static/adminfe/static/js/chunk-7637.8f5fb36e.js.map new file mode 100644 index 000000000..ddd53f1cd Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-7637.8f5fb36e.js.map differ diff --git a/priv/static/adminfe/static/js/chunk-87b3.4704cadf.js b/priv/static/adminfe/static/js/chunk-87b3.4704cadf.js deleted file mode 100644 index 9766fd7d2..000000000 Binary files a/priv/static/adminfe/static/js/chunk-87b3.4704cadf.js and /dev/null differ diff --git a/priv/static/adminfe/static/js/chunk-87b3.4704cadf.js.map b/priv/static/adminfe/static/js/chunk-87b3.4704cadf.js.map deleted file mode 100644 index 7472fcd92..000000000 Binary files a/priv/static/adminfe/static/js/chunk-87b3.4704cadf.js.map and /dev/null differ diff --git a/priv/static/adminfe/static/js/chunk-970d.2457e066.js b/priv/static/adminfe/static/js/chunk-970d.2457e066.js new file mode 100644 index 000000000..0f99d835e Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-970d.2457e066.js differ diff --git a/priv/static/adminfe/static/js/chunk-970d.2457e066.js.map b/priv/static/adminfe/static/js/chunk-970d.2457e066.js.map new file mode 100644 index 000000000..6896407b0 Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-970d.2457e066.js.map differ diff --git a/priv/static/adminfe/static/js/chunk-cf57.42b96339.js b/priv/static/adminfe/static/js/chunk-cf57.42b96339.js deleted file mode 100644 index 81122f992..000000000 Binary files a/priv/static/adminfe/static/js/chunk-cf57.42b96339.js and /dev/null differ diff --git a/priv/static/adminfe/static/js/chunk-cf57.42b96339.js.map b/priv/static/adminfe/static/js/chunk-cf57.42b96339.js.map deleted file mode 100644 index 7471835b9..000000000 Binary files a/priv/static/adminfe/static/js/chunk-cf57.42b96339.js.map and /dev/null differ diff --git a/priv/static/adminfe/static/js/chunk-d38a.a851004a.js b/priv/static/adminfe/static/js/chunk-d38a.a851004a.js new file mode 100644 index 000000000..c302af310 Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-d38a.a851004a.js differ diff --git a/priv/static/adminfe/static/js/chunk-d38a.a851004a.js.map b/priv/static/adminfe/static/js/chunk-d38a.a851004a.js.map new file mode 100644 index 000000000..6779f6dc1 Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-d38a.a851004a.js.map differ diff --git a/priv/static/adminfe/static/js/chunk-e458.4e5aad44.js b/priv/static/adminfe/static/js/chunk-e458.4e5aad44.js new file mode 100644 index 000000000..a02c83110 Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-e458.4e5aad44.js differ diff --git a/priv/static/adminfe/static/js/chunk-e458.4e5aad44.js.map b/priv/static/adminfe/static/js/chunk-e458.4e5aad44.js.map new file mode 100644 index 000000000..e623af23d Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-e458.4e5aad44.js.map differ diff --git a/priv/static/adminfe/static/js/chunk-e5cf.501d7902.js b/priv/static/adminfe/static/js/chunk-e5cf.501d7902.js deleted file mode 100644 index fe5552943..000000000 Binary files a/priv/static/adminfe/static/js/chunk-e5cf.501d7902.js and /dev/null differ diff --git a/priv/static/adminfe/static/js/chunk-e5cf.501d7902.js.map b/priv/static/adminfe/static/js/chunk-e5cf.501d7902.js.map deleted file mode 100644 index 60676bfe7..000000000 Binary files a/priv/static/adminfe/static/js/chunk-e5cf.501d7902.js.map and /dev/null differ diff --git a/priv/static/adminfe/static/js/runtime.1b4f6ce0.js b/priv/static/adminfe/static/js/runtime.1b4f6ce0.js new file mode 100644 index 000000000..6558531ba Binary files /dev/null and b/priv/static/adminfe/static/js/runtime.1b4f6ce0.js differ diff --git a/priv/static/adminfe/static/js/runtime.1b4f6ce0.js.map b/priv/static/adminfe/static/js/runtime.1b4f6ce0.js.map new file mode 100644 index 000000000..9295ac636 Binary files /dev/null and b/priv/static/adminfe/static/js/runtime.1b4f6ce0.js.map differ diff --git a/priv/static/adminfe/static/js/runtime.fa19e5d1.js b/priv/static/adminfe/static/js/runtime.fa19e5d1.js deleted file mode 100644 index b905e42e1..000000000 Binary files a/priv/static/adminfe/static/js/runtime.fa19e5d1.js and /dev/null differ diff --git a/priv/static/adminfe/static/js/runtime.fa19e5d1.js.map b/priv/static/adminfe/static/js/runtime.fa19e5d1.js.map deleted file mode 100644 index 6a2565556..000000000 Binary files a/priv/static/adminfe/static/js/runtime.fa19e5d1.js.map and /dev/null differ diff --git a/priv/static/font/fontello.1575660578688.eot b/priv/static/font/fontello.1575660578688.eot deleted file mode 100644 index 31a66127f..000000000 Binary files a/priv/static/font/fontello.1575660578688.eot and /dev/null differ diff --git a/priv/static/font/fontello.1575660578688.svg b/priv/static/font/fontello.1575660578688.svg deleted file mode 100644 index 19fa56ba4..000000000 --- a/priv/static/font/fontello.1575660578688.svg +++ /dev/null @@ -1,126 +0,0 @@ - - - -Copyright (C) 2019 by original authors @ fontello.com - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - \ No newline at end of file diff --git a/priv/static/font/fontello.1575660578688.ttf b/priv/static/font/fontello.1575660578688.ttf deleted file mode 100644 index 7e990495e..000000000 Binary files a/priv/static/font/fontello.1575660578688.ttf and /dev/null differ diff --git a/priv/static/font/fontello.1575660578688.woff b/priv/static/font/fontello.1575660578688.woff deleted file mode 100644 index 239190cba..000000000 Binary files a/priv/static/font/fontello.1575660578688.woff and /dev/null differ diff --git a/priv/static/font/fontello.1575660578688.woff2 b/priv/static/font/fontello.1575660578688.woff2 deleted file mode 100644 index b4d3537c5..000000000 Binary files a/priv/static/font/fontello.1575660578688.woff2 and /dev/null differ diff --git a/priv/static/font/fontello.1575662648966.eot b/priv/static/font/fontello.1575662648966.eot deleted file mode 100644 index a5cb925ad..000000000 Binary files a/priv/static/font/fontello.1575662648966.eot and /dev/null differ diff --git a/priv/static/font/fontello.1575662648966.svg b/priv/static/font/fontello.1575662648966.svg deleted file mode 100644 index 19fa56ba4..000000000 --- a/priv/static/font/fontello.1575662648966.svg +++ /dev/null @@ -1,126 +0,0 @@ - - - -Copyright (C) 2019 by original authors @ fontello.com - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - \ No newline at end of file diff --git a/priv/static/font/fontello.1575662648966.ttf b/priv/static/font/fontello.1575662648966.ttf deleted file mode 100644 index ec67a3d00..000000000 Binary files a/priv/static/font/fontello.1575662648966.ttf and /dev/null differ diff --git a/priv/static/font/fontello.1575662648966.woff b/priv/static/font/fontello.1575662648966.woff deleted file mode 100644 index feee99308..000000000 Binary files a/priv/static/font/fontello.1575662648966.woff and /dev/null differ diff --git a/priv/static/font/fontello.1575662648966.woff2 b/priv/static/font/fontello.1575662648966.woff2 deleted file mode 100644 index a126c585f..000000000 Binary files a/priv/static/font/fontello.1575662648966.woff2 and /dev/null differ diff --git a/priv/static/fontello.1575660578688.css b/priv/static/fontello.1575660578688.css deleted file mode 100644 index f232f5600..000000000 Binary files a/priv/static/fontello.1575660578688.css and /dev/null differ diff --git a/priv/static/fontello.1575662648966.css b/priv/static/fontello.1575662648966.css deleted file mode 100644 index a47f73e3a..000000000 Binary files a/priv/static/fontello.1575662648966.css and /dev/null differ diff --git a/priv/static/index.html b/priv/static/index.html index 4304bdcbb..b37cbaa67 100644 --- a/priv/static/index.html +++ b/priv/static/index.html @@ -1 +1 @@ -Pleroma
\ No newline at end of file +Pleroma
\ No newline at end of file diff --git a/priv/static/static/static-fe.css b/priv/static/static-fe/static-fe.css similarity index 100% rename from priv/static/static/static-fe.css rename to priv/static/static-fe/static-fe.css diff --git a/priv/static/static/config.json b/priv/static/static/config.json index c82678699..727dde73b 100644 --- a/priv/static/static/config.json +++ b/priv/static/static/config.json @@ -1,23 +1,28 @@ { - "theme": "pleroma-dark", - "background": "/static/aurora_borealis.jpg", - "logo": "/static/logo.png", - "logoMask": true, - "logoMargin": ".1em", - "redirectRootNoLogin": "/main/all", - "redirectRootLogin": "/main/friends", - "showInstanceSpecificPanel": false, - "collapseMessageWithSubject": false, - "scopeCopy": true, - "subjectLineBehavior": "email", - "postContentType": "text/plain", "alwaysShowSubjectInput": true, + "background": "/static/aurora_borealis.jpg", + "collapseMessageWithSubject": false, + "disableChat": false, + "greentext": false, + "hideFilteredStatuses": false, + "hideMutedPosts": false, "hidePostStats": false, + "hideSitename": false, "hideUserStats": false, "loginMethod": "password", - "webPushNotifications": false, + "logo": "/static/logo.png", + "logoMargin": ".1em", + "logoMask": true, + "minimalScopesMode": false, "noAttachmentLinks": false, "nsfwCensorImage": "", + "postContentType": "text/plain", + "redirectRootLogin": "/main/friends", + "redirectRootNoLogin": "/main/all", + "scopeCopy": true, "showFeaturesPanel": true, - "minimalScopesMode": false + "showInstanceSpecificPanel": false, + "subjectLineBehavior": "email", + "theme": "pleroma-dark", + "webPushNotifications": false } diff --git a/priv/static/static/css/app.1055039ce3f2fe4dd110.css b/priv/static/static/css/app.1055039ce3f2fe4dd110.css deleted file mode 100644 index 1867ca81a..000000000 Binary files a/priv/static/static/css/app.1055039ce3f2fe4dd110.css and /dev/null differ diff --git a/priv/static/static/css/app.1055039ce3f2fe4dd110.css.map b/priv/static/static/css/app.1055039ce3f2fe4dd110.css.map deleted file mode 100644 index 861ee8313..000000000 --- a/priv/static/static/css/app.1055039ce3f2fe4dd110.css.map +++ /dev/null @@ -1 +0,0 @@ -{"version":3,"sources":["webpack:///./src/hocs/with_load_more/with_load_more.scss","webpack:///./src/components/tab_switcher/tab_switcher.scss","webpack:///./src/hocs/with_subscription/with_subscription.scss"],"names":[],"mappings":"AAAA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,C;ACTA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,C;ACxFA;AACA;AACA;AACA;AACA;AACA;AACA,C","file":"static/css/app.1055039ce3f2fe4dd110.css","sourcesContent":[".with-load-more-footer {\n padding: 10px;\n text-align: center;\n border-top: 1px solid;\n border-top-color: #222;\n border-top-color: var(--border, #222);\n}\n.with-load-more-footer .error {\n font-size: 14px;\n}",".tab-switcher {\n display: -ms-flexbox;\n display: flex;\n -ms-flex-direction: column;\n flex-direction: column;\n}\n.tab-switcher .contents {\n -ms-flex: 1 0 auto;\n flex: 1 0 auto;\n min-height: 0px;\n}\n.tab-switcher .contents .hidden {\n display: none;\n}\n.tab-switcher .contents.scrollable-tabs {\n -ms-flex-preferred-size: 0;\n flex-basis: 0;\n overflow-y: auto;\n}\n.tab-switcher .tabs {\n display: -ms-flexbox;\n display: flex;\n position: relative;\n width: 100%;\n overflow-y: hidden;\n overflow-x: auto;\n padding-top: 5px;\n box-sizing: border-box;\n}\n.tab-switcher .tabs::after, .tab-switcher .tabs::before {\n display: block;\n content: \"\";\n -ms-flex: 1 1 auto;\n flex: 1 1 auto;\n border-bottom: 1px solid;\n border-bottom-color: #222;\n border-bottom-color: var(--border, #222);\n}\n.tab-switcher .tabs .tab-wrapper {\n height: 28px;\n position: relative;\n display: -ms-flexbox;\n display: flex;\n -ms-flex: 0 0 auto;\n flex: 0 0 auto;\n}\n.tab-switcher .tabs .tab-wrapper .tab {\n width: 100%;\n min-width: 1px;\n position: relative;\n border-bottom-left-radius: 0;\n border-bottom-right-radius: 0;\n padding: 6px 1em;\n padding-bottom: 99px;\n margin-bottom: -93px;\n white-space: nowrap;\n color: #b9b9ba;\n color: var(--tabText, #b9b9ba);\n background-color: #182230;\n background-color: var(--tab, #182230);\n}\n.tab-switcher .tabs .tab-wrapper .tab:not(.active) {\n z-index: 4;\n}\n.tab-switcher .tabs .tab-wrapper .tab:not(.active):hover {\n z-index: 6;\n}\n.tab-switcher .tabs .tab-wrapper .tab.active {\n background: transparent;\n z-index: 5;\n color: #b9b9ba;\n color: var(--tabActiveText, #b9b9ba);\n}\n.tab-switcher .tabs .tab-wrapper .tab img {\n max-height: 26px;\n vertical-align: top;\n margin-top: -5px;\n}\n.tab-switcher .tabs .tab-wrapper:not(.active)::after {\n content: \"\";\n position: absolute;\n left: 0;\n right: 0;\n bottom: 0;\n z-index: 7;\n border-bottom: 1px solid;\n border-bottom-color: #222;\n border-bottom-color: var(--border, #222);\n}",".with-subscription-loading {\n padding: 10px;\n text-align: center;\n}\n.with-subscription-loading .error {\n font-size: 14px;\n}"],"sourceRoot":""} \ No newline at end of file diff --git a/priv/static/static/css/app.613cef07981cd95ccceb.css b/priv/static/static/css/app.613cef07981cd95ccceb.css new file mode 100644 index 000000000..c1d5f8188 Binary files /dev/null and b/priv/static/static/css/app.613cef07981cd95ccceb.css differ diff --git a/priv/static/static/css/app.613cef07981cd95ccceb.css.map b/priv/static/static/css/app.613cef07981cd95ccceb.css.map new file mode 100644 index 000000000..556e0bb0b --- /dev/null +++ b/priv/static/static/css/app.613cef07981cd95ccceb.css.map @@ -0,0 +1 @@ +{"version":3,"sources":["webpack:///./src/hocs/with_load_more/with_load_more.scss","webpack:///./src/components/tab_switcher/tab_switcher.scss","webpack:///./src/hocs/with_subscription/with_subscription.scss"],"names":[],"mappings":"AAAA,uBAAuB,aAAa,kBAAkB,qBAAqB,sBAAsB,qCAAqC,8BAA8B,e;ACApK,cAAc,oBAAoB,aAAa,0BAA0B,sBAAsB,wBAAwB,kBAAkB,cAAc,eAAe,gCAAgC,aAAa,wCAAwC,0BAA0B,aAAa,gBAAgB,oBAAoB,oBAAoB,aAAa,kBAAkB,WAAW,kBAAkB,gBAAgB,gBAAgB,sBAAsB,uDAAuD,cAAc,WAAW,kBAAkB,cAAc,wBAAwB,yBAAyB,wCAAwC,iCAAiC,YAAY,kBAAkB,oBAAoB,aAAa,kBAAkB,cAAc,sCAAsC,WAAW,cAAc,kBAAkB,4BAA4B,6BAA6B,gBAAgB,oBAAoB,oBAAoB,mBAAmB,cAAc,8BAA8B,yBAAyB,qCAAqC,mDAAmD,UAAU,yDAAyD,UAAU,6CAA6C,uBAAuB,UAAU,cAAc,oCAAoC,0CAA0C,gBAAgB,mBAAmB,gBAAgB,qDAAqD,WAAW,kBAAkB,OAAO,QAAQ,SAAS,UAAU,wBAAwB,yBAAyB,wC;ACAtlD,2BAA2B,aAAa,kBAAkB,kCAAkC,e","file":"static/css/app.613cef07981cd95ccceb.css","sourcesContent":[".with-load-more-footer{padding:10px;text-align:center;border-top:1px solid;border-top-color:#222;border-top-color:var(--border, #222)}.with-load-more-footer .error{font-size:14px}",".tab-switcher{display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column}.tab-switcher .contents{-ms-flex:1 0 auto;flex:1 0 auto;min-height:0px}.tab-switcher .contents .hidden{display:none}.tab-switcher .contents.scrollable-tabs{-ms-flex-preferred-size:0;flex-basis:0;overflow-y:auto}.tab-switcher .tabs{display:-ms-flexbox;display:flex;position:relative;width:100%;overflow-y:hidden;overflow-x:auto;padding-top:5px;box-sizing:border-box}.tab-switcher .tabs::after,.tab-switcher .tabs::before{display:block;content:\"\";-ms-flex:1 1 auto;flex:1 1 auto;border-bottom:1px solid;border-bottom-color:#222;border-bottom-color:var(--border, #222)}.tab-switcher .tabs .tab-wrapper{height:28px;position:relative;display:-ms-flexbox;display:flex;-ms-flex:0 0 auto;flex:0 0 auto}.tab-switcher .tabs .tab-wrapper .tab{width:100%;min-width:1px;position:relative;border-bottom-left-radius:0;border-bottom-right-radius:0;padding:6px 1em;padding-bottom:99px;margin-bottom:-93px;white-space:nowrap;color:#b9b9ba;color:var(--tabText, #b9b9ba);background-color:#182230;background-color:var(--tab, #182230)}.tab-switcher .tabs .tab-wrapper .tab:not(.active){z-index:4}.tab-switcher .tabs .tab-wrapper .tab:not(.active):hover{z-index:6}.tab-switcher .tabs .tab-wrapper .tab.active{background:transparent;z-index:5;color:#b9b9ba;color:var(--tabActiveText, #b9b9ba)}.tab-switcher .tabs .tab-wrapper .tab img{max-height:26px;vertical-align:top;margin-top:-5px}.tab-switcher .tabs .tab-wrapper:not(.active)::after{content:\"\";position:absolute;left:0;right:0;bottom:0;z-index:7;border-bottom:1px solid;border-bottom-color:#222;border-bottom-color:var(--border, #222)}",".with-subscription-loading{padding:10px;text-align:center}.with-subscription-loading .error{font-size:14px}"],"sourceRoot":""} \ No newline at end of file diff --git a/priv/static/static/css/vendors~app.b2603a50868c68a1c192.css b/priv/static/static/css/vendors~app.18fea621d430000acc27.css similarity index 92% rename from priv/static/static/css/vendors~app.b2603a50868c68a1c192.css rename to priv/static/static/css/vendors~app.18fea621d430000acc27.css index a2e625f5e..ef783cbb3 100644 Binary files a/priv/static/static/css/vendors~app.b2603a50868c68a1c192.css and b/priv/static/static/css/vendors~app.18fea621d430000acc27.css differ diff --git a/priv/static/static/css/vendors~app.18fea621d430000acc27.css.map b/priv/static/static/css/vendors~app.18fea621d430000acc27.css.map new file mode 100644 index 000000000..057d67d6a --- /dev/null +++ b/priv/static/static/css/vendors~app.18fea621d430000acc27.css.map @@ -0,0 +1 @@ +{"version":3,"sources":["webpack:///./node_modules/cropperjs/dist/cropper.css"],"names":[],"mappings":"AAAA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA,wCAAwC;AACxC;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA","file":"static/css/vendors~app.18fea621d430000acc27.css","sourcesContent":["/*!\n * Cropper.js v1.5.6\n * https://fengyuanchen.github.io/cropperjs\n *\n * Copyright 2015-present Chen Fengyuan\n * Released under the MIT license\n *\n * Date: 2019-10-04T04:33:44.164Z\n */\n\n.cropper-container {\n direction: ltr;\n font-size: 0;\n line-height: 0;\n position: relative;\n -ms-touch-action: none;\n touch-action: none;\n -webkit-user-select: none;\n -ms-user-select: none;\n user-select: none;\n}\n\n.cropper-container img {\n display: block;\n height: 100%;\n image-orientation: 0deg;\n max-height: none !important;\n max-width: none !important;\n min-height: 0 !important;\n min-width: 0 !important;\n width: 100%;\n}\n\n.cropper-wrap-box,\n.cropper-canvas,\n.cropper-drag-box,\n.cropper-crop-box,\n.cropper-modal {\n bottom: 0;\n left: 0;\n position: absolute;\n right: 0;\n top: 0;\n}\n\n.cropper-wrap-box,\n.cropper-canvas {\n overflow: hidden;\n}\n\n.cropper-drag-box {\n background-color: #fff;\n opacity: 0;\n}\n\n.cropper-modal {\n background-color: #000;\n opacity: 0.5;\n}\n\n.cropper-view-box {\n display: block;\n height: 100%;\n outline: 1px solid #39f;\n outline-color: rgba(51, 153, 255, 0.75);\n overflow: hidden;\n width: 100%;\n}\n\n.cropper-dashed {\n border: 0 dashed #eee;\n display: block;\n opacity: 0.5;\n position: absolute;\n}\n\n.cropper-dashed.dashed-h {\n border-bottom-width: 1px;\n border-top-width: 1px;\n height: calc(100% / 3);\n left: 0;\n top: calc(100% / 3);\n width: 100%;\n}\n\n.cropper-dashed.dashed-v {\n border-left-width: 1px;\n border-right-width: 1px;\n height: 100%;\n left: calc(100% / 3);\n top: 0;\n width: calc(100% / 3);\n}\n\n.cropper-center {\n display: block;\n height: 0;\n left: 50%;\n opacity: 0.75;\n position: absolute;\n top: 50%;\n width: 0;\n}\n\n.cropper-center::before,\n.cropper-center::after {\n background-color: #eee;\n content: ' ';\n display: block;\n position: absolute;\n}\n\n.cropper-center::before {\n height: 1px;\n left: -3px;\n top: 0;\n width: 7px;\n}\n\n.cropper-center::after {\n height: 7px;\n left: 0;\n top: -3px;\n width: 1px;\n}\n\n.cropper-face,\n.cropper-line,\n.cropper-point {\n display: block;\n height: 100%;\n opacity: 0.1;\n position: absolute;\n width: 100%;\n}\n\n.cropper-face {\n background-color: #fff;\n left: 0;\n top: 0;\n}\n\n.cropper-line {\n background-color: #39f;\n}\n\n.cropper-line.line-e {\n cursor: ew-resize;\n right: -3px;\n top: 0;\n width: 5px;\n}\n\n.cropper-line.line-n {\n cursor: ns-resize;\n height: 5px;\n left: 0;\n top: -3px;\n}\n\n.cropper-line.line-w {\n cursor: ew-resize;\n left: -3px;\n top: 0;\n width: 5px;\n}\n\n.cropper-line.line-s {\n bottom: -3px;\n cursor: ns-resize;\n height: 5px;\n left: 0;\n}\n\n.cropper-point {\n background-color: #39f;\n height: 5px;\n opacity: 0.75;\n width: 5px;\n}\n\n.cropper-point.point-e {\n cursor: ew-resize;\n margin-top: -3px;\n right: -3px;\n top: 50%;\n}\n\n.cropper-point.point-n {\n cursor: ns-resize;\n left: 50%;\n margin-left: -3px;\n top: -3px;\n}\n\n.cropper-point.point-w {\n cursor: ew-resize;\n left: -3px;\n margin-top: -3px;\n top: 50%;\n}\n\n.cropper-point.point-s {\n bottom: -3px;\n cursor: s-resize;\n left: 50%;\n margin-left: -3px;\n}\n\n.cropper-point.point-ne {\n cursor: nesw-resize;\n right: -3px;\n top: -3px;\n}\n\n.cropper-point.point-nw {\n cursor: nwse-resize;\n left: -3px;\n top: -3px;\n}\n\n.cropper-point.point-sw {\n bottom: -3px;\n cursor: nesw-resize;\n left: -3px;\n}\n\n.cropper-point.point-se {\n bottom: -3px;\n cursor: nwse-resize;\n height: 20px;\n opacity: 1;\n right: -3px;\n width: 20px;\n}\n\n@media (min-width: 768px) {\n .cropper-point.point-se {\n height: 15px;\n width: 15px;\n }\n}\n\n@media (min-width: 992px) {\n .cropper-point.point-se {\n height: 10px;\n width: 10px;\n }\n}\n\n@media (min-width: 1200px) {\n .cropper-point.point-se {\n height: 5px;\n opacity: 0.75;\n width: 5px;\n }\n}\n\n.cropper-point.point-se::before {\n background-color: #39f;\n bottom: -50%;\n content: ' ';\n display: block;\n height: 200%;\n opacity: 0;\n position: absolute;\n right: -50%;\n width: 200%;\n}\n\n.cropper-invisible {\n opacity: 0;\n}\n\n.cropper-bg {\n background-image: url('data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABAAAAAQAQMAAAAlPW0iAAAAA3NCSVQICAjb4U/gAAAABlBMVEXMzMz////TjRV2AAAACXBIWXMAAArrAAAK6wGCiw1aAAAAHHRFWHRTb2Z0d2FyZQBBZG9iZSBGaXJld29ya3MgQ1M26LyyjAAAABFJREFUCJlj+M/AgBVhF/0PAH6/D/HkDxOGAAAAAElFTkSuQmCC');\n}\n\n.cropper-hide {\n display: block;\n height: 0;\n position: absolute;\n width: 0;\n}\n\n.cropper-hidden {\n display: none !important;\n}\n\n.cropper-move {\n cursor: move;\n}\n\n.cropper-crop {\n cursor: crosshair;\n}\n\n.cropper-disabled .cropper-drag-box,\n.cropper-disabled .cropper-face,\n.cropper-disabled .cropper-line,\n.cropper-disabled .cropper-point {\n cursor: not-allowed;\n}\n"],"sourceRoot":""} \ No newline at end of file diff --git a/priv/static/static/css/vendors~app.b2603a50868c68a1c192.css.map b/priv/static/static/css/vendors~app.b2603a50868c68a1c192.css.map deleted file mode 100644 index e7013b291..000000000 --- a/priv/static/static/css/vendors~app.b2603a50868c68a1c192.css.map +++ /dev/null @@ -1 +0,0 @@ -{"version":3,"sources":["webpack:///./node_modules/cropperjs/dist/cropper.css"],"names":[],"mappings":"AAAA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA,wCAAwC;AACxC;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA","file":"static/css/vendors~app.b2603a50868c68a1c192.css","sourcesContent":["/*!\n * Cropper.js v1.4.3\n * https://fengyuanchen.github.io/cropperjs\n *\n * Copyright 2015-present Chen Fengyuan\n * Released under the MIT license\n *\n * Date: 2018-10-24T13:07:11.429Z\n */\n\n.cropper-container {\n direction: ltr;\n font-size: 0;\n line-height: 0;\n position: relative;\n -ms-touch-action: none;\n touch-action: none;\n -webkit-user-select: none;\n -moz-user-select: none;\n -ms-user-select: none;\n user-select: none;\n}\n\n.cropper-container img {\n display: block;\n height: 100%;\n image-orientation: 0deg;\n max-height: none !important;\n max-width: none !important;\n min-height: 0 !important;\n min-width: 0 !important;\n width: 100%;\n}\n\n.cropper-wrap-box,\n.cropper-canvas,\n.cropper-drag-box,\n.cropper-crop-box,\n.cropper-modal {\n bottom: 0;\n left: 0;\n position: absolute;\n right: 0;\n top: 0;\n}\n\n.cropper-wrap-box,\n.cropper-canvas {\n overflow: hidden;\n}\n\n.cropper-drag-box {\n background-color: #fff;\n opacity: 0;\n}\n\n.cropper-modal {\n background-color: #000;\n opacity: .5;\n}\n\n.cropper-view-box {\n display: block;\n height: 100%;\n outline-color: rgba(51, 153, 255, 0.75);\n outline: 1px solid #39f;\n overflow: hidden;\n width: 100%;\n}\n\n.cropper-dashed {\n border: 0 dashed #eee;\n display: block;\n opacity: .5;\n position: absolute;\n}\n\n.cropper-dashed.dashed-h {\n border-bottom-width: 1px;\n border-top-width: 1px;\n height: calc(100% / 3);\n left: 0;\n top: calc(100% / 3);\n width: 100%;\n}\n\n.cropper-dashed.dashed-v {\n border-left-width: 1px;\n border-right-width: 1px;\n height: 100%;\n left: calc(100% / 3);\n top: 0;\n width: calc(100% / 3);\n}\n\n.cropper-center {\n display: block;\n height: 0;\n left: 50%;\n opacity: .75;\n position: absolute;\n top: 50%;\n width: 0;\n}\n\n.cropper-center:before,\n.cropper-center:after {\n background-color: #eee;\n content: ' ';\n display: block;\n position: absolute;\n}\n\n.cropper-center:before {\n height: 1px;\n left: -3px;\n top: 0;\n width: 7px;\n}\n\n.cropper-center:after {\n height: 7px;\n left: 0;\n top: -3px;\n width: 1px;\n}\n\n.cropper-face,\n.cropper-line,\n.cropper-point {\n display: block;\n height: 100%;\n opacity: .1;\n position: absolute;\n width: 100%;\n}\n\n.cropper-face {\n background-color: #fff;\n left: 0;\n top: 0;\n}\n\n.cropper-line {\n background-color: #39f;\n}\n\n.cropper-line.line-e {\n cursor: ew-resize;\n right: -3px;\n top: 0;\n width: 5px;\n}\n\n.cropper-line.line-n {\n cursor: ns-resize;\n height: 5px;\n left: 0;\n top: -3px;\n}\n\n.cropper-line.line-w {\n cursor: ew-resize;\n left: -3px;\n top: 0;\n width: 5px;\n}\n\n.cropper-line.line-s {\n bottom: -3px;\n cursor: ns-resize;\n height: 5px;\n left: 0;\n}\n\n.cropper-point {\n background-color: #39f;\n height: 5px;\n opacity: .75;\n width: 5px;\n}\n\n.cropper-point.point-e {\n cursor: ew-resize;\n margin-top: -3px;\n right: -3px;\n top: 50%;\n}\n\n.cropper-point.point-n {\n cursor: ns-resize;\n left: 50%;\n margin-left: -3px;\n top: -3px;\n}\n\n.cropper-point.point-w {\n cursor: ew-resize;\n left: -3px;\n margin-top: -3px;\n top: 50%;\n}\n\n.cropper-point.point-s {\n bottom: -3px;\n cursor: s-resize;\n left: 50%;\n margin-left: -3px;\n}\n\n.cropper-point.point-ne {\n cursor: nesw-resize;\n right: -3px;\n top: -3px;\n}\n\n.cropper-point.point-nw {\n cursor: nwse-resize;\n left: -3px;\n top: -3px;\n}\n\n.cropper-point.point-sw {\n bottom: -3px;\n cursor: nesw-resize;\n left: -3px;\n}\n\n.cropper-point.point-se {\n bottom: -3px;\n cursor: nwse-resize;\n height: 20px;\n opacity: 1;\n right: -3px;\n width: 20px;\n}\n\n@media (min-width: 768px) {\n .cropper-point.point-se {\n height: 15px;\n width: 15px;\n }\n}\n\n@media (min-width: 992px) {\n .cropper-point.point-se {\n height: 10px;\n width: 10px;\n }\n}\n\n@media (min-width: 1200px) {\n .cropper-point.point-se {\n height: 5px;\n opacity: .75;\n width: 5px;\n }\n}\n\n.cropper-point.point-se:before {\n background-color: #39f;\n bottom: -50%;\n content: ' ';\n display: block;\n height: 200%;\n opacity: 0;\n position: absolute;\n right: -50%;\n width: 200%;\n}\n\n.cropper-invisible {\n opacity: 0;\n}\n\n.cropper-bg {\n background-image: url('data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABAAAAAQAQMAAAAlPW0iAAAAA3NCSVQICAjb4U/gAAAABlBMVEXMzMz////TjRV2AAAACXBIWXMAAArrAAAK6wGCiw1aAAAAHHRFWHRTb2Z0d2FyZQBBZG9iZSBGaXJld29ya3MgQ1M26LyyjAAAABFJREFUCJlj+M/AgBVhF/0PAH6/D/HkDxOGAAAAAElFTkSuQmCC');\n}\n\n.cropper-hide {\n display: block;\n height: 0;\n position: absolute;\n width: 0;\n}\n\n.cropper-hidden {\n display: none !important;\n}\n\n.cropper-move {\n cursor: move;\n}\n\n.cropper-crop {\n cursor: crosshair;\n}\n\n.cropper-disabled .cropper-drag-box,\n.cropper-disabled .cropper-face,\n.cropper-disabled .cropper-line,\n.cropper-disabled .cropper-point {\n cursor: not-allowed;\n}\n"],"sourceRoot":""} \ No newline at end of file diff --git a/priv/static/static/font/fontello.1583594169021.woff b/priv/static/static/font/fontello.1583594169021.woff deleted file mode 100644 index 408c26afb..000000000 Binary files a/priv/static/static/font/fontello.1583594169021.woff and /dev/null differ diff --git a/priv/static/static/font/fontello.1583594169021.woff2 b/priv/static/static/font/fontello.1583594169021.woff2 deleted file mode 100644 index b963e9489..000000000 Binary files a/priv/static/static/font/fontello.1583594169021.woff2 and /dev/null differ diff --git a/priv/static/static/font/fontello.1583594169021.eot b/priv/static/static/font/fontello.1588947937982.eot similarity index 87% rename from priv/static/static/font/fontello.1583594169021.eot rename to priv/static/static/font/fontello.1588947937982.eot index f822a48a3..b1297072e 100644 Binary files a/priv/static/static/font/fontello.1583594169021.eot and b/priv/static/static/font/fontello.1588947937982.eot differ diff --git a/priv/static/static/font/fontello.1583594169021.svg b/priv/static/static/font/fontello.1588947937982.svg similarity index 96% rename from priv/static/static/font/fontello.1583594169021.svg rename to priv/static/static/font/fontello.1588947937982.svg index b905a0f6c..e63fb7529 100644 --- a/priv/static/static/font/fontello.1583594169021.svg +++ b/priv/static/static/font/fontello.1588947937982.svg @@ -78,6 +78,10 @@ + + + + @@ -110,6 +114,8 @@ + + diff --git a/priv/static/static/font/fontello.1583594169021.ttf b/priv/static/static/font/fontello.1588947937982.ttf similarity index 87% rename from priv/static/static/font/fontello.1583594169021.ttf rename to priv/static/static/font/fontello.1588947937982.ttf index 5ed36e9aa..443801c4f 100644 Binary files a/priv/static/static/font/fontello.1583594169021.ttf and b/priv/static/static/font/fontello.1588947937982.ttf differ diff --git a/priv/static/static/font/fontello.1588947937982.woff b/priv/static/static/font/fontello.1588947937982.woff new file mode 100644 index 000000000..e96fea757 Binary files /dev/null and b/priv/static/static/font/fontello.1588947937982.woff differ diff --git a/priv/static/static/font/fontello.1588947937982.woff2 b/priv/static/static/font/fontello.1588947937982.woff2 new file mode 100644 index 000000000..50318a670 Binary files /dev/null and b/priv/static/static/font/fontello.1588947937982.woff2 differ diff --git a/priv/static/static/fontello.1583594169021.css b/priv/static/static/fontello.1588947937982.css similarity index 85% rename from priv/static/static/fontello.1583594169021.css rename to priv/static/static/fontello.1588947937982.css index c096e6103..d3d77a8b5 100644 Binary files a/priv/static/static/fontello.1583594169021.css and b/priv/static/static/fontello.1588947937982.css differ diff --git a/priv/static/static/fontello.json b/priv/static/static/fontello.json index 5a7086a23..7f0e7cdd5 100755 --- a/priv/static/static/fontello.json +++ b/priv/static/static/fontello.json @@ -345,6 +345,24 @@ "css": "link", "code": 59427, "src": "fontawesome" + }, + { + "uid": "4aad6bb50b02c18508aae9cbe14e784e", + "css": "share", + "code": 61920, + "src": "fontawesome" + }, + { + "uid": "8b80d36d4ef43889db10bc1f0dc9a862", + "css": "user", + "code": 59428, + "src": "fontawesome" + }, + { + "uid": "12f4ece88e46abd864e40b35e05b11cd", + "css": "ok", + "code": 59431, + "src": "fontawesome" } ] -} +} \ No newline at end of file diff --git a/priv/static/static/js/2.18e4adec273c4ce867a8.js b/priv/static/static/js/2.18e4adec273c4ce867a8.js new file mode 100644 index 000000000..d191aa852 Binary files /dev/null and b/priv/static/static/js/2.18e4adec273c4ce867a8.js differ diff --git a/priv/static/static/js/2.18e4adec273c4ce867a8.js.map b/priv/static/static/js/2.18e4adec273c4ce867a8.js.map new file mode 100644 index 000000000..a7f98bfef Binary files /dev/null and b/priv/static/static/js/2.18e4adec273c4ce867a8.js.map differ diff --git a/priv/static/static/js/2.f158cbd2b8770e467dfe.js b/priv/static/static/js/2.f158cbd2b8770e467dfe.js deleted file mode 100644 index 24f80fe7b..000000000 Binary files a/priv/static/static/js/2.f158cbd2b8770e467dfe.js and /dev/null differ diff --git a/priv/static/static/js/2.f158cbd2b8770e467dfe.js.map b/priv/static/static/js/2.f158cbd2b8770e467dfe.js.map deleted file mode 100644 index 94ca6f090..000000000 Binary files a/priv/static/static/js/2.f158cbd2b8770e467dfe.js.map and /dev/null differ diff --git a/priv/static/static/js/app.5c94bdec79a7d0f3cfcb.js b/priv/static/static/js/app.5c94bdec79a7d0f3cfcb.js deleted file mode 100644 index 7ef7a5f12..000000000 Binary files a/priv/static/static/js/app.5c94bdec79a7d0f3cfcb.js and /dev/null differ diff --git a/priv/static/static/js/app.5c94bdec79a7d0f3cfcb.js.map b/priv/static/static/js/app.5c94bdec79a7d0f3cfcb.js.map deleted file mode 100644 index 163f78149..000000000 Binary files a/priv/static/static/js/app.5c94bdec79a7d0f3cfcb.js.map and /dev/null differ diff --git a/priv/static/static/js/app.996428ccaaaa7f28cb8d.js b/priv/static/static/js/app.996428ccaaaa7f28cb8d.js new file mode 100644 index 000000000..00f3a28e0 Binary files /dev/null and b/priv/static/static/js/app.996428ccaaaa7f28cb8d.js differ diff --git a/priv/static/static/js/app.996428ccaaaa7f28cb8d.js.map b/priv/static/static/js/app.996428ccaaaa7f28cb8d.js.map new file mode 100644 index 000000000..9daca3ff5 Binary files /dev/null and b/priv/static/static/js/app.996428ccaaaa7f28cb8d.js.map differ diff --git a/priv/static/static/js/vendors~app.561a1c605d1dfb0e6f74.js b/priv/static/static/js/vendors~app.561a1c605d1dfb0e6f74.js new file mode 100644 index 000000000..d1f1a1830 Binary files /dev/null and b/priv/static/static/js/vendors~app.561a1c605d1dfb0e6f74.js differ diff --git a/priv/static/static/js/vendors~app.561a1c605d1dfb0e6f74.js.map b/priv/static/static/js/vendors~app.561a1c605d1dfb0e6f74.js.map new file mode 100644 index 000000000..0d4a859ea Binary files /dev/null and b/priv/static/static/js/vendors~app.561a1c605d1dfb0e6f74.js.map differ diff --git a/priv/static/static/js/vendors~app.c5bbd3734647f0cc7eef.js b/priv/static/static/js/vendors~app.c5bbd3734647f0cc7eef.js deleted file mode 100644 index 8964180cd..000000000 Binary files a/priv/static/static/js/vendors~app.c5bbd3734647f0cc7eef.js and /dev/null differ diff --git a/priv/static/static/js/vendors~app.c5bbd3734647f0cc7eef.js.map b/priv/static/static/js/vendors~app.c5bbd3734647f0cc7eef.js.map deleted file mode 100644 index fab720d23..000000000 Binary files a/priv/static/static/js/vendors~app.c5bbd3734647f0cc7eef.js.map and /dev/null differ diff --git a/priv/static/sw-pleroma.js b/priv/static/sw-pleroma.js index 88e8fcd5a..d2be1782b 100644 Binary files a/priv/static/sw-pleroma.js and b/priv/static/sw-pleroma.js differ diff --git a/priv/static/sw-pleroma.js.map b/priv/static/sw-pleroma.js.map index 5d9874693..c704cb951 100644 Binary files a/priv/static/sw-pleroma.js.map and b/priv/static/sw-pleroma.js.map differ diff --git a/restarter/lib/pleroma.ex b/restarter/lib/pleroma.ex index 7f08c637c..149a569ce 100644 --- a/restarter/lib/pleroma.ex +++ b/restarter/lib/pleroma.ex @@ -62,7 +62,7 @@ def handle_cast(:refresh, _state) do end def handle_cast({:restart, :test, _}, state) do - Logger.warn("pleroma restarted") + Logger.debug("pleroma manually restarted") {:noreply, Map.put(state, :need_reboot, false)} end @@ -75,7 +75,7 @@ def handle_cast({:restart, _, delay}, state) do def handle_cast({:after_boot, _}, %{after_boot: true} = state), do: {:noreply, state} def handle_cast({:after_boot, :test}, state) do - Logger.warn("pleroma restarted") + Logger.debug("pleroma restarted after boot") state = %{state | after_boot: true, rebooted: true} {:noreply, state} end diff --git a/test/activity/ir/topics_test.exs b/test/activity/ir/topics_test.exs index 44aec1e19..14a6e6b71 100644 --- a/test/activity/ir/topics_test.exs +++ b/test/activity/ir/topics_test.exs @@ -83,7 +83,7 @@ test "converts tags to hash tags", %{activity: %{object: %{data: data} = object} assert Enum.member?(topics, "hashtag:bar") end - test "only converts strinngs to hash tags", %{ + test "only converts strings to hash tags", %{ activity: %{object: %{data: data} = object} = activity } do tagged_data = Map.put(data, "tag", [2]) diff --git a/test/activity_test.exs b/test/activity_test.exs index 0c19f481b..2a92327d1 100644 --- a/test/activity_test.exs +++ b/test/activity_test.exs @@ -11,6 +11,11 @@ defmodule Pleroma.ActivityTest do alias Pleroma.ThreadMute import Pleroma.Factory + setup_all do + Tesla.Mock.mock_global(fn env -> apply(HttpRequestMock, :request, [env]) end) + :ok + end + test "returns an activity by it's AP id" do activity = insert(:note_activity) found_activity = Activity.get_by_ap_id(activity.data["id"]) @@ -107,8 +112,6 @@ test "when association is not loaded" do describe "search" do setup do - Tesla.Mock.mock_global(fn env -> apply(HttpRequestMock, :request, [env]) end) - user = insert(:user) params = %{ @@ -125,8 +128,8 @@ test "when association is not loaded" do "to" => ["https://www.w3.org/ns/activitystreams#Public"] } - {:ok, local_activity} = Pleroma.Web.CommonAPI.post(user, %{"status" => "find me!"}) - {:ok, japanese_activity} = Pleroma.Web.CommonAPI.post(user, %{"status" => "更新情報"}) + {:ok, local_activity} = Pleroma.Web.CommonAPI.post(user, %{status: "find me!"}) + {:ok, japanese_activity} = Pleroma.Web.CommonAPI.post(user, %{status: "更新情報"}) {:ok, job} = Pleroma.Web.Federator.incoming_ap_doc(params) {:ok, remote_activity} = ObanHelpers.perform(job) @@ -225,8 +228,8 @@ test "get_by_id/1" do test "all_by_actor_and_id/2" do user = insert(:user) - {:ok, %{id: id1}} = Pleroma.Web.CommonAPI.post(user, %{"status" => "cofe"}) - {:ok, %{id: id2}} = Pleroma.Web.CommonAPI.post(user, %{"status" => "cofefe"}) + {:ok, %{id: id1}} = Pleroma.Web.CommonAPI.post(user, %{status: "cofe"}) + {:ok, %{id: id2}} = Pleroma.Web.CommonAPI.post(user, %{status: "cofefe"}) assert [] == Activity.all_by_actor_and_id(user, []) diff --git a/test/bbs/handler_test.exs b/test/bbs/handler_test.exs index 74982547b..eb716486e 100644 --- a/test/bbs/handler_test.exs +++ b/test/bbs/handler_test.exs @@ -21,8 +21,8 @@ test "getting the home timeline" do {:ok, user} = User.follow(user, followed) - {:ok, _first} = CommonAPI.post(user, %{"status" => "hey"}) - {:ok, _second} = CommonAPI.post(followed, %{"status" => "hello"}) + {:ok, _first} = CommonAPI.post(user, %{status: "hey"}) + {:ok, _second} = CommonAPI.post(followed, %{status: "hello"}) output = capture_io(fn -> @@ -62,7 +62,7 @@ test "replying" do user = insert(:user) another_user = insert(:user) - {:ok, activity} = CommonAPI.post(another_user, %{"status" => "this is a test post"}) + {:ok, activity} = CommonAPI.post(another_user, %{status: "this is a test post"}) activity_object = Object.normalize(activity) output = diff --git a/test/bookmark_test.exs b/test/bookmark_test.exs index 021f79322..2726fe7cd 100644 --- a/test/bookmark_test.exs +++ b/test/bookmark_test.exs @@ -11,7 +11,7 @@ defmodule Pleroma.BookmarkTest do describe "create/2" do test "with valid params" do user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "Some cool information"}) + {:ok, activity} = CommonAPI.post(user, %{status: "Some cool information"}) {:ok, bookmark} = Bookmark.create(user.id, activity.id) assert bookmark.user_id == user.id assert bookmark.activity_id == activity.id @@ -32,7 +32,7 @@ test "with invalid params" do test "with valid params" do user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "Some cool information"}) + {:ok, activity} = CommonAPI.post(user, %{status: "Some cool information"}) {:ok, _bookmark} = Bookmark.create(user.id, activity.id) {:ok, _deleted_bookmark} = Bookmark.destroy(user.id, activity.id) @@ -45,7 +45,7 @@ test "gets a bookmark" do {:ok, activity} = CommonAPI.post(user, %{ - "status" => + status: "Scientists Discover The Secret Behind Tenshi Eating A Corndog Being So Cute – Science Daily" }) diff --git a/test/captcha_test.exs b/test/captcha_test.exs index ac1d846e8..1ab9019ab 100644 --- a/test/captcha_test.exs +++ b/test/captcha_test.exs @@ -61,7 +61,7 @@ test "new and validate" do assert is_binary(answer) assert :ok = Native.validate(token, answer, answer) - assert {:error, "Invalid CAPTCHA"} == Native.validate(token, answer, answer <> "foobar") + assert {:error, :invalid} == Native.validate(token, answer, answer <> "foobar") end end @@ -78,6 +78,7 @@ test "validate" do assert is_binary(answer) assert :ok = Captcha.validate(token, "63615261b77f5354fb8c4e4986477555", answer) + Cachex.del(:used_captcha_cache, token) end test "doesn't validate invalid answer" do @@ -92,7 +93,7 @@ test "doesn't validate invalid answer" do assert is_binary(answer) - assert {:error, "Invalid answer data"} = + assert {:error, :invalid_answer_data} = Captcha.validate(token, "63615261b77f5354fb8c4e4986477555", answer <> "foobar") end @@ -108,7 +109,7 @@ test "nil answer_data" do assert is_binary(answer) - assert {:error, "Invalid answer data"} = + assert {:error, :invalid_answer_data} = Captcha.validate(token, "63615261b77f5354fb8c4e4986477555", nil) end end diff --git a/test/config/config_db_test.exs b/test/config/config_db_test.exs index ac3dde681..336de7359 100644 --- a/test/config/config_db_test.exs +++ b/test/config/config_db_test.exs @@ -43,11 +43,9 @@ test "get_all_as_keyword/0" do {ConfigDB.from_string(saved.key), ConfigDB.from_binary(saved.value)} ] - assert config[:quack] == [ - level: :info, - meta: [:none], - webhook_url: "https://hooks.slack.com/services/KEY/some_val" - ] + assert config[:quack][:level] == :info + assert config[:quack][:meta] == [:none] + assert config[:quack][:webhook_url] == "https://hooks.slack.com/services/KEY/some_val" end describe "update_or_create/1" do diff --git a/test/config/transfer_task_test.exs b/test/config/transfer_task_test.exs index 0265a6156..473899d1d 100644 --- a/test/config/transfer_task_test.exs +++ b/test/config/transfer_task_test.exs @@ -16,6 +16,8 @@ test "transfer config values from db to env" do refute Application.get_env(:pleroma, :test_key) refute Application.get_env(:idna, :test_key) refute Application.get_env(:quack, :test_key) + refute Application.get_env(:postgrex, :test_key) + initial = Application.get_env(:logger, :level) ConfigDB.create(%{ group: ":pleroma", @@ -35,16 +37,28 @@ test "transfer config values from db to env" do value: [:test_value1, :test_value2] }) + ConfigDB.create(%{ + group: ":postgrex", + key: ":test_key", + value: :value + }) + + ConfigDB.create(%{group: ":logger", key: ":level", value: :debug}) + TransferTask.start_link([]) assert Application.get_env(:pleroma, :test_key) == [live: 2, com: 3] assert Application.get_env(:idna, :test_key) == [live: 15, com: 35] assert Application.get_env(:quack, :test_key) == [:test_value1, :test_value2] + assert Application.get_env(:logger, :level) == :debug + assert Application.get_env(:postgrex, :test_key) == :value on_exit(fn -> Application.delete_env(:pleroma, :test_key) Application.delete_env(:idna, :test_key) Application.delete_env(:quack, :test_key) + Application.delete_env(:postgrex, :test_key) + Application.put_env(:logger, :level, initial) end) end @@ -78,8 +92,8 @@ test "transfer config values for 1 group and some keys" do end test "transfer config values with full subkey update" do - emoji = Application.get_env(:pleroma, :emoji) - assets = Application.get_env(:pleroma, :assets) + clear_config(:emoji) + clear_config(:assets) ConfigDB.create(%{ group: ":pleroma", @@ -99,11 +113,6 @@ test "transfer config values with full subkey update" do assert emoji_env[:groups] == [a: 1, b: 2] assets_env = Application.get_env(:pleroma, :assets) assert assets_env[:mascots] == [a: 1, b: 2] - - on_exit(fn -> - Application.put_env(:pleroma, :emoji, emoji) - Application.put_env(:pleroma, :assets, assets) - end) end describe "pleroma restart" do @@ -112,8 +121,7 @@ test "transfer config values with full subkey update" do end test "don't restart if no reboot time settings were changed" do - emoji = Application.get_env(:pleroma, :emoji) - on_exit(fn -> Application.put_env(:pleroma, :emoji, emoji) end) + clear_config(:emoji) ConfigDB.create(%{ group: ":pleroma", @@ -128,8 +136,7 @@ test "don't restart if no reboot time settings were changed" do end test "on reboot time key" do - chat = Application.get_env(:pleroma, :chat) - on_exit(fn -> Application.put_env(:pleroma, :chat, chat) end) + clear_config(:chat) ConfigDB.create(%{ group: ":pleroma", @@ -141,8 +148,7 @@ test "on reboot time key" do end test "on reboot time subkey" do - captcha = Application.get_env(:pleroma, Pleroma.Captcha) - on_exit(fn -> Application.put_env(:pleroma, Pleroma.Captcha, captcha) end) + clear_config(Pleroma.Captcha) ConfigDB.create(%{ group: ":pleroma", @@ -154,13 +160,8 @@ test "on reboot time subkey" do end test "don't restart pleroma on reboot time key and subkey if there is false flag" do - chat = Application.get_env(:pleroma, :chat) - captcha = Application.get_env(:pleroma, Pleroma.Captcha) - - on_exit(fn -> - Application.put_env(:pleroma, :chat, chat) - Application.put_env(:pleroma, Pleroma.Captcha, captcha) - end) + clear_config(:chat) + clear_config(Pleroma.Captcha) ConfigDB.create(%{ group: ":pleroma", diff --git a/test/conversation/participation_test.exs b/test/conversation/participation_test.exs index 3536842e8..59a1b6492 100644 --- a/test/conversation/participation_test.exs +++ b/test/conversation/participation_test.exs @@ -16,7 +16,7 @@ test "getting a participation will also preload things" do other_user = insert(:user) {:ok, _activity} = - CommonAPI.post(user, %{"status" => "Hey @#{other_user.nickname}.", "visibility" => "direct"}) + CommonAPI.post(user, %{status: "Hey @#{other_user.nickname}.", visibility: "direct"}) [participation] = Participation.for_user(user) @@ -30,7 +30,7 @@ test "for a new conversation or a reply, it doesn't mark the author's participat other_user = insert(:user) {:ok, _} = - CommonAPI.post(user, %{"status" => "Hey @#{other_user.nickname}.", "visibility" => "direct"}) + CommonAPI.post(user, %{status: "Hey @#{other_user.nickname}.", visibility: "direct"}) user = User.get_cached_by_id(user.id) other_user = User.get_cached_by_id(other_user.id) @@ -43,9 +43,9 @@ test "for a new conversation or a reply, it doesn't mark the author's participat {:ok, _} = CommonAPI.post(other_user, %{ - "status" => "Hey @#{user.nickname}.", - "visibility" => "direct", - "in_reply_to_conversation_id" => participation.id + status: "Hey @#{user.nickname}.", + visibility: "direct", + in_reply_to_conversation_id: participation.id }) user = User.get_cached_by_id(user.id) @@ -64,7 +64,7 @@ test "for a new conversation, it sets the recipents of the participation" do third_user = insert(:user) {:ok, activity} = - CommonAPI.post(user, %{"status" => "Hey @#{other_user.nickname}.", "visibility" => "direct"}) + CommonAPI.post(user, %{status: "Hey @#{other_user.nickname}.", visibility: "direct"}) user = User.get_cached_by_id(user.id) other_user = User.get_cached_by_id(other_user.id) @@ -79,9 +79,9 @@ test "for a new conversation, it sets the recipents of the participation" do {:ok, _activity} = CommonAPI.post(user, %{ - "in_reply_to_status_id" => activity.id, - "status" => "Hey @#{third_user.nickname}.", - "visibility" => "direct" + in_reply_to_status_id: activity.id, + status: "Hey @#{third_user.nickname}.", + visibility: "direct" }) [participation] = Participation.for_user(user) @@ -154,14 +154,14 @@ test "it marks all the user's participations as read" do test "gets all the participations for a user, ordered by updated at descending" do user = insert(:user) - {:ok, activity_one} = CommonAPI.post(user, %{"status" => "x", "visibility" => "direct"}) - {:ok, activity_two} = CommonAPI.post(user, %{"status" => "x", "visibility" => "direct"}) + {:ok, activity_one} = CommonAPI.post(user, %{status: "x", visibility: "direct"}) + {:ok, activity_two} = CommonAPI.post(user, %{status: "x", visibility: "direct"}) {:ok, activity_three} = CommonAPI.post(user, %{ - "status" => "x", - "visibility" => "direct", - "in_reply_to_status_id" => activity_one.id + status: "x", + visibility: "direct", + in_reply_to_status_id: activity_one.id }) # Offset participations because the accuracy of updated_at is down to a second @@ -201,7 +201,7 @@ test "gets all the participations for a user, ordered by updated at descending" test "Doesn't die when the conversation gets empty" do user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => ".", "visibility" => "direct"}) + {:ok, activity} = CommonAPI.post(user, %{status: ".", visibility: "direct"}) [participation] = Participation.for_user_with_last_activity_id(user) assert participation.last_activity_id == activity.id @@ -215,7 +215,7 @@ test "it sets recipients, always keeping the owner of the participation even whe user = insert(:user) other_user = insert(:user) - {:ok, _activity} = CommonAPI.post(user, %{"status" => ".", "visibility" => "direct"}) + {:ok, _activity} = CommonAPI.post(user, %{status: ".", visibility: "direct"}) [participation] = Participation.for_user_with_last_activity_id(user) participation = Repo.preload(participation, :recipients) @@ -239,26 +239,26 @@ test "when the user blocks a recipient, the existing conversations with them are {:ok, _direct1} = CommonAPI.post(third_user, %{ - "status" => "Hi @#{blocker.nickname}", - "visibility" => "direct" + status: "Hi @#{blocker.nickname}", + visibility: "direct" }) {:ok, _direct2} = CommonAPI.post(third_user, %{ - "status" => "Hi @#{blocker.nickname}, @#{blocked.nickname}", - "visibility" => "direct" + status: "Hi @#{blocker.nickname}, @#{blocked.nickname}", + visibility: "direct" }) {:ok, _direct3} = CommonAPI.post(blocked, %{ - "status" => "Hi @#{blocker.nickname}", - "visibility" => "direct" + status: "Hi @#{blocker.nickname}", + visibility: "direct" }) {:ok, _direct4} = CommonAPI.post(blocked, %{ - "status" => "Hi @#{blocker.nickname}, @#{third_user.nickname}", - "visibility" => "direct" + status: "Hi @#{blocker.nickname}, @#{third_user.nickname}", + visibility: "direct" }) assert [%{read: false}, %{read: false}, %{read: false}, %{read: false}] = @@ -293,8 +293,8 @@ test "the new conversation with the blocked user is not marked as unread " do # When the blocked user is the author {:ok, _direct1} = CommonAPI.post(blocked, %{ - "status" => "Hi @#{blocker.nickname}", - "visibility" => "direct" + status: "Hi @#{blocker.nickname}", + visibility: "direct" }) assert [%{read: true}] = Participation.for_user(blocker) @@ -303,8 +303,8 @@ test "the new conversation with the blocked user is not marked as unread " do # When the blocked user is a recipient {:ok, _direct2} = CommonAPI.post(third_user, %{ - "status" => "Hi @#{blocker.nickname}, @#{blocked.nickname}", - "visibility" => "direct" + status: "Hi @#{blocker.nickname}, @#{blocked.nickname}", + visibility: "direct" }) assert [%{read: true}, %{read: true}] = Participation.for_user(blocker) @@ -321,8 +321,8 @@ test "the conversation with the blocked user is not marked as unread on a reply" {:ok, _direct1} = CommonAPI.post(blocker, %{ - "status" => "Hi @#{third_user.nickname}, @#{blocked.nickname}", - "visibility" => "direct" + status: "Hi @#{third_user.nickname}, @#{blocked.nickname}", + visibility: "direct" }) {:ok, _user_relationship} = User.block(blocker, blocked) @@ -334,9 +334,9 @@ test "the conversation with the blocked user is not marked as unread on a reply" # When it's a reply from the blocked user {:ok, _direct2} = CommonAPI.post(blocked, %{ - "status" => "reply", - "visibility" => "direct", - "in_reply_to_conversation_id" => blocked_participation.id + status: "reply", + visibility: "direct", + in_reply_to_conversation_id: blocked_participation.id }) assert [%{read: true}] = Participation.for_user(blocker) @@ -347,9 +347,9 @@ test "the conversation with the blocked user is not marked as unread on a reply" # When it's a reply from the third user {:ok, _direct3} = CommonAPI.post(third_user, %{ - "status" => "reply", - "visibility" => "direct", - "in_reply_to_conversation_id" => third_user_participation.id + status: "reply", + visibility: "direct", + in_reply_to_conversation_id: third_user_participation.id }) assert [%{read: true}] = Participation.for_user(blocker) diff --git a/test/conversation_test.exs b/test/conversation_test.exs index 056a0e920..359aa6840 100644 --- a/test/conversation_test.exs +++ b/test/conversation_test.exs @@ -18,7 +18,7 @@ test "it goes through old direct conversations" do other_user = insert(:user) {:ok, _activity} = - CommonAPI.post(user, %{"visibility" => "direct", "status" => "hey @#{other_user.nickname}"}) + CommonAPI.post(user, %{visibility: "direct", status: "hey @#{other_user.nickname}"}) Pleroma.Tests.ObanHelpers.perform_all() @@ -46,7 +46,7 @@ test "it creates a conversation for given ap_id" do test "public posts don't create conversations" do user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "Hey"}) + {:ok, activity} = CommonAPI.post(user, %{status: "Hey"}) object = Pleroma.Object.normalize(activity) context = object.data["context"] @@ -62,7 +62,7 @@ test "it creates or updates a conversation and participations for a given DM" do tridi = insert(:user) {:ok, activity} = - CommonAPI.post(har, %{"status" => "Hey @#{jafnhar.nickname}", "visibility" => "direct"}) + CommonAPI.post(har, %{status: "Hey @#{jafnhar.nickname}", visibility: "direct"}) object = Pleroma.Object.normalize(activity) context = object.data["context"] @@ -81,9 +81,9 @@ test "it creates or updates a conversation and participations for a given DM" do {:ok, activity} = CommonAPI.post(jafnhar, %{ - "status" => "Hey @#{har.nickname}", - "visibility" => "direct", - "in_reply_to_status_id" => activity.id + status: "Hey @#{har.nickname}", + visibility: "direct", + in_reply_to_status_id: activity.id }) object = Pleroma.Object.normalize(activity) @@ -105,9 +105,9 @@ test "it creates or updates a conversation and participations for a given DM" do {:ok, activity} = CommonAPI.post(tridi, %{ - "status" => "Hey @#{har.nickname}", - "visibility" => "direct", - "in_reply_to_status_id" => activity.id + status: "Hey @#{har.nickname}", + visibility: "direct", + in_reply_to_status_id: activity.id }) object = Pleroma.Object.normalize(activity) @@ -149,14 +149,14 @@ test "create_or_bump_for returns the conversation with participations" do jafnhar = insert(:user, local: false) {:ok, activity} = - CommonAPI.post(har, %{"status" => "Hey @#{jafnhar.nickname}", "visibility" => "direct"}) + CommonAPI.post(har, %{status: "Hey @#{jafnhar.nickname}", visibility: "direct"}) {:ok, conversation} = Conversation.create_or_bump_for(activity) assert length(conversation.participations) == 2 {:ok, activity} = - CommonAPI.post(har, %{"status" => "Hey @#{jafnhar.nickname}", "visibility" => "public"}) + CommonAPI.post(har, %{status: "Hey @#{jafnhar.nickname}", visibility: "public"}) assert {:error, _} = Conversation.create_or_bump_for(activity) end diff --git a/test/emoji/formatter_test.exs b/test/emoji/formatter_test.exs index 3bfee9420..12af6cd8b 100644 --- a/test/emoji/formatter_test.exs +++ b/test/emoji/formatter_test.exs @@ -3,7 +3,6 @@ # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.Emoji.FormatterTest do - alias Pleroma.Emoji alias Pleroma.Emoji.Formatter use Pleroma.DataCase @@ -32,30 +31,19 @@ test "it does not add XSS emoji" do end end - describe "get_emoji" do + describe "get_emoji_map" do test "it returns the emoji used in the text" do - text = "I love :firefox:" - - assert Formatter.get_emoji(text) == [ - {"firefox", - %Emoji{ - code: "firefox", - file: "/emoji/Firefox.gif", - tags: ["Gif", "Fun"], - safe_code: "firefox", - safe_file: "/emoji/Firefox.gif" - }} - ] + assert Formatter.get_emoji_map("I love :firefox:") == %{ + "firefox" => "http://localhost:4001/emoji/Firefox.gif" + } end test "it returns a nice empty result when no emojis are present" do - text = "I love moominamma" - assert Formatter.get_emoji(text) == [] + assert Formatter.get_emoji_map("I love moominamma") == %{} end test "it doesn't die when text is absent" do - text = nil - assert Formatter.get_emoji(text) == [] + assert Formatter.get_emoji_map(nil) == %{} end end end diff --git a/test/filter_test.exs b/test/filter_test.exs index b2a8330ee..63a30c736 100644 --- a/test/filter_test.exs +++ b/test/filter_test.exs @@ -141,17 +141,15 @@ test "updating a filter" do context: ["home"] } - query_two = %Pleroma.Filter{ - user_id: user.id, - filter_id: 1, + changes = %{ phrase: "who", context: ["home", "timeline"] } {:ok, filter_one} = Pleroma.Filter.create(query_one) - {:ok, filter_two} = Pleroma.Filter.update(query_two) + {:ok, filter_two} = Pleroma.Filter.update(filter_one, changes) assert filter_one != filter_two - assert filter_two.phrase == query_two.phrase - assert filter_two.context == query_two.context + assert filter_two.phrase == changes.phrase + assert filter_two.context == changes.context end end diff --git a/test/fixtures/config/temp.secret.exs b/test/fixtures/config/temp.secret.exs index f4686c101..dc950ca30 100644 --- a/test/fixtures/config/temp.secret.exs +++ b/test/fixtures/config/temp.secret.exs @@ -7,3 +7,5 @@ config :quack, level: :info config :pleroma, Pleroma.Repo, pool: Ecto.Adapters.SQL.Sandbox + +config :postgrex, :json_library, Poison diff --git a/test/fixtures/emoji/packs/blank.png.zip b/test/fixtures/emoji/packs/blank.png.zip new file mode 100644 index 000000000..651daf127 Binary files /dev/null and b/test/fixtures/emoji/packs/blank.png.zip differ diff --git a/test/fixtures/emoji/packs/default-manifest.json b/test/fixtures/emoji/packs/default-manifest.json new file mode 100644 index 000000000..c8433808d --- /dev/null +++ b/test/fixtures/emoji/packs/default-manifest.json @@ -0,0 +1,10 @@ +{ + "finmoji": { + "license": "CC BY-NC-ND 4.0", + "homepage": "https://finland.fi/emoji/", + "description": "Finland is the first country in the world to publish its own set of country themed emojis. The Finland emoji collection contains 56 tongue-in-cheek emotions, which were created to explain some hard-to-describe Finnish emotions, Finnish words and customs.", + "src": "https://finland.fi/wp-content/uploads/2017/06/finland-emojis.zip", + "src_sha256": "384025A1AC6314473863A11AC7AB38A12C01B851A3F82359B89B4D4211D3291D", + "files": "finmoji.json" + } +} \ No newline at end of file diff --git a/test/fixtures/emoji/packs/finmoji.json b/test/fixtures/emoji/packs/finmoji.json new file mode 100644 index 000000000..279770998 --- /dev/null +++ b/test/fixtures/emoji/packs/finmoji.json @@ -0,0 +1,3 @@ +{ + "blank": "blank.png" +} \ No newline at end of file diff --git a/test/fixtures/emoji/packs/manifest.json b/test/fixtures/emoji/packs/manifest.json new file mode 100644 index 000000000..2d51a459b --- /dev/null +++ b/test/fixtures/emoji/packs/manifest.json @@ -0,0 +1,10 @@ +{ + "blobs.gg": { + "src_sha256": "3a12f3a181678d5b3584a62095411b0d60a335118135910d879920f8ade5a57f", + "src": "https://git.pleroma.social/pleroma/emoji-index/raw/master/packs/blobs_gg.zip", + "license": "Apache 2.0", + "homepage": "https://blobs.gg", + "files": "blobs_gg.json", + "description": "Blob Emoji from blobs.gg repacked as apng" + } +} \ No newline at end of file diff --git a/test/fixtures/tesla_mock/craigmaloney.json b/test/fixtures/tesla_mock/craigmaloney.json new file mode 100644 index 000000000..56ea9c7c3 --- /dev/null +++ b/test/fixtures/tesla_mock/craigmaloney.json @@ -0,0 +1,112 @@ +{ + "@context": [ + "https://www.w3.org/ns/activitystreams", + "https://w3id.org/security/v1", + { + "CacheFile": "pt:CacheFile", + "Hashtag": "as:Hashtag", + "Infohash": "pt:Infohash", + "RsaSignature2017": "https://w3id.org/security#RsaSignature2017", + "category": "sc:category", + "commentsEnabled": { + "@id": "pt:commentsEnabled", + "@type": "sc:Boolean" + }, + "downloadEnabled": { + "@id": "pt:downloadEnabled", + "@type": "sc:Boolean" + }, + "expires": "sc:expires", + "fps": { + "@id": "pt:fps", + "@type": "sc:Number" + }, + "language": "sc:inLanguage", + "licence": "sc:license", + "originallyPublishedAt": "sc:datePublished", + "position": { + "@id": "pt:position", + "@type": "sc:Number" + }, + "pt": "https://joinpeertube.org/ns#", + "sc": "http://schema.org#", + "sensitive": "as:sensitive", + "size": { + "@id": "pt:size", + "@type": "sc:Number" + }, + "startTimestamp": { + "@id": "pt:startTimestamp", + "@type": "sc:Number" + }, + "state": { + "@id": "pt:state", + "@type": "sc:Number" + }, + "stopTimestamp": { + "@id": "pt:stopTimestamp", + "@type": "sc:Number" + }, + "subtitleLanguage": "sc:subtitleLanguage", + "support": { + "@id": "pt:support", + "@type": "sc:Text" + }, + "uuid": "sc:identifier", + "views": { + "@id": "pt:views", + "@type": "sc:Number" + }, + "waitTranscoding": { + "@id": "pt:waitTranscoding", + "@type": "sc:Boolean" + } + }, + { + "comments": { + "@id": "as:comments", + "@type": "@id" + }, + "dislikes": { + "@id": "as:dislikes", + "@type": "@id" + }, + "likes": { + "@id": "as:likes", + "@type": "@id" + }, + "playlists": { + "@id": "pt:playlists", + "@type": "@id" + }, + "shares": { + "@id": "as:shares", + "@type": "@id" + } + } + ], + "endpoints": { + "sharedInbox": "https://peertube.social/inbox" + }, + "followers": "https://peertube.social/accounts/craigmaloney/followers", + "following": "https://peertube.social/accounts/craigmaloney/following", + "icon": { + "mediaType": "image/png", + "type": "Image", + "url": "https://peertube.social/lazy-static/avatars/87bd694b-95bc-4066-83f4-bddfcd2b9caa.png" + }, + "id": "https://peertube.social/accounts/craigmaloney", + "inbox": "https://peertube.social/accounts/craigmaloney/inbox", + "name": "Craig Maloney", + "outbox": "https://peertube.social/accounts/craigmaloney/outbox", + "playlists": "https://peertube.social/accounts/craigmaloney/playlists", + "preferredUsername": "craigmaloney", + "publicKey": { + "id": "https://peertube.social/accounts/craigmaloney#main-key", + "owner": "https://peertube.social/accounts/craigmaloney", + "publicKeyPem": "-----BEGIN PUBLIC KEY-----\nMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEA9qvGIYUW01yc8CCsrwxK\n5OXlV5s7EbNWY8tJr/p1oGuELZwAnG2XKxtdbvgcCT+YxL5uRXIdCFIIIKrzRFr/\nHfS0mOgNT9u3gu+SstCNgtatciT0RVP77yiC3b2NHq1NRRvvVhzQb4cpIWObIxqh\nb2ypDClTc7XaKtgmQCbwZlGyZMT+EKz/vustD6BlpGsglRkm7iES6s1PPGb1BU+n\nS94KhbS2DOFiLcXCVWt0QarokIIuKznp4+xP1axKyP+SkT5AHx08Nd5TYFb2C1Jl\nz0WD/1q0mAN62m7QrA3SQPUgB+wWD+S3Nzf7FwNPiP4srbBgxVEUnji/r9mQ6BXC\nrQIDAQAB\n-----END PUBLIC KEY-----" + }, + "summary": null, + "type": "Person", + "url": "https://peertube.social/accounts/craigmaloney" +} diff --git a/test/fixtures/tesla_mock/funkwhale_audio.json b/test/fixtures/tesla_mock/funkwhale_audio.json new file mode 100644 index 000000000..15736b1f8 --- /dev/null +++ b/test/fixtures/tesla_mock/funkwhale_audio.json @@ -0,0 +1,44 @@ +{ + "id": "https://channels.tests.funkwhale.audio/federation/music/uploads/42342395-0208-4fee-a38d-259a6dae0871", + "type": "Audio", + "name": "Compositions - Test Audio for Pleroma", + "attributedTo": "https://channels.tests.funkwhale.audio/federation/actors/compositions", + "published": "2020-03-11T10:01:52.714918+00:00", + "to": "https://www.w3.org/ns/activitystreams#Public", + "url": [ + { + "type": "Link", + "mimeType": "audio/ogg", + "href": "https://channels.tests.funkwhale.audio/api/v1/listen/3901e5d8-0445-49d5-9711-e096cf32e515/?upload=42342395-0208-4fee-a38d-259a6dae0871&download=false" + }, + { + "type": "Link", + "mimeType": "text/html", + "href": "https://channels.tests.funkwhale.audio/library/tracks/74" + } + ], + "content": "

This is a test Audio for Pleroma.

", + "mediaType": "text/html", + "tag": [ + { + "type": "Hashtag", + "name": "#funkwhale" + }, + { + "type": "Hashtag", + "name": "#test" + }, + { + "type": "Hashtag", + "name": "#tests" + } + ], + "summary": "#funkwhale #test #tests", + "@context": [ + "https://www.w3.org/ns/activitystreams", + "https://w3id.org/security/v1", + { + "manuallyApprovesFollowers": "as:manuallyApprovesFollowers" + } + ] +} diff --git a/test/fixtures/tesla_mock/funkwhale_channel.json b/test/fixtures/tesla_mock/funkwhale_channel.json new file mode 100644 index 000000000..cf9ee8151 --- /dev/null +++ b/test/fixtures/tesla_mock/funkwhale_channel.json @@ -0,0 +1,44 @@ +{ + "id": "https://channels.tests.funkwhale.audio/federation/actors/compositions", + "outbox": "https://channels.tests.funkwhale.audio/federation/actors/compositions/outbox", + "inbox": "https://channels.tests.funkwhale.audio/federation/actors/compositions/inbox", + "preferredUsername": "compositions", + "type": "Person", + "name": "Compositions", + "followers": "https://channels.tests.funkwhale.audio/federation/actors/compositions/followers", + "following": "https://channels.tests.funkwhale.audio/federation/actors/compositions/following", + "manuallyApprovesFollowers": false, + "url": [ + { + "type": "Link", + "href": "https://channels.tests.funkwhale.audio/channels/compositions", + "mediaType": "text/html" + }, + { + "type": "Link", + "href": "https://channels.tests.funkwhale.audio/api/v1/channels/compositions/rss", + "mediaType": "application/rss+xml" + } + ], + "icon": { + "type": "Image", + "url": "https://channels.tests.funkwhale.audio/media/attachments/75/b4/f1/nosmile.jpeg", + "mediaType": "image/jpeg" + }, + "summary": "

I'm testing federation with the fediverse :)

", + "@context": [ + "https://www.w3.org/ns/activitystreams", + "https://w3id.org/security/v1", + { + "manuallyApprovesFollowers": "as:manuallyApprovesFollowers" + } + ], + "publicKey": { + "owner": "https://channels.tests.funkwhale.audio/federation/actors/compositions", + "publicKeyPem": "-----BEGIN RSA PUBLIC KEY-----\nMIIBCgKCAQEAv25u57oZfVLV3KltS+HcsdSx9Op4MmzIes1J8Wu8s0KbdXf2zEwS\nsVqyHgs/XCbnzsR3FqyJTo46D2BVnvZcuU5srNcR2I2HMaqQ0oVdnATE4K6KdcgV\nN+98pMWo56B8LTgE1VpvqbsrXLi9jCTzjrkebVMOP+ZVu+64v1qdgddseblYMnBZ\nct0s7ONbHnqrWlTGf5wES1uIZTVdn5r4MduZG+Uenfi1opBS0lUUxfWdW9r0oF2b\nyneZUyaUCbEroeKbqsweXCWVgnMarUOsgqC42KM4cf95lySSwTSaUtZYIbTw7s9W\n2jveU/rVg8BYZu5JK5obgBoxtlUeUoSswwIDAQAB\n-----END RSA PUBLIC KEY-----\n", + "id": "https://channels.tests.funkwhale.audio/federation/actors/compositions#main-key" + }, + "endpoints": { + "sharedInbox": "https://channels.tests.funkwhale.audio/federation/shared/inbox" + } +} diff --git a/test/fixtures/tesla_mock/peertube-social.json b/test/fixtures/tesla_mock/peertube-social.json new file mode 100644 index 000000000..0e996ba35 --- /dev/null +++ b/test/fixtures/tesla_mock/peertube-social.json @@ -0,0 +1,234 @@ +{ + "@context": [ + "https://www.w3.org/ns/activitystreams", + "https://w3id.org/security/v1", + { + "CacheFile": "pt:CacheFile", + "Hashtag": "as:Hashtag", + "Infohash": "pt:Infohash", + "RsaSignature2017": "https://w3id.org/security#RsaSignature2017", + "category": "sc:category", + "commentsEnabled": { + "@id": "pt:commentsEnabled", + "@type": "sc:Boolean" + }, + "downloadEnabled": { + "@id": "pt:downloadEnabled", + "@type": "sc:Boolean" + }, + "expires": "sc:expires", + "fps": { + "@id": "pt:fps", + "@type": "sc:Number" + }, + "language": "sc:inLanguage", + "licence": "sc:license", + "originallyPublishedAt": "sc:datePublished", + "position": { + "@id": "pt:position", + "@type": "sc:Number" + }, + "pt": "https://joinpeertube.org/ns#", + "sc": "http://schema.org#", + "sensitive": "as:sensitive", + "size": { + "@id": "pt:size", + "@type": "sc:Number" + }, + "startTimestamp": { + "@id": "pt:startTimestamp", + "@type": "sc:Number" + }, + "state": { + "@id": "pt:state", + "@type": "sc:Number" + }, + "stopTimestamp": { + "@id": "pt:stopTimestamp", + "@type": "sc:Number" + }, + "subtitleLanguage": "sc:subtitleLanguage", + "support": { + "@id": "pt:support", + "@type": "sc:Text" + }, + "uuid": "sc:identifier", + "views": { + "@id": "pt:views", + "@type": "sc:Number" + }, + "waitTranscoding": { + "@id": "pt:waitTranscoding", + "@type": "sc:Boolean" + } + }, + { + "comments": { + "@id": "as:comments", + "@type": "@id" + }, + "dislikes": { + "@id": "as:dislikes", + "@type": "@id" + }, + "likes": { + "@id": "as:likes", + "@type": "@id" + }, + "playlists": { + "@id": "pt:playlists", + "@type": "@id" + }, + "shares": { + "@id": "as:shares", + "@type": "@id" + } + } + ], + "attributedTo": [ + { + "id": "https://peertube.social/accounts/craigmaloney", + "type": "Person" + }, + { + "id": "https://peertube.social/video-channels/9909c7d9-6b5b-4aae-9164-c1af7229c91c", + "type": "Group" + } + ], + "category": { + "identifier": "15", + "name": "Science & Technology" + }, + "cc": [ + "https://peertube.social/accounts/craigmaloney/followers" + ], + "comments": "https://peertube.social/videos/watch/278d2b7c-0f38-4aaa-afe6-9ecc0c4a34fe/comments", + "commentsEnabled": true, + "content": "Support this and our other Michigan!/usr/group videos and meetings. Learn more at http://mug.org/membership\n\nTwenty Years in Jail: FreeBSD's Jails, Then and Now\n\nJails started as a limited virtualization system, but over the last two years they've...", + "dislikes": "https://peertube.social/videos/watch/278d2b7c-0f38-4aaa-afe6-9ecc0c4a34fe/dislikes", + "downloadEnabled": true, + "duration": "PT5151S", + "icon": { + "height": 122, + "mediaType": "image/jpeg", + "type": "Image", + "url": "https://peertube.social/static/thumbnails/278d2b7c-0f38-4aaa-afe6-9ecc0c4a34fe.jpg", + "width": 223 + }, + "id": "https://peertube.social/videos/watch/278d2b7c-0f38-4aaa-afe6-9ecc0c4a34fe", + "language": { + "identifier": "en", + "name": "English" + }, + "licence": { + "identifier": "1", + "name": "Attribution" + }, + "likes": "https://peertube.social/videos/watch/278d2b7c-0f38-4aaa-afe6-9ecc0c4a34fe/likes", + "mediaType": "text/markdown", + "name": "Twenty Years in Jail: FreeBSD's Jails, Then and Now", + "originallyPublishedAt": "2019-08-13T00:00:00.000Z", + "published": "2020-02-12T01:06:08.054Z", + "sensitive": false, + "shares": "https://peertube.social/videos/watch/278d2b7c-0f38-4aaa-afe6-9ecc0c4a34fe/announces", + "state": 1, + "subtitleLanguage": [], + "support": "Learn more at http://mug.org", + "tag": [ + { + "name": "linux", + "type": "Hashtag" + }, + { + "name": "mug.org", + "type": "Hashtag" + }, + { + "name": "open", + "type": "Hashtag" + }, + { + "name": "oss", + "type": "Hashtag" + }, + { + "name": "source", + "type": "Hashtag" + } + ], + "to": [ + "https://www.w3.org/ns/activitystreams#Public" + ], + "type": "Video", + "updated": "2020-02-15T15:01:09.474Z", + "url": [ + { + "href": "https://peertube.social/videos/watch/278d2b7c-0f38-4aaa-afe6-9ecc0c4a34fe", + "mediaType": "text/html", + "type": "Link" + }, + { + "fps": 30, + "height": 240, + "href": "https://peertube.social/static/webseed/278d2b7c-0f38-4aaa-afe6-9ecc0c4a34fe-240.mp4", + "mediaType": "video/mp4", + "size": 119465800, + "type": "Link" + }, + { + "height": 240, + "href": "https://peertube.social/static/torrents/278d2b7c-0f38-4aaa-afe6-9ecc0c4a34fe-240.torrent", + "mediaType": "application/x-bittorrent", + "type": "Link" + }, + { + "height": 240, + "href": "magnet:?xs=https%3A%2F%2Fpeertube.social%2Fstatic%2Ftorrents%2F278d2b7c-0f38-4aaa-afe6-9ecc0c4a34fe-240.torrent&xt=urn:btih:b3365331a8543bf48d09add56d7fe4b1cbbb5659&dn=Twenty+Years+in+Jail%3A+FreeBSD's+Jails%2C+Then+and+Now&tr=wss%3A%2F%2Fpeertube.social%3A443%2Ftracker%2Fsocket&tr=https%3A%2F%2Fpeertube.social%2Ftracker%2Fannounce&ws=https%3A%2F%2Fpeertube.social%2Fstatic%2Fwebseed%2F278d2b7c-0f38-4aaa-afe6-9ecc0c4a34fe-240.mp4", + "mediaType": "application/x-bittorrent;x-scheme-handler/magnet", + "type": "Link" + }, + { + "fps": 30, + "height": 360, + "href": "https://peertube.social/static/webseed/278d2b7c-0f38-4aaa-afe6-9ecc0c4a34fe-360.mp4", + "mediaType": "video/mp4", + "size": 143930318, + "type": "Link" + }, + { + "height": 360, + "href": "https://peertube.social/static/torrents/278d2b7c-0f38-4aaa-afe6-9ecc0c4a34fe-360.torrent", + "mediaType": "application/x-bittorrent", + "type": "Link" + }, + { + "height": 360, + "href": "magnet:?xs=https%3A%2F%2Fpeertube.social%2Fstatic%2Ftorrents%2F278d2b7c-0f38-4aaa-afe6-9ecc0c4a34fe-360.torrent&xt=urn:btih:0d37b23c98cb0d89e28b5dc8f49b3c97a041e569&dn=Twenty+Years+in+Jail%3A+FreeBSD's+Jails%2C+Then+and+Now&tr=wss%3A%2F%2Fpeertube.social%3A443%2Ftracker%2Fsocket&tr=https%3A%2F%2Fpeertube.social%2Ftracker%2Fannounce&ws=https%3A%2F%2Fpeertube.social%2Fstatic%2Fwebseed%2F278d2b7c-0f38-4aaa-afe6-9ecc0c4a34fe-360.mp4", + "mediaType": "application/x-bittorrent;x-scheme-handler/magnet", + "type": "Link" + }, + { + "fps": 30, + "height": 480, + "href": "https://peertube.social/static/webseed/278d2b7c-0f38-4aaa-afe6-9ecc0c4a34fe-480.mp4", + "mediaType": "video/mp4", + "size": 130530754, + "type": "Link" + }, + { + "height": 480, + "href": "https://peertube.social/static/torrents/278d2b7c-0f38-4aaa-afe6-9ecc0c4a34fe-480.torrent", + "mediaType": "application/x-bittorrent", + "type": "Link" + }, + { + "height": 480, + "href": "magnet:?xs=https%3A%2F%2Fpeertube.social%2Fstatic%2Ftorrents%2F278d2b7c-0f38-4aaa-afe6-9ecc0c4a34fe-480.torrent&xt=urn:btih:3a13ff822ad9494165eff6167183ddaaabc1372a&dn=Twenty+Years+in+Jail%3A+FreeBSD's+Jails%2C+Then+and+Now&tr=wss%3A%2F%2Fpeertube.social%3A443%2Ftracker%2Fsocket&tr=https%3A%2F%2Fpeertube.social%2Ftracker%2Fannounce&ws=https%3A%2F%2Fpeertube.social%2Fstatic%2Fwebseed%2F278d2b7c-0f38-4aaa-afe6-9ecc0c4a34fe-480.mp4", + "mediaType": "application/x-bittorrent;x-scheme-handler/magnet", + "type": "Link" + } + ], + "uuid": "278d2b7c-0f38-4aaa-afe6-9ecc0c4a34fe", + "views": 2, + "waitTranscoding": false +} diff --git a/test/fixtures/users_mock/localhost.json b/test/fixtures/users_mock/localhost.json new file mode 100644 index 000000000..a49935db1 --- /dev/null +++ b/test/fixtures/users_mock/localhost.json @@ -0,0 +1,41 @@ +{ + "@context": [ + "https://www.w3.org/ns/activitystreams", + "http://localhost:4001/schemas/litepub-0.1.jsonld", + { + "@language": "und" + } + ], + "attachment": [], + "endpoints": { + "oauthAuthorizationEndpoint": "http://localhost:4001/oauth/authorize", + "oauthRegistrationEndpoint": "http://localhost:4001/api/v1/apps", + "oauthTokenEndpoint": "http://localhost:4001/oauth/token", + "sharedInbox": "http://localhost:4001/inbox" + }, + "followers": "http://localhost:4001/users/{{nickname}}/followers", + "following": "http://localhost:4001/users/{{nickname}}/following", + "icon": { + "type": "Image", + "url": "http://localhost:4001/media/4e914f5b84e4a259a3f6c2d2edc9ab642f2ab05f3e3d9c52c81fc2d984b3d51e.jpg" + }, + "id": "http://localhost:4001/users/{{nickname}}", + "image": { + "type": "Image", + "url": "http://localhost:4001/media/f739efddefeee49c6e67e947c4811fdc911785c16ae43da4c3684051fbf8da6a.jpg?name=f739efddefeee49c6e67e947c4811fdc911785c16ae43da4c3684051fbf8da6a.jpg" + }, + "inbox": "http://localhost:4001/users/{{nickname}}/inbox", + "manuallyApprovesFollowers": false, + "name": "{{nickname}}", + "outbox": "http://localhost:4001/users/{{nickname}}/outbox", + "preferredUsername": "{{nickname}}", + "publicKey": { + "id": "http://localhost:4001/users/{{nickname}}#main-key", + "owner": "http://localhost:4001/users/{{nickname}}", + "publicKeyPem": "-----BEGIN PUBLIC KEY-----\nMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEA5DLtwGXNZElJyxFGfcVc\nXANhaMadj/iYYQwZjOJTV9QsbtiNBeIK54PJrYuU0/0YIdrvS1iqheX5IwXRhcwa\nhm3ZyLz7XeN9st7FBni4BmZMBtMpxAuYuu5p/jbWy13qAiYOhPreCx0wrWgm/lBD\n9mkgaxIxPooBE0S4ZWEJIDIV1Vft3AWcRUyWW1vIBK0uZzs6GYshbQZB952S0yo4\nFzI1hABGHncH8UvuFauh4EZ8tY7/X5I0pGRnDOcRN1dAht5w5yTA+6r5kebiFQjP\nIzN/eCO/a9Flrj9YGW7HDNtjSOH0A31PLRGlJtJO3yK57dnf5ppyCZGfL4emShQo\ncQIDAQAB\n-----END PUBLIC KEY-----\n\n" + }, + "summary": "your friendly neighborhood pleroma developer
I like cute things and distributed systems, and really hate delete and redrafts", + "tag": [], + "type": "Person", + "url": "http://localhost:4001/users/{{nickname}}" +} \ No newline at end of file diff --git a/test/fixtures/warnings/otp_version/21.1 b/test/fixtures/warnings/otp_version/21.1 new file mode 100644 index 000000000..90cd64c4f --- /dev/null +++ b/test/fixtures/warnings/otp_version/21.1 @@ -0,0 +1 @@ +21.1 \ No newline at end of file diff --git a/test/fixtures/warnings/otp_version/22.1 b/test/fixtures/warnings/otp_version/22.1 new file mode 100644 index 000000000..d9b314368 --- /dev/null +++ b/test/fixtures/warnings/otp_version/22.1 @@ -0,0 +1 @@ +22.1 \ No newline at end of file diff --git a/test/fixtures/warnings/otp_version/22.4 b/test/fixtures/warnings/otp_version/22.4 new file mode 100644 index 000000000..1da8ccd28 --- /dev/null +++ b/test/fixtures/warnings/otp_version/22.4 @@ -0,0 +1 @@ +22.4 \ No newline at end of file diff --git a/test/fixtures/warnings/otp_version/23.0 b/test/fixtures/warnings/otp_version/23.0 new file mode 100644 index 000000000..4266d8634 --- /dev/null +++ b/test/fixtures/warnings/otp_version/23.0 @@ -0,0 +1 @@ +23.0 \ No newline at end of file diff --git a/test/following_relationship_test.exs b/test/following_relationship_test.exs index 865bb3838..17a468abb 100644 --- a/test/following_relationship_test.exs +++ b/test/following_relationship_test.exs @@ -15,28 +15,28 @@ defmodule Pleroma.FollowingRelationshipTest do test "returns following addresses without internal.fetch" do user = insert(:user) fetch_actor = InternalFetchActor.get_actor() - FollowingRelationship.follow(fetch_actor, user, "accept") + FollowingRelationship.follow(fetch_actor, user, :follow_accept) assert FollowingRelationship.following(fetch_actor) == [user.follower_address] end test "returns following addresses without relay" do user = insert(:user) relay_actor = Relay.get_actor() - FollowingRelationship.follow(relay_actor, user, "accept") + FollowingRelationship.follow(relay_actor, user, :follow_accept) assert FollowingRelationship.following(relay_actor) == [user.follower_address] end test "returns following addresses without remote user" do user = insert(:user) actor = insert(:user, local: false) - FollowingRelationship.follow(actor, user, "accept") + FollowingRelationship.follow(actor, user, :follow_accept) assert FollowingRelationship.following(actor) == [user.follower_address] end test "returns following addresses with local user" do user = insert(:user) actor = insert(:user, local: true) - FollowingRelationship.follow(actor, user, "accept") + FollowingRelationship.follow(actor, user, :follow_accept) assert FollowingRelationship.following(actor) == [ actor.follower_address, diff --git a/test/formatter_test.exs b/test/formatter_test.exs index cf8441cf6..bef5a2c28 100644 --- a/test/formatter_test.exs +++ b/test/formatter_test.exs @@ -140,7 +140,7 @@ test "gives a replacement for user links, using local nicknames in user links te archaeme = insert(:user, nickname: "archa_eme_", - source_data: %{"url" => "https://archeme/@archa_eme_"} + uri: "https://archeme/@archa_eme_" ) archaeme_remote = insert(:user, %{nickname: "archaeme@archae.me"}) @@ -150,13 +150,13 @@ test "gives a replacement for user links, using local nicknames in user links te assert length(mentions) == 3 expected_text = - ~s(@gsimg According to @gsimg According to @archa_eme_, that is @daggsy. Also hello @archa_eme_, that is @daggsy. Also hello @archaeme) + }" href="#{archaeme_remote.ap_id}" rel="ugc">@archaeme) assert expected_text == text end @@ -171,7 +171,7 @@ test "gives a replacement for user links when the user is using Osada" do assert length(mentions) == 1 expected_text = - ~s(@mike test) @@ -187,7 +187,7 @@ test "gives a replacement for single-character local nicknames" do assert length(mentions) == 1 expected_text = - ~s(@o hi) + ~s(@o hi) assert expected_text == text end @@ -209,17 +209,13 @@ test "given the 'safe_mention' option, it will only mention people in the beginn assert mentions == [{"@#{user.nickname}", user}, {"@#{other_user.nickname}", other_user}] assert expected_text == - ~s(@#{user.nickname} @#{user.nickname} @#{ - other_user.nickname - } hey dudes i hate @#{other_user.nickname} hey dudes i hate @#{ - third_user.nickname - }) + }" href="#{third_user.ap_id}" rel="ugc">@#{third_user.nickname}) end test "given the 'safe_mention' option, it will still work without any mention" do diff --git a/test/html_test.exs b/test/html_test.exs index a006fd492..0a4b4ebbc 100644 --- a/test/html_test.exs +++ b/test/html_test.exs @@ -171,7 +171,7 @@ test "extracts the url" do {:ok, activity} = CommonAPI.post(user, %{ - "status" => + status: "I think I just found the best github repo https://github.com/komeiji-satori/Dress" }) @@ -186,7 +186,7 @@ test "skips mentions" do {:ok, activity} = CommonAPI.post(user, %{ - "status" => + status: "@#{other_user.nickname} install misskey! https://github.com/syuilo/misskey/blob/develop/docs/setup.en.md" }) @@ -203,8 +203,7 @@ test "skips hashtags" do {:ok, activity} = CommonAPI.post(user, %{ - "status" => - "#cofe https://www.pixiv.net/member_illust.php?mode=medium&illust_id=72255140" + status: "#cofe https://www.pixiv.net/member_illust.php?mode=medium&illust_id=72255140" }) object = Object.normalize(activity) @@ -218,9 +217,9 @@ test "skips microformats hashtags" do {:ok, activity} = CommonAPI.post(user, %{ - "status" => + status: "#cofe https://www.pixiv.net/member_illust.php?mode=medium&illust_id=72255140", - "content_type" => "text/html" + content_type: "text/html" }) object = Object.normalize(activity) @@ -232,8 +231,7 @@ test "skips microformats hashtags" do test "does not crash when there is an HTML entity in a link" do user = insert(:user) - {:ok, activity} = - CommonAPI.post(user, %{"status" => "\"http://cofe.com/?boomer=ok&foo=bar\""}) + {:ok, activity} = CommonAPI.post(user, %{status: "\"http://cofe.com/?boomer=ok&foo=bar\""}) object = Object.normalize(activity) diff --git a/test/http/adapter_helper/gun_test.exs b/test/http/adapter_helper/gun_test.exs new file mode 100644 index 000000000..2e961826e --- /dev/null +++ b/test/http/adapter_helper/gun_test.exs @@ -0,0 +1,258 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.HTTP.AdapterHelper.GunTest do + use ExUnit.Case, async: true + use Pleroma.Tests.Helpers + + import Mox + + alias Pleroma.Config + alias Pleroma.Gun.Conn + alias Pleroma.HTTP.AdapterHelper.Gun + alias Pleroma.Pool.Connections + + setup :verify_on_exit! + + defp gun_mock(_) do + gun_mock() + :ok + end + + defp gun_mock do + Pleroma.GunMock + |> stub(:open, fn _, _, _ -> Task.start_link(fn -> Process.sleep(1000) end) end) + |> stub(:await_up, fn _, _ -> {:ok, :http} end) + |> stub(:set_owner, fn _, _ -> :ok end) + end + + describe "options/1" do + setup do: clear_config([:http, :adapter], a: 1, b: 2) + + test "https url with default port" do + uri = URI.parse("https://example.com") + + opts = Gun.options([receive_conn: false], uri) + assert opts[:certificates_verification] + assert opts[:tls_opts][:log_level] == :warning + end + + test "https ipv4 with default port" do + uri = URI.parse("https://127.0.0.1") + + opts = Gun.options([receive_conn: false], uri) + assert opts[:certificates_verification] + assert opts[:tls_opts][:log_level] == :warning + end + + test "https ipv6 with default port" do + uri = URI.parse("https://[2a03:2880:f10c:83:face:b00c:0:25de]") + + opts = Gun.options([receive_conn: false], uri) + assert opts[:certificates_verification] + assert opts[:tls_opts][:log_level] == :warning + end + + test "https url with non standart port" do + uri = URI.parse("https://example.com:115") + + opts = Gun.options([receive_conn: false], uri) + + assert opts[:certificates_verification] + end + + test "get conn on next request" do + gun_mock() + level = Application.get_env(:logger, :level) + Logger.configure(level: :debug) + on_exit(fn -> Logger.configure(level: level) end) + uri = URI.parse("http://some-domain2.com") + + opts = Gun.options(uri) + + assert opts[:conn] == nil + assert opts[:close_conn] == nil + + Process.sleep(50) + opts = Gun.options(uri) + + assert is_pid(opts[:conn]) + assert opts[:close_conn] == false + end + + test "merges with defaul http adapter config" do + defaults = Gun.options([receive_conn: false], URI.parse("https://example.com")) + assert Keyword.has_key?(defaults, :a) + assert Keyword.has_key?(defaults, :b) + end + + test "default ssl adapter opts with connection" do + gun_mock() + uri = URI.parse("https://some-domain.com") + + :ok = Conn.open(uri, :gun_connections) + + opts = Gun.options(uri) + + assert opts[:certificates_verification] + refute opts[:tls_opts] == [] + + assert opts[:close_conn] == false + assert is_pid(opts[:conn]) + end + + test "parses string proxy host & port" do + proxy = Config.get([:http, :proxy_url]) + Config.put([:http, :proxy_url], "localhost:8123") + on_exit(fn -> Config.put([:http, :proxy_url], proxy) end) + + uri = URI.parse("https://some-domain.com") + opts = Gun.options([receive_conn: false], uri) + assert opts[:proxy] == {'localhost', 8123} + end + + test "parses tuple proxy scheme host and port" do + proxy = Config.get([:http, :proxy_url]) + Config.put([:http, :proxy_url], {:socks, 'localhost', 1234}) + on_exit(fn -> Config.put([:http, :proxy_url], proxy) end) + + uri = URI.parse("https://some-domain.com") + opts = Gun.options([receive_conn: false], uri) + assert opts[:proxy] == {:socks, 'localhost', 1234} + end + + test "passed opts have more weight than defaults" do + proxy = Config.get([:http, :proxy_url]) + Config.put([:http, :proxy_url], {:socks5, 'localhost', 1234}) + on_exit(fn -> Config.put([:http, :proxy_url], proxy) end) + uri = URI.parse("https://some-domain.com") + opts = Gun.options([receive_conn: false, proxy: {'example.com', 4321}], uri) + + assert opts[:proxy] == {'example.com', 4321} + end + end + + describe "options/1 with receive_conn parameter" do + setup :gun_mock + + test "receive conn by default" do + uri = URI.parse("http://another-domain.com") + :ok = Conn.open(uri, :gun_connections) + + received_opts = Gun.options(uri) + assert received_opts[:close_conn] == false + assert is_pid(received_opts[:conn]) + end + + test "don't receive conn if receive_conn is false" do + uri = URI.parse("http://another-domain.com") + :ok = Conn.open(uri, :gun_connections) + + opts = [receive_conn: false] + received_opts = Gun.options(opts, uri) + assert received_opts[:close_conn] == nil + assert received_opts[:conn] == nil + end + end + + describe "after_request/1" do + setup :gun_mock + + test "body_as not chunks" do + uri = URI.parse("http://some-domain.com") + :ok = Conn.open(uri, :gun_connections) + opts = Gun.options(uri) + :ok = Gun.after_request(opts) + conn = opts[:conn] + + assert %Connections{ + conns: %{ + "http:some-domain.com:80" => %Pleroma.Gun.Conn{ + conn: ^conn, + conn_state: :idle, + used_by: [] + } + } + } = Connections.get_state(:gun_connections) + end + + test "body_as chunks" do + uri = URI.parse("http://some-domain.com") + :ok = Conn.open(uri, :gun_connections) + opts = Gun.options([body_as: :chunks], uri) + :ok = Gun.after_request(opts) + conn = opts[:conn] + self = self() + + assert %Connections{ + conns: %{ + "http:some-domain.com:80" => %Pleroma.Gun.Conn{ + conn: ^conn, + conn_state: :active, + used_by: [{^self, _}] + } + } + } = Connections.get_state(:gun_connections) + end + + test "with no connection" do + uri = URI.parse("http://uniq-domain.com") + + :ok = Conn.open(uri, :gun_connections) + + opts = Gun.options([body_as: :chunks], uri) + conn = opts[:conn] + opts = Keyword.delete(opts, :conn) + self = self() + + :ok = Gun.after_request(opts) + + assert %Connections{ + conns: %{ + "http:uniq-domain.com:80" => %Pleroma.Gun.Conn{ + conn: ^conn, + conn_state: :active, + used_by: [{^self, _}] + } + } + } = Connections.get_state(:gun_connections) + end + + test "with ipv4" do + uri = URI.parse("http://127.0.0.1") + :ok = Conn.open(uri, :gun_connections) + opts = Gun.options(uri) + :ok = Gun.after_request(opts) + conn = opts[:conn] + + assert %Connections{ + conns: %{ + "http:127.0.0.1:80" => %Pleroma.Gun.Conn{ + conn: ^conn, + conn_state: :idle, + used_by: [] + } + } + } = Connections.get_state(:gun_connections) + end + + test "with ipv6" do + uri = URI.parse("http://[2a03:2880:f10c:83:face:b00c:0:25de]") + :ok = Conn.open(uri, :gun_connections) + opts = Gun.options(uri) + :ok = Gun.after_request(opts) + conn = opts[:conn] + + assert %Connections{ + conns: %{ + "http:2a03:2880:f10c:83:face:b00c:0:25de:80" => %Pleroma.Gun.Conn{ + conn: ^conn, + conn_state: :idle, + used_by: [] + } + } + } = Connections.get_state(:gun_connections) + end + end +end diff --git a/test/http/adapter_helper/hackney_test.exs b/test/http/adapter_helper/hackney_test.exs new file mode 100644 index 000000000..3f7e708e0 --- /dev/null +++ b/test/http/adapter_helper/hackney_test.exs @@ -0,0 +1,47 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.HTTP.AdapterHelper.HackneyTest do + use ExUnit.Case, async: true + use Pleroma.Tests.Helpers + + alias Pleroma.HTTP.AdapterHelper.Hackney + + setup_all do + uri = URI.parse("http://domain.com") + {:ok, uri: uri} + end + + describe "options/2" do + setup do: clear_config([:http, :adapter], a: 1, b: 2) + + test "add proxy and opts from config", %{uri: uri} do + opts = Hackney.options([proxy: "localhost:8123"], uri) + + assert opts[:a] == 1 + assert opts[:b] == 2 + assert opts[:proxy] == "localhost:8123" + end + + test "respect connection opts and no proxy", %{uri: uri} do + opts = Hackney.options([a: 2, b: 1], uri) + + assert opts[:a] == 2 + assert opts[:b] == 1 + refute Keyword.has_key?(opts, :proxy) + end + + test "add opts for https" do + uri = URI.parse("https://domain.com") + + opts = Hackney.options(uri) + + assert opts[:ssl_options] == [ + partial_chain: &:hackney_connect.partial_chain/1, + versions: [:tlsv1, :"tlsv1.1", :"tlsv1.2"], + server_name_indication: 'domain.com' + ] + end + end +end diff --git a/test/http/adapter_helper_test.exs b/test/http/adapter_helper_test.exs new file mode 100644 index 000000000..24d501ad5 --- /dev/null +++ b/test/http/adapter_helper_test.exs @@ -0,0 +1,28 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.HTTP.AdapterHelperTest do + use ExUnit.Case, async: true + + alias Pleroma.HTTP.AdapterHelper + + describe "format_proxy/1" do + test "with nil" do + assert AdapterHelper.format_proxy(nil) == nil + end + + test "with string" do + assert AdapterHelper.format_proxy("127.0.0.1:8123") == {{127, 0, 0, 1}, 8123} + end + + test "localhost with port" do + assert AdapterHelper.format_proxy("localhost:8123") == {'localhost', 8123} + end + + test "tuple" do + assert AdapterHelper.format_proxy({:socks4, :localhost, 9050}) == + {:socks4, 'localhost', 9050} + end + end +end diff --git a/test/http/connection_test.exs b/test/http/connection_test.exs new file mode 100644 index 000000000..7c94a50b2 --- /dev/null +++ b/test/http/connection_test.exs @@ -0,0 +1,135 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.HTTP.ConnectionTest do + use ExUnit.Case + use Pleroma.Tests.Helpers + + import ExUnit.CaptureLog + + alias Pleroma.Config + alias Pleroma.HTTP.Connection + + describe "parse_host/1" do + test "as atom to charlist" do + assert Connection.parse_host(:localhost) == 'localhost' + end + + test "as string to charlist" do + assert Connection.parse_host("localhost.com") == 'localhost.com' + end + + test "as string ip to tuple" do + assert Connection.parse_host("127.0.0.1") == {127, 0, 0, 1} + end + end + + describe "parse_proxy/1" do + test "ip with port" do + assert Connection.parse_proxy("127.0.0.1:8123") == {:ok, {127, 0, 0, 1}, 8123} + end + + test "host with port" do + assert Connection.parse_proxy("localhost:8123") == {:ok, 'localhost', 8123} + end + + test "as tuple" do + assert Connection.parse_proxy({:socks4, :localhost, 9050}) == + {:ok, :socks4, 'localhost', 9050} + end + + test "as tuple with string host" do + assert Connection.parse_proxy({:socks5, "localhost", 9050}) == + {:ok, :socks5, 'localhost', 9050} + end + end + + describe "parse_proxy/1 errors" do + test "ip without port" do + capture_log(fn -> + assert Connection.parse_proxy("127.0.0.1") == {:error, :invalid_proxy} + end) =~ "parsing proxy fail \"127.0.0.1\"" + end + + test "host without port" do + capture_log(fn -> + assert Connection.parse_proxy("localhost") == {:error, :invalid_proxy} + end) =~ "parsing proxy fail \"localhost\"" + end + + test "host with bad port" do + capture_log(fn -> + assert Connection.parse_proxy("localhost:port") == {:error, :invalid_proxy_port} + end) =~ "parsing port in proxy fail \"localhost:port\"" + end + + test "ip with bad port" do + capture_log(fn -> + assert Connection.parse_proxy("127.0.0.1:15.9") == {:error, :invalid_proxy_port} + end) =~ "parsing port in proxy fail \"127.0.0.1:15.9\"" + end + + test "as tuple without port" do + capture_log(fn -> + assert Connection.parse_proxy({:socks5, :localhost}) == {:error, :invalid_proxy} + end) =~ "parsing proxy fail {:socks5, :localhost}" + end + + test "with nil" do + assert Connection.parse_proxy(nil) == nil + end + end + + describe "options/3" do + setup do: clear_config([:http, :proxy_url]) + + test "without proxy_url in config" do + Config.delete([:http, :proxy_url]) + + opts = Connection.options(%URI{}) + refute Keyword.has_key?(opts, :proxy) + end + + test "parses string proxy host & port" do + Config.put([:http, :proxy_url], "localhost:8123") + + opts = Connection.options(%URI{}) + assert opts[:proxy] == {'localhost', 8123} + end + + test "parses tuple proxy scheme host and port" do + Config.put([:http, :proxy_url], {:socks, 'localhost', 1234}) + + opts = Connection.options(%URI{}) + assert opts[:proxy] == {:socks, 'localhost', 1234} + end + + test "passed opts have more weight than defaults" do + Config.put([:http, :proxy_url], {:socks5, 'localhost', 1234}) + + opts = Connection.options(%URI{}, proxy: {'example.com', 4321}) + + assert opts[:proxy] == {'example.com', 4321} + end + end + + describe "format_host/1" do + test "with domain" do + assert Connection.format_host("example.com") == 'example.com' + end + + test "with idna domain" do + assert Connection.format_host("ですexample.com") == 'xn--example-183fne.com' + end + + test "with ipv4" do + assert Connection.format_host("127.0.0.1") == '127.0.0.1' + end + + test "with ipv6" do + assert Connection.format_host("2a03:2880:f10c:83:face:b00c:0:25de") == + '2a03:2880:f10c:83:face:b00c:0:25de' + end + end +end diff --git a/test/http/request_builder_test.exs b/test/http/request_builder_test.exs index bf3a15ebe..fab909905 100644 --- a/test/http/request_builder_test.exs +++ b/test/http/request_builder_test.exs @@ -3,57 +3,38 @@ # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.HTTP.RequestBuilderTest do - use ExUnit.Case, async: true + use ExUnit.Case use Pleroma.Tests.Helpers + alias Pleroma.HTTP.Request alias Pleroma.HTTP.RequestBuilder describe "headers/2" do - setup do: clear_config([:http, :send_user_agent]) - setup do: clear_config([:http, :user_agent]) - test "don't send pleroma user agent" do - assert RequestBuilder.headers(%{}, []) == %{headers: []} + assert RequestBuilder.headers(%Request{}, []) == %Request{headers: []} end test "send pleroma user agent" do - Pleroma.Config.put([:http, :send_user_agent], true) - Pleroma.Config.put([:http, :user_agent], :default) + clear_config([:http, :send_user_agent], true) + clear_config([:http, :user_agent], :default) - assert RequestBuilder.headers(%{}, []) == %{ - headers: [{"User-Agent", Pleroma.Application.user_agent()}] + assert RequestBuilder.headers(%Request{}, []) == %Request{ + headers: [{"user-agent", Pleroma.Application.user_agent()}] } end test "send custom user agent" do - Pleroma.Config.put([:http, :send_user_agent], true) - Pleroma.Config.put([:http, :user_agent], "totally-not-pleroma") + clear_config([:http, :send_user_agent], true) + clear_config([:http, :user_agent], "totally-not-pleroma") - assert RequestBuilder.headers(%{}, []) == %{ - headers: [{"User-Agent", "totally-not-pleroma"}] + assert RequestBuilder.headers(%Request{}, []) == %Request{ + headers: [{"user-agent", "totally-not-pleroma"}] } end end - describe "add_optional_params/3" do - test "don't add if keyword is empty" do - assert RequestBuilder.add_optional_params(%{}, %{}, []) == %{} - end - - test "add query parameter" do - assert RequestBuilder.add_optional_params( - %{}, - %{query: :query, body: :body, another: :val}, - [ - {:query, "param1=val1¶m2=val2"}, - {:body, "some body"} - ] - ) == %{query: "param1=val1¶m2=val2", body: "some body"} - end - end - describe "add_param/4" do test "add file parameter" do - %{ + %Request{ body: %Tesla.Multipart{ boundary: _, content_type_params: [], @@ -70,7 +51,7 @@ test "add file parameter" do } ] } - } = RequestBuilder.add_param(%{}, :file, "filename.png", "some-path/filename.png") + } = RequestBuilder.add_param(%Request{}, :file, "filename.png", "some-path/filename.png") end test "add key to body" do @@ -82,7 +63,7 @@ test "add key to body" do %Tesla.Multipart.Part{ body: "\"someval\"", dispositions: [name: "somekey"], - headers: ["Content-Type": "application/json"] + headers: [{"content-type", "application/json"}] } ] } diff --git a/test/http_test.exs b/test/http_test.exs index 3edb0de36..618485b55 100644 --- a/test/http_test.exs +++ b/test/http_test.exs @@ -3,8 +3,10 @@ # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.HTTPTest do - use Pleroma.DataCase + use ExUnit.Case, async: true + use Pleroma.Tests.Helpers import Tesla.Mock + alias Pleroma.HTTP setup do mock(fn @@ -27,7 +29,7 @@ defmodule Pleroma.HTTPTest do describe "get/1" do test "returns successfully result" do - assert Pleroma.HTTP.get("http://example.com/hello") == { + assert HTTP.get("http://example.com/hello") == { :ok, %Tesla.Env{status: 200, body: "hello"} } @@ -36,7 +38,7 @@ test "returns successfully result" do describe "get/2 (with headers)" do test "returns successfully result for json content-type" do - assert Pleroma.HTTP.get("http://example.com/hello", [{"content-type", "application/json"}]) == + assert HTTP.get("http://example.com/hello", [{"content-type", "application/json"}]) == { :ok, %Tesla.Env{ @@ -50,7 +52,7 @@ test "returns successfully result for json content-type" do describe "post/2" do test "returns successfully result" do - assert Pleroma.HTTP.post("http://example.com/world", "") == { + assert HTTP.post("http://example.com/world", "") == { :ok, %Tesla.Env{status: 200, body: "world"} } diff --git a/test/instance_static/add/shortcode.png b/test/instance_static/add/shortcode.png new file mode 100644 index 000000000..8f50fa023 Binary files /dev/null and b/test/instance_static/add/shortcode.png differ diff --git a/test/instance_static/emoji/pack_bad_sha/blank.png b/test/instance_static/emoji/pack_bad_sha/blank.png new file mode 100644 index 000000000..8f50fa023 Binary files /dev/null and b/test/instance_static/emoji/pack_bad_sha/blank.png differ diff --git a/test/instance_static/emoji/pack_bad_sha/pack.json b/test/instance_static/emoji/pack_bad_sha/pack.json new file mode 100644 index 000000000..35caf4298 --- /dev/null +++ b/test/instance_static/emoji/pack_bad_sha/pack.json @@ -0,0 +1,13 @@ +{ + "pack": { + "license": "Test license", + "homepage": "https://pleroma.social", + "description": "Test description", + "can-download": true, + "share-files": true, + "download-sha256": "57482F30674FD3DE821FF48C81C00DA4D4AF1F300209253684ABA7075E5FC238" + }, + "files": { + "blank": "blank.png" + } +} \ No newline at end of file diff --git a/test/instance_static/emoji/pack_bad_sha/pack_bad_sha.zip b/test/instance_static/emoji/pack_bad_sha/pack_bad_sha.zip new file mode 100644 index 000000000..148446c64 Binary files /dev/null and b/test/instance_static/emoji/pack_bad_sha/pack_bad_sha.zip differ diff --git a/test/instance_static/emoji/test_pack/pack.json b/test/instance_static/emoji/test_pack/pack.json index 5a8ee75f9..481891b08 100644 --- a/test/instance_static/emoji/test_pack/pack.json +++ b/test/instance_static/emoji/test_pack/pack.json @@ -1,13 +1,11 @@ { - "pack": { - "license": "Test license", - "homepage": "https://pleroma.social", - "description": "Test description", - - "share-files": true - }, - "files": { "blank": "blank.png" + }, + "pack": { + "description": "Test description", + "homepage": "https://pleroma.social", + "license": "Test license", + "share-files": true } -} +} \ No newline at end of file diff --git a/test/instance_static/emoji/test_pack_nonshared/pack.json b/test/instance_static/emoji/test_pack_nonshared/pack.json index b96781f81..93d643a5f 100644 --- a/test/instance_static/emoji/test_pack_nonshared/pack.json +++ b/test/instance_static/emoji/test_pack_nonshared/pack.json @@ -3,14 +3,11 @@ "license": "Test license", "homepage": "https://pleroma.social", "description": "Test description", - "fallback-src": "https://nonshared-pack", "fallback-src-sha256": "74409E2674DAA06C072729C6C8426C4CB3B7E0B85ED77792DB7A436E11D76DAF", - "share-files": false }, - "files": { "blank": "blank.png" } -} +} \ No newline at end of file diff --git a/test/integration/mastodon_websocket_test.exs b/test/integration/mastodon_websocket_test.exs index bd229c55f..ea17e9feb 100644 --- a/test/integration/mastodon_websocket_test.exs +++ b/test/integration/mastodon_websocket_test.exs @@ -12,17 +12,14 @@ defmodule Pleroma.Integration.MastodonWebsocketTest do alias Pleroma.Web.CommonAPI alias Pleroma.Web.OAuth + @moduletag needs_streamer: true, capture_log: true + @path Pleroma.Web.Endpoint.url() |> URI.parse() |> Map.put(:scheme, "ws") |> Map.put(:path, "/api/v1/streaming") |> URI.to_string() - setup_all do - start_supervised(Pleroma.Web.Streamer.supervisor()) - :ok - end - def start_socket(qs \\ nil, headers \\ []) do path = case qs do @@ -35,7 +32,7 @@ def start_socket(qs \\ nil, headers \\ []) do test "refuses invalid requests" do capture_log(fn -> - assert {:error, {400, _}} = start_socket() + assert {:error, {404, _}} = start_socket() assert {:error, {404, _}} = start_socket("?stream=ncjdk") Process.sleep(30) end) @@ -43,8 +40,8 @@ test "refuses invalid requests" do test "requires authentication and a valid token for protected streams" do capture_log(fn -> - assert {:error, {403, _}} = start_socket("?stream=user&access_token=aaaaaaaaaaaa") - assert {:error, {403, _}} = start_socket("?stream=user") + assert {:error, {401, _}} = start_socket("?stream=user&access_token=aaaaaaaaaaaa") + assert {:error, {401, _}} = start_socket("?stream=user") Process.sleep(30) end) end @@ -58,7 +55,7 @@ test "allows public streams without authentication" do test "receives well formatted events" do user = insert(:user) {:ok, _} = start_socket("?stream=public") - {:ok, activity} = CommonAPI.post(user, %{"status" => "nice echo chamber"}) + {:ok, activity} = CommonAPI.post(user, %{status: "nice echo chamber"}) assert_receive {:text, raw_json}, 1_000 assert {:ok, json} = Jason.decode(raw_json) @@ -103,7 +100,7 @@ test "accepts the 'user' stream", %{token: token} = _state do assert {:ok, _} = start_socket("?stream=user&access_token=#{token.token}") assert capture_log(fn -> - assert {:error, {403, "Forbidden"}} = start_socket("?stream=user") + assert {:error, {401, _}} = start_socket("?stream=user") Process.sleep(30) end) =~ ":badarg" end @@ -112,7 +109,7 @@ test "accepts the 'user:notification' stream", %{token: token} = _state do assert {:ok, _} = start_socket("?stream=user:notification&access_token=#{token.token}") assert capture_log(fn -> - assert {:error, {403, "Forbidden"}} = start_socket("?stream=user:notification") + assert {:error, {401, _}} = start_socket("?stream=user:notification") Process.sleep(30) end) =~ ":badarg" end @@ -121,7 +118,7 @@ test "accepts valid token on Sec-WebSocket-Protocol header", %{token: token} do assert {:ok, _} = start_socket("?stream=user", [{"Sec-WebSocket-Protocol", token.token}]) assert capture_log(fn -> - assert {:error, {403, "Forbidden"}} = + assert {:error, {401, _}} = start_socket("?stream=user", [{"Sec-WebSocket-Protocol", "I am a friend"}]) Process.sleep(30) diff --git a/test/marker_test.exs b/test/marker_test.exs index c80ae16b6..5b6d0b4a4 100644 --- a/test/marker_test.exs +++ b/test/marker_test.exs @@ -8,12 +8,39 @@ defmodule Pleroma.MarkerTest do import Pleroma.Factory + describe "multi_set_unread_count/3" do + test "returns multi" do + user = insert(:user) + + assert %Ecto.Multi{ + operations: [marker: {:run, _}, counters: {:run, _}] + } = + Marker.multi_set_last_read_id( + Ecto.Multi.new(), + user, + "notifications" + ) + end + + test "return empty multi" do + user = insert(:user) + multi = Ecto.Multi.new() + assert Marker.multi_set_last_read_id(multi, user, "home") == multi + end + end + describe "get_markers/2" do test "returns user markers" do user = insert(:user) marker = insert(:marker, user: user) + insert(:notification, user: user) + insert(:notification, user: user) insert(:marker, timeline: "home", user: user) - assert Marker.get_markers(user, ["notifications"]) == [refresh_record(marker)] + + assert Marker.get_markers( + user, + ["notifications"] + ) == [%Marker{refresh_record(marker) | unread_count: 2}] end end diff --git a/test/mfa/backup_codes_test.exs b/test/mfa/backup_codes_test.exs new file mode 100644 index 000000000..7bc01b36b --- /dev/null +++ b/test/mfa/backup_codes_test.exs @@ -0,0 +1,11 @@ +defmodule Pleroma.MFA.BackupCodesTest do + use Pleroma.DataCase + + alias Pleroma.MFA.BackupCodes + + test "generate backup codes" do + codes = BackupCodes.generate(number_of_codes: 2, length: 4) + + assert [<<_::bytes-size(4)>>, <<_::bytes-size(4)>>] = codes + end +end diff --git a/test/mfa/totp_test.exs b/test/mfa/totp_test.exs new file mode 100644 index 000000000..50153d208 --- /dev/null +++ b/test/mfa/totp_test.exs @@ -0,0 +1,17 @@ +defmodule Pleroma.MFA.TOTPTest do + use Pleroma.DataCase + + alias Pleroma.MFA.TOTP + + test "create provisioning_uri to generate qrcode" do + uri = + TOTP.provisioning_uri("test-secrcet", "test@example.com", + issuer: "Plerome-42", + digits: 8, + period: 60 + ) + + assert uri == + "otpauth://totp/test@example.com?digits=8&issuer=Plerome-42&period=60&secret=test-secrcet" + end +end diff --git a/test/mfa_test.exs b/test/mfa_test.exs new file mode 100644 index 000000000..8875cefd9 --- /dev/null +++ b/test/mfa_test.exs @@ -0,0 +1,52 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2018 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.MFATest do + use Pleroma.DataCase + + import Pleroma.Factory + alias Pleroma.MFA + + describe "mfa_settings" do + test "returns settings user's" do + user = + insert(:user, + multi_factor_authentication_settings: %MFA.Settings{ + enabled: true, + totp: %MFA.Settings.TOTP{secret: "xx", confirmed: true} + } + ) + + settings = MFA.mfa_settings(user) + assert match?(^settings, %{enabled: true, totp: true}) + end + end + + describe "generate backup codes" do + test "returns backup codes" do + user = insert(:user) + + {:ok, [code1, code2]} = MFA.generate_backup_codes(user) + updated_user = refresh_record(user) + [hash1, hash2] = updated_user.multi_factor_authentication_settings.backup_codes + assert Pbkdf2.verify_pass(code1, hash1) + assert Pbkdf2.verify_pass(code2, hash2) + end + end + + describe "invalidate_backup_code" do + test "invalid used code" do + user = insert(:user) + + {:ok, _} = MFA.generate_backup_codes(user) + user = refresh_record(user) + assert length(user.multi_factor_authentication_settings.backup_codes) == 2 + [hash_code | _] = user.multi_factor_authentication_settings.backup_codes + + {:ok, user} = MFA.invalidate_backup_code(user, hash_code) + + assert length(user.multi_factor_authentication_settings.backup_codes) == 1 + end + end +end diff --git a/test/notification_test.exs b/test/notification_test.exs index d240ede94..111ff09f4 100644 --- a/test/notification_test.exs +++ b/test/notification_test.exs @@ -6,12 +6,18 @@ defmodule Pleroma.NotificationTest do use Pleroma.DataCase import Pleroma.Factory + import Mock + alias Pleroma.FollowingRelationship alias Pleroma.Notification alias Pleroma.Tests.ObanHelpers alias Pleroma.User + alias Pleroma.Web.ActivityPub.ActivityPub + alias Pleroma.Web.ActivityPub.Builder alias Pleroma.Web.ActivityPub.Transmogrifier alias Pleroma.Web.CommonAPI + alias Pleroma.Web.MastodonAPI.NotificationView + alias Pleroma.Web.Push alias Pleroma.Web.Streamer describe "create_notifications" do @@ -19,8 +25,8 @@ test "creates a notification for an emoji reaction" do user = insert(:user) other_user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "yeah"}) - {:ok, activity, _object} = CommonAPI.react_with_emoji(activity.id, other_user, "☕") + {:ok, activity} = CommonAPI.post(user, %{status: "yeah"}) + {:ok, activity} = CommonAPI.react_with_emoji(activity.id, other_user, "☕") {:ok, [notification]} = Notification.create_notifications(activity) @@ -34,7 +40,7 @@ test "notifies someone when they are directly addressed" do {:ok, activity} = CommonAPI.post(user, %{ - "status" => "hey @#{other_user.nickname} and @#{third_user.nickname}" + status: "hey @#{other_user.nickname} and @#{third_user.nickname}" }) {:ok, [notification, other_notification]} = Notification.create_notifications(activity) @@ -43,6 +49,9 @@ test "notifies someone when they are directly addressed" do assert notified_ids == [other_user.id, third_user.id] assert notification.activity_id == activity.id assert other_notification.activity_id == activity.id + + assert [%Pleroma.Marker{unread_count: 2}] = + Pleroma.Marker.get_markers(other_user, ["notifications"]) end test "it creates a notification for subscribed users" do @@ -51,7 +60,7 @@ test "it creates a notification for subscribed users" do User.subscribe(subscriber, user) - {:ok, status} = CommonAPI.post(user, %{"status" => "Akariiiin"}) + {:ok, status} = CommonAPI.post(user, %{status: "Akariiiin"}) {:ok, [notification]} = Notification.create_notifications(status) assert notification.user_id == subscriber.id @@ -64,12 +73,12 @@ test "does not create a notification for subscribed users if status is a reply" User.subscribe(subscriber, other_user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "test post"}) + {:ok, activity} = CommonAPI.post(user, %{status: "test post"}) {:ok, _reply_activity} = CommonAPI.post(other_user, %{ - "status" => "test reply", - "in_reply_to_status_id" => activity.id + status: "test reply", + in_reply_to_status_id: activity.id }) user_notifications = Notification.for_user(user) @@ -80,18 +89,96 @@ test "does not create a notification for subscribed users if status is a reply" end end + describe "CommonApi.post/2 notification-related functionality" do + test_with_mock "creates but does NOT send notification to blocker user", + Push, + [:passthrough], + [] do + user = insert(:user) + blocker = insert(:user) + {:ok, _user_relationship} = User.block(blocker, user) + + {:ok, _activity} = CommonAPI.post(user, %{status: "hey @#{blocker.nickname}!"}) + + blocker_id = blocker.id + assert [%Notification{user_id: ^blocker_id}] = Repo.all(Notification) + refute called(Push.send(:_)) + end + + test_with_mock "creates but does NOT send notification to notification-muter user", + Push, + [:passthrough], + [] do + user = insert(:user) + muter = insert(:user) + {:ok, _user_relationships} = User.mute(muter, user) + + {:ok, _activity} = CommonAPI.post(user, %{status: "hey @#{muter.nickname}!"}) + + muter_id = muter.id + assert [%Notification{user_id: ^muter_id}] = Repo.all(Notification) + refute called(Push.send(:_)) + end + + test_with_mock "creates but does NOT send notification to thread-muter user", + Push, + [:passthrough], + [] do + user = insert(:user) + thread_muter = insert(:user) + + {:ok, activity} = CommonAPI.post(user, %{status: "hey @#{thread_muter.nickname}!"}) + + {:ok, _} = CommonAPI.add_mute(thread_muter, activity) + + {:ok, _same_context_activity} = + CommonAPI.post(user, %{ + status: "hey-hey-hey @#{thread_muter.nickname}!", + in_reply_to_status_id: activity.id + }) + + [pre_mute_notification, post_mute_notification] = + Repo.all(from(n in Notification, where: n.user_id == ^thread_muter.id, order_by: n.id)) + + pre_mute_notification_id = pre_mute_notification.id + post_mute_notification_id = post_mute_notification.id + + assert called( + Push.send( + :meck.is(fn + %Notification{id: ^pre_mute_notification_id} -> true + _ -> false + end) + ) + ) + + refute called( + Push.send( + :meck.is(fn + %Notification{id: ^post_mute_notification_id} -> true + _ -> false + end) + ) + ) + end + end + describe "create_notification" do @tag needs_streamer: true test "it creates a notification for user and send to the 'user' and the 'user:notification' stream" do user = insert(:user) - task = Task.async(fn -> assert_receive {:text, _}, 4_000 end) - task_user_notification = Task.async(fn -> assert_receive {:text, _}, 4_000 end) - Streamer.add_socket("user", %{transport_pid: task.pid, assigns: %{user: user}}) - Streamer.add_socket( - "user:notification", - %{transport_pid: task_user_notification.pid, assigns: %{user: user}} - ) + task = + Task.async(fn -> + Streamer.get_topic_and_add_socket("user", user) + assert_receive {:render_with_user, _, _, _}, 4_000 + end) + + task_user_notification = + Task.async(fn -> + Streamer.get_topic_and_add_socket("user:notification", user) + assert_receive {:render_with_user, _, _, _}, 4_000 + end) activity = insert(:note_activity) @@ -115,7 +202,7 @@ test "it creates a notification for the user if the user mutes the activity auth muted = insert(:user) {:ok, _} = User.mute(muter, muted) muter = Repo.get(User, muter.id) - {:ok, activity} = CommonAPI.post(muted, %{"status" => "Hi @#{muter.nickname}"}) + {:ok, activity} = CommonAPI.post(muted, %{status: "Hi @#{muter.nickname}"}) assert Notification.create_notification(activity, muter) end @@ -126,7 +213,7 @@ test "notification created if user is muted without notifications" do {:ok, _user_relationships} = User.mute(muter, muted, false) - {:ok, activity} = CommonAPI.post(muted, %{"status" => "Hi @#{muter.nickname}"}) + {:ok, activity} = CommonAPI.post(muted, %{status: "Hi @#{muter.nickname}"}) assert Notification.create_notification(activity, muter) end @@ -134,13 +221,13 @@ test "notification created if user is muted without notifications" do test "it creates a notification for an activity from a muted thread" do muter = insert(:user) other_user = insert(:user) - {:ok, activity} = CommonAPI.post(muter, %{"status" => "hey"}) + {:ok, activity} = CommonAPI.post(muter, %{status: "hey"}) CommonAPI.add_mute(muter, activity) {:ok, activity} = CommonAPI.post(other_user, %{ - "status" => "Hi @#{muter.nickname}", - "in_reply_to_status_id" => activity.id + status: "Hi @#{muter.nickname}", + in_reply_to_status_id: activity.id }) assert Notification.create_notification(activity, muter) @@ -153,7 +240,7 @@ test "it disables notifications from followers" do insert(:user, notification_settings: %Pleroma.User.NotificationSetting{followers: false}) User.follow(follower, followed) - {:ok, activity} = CommonAPI.post(follower, %{"status" => "hey @#{followed.nickname}"}) + {:ok, activity} = CommonAPI.post(follower, %{status: "hey @#{followed.nickname}"}) refute Notification.create_notification(activity, followed) end @@ -165,7 +252,7 @@ test "it disables notifications from non-followers" do notification_settings: %Pleroma.User.NotificationSetting{non_followers: false} ) - {:ok, activity} = CommonAPI.post(follower, %{"status" => "hey @#{followed.nickname}"}) + {:ok, activity} = CommonAPI.post(follower, %{status: "hey @#{followed.nickname}"}) refute Notification.create_notification(activity, followed) end @@ -176,7 +263,7 @@ test "it disables notifications from people the user follows" do followed = insert(:user) User.follow(follower, followed) follower = Repo.get(User, follower.id) - {:ok, activity} = CommonAPI.post(followed, %{"status" => "hey @#{follower.nickname}"}) + {:ok, activity} = CommonAPI.post(followed, %{status: "hey @#{follower.nickname}"}) refute Notification.create_notification(activity, follower) end @@ -185,7 +272,7 @@ test "it disables notifications from people the user does not follow" do insert(:user, notification_settings: %Pleroma.User.NotificationSetting{non_follows: false}) followed = insert(:user) - {:ok, activity} = CommonAPI.post(followed, %{"status" => "hey @#{follower.nickname}"}) + {:ok, activity} = CommonAPI.post(followed, %{status: "hey @#{follower.nickname}"}) refute Notification.create_notification(activity, follower) end @@ -196,23 +283,13 @@ test "it doesn't create a notification for user if he is the activity author" do refute Notification.create_notification(activity, author) end - test "it doesn't create a notification for follow-unfollow-follow chains" do - user = insert(:user) - followed_user = insert(:user) - {:ok, _, _, activity} = CommonAPI.follow(user, followed_user) - Notification.create_notification(activity, followed_user) - CommonAPI.unfollow(user, followed_user) - {:ok, _, _, activity_dupe} = CommonAPI.follow(user, followed_user) - refute Notification.create_notification(activity_dupe, followed_user) - end - test "it doesn't create duplicate notifications for follow+subscribed users" do user = insert(:user) subscriber = insert(:user) {:ok, _, _, _} = CommonAPI.follow(subscriber, user) User.subscribe(subscriber, user) - {:ok, status} = CommonAPI.post(user, %{"status" => "Akariiiin"}) + {:ok, status} = CommonAPI.post(user, %{status: "Akariiiin"}) {:ok, [_notif]} = Notification.create_notifications(status) end @@ -222,18 +299,78 @@ test "it doesn't create subscription notifications if the recipient cannot see t User.subscribe(subscriber, user) - {:ok, status} = CommonAPI.post(user, %{"status" => "inwisible", "visibility" => "direct"}) + {:ok, status} = CommonAPI.post(user, %{status: "inwisible", visibility: "direct"}) assert {:ok, []} == Notification.create_notifications(status) end end + describe "follow / follow_request notifications" do + test "it creates `follow` notification for approved Follow activity" do + user = insert(:user) + followed_user = insert(:user, locked: false) + + {:ok, _, _, _activity} = CommonAPI.follow(user, followed_user) + assert FollowingRelationship.following?(user, followed_user) + assert [notification] = Notification.for_user(followed_user) + + assert %{type: "follow"} = + NotificationView.render("show.json", %{ + notification: notification, + for: followed_user + }) + end + + test "it creates `follow_request` notification for pending Follow activity" do + user = insert(:user) + followed_user = insert(:user, locked: true) + + {:ok, _, _, _activity} = CommonAPI.follow(user, followed_user) + refute FollowingRelationship.following?(user, followed_user) + assert [notification] = Notification.for_user(followed_user) + + render_opts = %{notification: notification, for: followed_user} + assert %{type: "follow_request"} = NotificationView.render("show.json", render_opts) + + # After request is accepted, the same notification is rendered with type "follow": + assert {:ok, _} = CommonAPI.accept_follow_request(user, followed_user) + + notification_id = notification.id + assert [%{id: ^notification_id}] = Notification.for_user(followed_user) + assert %{type: "follow"} = NotificationView.render("show.json", render_opts) + end + + test "it doesn't create a notification for follow-unfollow-follow chains" do + user = insert(:user) + followed_user = insert(:user, locked: false) + + {:ok, _, _, _activity} = CommonAPI.follow(user, followed_user) + assert FollowingRelationship.following?(user, followed_user) + assert [notification] = Notification.for_user(followed_user) + + CommonAPI.unfollow(user, followed_user) + {:ok, _, _, _activity_dupe} = CommonAPI.follow(user, followed_user) + + notification_id = notification.id + assert [%{id: ^notification_id}] = Notification.for_user(followed_user) + end + + test "dismisses the notification on follow request rejection" do + user = insert(:user, locked: true) + follower = insert(:user) + {:ok, _, _, _follow_activity} = CommonAPI.follow(follower, user) + assert [notification] = Notification.for_user(user) + {:ok, _follower} = CommonAPI.reject_follow_request(follower, user) + assert [] = Notification.for_user(user) + end + end + describe "get notification" do test "it gets a notification that belongs to the user" do user = insert(:user) other_user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "hey @#{other_user.nickname}"}) + {:ok, activity} = CommonAPI.post(user, %{status: "hey @#{other_user.nickname}"}) {:ok, [notification]} = Notification.create_notifications(activity) {:ok, notification} = Notification.get(other_user, notification.id) @@ -245,7 +382,7 @@ test "it returns error if the notification doesn't belong to the user" do user = insert(:user) other_user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "hey @#{other_user.nickname}"}) + {:ok, activity} = CommonAPI.post(user, %{status: "hey @#{other_user.nickname}"}) {:ok, [notification]} = Notification.create_notifications(activity) {:error, _notification} = Notification.get(user, notification.id) @@ -257,7 +394,7 @@ test "it dismisses a notification that belongs to the user" do user = insert(:user) other_user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "hey @#{other_user.nickname}"}) + {:ok, activity} = CommonAPI.post(user, %{status: "hey @#{other_user.nickname}"}) {:ok, [notification]} = Notification.create_notifications(activity) {:ok, notification} = Notification.dismiss(other_user, notification.id) @@ -269,7 +406,7 @@ test "it returns error if the notification doesn't belong to the user" do user = insert(:user) other_user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "hey @#{other_user.nickname}"}) + {:ok, activity} = CommonAPI.post(user, %{status: "hey @#{other_user.nickname}"}) {:ok, [notification]} = Notification.create_notifications(activity) {:error, _notification} = Notification.dismiss(user, notification.id) @@ -284,14 +421,14 @@ test "it clears all notifications belonging to the user" do {:ok, activity} = CommonAPI.post(user, %{ - "status" => "hey @#{other_user.nickname} and @#{third_user.nickname} !" + status: "hey @#{other_user.nickname} and @#{third_user.nickname} !" }) {:ok, _notifs} = Notification.create_notifications(activity) {:ok, activity} = CommonAPI.post(user, %{ - "status" => "hey again @#{other_user.nickname} and @#{third_user.nickname} !" + status: "hey again @#{other_user.nickname} and @#{third_user.nickname} !" }) {:ok, _notifs} = Notification.create_notifications(activity) @@ -309,12 +446,12 @@ test "it sets all notifications as read up to a specified notification ID" do {:ok, _activity} = CommonAPI.post(user, %{ - "status" => "hey @#{other_user.nickname}!" + status: "hey @#{other_user.nickname}!" }) {:ok, _activity} = CommonAPI.post(user, %{ - "status" => "hey again @#{other_user.nickname}!" + status: "hey again @#{other_user.nickname}!" }) [n2, n1] = notifs = Notification.for_user(other_user) @@ -324,7 +461,7 @@ test "it sets all notifications as read up to a specified notification ID" do {:ok, _activity} = CommonAPI.post(user, %{ - "status" => "hey yet again @#{other_user.nickname}!" + status: "hey yet again @#{other_user.nickname}!" }) Notification.set_read_up_to(other_user, n2.id) @@ -334,6 +471,16 @@ test "it sets all notifications as read up to a specified notification ID" do assert n1.seen == true assert n2.seen == true assert n3.seen == false + + assert %Pleroma.Marker{} = + m = + Pleroma.Repo.get_by( + Pleroma.Marker, + user_id: other_user.id, + timeline: "notifications" + ) + + assert m.last_read_id == to_string(n2.id) end end @@ -353,7 +500,7 @@ test "Returns recent notifications" do Enum.each(0..10, fn i -> {:ok, _activity} = CommonAPI.post(user1, %{ - "status" => "hey ##{i} @#{user2.nickname}!" + status: "hey ##{i} @#{user2.nickname}!" }) end) @@ -382,17 +529,19 @@ test "Returns recent notifications" do end end - describe "notification target determination" do + describe "notification target determination / get_notified_from_activity/2" do test "it sends notifications to addressed users in new messages" do user = insert(:user) other_user = insert(:user) {:ok, activity} = CommonAPI.post(user, %{ - "status" => "hey @#{other_user.nickname}!" + status: "hey @#{other_user.nickname}!" }) - assert other_user in Notification.get_notified_from_activity(activity) + {enabled_receivers, _disabled_receivers} = Notification.get_notified_from_activity(activity) + + assert other_user in enabled_receivers end test "it sends notifications to mentioned users in new messages" do @@ -420,7 +569,9 @@ test "it sends notifications to mentioned users in new messages" do {:ok, activity} = Transmogrifier.handle_incoming(create_activity) - assert other_user in Notification.get_notified_from_activity(activity) + {enabled_receivers, _disabled_receivers} = Notification.get_notified_from_activity(activity) + + assert other_user in enabled_receivers end test "it does not send notifications to users who are only cc in new messages" do @@ -442,7 +593,9 @@ test "it does not send notifications to users who are only cc in new messages" d {:ok, activity} = Transmogrifier.handle_incoming(create_activity) - assert other_user not in Notification.get_notified_from_activity(activity) + {enabled_receivers, _disabled_receivers} = Notification.get_notified_from_activity(activity) + + assert other_user not in enabled_receivers end test "it does not send notification to mentioned users in likes" do @@ -452,12 +605,37 @@ test "it does not send notification to mentioned users in likes" do {:ok, activity_one} = CommonAPI.post(user, %{ - "status" => "hey @#{other_user.nickname}!" + status: "hey @#{other_user.nickname}!" }) - {:ok, activity_two, _} = CommonAPI.favorite(activity_one.id, third_user) + {:ok, activity_two} = CommonAPI.favorite(third_user, activity_one.id) - assert other_user not in Notification.get_notified_from_activity(activity_two) + {enabled_receivers, _disabled_receivers} = + Notification.get_notified_from_activity(activity_two) + + assert other_user not in enabled_receivers + end + + test "it only notifies the post's author in likes" do + user = insert(:user) + other_user = insert(:user) + third_user = insert(:user) + + {:ok, activity_one} = + CommonAPI.post(user, %{ + status: "hey @#{other_user.nickname}!" + }) + + {:ok, like_data, _} = Builder.like(third_user, activity_one.object) + + {:ok, like, _} = + like_data + |> Map.put("to", [other_user.ap_id | like_data["to"]]) + |> ActivityPub.persist(local: true) + + {enabled_receivers, _disabled_receivers} = Notification.get_notified_from_activity(like) + + assert other_user not in enabled_receivers end test "it does not send notification to mentioned users in announces" do @@ -467,12 +645,93 @@ test "it does not send notification to mentioned users in announces" do {:ok, activity_one} = CommonAPI.post(user, %{ - "status" => "hey @#{other_user.nickname}!" + status: "hey @#{other_user.nickname}!" }) {:ok, activity_two, _} = CommonAPI.repeat(activity_one.id, third_user) - assert other_user not in Notification.get_notified_from_activity(activity_two) + {enabled_receivers, _disabled_receivers} = + Notification.get_notified_from_activity(activity_two) + + assert other_user not in enabled_receivers + end + + test "it returns blocking recipient in disabled recipients list" do + user = insert(:user) + other_user = insert(:user) + {:ok, _user_relationship} = User.block(other_user, user) + + {:ok, activity} = CommonAPI.post(user, %{status: "hey @#{other_user.nickname}!"}) + + {enabled_receivers, disabled_receivers} = Notification.get_notified_from_activity(activity) + + assert [] == enabled_receivers + assert [other_user] == disabled_receivers + end + + test "it returns notification-muting recipient in disabled recipients list" do + user = insert(:user) + other_user = insert(:user) + {:ok, _user_relationships} = User.mute(other_user, user) + + {:ok, activity} = CommonAPI.post(user, %{status: "hey @#{other_user.nickname}!"}) + + {enabled_receivers, disabled_receivers} = Notification.get_notified_from_activity(activity) + + assert [] == enabled_receivers + assert [other_user] == disabled_receivers + end + + test "it returns thread-muting recipient in disabled recipients list" do + user = insert(:user) + other_user = insert(:user) + + {:ok, activity} = CommonAPI.post(user, %{status: "hey @#{other_user.nickname}!"}) + + {:ok, _} = CommonAPI.add_mute(other_user, activity) + + {:ok, same_context_activity} = + CommonAPI.post(user, %{ + status: "hey-hey-hey @#{other_user.nickname}!", + in_reply_to_status_id: activity.id + }) + + {enabled_receivers, disabled_receivers} = + Notification.get_notified_from_activity(same_context_activity) + + assert [other_user] == disabled_receivers + refute other_user in enabled_receivers + end + + test "it returns non-following domain-blocking recipient in disabled recipients list" do + blocked_domain = "blocked.domain" + user = insert(:user, %{ap_id: "https://#{blocked_domain}/@actor"}) + other_user = insert(:user) + + {:ok, other_user} = User.block_domain(other_user, blocked_domain) + + {:ok, activity} = CommonAPI.post(user, %{status: "hey @#{other_user.nickname}!"}) + + {enabled_receivers, disabled_receivers} = Notification.get_notified_from_activity(activity) + + assert [] == enabled_receivers + assert [other_user] == disabled_receivers + end + + test "it returns following domain-blocking recipient in enabled recipients list" do + blocked_domain = "blocked.domain" + user = insert(:user, %{ap_id: "https://#{blocked_domain}/@actor"}) + other_user = insert(:user) + + {:ok, other_user} = User.block_domain(other_user, blocked_domain) + {:ok, other_user} = User.follow(other_user, user) + + {:ok, activity} = CommonAPI.post(user, %{status: "hey @#{other_user.nickname}!"}) + + {enabled_receivers, disabled_receivers} = Notification.get_notified_from_activity(activity) + + assert [other_user] == enabled_receivers + assert [] == disabled_receivers end end @@ -481,11 +740,11 @@ test "liking an activity results in 1 notification, then 0 if the activity is de user = insert(:user) other_user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "test post"}) + {:ok, activity} = CommonAPI.post(user, %{status: "test post"}) assert Enum.empty?(Notification.for_user(user)) - {:ok, _, _} = CommonAPI.favorite(activity.id, other_user) + {:ok, _} = CommonAPI.favorite(other_user, activity.id) assert length(Notification.for_user(user)) == 1 @@ -498,15 +757,15 @@ test "liking an activity results in 1 notification, then 0 if the activity is un user = insert(:user) other_user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "test post"}) + {:ok, activity} = CommonAPI.post(user, %{status: "test post"}) assert Enum.empty?(Notification.for_user(user)) - {:ok, _, _} = CommonAPI.favorite(activity.id, other_user) + {:ok, _} = CommonAPI.favorite(other_user, activity.id) assert length(Notification.for_user(user)) == 1 - {:ok, _, _, _} = CommonAPI.unfavorite(activity.id, other_user) + {:ok, _} = CommonAPI.unfavorite(activity.id, other_user) assert Enum.empty?(Notification.for_user(user)) end @@ -515,7 +774,7 @@ test "repeating an activity results in 1 notification, then 0 if the activity is user = insert(:user) other_user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "test post"}) + {:ok, activity} = CommonAPI.post(user, %{status: "test post"}) assert Enum.empty?(Notification.for_user(user)) @@ -532,7 +791,7 @@ test "repeating an activity results in 1 notification, then 0 if the activity is user = insert(:user) other_user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "test post"}) + {:ok, activity} = CommonAPI.post(user, %{status: "test post"}) assert Enum.empty?(Notification.for_user(user)) @@ -540,7 +799,7 @@ test "repeating an activity results in 1 notification, then 0 if the activity is assert length(Notification.for_user(user)) == 1 - {:ok, _, _} = CommonAPI.unrepeat(activity.id, other_user) + {:ok, _} = CommonAPI.unrepeat(activity.id, other_user) assert Enum.empty?(Notification.for_user(user)) end @@ -549,7 +808,7 @@ test "liking an activity which is already deleted does not generate a notificati user = insert(:user) other_user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "test post"}) + {:ok, activity} = CommonAPI.post(user, %{status: "test post"}) assert Enum.empty?(Notification.for_user(user)) @@ -557,7 +816,7 @@ test "liking an activity which is already deleted does not generate a notificati assert Enum.empty?(Notification.for_user(user)) - {:error, _} = CommonAPI.favorite(activity.id, other_user) + {:error, :not_found} = CommonAPI.favorite(other_user, activity.id) assert Enum.empty?(Notification.for_user(user)) end @@ -566,7 +825,7 @@ test "repeating an activity which is already deleted does not generate a notific user = insert(:user) other_user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "test post"}) + {:ok, activity} = CommonAPI.post(user, %{status: "test post"}) assert Enum.empty?(Notification.for_user(user)) @@ -583,13 +842,13 @@ test "replying to a deleted post without tagging does not generate a notificatio user = insert(:user) other_user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "test post"}) + {:ok, activity} = CommonAPI.post(user, %{status: "test post"}) {:ok, _deletion_activity} = CommonAPI.delete(activity.id, user) {:ok, _reply_activity} = CommonAPI.post(other_user, %{ - "status" => "test reply", - "in_reply_to_status_id" => activity.id + status: "test reply", + in_reply_to_status_id: activity.id }) assert Enum.empty?(Notification.for_user(user)) @@ -600,7 +859,7 @@ test "notifications are deleted if a local user is deleted" do other_user = insert(:user) {:ok, _activity} = - CommonAPI.post(user, %{"status" => "hi @#{other_user.nickname}", "visibility" => "direct"}) + CommonAPI.post(user, %{status: "hi @#{other_user.nickname}", visibility: "direct"}) refute Enum.empty?(Notification.for_user(other_user)) @@ -649,12 +908,20 @@ test "notifications are deleted if a remote user is deleted" do "object" => remote_user.ap_id } + remote_user_url = remote_user.ap_id + + Tesla.Mock.mock(fn + %{method: :get, url: ^remote_user_url} -> + %Tesla.Env{status: 404, body: ""} + end) + {:ok, _delete_activity} = Transmogrifier.handle_incoming(delete_user_message) ObanHelpers.perform_all() assert Enum.empty?(Notification.for_user(local_user)) end + @tag capture_log: true test "move activity generates a notification" do %{ap_id: old_ap_id} = old_user = insert(:user) %{ap_id: new_ap_id} = new_user = insert(:user, also_known_as: [old_ap_id]) @@ -664,6 +931,18 @@ test "move activity generates a notification" do User.follow(follower, old_user) User.follow(other_follower, old_user) + old_user_url = old_user.ap_id + + body = + File.read!("test/fixtures/users_mock/localhost.json") + |> String.replace("{{nickname}}", old_user.nickname) + |> Jason.encode!() + + Tesla.Mock.mock(fn + %{method: :get, url: ^old_user_url} -> + %Tesla.Env{status: 200, body: body} + end) + Pleroma.Web.ActivityPub.ActivityPub.move(old_user, new_user) ObanHelpers.perform_all() @@ -691,7 +970,7 @@ test "it returns notifications for muted user without notifications" do muted = insert(:user) {:ok, _user_relationships} = User.mute(user, muted, false) - {:ok, _activity} = CommonAPI.post(muted, %{"status" => "hey @#{user.nickname}"}) + {:ok, _activity} = CommonAPI.post(muted, %{status: "hey @#{user.nickname}"}) assert length(Notification.for_user(user)) == 1 end @@ -701,7 +980,7 @@ test "it doesn't return notifications for muted user with notifications" do muted = insert(:user) {:ok, _user_relationships} = User.mute(user, muted) - {:ok, _activity} = CommonAPI.post(muted, %{"status" => "hey @#{user.nickname}"}) + {:ok, _activity} = CommonAPI.post(muted, %{status: "hey @#{user.nickname}"}) assert Notification.for_user(user) == [] end @@ -711,26 +990,38 @@ test "it doesn't return notifications for blocked user" do blocked = insert(:user) {:ok, _user_relationship} = User.block(user, blocked) - {:ok, _activity} = CommonAPI.post(blocked, %{"status" => "hey @#{user.nickname}"}) + {:ok, _activity} = CommonAPI.post(blocked, %{status: "hey @#{user.nickname}"}) assert Notification.for_user(user) == [] end - test "it doesn't return notificatitons for blocked domain" do + test "it doesn't return notifications for domain-blocked non-followed user" do user = insert(:user) blocked = insert(:user, ap_id: "http://some-domain.com") {:ok, user} = User.block_domain(user, "some-domain.com") - {:ok, _activity} = CommonAPI.post(blocked, %{"status" => "hey @#{user.nickname}"}) + {:ok, _activity} = CommonAPI.post(blocked, %{status: "hey @#{user.nickname}"}) assert Notification.for_user(user) == [] end + test "it returns notifications for domain-blocked but followed user" do + user = insert(:user) + blocked = insert(:user, ap_id: "http://some-domain.com") + + {:ok, user} = User.block_domain(user, "some-domain.com") + {:ok, _} = User.follow(user, blocked) + + {:ok, _activity} = CommonAPI.post(blocked, %{status: "hey @#{user.nickname}"}) + + assert length(Notification.for_user(user)) == 1 + end + test "it doesn't return notifications for muted thread" do user = insert(:user) another_user = insert(:user) - {:ok, activity} = CommonAPI.post(another_user, %{"status" => "hey @#{user.nickname}"}) + {:ok, activity} = CommonAPI.post(another_user, %{status: "hey @#{user.nickname}"}) {:ok, _} = Pleroma.ThreadMute.add_mute(user.id, activity.data["context"]) assert Notification.for_user(user) == [] @@ -741,7 +1032,7 @@ test "it returns notifications from a muted user when with_muted is set" do muted = insert(:user) {:ok, _user_relationships} = User.mute(user, muted) - {:ok, _activity} = CommonAPI.post(muted, %{"status" => "hey @#{user.nickname}"}) + {:ok, _activity} = CommonAPI.post(muted, %{status: "hey @#{user.nickname}"}) assert length(Notification.for_user(user, %{with_muted: true})) == 1 end @@ -751,17 +1042,18 @@ test "it doesn't return notifications from a blocked user when with_muted is set blocked = insert(:user) {:ok, _user_relationship} = User.block(user, blocked) - {:ok, _activity} = CommonAPI.post(blocked, %{"status" => "hey @#{user.nickname}"}) + {:ok, _activity} = CommonAPI.post(blocked, %{status: "hey @#{user.nickname}"}) assert Enum.empty?(Notification.for_user(user, %{with_muted: true})) end - test "it doesn't return notifications from a domain-blocked user when with_muted is set" do + test "when with_muted is set, " <> + "it doesn't return notifications from a domain-blocked non-followed user" do user = insert(:user) blocked = insert(:user, ap_id: "http://some-domain.com") {:ok, user} = User.block_domain(user, "some-domain.com") - {:ok, _activity} = CommonAPI.post(blocked, %{"status" => "hey @#{user.nickname}"}) + {:ok, _activity} = CommonAPI.post(blocked, %{status: "hey @#{user.nickname}"}) assert Enum.empty?(Notification.for_user(user, %{with_muted: true})) end @@ -770,7 +1062,7 @@ test "it returns notifications from muted threads when with_muted is set" do user = insert(:user) another_user = insert(:user) - {:ok, activity} = CommonAPI.post(another_user, %{"status" => "hey @#{user.nickname}"}) + {:ok, activity} = CommonAPI.post(another_user, %{status: "hey @#{user.nickname}"}) {:ok, _} = Pleroma.ThreadMute.add_mute(user.id, activity.data["context"]) assert length(Notification.for_user(user, %{with_muted: true})) == 1 diff --git a/test/object_test.exs b/test/object_test.exs index fe583decd..198d3b1cf 100644 --- a/test/object_test.exs +++ b/test/object_test.exs @@ -380,7 +380,8 @@ test "preserves internal fields on refetch", %{mock_modified: mock_modified} do user = insert(:user) activity = Activity.get_create_by_object_ap_id(object.data["id"]) - {:ok, _activity, object} = CommonAPI.favorite(activity.id, user) + {:ok, activity} = CommonAPI.favorite(user, activity.id) + object = Object.get_by_ap_id(activity.data["object"]) assert object.data["like_count"] == 1 diff --git a/test/otp_version_test.exs b/test/otp_version_test.exs new file mode 100644 index 000000000..7d2538ec8 --- /dev/null +++ b/test/otp_version_test.exs @@ -0,0 +1,42 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.OTPVersionTest do + use ExUnit.Case, async: true + + alias Pleroma.OTPVersion + + describe "check/1" do + test "22.4" do + assert OTPVersion.get_version_from_files(["test/fixtures/warnings/otp_version/22.4"]) == + "22.4" + end + + test "22.1" do + assert OTPVersion.get_version_from_files(["test/fixtures/warnings/otp_version/22.1"]) == + "22.1" + end + + test "21.1" do + assert OTPVersion.get_version_from_files(["test/fixtures/warnings/otp_version/21.1"]) == + "21.1" + end + + test "23.0" do + assert OTPVersion.get_version_from_files(["test/fixtures/warnings/otp_version/23.0"]) == + "23.0" + end + + test "with non existance file" do + assert OTPVersion.get_version_from_files([ + "test/fixtures/warnings/otp_version/non-exising", + "test/fixtures/warnings/otp_version/22.4" + ]) == "22.4" + end + + test "empty paths" do + assert OTPVersion.get_version_from_files([]) == nil + end + end +end diff --git a/test/plugs/authentication_plug_test.exs b/test/plugs/authentication_plug_test.exs index ae2f3f8ec..c8ede71c0 100644 --- a/test/plugs/authentication_plug_test.exs +++ b/test/plugs/authentication_plug_test.exs @@ -6,6 +6,8 @@ defmodule Pleroma.Plugs.AuthenticationPlugTest do use Pleroma.Web.ConnCase, async: true alias Pleroma.Plugs.AuthenticationPlug + alias Pleroma.Plugs.OAuthScopesPlug + alias Pleroma.Plugs.PlugHelper alias Pleroma.User import ExUnit.CaptureLog @@ -14,7 +16,7 @@ defmodule Pleroma.Plugs.AuthenticationPlugTest do user = %User{ id: 1, name: "dude", - password_hash: Comeonin.Pbkdf2.hashpwsalt("guy") + password_hash: Pbkdf2.hash_pwd_salt("guy") } conn = @@ -36,13 +38,16 @@ test "it does nothing if a user is assigned", %{conn: conn} do assert ret_conn == conn end - test "with a correct password in the credentials, it assigns the auth_user", %{conn: conn} do + test "with a correct password in the credentials, " <> + "it assigns the auth_user and marks OAuthScopesPlug as skipped", + %{conn: conn} do conn = conn |> assign(:auth_credentials, %{password: "guy"}) |> AuthenticationPlug.call(%{}) assert conn.assigns.user == conn.assigns.auth_user + assert PlugHelper.plug_skipped?(conn, OAuthScopesPlug) end test "with a wrong password in the credentials, it does nothing", %{conn: conn} do @@ -74,6 +79,13 @@ test "check sha512-crypt hash" do assert AuthenticationPlug.checkpw("password", hash) end + test "check bcrypt hash" do + hash = "$2a$10$uyhC/R/zoE1ndwwCtMusK.TLVzkQ/Ugsbqp3uXI.CTTz0gBw.24jS" + + assert AuthenticationPlug.checkpw("password", hash) + refute AuthenticationPlug.checkpw("password1", hash) + end + test "it returns false when hash invalid" do hash = "psBWV8gxkGOZWBz$PmfCycChoxeJ3GgGzwvhlgacb9mUoZ.KUXNCssekER4SJ7bOK53uXrHNb2e4i8yPFgSKyzaW9CcmrDXWIEMtD1" diff --git a/test/plugs/ensure_authenticated_plug_test.exs b/test/plugs/ensure_authenticated_plug_test.exs index 7f3559b83..a0667c5e0 100644 --- a/test/plugs/ensure_authenticated_plug_test.exs +++ b/test/plugs/ensure_authenticated_plug_test.exs @@ -20,34 +20,61 @@ test "it continues if a user is assigned", %{conn: conn} do conn = assign(conn, :user, %User{}) ret_conn = EnsureAuthenticatedPlug.call(conn, %{}) - assert ret_conn == conn + refute ret_conn.halted end end + test "it halts if user is assigned and MFA enabled", %{conn: conn} do + conn = + conn + |> assign(:user, %User{multi_factor_authentication_settings: %{enabled: true}}) + |> assign(:auth_credentials, %{password: "xd-42"}) + |> EnsureAuthenticatedPlug.call(%{}) + + assert conn.status == 403 + assert conn.halted == true + + assert conn.resp_body == + "{\"error\":\"Two-factor authentication enabled, you must use a access token.\"}" + end + + test "it continues if user is assigned and MFA disabled", %{conn: conn} do + conn = + conn + |> assign(:user, %User{multi_factor_authentication_settings: %{enabled: false}}) + |> assign(:auth_credentials, %{password: "xd-42"}) + |> EnsureAuthenticatedPlug.call(%{}) + + refute conn.status == 403 + refute conn.halted + end + describe "with :if_func / :unless_func options" do setup do %{ - true_fn: fn -> true end, - false_fn: fn -> false end + true_fn: fn _conn -> true end, + false_fn: fn _conn -> false end } end test "it continues if a user is assigned", %{conn: conn, true_fn: true_fn, false_fn: false_fn} do conn = assign(conn, :user, %User{}) - assert EnsureAuthenticatedPlug.call(conn, if_func: true_fn) == conn - assert EnsureAuthenticatedPlug.call(conn, if_func: false_fn) == conn - assert EnsureAuthenticatedPlug.call(conn, unless_func: true_fn) == conn - assert EnsureAuthenticatedPlug.call(conn, unless_func: false_fn) == conn + refute EnsureAuthenticatedPlug.call(conn, if_func: true_fn).halted + refute EnsureAuthenticatedPlug.call(conn, if_func: false_fn).halted + refute EnsureAuthenticatedPlug.call(conn, unless_func: true_fn).halted + refute EnsureAuthenticatedPlug.call(conn, unless_func: false_fn).halted end test "it continues if a user is NOT assigned but :if_func evaluates to `false`", %{conn: conn, false_fn: false_fn} do - assert EnsureAuthenticatedPlug.call(conn, if_func: false_fn) == conn + ret_conn = EnsureAuthenticatedPlug.call(conn, if_func: false_fn) + refute ret_conn.halted end test "it continues if a user is NOT assigned but :unless_func evaluates to `true`", %{conn: conn, true_fn: true_fn} do - assert EnsureAuthenticatedPlug.call(conn, unless_func: true_fn) == conn + ret_conn = EnsureAuthenticatedPlug.call(conn, unless_func: true_fn) + refute ret_conn.halted end test "it halts if a user is NOT assigned and :if_func evaluates to `true`", diff --git a/test/plugs/ensure_public_or_authenticated_plug_test.exs b/test/plugs/ensure_public_or_authenticated_plug_test.exs index 411252274..fc2934369 100644 --- a/test/plugs/ensure_public_or_authenticated_plug_test.exs +++ b/test/plugs/ensure_public_or_authenticated_plug_test.exs @@ -29,7 +29,7 @@ test "it continues if public", %{conn: conn} do conn |> EnsurePublicOrAuthenticatedPlug.call(%{}) - assert ret_conn == conn + refute ret_conn.halted end test "it continues if a user is assigned, even if not public", %{conn: conn} do @@ -43,6 +43,6 @@ test "it continues if a user is assigned, even if not public", %{conn: conn} do conn |> EnsurePublicOrAuthenticatedPlug.call(%{}) - assert ret_conn == conn + refute ret_conn.halted end end diff --git a/test/plugs/legacy_authentication_plug_test.exs b/test/plugs/legacy_authentication_plug_test.exs index 7559de7d3..3b8c07627 100644 --- a/test/plugs/legacy_authentication_plug_test.exs +++ b/test/plugs/legacy_authentication_plug_test.exs @@ -8,6 +8,8 @@ defmodule Pleroma.Plugs.LegacyAuthenticationPlugTest do import Pleroma.Factory alias Pleroma.Plugs.LegacyAuthenticationPlug + alias Pleroma.Plugs.OAuthScopesPlug + alias Pleroma.Plugs.PlugHelper alias Pleroma.User setup do @@ -36,7 +38,8 @@ test "it does nothing if a user is assigned", %{conn: conn, user: user} do end @tag :skip_on_mac - test "it authenticates the auth_user if present and password is correct and resets the password", + test "if `auth_user` is present and password is correct, " <> + "it authenticates the user, resets the password, marks OAuthScopesPlug as skipped", %{ conn: conn, user: user @@ -49,6 +52,7 @@ test "it authenticates the auth_user if present and password is correct and rese conn = LegacyAuthenticationPlug.call(conn, %{}) assert conn.assigns.user.id == user.id + assert PlugHelper.plug_skipped?(conn, OAuthScopesPlug) end @tag :skip_on_mac diff --git a/test/plugs/oauth_scopes_plug_test.exs b/test/plugs/oauth_scopes_plug_test.exs index e79ecf263..884de7b4d 100644 --- a/test/plugs/oauth_scopes_plug_test.exs +++ b/test/plugs/oauth_scopes_plug_test.exs @@ -5,15 +5,22 @@ defmodule Pleroma.Plugs.OAuthScopesPlugTest do use Pleroma.Web.ConnCase, async: true - alias Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug alias Pleroma.Plugs.OAuthScopesPlug alias Pleroma.Repo import Mock import Pleroma.Factory - setup_with_mocks([{EnsurePublicOrAuthenticatedPlug, [], [call: fn conn, _ -> conn end]}]) do - :ok + test "is not performed if marked as skipped", %{conn: conn} do + with_mock OAuthScopesPlug, [:passthrough], perform: &passthrough([&1, &2]) do + conn = + conn + |> OAuthScopesPlug.skip_plug() + |> OAuthScopesPlug.call(%{scopes: ["random_scope"]}) + + refute called(OAuthScopesPlug.perform(:_, :_)) + refute conn.halted + end end test "if `token.scopes` fulfills specified 'any of' conditions, " <> @@ -48,7 +55,7 @@ test "if `token.scopes` fulfills specified 'all of' conditions, " <> describe "with `fallback: :proceed_unauthenticated` option, " do test "if `token.scopes` doesn't fulfill specified conditions, " <> - "clears :user and :token assigns and calls EnsurePublicOrAuthenticatedPlug", + "clears :user and :token assigns", %{conn: conn} do user = insert(:user) token1 = insert(:oauth_token, scopes: ["read", "write"], user: user) @@ -67,35 +74,6 @@ test "if `token.scopes` doesn't fulfill specified conditions, " <> refute ret_conn.halted refute ret_conn.assigns[:user] refute ret_conn.assigns[:token] - - assert called(EnsurePublicOrAuthenticatedPlug.call(ret_conn, :_)) - end - end - - test "with :skip_instance_privacy_check option, " <> - "if `token.scopes` doesn't fulfill specified conditions, " <> - "clears :user and :token assigns and does NOT call EnsurePublicOrAuthenticatedPlug", - %{conn: conn} do - user = insert(:user) - token1 = insert(:oauth_token, scopes: ["read:statuses", "write"], user: user) - - for token <- [token1, nil], op <- [:|, :&] do - ret_conn = - conn - |> assign(:user, user) - |> assign(:token, token) - |> OAuthScopesPlug.call(%{ - scopes: ["read"], - op: op, - fallback: :proceed_unauthenticated, - skip_instance_privacy_check: true - }) - - refute ret_conn.halted - refute ret_conn.assigns[:user] - refute ret_conn.assigns[:token] - - refute called(EnsurePublicOrAuthenticatedPlug.call(ret_conn, :_)) end end end diff --git a/test/plugs/rate_limiter_test.exs b/test/plugs/rate_limiter_test.exs index 0ce9f3a0a..4d3d694f4 100644 --- a/test/plugs/rate_limiter_test.exs +++ b/test/plugs/rate_limiter_test.exs @@ -5,8 +5,10 @@ defmodule Pleroma.Plugs.RateLimiterTest do use Pleroma.Web.ConnCase + alias Phoenix.ConnTest alias Pleroma.Config alias Pleroma.Plugs.RateLimiter + alias Plug.Conn import Pleroma.Factory import Pleroma.Tests.Helpers, only: [clear_config: 1, clear_config: 2] @@ -36,8 +38,15 @@ test "config is required for plug to work" do end test "it is disabled if it remote ip plug is enabled but no remote ip is found" do - Config.put([Pleroma.Web.Endpoint, :http, :ip], {127, 0, 0, 1}) - assert RateLimiter.disabled?(Plug.Conn.assign(build_conn(), :remote_ip_found, false)) + assert RateLimiter.disabled?(Conn.assign(build_conn(), :remote_ip_found, false)) + end + + test "it is enabled if remote ip found" do + refute RateLimiter.disabled?(Conn.assign(build_conn(), :remote_ip_found, true)) + end + + test "it is enabled if remote_ip_found flag doesn't exist" do + refute RateLimiter.disabled?(build_conn()) end test "it restricts based on config values" do @@ -58,7 +67,7 @@ test "it restricts based on config values" do end conn = RateLimiter.call(conn, plug_opts) - assert %{"error" => "Throttled"} = Phoenix.ConnTest.json_response(conn, :too_many_requests) + assert %{"error" => "Throttled"} = ConnTest.json_response(conn, :too_many_requests) assert conn.halted Process.sleep(50) @@ -68,7 +77,7 @@ test "it restricts based on config values" do conn = RateLimiter.call(conn, plug_opts) assert {1, 4} = RateLimiter.inspect_bucket(conn, limiter_name, plug_opts) - refute conn.status == Plug.Conn.Status.code(:too_many_requests) + refute conn.status == Conn.Status.code(:too_many_requests) refute conn.resp_body refute conn.halted end @@ -98,7 +107,7 @@ test "`params` option allows different queries to be tracked independently" do plug_opts = RateLimiter.init(name: limiter_name, params: ["id"]) conn = build_conn(:get, "/?id=1") - conn = Plug.Conn.fetch_query_params(conn) + conn = Conn.fetch_query_params(conn) conn_2 = build_conn(:get, "/?id=2") RateLimiter.call(conn, plug_opts) @@ -119,7 +128,7 @@ test "it supports combination of options modifying bucket name" do id = "100" conn = build_conn(:get, "/?id=#{id}") - conn = Plug.Conn.fetch_query_params(conn) + conn = Conn.fetch_query_params(conn) conn_2 = build_conn(:get, "/?id=#{101}") RateLimiter.call(conn, plug_opts) @@ -147,13 +156,13 @@ test "are restricted based on remote IP" do conn = RateLimiter.call(conn, plug_opts) - assert %{"error" => "Throttled"} = Phoenix.ConnTest.json_response(conn, :too_many_requests) + assert %{"error" => "Throttled"} = ConnTest.json_response(conn, :too_many_requests) assert conn.halted conn_2 = RateLimiter.call(conn_2, plug_opts) assert {1, 4} = RateLimiter.inspect_bucket(conn_2, limiter_name, plug_opts) - refute conn_2.status == Plug.Conn.Status.code(:too_many_requests) + refute conn_2.status == Conn.Status.code(:too_many_requests) refute conn_2.resp_body refute conn_2.halted end @@ -187,7 +196,7 @@ test "can have limits separate from unauthenticated connections" do conn = RateLimiter.call(conn, plug_opts) - assert %{"error" => "Throttled"} = Phoenix.ConnTest.json_response(conn, :too_many_requests) + assert %{"error" => "Throttled"} = ConnTest.json_response(conn, :too_many_requests) assert conn.halted end @@ -210,12 +219,12 @@ test "different users are counted independently" do end conn = RateLimiter.call(conn, plug_opts) - assert %{"error" => "Throttled"} = Phoenix.ConnTest.json_response(conn, :too_many_requests) + assert %{"error" => "Throttled"} = ConnTest.json_response(conn, :too_many_requests) assert conn.halted conn_2 = RateLimiter.call(conn_2, plug_opts) assert {1, 4} = RateLimiter.inspect_bucket(conn_2, limiter_name, plug_opts) - refute conn_2.status == Plug.Conn.Status.code(:too_many_requests) + refute conn_2.status == Conn.Status.code(:too_many_requests) refute conn_2.resp_body refute conn_2.halted end diff --git a/test/pool/connections_test.exs b/test/pool/connections_test.exs new file mode 100644 index 000000000..aeda54875 --- /dev/null +++ b/test/pool/connections_test.exs @@ -0,0 +1,760 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Pool.ConnectionsTest do + use ExUnit.Case, async: true + use Pleroma.Tests.Helpers + + import ExUnit.CaptureLog + import Mox + + alias Pleroma.Gun.Conn + alias Pleroma.GunMock + alias Pleroma.Pool.Connections + + setup :verify_on_exit! + + setup_all do + name = :test_connections + {:ok, pid} = Connections.start_link({name, [checkin_timeout: 150]}) + {:ok, _} = Registry.start_link(keys: :unique, name: Pleroma.GunMock) + + on_exit(fn -> + if Process.alive?(pid), do: GenServer.stop(name) + end) + + {:ok, name: name} + end + + defp open_mock(num \\ 1) do + GunMock + |> expect(:open, num, &start_and_register(&1, &2, &3)) + |> expect(:await_up, num, fn _, _ -> {:ok, :http} end) + |> expect(:set_owner, num, fn _, _ -> :ok end) + end + + defp connect_mock(mock) do + mock + |> expect(:connect, &connect(&1, &2)) + |> expect(:await, &await(&1, &2)) + end + + defp info_mock(mock), do: expect(mock, :info, &info(&1)) + + defp start_and_register('gun-not-up.com', _, _), do: {:error, :timeout} + + defp start_and_register(host, port, _) do + {:ok, pid} = Task.start_link(fn -> Process.sleep(1000) end) + + scheme = + case port do + 443 -> "https" + _ -> "http" + end + + Registry.register(GunMock, pid, %{ + origin_scheme: scheme, + origin_host: host, + origin_port: port + }) + + {:ok, pid} + end + + defp info(pid) do + [{_, info}] = Registry.lookup(GunMock, pid) + info + end + + defp connect(pid, _) do + ref = make_ref() + Registry.register(GunMock, ref, pid) + ref + end + + defp await(pid, ref) do + [{_, ^pid}] = Registry.lookup(GunMock, ref) + {:response, :fin, 200, []} + end + + defp now, do: :os.system_time(:second) + + describe "alive?/2" do + test "is alive", %{name: name} do + assert Connections.alive?(name) + end + + test "returns false if not started" do + refute Connections.alive?(:some_random_name) + end + end + + test "opens connection and reuse it on next request", %{name: name} do + open_mock() + url = "http://some-domain.com" + key = "http:some-domain.com:80" + refute Connections.checkin(url, name) + :ok = Conn.open(url, name) + + conn = Connections.checkin(url, name) + assert is_pid(conn) + assert Process.alive?(conn) + + self = self() + + %Connections{ + conns: %{ + ^key => %Conn{ + conn: ^conn, + gun_state: :up, + used_by: [{^self, _}], + conn_state: :active + } + } + } = Connections.get_state(name) + + reused_conn = Connections.checkin(url, name) + + assert conn == reused_conn + + %Connections{ + conns: %{ + ^key => %Conn{ + conn: ^conn, + gun_state: :up, + used_by: [{^self, _}, {^self, _}], + conn_state: :active + } + } + } = Connections.get_state(name) + + :ok = Connections.checkout(conn, self, name) + + %Connections{ + conns: %{ + ^key => %Conn{ + conn: ^conn, + gun_state: :up, + used_by: [{^self, _}], + conn_state: :active + } + } + } = Connections.get_state(name) + + :ok = Connections.checkout(conn, self, name) + + %Connections{ + conns: %{ + ^key => %Conn{ + conn: ^conn, + gun_state: :up, + used_by: [], + conn_state: :idle + } + } + } = Connections.get_state(name) + end + + test "reuse connection for idna domains", %{name: name} do + open_mock() + url = "http://ですsome-domain.com" + refute Connections.checkin(url, name) + + :ok = Conn.open(url, name) + + conn = Connections.checkin(url, name) + assert is_pid(conn) + assert Process.alive?(conn) + + self = self() + + %Connections{ + conns: %{ + "http:ですsome-domain.com:80" => %Conn{ + conn: ^conn, + gun_state: :up, + used_by: [{^self, _}], + conn_state: :active + } + } + } = Connections.get_state(name) + + reused_conn = Connections.checkin(url, name) + + assert conn == reused_conn + end + + test "reuse for ipv4", %{name: name} do + open_mock() + url = "http://127.0.0.1" + + refute Connections.checkin(url, name) + + :ok = Conn.open(url, name) + + conn = Connections.checkin(url, name) + assert is_pid(conn) + assert Process.alive?(conn) + + self = self() + + %Connections{ + conns: %{ + "http:127.0.0.1:80" => %Conn{ + conn: ^conn, + gun_state: :up, + used_by: [{^self, _}], + conn_state: :active + } + } + } = Connections.get_state(name) + + reused_conn = Connections.checkin(url, name) + + assert conn == reused_conn + + :ok = Connections.checkout(conn, self, name) + :ok = Connections.checkout(reused_conn, self, name) + + %Connections{ + conns: %{ + "http:127.0.0.1:80" => %Conn{ + conn: ^conn, + gun_state: :up, + used_by: [], + conn_state: :idle + } + } + } = Connections.get_state(name) + end + + test "reuse for ipv6", %{name: name} do + open_mock() + url = "http://[2a03:2880:f10c:83:face:b00c:0:25de]" + + refute Connections.checkin(url, name) + + :ok = Conn.open(url, name) + + conn = Connections.checkin(url, name) + assert is_pid(conn) + assert Process.alive?(conn) + + self = self() + + %Connections{ + conns: %{ + "http:2a03:2880:f10c:83:face:b00c:0:25de:80" => %Conn{ + conn: ^conn, + gun_state: :up, + used_by: [{^self, _}], + conn_state: :active + } + } + } = Connections.get_state(name) + + reused_conn = Connections.checkin(url, name) + + assert conn == reused_conn + end + + test "up and down ipv4", %{name: name} do + open_mock() + |> info_mock() + |> allow(self(), name) + + self = self() + url = "http://127.0.0.1" + :ok = Conn.open(url, name) + conn = Connections.checkin(url, name) + send(name, {:gun_down, conn, nil, nil, nil}) + send(name, {:gun_up, conn, nil}) + + %Connections{ + conns: %{ + "http:127.0.0.1:80" => %Conn{ + conn: ^conn, + gun_state: :up, + used_by: [{^self, _}], + conn_state: :active + } + } + } = Connections.get_state(name) + end + + test "up and down ipv6", %{name: name} do + self = self() + + open_mock() + |> info_mock() + |> allow(self, name) + + url = "http://[2a03:2880:f10c:83:face:b00c:0:25de]" + :ok = Conn.open(url, name) + conn = Connections.checkin(url, name) + send(name, {:gun_down, conn, nil, nil, nil}) + send(name, {:gun_up, conn, nil}) + + %Connections{ + conns: %{ + "http:2a03:2880:f10c:83:face:b00c:0:25de:80" => %Conn{ + conn: ^conn, + gun_state: :up, + used_by: [{^self, _}], + conn_state: :active + } + } + } = Connections.get_state(name) + end + + test "reuses connection based on protocol", %{name: name} do + open_mock(2) + http_url = "http://some-domain.com" + http_key = "http:some-domain.com:80" + https_url = "https://some-domain.com" + https_key = "https:some-domain.com:443" + + refute Connections.checkin(http_url, name) + :ok = Conn.open(http_url, name) + conn = Connections.checkin(http_url, name) + assert is_pid(conn) + assert Process.alive?(conn) + + refute Connections.checkin(https_url, name) + :ok = Conn.open(https_url, name) + https_conn = Connections.checkin(https_url, name) + + refute conn == https_conn + + reused_https = Connections.checkin(https_url, name) + + refute conn == reused_https + + assert reused_https == https_conn + + %Connections{ + conns: %{ + ^http_key => %Conn{ + conn: ^conn, + gun_state: :up + }, + ^https_key => %Conn{ + conn: ^https_conn, + gun_state: :up + } + } + } = Connections.get_state(name) + end + + test "connection can't get up", %{name: name} do + expect(GunMock, :open, &start_and_register(&1, &2, &3)) + url = "http://gun-not-up.com" + + assert capture_log(fn -> + refute Conn.open(url, name) + refute Connections.checkin(url, name) + end) =~ + "Opening connection to http://gun-not-up.com failed with error {:error, :timeout}" + end + + test "process gun_down message and then gun_up", %{name: name} do + self = self() + + open_mock() + |> info_mock() + |> allow(self, name) + + url = "http://gun-down-and-up.com" + key = "http:gun-down-and-up.com:80" + :ok = Conn.open(url, name) + conn = Connections.checkin(url, name) + + assert is_pid(conn) + assert Process.alive?(conn) + + %Connections{ + conns: %{ + ^key => %Conn{ + conn: ^conn, + gun_state: :up, + used_by: [{^self, _}] + } + } + } = Connections.get_state(name) + + send(name, {:gun_down, conn, :http, nil, nil}) + + %Connections{ + conns: %{ + ^key => %Conn{ + conn: ^conn, + gun_state: :down, + used_by: [{^self, _}] + } + } + } = Connections.get_state(name) + + send(name, {:gun_up, conn, :http}) + + conn2 = Connections.checkin(url, name) + assert conn == conn2 + + assert is_pid(conn2) + assert Process.alive?(conn2) + + %Connections{ + conns: %{ + ^key => %Conn{ + conn: _, + gun_state: :up, + used_by: [{^self, _}, {^self, _}] + } + } + } = Connections.get_state(name) + end + + test "async processes get same conn for same domain", %{name: name} do + open_mock() + url = "http://some-domain.com" + :ok = Conn.open(url, name) + + tasks = + for _ <- 1..5 do + Task.async(fn -> + Connections.checkin(url, name) + end) + end + + tasks_with_results = Task.yield_many(tasks) + + results = + Enum.map(tasks_with_results, fn {task, res} -> + res || Task.shutdown(task, :brutal_kill) + end) + + conns = for {:ok, value} <- results, do: value + + %Connections{ + conns: %{ + "http:some-domain.com:80" => %Conn{ + conn: conn, + gun_state: :up + } + } + } = Connections.get_state(name) + + assert Enum.all?(conns, fn res -> res == conn end) + end + + test "remove frequently used and idle", %{name: name} do + open_mock(3) + self = self() + http_url = "http://some-domain.com" + https_url = "https://some-domain.com" + :ok = Conn.open(https_url, name) + :ok = Conn.open(http_url, name) + + conn1 = Connections.checkin(https_url, name) + + [conn2 | _conns] = + for _ <- 1..4 do + Connections.checkin(http_url, name) + end + + http_key = "http:some-domain.com:80" + + %Connections{ + conns: %{ + ^http_key => %Conn{ + conn: ^conn2, + gun_state: :up, + conn_state: :active, + used_by: [{^self, _}, {^self, _}, {^self, _}, {^self, _}] + }, + "https:some-domain.com:443" => %Conn{ + conn: ^conn1, + gun_state: :up, + conn_state: :active, + used_by: [{^self, _}] + } + } + } = Connections.get_state(name) + + :ok = Connections.checkout(conn1, self, name) + + another_url = "http://another-domain.com" + :ok = Conn.open(another_url, name) + conn = Connections.checkin(another_url, name) + + %Connections{ + conns: %{ + "http:another-domain.com:80" => %Conn{ + conn: ^conn, + gun_state: :up + }, + ^http_key => %Conn{ + conn: _, + gun_state: :up + } + } + } = Connections.get_state(name) + end + + describe "with proxy" do + test "as ip", %{name: name} do + open_mock() + |> connect_mock() + + url = "http://proxy-string.com" + key = "http:proxy-string.com:80" + :ok = Conn.open(url, name, proxy: {{127, 0, 0, 1}, 8123}) + + conn = Connections.checkin(url, name) + + %Connections{ + conns: %{ + ^key => %Conn{ + conn: ^conn, + gun_state: :up + } + } + } = Connections.get_state(name) + + reused_conn = Connections.checkin(url, name) + + assert reused_conn == conn + end + + test "as host", %{name: name} do + open_mock() + |> connect_mock() + + url = "http://proxy-tuple-atom.com" + :ok = Conn.open(url, name, proxy: {'localhost', 9050}) + conn = Connections.checkin(url, name) + + %Connections{ + conns: %{ + "http:proxy-tuple-atom.com:80" => %Conn{ + conn: ^conn, + gun_state: :up + } + } + } = Connections.get_state(name) + + reused_conn = Connections.checkin(url, name) + + assert reused_conn == conn + end + + test "as ip and ssl", %{name: name} do + open_mock() + |> connect_mock() + + url = "https://proxy-string.com" + + :ok = Conn.open(url, name, proxy: {{127, 0, 0, 1}, 8123}) + conn = Connections.checkin(url, name) + + %Connections{ + conns: %{ + "https:proxy-string.com:443" => %Conn{ + conn: ^conn, + gun_state: :up + } + } + } = Connections.get_state(name) + + reused_conn = Connections.checkin(url, name) + + assert reused_conn == conn + end + + test "as host and ssl", %{name: name} do + open_mock() + |> connect_mock() + + url = "https://proxy-tuple-atom.com" + :ok = Conn.open(url, name, proxy: {'localhost', 9050}) + conn = Connections.checkin(url, name) + + %Connections{ + conns: %{ + "https:proxy-tuple-atom.com:443" => %Conn{ + conn: ^conn, + gun_state: :up + } + } + } = Connections.get_state(name) + + reused_conn = Connections.checkin(url, name) + + assert reused_conn == conn + end + + test "with socks type", %{name: name} do + open_mock() + + url = "http://proxy-socks.com" + + :ok = Conn.open(url, name, proxy: {:socks5, 'localhost', 1234}) + + conn = Connections.checkin(url, name) + + %Connections{ + conns: %{ + "http:proxy-socks.com:80" => %Conn{ + conn: ^conn, + gun_state: :up + } + } + } = Connections.get_state(name) + + reused_conn = Connections.checkin(url, name) + + assert reused_conn == conn + end + + test "with socks4 type and ssl", %{name: name} do + open_mock() + url = "https://proxy-socks.com" + + :ok = Conn.open(url, name, proxy: {:socks4, 'localhost', 1234}) + + conn = Connections.checkin(url, name) + + %Connections{ + conns: %{ + "https:proxy-socks.com:443" => %Conn{ + conn: ^conn, + gun_state: :up + } + } + } = Connections.get_state(name) + + reused_conn = Connections.checkin(url, name) + + assert reused_conn == conn + end + end + + describe "crf/3" do + setup do + crf = Connections.crf(1, 10, 1) + {:ok, crf: crf} + end + + test "more used will have crf higher", %{crf: crf} do + # used 3 times + crf1 = Connections.crf(1, 10, crf) + crf1 = Connections.crf(1, 10, crf1) + + # used 2 times + crf2 = Connections.crf(1, 10, crf) + + assert crf1 > crf2 + end + + test "recently used will have crf higher on equal references", %{crf: crf} do + # used 3 sec ago + crf1 = Connections.crf(3, 10, crf) + + # used 4 sec ago + crf2 = Connections.crf(4, 10, crf) + + assert crf1 > crf2 + end + + test "equal crf on equal reference and time", %{crf: crf} do + # used 2 times + crf1 = Connections.crf(1, 10, crf) + + # used 2 times + crf2 = Connections.crf(1, 10, crf) + + assert crf1 == crf2 + end + + test "recently used will have higher crf", %{crf: crf} do + crf1 = Connections.crf(2, 10, crf) + crf1 = Connections.crf(1, 10, crf1) + + crf2 = Connections.crf(3, 10, crf) + crf2 = Connections.crf(4, 10, crf2) + assert crf1 > crf2 + end + end + + describe "get_unused_conns/1" do + test "crf is equalent, sorting by reference", %{name: name} do + Connections.add_conn(name, "1", %Conn{ + conn_state: :idle, + last_reference: now() - 1 + }) + + Connections.add_conn(name, "2", %Conn{ + conn_state: :idle, + last_reference: now() + }) + + assert [{"1", _unused_conn} | _others] = Connections.get_unused_conns(name) + end + + test "reference is equalent, sorting by crf", %{name: name} do + Connections.add_conn(name, "1", %Conn{ + conn_state: :idle, + crf: 1.999 + }) + + Connections.add_conn(name, "2", %Conn{ + conn_state: :idle, + crf: 2 + }) + + assert [{"1", _unused_conn} | _others] = Connections.get_unused_conns(name) + end + + test "higher crf and lower reference", %{name: name} do + Connections.add_conn(name, "1", %Conn{ + conn_state: :idle, + crf: 3, + last_reference: now() - 1 + }) + + Connections.add_conn(name, "2", %Conn{ + conn_state: :idle, + crf: 2, + last_reference: now() + }) + + assert [{"2", _unused_conn} | _others] = Connections.get_unused_conns(name) + end + + test "lower crf and lower reference", %{name: name} do + Connections.add_conn(name, "1", %Conn{ + conn_state: :idle, + crf: 1.99, + last_reference: now() - 1 + }) + + Connections.add_conn(name, "2", %Conn{ + conn_state: :idle, + crf: 2, + last_reference: now() + }) + + assert [{"1", _unused_conn} | _others] = Connections.get_unused_conns(name) + end + end + + test "count/1" do + name = :test_count + {:ok, _} = Connections.start_link({name, [checkin_timeout: 150]}) + assert Connections.count(name) == 0 + Connections.add_conn(name, "1", %Conn{conn: self()}) + assert Connections.count(name) == 1 + Connections.remove_conn(name, "1") + assert Connections.count(name) == 0 + end +end diff --git a/test/reverse_proxy_test.exs b/test/reverse_proxy/reverse_proxy_test.exs similarity index 76% rename from test/reverse_proxy_test.exs rename to test/reverse_proxy/reverse_proxy_test.exs index 87c6aca4e..c677066b3 100644 --- a/test/reverse_proxy_test.exs +++ b/test/reverse_proxy/reverse_proxy_test.exs @@ -4,13 +4,16 @@ defmodule Pleroma.ReverseProxyTest do use Pleroma.Web.ConnCase, async: true + import ExUnit.CaptureLog import Mox + alias Pleroma.ReverseProxy alias Pleroma.ReverseProxy.ClientMock + alias Plug.Conn setup_all do - {:ok, _} = Registry.start_link(keys: :unique, name: Pleroma.ReverseProxy.ClientMock) + {:ok, _} = Registry.start_link(keys: :unique, name: ClientMock) :ok end @@ -21,7 +24,7 @@ defp user_agent_mock(user_agent, invokes) do ClientMock |> expect(:request, fn :get, url, _, _, _ -> - Registry.register(Pleroma.ReverseProxy.ClientMock, url, 0) + Registry.register(ClientMock, url, 0) {:ok, 200, [ @@ -29,14 +32,14 @@ defp user_agent_mock(user_agent, invokes) do {"content-length", byte_size(json) |> to_string()} ], %{url: url}} end) - |> expect(:stream_body, invokes, fn %{url: url} -> - case Registry.lookup(Pleroma.ReverseProxy.ClientMock, url) do + |> expect(:stream_body, invokes, fn %{url: url} = client -> + case Registry.lookup(ClientMock, url) do [{_, 0}] -> - Registry.update_value(Pleroma.ReverseProxy.ClientMock, url, &(&1 + 1)) - {:ok, json} + Registry.update_value(ClientMock, url, &(&1 + 1)) + {:ok, json, client} [{_, 1}] -> - Registry.unregister(Pleroma.ReverseProxy.ClientMock, url) + Registry.unregister(ClientMock, url) :done end end) @@ -78,7 +81,39 @@ test "closed connection", %{conn: conn} do assert conn.halted end - describe "max_body " do + defp stream_mock(invokes, with_close? \\ false) do + ClientMock + |> expect(:request, fn :get, "/stream-bytes/" <> length, _, _, _ -> + Registry.register(ClientMock, "/stream-bytes/" <> length, 0) + + {:ok, 200, [{"content-type", "application/octet-stream"}], + %{url: "/stream-bytes/" <> length}} + end) + |> expect(:stream_body, invokes, fn %{url: "/stream-bytes/" <> length} = client -> + max = String.to_integer(length) + + case Registry.lookup(ClientMock, "/stream-bytes/" <> length) do + [{_, current}] when current < max -> + Registry.update_value( + ClientMock, + "/stream-bytes/" <> length, + &(&1 + 10) + ) + + {:ok, "0123456789", client} + + [{_, ^max}] -> + Registry.unregister(ClientMock, "/stream-bytes/" <> length) + :done + end + end) + + if with_close? do + expect(ClientMock, :close, fn _ -> :ok end) + end + end + + describe "max_body" do test "length returns error if content-length more than option", %{conn: conn} do user_agent_mock("hackney/1.15.1", 0) @@ -94,38 +129,6 @@ test "length returns error if content-length more than option", %{conn: conn} do end) == "" end - defp stream_mock(invokes, with_close? \\ false) do - ClientMock - |> expect(:request, fn :get, "/stream-bytes/" <> length, _, _, _ -> - Registry.register(Pleroma.ReverseProxy.ClientMock, "/stream-bytes/" <> length, 0) - - {:ok, 200, [{"content-type", "application/octet-stream"}], - %{url: "/stream-bytes/" <> length}} - end) - |> expect(:stream_body, invokes, fn %{url: "/stream-bytes/" <> length} -> - max = String.to_integer(length) - - case Registry.lookup(Pleroma.ReverseProxy.ClientMock, "/stream-bytes/" <> length) do - [{_, current}] when current < max -> - Registry.update_value( - Pleroma.ReverseProxy.ClientMock, - "/stream-bytes/" <> length, - &(&1 + 10) - ) - - {:ok, "0123456789"} - - [{_, ^max}] -> - Registry.unregister(Pleroma.ReverseProxy.ClientMock, "/stream-bytes/" <> length) - :done - end - end) - - if with_close? do - expect(ClientMock, :close, fn _ -> :ok end) - end - end - test "max_body_length returns error if streaming body more than that option", %{conn: conn} do stream_mock(3, true) @@ -214,24 +217,24 @@ test "streaming", %{conn: conn} do conn = ReverseProxy.call(conn, "/stream-bytes/200") assert conn.state == :chunked assert byte_size(conn.resp_body) == 200 - assert Plug.Conn.get_resp_header(conn, "content-type") == ["application/octet-stream"] + assert Conn.get_resp_header(conn, "content-type") == ["application/octet-stream"] end defp headers_mock(_) do ClientMock |> expect(:request, fn :get, "/headers", headers, _, _ -> - Registry.register(Pleroma.ReverseProxy.ClientMock, "/headers", 0) + Registry.register(ClientMock, "/headers", 0) {:ok, 200, [{"content-type", "application/json"}], %{url: "/headers", headers: headers}} end) - |> expect(:stream_body, 2, fn %{url: url, headers: headers} -> - case Registry.lookup(Pleroma.ReverseProxy.ClientMock, url) do + |> expect(:stream_body, 2, fn %{url: url, headers: headers} = client -> + case Registry.lookup(ClientMock, url) do [{_, 0}] -> - Registry.update_value(Pleroma.ReverseProxy.ClientMock, url, &(&1 + 1)) + Registry.update_value(ClientMock, url, &(&1 + 1)) headers = for {k, v} <- headers, into: %{}, do: {String.capitalize(k), v} - {:ok, Jason.encode!(%{headers: headers})} + {:ok, Jason.encode!(%{headers: headers}), client} [{_, 1}] -> - Registry.unregister(Pleroma.ReverseProxy.ClientMock, url) + Registry.unregister(ClientMock, url) :done end end) @@ -244,7 +247,7 @@ defp headers_mock(_) do test "header passes", %{conn: conn} do conn = - Plug.Conn.put_req_header( + Conn.put_req_header( conn, "accept", "text/html" @@ -257,7 +260,7 @@ test "header passes", %{conn: conn} do test "header is filtered", %{conn: conn} do conn = - Plug.Conn.put_req_header( + Conn.put_req_header( conn, "accept-language", "en-US" @@ -290,18 +293,18 @@ test "add cache-control", %{conn: conn} do defp disposition_headers_mock(headers) do ClientMock |> expect(:request, fn :get, "/disposition", _, _, _ -> - Registry.register(Pleroma.ReverseProxy.ClientMock, "/disposition", 0) + Registry.register(ClientMock, "/disposition", 0) {:ok, 200, headers, %{url: "/disposition"}} end) - |> expect(:stream_body, 2, fn %{url: "/disposition"} -> - case Registry.lookup(Pleroma.ReverseProxy.ClientMock, "/disposition") do + |> expect(:stream_body, 2, fn %{url: "/disposition"} = client -> + case Registry.lookup(ClientMock, "/disposition") do [{_, 0}] -> - Registry.update_value(Pleroma.ReverseProxy.ClientMock, "/disposition", &(&1 + 1)) - {:ok, ""} + Registry.update_value(ClientMock, "/disposition", &(&1 + 1)) + {:ok, "", client} [{_, 1}] -> - Registry.unregister(Pleroma.ReverseProxy.ClientMock, "/disposition") + Registry.unregister(ClientMock, "/disposition") :done end end) diff --git a/test/signature_test.exs b/test/signature_test.exs index 04736d8b9..a7a75aa4d 100644 --- a/test/signature_test.exs +++ b/test/signature_test.exs @@ -19,12 +19,7 @@ defmodule Pleroma.SignatureTest do @private_key "-----BEGIN RSA PRIVATE KEY-----\nMIIEpQIBAAKCAQEA48qb4v6kqigZutO9Ot0wkp27GIF2LiVaADgxQORZozZR63jH\nTaoOrS3Xhngbgc8SSOhfXET3omzeCLqaLNfXnZ8OXmuhJfJSU6mPUvmZ9QdT332j\nfN/g3iWGhYMf/M9ftCKh96nvFVO/tMruzS9xx7tkrfJjehdxh/3LlJMMImPtwcD7\nkFXwyt1qZTAU6Si4oQAJxRDQXHp1ttLl3Ob829VM7IKkrVmY8TD+JSlV0jtVJPj6\n1J19ytKTx/7UaucYvb9HIiBpkuiy5n/irDqKLVf5QEdZoNCdojOZlKJmTLqHhzKP\n3E9TxsUjhrf4/EqegNc/j982RvOxeu4i40zMQwIDAQABAoIBAQDH5DXjfh21i7b4\ncXJuw0cqget617CDUhemdakTDs9yH+rHPZd3mbGDWuT0hVVuFe4vuGpmJ8c+61X0\nRvugOlBlavxK8xvYlsqTzAmPgKUPljyNtEzQ+gz0I+3mH2jkin2rL3D+SksZZgKm\nfiYMPIQWB2WUF04gB46DDb2mRVuymGHyBOQjIx3WC0KW2mzfoFUFRlZEF+Nt8Ilw\nT+g/u0aZ1IWoszbsVFOEdghgZET0HEarum0B2Je/ozcPYtwmU10iBANGMKdLqaP/\nj954BPunrUf6gmlnLZKIKklJj0advx0NA+cL79+zeVB3zexRYSA5o9q0WPhiuTwR\n/aedWHnBAoGBAP0sDWBAM1Y4TRAf8ZI9PcztwLyHPzfEIqzbObJJnx1icUMt7BWi\n+/RMOnhrlPGE1kMhOqSxvXYN3u+eSmWTqai2sSH5Hdw2EqnrISSTnwNUPINX7fHH\njEkgmXQ6ixE48SuBZnb4w1EjdB/BA6/sjL+FNhggOc87tizLTkMXmMtTAoGBAOZV\n+wPuAMBDBXmbmxCuDIjoVmgSlgeRunB1SA8RCPAFAiUo3+/zEgzW2Oz8kgI+xVwM\n33XkLKrWG1Orhpp6Hm57MjIc5MG+zF4/YRDpE/KNG9qU1tiz0UD5hOpIU9pP4bR/\ngxgPxZzvbk4h5BfHWLpjlk8UUpgk6uxqfti48c1RAoGBALBOKDZ6HwYRCSGMjUcg\n3NPEUi84JD8qmFc2B7Tv7h2he2ykIz9iFAGpwCIyETQsJKX1Ewi0OlNnD3RhEEAy\nl7jFGQ+mkzPSeCbadmcpYlgIJmf1KN/x7fDTAepeBpCEzfZVE80QKbxsaybd3Dp8\nCfwpwWUFtBxr4c7J+gNhAGe/AoGAPn8ZyqkrPv9wXtyfqFjxQbx4pWhVmNwrkBPi\nZ2Qh3q4dNOPwTvTO8vjghvzIyR8rAZzkjOJKVFgftgYWUZfM5gE7T2mTkBYq8W+U\n8LetF+S9qAM2gDnaDx0kuUTCq7t87DKk6URuQ/SbI0wCzYjjRD99KxvChVGPBHKo\n1DjqMuECgYEAgJGNm7/lJCS2wk81whfy/ttKGsEIkyhPFYQmdGzSYC5aDc2gp1R3\nxtOkYEvdjfaLfDGEa4UX8CHHF+w3t9u8hBtcdhMH6GYb9iv6z0VBTt4A/11HUR49\n3Z7TQ18Iyh3jAUCzFV9IJlLIExq5Y7P4B3ojWFBN607sDCt8BMPbDYs=\n-----END RSA PRIVATE KEY-----" - @public_key %{ - "id" => "https://mastodon.social/users/lambadalambda#main-key", - "owner" => "https://mastodon.social/users/lambadalambda", - "publicKeyPem" => - "-----BEGIN PUBLIC KEY-----\nMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEAw0P/Tq4gb4G/QVuMGbJo\nC/AfMNcv+m7NfrlOwkVzcU47jgESuYI4UtJayissCdBycHUnfVUd9qol+eznSODz\nCJhfJloqEIC+aSnuEPGA0POtWad6DU0E6/Ho5zQn5WAWUwbRQqowbrsm/GHo2+3v\neR5jGenwA6sYhINg/c3QQbksyV0uJ20Umyx88w8+TJuv53twOfmyDWuYNoQ3y5cc\nHKOZcLHxYOhvwg3PFaGfFHMFiNmF40dTXt9K96r7sbzc44iLD+VphbMPJEjkMuf8\nPGEFOBzy8pm3wJZw2v32RNW2VESwMYyqDzwHXGSq1a73cS7hEnc79gXlELsK04L9\nQQIDAQAB\n-----END PUBLIC KEY-----\n" - } + @public_key "-----BEGIN PUBLIC KEY-----\nMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEAw0P/Tq4gb4G/QVuMGbJo\nC/AfMNcv+m7NfrlOwkVzcU47jgESuYI4UtJayissCdBycHUnfVUd9qol+eznSODz\nCJhfJloqEIC+aSnuEPGA0POtWad6DU0E6/Ho5zQn5WAWUwbRQqowbrsm/GHo2+3v\neR5jGenwA6sYhINg/c3QQbksyV0uJ20Umyx88w8+TJuv53twOfmyDWuYNoQ3y5cc\nHKOZcLHxYOhvwg3PFaGfFHMFiNmF40dTXt9K96r7sbzc44iLD+VphbMPJEjkMuf8\nPGEFOBzy8pm3wJZw2v32RNW2VESwMYyqDzwHXGSq1a73cS7hEnc79gXlELsK04L9\nQQIDAQAB\n-----END PUBLIC KEY-----\n" @rsa_public_key { :RSAPublicKey, @@ -42,19 +37,20 @@ defp make_fake_conn(key_id), test "it returns key" do expected_result = {:ok, @rsa_public_key} - user = insert(:user, source_data: %{"publicKey" => @public_key}) + user = insert(:user, public_key: @public_key) assert Signature.fetch_public_key(make_fake_conn(user.ap_id)) == expected_result end test "it returns error when not found user" do assert capture_log(fn -> - assert Signature.fetch_public_key(make_fake_conn("test-ap_id")) == {:error, :error} + assert Signature.fetch_public_key(make_fake_conn("https://test-ap-id")) == + {:error, :error} end) =~ "[error] Could not decode user" end - test "it returns error if public key is empty" do - user = insert(:user, source_data: %{"publicKey" => %{}}) + test "it returns error if public key is nil" do + user = insert(:user, public_key: nil) assert Signature.fetch_public_key(make_fake_conn(user.ap_id)) == {:error, :error} end @@ -69,7 +65,7 @@ test "it returns key" do test "it returns error when not found user" do assert capture_log(fn -> - {:error, _} = Signature.refetch_public_key(make_fake_conn("test-ap_id")) + {:error, _} = Signature.refetch_public_key(make_fake_conn("https://test-ap_id")) end) =~ "[error] Could not decode user" end end @@ -105,12 +101,21 @@ test "it returns error" do describe "key_id_to_actor_id/1" do test "it properly deduces the actor id for misskey" do assert Signature.key_id_to_actor_id("https://example.com/users/1234/publickey") == - "https://example.com/users/1234" + {:ok, "https://example.com/users/1234"} end test "it properly deduces the actor id for mastodon and pleroma" do assert Signature.key_id_to_actor_id("https://example.com/users/1234#main-key") == - "https://example.com/users/1234" + {:ok, "https://example.com/users/1234"} + end + + test "it calls webfinger for 'acct:' accounts" do + with_mock(Pleroma.Web.WebFinger, + finger: fn _ -> %{"ap_id" => "https://gensokyo.2hu/users/raymoo"} end + ) do + assert Signature.key_id_to_actor_id("acct:raymoo@gensokyo.2hu") == + {:ok, "https://gensokyo.2hu/users/raymoo"} + end end end diff --git a/test/stat_test.exs b/test/stats_test.exs similarity index 63% rename from test/stat_test.exs rename to test/stats_test.exs index 33b77e7e7..4b76e2e78 100644 --- a/test/stat_test.exs +++ b/test/stats_test.exs @@ -2,36 +2,46 @@ # Copyright © 2017-2020 Pleroma Authors # SPDX-License-Identifier: AGPL-3.0-only -defmodule Pleroma.StateTest do +defmodule Pleroma.StatsTest do use Pleroma.DataCase import Pleroma.Factory alias Pleroma.Web.CommonAPI + describe "user count" do + test "it ignores internal users" do + _user = insert(:user, local: true) + _internal = insert(:user, local: true, nickname: nil) + _internal = Pleroma.Web.ActivityPub.Relay.get_actor() + + assert match?(%{stats: %{user_count: 1}}, Pleroma.Stats.calculate_stat_data()) + end + end + describe "status visibility count" do test "on new status" do user = insert(:user) other_user = insert(:user) - CommonAPI.post(user, %{"visibility" => "public", "status" => "hey"}) + CommonAPI.post(user, %{visibility: "public", status: "hey"}) Enum.each(0..1, fn _ -> CommonAPI.post(user, %{ - "visibility" => "unlisted", - "status" => "hey" + visibility: "unlisted", + status: "hey" }) end) Enum.each(0..2, fn _ -> CommonAPI.post(user, %{ - "visibility" => "direct", - "status" => "hey @#{other_user.nickname}" + visibility: "direct", + status: "hey @#{other_user.nickname}" }) end) Enum.each(0..3, fn _ -> CommonAPI.post(user, %{ - "visibility" => "private", - "status" => "hey" + visibility: "private", + status: "hey" }) end) @@ -41,7 +51,7 @@ test "on new status" do test "on status delete" do user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"visibility" => "public", "status" => "hey"}) + {:ok, activity} = CommonAPI.post(user, %{visibility: "public", status: "hey"}) assert %{public: 1} = Pleroma.Stats.get_status_visibility_count() CommonAPI.delete(activity.id, user) assert %{public: 0} = Pleroma.Stats.get_status_visibility_count() @@ -49,18 +59,18 @@ test "on status delete" do test "on status visibility update" do user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"visibility" => "public", "status" => "hey"}) + {:ok, activity} = CommonAPI.post(user, %{visibility: "public", status: "hey"}) assert %{public: 1, private: 0} = Pleroma.Stats.get_status_visibility_count() - {:ok, _} = CommonAPI.update_activity_scope(activity.id, %{"visibility" => "private"}) + {:ok, _} = CommonAPI.update_activity_scope(activity.id, %{visibility: "private"}) assert %{public: 0, private: 1} = Pleroma.Stats.get_status_visibility_count() end test "doesn't count unrelated activities" do user = insert(:user) other_user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"visibility" => "public", "status" => "hey"}) + {:ok, activity} = CommonAPI.post(user, %{visibility: "public", status: "hey"}) _ = CommonAPI.follow(user, other_user) - CommonAPI.favorite(activity.id, other_user) + CommonAPI.favorite(other_user, activity.id) CommonAPI.repeat(activity.id, other_user) assert %{direct: 0, private: 0, public: 1, unlisted: 0} = diff --git a/test/support/api_spec_helpers.ex b/test/support/api_spec_helpers.ex new file mode 100644 index 000000000..80c69c788 --- /dev/null +++ b/test/support/api_spec_helpers.ex @@ -0,0 +1,57 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Tests.ApiSpecHelpers do + @moduledoc """ + OpenAPI spec test helpers + """ + + import ExUnit.Assertions + + alias OpenApiSpex.Cast.Error + alias OpenApiSpex.Reference + alias OpenApiSpex.Schema + + def assert_schema(value, schema) do + api_spec = Pleroma.Web.ApiSpec.spec() + + case OpenApiSpex.cast_value(value, schema, api_spec) do + {:ok, data} -> + data + + {:error, errors} -> + errors = + Enum.map(errors, fn error -> + message = Error.message(error) + path = Error.path_to_string(error) + "#{message} at #{path}" + end) + + flunk( + "Value does not conform to schema #{schema.title}: #{Enum.join(errors, "\n")}\n#{ + inspect(value) + }" + ) + end + end + + def resolve_schema(%Schema{} = schema), do: schema + + def resolve_schema(%Reference{} = ref) do + schemas = Pleroma.Web.ApiSpec.spec().components.schemas + Reference.resolve_schema(ref, schemas) + end + + def api_operations do + paths = Pleroma.Web.ApiSpec.spec().paths + + Enum.flat_map(paths, fn {_, path_item} -> + path_item + |> Map.take([:delete, :get, :head, :options, :patch, :post, :put, :trace]) + |> Map.values() + |> Enum.reject(&is_nil/1) + |> Enum.uniq() + end) + end +end diff --git a/test/support/builders/activity_builder.ex b/test/support/builders/activity_builder.ex index 6e5a8e059..7c4950bfa 100644 --- a/test/support/builders/activity_builder.ex +++ b/test/support/builders/activity_builder.ex @@ -21,7 +21,15 @@ def build(data \\ %{}, opts \\ %{}) do def insert(data \\ %{}, opts \\ %{}) do activity = build(data, opts) - ActivityPub.insert(activity) + + case ActivityPub.insert(activity) do + ok = {:ok, activity} -> + ActivityPub.notify_and_stream(activity) + ok + + error -> + error + end end def insert_list(times, data \\ %{}, opts \\ %{}) do diff --git a/test/support/builders/user_builder.ex b/test/support/builders/user_builder.ex index fcfea666f..0c687c029 100644 --- a/test/support/builders/user_builder.ex +++ b/test/support/builders/user_builder.ex @@ -7,10 +7,11 @@ def build(data \\ %{}) do email: "test@example.org", name: "Test Name", nickname: "testname", - password_hash: Comeonin.Pbkdf2.hashpwsalt("test"), + password_hash: Pbkdf2.hash_pwd_salt("test"), bio: "A tester.", ap_id: "some id", last_digest_emailed_at: NaiveDateTime.truncate(NaiveDateTime.utc_now(), :second), + multi_factor_authentication_settings: %Pleroma.MFA.Settings{}, notification_settings: %Pleroma.User.NotificationSetting{} } diff --git a/test/support/captcha_mock.ex b/test/support/captcha_mock.ex index 6dae94edf..7b0c1d5af 100644 --- a/test/support/captcha_mock.ex +++ b/test/support/captcha_mock.ex @@ -6,12 +6,16 @@ defmodule Pleroma.Captcha.Mock do alias Pleroma.Captcha.Service @behaviour Service + @solution "63615261b77f5354fb8c4e4986477555" + + def solution, do: @solution + @impl Service def new, do: %{ type: :mock, token: "afa1815e14e29355e6c8f6b143a39fa2", - answer_data: "63615261b77f5354fb8c4e4986477555", + answer_data: @solution, url: "https://example.org/captcha.png" } diff --git a/test/support/conn_case.ex b/test/support/conn_case.ex index 064874201..b23918dd1 100644 --- a/test/support/conn_case.ex +++ b/test/support/conn_case.ex @@ -51,6 +51,60 @@ defp oauth_access(scopes, opts \\ []) do %{user: user, token: token, conn: conn} end + defp request_content_type(%{conn: conn}) do + conn = put_req_header(conn, "content-type", "multipart/form-data") + [conn: conn] + end + + defp json_response_and_validate_schema( + %{ + private: %{ + open_api_spex: %{operation_id: op_id, operation_lookup: lookup, spec: spec} + } + } = conn, + status + ) do + content_type = + conn + |> Plug.Conn.get_resp_header("content-type") + |> List.first() + |> String.split(";") + |> List.first() + + status = Plug.Conn.Status.code(status) + + unless lookup[op_id].responses[status] do + err = "Response schema not found for #{status} #{conn.method} #{conn.request_path}" + flunk(err) + end + + schema = lookup[op_id].responses[status].content[content_type].schema + json = json_response(conn, status) + + case OpenApiSpex.cast_value(json, schema, spec) do + {:ok, _data} -> + json + + {:error, errors} -> + errors = + Enum.map(errors, fn error -> + message = OpenApiSpex.Cast.Error.message(error) + path = OpenApiSpex.Cast.Error.path_to_string(error) + "#{message} at #{path}" + end) + + flunk( + "Response does not conform to schema of #{op_id} operation: #{ + Enum.join(errors, "\n") + }\n#{inspect(json)}" + ) + end + end + + defp json_response_and_validate_schema(conn, _status) do + flunk("Response schema not found for #{conn.method} #{conn.request_path} #{conn.status}") + end + defp ensure_federating_or_authenticated(conn, url, user) do initial_setting = Config.get([:instance, :federating]) on_exit(fn -> Config.put([:instance, :federating], initial_setting) end) @@ -85,7 +139,11 @@ defp ensure_federating_or_authenticated(conn, url, user) do end if tags[:needs_streamer] do - start_supervised(Pleroma.Web.Streamer.supervisor()) + start_supervised(%{ + id: Pleroma.Web.Streamer.registry(), + start: + {Registry, :start_link, [[keys: :duplicate, name: Pleroma.Web.Streamer.registry()]]} + }) end {:ok, conn: Phoenix.ConnTest.build_conn()} diff --git a/test/support/data_case.ex b/test/support/data_case.ex index 1669f2520..ba8848952 100644 --- a/test/support/data_case.ex +++ b/test/support/data_case.ex @@ -40,7 +40,11 @@ defmodule Pleroma.DataCase do end if tags[:needs_streamer] do - start_supervised(Pleroma.Web.Streamer.supervisor()) + start_supervised(%{ + id: Pleroma.Web.Streamer.registry(), + start: + {Registry, :start_link, [[keys: :duplicate, name: Pleroma.Web.Streamer.registry()]]} + }) end :ok diff --git a/test/support/factory.ex b/test/support/factory.ex index af639b6cd..d4284831c 100644 --- a/test/support/factory.ex +++ b/test/support/factory.ex @@ -29,10 +29,12 @@ def user_factory do name: sequence(:name, &"Test テスト User #{&1}"), email: sequence(:email, &"user#{&1}@example.com"), nickname: sequence(:nickname, &"nick#{&1}"), - password_hash: Comeonin.Pbkdf2.hashpwsalt("test"), + password_hash: Pbkdf2.hash_pwd_salt("test"), bio: sequence(:bio, &"Tester Number #{&1}"), last_digest_emailed_at: NaiveDateTime.utc_now(), - notification_settings: %Pleroma.User.NotificationSetting{} + last_refreshed_at: NaiveDateTime.utc_now(), + notification_settings: %Pleroma.User.NotificationSetting{}, + multi_factor_authentication_settings: %Pleroma.MFA.Settings{} } %{ @@ -294,7 +296,7 @@ def follow_activity_factory do def oauth_app_factory do %Pleroma.Web.OAuth.App{ - client_name: "Some client", + client_name: sequence(:client_name, &"Some client #{&1}"), redirect_uris: "https://example.com/callback", scopes: ["read", "write", "follow", "push", "admin"], website: "https://example.com", @@ -421,4 +423,13 @@ def marker_factory do last_read_id: "1" } end + + def mfa_token_factory do + %Pleroma.MFA.Token{ + token: :crypto.strong_rand_bytes(32) |> Base.url_encode64(padding: false), + authorization: build(:oauth_authorization), + valid_until: NaiveDateTime.add(NaiveDateTime.utc_now(), 60 * 10), + user: build(:user) + } + end end diff --git a/test/support/helpers.ex b/test/support/helpers.ex index e68e9bfd2..26281b45e 100644 --- a/test/support/helpers.ex +++ b/test/support/helpers.ex @@ -40,12 +40,18 @@ defmacro __using__(_opts) do clear_config: 2 ] - def to_datetime(naive_datetime) do + def to_datetime(%NaiveDateTime{} = naive_datetime) do naive_datetime |> DateTime.from_naive!("Etc/UTC") |> DateTime.truncate(:second) end + def to_datetime(datetime) when is_binary(datetime) do + datetime + |> NaiveDateTime.from_iso8601!() + |> to_datetime() + end + def collect_ids(collection) do collection |> Enum.map(& &1.id) diff --git a/test/support/http_request_mock.ex b/test/support/http_request_mock.ex index e72638814..3a95e92da 100644 --- a/test/support/http_request_mock.ex +++ b/test/support/http_request_mock.ex @@ -107,7 +107,7 @@ def get( "https://osada.macgirvin.com/.well-known/webfinger?resource=acct:mike@osada.macgirvin.com", _, _, - Accept: "application/xrd+xml,application/jrd+json" + [{"accept", "application/xrd+xml,application/jrd+json"}] ) do {:ok, %Tesla.Env{ @@ -120,7 +120,7 @@ def get( "https://social.heldscal.la/.well-known/webfinger?resource=https://social.heldscal.la/user/29191", _, _, - Accept: "application/xrd+xml,application/jrd+json" + [{"accept", "application/xrd+xml,application/jrd+json"}] ) do {:ok, %Tesla.Env{ @@ -141,7 +141,7 @@ def get( "https://pawoo.net/.well-known/webfinger?resource=acct:https://pawoo.net/users/pekorino", _, _, - Accept: "application/xrd+xml,application/jrd+json" + [{"accept", "application/xrd+xml,application/jrd+json"}] ) do {:ok, %Tesla.Env{ @@ -167,7 +167,7 @@ def get( "https://social.stopwatchingus-heidelberg.de/.well-known/webfinger?resource=acct:https://social.stopwatchingus-heidelberg.de/user/18330", _, _, - Accept: "application/xrd+xml,application/jrd+json" + [{"accept", "application/xrd+xml,application/jrd+json"}] ) do {:ok, %Tesla.Env{ @@ -188,7 +188,7 @@ def get( "https://mamot.fr/.well-known/webfinger?resource=acct:https://mamot.fr/users/Skruyb", _, _, - Accept: "application/xrd+xml,application/jrd+json" + [{"accept", "application/xrd+xml,application/jrd+json"}] ) do {:ok, %Tesla.Env{ @@ -201,7 +201,7 @@ def get( "https://social.heldscal.la/.well-known/webfinger?resource=nonexistant@social.heldscal.la", _, _, - Accept: "application/xrd+xml,application/jrd+json" + [{"accept", "application/xrd+xml,application/jrd+json"}] ) do {:ok, %Tesla.Env{ @@ -211,10 +211,10 @@ def get( end def get( - "https://squeet.me/xrd/?uri=lain@squeet.me", + "https://squeet.me/xrd/?uri=acct:lain@squeet.me", _, _, - Accept: "application/xrd+xml,application/jrd+json" + [{"accept", "application/xrd+xml,application/jrd+json"}] ) do {:ok, %Tesla.Env{ @@ -227,7 +227,7 @@ def get( "https://mst3k.interlinked.me/users/luciferMysticus", _, _, - Accept: "application/activity+json" + [{"accept", "application/activity+json"}] ) do {:ok, %Tesla.Env{ @@ -248,7 +248,7 @@ def get( "https://hubzilla.example.org/channel/kaniini", _, _, - Accept: "application/activity+json" + [{"accept", "application/activity+json"}] ) do {:ok, %Tesla.Env{ @@ -257,7 +257,7 @@ def get( }} end - def get("https://niu.moe/users/rye", _, _, Accept: "application/activity+json") do + def get("https://niu.moe/users/rye", _, _, [{"accept", "application/activity+json"}]) do {:ok, %Tesla.Env{ status: 200, @@ -265,7 +265,7 @@ def get("https://niu.moe/users/rye", _, _, Accept: "application/activity+json") }} end - def get("https://n1u.moe/users/rye", _, _, Accept: "application/activity+json") do + def get("https://n1u.moe/users/rye", _, _, [{"accept", "application/activity+json"}]) do {:ok, %Tesla.Env{ status: 200, @@ -284,7 +284,7 @@ def get("http://mastodon.example.org/users/admin/statuses/100787282858396771", _ }} end - def get("https://puckipedia.com/", _, _, Accept: "application/activity+json") do + def get("https://puckipedia.com/", _, _, [{"accept", "application/activity+json"}]) do {:ok, %Tesla.Env{ status: 200, @@ -308,9 +308,25 @@ def get("https://peertube.moe/videos/watch/df5f464b-be8d-46fb-ad81-2d4c2d1630e3" }} end - def get("https://mobilizon.org/events/252d5816-00a3-4a89-a66f-15bf65c33e39", _, _, - Accept: "application/activity+json" - ) do + def get("https://peertube.social/accounts/craigmaloney", _, _, _) do + {:ok, + %Tesla.Env{ + status: 200, + body: File.read!("test/fixtures/tesla_mock/craigmaloney.json") + }} + end + + def get("https://peertube.social/videos/watch/278d2b7c-0f38-4aaa-afe6-9ecc0c4a34fe", _, _, _) do + {:ok, + %Tesla.Env{ + status: 200, + body: File.read!("test/fixtures/tesla_mock/peertube-social.json") + }} + end + + def get("https://mobilizon.org/events/252d5816-00a3-4a89-a66f-15bf65c33e39", _, _, [ + {"accept", "application/activity+json"} + ]) do {:ok, %Tesla.Env{ status: 200, @@ -318,7 +334,7 @@ def get("https://mobilizon.org/events/252d5816-00a3-4a89-a66f-15bf65c33e39", _, }} end - def get("https://mobilizon.org/@tcit", _, _, Accept: "application/activity+json") do + def get("https://mobilizon.org/@tcit", _, _, [{"accept", "application/activity+json"}]) do {:ok, %Tesla.Env{ status: 200, @@ -358,7 +374,7 @@ def get("https://wedistribute.org/wp-json/pterotype/v1/actor/-blog", _, _, _) do }} end - def get("http://mastodon.example.org/users/admin", _, _, Accept: "application/activity+json") do + def get("http://mastodon.example.org/users/admin", _, _, _) do {:ok, %Tesla.Env{ status: 200, @@ -366,7 +382,9 @@ def get("http://mastodon.example.org/users/admin", _, _, Accept: "application/ac }} end - def get("http://mastodon.example.org/users/relay", _, _, Accept: "application/activity+json") do + def get("http://mastodon.example.org/users/relay", _, _, [ + {"accept", "application/activity+json"} + ]) do {:ok, %Tesla.Env{ status: 200, @@ -374,7 +392,9 @@ def get("http://mastodon.example.org/users/relay", _, _, Accept: "application/ac }} end - def get("http://mastodon.example.org/users/gargron", _, _, Accept: "application/activity+json") do + def get("http://mastodon.example.org/users/gargron", _, _, [ + {"accept", "application/activity+json"} + ]) do {:error, :nxdomain} end @@ -557,7 +577,7 @@ def get( "http://mastodon.example.org/@admin/99541947525187367", _, _, - Accept: "application/activity+json" + _ ) do {:ok, %Tesla.Env{ @@ -582,7 +602,7 @@ def get("https://shitposter.club/notice/7369654", _, _, _) do }} end - def get("https://mstdn.io/users/mayuutann", _, _, Accept: "application/activity+json") do + def get("https://mstdn.io/users/mayuutann", _, _, [{"accept", "application/activity+json"}]) do {:ok, %Tesla.Env{ status: 200, @@ -594,7 +614,7 @@ def get( "https://mstdn.io/users/mayuutann/statuses/99568293732299394", _, _, - Accept: "application/activity+json" + [{"accept", "application/activity+json"}] ) do {:ok, %Tesla.Env{ @@ -614,7 +634,7 @@ def get("https://pleroma.soykaf.com/users/lain/feed.atom", _, _, _) do }} end - def get(url, _, _, Accept: "application/xrd+xml,application/jrd+json") + def get(url, _, _, [{"accept", "application/xrd+xml,application/jrd+json"}]) when url in [ "https://pleroma.soykaf.com/.well-known/webfinger?resource=acct:https://pleroma.soykaf.com/users/lain", "https://pleroma.soykaf.com/.well-known/webfinger?resource=https://pleroma.soykaf.com/users/lain" @@ -641,7 +661,7 @@ def get( "https://shitposter.club/.well-known/webfinger?resource=https://shitposter.club/user/1", _, _, - Accept: "application/xrd+xml,application/jrd+json" + [{"accept", "application/xrd+xml,application/jrd+json"}] ) do {:ok, %Tesla.Env{ @@ -685,7 +705,7 @@ def get( "https://shitposter.club/.well-known/webfinger?resource=https://shitposter.club/user/5381", _, _, - Accept: "application/xrd+xml,application/jrd+json" + [{"accept", "application/xrd+xml,application/jrd+json"}] ) do {:ok, %Tesla.Env{ @@ -738,7 +758,7 @@ def get( "https://social.sakamoto.gq/.well-known/webfinger?resource=https://social.sakamoto.gq/users/eal", _, _, - Accept: "application/xrd+xml,application/jrd+json" + [{"accept", "application/xrd+xml,application/jrd+json"}] ) do {:ok, %Tesla.Env{ @@ -751,7 +771,7 @@ def get( "https://social.sakamoto.gq/objects/0ccc1a2c-66b0-4305-b23a-7f7f2b040056", _, _, - Accept: "application/atom+xml" + [{"accept", "application/atom+xml"}] ) do {:ok, %Tesla.Env{status: 200, body: File.read!("test/fixtures/tesla_mock/sakamoto.atom")}} end @@ -768,7 +788,7 @@ def get( "https://mastodon.social/.well-known/webfinger?resource=https://mastodon.social/users/lambadalambda", _, _, - Accept: "application/xrd+xml,application/jrd+json" + [{"accept", "application/xrd+xml,application/jrd+json"}] ) do {:ok, %Tesla.Env{ @@ -790,7 +810,7 @@ def get( "http://gs.example.org/.well-known/webfinger?resource=http://gs.example.org:4040/index.php/user/1", _, _, - Accept: "application/xrd+xml,application/jrd+json" + [{"accept", "application/xrd+xml,application/jrd+json"}] ) do {:ok, %Tesla.Env{ @@ -804,7 +824,7 @@ def get( "http://gs.example.org:4040/index.php/user/1", _, _, - Accept: "application/activity+json" + [{"accept", "application/activity+json"}] ) do {:ok, %Tesla.Env{status: 406, body: ""}} end @@ -840,7 +860,7 @@ def get( "https://squeet.me/xrd?uri=lain@squeet.me", _, _, - Accept: "application/xrd+xml,application/jrd+json" + [{"accept", "application/xrd+xml,application/jrd+json"}] ) do {:ok, %Tesla.Env{ @@ -850,10 +870,10 @@ def get( end def get( - "https://social.heldscal.la/.well-known/webfinger?resource=shp@social.heldscal.la", + "https://social.heldscal.la/.well-known/webfinger?resource=acct:shp@social.heldscal.la", _, _, - Accept: "application/xrd+xml,application/jrd+json" + [{"accept", "application/xrd+xml,application/jrd+json"}] ) do {:ok, %Tesla.Env{ @@ -863,10 +883,10 @@ def get( end def get( - "https://social.heldscal.la/.well-known/webfinger?resource=invalid_content@social.heldscal.la", + "https://social.heldscal.la/.well-known/webfinger?resource=acct:invalid_content@social.heldscal.la", _, _, - Accept: "application/xrd+xml,application/jrd+json" + [{"accept", "application/xrd+xml,application/jrd+json"}] ) do {:ok, %Tesla.Env{status: 200, body: ""}} end @@ -880,10 +900,10 @@ def get("http://framatube.org/.well-known/host-meta", _, _, _) do end def get( - "http://framatube.org/main/xrd?uri=framasoft@framatube.org", + "http://framatube.org/main/xrd?uri=acct:framasoft@framatube.org", _, _, - Accept: "application/xrd+xml,application/jrd+json" + [{"accept", "application/xrd+xml,application/jrd+json"}] ) do {:ok, %Tesla.Env{ @@ -905,7 +925,7 @@ def get( "http://gnusocial.de/main/xrd?uri=winterdienst@gnusocial.de", _, _, - Accept: "application/xrd+xml,application/jrd+json" + [{"accept", "application/xrd+xml,application/jrd+json"}] ) do {:ok, %Tesla.Env{ @@ -939,10 +959,10 @@ def get("http://gerzilla.de/.well-known/host-meta", _, _, _) do end def get( - "https://gerzilla.de/xrd/?uri=kaniini@gerzilla.de", + "https://gerzilla.de/xrd/?uri=acct:kaniini@gerzilla.de", _, _, - Accept: "application/xrd+xml,application/jrd+json" + [{"accept", "application/xrd+xml,application/jrd+json"}] ) do {:ok, %Tesla.Env{ @@ -1005,7 +1025,7 @@ def get("https://apfed.club/channel/indio", _, _, _) do %Tesla.Env{status: 200, body: File.read!("test/fixtures/tesla_mock/osada-user-indio.json")}} end - def get("https://social.heldscal.la/user/23211", _, _, Accept: "application/activity+json") do + def get("https://social.heldscal.la/user/23211", _, _, [{"accept", "application/activity+json"}]) do {:ok, Tesla.Mock.json(%{"id" => "https://social.heldscal.la/user/23211"}, status: 200)} end @@ -1135,10 +1155,10 @@ def get("http://404.site" <> _, _, _, _) do end def get( - "https://zetsubou.xn--q9jyb4c/.well-known/webfinger?resource=lain@zetsubou.xn--q9jyb4c", + "https://zetsubou.xn--q9jyb4c/.well-known/webfinger?resource=acct:lain@zetsubou.xn--q9jyb4c", _, _, - Accept: "application/xrd+xml,application/jrd+json" + [{"accept", "application/xrd+xml,application/jrd+json"}] ) do {:ok, %Tesla.Env{ @@ -1148,10 +1168,10 @@ def get( end def get( - "https://zetsubou.xn--q9jyb4c/.well-known/webfinger?resource=https://zetsubou.xn--q9jyb4c/users/lain", + "https://zetsubou.xn--q9jyb4c/.well-known/webfinger?resource=acct:https://zetsubou.xn--q9jyb4c/users/lain", _, _, - Accept: "application/xrd+xml,application/jrd+json" + [{"accept", "application/xrd+xml,application/jrd+json"}] ) do {:ok, %Tesla.Env{ @@ -1173,7 +1193,9 @@ def get( }} end - def get("https://info.pleroma.site/activity.json", _, _, Accept: "application/activity+json") do + def get("https://info.pleroma.site/activity.json", _, _, [ + {"accept", "application/activity+json"} + ]) do {:ok, %Tesla.Env{ status: 200, @@ -1185,7 +1207,9 @@ def get("https://info.pleroma.site/activity.json", _, _, _) do {:ok, %Tesla.Env{status: 404, body: ""}} end - def get("https://info.pleroma.site/activity2.json", _, _, Accept: "application/activity+json") do + def get("https://info.pleroma.site/activity2.json", _, _, [ + {"accept", "application/activity+json"} + ]) do {:ok, %Tesla.Env{ status: 200, @@ -1197,7 +1221,9 @@ def get("https://info.pleroma.site/activity2.json", _, _, _) do {:ok, %Tesla.Env{status: 404, body: ""}} end - def get("https://info.pleroma.site/activity3.json", _, _, Accept: "application/activity+json") do + def get("https://info.pleroma.site/activity3.json", _, _, [ + {"accept", "application/activity+json"} + ]) do {:ok, %Tesla.Env{ status: 200, @@ -1273,6 +1299,21 @@ def get("https://patch.cx/users/rin", _, _, _) do {:ok, %Tesla.Env{status: 200, body: File.read!("test/fixtures/tesla_mock/rin.json")}} end + def get( + "https://channels.tests.funkwhale.audio/federation/music/uploads/42342395-0208-4fee-a38d-259a6dae0871", + _, + _, + _ + ) do + {:ok, + %Tesla.Env{status: 200, body: File.read!("test/fixtures/tesla_mock/funkwhale_audio.json")}} + end + + def get("https://channels.tests.funkwhale.audio/federation/actors/compositions", _, _, _) do + {:ok, + %Tesla.Env{status: 200, body: File.read!("test/fixtures/tesla_mock/funkwhale_channel.json")}} + end + def get("http://example.com/rel_me/error", _, _, _) do {:ok, %Tesla.Env{status: 404, body: ""}} end diff --git a/test/tasks/app_test.exs b/test/tasks/app_test.exs new file mode 100644 index 000000000..b8f03566d --- /dev/null +++ b/test/tasks/app_test.exs @@ -0,0 +1,65 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Mix.Tasks.Pleroma.AppTest do + use Pleroma.DataCase, async: true + + setup_all do + Mix.shell(Mix.Shell.Process) + + on_exit(fn -> + Mix.shell(Mix.Shell.IO) + end) + end + + describe "creates new app" do + test "with default scopes" do + name = "Some name" + redirect = "https://example.com" + Mix.Tasks.Pleroma.App.run(["create", "-n", name, "-r", redirect]) + + assert_app(name, redirect, ["read", "write", "follow", "push"]) + end + + test "with custom scopes" do + name = "Another name" + redirect = "https://example.com" + + Mix.Tasks.Pleroma.App.run([ + "create", + "-n", + name, + "-r", + redirect, + "-s", + "read,write,follow,push,admin" + ]) + + assert_app(name, redirect, ["read", "write", "follow", "push", "admin"]) + end + end + + test "with errors" do + Mix.Tasks.Pleroma.App.run(["create"]) + {:mix_shell, :error, ["Creating failed:"]} + {:mix_shell, :error, ["name: can't be blank"]} + {:mix_shell, :error, ["redirect_uris: can't be blank"]} + end + + defp assert_app(name, redirect, scopes) do + app = Repo.get_by(Pleroma.Web.OAuth.App, client_name: name) + + assert_received {:mix_shell, :info, [message]} + assert message == "#{name} successfully created:" + + assert_received {:mix_shell, :info, [message]} + assert message == "App client_id: #{app.client_id}" + + assert_received {:mix_shell, :info, [message]} + assert message == "App client_secret: #{app.client_secret}" + + assert app.scopes == scopes + assert app.redirect_uris == redirect + end +end diff --git a/test/tasks/config_test.exs b/test/tasks/config_test.exs index 3dee4f082..04bc947a9 100644 --- a/test/tasks/config_test.exs +++ b/test/tasks/config_test.exs @@ -38,7 +38,7 @@ test "error if file with custom settings doesn't exist" do on_exit(fn -> Application.put_env(:quack, :level, initial) end) end - test "settings are migrated to db" do + test "filtered settings are migrated to db" do assert Repo.all(ConfigDB) == [] Mix.Tasks.Pleroma.Config.migrate_to_db("test/fixtures/config/temp.secret.exs") @@ -47,6 +47,7 @@ test "settings are migrated to db" do config2 = ConfigDB.get_by_params(%{group: ":pleroma", key: ":second_setting"}) config3 = ConfigDB.get_by_params(%{group: ":quack", key: ":level"}) refute ConfigDB.get_by_params(%{group: ":pleroma", key: "Pleroma.Repo"}) + refute ConfigDB.get_by_params(%{group: ":postgrex", key: ":json_library"}) assert ConfigDB.from_binary(config1.value) == [key: "value", key2: [Repo]] assert ConfigDB.from_binary(config2.value) == [key: "value2", key2: ["Activity"]] diff --git a/test/tasks/count_statuses_test.exs b/test/tasks/count_statuses_test.exs index 73c2ea690..c5cd16960 100644 --- a/test/tasks/count_statuses_test.exs +++ b/test/tasks/count_statuses_test.exs @@ -13,11 +13,11 @@ defmodule Mix.Tasks.Pleroma.CountStatusesTest do test "counts statuses" do user = insert(:user) - {:ok, _} = CommonAPI.post(user, %{"status" => "test"}) - {:ok, _} = CommonAPI.post(user, %{"status" => "test2"}) + {:ok, _} = CommonAPI.post(user, %{status: "test"}) + {:ok, _} = CommonAPI.post(user, %{status: "test2"}) user2 = insert(:user) - {:ok, _} = CommonAPI.post(user2, %{"status" => "test3"}) + {:ok, _} = CommonAPI.post(user2, %{status: "test3"}) user = refresh_record(user) user2 = refresh_record(user2) diff --git a/test/tasks/database_test.exs b/test/tasks/database_test.exs index ed1c31d9c..883828d77 100644 --- a/test/tasks/database_test.exs +++ b/test/tasks/database_test.exs @@ -26,7 +26,7 @@ defmodule Mix.Tasks.Pleroma.DatabaseTest do describe "running remove_embedded_objects" do test "it replaces objects with references" do user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "test"}) + {:ok, activity} = CommonAPI.post(user, %{status: "test"}) new_data = Map.put(activity.data, "object", activity.object.data) {:ok, activity} = @@ -99,10 +99,10 @@ test "following and followers count are updated" do test "it turns OrderedCollection likes into empty arrays" do [user, user2] = insert_pair(:user) - {:ok, %{id: id, object: object}} = CommonAPI.post(user, %{"status" => "test"}) - {:ok, %{object: object2}} = CommonAPI.post(user, %{"status" => "test test"}) + {:ok, %{id: id, object: object}} = CommonAPI.post(user, %{status: "test"}) + {:ok, %{object: object2}} = CommonAPI.post(user, %{status: "test test"}) - CommonAPI.favorite(id, user2) + CommonAPI.favorite(user2, id) likes = %{ "first" => diff --git a/test/tasks/digest_test.exs b/test/tasks/digest_test.exs index 96d762685..eefbc8936 100644 --- a/test/tasks/digest_test.exs +++ b/test/tasks/digest_test.exs @@ -25,7 +25,7 @@ test "Sends digest to the given user" do Enum.each(0..10, fn i -> {:ok, _activity} = CommonAPI.post(user1, %{ - "status" => "hey ##{i} @#{user2.nickname}!" + status: "hey ##{i} @#{user2.nickname}!" }) end) diff --git a/test/tasks/emoji_test.exs b/test/tasks/emoji_test.exs new file mode 100644 index 000000000..f5de3ef0e --- /dev/null +++ b/test/tasks/emoji_test.exs @@ -0,0 +1,226 @@ +defmodule Mix.Tasks.Pleroma.EmojiTest do + use ExUnit.Case, async: true + + import ExUnit.CaptureIO + import Tesla.Mock + + alias Mix.Tasks.Pleroma.Emoji + + describe "ls-packs" do + test "with default manifest as url" do + mock(fn + %{ + method: :get, + url: "https://git.pleroma.social/pleroma/emoji-index/raw/master/index.json" + } -> + %Tesla.Env{ + status: 200, + body: File.read!("test/fixtures/emoji/packs/default-manifest.json") + } + end) + + capture_io(fn -> Emoji.run(["ls-packs"]) end) =~ + "https://finland.fi/wp-content/uploads/2017/06/finland-emojis.zip" + end + + test "with passed manifest as file" do + capture_io(fn -> + Emoji.run(["ls-packs", "-m", "test/fixtures/emoji/packs/manifest.json"]) + end) =~ "https://git.pleroma.social/pleroma/emoji-index/raw/master/packs/blobs_gg.zip" + end + end + + describe "get-packs" do + test "download pack from default manifest" do + mock(fn + %{ + method: :get, + url: "https://git.pleroma.social/pleroma/emoji-index/raw/master/index.json" + } -> + %Tesla.Env{ + status: 200, + body: File.read!("test/fixtures/emoji/packs/default-manifest.json") + } + + %{ + method: :get, + url: "https://finland.fi/wp-content/uploads/2017/06/finland-emojis.zip" + } -> + %Tesla.Env{ + status: 200, + body: File.read!("test/fixtures/emoji/packs/blank.png.zip") + } + + %{ + method: :get, + url: "https://git.pleroma.social/pleroma/emoji-index/raw/master/finmoji.json" + } -> + %Tesla.Env{ + status: 200, + body: File.read!("test/fixtures/emoji/packs/finmoji.json") + } + end) + + assert capture_io(fn -> Emoji.run(["get-packs", "finmoji"]) end) =~ "Writing pack.json for" + + emoji_path = + Path.join( + Pleroma.Config.get!([:instance, :static_dir]), + "emoji" + ) + + assert File.exists?(Path.join([emoji_path, "finmoji", "pack.json"])) + on_exit(fn -> File.rm_rf!("test/instance_static/emoji/finmoji") end) + end + + test "pack not found" do + mock(fn + %{ + method: :get, + url: "https://git.pleroma.social/pleroma/emoji-index/raw/master/index.json" + } -> + %Tesla.Env{ + status: 200, + body: File.read!("test/fixtures/emoji/packs/default-manifest.json") + } + end) + + assert capture_io(fn -> Emoji.run(["get-packs", "not_found"]) end) =~ + "No pack named \"not_found\" found" + end + + test "raise on bad sha256" do + mock(fn + %{ + method: :get, + url: "https://git.pleroma.social/pleroma/emoji-index/raw/master/packs/blobs_gg.zip" + } -> + %Tesla.Env{ + status: 200, + body: File.read!("test/fixtures/emoji/packs/blank.png.zip") + } + end) + + assert_raise RuntimeError, ~r/^Bad SHA256 for blobs.gg/, fn -> + capture_io(fn -> + Emoji.run(["get-packs", "blobs.gg", "-m", "test/fixtures/emoji/packs/manifest.json"]) + end) + end + end + end + + describe "gen-pack" do + setup do + url = "https://finland.fi/wp-content/uploads/2017/06/finland-emojis.zip" + + mock(fn %{ + method: :get, + url: ^url + } -> + %Tesla.Env{status: 200, body: File.read!("test/fixtures/emoji/packs/blank.png.zip")} + end) + + {:ok, url: url} + end + + test "with default extensions", %{url: url} do + name = "pack1" + pack_json = "#{name}.json" + files_json = "#{name}_file.json" + refute File.exists?(pack_json) + refute File.exists?(files_json) + + captured = + capture_io(fn -> + Emoji.run([ + "gen-pack", + url, + "--name", + name, + "--license", + "license", + "--homepage", + "homepage", + "--description", + "description", + "--files", + files_json, + "--extensions", + ".png .gif" + ]) + end) + + assert captured =~ "#{pack_json} has been created with the pack1 pack" + assert captured =~ "Using .png .gif extensions" + + assert File.exists?(pack_json) + assert File.exists?(files_json) + + on_exit(fn -> + File.rm!(pack_json) + File.rm!(files_json) + end) + end + + test "with custom extensions and update existing files", %{url: url} do + name = "pack2" + pack_json = "#{name}.json" + files_json = "#{name}_file.json" + refute File.exists?(pack_json) + refute File.exists?(files_json) + + captured = + capture_io(fn -> + Emoji.run([ + "gen-pack", + url, + "--name", + name, + "--license", + "license", + "--homepage", + "homepage", + "--description", + "description", + "--files", + files_json, + "--extensions", + " .png .gif .jpeg " + ]) + end) + + assert captured =~ "#{pack_json} has been created with the pack2 pack" + assert captured =~ "Using .png .gif .jpeg extensions" + + assert File.exists?(pack_json) + assert File.exists?(files_json) + + captured = + capture_io(fn -> + Emoji.run([ + "gen-pack", + url, + "--name", + name, + "--license", + "license", + "--homepage", + "homepage", + "--description", + "description", + "--files", + files_json, + "--extensions", + " .png .gif .jpeg " + ]) + end) + + assert captured =~ "#{pack_json} has been updated with the pack2 pack" + + on_exit(fn -> + File.rm!(pack_json) + File.rm!(files_json) + end) + end + end +end diff --git a/test/tasks/refresh_counter_cache_test.exs b/test/tasks/refresh_counter_cache_test.exs index b63f44c08..851971a77 100644 --- a/test/tasks/refresh_counter_cache_test.exs +++ b/test/tasks/refresh_counter_cache_test.exs @@ -12,26 +12,26 @@ test "counts statuses" do user = insert(:user) other_user = insert(:user) - CommonAPI.post(user, %{"visibility" => "public", "status" => "hey"}) + CommonAPI.post(user, %{visibility: "public", status: "hey"}) Enum.each(0..1, fn _ -> CommonAPI.post(user, %{ - "visibility" => "unlisted", - "status" => "hey" + visibility: "unlisted", + status: "hey" }) end) Enum.each(0..2, fn _ -> CommonAPI.post(user, %{ - "visibility" => "direct", - "status" => "hey @#{other_user.nickname}" + visibility: "direct", + status: "hey @#{other_user.nickname}" }) end) Enum.each(0..3, fn _ -> CommonAPI.post(user, %{ - "visibility" => "private", - "status" => "hey" + visibility: "private", + status: "hey" }) end) diff --git a/test/tasks/user_test.exs b/test/tasks/user_test.exs index b45f37263..4aa873f0b 100644 --- a/test/tasks/user_test.exs +++ b/test/tasks/user_test.exs @@ -3,15 +3,21 @@ # SPDX-License-Identifier: AGPL-3.0-only defmodule Mix.Tasks.Pleroma.UserTest do + alias Pleroma.Activity + alias Pleroma.Object alias Pleroma.Repo + alias Pleroma.Tests.ObanHelpers alias Pleroma.User + alias Pleroma.Web.CommonAPI alias Pleroma.Web.OAuth.Authorization alias Pleroma.Web.OAuth.Token use Pleroma.DataCase + use Oban.Testing, repo: Pleroma.Repo - import Pleroma.Factory import ExUnit.CaptureIO + import Mock + import Pleroma.Factory setup_all do Mix.shell(Mix.Shell.Process) @@ -87,12 +93,39 @@ test "user is not created" do test "user is deleted" do user = insert(:user) - Mix.Tasks.Pleroma.User.run(["rm", user.nickname]) + with_mock Pleroma.Web.Federator, + publish: fn _ -> nil end do + Mix.Tasks.Pleroma.User.run(["rm", user.nickname]) + ObanHelpers.perform_all() - assert_received {:mix_shell, :info, [message]} - assert message =~ " deleted" + assert_received {:mix_shell, :info, [message]} + assert message =~ " deleted" + assert %{deactivated: true} = User.get_by_nickname(user.nickname) - refute User.get_by_nickname(user.nickname) + assert called(Pleroma.Web.Federator.publish(:_)) + end + end + + test "a remote user's create activity is deleted when the object has been pruned" do + user = insert(:user) + + {:ok, post} = CommonAPI.post(user, %{status: "uguu"}) + object = Object.normalize(post) + Object.prune(object) + + with_mock Pleroma.Web.Federator, + publish: fn _ -> nil end do + Mix.Tasks.Pleroma.User.run(["rm", user.nickname]) + ObanHelpers.perform_all() + + assert_received {:mix_shell, :info, [message]} + assert message =~ " deleted" + assert %{deactivated: true} = User.get_by_nickname(user.nickname) + + assert called(Pleroma.Web.Federator.publish(:_)) + end + + refute Activity.get_by_id(post.id) end test "no user to delete" do @@ -140,7 +173,7 @@ test "no user to toggle" do test "user is unsubscribed" do followed = insert(:user) user = insert(:user) - User.follow(user, followed, "accept") + User.follow(user, followed, :follow_accept) Mix.Tasks.Pleroma.User.run(["unsubscribe", user.nickname]) diff --git a/test/test_helper.exs b/test/test_helper.exs index 6b91d2b46..ee880e226 100644 --- a/test/test_helper.exs +++ b/test/test_helper.exs @@ -6,7 +6,10 @@ ExUnit.start(exclude: [:federated | os_exclude]) Ecto.Adapters.SQL.Sandbox.mode(Pleroma.Repo, :manual) + Mox.defmock(Pleroma.ReverseProxy.ClientMock, for: Pleroma.ReverseProxy.Client) +Mox.defmock(Pleroma.GunMock, for: Pleroma.Gun) + {:ok, _} = Application.ensure_all_started(:ex_machina) ExUnit.after_suite(fn _results -> diff --git a/test/uploaders/s3_test.exs b/test/uploaders/s3_test.exs index 6950ccb25..d949c90a5 100644 --- a/test/uploaders/s3_test.exs +++ b/test/uploaders/s3_test.exs @@ -58,7 +58,7 @@ test "it returns path with bucket namespace when namespace is set" do name: "image-tet.jpg", content_type: "image/jpg", path: "test_folder/image-tet.jpg", - tempfile: Path.absname("test/fixtures/image_tmp.jpg") + tempfile: Path.absname("test/instance_static/add/shortcode.png") } [file_upload: file_upload] diff --git a/test/user_invite_token_test.exs b/test/user_invite_token_test.exs index 4f70ef337..63f18f13c 100644 --- a/test/user_invite_token_test.exs +++ b/test/user_invite_token_test.exs @@ -4,7 +4,6 @@ defmodule Pleroma.UserInviteTokenTest do use ExUnit.Case, async: true - use Pleroma.DataCase alias Pleroma.UserInviteToken describe "valid_invite?/1 one time invites" do @@ -64,7 +63,6 @@ test "expires today returns true", %{invite: invite} do test "expires yesterday returns false", %{invite: invite} do invite = %{invite | expires_at: Date.add(Date.utc_today(), -1)} - invite = Repo.insert!(invite) refute UserInviteToken.valid_invite?(invite) end end @@ -82,7 +80,6 @@ test "not overdue date and less uses returns true", %{invite: invite} do test "overdue date and less uses returns false", %{invite: invite} do invite = %{invite | expires_at: Date.add(Date.utc_today(), -1)} - invite = Repo.insert!(invite) refute UserInviteToken.valid_invite?(invite) end @@ -93,7 +90,6 @@ test "not overdue date with more uses returns false", %{invite: invite} do test "overdue date with more uses returns false", %{invite: invite} do invite = %{invite | expires_at: Date.add(Date.utc_today(), -1), uses: 5} - invite = Repo.insert!(invite) refute UserInviteToken.valid_invite?(invite) end end diff --git a/test/user_search_test.exs b/test/user_search_test.exs index cb847b516..17c63322a 100644 --- a/test/user_search_test.exs +++ b/test/user_search_test.exs @@ -172,6 +172,7 @@ test "works with URIs" do |> Map.put(:search_rank, nil) |> Map.put(:search_type, nil) |> Map.put(:last_digest_emailed_at, nil) + |> Map.put(:multi_factor_authentication_settings, nil) |> Map.put(:notification_settings, nil) assert user == expected diff --git a/test/user_test.exs b/test/user_test.exs index 119a36ec1..6b9df60a4 100644 --- a/test/user_test.exs +++ b/test/user_test.exs @@ -15,7 +15,6 @@ defmodule Pleroma.UserTest do use Pleroma.DataCase use Oban.Testing, repo: Pleroma.Repo - import Mock import Pleroma.Factory import ExUnit.CaptureLog @@ -86,7 +85,7 @@ test "returns invisible actor" do {:ok, user: insert(:user)} end - test "outgoing_relations_ap_ids/1", %{user: user} do + test "outgoing_relationships_ap_ids/1", %{user: user} do rel_types = [:block, :mute, :notification_mute, :reblog_mute, :inverse_subscription] ap_ids_by_rel = @@ -124,10 +123,10 @@ test "outgoing_relations_ap_ids/1", %{user: user} do assert ap_ids_by_rel[:inverse_subscription] == Enum.sort(Enum.map(User.subscriber_users(user), & &1.ap_id)) - outgoing_relations_ap_ids = User.outgoing_relations_ap_ids(user, rel_types) + outgoing_relationships_ap_ids = User.outgoing_relationships_ap_ids(user, rel_types) assert ap_ids_by_rel == - Enum.into(outgoing_relations_ap_ids, %{}, fn {k, v} -> {k, Enum.sort(v)} end) + Enum.into(outgoing_relationships_ap_ids, %{}, fn {k, v} -> {k, Enum.sort(v)} end) end end @@ -194,7 +193,8 @@ test "doesn't return already accepted or duplicate follow requests" do CommonAPI.follow(pending_follower, locked) CommonAPI.follow(pending_follower, locked) CommonAPI.follow(accepted_follower, locked) - Pleroma.FollowingRelationship.update(accepted_follower, locked, "accept") + + Pleroma.FollowingRelationship.update(accepted_follower, locked, :follow_accept) assert [^pending_follower] = User.get_follow_requests(locked) end @@ -319,7 +319,7 @@ test "unfollow with syncronizes external user" do following_address: "http://localhost:4001/users/fuser2/following" }) - {:ok, user} = User.follow(user, followed, "accept") + {:ok, user} = User.follow(user, followed, :follow_accept) {:ok, user, _activity} = User.unfollow(user, followed) @@ -332,7 +332,7 @@ test "unfollow takes a user and another user" do followed = insert(:user) user = insert(:user) - {:ok, user} = User.follow(user, followed, "accept") + {:ok, user} = User.follow(user, followed, :follow_accept) assert User.following(user) == [user.follower_address, followed.follower_address] @@ -353,7 +353,7 @@ test "unfollow doesn't unfollow yourself" do test "test if a user is following another user" do followed = insert(:user) user = insert(:user) - User.follow(user, followed, "accept") + User.follow(user, followed, :follow_accept) assert User.following?(user, followed) refute User.following?(followed, user) @@ -581,7 +581,7 @@ test "updates an existing user, if stale" do {:ok, user} = User.get_or_fetch_by_ap_id("http://mastodon.example.org/users/admin") - assert user.source_data["endpoints"] + assert user.inbox refute user.last_refreshed_at == orig_user.last_refreshed_at end @@ -609,7 +609,7 @@ test "returns an ap_followers link for a user" do ) <> "/followers" end - describe "remote user creation changeset" do + describe "remote user changeset" do @valid_remote %{ bio: "hello", name: "Someone", @@ -621,28 +621,28 @@ test "returns an ap_followers link for a user" do setup do: clear_config([:instance, :user_name_length]) test "it confirms validity" do - cs = User.remote_user_creation(@valid_remote) + cs = User.remote_user_changeset(@valid_remote) assert cs.valid? end test "it sets the follower_adress" do - cs = User.remote_user_creation(@valid_remote) + cs = User.remote_user_changeset(@valid_remote) # remote users get a fake local follower address assert cs.changes.follower_address == User.ap_followers(%User{nickname: @valid_remote[:nickname]}) end test "it enforces the fqn format for nicknames" do - cs = User.remote_user_creation(%{@valid_remote | nickname: "bla"}) + cs = User.remote_user_changeset(%{@valid_remote | nickname: "bla"}) assert Ecto.Changeset.get_field(cs, :local) == false assert cs.changes.avatar refute cs.valid? end test "it has required fields" do - [:name, :ap_id] + [:ap_id] |> Enum.each(fn field -> - cs = User.remote_user_creation(Map.delete(@valid_remote, field)) + cs = User.remote_user_changeset(Map.delete(@valid_remote, field)) refute cs.valid? end) end @@ -755,8 +755,8 @@ test "it imports user followings from list" do ] {:ok, job} = User.follow_import(user1, identifiers) - result = ObanHelpers.perform(job) + assert {:ok, result} = ObanHelpers.perform(job) assert is_list(result) assert result == [user2, user3] end @@ -978,14 +978,26 @@ test "it imports user blocks from list" do ] {:ok, job} = User.blocks_import(user1, identifiers) - result = ObanHelpers.perform(job) + assert {:ok, result} = ObanHelpers.perform(job) assert is_list(result) assert result == [user2, user3] end end describe "get_recipients_from_activity" do + test "works for announces" do + actor = insert(:user) + user = insert(:user, local: true) + + {:ok, activity} = CommonAPI.post(actor, %{status: "hello"}) + {:ok, announce, _} = CommonAPI.repeat(activity.id, user) + + recipients = User.get_recipients_from_activity(announce) + + assert user in recipients + end + test "get recipients" do actor = insert(:user) user = insert(:user, local: true) @@ -995,7 +1007,7 @@ test "get recipients" do {:ok, activity} = CommonAPI.post(actor, %{ - "status" => "hey @#{addressed.nickname} @#{addressed_remote.nickname}" + status: "hey @#{addressed.nickname} @#{addressed_remote.nickname}" }) assert Enum.map([actor, addressed], & &1.ap_id) -- @@ -1017,7 +1029,7 @@ test "has following" do {:ok, activity} = CommonAPI.post(actor, %{ - "status" => "hey @#{addressed.nickname}" + status: "hey @#{addressed.nickname}" }) assert Enum.map([actor, addressed], & &1.ap_id) -- @@ -1078,7 +1090,7 @@ test "hide a user's statuses from timelines and notifications" do {:ok, user2} = User.follow(user2, user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "hey @#{user2.nickname}"}) + {:ok, activity} = CommonAPI.post(user, %{status: "hey @#{user2.nickname}"}) activity = Repo.preload(activity, :bookmark) @@ -1114,24 +1126,15 @@ test "hide a user's statuses from timelines and notifications" do setup do: clear_config([:instance, :federating]) test ".delete_user_activities deletes all create activities", %{user: user} do - {:ok, activity} = CommonAPI.post(user, %{"status" => "2hu"}) + {:ok, activity} = CommonAPI.post(user, %{status: "2hu"}) User.delete_user_activities(user) - # TODO: Remove favorites, repeats, delete activities. + # TODO: Test removal favorites, repeats, delete activities. refute Activity.get_by_id(activity.id) end - test "it deletes deactivated user" do - {:ok, user} = insert(:user, deactivated: true) |> User.set_cache() - - {:ok, job} = User.delete(user) - {:ok, _user} = ObanHelpers.perform(job) - - refute User.get_by_id(user.id) - end - - test "it deletes a user, all follow relationships and all activities", %{user: user} do + test "it deactivates a user, all follow relationships and all activities", %{user: user} do follower = insert(:user) {:ok, follower} = User.follow(follower, user) @@ -1141,8 +1144,8 @@ test "it deletes a user, all follow relationships and all activities", %{user: u object_two = insert(:note, user: follower) activity_two = insert(:note_activity, user: follower, note: object_two) - {:ok, like, _} = CommonAPI.favorite(activity_two.id, user) - {:ok, like_two, _} = CommonAPI.favorite(activity.id, follower) + {:ok, like} = CommonAPI.favorite(user, activity_two.id) + {:ok, like_two} = CommonAPI.favorite(follower, activity.id) {:ok, repeat, _} = CommonAPI.repeat(activity_two.id, user) {:ok, job} = User.delete(user) @@ -1151,8 +1154,7 @@ test "it deletes a user, all follow relationships and all activities", %{user: u follower = User.get_cached_by_id(follower.id) refute User.following?(follower, user) - refute User.get_by_id(user.id) - assert {:ok, nil} == Cachex.get(:user_cache, "ap_id:#{user.ap_id}") + assert %{deactivated: true} = User.get_by_id(user.id) user_activities = user.ap_id @@ -1167,89 +1169,12 @@ test "it deletes a user, all follow relationships and all activities", %{user: u refute Activity.get_by_id(like_two.id) refute Activity.get_by_id(repeat.id) end - - test_with_mock "it sends out User Delete activity", - %{user: user}, - Pleroma.Web.ActivityPub.Publisher, - [:passthrough], - [] do - Pleroma.Config.put([:instance, :federating], true) - - {:ok, follower} = User.get_or_fetch_by_ap_id("http://mastodon.example.org/users/admin") - {:ok, _} = User.follow(follower, user) - - {:ok, job} = User.delete(user) - {:ok, _user} = ObanHelpers.perform(job) - - assert ObanHelpers.member?( - %{ - "op" => "publish_one", - "params" => %{ - "inbox" => "http://mastodon.example.org/inbox", - "id" => "pleroma:fakeid" - } - }, - all_enqueued(worker: Pleroma.Workers.PublisherWorker) - ) - end end test "get_public_key_for_ap_id fetches a user that's not in the db" do assert {:ok, _key} = User.get_public_key_for_ap_id("http://mastodon.example.org/users/admin") end - describe "insert or update a user from given data" do - test "with normal data" do - user = insert(:user, %{nickname: "nick@name.de"}) - data = %{ap_id: user.ap_id <> "xxx", name: user.name, nickname: user.nickname} - - assert {:ok, %User{}} = User.insert_or_update_user(data) - end - - test "with overly long fields" do - current_max_length = Pleroma.Config.get([:instance, :account_field_value_length], 255) - user = insert(:user, nickname: "nickname@supergood.domain") - - data = %{ - ap_id: user.ap_id, - name: user.name, - nickname: user.nickname, - fields: [ - %{"name" => "myfield", "value" => String.duplicate("h", current_max_length + 1)} - ] - } - - assert {:ok, %User{}} = User.insert_or_update_user(data) - end - - test "with an overly long bio" do - current_max_length = Pleroma.Config.get([:instance, :user_bio_length], 5000) - user = insert(:user, nickname: "nickname@supergood.domain") - - data = %{ - ap_id: user.ap_id, - name: user.name, - nickname: user.nickname, - bio: String.duplicate("h", current_max_length + 1) - } - - assert {:ok, %User{}} = User.insert_or_update_user(data) - end - - test "with an overly long display name" do - current_max_length = Pleroma.Config.get([:instance, :user_name_length], 100) - user = insert(:user, nickname: "nickname@supergood.domain") - - data = %{ - ap_id: user.ap_id, - name: String.duplicate("h", current_max_length + 1), - nickname: user.nickname - } - - assert {:ok, %User{}} = User.insert_or_update_user(data) - end - end - describe "per-user rich-text filtering" do test "html_filter_policy returns default policies, when rich-text is enabled" do user = insert(:user) @@ -1404,7 +1329,7 @@ test "preserves hosts in user links text" do bio = "A.k.a. @nick@domain.com" expected_text = - ~s(A.k.a. @nick@domain.com) @@ -1486,7 +1411,7 @@ test "Only includes users who has no recent activity" do {:ok, _} = CommonAPI.post(user, %{ - "status" => "hey @#{to.nickname}" + status: "hey @#{to.nickname}" }) end) @@ -1518,12 +1443,12 @@ test "Only includes users with no read notifications" do Enum.each(recipients, fn to -> {:ok, _} = CommonAPI.post(sender, %{ - "status" => "hey @#{to.nickname}" + status: "hey @#{to.nickname}" }) {:ok, _} = CommonAPI.post(sender, %{ - "status" => "hey again @#{to.nickname}" + status: "hey again @#{to.nickname}" }) end) diff --git a/test/web/activity_pub/activity_pub_controller_test.exs b/test/web/activity_pub/activity_pub_controller_test.exs index 573853afa..c432c90e3 100644 --- a/test/web/activity_pub/activity_pub_controller_test.exs +++ b/test/web/activity_pub/activity_pub_controller_test.exs @@ -341,7 +341,7 @@ test "it caches a response", %{conn: conn} do test "cached purged after activity deletion", %{conn: conn} do user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "cofe"}) + {:ok, activity} = CommonAPI.post(user, %{status: "cofe"}) uuid = String.split(activity.data["id"], "/") |> List.last() @@ -765,51 +765,110 @@ test "it requires authentication if instance is NOT federating", %{ end end - describe "POST /users/:nickname/outbox" do - test "it rejects posts from other users / unauuthenticated users", %{conn: conn} do - data = File.read!("test/fixtures/activitypub-client-post-activity.json") |> Poison.decode!() + describe "POST /users/:nickname/outbox (C2S)" do + setup do + [ + activity: %{ + "@context" => "https://www.w3.org/ns/activitystreams", + "type" => "Create", + "object" => %{"type" => "Note", "content" => "AP C2S test"}, + "to" => "https://www.w3.org/ns/activitystreams#Public", + "cc" => [] + } + ] + end + + test "it rejects posts from other users / unauthenticated users", %{ + conn: conn, + activity: activity + } do user = insert(:user) other_user = insert(:user) conn = put_req_header(conn, "content-type", "application/activity+json") conn - |> post("/users/#{user.nickname}/outbox", data) + |> post("/users/#{user.nickname}/outbox", activity) |> json_response(403) conn |> assign(:user, other_user) - |> post("/users/#{user.nickname}/outbox", data) + |> post("/users/#{user.nickname}/outbox", activity) |> json_response(403) end - test "it inserts an incoming create activity into the database", %{conn: conn} do - data = File.read!("test/fixtures/activitypub-client-post-activity.json") |> Poison.decode!() + test "it inserts an incoming create activity into the database", %{ + conn: conn, + activity: activity + } do user = insert(:user) - conn = + result = conn |> assign(:user, user) |> put_req_header("content-type", "application/activity+json") - |> post("/users/#{user.nickname}/outbox", data) - - result = json_response(conn, 201) + |> post("/users/#{user.nickname}/outbox", activity) + |> json_response(201) assert Activity.get_by_ap_id(result["id"]) + assert result["object"] + assert %Object{data: object} = Object.normalize(result["object"]) + assert object["content"] == activity["object"]["content"] end - test "it rejects an incoming activity with bogus type", %{conn: conn} do - data = File.read!("test/fixtures/activitypub-client-post-activity.json") |> Poison.decode!() + test "it rejects anything beyond 'Note' creations", %{conn: conn, activity: activity} do user = insert(:user) - data = - data - |> Map.put("type", "BadType") + activity = + activity + |> put_in(["object", "type"], "Benis") + + _result = + conn + |> assign(:user, user) + |> put_req_header("content-type", "application/activity+json") + |> post("/users/#{user.nickname}/outbox", activity) + |> json_response(400) + end + + test "it inserts an incoming sensitive activity into the database", %{ + conn: conn, + activity: activity + } do + user = insert(:user) + conn = assign(conn, :user, user) + object = Map.put(activity["object"], "sensitive", true) + activity = Map.put(activity, "object", object) + + response = + conn + |> put_req_header("content-type", "application/activity+json") + |> post("/users/#{user.nickname}/outbox", activity) + |> json_response(201) + + assert Activity.get_by_ap_id(response["id"]) + assert response["object"] + assert %Object{data: response_object} = Object.normalize(response["object"]) + assert response_object["sensitive"] == true + assert response_object["content"] == activity["object"]["content"] + + representation = + conn + |> put_req_header("accept", "application/activity+json") + |> get(response["id"]) + |> json_response(200) + + assert representation["object"]["sensitive"] == true + end + + test "it rejects an incoming activity with bogus type", %{conn: conn, activity: activity} do + user = insert(:user) + activity = Map.put(activity, "type", "BadType") conn = conn |> assign(:user, user) |> put_req_header("content-type", "application/activity+json") - |> post("/users/#{user.nickname}/outbox", data) + |> post("/users/#{user.nickname}/outbox", activity) assert json_response(conn, 400) end @@ -1019,12 +1078,12 @@ test "it works for more than 10 users", %{conn: conn} do assert result["totalItems"] == 15 end - test "returns 403 if requester is not logged in", %{conn: conn} do + test "does not require authentication", %{conn: conn} do user = insert(:user) conn |> get("/users/#{user.nickname}/followers") - |> json_response(403) + |> json_response(200) end end @@ -1116,12 +1175,12 @@ test "it works for more than 10 users", %{conn: conn} do assert result["totalItems"] == 15 end - test "returns 403 if requester is not logged in", %{conn: conn} do + test "does not require authentication", %{conn: conn} do user = insert(:user) conn |> get("/users/#{user.nickname}/following") - |> json_response(403) + |> json_response(200) end end @@ -1239,16 +1298,56 @@ test "POST /api/ap/upload_media", %{conn: conn} do filename: "an_image.jpg" } - conn = + object = conn |> assign(:user, user) |> post("/api/ap/upload_media", %{"file" => image, "description" => desc}) + |> json_response(:created) - assert object = json_response(conn, :created) assert object["name"] == desc assert object["type"] == "Document" assert object["actor"] == user.ap_id + assert [%{"href" => object_href, "mediaType" => object_mediatype}] = object["url"] + assert is_binary(object_href) + assert object_mediatype == "image/jpeg" + activity_request = %{ + "@context" => "https://www.w3.org/ns/activitystreams", + "type" => "Create", + "object" => %{ + "type" => "Note", + "content" => "AP C2S test, attachment", + "attachment" => [object] + }, + "to" => "https://www.w3.org/ns/activitystreams#Public", + "cc" => [] + } + + activity_response = + conn + |> assign(:user, user) + |> post("/users/#{user.nickname}/outbox", activity_request) + |> json_response(:created) + + assert activity_response["id"] + assert activity_response["object"] + assert activity_response["actor"] == user.ap_id + + assert %Object{data: %{"attachment" => [attachment]}} = + Object.normalize(activity_response["object"]) + + assert attachment["type"] == "Document" + assert attachment["name"] == desc + + assert [ + %{ + "href" => ^object_href, + "type" => "Link", + "mediaType" => ^object_mediatype + } + ] = attachment["url"] + + # Fails if unauthenticated conn |> post("/api/ap/upload_media", %{"file" => image, "description" => desc}) |> json_response(403) diff --git a/test/web/activity_pub/activity_pub_test.exs b/test/web/activity_pub/activity_pub_test.exs index a43dd34f0..77bd07edf 100644 --- a/test/web/activity_pub/activity_pub_test.exs +++ b/test/web/activity_pub/activity_pub_test.exs @@ -16,11 +16,11 @@ defmodule Pleroma.Web.ActivityPub.ActivityPubTest do alias Pleroma.Web.ActivityPub.Utils alias Pleroma.Web.AdminAPI.AccountView alias Pleroma.Web.CommonAPI - alias Pleroma.Web.Federator + import ExUnit.CaptureLog + import Mock import Pleroma.Factory import Tesla.Mock - import Mock setup do mock(fn env -> apply(HttpRequestMock, :request, [env]) end) @@ -32,7 +32,7 @@ defmodule Pleroma.Web.ActivityPub.ActivityPubTest do describe "streaming out participations" do test "it streams them out" do user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => ".", "visibility" => "direct"}) + {:ok, activity} = CommonAPI.post(user, %{status: ".", visibility: "direct"}) {:ok, conversation} = Pleroma.Conversation.create_or_bump_for(activity) @@ -56,8 +56,8 @@ test "streams them out on activity creation" do stream: fn _, _ -> nil end do {:ok, activity} = CommonAPI.post(user_one, %{ - "status" => "@#{user_two.nickname}", - "visibility" => "direct" + status: "@#{user_two.nickname}", + visibility: "direct" }) conversation = @@ -74,15 +74,13 @@ test "streams them out on activity creation" do test "it restricts by the appropriate visibility" do user = insert(:user) - {:ok, public_activity} = CommonAPI.post(user, %{"status" => ".", "visibility" => "public"}) + {:ok, public_activity} = CommonAPI.post(user, %{status: ".", visibility: "public"}) - {:ok, direct_activity} = CommonAPI.post(user, %{"status" => ".", "visibility" => "direct"}) + {:ok, direct_activity} = CommonAPI.post(user, %{status: ".", visibility: "direct"}) - {:ok, unlisted_activity} = - CommonAPI.post(user, %{"status" => ".", "visibility" => "unlisted"}) + {:ok, unlisted_activity} = CommonAPI.post(user, %{status: ".", visibility: "unlisted"}) - {:ok, private_activity} = - CommonAPI.post(user, %{"status" => ".", "visibility" => "private"}) + {:ok, private_activity} = CommonAPI.post(user, %{status: ".", visibility: "private"}) activities = ActivityPub.fetch_activities([], %{:visibility => "direct", "actor_id" => user.ap_id}) @@ -118,15 +116,13 @@ test "it restricts by the appropriate visibility" do test "it excludes by the appropriate visibility" do user = insert(:user) - {:ok, public_activity} = CommonAPI.post(user, %{"status" => ".", "visibility" => "public"}) + {:ok, public_activity} = CommonAPI.post(user, %{status: ".", visibility: "public"}) - {:ok, direct_activity} = CommonAPI.post(user, %{"status" => ".", "visibility" => "direct"}) + {:ok, direct_activity} = CommonAPI.post(user, %{status: ".", visibility: "direct"}) - {:ok, unlisted_activity} = - CommonAPI.post(user, %{"status" => ".", "visibility" => "unlisted"}) + {:ok, unlisted_activity} = CommonAPI.post(user, %{status: ".", visibility: "unlisted"}) - {:ok, private_activity} = - CommonAPI.post(user, %{"status" => ".", "visibility" => "private"}) + {:ok, private_activity} = CommonAPI.post(user, %{status: ".", visibility: "private"}) activities = ActivityPub.fetch_activities([], %{ @@ -180,7 +176,6 @@ test "it returns a user" do {:ok, user} = ActivityPub.make_user_from_ap_id(user_id) assert user.ap_id == user_id assert user.nickname == "admin@mastodon.example.org" - assert user.source_data assert user.ap_enabled assert user.follower_address == "http://mastodon.example.org/users/admin/followers" end @@ -194,9 +189,9 @@ test "it returns a user that is invisible" do test "it fetches the appropriate tag-restricted posts" do user = insert(:user) - {:ok, status_one} = CommonAPI.post(user, %{"status" => ". #test"}) - {:ok, status_two} = CommonAPI.post(user, %{"status" => ". #essais"}) - {:ok, status_three} = CommonAPI.post(user, %{"status" => ". #test #reject"}) + {:ok, status_one} = CommonAPI.post(user, %{status: ". #test"}) + {:ok, status_two} = CommonAPI.post(user, %{status: ". #essais"}) + {:ok, status_three} = CommonAPI.post(user, %{status: ". #test #reject"}) fetch_one = ActivityPub.fetch_activities([], %{"type" => "Create", "tag" => "test"}) @@ -433,26 +428,26 @@ test "increases user note count only for public activities" do {:ok, _} = CommonAPI.post(User.get_cached_by_id(user.id), %{ - "status" => "1", - "visibility" => "public" + status: "1", + visibility: "public" }) {:ok, _} = CommonAPI.post(User.get_cached_by_id(user.id), %{ - "status" => "2", - "visibility" => "unlisted" + status: "2", + visibility: "unlisted" }) {:ok, _} = CommonAPI.post(User.get_cached_by_id(user.id), %{ - "status" => "2", - "visibility" => "private" + status: "2", + visibility: "private" }) {:ok, _} = CommonAPI.post(User.get_cached_by_id(user.id), %{ - "status" => "3", - "visibility" => "direct" + status: "3", + visibility: "direct" }) user = User.get_cached_by_id(user.id) @@ -463,27 +458,27 @@ test "increases replies count" do user = insert(:user) user2 = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "1", "visibility" => "public"}) + {:ok, activity} = CommonAPI.post(user, %{status: "1", visibility: "public"}) ap_id = activity.data["id"] - reply_data = %{"status" => "1", "in_reply_to_status_id" => activity.id} + reply_data = %{status: "1", in_reply_to_status_id: activity.id} # public - {:ok, _} = CommonAPI.post(user2, Map.put(reply_data, "visibility", "public")) + {:ok, _} = CommonAPI.post(user2, Map.put(reply_data, :visibility, "public")) assert %{data: data, object: object} = Activity.get_by_ap_id_with_object(ap_id) assert object.data["repliesCount"] == 1 # unlisted - {:ok, _} = CommonAPI.post(user2, Map.put(reply_data, "visibility", "unlisted")) + {:ok, _} = CommonAPI.post(user2, Map.put(reply_data, :visibility, "unlisted")) assert %{data: data, object: object} = Activity.get_by_ap_id_with_object(ap_id) assert object.data["repliesCount"] == 2 # private - {:ok, _} = CommonAPI.post(user2, Map.put(reply_data, "visibility", "private")) + {:ok, _} = CommonAPI.post(user2, Map.put(reply_data, :visibility, "private")) assert %{data: data, object: object} = Activity.get_by_ap_id_with_object(ap_id) assert object.data["repliesCount"] == 2 # direct - {:ok, _} = CommonAPI.post(user2, Map.put(reply_data, "visibility", "direct")) + {:ok, _} = CommonAPI.post(user2, Map.put(reply_data, :visibility, "direct")) assert %{data: data, object: object} = Activity.get_by_ap_id_with_object(ap_id) assert object.data["repliesCount"] == 2 end @@ -570,13 +565,13 @@ test "doesn't return transitive interactions concerning blocked users" do {:ok, _user_relationship} = User.block(blocker, blockee) - {:ok, activity_one} = CommonAPI.post(friend, %{"status" => "hey!"}) + {:ok, activity_one} = CommonAPI.post(friend, %{status: "hey!"}) - {:ok, activity_two} = CommonAPI.post(friend, %{"status" => "hey! @#{blockee.nickname}"}) + {:ok, activity_two} = CommonAPI.post(friend, %{status: "hey! @#{blockee.nickname}"}) - {:ok, activity_three} = CommonAPI.post(blockee, %{"status" => "hey! @#{friend.nickname}"}) + {:ok, activity_three} = CommonAPI.post(blockee, %{status: "hey! @#{friend.nickname}"}) - {:ok, activity_four} = CommonAPI.post(blockee, %{"status" => "hey! @#{blocker.nickname}"}) + {:ok, activity_four} = CommonAPI.post(blockee, %{status: "hey! @#{blocker.nickname}"}) activities = ActivityPub.fetch_activities([], %{"blocking_user" => blocker}) @@ -593,9 +588,9 @@ test "doesn't return announce activities concerning blocked users" do {:ok, _user_relationship} = User.block(blocker, blockee) - {:ok, activity_one} = CommonAPI.post(friend, %{"status" => "hey!"}) + {:ok, activity_one} = CommonAPI.post(friend, %{status: "hey!"}) - {:ok, activity_two} = CommonAPI.post(blockee, %{"status" => "hey! @#{friend.nickname}"}) + {:ok, activity_two} = CommonAPI.post(blockee, %{status: "hey! @#{friend.nickname}"}) {:ok, activity_three, _} = CommonAPI.repeat(activity_two.id, friend) @@ -775,10 +770,9 @@ test "excludes reblogs on request" do test "doesn't retrieve unlisted activities" do user = insert(:user) - {:ok, _unlisted_activity} = - CommonAPI.post(user, %{"status" => "yeah", "visibility" => "unlisted"}) + {:ok, _unlisted_activity} = CommonAPI.post(user, %{status: "yeah", visibility: "unlisted"}) - {:ok, listed_activity} = CommonAPI.post(user, %{"status" => "yeah"}) + {:ok, listed_activity} = CommonAPI.post(user, %{status: "yeah"}) [activity] = ActivityPub.fetch_public_activities() @@ -874,250 +868,6 @@ test "returns reblogs for users for whom reblogs have not been muted" do end end - describe "react to an object" do - test_with_mock "sends an activity to federation", Federator, [:passthrough], [] do - Config.put([:instance, :federating], true) - user = insert(:user) - reactor = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "YASSSS queen slay"}) - assert object = Object.normalize(activity) - - {:ok, reaction_activity, _object} = ActivityPub.react_with_emoji(reactor, object, "🔥") - - assert called(Federator.publish(reaction_activity)) - end - - test "adds an emoji reaction activity to the db" do - user = insert(:user) - reactor = insert(:user) - third_user = insert(:user) - fourth_user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "YASSSS queen slay"}) - assert object = Object.normalize(activity) - - {:ok, reaction_activity, object} = ActivityPub.react_with_emoji(reactor, object, "🔥") - - assert reaction_activity - - assert reaction_activity.data["actor"] == reactor.ap_id - assert reaction_activity.data["type"] == "EmojiReact" - assert reaction_activity.data["content"] == "🔥" - assert reaction_activity.data["object"] == object.data["id"] - assert reaction_activity.data["to"] == [User.ap_followers(reactor), activity.data["actor"]] - assert reaction_activity.data["context"] == object.data["context"] - assert object.data["reaction_count"] == 1 - assert object.data["reactions"] == [["🔥", [reactor.ap_id]]] - - {:ok, _reaction_activity, object} = ActivityPub.react_with_emoji(third_user, object, "☕") - - assert object.data["reaction_count"] == 2 - assert object.data["reactions"] == [["🔥", [reactor.ap_id]], ["☕", [third_user.ap_id]]] - - {:ok, _reaction_activity, object} = ActivityPub.react_with_emoji(fourth_user, object, "🔥") - - assert object.data["reaction_count"] == 3 - - assert object.data["reactions"] == [ - ["🔥", [fourth_user.ap_id, reactor.ap_id]], - ["☕", [third_user.ap_id]] - ] - end - - test "reverts emoji reaction on error" do - [user, reactor] = insert_list(2, :user) - - {:ok, activity} = CommonAPI.post(user, %{"status" => "Status"}) - object = Object.normalize(activity) - - with_mock(Utils, [:passthrough], maybe_federate: fn _ -> {:error, :reverted} end) do - assert {:error, :reverted} = ActivityPub.react_with_emoji(reactor, object, "😀") - end - - object = Object.get_by_ap_id(object.data["id"]) - refute object.data["reaction_count"] - refute object.data["reactions"] - end - end - - describe "unreacting to an object" do - test_with_mock "sends an activity to federation", Federator, [:passthrough], [] do - Config.put([:instance, :federating], true) - user = insert(:user) - reactor = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "YASSSS queen slay"}) - assert object = Object.normalize(activity) - - {:ok, reaction_activity, _object} = ActivityPub.react_with_emoji(reactor, object, "🔥") - - assert called(Federator.publish(reaction_activity)) - - {:ok, unreaction_activity, _object} = - ActivityPub.unreact_with_emoji(reactor, reaction_activity.data["id"]) - - assert called(Federator.publish(unreaction_activity)) - end - - test "adds an undo activity to the db" do - user = insert(:user) - reactor = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "YASSSS queen slay"}) - assert object = Object.normalize(activity) - - {:ok, reaction_activity, _object} = ActivityPub.react_with_emoji(reactor, object, "🔥") - - {:ok, unreaction_activity, _object} = - ActivityPub.unreact_with_emoji(reactor, reaction_activity.data["id"]) - - assert unreaction_activity.actor == reactor.ap_id - assert unreaction_activity.data["object"] == reaction_activity.data["id"] - - object = Object.get_by_ap_id(object.data["id"]) - assert object.data["reaction_count"] == 0 - assert object.data["reactions"] == [] - end - - test "reverts emoji unreact on error" do - [user, reactor] = insert_list(2, :user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "Status"}) - object = Object.normalize(activity) - - {:ok, reaction_activity, _object} = ActivityPub.react_with_emoji(reactor, object, "😀") - - with_mock(Utils, [:passthrough], maybe_federate: fn _ -> {:error, :reverted} end) do - assert {:error, :reverted} = - ActivityPub.unreact_with_emoji(reactor, reaction_activity.data["id"]) - end - - object = Object.get_by_ap_id(object.data["id"]) - - assert object.data["reaction_count"] == 1 - assert object.data["reactions"] == [["😀", [reactor.ap_id]]] - end - end - - describe "like an object" do - test_with_mock "sends an activity to federation", Federator, [:passthrough], [] do - Config.put([:instance, :federating], true) - note_activity = insert(:note_activity) - assert object_activity = Object.normalize(note_activity) - - user = insert(:user) - - {:ok, like_activity, _object} = ActivityPub.like(user, object_activity) - assert called(Federator.publish(like_activity)) - end - - test "returns exist activity if object already liked" do - note_activity = insert(:note_activity) - assert object_activity = Object.normalize(note_activity) - - user = insert(:user) - - {:ok, like_activity, _object} = ActivityPub.like(user, object_activity) - - {:ok, like_activity_exist, _object} = ActivityPub.like(user, object_activity) - assert like_activity == like_activity_exist - end - - test "reverts like activity on error" do - note_activity = insert(:note_activity) - object = Object.normalize(note_activity) - user = insert(:user) - - with_mock(Utils, [:passthrough], maybe_federate: fn _ -> {:error, :reverted} end) do - assert {:error, :reverted} = ActivityPub.like(user, object) - end - - assert Repo.aggregate(Activity, :count, :id) == 1 - assert Repo.get(Object, object.id) == object - end - - test "adds a like activity to the db" do - note_activity = insert(:note_activity) - assert object = Object.normalize(note_activity) - - user = insert(:user) - user_two = insert(:user) - - {:ok, like_activity, object} = ActivityPub.like(user, object) - - assert like_activity.data["actor"] == user.ap_id - assert like_activity.data["type"] == "Like" - assert like_activity.data["object"] == object.data["id"] - assert like_activity.data["to"] == [User.ap_followers(user), note_activity.data["actor"]] - assert like_activity.data["context"] == object.data["context"] - assert object.data["like_count"] == 1 - assert object.data["likes"] == [user.ap_id] - - # Just return the original activity if the user already liked it. - {:ok, same_like_activity, object} = ActivityPub.like(user, object) - - assert like_activity == same_like_activity - assert object.data["likes"] == [user.ap_id] - assert object.data["like_count"] == 1 - - {:ok, _like_activity, object} = ActivityPub.like(user_two, object) - assert object.data["like_count"] == 2 - end - end - - describe "unliking" do - test_with_mock "sends an activity to federation", Federator, [:passthrough], [] do - Config.put([:instance, :federating], true) - - note_activity = insert(:note_activity) - object = Object.normalize(note_activity) - user = insert(:user) - - {:ok, object} = ActivityPub.unlike(user, object) - refute called(Federator.publish()) - - {:ok, _like_activity, object} = ActivityPub.like(user, object) - assert object.data["like_count"] == 1 - - {:ok, unlike_activity, _, object} = ActivityPub.unlike(user, object) - assert object.data["like_count"] == 0 - - assert called(Federator.publish(unlike_activity)) - end - - test "reverts unliking on error" do - note_activity = insert(:note_activity) - object = Object.normalize(note_activity) - user = insert(:user) - - {:ok, like_activity, object} = ActivityPub.like(user, object) - assert object.data["like_count"] == 1 - - with_mock(Utils, [:passthrough], maybe_federate: fn _ -> {:error, :reverted} end) do - assert {:error, :reverted} = ActivityPub.unlike(user, object) - end - - assert Object.get_by_ap_id(object.data["id"]) == object - assert object.data["like_count"] == 1 - assert Activity.get_by_id(like_activity.id) - end - - test "unliking a previously liked object" do - note_activity = insert(:note_activity) - object = Object.normalize(note_activity) - user = insert(:user) - - # Unliking something that hasn't been liked does nothing - {:ok, object} = ActivityPub.unlike(user, object) - assert object.data["like_count"] == 0 - - {:ok, like_activity, object} = ActivityPub.like(user, object) - assert object.data["like_count"] == 1 - - {:ok, unlike_activity, _, object} = ActivityPub.unlike(user, object) - assert object.data["like_count"] == 0 - - assert Activity.get_by_id(like_activity.id) == nil - assert note_activity.actor in unlike_activity.recipients - end - end - describe "announcing an object" do test "adds an announce activity to the db" do note_activity = insert(:note_activity) @@ -1157,7 +907,7 @@ test "reverts annouce from object on error" do describe "announcing a private object" do test "adds an announce activity to the db if the audience is not widened" do user = insert(:user) - {:ok, note_activity} = CommonAPI.post(user, %{"status" => ".", "visibility" => "private"}) + {:ok, note_activity} = CommonAPI.post(user, %{status: ".", visibility: "private"}) object = Object.normalize(note_activity) {:ok, announce_activity, object} = ActivityPub.announce(user, object, nil, true, false) @@ -1171,7 +921,7 @@ test "adds an announce activity to the db if the audience is not widened" do test "does not add an announce activity to the db if the audience is widened" do user = insert(:user) - {:ok, note_activity} = CommonAPI.post(user, %{"status" => ".", "visibility" => "private"}) + {:ok, note_activity} = CommonAPI.post(user, %{status: ".", visibility: "private"}) object = Object.normalize(note_activity) assert {:error, _} = ActivityPub.announce(user, object, nil, true, true) @@ -1180,59 +930,13 @@ test "does not add an announce activity to the db if the audience is widened" do test "does not add an announce activity to the db if the announcer is not the author" do user = insert(:user) announcer = insert(:user) - {:ok, note_activity} = CommonAPI.post(user, %{"status" => ".", "visibility" => "private"}) + {:ok, note_activity} = CommonAPI.post(user, %{status: ".", visibility: "private"}) object = Object.normalize(note_activity) assert {:error, _} = ActivityPub.announce(announcer, object, nil, true, false) end end - describe "unannouncing an object" do - test "unannouncing a previously announced object" do - note_activity = insert(:note_activity) - object = Object.normalize(note_activity) - user = insert(:user) - - # Unannouncing an object that is not announced does nothing - {:ok, object} = ActivityPub.unannounce(user, object) - refute object.data["announcement_count"] - - {:ok, announce_activity, object} = ActivityPub.announce(user, object) - assert object.data["announcement_count"] == 1 - - {:ok, unannounce_activity, object} = ActivityPub.unannounce(user, object) - assert object.data["announcement_count"] == 0 - - assert unannounce_activity.data["to"] == [ - User.ap_followers(user), - object.data["actor"] - ] - - assert unannounce_activity.data["type"] == "Undo" - assert unannounce_activity.data["object"] == announce_activity.data - assert unannounce_activity.data["actor"] == user.ap_id - assert unannounce_activity.data["context"] == announce_activity.data["context"] - - assert Activity.get_by_id(announce_activity.id) == nil - end - - test "reverts unannouncing on error" do - note_activity = insert(:note_activity) - object = Object.normalize(note_activity) - user = insert(:user) - - {:ok, _announce_activity, object} = ActivityPub.announce(user, object) - assert object.data["announcement_count"] == 1 - - with_mock(Utils, [:passthrough], maybe_federate: fn _ -> {:error, :reverted} end) do - assert {:error, :reverted} = ActivityPub.unannounce(user, object) - end - - object = Object.get_by_ap_id(object.data["id"]) - assert object.data["announcement_count"] == 1 - end - end - describe "uploading files" do test "copies the file to the configured folder" do file = %Plug.Upload{ @@ -1247,7 +951,7 @@ test "copies the file to the configured folder" do test "works with base64 encoded images" do file = %{ - "img" => data_uri() + img: data_uri() } {:ok, %Object{}} = ActivityPub.upload(file) @@ -1339,7 +1043,7 @@ test "creates an undo activity for a pending follow request" do end end - describe "blocking / unblocking" do + describe "blocking" do test "reverts block activity on error" do [blocker, blocked] = insert_list(2, :user) @@ -1352,177 +1056,38 @@ test "reverts block activity on error" do end test "creates a block activity" do + clear_config([:instance, :federating], true) blocker = insert(:user) blocked = insert(:user) - {:ok, activity} = ActivityPub.block(blocker, blocked) + with_mock Pleroma.Web.Federator, + publish: fn _ -> nil end do + {:ok, activity} = ActivityPub.block(blocker, blocked) - assert activity.data["type"] == "Block" - assert activity.data["actor"] == blocker.ap_id - assert activity.data["object"] == blocked.ap_id - end + assert activity.data["type"] == "Block" + assert activity.data["actor"] == blocker.ap_id + assert activity.data["object"] == blocked.ap_id - test "reverts unblock activity on error" do - [blocker, blocked] = insert_list(2, :user) - {:ok, block_activity} = ActivityPub.block(blocker, blocked) - - with_mock(Utils, [:passthrough], maybe_federate: fn _ -> {:error, :reverted} end) do - assert {:error, :reverted} = ActivityPub.unblock(blocker, blocked) + assert called(Pleroma.Web.Federator.publish(activity)) end - - assert block_activity.data["type"] == "Block" - assert block_activity.data["actor"] == blocker.ap_id - - assert Repo.aggregate(Activity, :count, :id) == 1 - assert Repo.aggregate(Object, :count, :id) == 1 end - test "creates an undo activity for the last block" do + test "works with outgoing blocks disabled, but doesn't federate" do + clear_config([:instance, :federating], true) + clear_config([:activitypub, :outgoing_blocks], false) blocker = insert(:user) blocked = insert(:user) - {:ok, block_activity} = ActivityPub.block(blocker, blocked) - {:ok, activity} = ActivityPub.unblock(blocker, blocked) + with_mock Pleroma.Web.Federator, + publish: fn _ -> nil end do + {:ok, activity} = ActivityPub.block(blocker, blocked) - assert activity.data["type"] == "Undo" - assert activity.data["actor"] == blocker.ap_id + assert activity.data["type"] == "Block" + assert activity.data["actor"] == blocker.ap_id + assert activity.data["object"] == blocked.ap_id - embedded_object = activity.data["object"] - assert is_map(embedded_object) - assert embedded_object["type"] == "Block" - assert embedded_object["object"] == blocked.ap_id - assert embedded_object["id"] == block_activity.data["id"] - end - end - - describe "deletion" do - setup do: clear_config([:instance, :rewrite_policy]) - - test "it reverts deletion on error" do - note = insert(:note_activity) - object = Object.normalize(note) - - with_mock(Utils, [:passthrough], maybe_federate: fn _ -> {:error, :reverted} end) do - assert {:error, :reverted} = ActivityPub.delete(object) + refute called(Pleroma.Web.Federator.publish(:_)) end - - assert Repo.aggregate(Activity, :count, :id) == 1 - assert Repo.get(Object, object.id) == object - assert Activity.get_by_id(note.id) == note - end - - test "it creates a delete activity and deletes the original object" do - note = insert(:note_activity) - object = Object.normalize(note) - {:ok, delete} = ActivityPub.delete(object) - - assert delete.data["type"] == "Delete" - assert delete.data["actor"] == note.data["actor"] - assert delete.data["object"] == object.data["id"] - - assert Activity.get_by_id(delete.id) != nil - - assert Repo.get(Object, object.id).data["type"] == "Tombstone" - end - - test "decrements user note count only for public activities" do - user = insert(:user, note_count: 10) - - {:ok, a1} = - CommonAPI.post(User.get_cached_by_id(user.id), %{ - "status" => "yeah", - "visibility" => "public" - }) - - {:ok, a2} = - CommonAPI.post(User.get_cached_by_id(user.id), %{ - "status" => "yeah", - "visibility" => "unlisted" - }) - - {:ok, a3} = - CommonAPI.post(User.get_cached_by_id(user.id), %{ - "status" => "yeah", - "visibility" => "private" - }) - - {:ok, a4} = - CommonAPI.post(User.get_cached_by_id(user.id), %{ - "status" => "yeah", - "visibility" => "direct" - }) - - {:ok, _} = Object.normalize(a1) |> ActivityPub.delete() - {:ok, _} = Object.normalize(a2) |> ActivityPub.delete() - {:ok, _} = Object.normalize(a3) |> ActivityPub.delete() - {:ok, _} = Object.normalize(a4) |> ActivityPub.delete() - - user = User.get_cached_by_id(user.id) - assert user.note_count == 10 - end - - test "it creates a delete activity and checks that it is also sent to users mentioned by the deleted object" do - user = insert(:user) - note = insert(:note_activity) - object = Object.normalize(note) - - {:ok, object} = - object - |> Object.change(%{ - data: %{ - "actor" => object.data["actor"], - "id" => object.data["id"], - "to" => [user.ap_id], - "type" => "Note" - } - }) - |> Object.update_and_set_cache() - - {:ok, delete} = ActivityPub.delete(object) - - assert user.ap_id in delete.data["to"] - end - - test "decreases reply count" do - user = insert(:user) - user2 = insert(:user) - - {:ok, activity} = CommonAPI.post(user, %{"status" => "1", "visibility" => "public"}) - reply_data = %{"status" => "1", "in_reply_to_status_id" => activity.id} - ap_id = activity.data["id"] - - {:ok, public_reply} = CommonAPI.post(user2, Map.put(reply_data, "visibility", "public")) - {:ok, unlisted_reply} = CommonAPI.post(user2, Map.put(reply_data, "visibility", "unlisted")) - {:ok, private_reply} = CommonAPI.post(user2, Map.put(reply_data, "visibility", "private")) - {:ok, direct_reply} = CommonAPI.post(user2, Map.put(reply_data, "visibility", "direct")) - - _ = CommonAPI.delete(direct_reply.id, user2) - assert %{data: data, object: object} = Activity.get_by_ap_id_with_object(ap_id) - assert object.data["repliesCount"] == 2 - - _ = CommonAPI.delete(private_reply.id, user2) - assert %{data: data, object: object} = Activity.get_by_ap_id_with_object(ap_id) - assert object.data["repliesCount"] == 2 - - _ = CommonAPI.delete(public_reply.id, user2) - assert %{data: data, object: object} = Activity.get_by_ap_id_with_object(ap_id) - assert object.data["repliesCount"] == 1 - - _ = CommonAPI.delete(unlisted_reply.id, user2) - assert %{data: data, object: object} = Activity.get_by_ap_id_with_object(ap_id) - assert object.data["repliesCount"] == 0 - end - - test "it passes delete activity through MRF before deleting the object" do - Pleroma.Config.put([:instance, :rewrite_policy], Pleroma.Web.ActivityPub.MRF.DropPolicy) - - note = insert(:note_activity) - object = Object.normalize(note) - - {:error, {:reject, _}} = ActivityPub.delete(object) - - assert Activity.get_by_id(note.id) - assert Repo.get(Object, object.id).data["type"] == object.data["type"] end end @@ -1541,23 +1106,22 @@ test "it filters broken threads" do {:ok, user3} = User.follow(user3, user2) assert User.following?(user3, user2) - {:ok, public_activity} = CommonAPI.post(user3, %{"status" => "hi 1"}) + {:ok, public_activity} = CommonAPI.post(user3, %{status: "hi 1"}) - {:ok, private_activity_1} = - CommonAPI.post(user3, %{"status" => "hi 2", "visibility" => "private"}) + {:ok, private_activity_1} = CommonAPI.post(user3, %{status: "hi 2", visibility: "private"}) {:ok, private_activity_2} = CommonAPI.post(user2, %{ - "status" => "hi 3", - "visibility" => "private", - "in_reply_to_status_id" => private_activity_1.id + status: "hi 3", + visibility: "private", + in_reply_to_status_id: private_activity_1.id }) {:ok, private_activity_3} = CommonAPI.post(user3, %{ - "status" => "hi 4", - "visibility" => "private", - "in_reply_to_status_id" => private_activity_2.id + status: "hi 4", + visibility: "private", + in_reply_to_status_id: private_activity_2.id }) activities = @@ -1607,9 +1171,9 @@ test "returned pinned statuses" do Config.put([:instance, :max_pinned_statuses], 3) user = insert(:user) - {:ok, activity_one} = CommonAPI.post(user, %{"status" => "HI!!!"}) - {:ok, activity_two} = CommonAPI.post(user, %{"status" => "HI!!!"}) - {:ok, activity_three} = CommonAPI.post(user, %{"status" => "HI!!!"}) + {:ok, activity_one} = CommonAPI.post(user, %{status: "HI!!!"}) + {:ok, activity_two} = CommonAPI.post(user, %{status: "HI!!!"}) + {:ok, activity_three} = CommonAPI.post(user, %{status: "HI!!!"}) CommonAPI.pin(activity_one.id, user) user = refresh_record(user) @@ -1630,7 +1194,7 @@ test "returned pinned statuses" do reporter = insert(:user) target_account = insert(:user) content = "foobar" - {:ok, activity} = CommonAPI.post(target_account, %{"status" => content}) + {:ok, activity} = CommonAPI.post(target_account, %{status: content}) context = Utils.generate_context_id() reporter_ap_id = reporter.ap_id @@ -1726,8 +1290,7 @@ test "fetch_activities/2 returns activities addressed to a list " do {:ok, list} = Pleroma.List.create("foo", user) {:ok, list} = Pleroma.List.follow(list, member) - {:ok, activity} = - CommonAPI.post(user, %{"status" => "foobar", "visibility" => "list:#{list.id}"}) + {:ok, activity} = CommonAPI.post(user, %{status: "foobar", visibility: "list:#{list.id}"}) activity = Repo.preload(activity, :bookmark) activity = %Activity{activity | thread_muted?: !!activity.thread_muted?} @@ -1745,8 +1308,8 @@ test "fetches private posts for followed users" do {:ok, activity} = CommonAPI.post(user, %{ - "status" => "thought I looked cute might delete later :3", - "visibility" => "private" + status: "thought I looked cute might delete later :3", + visibility: "private" }) [result] = ActivityPub.fetch_activities_bounded([user.follower_address], []) @@ -1755,12 +1318,12 @@ test "fetches private posts for followed users" do test "fetches only public posts for other users" do user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "#cofe", "visibility" => "public"}) + {:ok, activity} = CommonAPI.post(user, %{status: "#cofe", visibility: "public"}) {:ok, _private_activity} = CommonAPI.post(user, %{ - "status" => "why is tenshi eating a corndog so cute?", - "visibility" => "private" + status: "why is tenshi eating a corndog so cute?", + visibility: "private" }) [result] = ActivityPub.fetch_activities_bounded([], [user.follower_address]) @@ -1888,20 +1451,20 @@ test "returns a favourite activities sorted by adds to favorite" do other_user = insert(:user) user1 = insert(:user) user2 = insert(:user) - {:ok, a1} = CommonAPI.post(user1, %{"status" => "bla"}) - {:ok, _a2} = CommonAPI.post(user2, %{"status" => "traps are happy"}) - {:ok, a3} = CommonAPI.post(user2, %{"status" => "Trees Are "}) - {:ok, a4} = CommonAPI.post(user2, %{"status" => "Agent Smith "}) - {:ok, a5} = CommonAPI.post(user1, %{"status" => "Red or Blue "}) + {:ok, a1} = CommonAPI.post(user1, %{status: "bla"}) + {:ok, _a2} = CommonAPI.post(user2, %{status: "traps are happy"}) + {:ok, a3} = CommonAPI.post(user2, %{status: "Trees Are "}) + {:ok, a4} = CommonAPI.post(user2, %{status: "Agent Smith "}) + {:ok, a5} = CommonAPI.post(user1, %{status: "Red or Blue "}) - {:ok, _, _} = CommonAPI.favorite(a4.id, user) - {:ok, _, _} = CommonAPI.favorite(a3.id, other_user) - {:ok, _, _} = CommonAPI.favorite(a3.id, user) - {:ok, _, _} = CommonAPI.favorite(a5.id, other_user) - {:ok, _, _} = CommonAPI.favorite(a5.id, user) - {:ok, _, _} = CommonAPI.favorite(a4.id, other_user) - {:ok, _, _} = CommonAPI.favorite(a1.id, user) - {:ok, _, _} = CommonAPI.favorite(a1.id, other_user) + {:ok, _} = CommonAPI.favorite(user, a4.id) + {:ok, _} = CommonAPI.favorite(other_user, a3.id) + {:ok, _} = CommonAPI.favorite(user, a3.id) + {:ok, _} = CommonAPI.favorite(other_user, a5.id) + {:ok, _} = CommonAPI.favorite(user, a5.id) + {:ok, _} = CommonAPI.favorite(other_user, a4.id) + {:ok, _} = CommonAPI.favorite(user, a1.id) + {:ok, _} = CommonAPI.favorite(other_user, a1.id) result = ActivityPub.fetch_favourites(user) assert Enum.map(result, & &1.id) == [a1.id, a5.id, a3.id, a4.id] @@ -1968,4 +1531,543 @@ test "old user must be in the new user's `also_known_as` list" do ActivityPub.move(old_user, new_user) end end + + test "doesn't retrieve replies activities with exclude_replies" do + user = insert(:user) + + {:ok, activity} = CommonAPI.post(user, %{status: "yeah"}) + + {:ok, _reply} = CommonAPI.post(user, %{status: "yeah", in_reply_to_status_id: activity.id}) + + [result] = ActivityPub.fetch_public_activities(%{"exclude_replies" => "true"}) + + assert result.id == activity.id + + assert length(ActivityPub.fetch_public_activities()) == 2 + end + + describe "replies filtering with public messages" do + setup :public_messages + + test "public timeline", %{users: %{u1: user}} do + activities_ids = + %{} + |> Map.put("type", ["Create", "Announce"]) + |> Map.put("local_only", false) + |> Map.put("blocking_user", user) + |> Map.put("muting_user", user) + |> Map.put("reply_filtering_user", user) + |> ActivityPub.fetch_public_activities() + |> Enum.map(& &1.id) + + assert length(activities_ids) == 16 + end + + test "public timeline with reply_visibility `following`", %{ + users: %{u1: user}, + u1: u1, + u2: u2, + u3: u3, + u4: u4, + activities: activities + } do + activities_ids = + %{} + |> Map.put("type", ["Create", "Announce"]) + |> Map.put("local_only", false) + |> Map.put("blocking_user", user) + |> Map.put("muting_user", user) + |> Map.put("reply_visibility", "following") + |> Map.put("reply_filtering_user", user) + |> ActivityPub.fetch_public_activities() + |> Enum.map(& &1.id) + + assert length(activities_ids) == 14 + + visible_ids = + Map.values(u1) ++ Map.values(u2) ++ Map.values(u4) ++ Map.values(activities) ++ [u3[:r1]] + + assert Enum.all?(visible_ids, &(&1 in activities_ids)) + end + + test "public timeline with reply_visibility `self`", %{ + users: %{u1: user}, + u1: u1, + u2: u2, + u3: u3, + u4: u4, + activities: activities + } do + activities_ids = + %{} + |> Map.put("type", ["Create", "Announce"]) + |> Map.put("local_only", false) + |> Map.put("blocking_user", user) + |> Map.put("muting_user", user) + |> Map.put("reply_visibility", "self") + |> Map.put("reply_filtering_user", user) + |> ActivityPub.fetch_public_activities() + |> Enum.map(& &1.id) + + assert length(activities_ids) == 10 + visible_ids = Map.values(u1) ++ [u2[:r1], u3[:r1], u4[:r1]] ++ Map.values(activities) + assert Enum.all?(visible_ids, &(&1 in activities_ids)) + end + + test "home timeline", %{ + users: %{u1: user}, + activities: activities, + u1: u1, + u2: u2, + u3: u3, + u4: u4 + } do + params = + %{} + |> Map.put("type", ["Create", "Announce"]) + |> Map.put("blocking_user", user) + |> Map.put("muting_user", user) + |> Map.put("user", user) + |> Map.put("reply_filtering_user", user) + + activities_ids = + ActivityPub.fetch_activities([user.ap_id | User.following(user)], params) + |> Enum.map(& &1.id) + + assert length(activities_ids) == 13 + + visible_ids = + Map.values(u1) ++ + Map.values(u3) ++ + [ + activities[:a1], + activities[:a2], + activities[:a4], + u2[:r1], + u2[:r3], + u4[:r1], + u4[:r2] + ] + + assert Enum.all?(visible_ids, &(&1 in activities_ids)) + end + + test "home timeline with reply_visibility `following`", %{ + users: %{u1: user}, + activities: activities, + u1: u1, + u2: u2, + u3: u3, + u4: u4 + } do + params = + %{} + |> Map.put("type", ["Create", "Announce"]) + |> Map.put("blocking_user", user) + |> Map.put("muting_user", user) + |> Map.put("user", user) + |> Map.put("reply_visibility", "following") + |> Map.put("reply_filtering_user", user) + + activities_ids = + ActivityPub.fetch_activities([user.ap_id | User.following(user)], params) + |> Enum.map(& &1.id) + + assert length(activities_ids) == 11 + + visible_ids = + Map.values(u1) ++ + [ + activities[:a1], + activities[:a2], + activities[:a4], + u2[:r1], + u2[:r3], + u3[:r1], + u4[:r1], + u4[:r2] + ] + + assert Enum.all?(visible_ids, &(&1 in activities_ids)) + end + + test "home timeline with reply_visibility `self`", %{ + users: %{u1: user}, + activities: activities, + u1: u1, + u2: u2, + u3: u3, + u4: u4 + } do + params = + %{} + |> Map.put("type", ["Create", "Announce"]) + |> Map.put("blocking_user", user) + |> Map.put("muting_user", user) + |> Map.put("user", user) + |> Map.put("reply_visibility", "self") + |> Map.put("reply_filtering_user", user) + + activities_ids = + ActivityPub.fetch_activities([user.ap_id | User.following(user)], params) + |> Enum.map(& &1.id) + + assert length(activities_ids) == 9 + + visible_ids = + Map.values(u1) ++ + [ + activities[:a1], + activities[:a2], + activities[:a4], + u2[:r1], + u3[:r1], + u4[:r1] + ] + + assert Enum.all?(visible_ids, &(&1 in activities_ids)) + end + end + + describe "replies filtering with private messages" do + setup :private_messages + + test "public timeline", %{users: %{u1: user}} do + activities_ids = + %{} + |> Map.put("type", ["Create", "Announce"]) + |> Map.put("local_only", false) + |> Map.put("blocking_user", user) + |> Map.put("muting_user", user) + |> Map.put("user", user) + |> ActivityPub.fetch_public_activities() + |> Enum.map(& &1.id) + + assert activities_ids == [] + end + + test "public timeline with default reply_visibility `following`", %{users: %{u1: user}} do + activities_ids = + %{} + |> Map.put("type", ["Create", "Announce"]) + |> Map.put("local_only", false) + |> Map.put("blocking_user", user) + |> Map.put("muting_user", user) + |> Map.put("reply_visibility", "following") + |> Map.put("reply_filtering_user", user) + |> Map.put("user", user) + |> ActivityPub.fetch_public_activities() + |> Enum.map(& &1.id) + + assert activities_ids == [] + end + + test "public timeline with default reply_visibility `self`", %{users: %{u1: user}} do + activities_ids = + %{} + |> Map.put("type", ["Create", "Announce"]) + |> Map.put("local_only", false) + |> Map.put("blocking_user", user) + |> Map.put("muting_user", user) + |> Map.put("reply_visibility", "self") + |> Map.put("reply_filtering_user", user) + |> Map.put("user", user) + |> ActivityPub.fetch_public_activities() + |> Enum.map(& &1.id) + + assert activities_ids == [] + end + + test "home timeline", %{users: %{u1: user}} do + params = + %{} + |> Map.put("type", ["Create", "Announce"]) + |> Map.put("blocking_user", user) + |> Map.put("muting_user", user) + |> Map.put("user", user) + + activities_ids = + ActivityPub.fetch_activities([user.ap_id | User.following(user)], params) + |> Enum.map(& &1.id) + + assert length(activities_ids) == 12 + end + + test "home timeline with default reply_visibility `following`", %{users: %{u1: user}} do + params = + %{} + |> Map.put("type", ["Create", "Announce"]) + |> Map.put("blocking_user", user) + |> Map.put("muting_user", user) + |> Map.put("user", user) + |> Map.put("reply_visibility", "following") + |> Map.put("reply_filtering_user", user) + + activities_ids = + ActivityPub.fetch_activities([user.ap_id | User.following(user)], params) + |> Enum.map(& &1.id) + + assert length(activities_ids) == 12 + end + + test "home timeline with default reply_visibility `self`", %{ + users: %{u1: user}, + activities: activities, + u1: u1, + u2: u2, + u3: u3, + u4: u4 + } do + params = + %{} + |> Map.put("type", ["Create", "Announce"]) + |> Map.put("blocking_user", user) + |> Map.put("muting_user", user) + |> Map.put("user", user) + |> Map.put("reply_visibility", "self") + |> Map.put("reply_filtering_user", user) + + activities_ids = + ActivityPub.fetch_activities([user.ap_id | User.following(user)], params) + |> Enum.map(& &1.id) + + assert length(activities_ids) == 10 + + visible_ids = + Map.values(u1) ++ Map.values(u4) ++ [u2[:r1], u3[:r1]] ++ Map.values(activities) + + assert Enum.all?(visible_ids, &(&1 in activities_ids)) + end + end + + defp public_messages(_) do + [u1, u2, u3, u4] = insert_list(4, :user) + {:ok, u1} = User.follow(u1, u2) + {:ok, u2} = User.follow(u2, u1) + {:ok, u1} = User.follow(u1, u4) + {:ok, u4} = User.follow(u4, u1) + + {:ok, u2} = User.follow(u2, u3) + {:ok, u3} = User.follow(u3, u2) + + {:ok, a1} = CommonAPI.post(u1, %{status: "Status"}) + + {:ok, r1_1} = + CommonAPI.post(u2, %{ + status: "@#{u1.nickname} reply from u2 to u1", + in_reply_to_status_id: a1.id + }) + + {:ok, r1_2} = + CommonAPI.post(u3, %{ + status: "@#{u1.nickname} reply from u3 to u1", + in_reply_to_status_id: a1.id + }) + + {:ok, r1_3} = + CommonAPI.post(u4, %{ + status: "@#{u1.nickname} reply from u4 to u1", + in_reply_to_status_id: a1.id + }) + + {:ok, a2} = CommonAPI.post(u2, %{status: "Status"}) + + {:ok, r2_1} = + CommonAPI.post(u1, %{ + status: "@#{u2.nickname} reply from u1 to u2", + in_reply_to_status_id: a2.id + }) + + {:ok, r2_2} = + CommonAPI.post(u3, %{ + status: "@#{u2.nickname} reply from u3 to u2", + in_reply_to_status_id: a2.id + }) + + {:ok, r2_3} = + CommonAPI.post(u4, %{ + status: "@#{u2.nickname} reply from u4 to u2", + in_reply_to_status_id: a2.id + }) + + {:ok, a3} = CommonAPI.post(u3, %{status: "Status"}) + + {:ok, r3_1} = + CommonAPI.post(u1, %{ + status: "@#{u3.nickname} reply from u1 to u3", + in_reply_to_status_id: a3.id + }) + + {:ok, r3_2} = + CommonAPI.post(u2, %{ + status: "@#{u3.nickname} reply from u2 to u3", + in_reply_to_status_id: a3.id + }) + + {:ok, r3_3} = + CommonAPI.post(u4, %{ + status: "@#{u3.nickname} reply from u4 to u3", + in_reply_to_status_id: a3.id + }) + + {:ok, a4} = CommonAPI.post(u4, %{status: "Status"}) + + {:ok, r4_1} = + CommonAPI.post(u1, %{ + status: "@#{u4.nickname} reply from u1 to u4", + in_reply_to_status_id: a4.id + }) + + {:ok, r4_2} = + CommonAPI.post(u2, %{ + status: "@#{u4.nickname} reply from u2 to u4", + in_reply_to_status_id: a4.id + }) + + {:ok, r4_3} = + CommonAPI.post(u3, %{ + status: "@#{u4.nickname} reply from u3 to u4", + in_reply_to_status_id: a4.id + }) + + {:ok, + users: %{u1: u1, u2: u2, u3: u3, u4: u4}, + activities: %{a1: a1.id, a2: a2.id, a3: a3.id, a4: a4.id}, + u1: %{r1: r1_1.id, r2: r1_2.id, r3: r1_3.id}, + u2: %{r1: r2_1.id, r2: r2_2.id, r3: r2_3.id}, + u3: %{r1: r3_1.id, r2: r3_2.id, r3: r3_3.id}, + u4: %{r1: r4_1.id, r2: r4_2.id, r3: r4_3.id}} + end + + defp private_messages(_) do + [u1, u2, u3, u4] = insert_list(4, :user) + {:ok, u1} = User.follow(u1, u2) + {:ok, u2} = User.follow(u2, u1) + {:ok, u1} = User.follow(u1, u3) + {:ok, u3} = User.follow(u3, u1) + {:ok, u1} = User.follow(u1, u4) + {:ok, u4} = User.follow(u4, u1) + + {:ok, u2} = User.follow(u2, u3) + {:ok, u3} = User.follow(u3, u2) + + {:ok, a1} = CommonAPI.post(u1, %{status: "Status", visibility: "private"}) + + {:ok, r1_1} = + CommonAPI.post(u2, %{ + status: "@#{u1.nickname} reply from u2 to u1", + in_reply_to_status_id: a1.id, + visibility: "private" + }) + + {:ok, r1_2} = + CommonAPI.post(u3, %{ + status: "@#{u1.nickname} reply from u3 to u1", + in_reply_to_status_id: a1.id, + visibility: "private" + }) + + {:ok, r1_3} = + CommonAPI.post(u4, %{ + status: "@#{u1.nickname} reply from u4 to u1", + in_reply_to_status_id: a1.id, + visibility: "private" + }) + + {:ok, a2} = CommonAPI.post(u2, %{status: "Status", visibility: "private"}) + + {:ok, r2_1} = + CommonAPI.post(u1, %{ + status: "@#{u2.nickname} reply from u1 to u2", + in_reply_to_status_id: a2.id, + visibility: "private" + }) + + {:ok, r2_2} = + CommonAPI.post(u3, %{ + status: "@#{u2.nickname} reply from u3 to u2", + in_reply_to_status_id: a2.id, + visibility: "private" + }) + + {:ok, a3} = CommonAPI.post(u3, %{status: "Status", visibility: "private"}) + + {:ok, r3_1} = + CommonAPI.post(u1, %{ + status: "@#{u3.nickname} reply from u1 to u3", + in_reply_to_status_id: a3.id, + visibility: "private" + }) + + {:ok, r3_2} = + CommonAPI.post(u2, %{ + status: "@#{u3.nickname} reply from u2 to u3", + in_reply_to_status_id: a3.id, + visibility: "private" + }) + + {:ok, a4} = CommonAPI.post(u4, %{status: "Status", visibility: "private"}) + + {:ok, r4_1} = + CommonAPI.post(u1, %{ + status: "@#{u4.nickname} reply from u1 to u4", + in_reply_to_status_id: a4.id, + visibility: "private" + }) + + {:ok, + users: %{u1: u1, u2: u2, u3: u3, u4: u4}, + activities: %{a1: a1.id, a2: a2.id, a3: a3.id, a4: a4.id}, + u1: %{r1: r1_1.id, r2: r1_2.id, r3: r1_3.id}, + u2: %{r1: r2_1.id, r2: r2_2.id}, + u3: %{r1: r3_1.id, r2: r3_2.id}, + u4: %{r1: r4_1.id}} + end + + describe "maybe_update_follow_information/1" do + setup do + clear_config([:instance, :external_user_synchronization], true) + + user = %{ + local: false, + ap_id: "https://gensokyo.2hu/users/raymoo", + following_address: "https://gensokyo.2hu/users/following", + follower_address: "https://gensokyo.2hu/users/followers", + type: "Person" + } + + %{user: user} + end + + test "logs an error when it can't fetch the info", %{user: user} do + assert capture_log(fn -> + ActivityPub.maybe_update_follow_information(user) + end) =~ "Follower/Following counter update for #{user.ap_id} failed" + end + + test "just returns the input if the user type is Application", %{ + user: user + } do + user = + user + |> Map.put(:type, "Application") + + refute capture_log(fn -> + assert ^user = ActivityPub.maybe_update_follow_information(user) + end) =~ "Follower/Following counter update for #{user.ap_id} failed" + end + + test "it just returns the input if the user has no following/follower addresses", %{ + user: user + } do + user = + user + |> Map.put(:following_address, nil) + |> Map.put(:follower_address, nil) + + refute capture_log(fn -> + assert ^user = ActivityPub.maybe_update_follow_information(user) + end) =~ "Follower/Following counter update for #{user.ap_id} failed" + end + end end diff --git a/test/web/activity_pub/mrf/anti_followbot_policy_test.exs b/test/web/activity_pub/mrf/anti_followbot_policy_test.exs index 37a7bfcf7..fca0de7c6 100644 --- a/test/web/activity_pub/mrf/anti_followbot_policy_test.exs +++ b/test/web/activity_pub/mrf/anti_followbot_policy_test.exs @@ -1,5 +1,5 @@ # Pleroma: A lightweight social networking server -# Copyright © 2019 Pleroma Authors +# Copyright © 2017-2020 Pleroma Authors # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.Web.ActivityPub.MRF.AntiFollowbotPolicyTest do diff --git a/test/web/activity_pub/mrf/anti_link_spam_policy_test.exs b/test/web/activity_pub/mrf/anti_link_spam_policy_test.exs index b524fdd23..1a13699be 100644 --- a/test/web/activity_pub/mrf/anti_link_spam_policy_test.exs +++ b/test/web/activity_pub/mrf/anti_link_spam_policy_test.exs @@ -1,5 +1,5 @@ # Pleroma: A lightweight social networking server -# Copyright © 2019 Pleroma Authors +# Copyright © 2017-2020 Pleroma Authors # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.Web.ActivityPub.MRF.AntiLinkSpamPolicyTest do @@ -110,6 +110,15 @@ test "it allows posts with links" do end describe "with unknown actors" do + setup do + Tesla.Mock.mock(fn + %{method: :get, url: "http://invalid.actor"} -> + %Tesla.Env{status: 500, body: ""} + end) + + :ok + end + test "it rejects posts without links" do message = @linkless_message diff --git a/test/web/activity_pub/mrf/ensure_re_prepended_test.exs b/test/web/activity_pub/mrf/ensure_re_prepended_test.exs index dbc8b9e80..38ddec5bb 100644 --- a/test/web/activity_pub/mrf/ensure_re_prepended_test.exs +++ b/test/web/activity_pub/mrf/ensure_re_prepended_test.exs @@ -1,5 +1,5 @@ # Pleroma: A lightweight social networking server -# Copyright © 2019 Pleroma Authors +# Copyright © 2017-2020 Pleroma Authors # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.Web.ActivityPub.MRF.EnsureRePrependedTest do diff --git a/test/web/activity_pub/mrf/no_placeholder_text_policy_test.exs b/test/web/activity_pub/mrf/no_placeholder_text_policy_test.exs index 63ed71129..64ea61dd4 100644 --- a/test/web/activity_pub/mrf/no_placeholder_text_policy_test.exs +++ b/test/web/activity_pub/mrf/no_placeholder_text_policy_test.exs @@ -1,5 +1,5 @@ # Pleroma: A lightweight social networking server -# Copyright © 2019 Pleroma Authors +# Copyright © 2017-2020 Pleroma Authors # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.Web.ActivityPub.MRF.NoPlaceholderTextPolicyTest do diff --git a/test/web/activity_pub/mrf/normalize_markup_test.exs b/test/web/activity_pub/mrf/normalize_markup_test.exs index 0207be56b..9b39c45bd 100644 --- a/test/web/activity_pub/mrf/normalize_markup_test.exs +++ b/test/web/activity_pub/mrf/normalize_markup_test.exs @@ -1,5 +1,5 @@ # Pleroma: A lightweight social networking server -# Copyright © 2019 Pleroma Authors +# Copyright © 2017-2020 Pleroma Authors # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.Web.ActivityPub.MRF.NormalizeMarkupTest do diff --git a/test/web/activity_pub/mrf/object_age_policy_test.exs b/test/web/activity_pub/mrf/object_age_policy_test.exs index 0fbc5f57a..b0fb753bd 100644 --- a/test/web/activity_pub/mrf/object_age_policy_test.exs +++ b/test/web/activity_pub/mrf/object_age_policy_test.exs @@ -1,5 +1,5 @@ # Pleroma: A lightweight social networking server -# Copyright © 2019 Pleroma Authors +# Copyright © 2017-2020 Pleroma Authors # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.Web.ActivityPub.MRF.ObjectAgePolicyTest do @@ -20,26 +20,38 @@ defmodule Pleroma.Web.ActivityPub.MRF.ObjectAgePolicyTest do :ok end + defp get_old_message do + File.read!("test/fixtures/mastodon-post-activity.json") + |> Poison.decode!() + end + + defp get_new_message do + old_message = get_old_message() + + new_object = + old_message + |> Map.get("object") + |> Map.put("published", DateTime.utc_now() |> DateTime.to_iso8601()) + + old_message + |> Map.put("object", new_object) + end + describe "with reject action" do test "it rejects an old post" do Config.put([:mrf_object_age, :actions], [:reject]) - data = - File.read!("test/fixtures/mastodon-post-activity.json") - |> Poison.decode!() + data = get_old_message() - {:reject, _} = ObjectAgePolicy.filter(data) + assert match?({:reject, _}, ObjectAgePolicy.filter(data)) end test "it allows a new post" do Config.put([:mrf_object_age, :actions], [:reject]) - data = - File.read!("test/fixtures/mastodon-post-activity.json") - |> Poison.decode!() - |> Map.put("published", DateTime.utc_now() |> DateTime.to_iso8601()) + data = get_new_message() - {:ok, _} = ObjectAgePolicy.filter(data) + assert match?({:ok, _}, ObjectAgePolicy.filter(data)) end end @@ -47,9 +59,7 @@ test "it allows a new post" do test "it delists an old post" do Config.put([:mrf_object_age, :actions], [:delist]) - data = - File.read!("test/fixtures/mastodon-post-activity.json") - |> Poison.decode!() + data = get_old_message() {:ok, _u} = User.get_or_fetch_by_ap_id(data["actor"]) @@ -61,14 +71,11 @@ test "it delists an old post" do test "it allows a new post" do Config.put([:mrf_object_age, :actions], [:delist]) - data = - File.read!("test/fixtures/mastodon-post-activity.json") - |> Poison.decode!() - |> Map.put("published", DateTime.utc_now() |> DateTime.to_iso8601()) + data = get_new_message() {:ok, _user} = User.get_or_fetch_by_ap_id(data["actor"]) - {:ok, ^data} = ObjectAgePolicy.filter(data) + assert match?({:ok, ^data}, ObjectAgePolicy.filter(data)) end end @@ -76,9 +83,7 @@ test "it allows a new post" do test "it strips followers collections from an old post" do Config.put([:mrf_object_age, :actions], [:strip_followers]) - data = - File.read!("test/fixtures/mastodon-post-activity.json") - |> Poison.decode!() + data = get_old_message() {:ok, user} = User.get_or_fetch_by_ap_id(data["actor"]) @@ -91,14 +96,11 @@ test "it strips followers collections from an old post" do test "it allows a new post" do Config.put([:mrf_object_age, :actions], [:strip_followers]) - data = - File.read!("test/fixtures/mastodon-post-activity.json") - |> Poison.decode!() - |> Map.put("published", DateTime.utc_now() |> DateTime.to_iso8601()) + data = get_new_message() {:ok, _u} = User.get_or_fetch_by_ap_id(data["actor"]) - {:ok, ^data} = ObjectAgePolicy.filter(data) + assert match?({:ok, ^data}, ObjectAgePolicy.filter(data)) end end end diff --git a/test/web/activity_pub/mrf/reject_non_public_test.exs b/test/web/activity_pub/mrf/reject_non_public_test.exs index abfd32df8..f36299b86 100644 --- a/test/web/activity_pub/mrf/reject_non_public_test.exs +++ b/test/web/activity_pub/mrf/reject_non_public_test.exs @@ -1,5 +1,5 @@ # Pleroma: A lightweight social networking server -# Copyright © 2019 Pleroma Authors +# Copyright © 2017-2020 Pleroma Authors # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.Web.ActivityPub.MRF.RejectNonPublicTest do diff --git a/test/web/activity_pub/mrf/simple_policy_test.exs b/test/web/activity_pub/mrf/simple_policy_test.exs index 5aebbc675..b7b9bc6a2 100644 --- a/test/web/activity_pub/mrf/simple_policy_test.exs +++ b/test/web/activity_pub/mrf/simple_policy_test.exs @@ -1,5 +1,5 @@ # Pleroma: A lightweight social networking server -# Copyright © 2019 Pleroma Authors +# Copyright © 2017-2020 Pleroma Authors # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.Web.ActivityPub.MRF.SimplePolicyTest do @@ -17,7 +17,8 @@ defmodule Pleroma.Web.ActivityPub.MRF.SimplePolicyTest do reject: [], accept: [], avatar_removal: [], - banner_removal: [] + banner_removal: [], + reject_deletes: [] ) describe "when :media_removal" do @@ -382,6 +383,66 @@ test "match with wildcard domain" do end end + describe "when :reject_deletes is empty" do + setup do: Config.put([:mrf_simple, :reject_deletes], []) + + test "it accepts deletions even from rejected servers" do + Config.put([:mrf_simple, :reject], ["remote.instance"]) + + deletion_message = build_remote_deletion_message() + + assert SimplePolicy.filter(deletion_message) == {:ok, deletion_message} + end + + test "it accepts deletions even from non-whitelisted servers" do + Config.put([:mrf_simple, :accept], ["non.matching.remote"]) + + deletion_message = build_remote_deletion_message() + + assert SimplePolicy.filter(deletion_message) == {:ok, deletion_message} + end + end + + describe "when :reject_deletes is not empty but it doesn't have a matching host" do + setup do: Config.put([:mrf_simple, :reject_deletes], ["non.matching.remote"]) + + test "it accepts deletions even from rejected servers" do + Config.put([:mrf_simple, :reject], ["remote.instance"]) + + deletion_message = build_remote_deletion_message() + + assert SimplePolicy.filter(deletion_message) == {:ok, deletion_message} + end + + test "it accepts deletions even from non-whitelisted servers" do + Config.put([:mrf_simple, :accept], ["non.matching.remote"]) + + deletion_message = build_remote_deletion_message() + + assert SimplePolicy.filter(deletion_message) == {:ok, deletion_message} + end + end + + describe "when :reject_deletes has a matching host" do + setup do: Config.put([:mrf_simple, :reject_deletes], ["remote.instance"]) + + test "it rejects the deletion" do + deletion_message = build_remote_deletion_message() + + assert SimplePolicy.filter(deletion_message) == {:reject, nil} + end + end + + describe "when :reject_deletes match with wildcard domain" do + setup do: Config.put([:mrf_simple, :reject_deletes], ["*.remote.instance"]) + + test "it rejects the deletion" do + deletion_message = build_remote_deletion_message() + + assert SimplePolicy.filter(deletion_message) == {:reject, nil} + end + end + defp build_local_message do %{ "actor" => "#{Pleroma.Web.base_url()}/users/alice", @@ -408,4 +469,11 @@ defp build_remote_user do "type" => "Person" } end + + defp build_remote_deletion_message do + %{ + "type" => "Delete", + "actor" => "https://remote.instance/users/bob" + } + end end diff --git a/test/web/activity_pub/object_validator_test.exs b/test/web/activity_pub/object_validator_test.exs new file mode 100644 index 000000000..96eff1c30 --- /dev/null +++ b/test/web/activity_pub/object_validator_test.exs @@ -0,0 +1,283 @@ +defmodule Pleroma.Web.ActivityPub.ObjectValidatorTest do + use Pleroma.DataCase + + alias Pleroma.Object + alias Pleroma.Web.ActivityPub.Builder + alias Pleroma.Web.ActivityPub.ObjectValidator + alias Pleroma.Web.ActivityPub.ObjectValidators.LikeValidator + alias Pleroma.Web.ActivityPub.Utils + alias Pleroma.Web.CommonAPI + + import Pleroma.Factory + + describe "EmojiReacts" do + setup do + user = insert(:user) + {:ok, post_activity} = CommonAPI.post(user, %{status: "uguu"}) + + object = Pleroma.Object.get_by_ap_id(post_activity.data["object"]) + + {:ok, valid_emoji_react, []} = Builder.emoji_react(user, object, "👌") + + %{user: user, post_activity: post_activity, valid_emoji_react: valid_emoji_react} + end + + test "it validates a valid EmojiReact", %{valid_emoji_react: valid_emoji_react} do + assert {:ok, _, _} = ObjectValidator.validate(valid_emoji_react, []) + end + + test "it is not valid without a 'content' field", %{valid_emoji_react: valid_emoji_react} do + without_content = + valid_emoji_react + |> Map.delete("content") + + {:error, cng} = ObjectValidator.validate(without_content, []) + + refute cng.valid? + assert {:content, {"can't be blank", [validation: :required]}} in cng.errors + end + + test "it is not valid with a non-emoji content field", %{valid_emoji_react: valid_emoji_react} do + without_emoji_content = + valid_emoji_react + |> Map.put("content", "x") + + {:error, cng} = ObjectValidator.validate(without_emoji_content, []) + + refute cng.valid? + + assert {:content, {"must be a single character emoji", []}} in cng.errors + end + end + + describe "Undos" do + setup do + user = insert(:user) + {:ok, post_activity} = CommonAPI.post(user, %{status: "uguu"}) + {:ok, like} = CommonAPI.favorite(user, post_activity.id) + {:ok, valid_like_undo, []} = Builder.undo(user, like) + + %{user: user, like: like, valid_like_undo: valid_like_undo} + end + + test "it validates a basic like undo", %{valid_like_undo: valid_like_undo} do + assert {:ok, _, _} = ObjectValidator.validate(valid_like_undo, []) + end + + test "it does not validate if the actor of the undo is not the actor of the object", %{ + valid_like_undo: valid_like_undo + } do + other_user = insert(:user, ap_id: "https://gensokyo.2hu/users/raymoo") + + bad_actor = + valid_like_undo + |> Map.put("actor", other_user.ap_id) + + {:error, cng} = ObjectValidator.validate(bad_actor, []) + + assert {:actor, {"not the same as object actor", []}} in cng.errors + end + + test "it does not validate if the object is missing", %{valid_like_undo: valid_like_undo} do + missing_object = + valid_like_undo + |> Map.put("object", "https://gensokyo.2hu/objects/1") + + {:error, cng} = ObjectValidator.validate(missing_object, []) + + assert {:object, {"can't find object", []}} in cng.errors + assert length(cng.errors) == 1 + end + end + + describe "deletes" do + setup do + user = insert(:user) + {:ok, post_activity} = CommonAPI.post(user, %{status: "cancel me daddy"}) + + {:ok, valid_post_delete, _} = Builder.delete(user, post_activity.data["object"]) + {:ok, valid_user_delete, _} = Builder.delete(user, user.ap_id) + + %{user: user, valid_post_delete: valid_post_delete, valid_user_delete: valid_user_delete} + end + + test "it is valid for a post deletion", %{valid_post_delete: valid_post_delete} do + {:ok, valid_post_delete, _} = ObjectValidator.validate(valid_post_delete, []) + + assert valid_post_delete["deleted_activity_id"] + end + + test "it is invalid if the object isn't in a list of certain types", %{ + valid_post_delete: valid_post_delete + } do + object = Object.get_by_ap_id(valid_post_delete["object"]) + + data = + object.data + |> Map.put("type", "Like") + + {:ok, _object} = + object + |> Ecto.Changeset.change(%{data: data}) + |> Object.update_and_set_cache() + + {:error, cng} = ObjectValidator.validate(valid_post_delete, []) + assert {:object, {"object not in allowed types", []}} in cng.errors + end + + test "it is valid for a user deletion", %{valid_user_delete: valid_user_delete} do + assert match?({:ok, _, _}, ObjectValidator.validate(valid_user_delete, [])) + end + + test "it's invalid if the id is missing", %{valid_post_delete: valid_post_delete} do + no_id = + valid_post_delete + |> Map.delete("id") + + {:error, cng} = ObjectValidator.validate(no_id, []) + + assert {:id, {"can't be blank", [validation: :required]}} in cng.errors + end + + test "it's invalid if the object doesn't exist", %{valid_post_delete: valid_post_delete} do + missing_object = + valid_post_delete + |> Map.put("object", "http://does.not/exist") + + {:error, cng} = ObjectValidator.validate(missing_object, []) + + assert {:object, {"can't find object", []}} in cng.errors + end + + test "it's invalid if the actor of the object and the actor of delete are from different domains", + %{valid_post_delete: valid_post_delete} do + valid_user = insert(:user) + + valid_other_actor = + valid_post_delete + |> Map.put("actor", valid_user.ap_id) + + assert match?({:ok, _, _}, ObjectValidator.validate(valid_other_actor, [])) + + invalid_other_actor = + valid_post_delete + |> Map.put("actor", "https://gensokyo.2hu/users/raymoo") + + {:error, cng} = ObjectValidator.validate(invalid_other_actor, []) + + assert {:actor, {"is not allowed to delete object", []}} in cng.errors + end + + test "it's valid if the actor of the object is a local superuser", + %{valid_post_delete: valid_post_delete} do + user = + insert(:user, local: true, is_moderator: true, ap_id: "https://gensokyo.2hu/users/raymoo") + + valid_other_actor = + valid_post_delete + |> Map.put("actor", user.ap_id) + + {:ok, _, meta} = ObjectValidator.validate(valid_other_actor, []) + assert meta[:do_not_federate] + end + end + + describe "likes" do + setup do + user = insert(:user) + {:ok, post_activity} = CommonAPI.post(user, %{status: "uguu"}) + + valid_like = %{ + "to" => [user.ap_id], + "cc" => [], + "type" => "Like", + "id" => Utils.generate_activity_id(), + "object" => post_activity.data["object"], + "actor" => user.ap_id, + "context" => "a context" + } + + %{valid_like: valid_like, user: user, post_activity: post_activity} + end + + test "returns ok when called in the ObjectValidator", %{valid_like: valid_like} do + {:ok, object, _meta} = ObjectValidator.validate(valid_like, []) + + assert "id" in Map.keys(object) + end + + test "is valid for a valid object", %{valid_like: valid_like} do + assert LikeValidator.cast_and_validate(valid_like).valid? + end + + test "sets the 'to' field to the object actor if no recipients are given", %{ + valid_like: valid_like, + user: user + } do + without_recipients = + valid_like + |> Map.delete("to") + + {:ok, object, _meta} = ObjectValidator.validate(without_recipients, []) + + assert object["to"] == [user.ap_id] + end + + test "sets the context field to the context of the object if no context is given", %{ + valid_like: valid_like, + post_activity: post_activity + } do + without_context = + valid_like + |> Map.delete("context") + + {:ok, object, _meta} = ObjectValidator.validate(without_context, []) + + assert object["context"] == post_activity.data["context"] + end + + test "it errors when the actor is missing or not known", %{valid_like: valid_like} do + without_actor = Map.delete(valid_like, "actor") + + refute LikeValidator.cast_and_validate(without_actor).valid? + + with_invalid_actor = Map.put(valid_like, "actor", "invalidactor") + + refute LikeValidator.cast_and_validate(with_invalid_actor).valid? + end + + test "it errors when the object is missing or not known", %{valid_like: valid_like} do + without_object = Map.delete(valid_like, "object") + + refute LikeValidator.cast_and_validate(without_object).valid? + + with_invalid_object = Map.put(valid_like, "object", "invalidobject") + + refute LikeValidator.cast_and_validate(with_invalid_object).valid? + end + + test "it errors when the actor has already like the object", %{ + valid_like: valid_like, + user: user, + post_activity: post_activity + } do + _like = CommonAPI.favorite(user, post_activity.id) + + refute LikeValidator.cast_and_validate(valid_like).valid? + end + + test "it works when actor or object are wrapped in maps", %{valid_like: valid_like} do + wrapped_like = + valid_like + |> Map.put("actor", %{"id" => valid_like["actor"]}) + |> Map.put("object", %{"id" => valid_like["object"]}) + + validated = LikeValidator.cast_and_validate(wrapped_like) + + assert validated.valid? + + assert {:actor, valid_like["actor"]} in validated.changes + assert {:object, valid_like["object"]} in validated.changes + end + end +end diff --git a/test/web/activity_pub/object_validators/note_validator_test.exs b/test/web/activity_pub/object_validators/note_validator_test.exs new file mode 100644 index 000000000..30c481ffb --- /dev/null +++ b/test/web/activity_pub/object_validators/note_validator_test.exs @@ -0,0 +1,35 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.ObjectValidators.NoteValidatorTest do + use Pleroma.DataCase + + alias Pleroma.Web.ActivityPub.ObjectValidators.NoteValidator + alias Pleroma.Web.ActivityPub.Utils + + import Pleroma.Factory + + describe "Notes" do + setup do + user = insert(:user) + + note = %{ + "id" => Utils.generate_activity_id(), + "type" => "Note", + "actor" => user.ap_id, + "to" => [user.follower_address], + "cc" => [], + "content" => "Hellow this is content.", + "context" => "xxx", + "summary" => "a post" + } + + %{user: user, note: note} + end + + test "a basic note validates", %{note: note} do + %{valid?: true} = NoteValidator.cast_and_validate(note) + end + end +end diff --git a/test/web/activity_pub/object_validators/types/date_time_test.exs b/test/web/activity_pub/object_validators/types/date_time_test.exs new file mode 100644 index 000000000..3e17a9497 --- /dev/null +++ b/test/web/activity_pub/object_validators/types/date_time_test.exs @@ -0,0 +1,32 @@ +defmodule Pleroma.Web.ActivityPub.ObjectValidators.Types.DateTimeTest do + alias Pleroma.Web.ActivityPub.ObjectValidators.Types.DateTime + use Pleroma.DataCase + + test "it validates an xsd:Datetime" do + valid_strings = [ + "2004-04-12T13:20:00", + "2004-04-12T13:20:15.5", + "2004-04-12T13:20:00-05:00", + "2004-04-12T13:20:00Z" + ] + + invalid_strings = [ + "2004-04-12T13:00", + "2004-04-1213:20:00", + "99-04-12T13:00", + "2004-04-12" + ] + + assert {:ok, "2004-04-01T12:00:00Z"} == DateTime.cast("2004-04-01T12:00:00Z") + + Enum.each(valid_strings, fn date_time -> + result = DateTime.cast(date_time) + assert {:ok, _} = result + end) + + Enum.each(invalid_strings, fn date_time -> + result = DateTime.cast(date_time) + assert :error == result + end) + end +end diff --git a/test/web/activity_pub/object_validators/types/object_id_test.exs b/test/web/activity_pub/object_validators/types/object_id_test.exs new file mode 100644 index 000000000..834213182 --- /dev/null +++ b/test/web/activity_pub/object_validators/types/object_id_test.exs @@ -0,0 +1,37 @@ +defmodule Pleroma.Web.ObjectValidators.Types.ObjectIDTest do + alias Pleroma.Web.ActivityPub.ObjectValidators.Types.ObjectID + use Pleroma.DataCase + + @uris [ + "http://lain.com/users/lain", + "http://lain.com", + "https://lain.com/object/1" + ] + + @non_uris [ + "https://", + "rin", + 1, + :x, + %{"1" => 2} + ] + + test "it accepts http uris" do + Enum.each(@uris, fn uri -> + assert {:ok, uri} == ObjectID.cast(uri) + end) + end + + test "it accepts an object with a nested uri id" do + Enum.each(@uris, fn uri -> + assert {:ok, uri} == ObjectID.cast(%{"id" => uri}) + end) + end + + test "it rejects non-uri strings" do + Enum.each(@non_uris, fn non_uri -> + assert :error == ObjectID.cast(non_uri) + assert :error == ObjectID.cast(%{"id" => non_uri}) + end) + end +end diff --git a/test/web/activity_pub/object_validators/types/recipients_test.exs b/test/web/activity_pub/object_validators/types/recipients_test.exs new file mode 100644 index 000000000..f278f039b --- /dev/null +++ b/test/web/activity_pub/object_validators/types/recipients_test.exs @@ -0,0 +1,27 @@ +defmodule Pleroma.Web.ObjectValidators.Types.RecipientsTest do + alias Pleroma.Web.ActivityPub.ObjectValidators.Types.Recipients + use Pleroma.DataCase + + test "it asserts that all elements of the list are object ids" do + list = ["https://lain.com/users/lain", "invalid"] + + assert :error == Recipients.cast(list) + end + + test "it works with a list" do + list = ["https://lain.com/users/lain"] + assert {:ok, list} == Recipients.cast(list) + end + + test "it works with a list with whole objects" do + list = ["https://lain.com/users/lain", %{"id" => "https://gensokyo.2hu/users/raymoo"}] + resulting_list = ["https://gensokyo.2hu/users/raymoo", "https://lain.com/users/lain"] + assert {:ok, resulting_list} == Recipients.cast(list) + end + + test "it turns a single string into a list" do + recipient = "https://lain.com/users/lain" + + assert {:ok, [recipient]} == Recipients.cast(recipient) + end +end diff --git a/test/web/activity_pub/pipeline_test.exs b/test/web/activity_pub/pipeline_test.exs new file mode 100644 index 000000000..f3c437498 --- /dev/null +++ b/test/web/activity_pub/pipeline_test.exs @@ -0,0 +1,87 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.PipelineTest do + use Pleroma.DataCase + + import Mock + import Pleroma.Factory + + describe "common_pipeline/2" do + test "it goes through validation, filtering, persisting, side effects and federation for local activities" do + activity = insert(:note_activity) + meta = [local: true] + + with_mocks([ + {Pleroma.Web.ActivityPub.ObjectValidator, [], [validate: fn o, m -> {:ok, o, m} end]}, + { + Pleroma.Web.ActivityPub.MRF, + [], + [filter: fn o -> {:ok, o} end] + }, + { + Pleroma.Web.ActivityPub.ActivityPub, + [], + [persist: fn o, m -> {:ok, o, m} end] + }, + { + Pleroma.Web.ActivityPub.SideEffects, + [], + [handle: fn o, m -> {:ok, o, m} end] + }, + { + Pleroma.Web.Federator, + [], + [publish: fn _o -> :ok end] + } + ]) do + assert {:ok, ^activity, ^meta} = + Pleroma.Web.ActivityPub.Pipeline.common_pipeline(activity, meta) + + assert_called(Pleroma.Web.ActivityPub.ObjectValidator.validate(activity, meta)) + assert_called(Pleroma.Web.ActivityPub.MRF.filter(activity)) + assert_called(Pleroma.Web.ActivityPub.ActivityPub.persist(activity, meta)) + assert_called(Pleroma.Web.ActivityPub.SideEffects.handle(activity, meta)) + assert_called(Pleroma.Web.Federator.publish(activity)) + end + end + + test "it goes through validation, filtering, persisting, side effects without federation for remote activities" do + activity = insert(:note_activity) + meta = [local: false] + + with_mocks([ + {Pleroma.Web.ActivityPub.ObjectValidator, [], [validate: fn o, m -> {:ok, o, m} end]}, + { + Pleroma.Web.ActivityPub.MRF, + [], + [filter: fn o -> {:ok, o} end] + }, + { + Pleroma.Web.ActivityPub.ActivityPub, + [], + [persist: fn o, m -> {:ok, o, m} end] + }, + { + Pleroma.Web.ActivityPub.SideEffects, + [], + [handle: fn o, m -> {:ok, o, m} end] + }, + { + Pleroma.Web.Federator, + [], + [] + } + ]) do + assert {:ok, ^activity, ^meta} = + Pleroma.Web.ActivityPub.Pipeline.common_pipeline(activity, meta) + + assert_called(Pleroma.Web.ActivityPub.ObjectValidator.validate(activity, meta)) + assert_called(Pleroma.Web.ActivityPub.MRF.filter(activity)) + assert_called(Pleroma.Web.ActivityPub.ActivityPub.persist(activity, meta)) + assert_called(Pleroma.Web.ActivityPub.SideEffects.handle(activity, meta)) + end + end + end +end diff --git a/test/web/activity_pub/publisher_test.exs b/test/web/activity_pub/publisher_test.exs index 801da03c1..c2bc38d52 100644 --- a/test/web/activity_pub/publisher_test.exs +++ b/test/web/activity_pub/publisher_test.exs @@ -48,10 +48,7 @@ test "it returns links" do describe "determine_inbox/2" do test "it returns sharedInbox for messages involving as:Public in to" do - user = - insert(:user, %{ - source_data: %{"endpoints" => %{"sharedInbox" => "http://example.com/inbox"}} - }) + user = insert(:user, %{shared_inbox: "http://example.com/inbox"}) activity = %Activity{ data: %{"to" => [@as_public], "cc" => [user.follower_address]} @@ -61,10 +58,7 @@ test "it returns sharedInbox for messages involving as:Public in to" do end test "it returns sharedInbox for messages involving as:Public in cc" do - user = - insert(:user, %{ - source_data: %{"endpoints" => %{"sharedInbox" => "http://example.com/inbox"}} - }) + user = insert(:user, %{shared_inbox: "http://example.com/inbox"}) activity = %Activity{ data: %{"cc" => [@as_public], "to" => [user.follower_address]} @@ -74,11 +68,7 @@ test "it returns sharedInbox for messages involving as:Public in cc" do end test "it returns sharedInbox for messages involving multiple recipients in to" do - user = - insert(:user, %{ - source_data: %{"endpoints" => %{"sharedInbox" => "http://example.com/inbox"}} - }) - + user = insert(:user, %{shared_inbox: "http://example.com/inbox"}) user_two = insert(:user) user_three = insert(:user) @@ -90,11 +80,7 @@ test "it returns sharedInbox for messages involving multiple recipients in to" d end test "it returns sharedInbox for messages involving multiple recipients in cc" do - user = - insert(:user, %{ - source_data: %{"endpoints" => %{"sharedInbox" => "http://example.com/inbox"}} - }) - + user = insert(:user, %{shared_inbox: "http://example.com/inbox"}) user_two = insert(:user) user_three = insert(:user) @@ -107,12 +93,10 @@ test "it returns sharedInbox for messages involving multiple recipients in cc" d test "it returns sharedInbox for messages involving multiple recipients in total" do user = - insert(:user, - source_data: %{ - "inbox" => "http://example.com/personal-inbox", - "endpoints" => %{"sharedInbox" => "http://example.com/inbox"} - } - ) + insert(:user, %{ + shared_inbox: "http://example.com/inbox", + inbox: "http://example.com/personal-inbox" + }) user_two = insert(:user) @@ -125,12 +109,10 @@ test "it returns sharedInbox for messages involving multiple recipients in total test "it returns inbox for messages involving single recipients in total" do user = - insert(:user, - source_data: %{ - "inbox" => "http://example.com/personal-inbox", - "endpoints" => %{"sharedInbox" => "http://example.com/inbox"} - } - ) + insert(:user, %{ + shared_inbox: "http://example.com/inbox", + inbox: "http://example.com/personal-inbox" + }) activity = %Activity{ data: %{"to" => [user.ap_id], "cc" => []} @@ -258,11 +240,11 @@ test "it returns inbox for messages involving single recipients in total" do [:passthrough], [] do follower = - insert(:user, + insert(:user, %{ local: false, - source_data: %{"inbox" => "https://domain.com/users/nick1/inbox"}, + inbox: "https://domain.com/users/nick1/inbox", ap_enabled: true - ) + }) actor = insert(:user, follower_address: follower.ap_id) user = insert(:user) @@ -295,14 +277,14 @@ test "it returns inbox for messages involving single recipients in total" do fetcher = insert(:user, local: false, - source_data: %{"inbox" => "https://domain.com/users/nick1/inbox"}, + inbox: "https://domain.com/users/nick1/inbox", ap_enabled: true ) another_fetcher = insert(:user, local: false, - source_data: %{"inbox" => "https://domain2.com/users/nick1/inbox"}, + inbox: "https://domain2.com/users/nick1/inbox", ap_enabled: true ) diff --git a/test/web/activity_pub/relay_test.exs b/test/web/activity_pub/relay_test.exs index 040625e4d..9e16e39c4 100644 --- a/test/web/activity_pub/relay_test.exs +++ b/test/web/activity_pub/relay_test.exs @@ -89,6 +89,11 @@ test "returns error when object is unknown" do } ) + Tesla.Mock.mock(fn + %{method: :get, url: "http://mastodon.example.org/eee/99541947525187367"} -> + %Tesla.Env{status: 500, body: ""} + end) + assert capture_log(fn -> assert Relay.publish(activity) == {:error, nil} end) =~ "[error] error: nil" diff --git a/test/web/activity_pub/side_effects_test.exs b/test/web/activity_pub/side_effects_test.exs new file mode 100644 index 000000000..797f00d08 --- /dev/null +++ b/test/web/activity_pub/side_effects_test.exs @@ -0,0 +1,267 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.SideEffectsTest do + use Oban.Testing, repo: Pleroma.Repo + use Pleroma.DataCase + + alias Pleroma.Activity + alias Pleroma.Notification + alias Pleroma.Object + alias Pleroma.Repo + alias Pleroma.Tests.ObanHelpers + alias Pleroma.User + alias Pleroma.Web.ActivityPub.ActivityPub + alias Pleroma.Web.ActivityPub.Builder + alias Pleroma.Web.ActivityPub.SideEffects + alias Pleroma.Web.CommonAPI + + import Pleroma.Factory + import Mock + + describe "delete objects" do + setup do + user = insert(:user) + other_user = insert(:user) + + {:ok, op} = CommonAPI.post(other_user, %{status: "big oof"}) + {:ok, post} = CommonAPI.post(user, %{status: "hey", in_reply_to_id: op}) + {:ok, favorite} = CommonAPI.favorite(user, post.id) + object = Object.normalize(post) + {:ok, delete_data, _meta} = Builder.delete(user, object.data["id"]) + {:ok, delete_user_data, _meta} = Builder.delete(user, user.ap_id) + {:ok, delete, _meta} = ActivityPub.persist(delete_data, local: true) + {:ok, delete_user, _meta} = ActivityPub.persist(delete_user_data, local: true) + + %{ + user: user, + delete: delete, + post: post, + object: object, + delete_user: delete_user, + op: op, + favorite: favorite + } + end + + test "it handles object deletions", %{ + delete: delete, + post: post, + object: object, + user: user, + op: op, + favorite: favorite + } do + with_mock Pleroma.Web.ActivityPub.ActivityPub, [:passthrough], + stream_out: fn _ -> nil end, + stream_out_participations: fn _, _ -> nil end do + {:ok, delete, _} = SideEffects.handle(delete) + user = User.get_cached_by_ap_id(object.data["actor"]) + + assert called(Pleroma.Web.ActivityPub.ActivityPub.stream_out(delete)) + assert called(Pleroma.Web.ActivityPub.ActivityPub.stream_out_participations(object, user)) + end + + object = Object.get_by_id(object.id) + assert object.data["type"] == "Tombstone" + refute Activity.get_by_id(post.id) + refute Activity.get_by_id(favorite.id) + + user = User.get_by_id(user.id) + assert user.note_count == 0 + + object = Object.normalize(op.data["object"], false) + + assert object.data["repliesCount"] == 0 + end + + test "it handles object deletions when the object itself has been pruned", %{ + delete: delete, + post: post, + object: object, + user: user, + op: op + } do + with_mock Pleroma.Web.ActivityPub.ActivityPub, [:passthrough], + stream_out: fn _ -> nil end, + stream_out_participations: fn _, _ -> nil end do + {:ok, delete, _} = SideEffects.handle(delete) + user = User.get_cached_by_ap_id(object.data["actor"]) + + assert called(Pleroma.Web.ActivityPub.ActivityPub.stream_out(delete)) + assert called(Pleroma.Web.ActivityPub.ActivityPub.stream_out_participations(object, user)) + end + + object = Object.get_by_id(object.id) + assert object.data["type"] == "Tombstone" + refute Activity.get_by_id(post.id) + + user = User.get_by_id(user.id) + assert user.note_count == 0 + + object = Object.normalize(op.data["object"], false) + + assert object.data["repliesCount"] == 0 + end + + test "it handles user deletions", %{delete_user: delete, user: user} do + {:ok, _delete, _} = SideEffects.handle(delete) + ObanHelpers.perform_all() + + assert User.get_cached_by_ap_id(user.ap_id).deactivated + end + end + + describe "EmojiReact objects" do + setup do + poster = insert(:user) + user = insert(:user) + + {:ok, post} = CommonAPI.post(poster, %{status: "hey"}) + + {:ok, emoji_react_data, []} = Builder.emoji_react(user, post.object, "👌") + {:ok, emoji_react, _meta} = ActivityPub.persist(emoji_react_data, local: true) + + %{emoji_react: emoji_react, user: user, poster: poster} + end + + test "adds the reaction to the object", %{emoji_react: emoji_react, user: user} do + {:ok, emoji_react, _} = SideEffects.handle(emoji_react) + object = Object.get_by_ap_id(emoji_react.data["object"]) + + assert object.data["reaction_count"] == 1 + assert ["👌", [user.ap_id]] in object.data["reactions"] + end + + test "creates a notification", %{emoji_react: emoji_react, poster: poster} do + {:ok, emoji_react, _} = SideEffects.handle(emoji_react) + assert Repo.get_by(Notification, user_id: poster.id, activity_id: emoji_react.id) + end + end + + describe "Undo objects" do + setup do + poster = insert(:user) + user = insert(:user) + {:ok, post} = CommonAPI.post(poster, %{status: "hey"}) + {:ok, like} = CommonAPI.favorite(user, post.id) + {:ok, reaction} = CommonAPI.react_with_emoji(post.id, user, "👍") + {:ok, announce, _} = CommonAPI.repeat(post.id, user) + {:ok, block} = ActivityPub.block(user, poster) + User.block(user, poster) + + {:ok, undo_data, _meta} = Builder.undo(user, like) + {:ok, like_undo, _meta} = ActivityPub.persist(undo_data, local: true) + + {:ok, undo_data, _meta} = Builder.undo(user, reaction) + {:ok, reaction_undo, _meta} = ActivityPub.persist(undo_data, local: true) + + {:ok, undo_data, _meta} = Builder.undo(user, announce) + {:ok, announce_undo, _meta} = ActivityPub.persist(undo_data, local: true) + + {:ok, undo_data, _meta} = Builder.undo(user, block) + {:ok, block_undo, _meta} = ActivityPub.persist(undo_data, local: true) + + %{ + like_undo: like_undo, + post: post, + like: like, + reaction_undo: reaction_undo, + reaction: reaction, + announce_undo: announce_undo, + announce: announce, + block_undo: block_undo, + block: block, + poster: poster, + user: user + } + end + + test "deletes the original block", %{block_undo: block_undo, block: block} do + {:ok, _block_undo, _} = SideEffects.handle(block_undo) + refute Activity.get_by_id(block.id) + end + + test "unblocks the blocked user", %{block_undo: block_undo, block: block} do + blocker = User.get_by_ap_id(block.data["actor"]) + blocked = User.get_by_ap_id(block.data["object"]) + + {:ok, _block_undo, _} = SideEffects.handle(block_undo) + refute User.blocks?(blocker, blocked) + end + + test "an announce undo removes the announce from the object", %{ + announce_undo: announce_undo, + post: post + } do + {:ok, _announce_undo, _} = SideEffects.handle(announce_undo) + + object = Object.get_by_ap_id(post.data["object"]) + + assert object.data["announcement_count"] == 0 + assert object.data["announcements"] == [] + end + + test "deletes the original announce", %{announce_undo: announce_undo, announce: announce} do + {:ok, _announce_undo, _} = SideEffects.handle(announce_undo) + refute Activity.get_by_id(announce.id) + end + + test "a reaction undo removes the reaction from the object", %{ + reaction_undo: reaction_undo, + post: post + } do + {:ok, _reaction_undo, _} = SideEffects.handle(reaction_undo) + + object = Object.get_by_ap_id(post.data["object"]) + + assert object.data["reaction_count"] == 0 + assert object.data["reactions"] == [] + end + + test "deletes the original reaction", %{reaction_undo: reaction_undo, reaction: reaction} do + {:ok, _reaction_undo, _} = SideEffects.handle(reaction_undo) + refute Activity.get_by_id(reaction.id) + end + + test "a like undo removes the like from the object", %{like_undo: like_undo, post: post} do + {:ok, _like_undo, _} = SideEffects.handle(like_undo) + + object = Object.get_by_ap_id(post.data["object"]) + + assert object.data["like_count"] == 0 + assert object.data["likes"] == [] + end + + test "deletes the original like", %{like_undo: like_undo, like: like} do + {:ok, _like_undo, _} = SideEffects.handle(like_undo) + refute Activity.get_by_id(like.id) + end + end + + describe "like objects" do + setup do + poster = insert(:user) + user = insert(:user) + {:ok, post} = CommonAPI.post(poster, %{status: "hey"}) + + {:ok, like_data, _meta} = Builder.like(user, post.object) + {:ok, like, _meta} = ActivityPub.persist(like_data, local: true) + + %{like: like, user: user, poster: poster} + end + + test "add the like to the original object", %{like: like, user: user} do + {:ok, like, _} = SideEffects.handle(like) + object = Object.get_by_ap_id(like.data["object"]) + assert object.data["like_count"] == 1 + assert user.ap_id in object.data["likes"] + end + + test "creates a notification", %{like: like, poster: poster} do + {:ok, like, _} = SideEffects.handle(like) + assert Repo.get_by(Notification, user_id: poster.id, activity_id: like.id) + end + end +end diff --git a/test/web/activity_pub/transmogrifier/delete_handling_test.exs b/test/web/activity_pub/transmogrifier/delete_handling_test.exs new file mode 100644 index 000000000..c9a53918c --- /dev/null +++ b/test/web/activity_pub/transmogrifier/delete_handling_test.exs @@ -0,0 +1,114 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.Transmogrifier.DeleteHandlingTest do + use Oban.Testing, repo: Pleroma.Repo + use Pleroma.DataCase + + alias Pleroma.Activity + alias Pleroma.Object + alias Pleroma.Tests.ObanHelpers + alias Pleroma.User + alias Pleroma.Web.ActivityPub.Transmogrifier + + import Pleroma.Factory + + setup_all do + Tesla.Mock.mock_global(fn env -> apply(HttpRequestMock, :request, [env]) end) + :ok + end + + test "it works for incoming deletes" do + activity = insert(:note_activity) + deleting_user = insert(:user) + + data = + File.read!("test/fixtures/mastodon-delete.json") + |> Poison.decode!() + |> Map.put("actor", deleting_user.ap_id) + |> put_in(["object", "id"], activity.data["object"]) + + {:ok, %Activity{actor: actor, local: false, data: %{"id" => id}}} = + Transmogrifier.handle_incoming(data) + + assert id == data["id"] + + # We delete the Create activity because we base our timelines on it. + # This should be changed after we unify objects and activities + refute Activity.get_by_id(activity.id) + assert actor == deleting_user.ap_id + + # Objects are replaced by a tombstone object. + object = Object.normalize(activity.data["object"]) + assert object.data["type"] == "Tombstone" + end + + test "it works for incoming when the object has been pruned" do + activity = insert(:note_activity) + + {:ok, object} = + Object.normalize(activity.data["object"]) + |> Repo.delete() + + Cachex.del(:object_cache, "object:#{object.data["id"]}") + + deleting_user = insert(:user) + + data = + File.read!("test/fixtures/mastodon-delete.json") + |> Poison.decode!() + |> Map.put("actor", deleting_user.ap_id) + |> put_in(["object", "id"], activity.data["object"]) + + {:ok, %Activity{actor: actor, local: false, data: %{"id" => id}}} = + Transmogrifier.handle_incoming(data) + + assert id == data["id"] + + # We delete the Create activity because we base our timelines on it. + # This should be changed after we unify objects and activities + refute Activity.get_by_id(activity.id) + assert actor == deleting_user.ap_id + end + + test "it fails for incoming deletes with spoofed origin" do + activity = insert(:note_activity) + %{ap_id: ap_id} = insert(:user, ap_id: "https://gensokyo.2hu/users/raymoo") + + data = + File.read!("test/fixtures/mastodon-delete.json") + |> Poison.decode!() + |> Map.put("actor", ap_id) + |> put_in(["object", "id"], activity.data["object"]) + + assert match?({:error, _}, Transmogrifier.handle_incoming(data)) + end + + @tag capture_log: true + test "it works for incoming user deletes" do + %{ap_id: ap_id} = insert(:user, ap_id: "http://mastodon.example.org/users/admin") + + data = + File.read!("test/fixtures/mastodon-delete-user.json") + |> Poison.decode!() + + {:ok, _} = Transmogrifier.handle_incoming(data) + ObanHelpers.perform_all() + + assert User.get_cached_by_ap_id(ap_id).deactivated + end + + test "it fails for incoming user deletes with spoofed origin" do + %{ap_id: ap_id} = insert(:user) + + data = + File.read!("test/fixtures/mastodon-delete-user.json") + |> Poison.decode!() + |> Map.put("actor", ap_id) + + assert match?({:error, _}, Transmogrifier.handle_incoming(data)) + + assert User.get_cached_by_ap_id(ap_id) + end +end diff --git a/test/web/activity_pub/transmogrifier/emoji_react_handling_test.exs b/test/web/activity_pub/transmogrifier/emoji_react_handling_test.exs new file mode 100644 index 000000000..0fb056b50 --- /dev/null +++ b/test/web/activity_pub/transmogrifier/emoji_react_handling_test.exs @@ -0,0 +1,61 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.Transmogrifier.EmojiReactHandlingTest do + use Pleroma.DataCase + + alias Pleroma.Activity + alias Pleroma.Object + alias Pleroma.Web.ActivityPub.Transmogrifier + alias Pleroma.Web.CommonAPI + + import Pleroma.Factory + + test "it works for incoming emoji reactions" do + user = insert(:user) + other_user = insert(:user, local: false) + {:ok, activity} = CommonAPI.post(user, %{status: "hello"}) + + data = + File.read!("test/fixtures/emoji-reaction.json") + |> Poison.decode!() + |> Map.put("object", activity.data["object"]) + |> Map.put("actor", other_user.ap_id) + + {:ok, %Activity{data: data, local: false}} = Transmogrifier.handle_incoming(data) + + assert data["actor"] == other_user.ap_id + assert data["type"] == "EmojiReact" + assert data["id"] == "http://mastodon.example.org/users/admin#reactions/2" + assert data["object"] == activity.data["object"] + assert data["content"] == "👌" + + object = Object.get_by_ap_id(data["object"]) + + assert object.data["reaction_count"] == 1 + assert match?([["👌", _]], object.data["reactions"]) + end + + test "it reject invalid emoji reactions" do + user = insert(:user) + other_user = insert(:user, local: false) + {:ok, activity} = CommonAPI.post(user, %{status: "hello"}) + + data = + File.read!("test/fixtures/emoji-reaction-too-long.json") + |> Poison.decode!() + |> Map.put("object", activity.data["object"]) + |> Map.put("actor", other_user.ap_id) + + assert {:error, _} = Transmogrifier.handle_incoming(data) + + data = + File.read!("test/fixtures/emoji-reaction-no-emoji.json") + |> Poison.decode!() + |> Map.put("object", activity.data["object"]) + |> Map.put("actor", other_user.ap_id) + + assert {:error, _} = Transmogrifier.handle_incoming(data) + end +end diff --git a/test/web/activity_pub/transmogrifier/like_handling_test.exs b/test/web/activity_pub/transmogrifier/like_handling_test.exs new file mode 100644 index 000000000..53fe1d550 --- /dev/null +++ b/test/web/activity_pub/transmogrifier/like_handling_test.exs @@ -0,0 +1,78 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.Transmogrifier.LikeHandlingTest do + use Pleroma.DataCase + + alias Pleroma.Activity + alias Pleroma.Web.ActivityPub.Transmogrifier + alias Pleroma.Web.CommonAPI + + import Pleroma.Factory + + test "it works for incoming likes" do + user = insert(:user) + + {:ok, activity} = CommonAPI.post(user, %{status: "hello"}) + + data = + File.read!("test/fixtures/mastodon-like.json") + |> Poison.decode!() + |> Map.put("object", activity.data["object"]) + + _actor = insert(:user, ap_id: data["actor"], local: false) + + {:ok, %Activity{data: data, local: false} = activity} = Transmogrifier.handle_incoming(data) + + refute Enum.empty?(activity.recipients) + + assert data["actor"] == "http://mastodon.example.org/users/admin" + assert data["type"] == "Like" + assert data["id"] == "http://mastodon.example.org/users/admin#likes/2" + assert data["object"] == activity.data["object"] + end + + test "it works for incoming misskey likes, turning them into EmojiReacts" do + user = insert(:user) + + {:ok, activity} = CommonAPI.post(user, %{status: "hello"}) + + data = + File.read!("test/fixtures/misskey-like.json") + |> Poison.decode!() + |> Map.put("object", activity.data["object"]) + + _actor = insert(:user, ap_id: data["actor"], local: false) + + {:ok, %Activity{data: activity_data, local: false}} = Transmogrifier.handle_incoming(data) + + assert activity_data["actor"] == data["actor"] + assert activity_data["type"] == "EmojiReact" + assert activity_data["id"] == data["id"] + assert activity_data["object"] == activity.data["object"] + assert activity_data["content"] == "🍮" + end + + test "it works for incoming misskey likes that contain unicode emojis, turning them into EmojiReacts" do + user = insert(:user) + + {:ok, activity} = CommonAPI.post(user, %{status: "hello"}) + + data = + File.read!("test/fixtures/misskey-like.json") + |> Poison.decode!() + |> Map.put("object", activity.data["object"]) + |> Map.put("_misskey_reaction", "⭐") + + _actor = insert(:user, ap_id: data["actor"], local: false) + + {:ok, %Activity{data: activity_data, local: false}} = Transmogrifier.handle_incoming(data) + + assert activity_data["actor"] == data["actor"] + assert activity_data["type"] == "EmojiReact" + assert activity_data["id"] == data["id"] + assert activity_data["object"] == activity.data["object"] + assert activity_data["content"] == "⭐" + end +end diff --git a/test/web/activity_pub/transmogrifier/undo_handling_test.exs b/test/web/activity_pub/transmogrifier/undo_handling_test.exs new file mode 100644 index 000000000..01dd6c370 --- /dev/null +++ b/test/web/activity_pub/transmogrifier/undo_handling_test.exs @@ -0,0 +1,185 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.Transmogrifier.UndoHandlingTest do + use Pleroma.DataCase + + alias Pleroma.Activity + alias Pleroma.Object + alias Pleroma.User + alias Pleroma.Web.ActivityPub.Transmogrifier + alias Pleroma.Web.CommonAPI + + import Pleroma.Factory + + test "it works for incoming emoji reaction undos" do + user = insert(:user) + + {:ok, activity} = CommonAPI.post(user, %{status: "hello"}) + {:ok, reaction_activity} = CommonAPI.react_with_emoji(activity.id, user, "👌") + + data = + File.read!("test/fixtures/mastodon-undo-like.json") + |> Poison.decode!() + |> Map.put("object", reaction_activity.data["id"]) + |> Map.put("actor", user.ap_id) + + {:ok, activity} = Transmogrifier.handle_incoming(data) + + assert activity.actor == user.ap_id + assert activity.data["id"] == data["id"] + assert activity.data["type"] == "Undo" + end + + test "it returns an error for incoming unlikes wihout a like activity" do + user = insert(:user) + {:ok, activity} = CommonAPI.post(user, %{status: "leave a like pls"}) + + data = + File.read!("test/fixtures/mastodon-undo-like.json") + |> Poison.decode!() + |> Map.put("object", activity.data["object"]) + + assert Transmogrifier.handle_incoming(data) == :error + end + + test "it works for incoming unlikes with an existing like activity" do + user = insert(:user) + {:ok, activity} = CommonAPI.post(user, %{status: "leave a like pls"}) + + like_data = + File.read!("test/fixtures/mastodon-like.json") + |> Poison.decode!() + |> Map.put("object", activity.data["object"]) + + _liker = insert(:user, ap_id: like_data["actor"], local: false) + + {:ok, %Activity{data: like_data, local: false}} = Transmogrifier.handle_incoming(like_data) + + data = + File.read!("test/fixtures/mastodon-undo-like.json") + |> Poison.decode!() + |> Map.put("object", like_data) + |> Map.put("actor", like_data["actor"]) + + {:ok, %Activity{data: data, local: false}} = Transmogrifier.handle_incoming(data) + + assert data["actor"] == "http://mastodon.example.org/users/admin" + assert data["type"] == "Undo" + assert data["id"] == "http://mastodon.example.org/users/admin#likes/2/undo" + assert data["object"] == "http://mastodon.example.org/users/admin#likes/2" + + note = Object.get_by_ap_id(like_data["object"]) + assert note.data["like_count"] == 0 + assert note.data["likes"] == [] + end + + test "it works for incoming unlikes with an existing like activity and a compact object" do + user = insert(:user) + {:ok, activity} = CommonAPI.post(user, %{status: "leave a like pls"}) + + like_data = + File.read!("test/fixtures/mastodon-like.json") + |> Poison.decode!() + |> Map.put("object", activity.data["object"]) + + _liker = insert(:user, ap_id: like_data["actor"], local: false) + + {:ok, %Activity{data: like_data, local: false}} = Transmogrifier.handle_incoming(like_data) + + data = + File.read!("test/fixtures/mastodon-undo-like.json") + |> Poison.decode!() + |> Map.put("object", like_data["id"]) + |> Map.put("actor", like_data["actor"]) + + {:ok, %Activity{data: data, local: false}} = Transmogrifier.handle_incoming(data) + + assert data["actor"] == "http://mastodon.example.org/users/admin" + assert data["type"] == "Undo" + assert data["id"] == "http://mastodon.example.org/users/admin#likes/2/undo" + assert data["object"] == "http://mastodon.example.org/users/admin#likes/2" + end + + test "it works for incoming unannounces with an existing notice" do + user = insert(:user) + {:ok, activity} = CommonAPI.post(user, %{status: "hey"}) + + announce_data = + File.read!("test/fixtures/mastodon-announce.json") + |> Poison.decode!() + |> Map.put("object", activity.data["object"]) + + _announcer = insert(:user, ap_id: announce_data["actor"], local: false) + + {:ok, %Activity{data: announce_data, local: false}} = + Transmogrifier.handle_incoming(announce_data) + + data = + File.read!("test/fixtures/mastodon-undo-announce.json") + |> Poison.decode!() + |> Map.put("object", announce_data) + |> Map.put("actor", announce_data["actor"]) + + {:ok, %Activity{data: data, local: false}} = Transmogrifier.handle_incoming(data) + + assert data["type"] == "Undo" + + assert data["object"] == + "http://mastodon.example.org/users/admin/statuses/99542391527669785/activity" + end + + test "it works for incomming unfollows with an existing follow" do + user = insert(:user) + + follow_data = + File.read!("test/fixtures/mastodon-follow-activity.json") + |> Poison.decode!() + |> Map.put("object", user.ap_id) + + _follower = insert(:user, ap_id: follow_data["actor"], local: false) + + {:ok, %Activity{data: _, local: false}} = Transmogrifier.handle_incoming(follow_data) + + data = + File.read!("test/fixtures/mastodon-unfollow-activity.json") + |> Poison.decode!() + |> Map.put("object", follow_data) + + {:ok, %Activity{data: data, local: false}} = Transmogrifier.handle_incoming(data) + + assert data["type"] == "Undo" + assert data["object"]["type"] == "Follow" + assert data["object"]["object"] == user.ap_id + assert data["actor"] == "http://mastodon.example.org/users/admin" + + refute User.following?(User.get_cached_by_ap_id(data["actor"]), user) + end + + test "it works for incoming unblocks with an existing block" do + user = insert(:user) + + block_data = + File.read!("test/fixtures/mastodon-block-activity.json") + |> Poison.decode!() + |> Map.put("object", user.ap_id) + + _blocker = insert(:user, ap_id: block_data["actor"], local: false) + + {:ok, %Activity{data: _, local: false}} = Transmogrifier.handle_incoming(block_data) + + data = + File.read!("test/fixtures/mastodon-unblock-activity.json") + |> Poison.decode!() + |> Map.put("object", block_data) + + {:ok, %Activity{data: data, local: false}} = Transmogrifier.handle_incoming(data) + assert data["type"] == "Undo" + assert data["object"] == block_data["id"] + + blocker = User.get_cached_by_ap_id(data["actor"]) + + refute User.blocks?(blocker, user) + end +end diff --git a/test/web/activity_pub/transmogrifier_test.exs b/test/web/activity_pub/transmogrifier_test.exs index b2cabbd30..0a54e3bb9 100644 --- a/test/web/activity_pub/transmogrifier_test.exs +++ b/test/web/activity_pub/transmogrifier_test.exs @@ -212,8 +212,8 @@ test "it rewrites Note votes to Answers and increments vote counters on question {:ok, activity} = CommonAPI.post(user, %{ - "status" => "suya...", - "poll" => %{"options" => ["suya", "suya.", "suya.."], "expires_in" => 10} + status: "suya...", + poll: %{options: ["suya", "suya.", "suya.."], expires_in: 10} }) object = Object.normalize(activity) @@ -260,6 +260,24 @@ test "it works for incoming notices with to/cc not being an array (kroeg)" do "

henlo from my Psion netBook

message sent from my Psion netBook

" end + test "it works for incoming honk announces" do + _user = insert(:user, ap_id: "https://honktest/u/test", local: false) + other_user = insert(:user) + {:ok, post} = CommonAPI.post(other_user, %{status: "bonkeronk"}) + + announce = %{ + "@context" => "https://www.w3.org/ns/activitystreams", + "actor" => "https://honktest/u/test", + "id" => "https://honktest/u/test/bonk/1793M7B9MQ48847vdx", + "object" => post.data["object"], + "published" => "2019-06-25T19:33:58Z", + "to" => "https://www.w3.org/ns/activitystreams#Public", + "type" => "Announce" + } + + {:ok, %Activity{local: false}} = Transmogrifier.handle_incoming(announce) + end + test "it works for incoming announces with actor being inlined (kroeg)" do data = File.read!("test/fixtures/kroeg-announce-with-inline-actor.json") |> Poison.decode!() @@ -325,178 +343,6 @@ test "it cleans up incoming notices which are not really DMs" do assert object_data["cc"] == to end - test "it works for incoming likes" do - user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "hello"}) - - data = - File.read!("test/fixtures/mastodon-like.json") - |> Poison.decode!() - |> Map.put("object", activity.data["object"]) - - {:ok, %Activity{data: data, local: false}} = Transmogrifier.handle_incoming(data) - - assert data["actor"] == "http://mastodon.example.org/users/admin" - assert data["type"] == "Like" - assert data["id"] == "http://mastodon.example.org/users/admin#likes/2" - assert data["object"] == activity.data["object"] - end - - test "it works for incoming misskey likes, turning them into EmojiReacts" do - user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "hello"}) - - data = - File.read!("test/fixtures/misskey-like.json") - |> Poison.decode!() - |> Map.put("object", activity.data["object"]) - - {:ok, %Activity{data: data, local: false}} = Transmogrifier.handle_incoming(data) - - assert data["actor"] == data["actor"] - assert data["type"] == "EmojiReact" - assert data["id"] == data["id"] - assert data["object"] == activity.data["object"] - assert data["content"] == "🍮" - end - - test "it works for incoming misskey likes that contain unicode emojis, turning them into EmojiReacts" do - user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "hello"}) - - data = - File.read!("test/fixtures/misskey-like.json") - |> Poison.decode!() - |> Map.put("object", activity.data["object"]) - |> Map.put("_misskey_reaction", "⭐") - - {:ok, %Activity{data: data, local: false}} = Transmogrifier.handle_incoming(data) - - assert data["actor"] == data["actor"] - assert data["type"] == "EmojiReact" - assert data["id"] == data["id"] - assert data["object"] == activity.data["object"] - assert data["content"] == "⭐" - end - - test "it works for incoming emoji reactions" do - user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "hello"}) - - data = - File.read!("test/fixtures/emoji-reaction.json") - |> Poison.decode!() - |> Map.put("object", activity.data["object"]) - - {:ok, %Activity{data: data, local: false}} = Transmogrifier.handle_incoming(data) - - assert data["actor"] == "http://mastodon.example.org/users/admin" - assert data["type"] == "EmojiReact" - assert data["id"] == "http://mastodon.example.org/users/admin#reactions/2" - assert data["object"] == activity.data["object"] - assert data["content"] == "👌" - end - - test "it reject invalid emoji reactions" do - user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "hello"}) - - data = - File.read!("test/fixtures/emoji-reaction-too-long.json") - |> Poison.decode!() - |> Map.put("object", activity.data["object"]) - - assert :error = Transmogrifier.handle_incoming(data) - - data = - File.read!("test/fixtures/emoji-reaction-no-emoji.json") - |> Poison.decode!() - |> Map.put("object", activity.data["object"]) - - assert :error = Transmogrifier.handle_incoming(data) - end - - test "it works for incoming emoji reaction undos" do - user = insert(:user) - - {:ok, activity} = CommonAPI.post(user, %{"status" => "hello"}) - {:ok, reaction_activity, _object} = CommonAPI.react_with_emoji(activity.id, user, "👌") - - data = - File.read!("test/fixtures/mastodon-undo-like.json") - |> Poison.decode!() - |> Map.put("object", reaction_activity.data["id"]) - |> Map.put("actor", user.ap_id) - - {:ok, activity} = Transmogrifier.handle_incoming(data) - - assert activity.actor == user.ap_id - assert activity.data["id"] == data["id"] - assert activity.data["type"] == "Undo" - end - - test "it returns an error for incoming unlikes wihout a like activity" do - user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "leave a like pls"}) - - data = - File.read!("test/fixtures/mastodon-undo-like.json") - |> Poison.decode!() - |> Map.put("object", activity.data["object"]) - - assert Transmogrifier.handle_incoming(data) == :error - end - - test "it works for incoming unlikes with an existing like activity" do - user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "leave a like pls"}) - - like_data = - File.read!("test/fixtures/mastodon-like.json") - |> Poison.decode!() - |> Map.put("object", activity.data["object"]) - - {:ok, %Activity{data: like_data, local: false}} = Transmogrifier.handle_incoming(like_data) - - data = - File.read!("test/fixtures/mastodon-undo-like.json") - |> Poison.decode!() - |> Map.put("object", like_data) - |> Map.put("actor", like_data["actor"]) - - {:ok, %Activity{data: data, local: false}} = Transmogrifier.handle_incoming(data) - - assert data["actor"] == "http://mastodon.example.org/users/admin" - assert data["type"] == "Undo" - assert data["id"] == "http://mastodon.example.org/users/admin#likes/2/undo" - assert data["object"]["id"] == "http://mastodon.example.org/users/admin#likes/2" - end - - test "it works for incoming unlikes with an existing like activity and a compact object" do - user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "leave a like pls"}) - - like_data = - File.read!("test/fixtures/mastodon-like.json") - |> Poison.decode!() - |> Map.put("object", activity.data["object"]) - - {:ok, %Activity{data: like_data, local: false}} = Transmogrifier.handle_incoming(like_data) - - data = - File.read!("test/fixtures/mastodon-undo-like.json") - |> Poison.decode!() - |> Map.put("object", like_data["id"]) - |> Map.put("actor", like_data["actor"]) - - {:ok, %Activity{data: data, local: false}} = Transmogrifier.handle_incoming(data) - - assert data["actor"] == "http://mastodon.example.org/users/admin" - assert data["type"] == "Undo" - assert data["id"] == "http://mastodon.example.org/users/admin#likes/2/undo" - assert data["object"]["id"] == "http://mastodon.example.org/users/admin#likes/2" - end - test "it works for incoming announces" do data = File.read!("test/fixtures/mastodon-announce.json") |> Poison.decode!() @@ -516,7 +362,7 @@ test "it works for incoming announces" do test "it works for incoming announces with an existing activity" do user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "hey"}) + {:ok, activity} = CommonAPI.post(user, %{status: "hey"}) data = File.read!("test/fixtures/mastodon-announce.json") @@ -566,7 +412,7 @@ test "it rejects incoming announces with an inlined activity from another origin test "it does not clobber the addressing on announce activities" do user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "hey"}) + {:ok, activity} = CommonAPI.post(user, %{status: "hey"}) data = File.read!("test/fixtures/mastodon-announce.json") @@ -652,8 +498,8 @@ test "it strips internal likes" do test "it strips internal reactions" do user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "#cofe"}) - {:ok, _, _} = CommonAPI.react_with_emoji(activity.id, user, "📢") + {:ok, activity} = CommonAPI.post(user, %{status: "#cofe"}) + {:ok, _} = CommonAPI.react_with_emoji(activity.id, user, "📢") %{object: object} = Activity.get_by_id_with_object(activity.id) assert Map.has_key?(object.data, "reactions") @@ -744,7 +590,7 @@ test "it works with custom profile fields" do user = User.get_cached_by_ap_id(activity.actor) - assert User.fields(user) == [ + assert user.fields == [ %{"name" => "foo", "value" => "bar"}, %{"name" => "foo1", "value" => "bar1"} ] @@ -765,7 +611,7 @@ test "it works with custom profile fields" do user = User.get_cached_by_ap_id(user.ap_id) - assert User.fields(user) == [ + assert user.fields == [ %{"name" => "foo", "value" => "updated"}, %{"name" => "foo1", "value" => "updated"} ] @@ -783,7 +629,7 @@ test "it works with custom profile fields" do user = User.get_cached_by_ap_id(user.ap_id) - assert User.fields(user) == [ + assert user.fields == [ %{"name" => "foo", "value" => "updated"}, %{"name" => "foo1", "value" => "updated"} ] @@ -794,7 +640,7 @@ test "it works with custom profile fields" do user = User.get_cached_by_ap_id(user.ap_id) - assert User.fields(user) == [] + assert user.fields == [] end test "it works for incoming update activities which lock the account" do @@ -820,112 +666,6 @@ test "it works for incoming update activities which lock the account" do assert user.locked == true end - test "it works for incoming deletes" do - activity = insert(:note_activity) - deleting_user = insert(:user) - - data = - File.read!("test/fixtures/mastodon-delete.json") - |> Poison.decode!() - - object = - data["object"] - |> Map.put("id", activity.data["object"]) - - data = - data - |> Map.put("object", object) - |> Map.put("actor", deleting_user.ap_id) - - {:ok, %Activity{actor: actor, local: false, data: %{"id" => id}}} = - Transmogrifier.handle_incoming(data) - - assert id == data["id"] - refute Activity.get_by_id(activity.id) - assert actor == deleting_user.ap_id - end - - test "it fails for incoming deletes with spoofed origin" do - activity = insert(:note_activity) - - data = - File.read!("test/fixtures/mastodon-delete.json") - |> Poison.decode!() - - object = - data["object"] - |> Map.put("id", activity.data["object"]) - - data = - data - |> Map.put("object", object) - - assert capture_log(fn -> - :error = Transmogrifier.handle_incoming(data) - end) =~ - "[error] Could not decode user at fetch http://mastodon.example.org/users/gargron, {:error, :nxdomain}" - - assert Activity.get_by_id(activity.id) - end - - @tag capture_log: true - test "it works for incoming user deletes" do - %{ap_id: ap_id} = insert(:user, ap_id: "http://mastodon.example.org/users/admin") - - data = - File.read!("test/fixtures/mastodon-delete-user.json") - |> Poison.decode!() - - {:ok, _} = Transmogrifier.handle_incoming(data) - ObanHelpers.perform_all() - - refute User.get_cached_by_ap_id(ap_id) - end - - test "it fails for incoming user deletes with spoofed origin" do - %{ap_id: ap_id} = insert(:user) - - data = - File.read!("test/fixtures/mastodon-delete-user.json") - |> Poison.decode!() - |> Map.put("actor", ap_id) - - assert capture_log(fn -> - assert :error == Transmogrifier.handle_incoming(data) - end) =~ "Object containment failed" - - assert User.get_cached_by_ap_id(ap_id) - end - - test "it works for incoming unannounces with an existing notice" do - user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "hey"}) - - announce_data = - File.read!("test/fixtures/mastodon-announce.json") - |> Poison.decode!() - |> Map.put("object", activity.data["object"]) - - {:ok, %Activity{data: announce_data, local: false}} = - Transmogrifier.handle_incoming(announce_data) - - data = - File.read!("test/fixtures/mastodon-undo-announce.json") - |> Poison.decode!() - |> Map.put("object", announce_data) - |> Map.put("actor", announce_data["actor"]) - - {:ok, %Activity{data: data, local: false}} = Transmogrifier.handle_incoming(data) - - assert data["type"] == "Undo" - assert object_data = data["object"] - assert object_data["type"] == "Announce" - assert object_data["object"] == activity.data["object"] - - assert object_data["id"] == - "http://mastodon.example.org/users/admin/statuses/99542391527669785/activity" - end - test "it works for incomming unfollows with an existing follow" do user = insert(:user) @@ -1020,32 +760,6 @@ test "incoming blocks successfully tear down any follow relationship" do refute User.following?(blocked, blocker) end - test "it works for incoming unblocks with an existing block" do - user = insert(:user) - - block_data = - File.read!("test/fixtures/mastodon-block-activity.json") - |> Poison.decode!() - |> Map.put("object", user.ap_id) - - {:ok, %Activity{data: _, local: false}} = Transmogrifier.handle_incoming(block_data) - - data = - File.read!("test/fixtures/mastodon-unblock-activity.json") - |> Poison.decode!() - |> Map.put("object", block_data) - - {:ok, %Activity{data: data, local: false}} = Transmogrifier.handle_incoming(data) - assert data["type"] == "Undo" - assert data["object"]["type"] == "Block" - assert data["object"]["object"] == user.ap_id - assert data["actor"] == "http://mastodon.example.org/users/admin" - - blocker = User.get_cached_by_ap_id(data["actor"]) - - refute User.blocks?(blocker, user) - end - test "it works for incoming accepts which were pre-accepted" do follower = insert(:user) followed = insert(:user) @@ -1119,6 +833,12 @@ test "it works for incoming accepts which are referenced by IRI only" do follower = User.get_cached_by_id(follower.id) assert User.following?(follower, followed) == true + + follower = User.get_by_id(follower.id) + assert follower.following_count == 1 + + followed = User.get_by_id(followed.id) + assert followed.follower_count == 1 end test "it fails for incoming accepts which cannot be correlated" do @@ -1219,6 +939,35 @@ test "it rejects activities without a valid ID" do :error = Transmogrifier.handle_incoming(data) end + test "skip converting the content when it is nil" do + object_id = "https://peertube.social/videos/watch/278d2b7c-0f38-4aaa-afe6-9ecc0c4a34fe" + + {:ok, object} = Fetcher.fetch_and_contain_remote_object_from_id(object_id) + + result = + Pleroma.Web.ActivityPub.Transmogrifier.fix_object(Map.merge(object, %{"content" => nil})) + + assert result["content"] == nil + end + + test "it converts content of object to html" do + object_id = "https://peertube.social/videos/watch/278d2b7c-0f38-4aaa-afe6-9ecc0c4a34fe" + + {:ok, %{"content" => content_markdown}} = + Fetcher.fetch_and_contain_remote_object_from_id(object_id) + + {:ok, %Pleroma.Object{data: %{"content" => content}} = object} = + Fetcher.fetch_object_from_id(object_id) + + assert content_markdown == + "Support this and our other Michigan!/usr/group videos and meetings. Learn more at http://mug.org/membership\n\nTwenty Years in Jail: FreeBSD's Jails, Then and Now\n\nJails started as a limited virtualization system, but over the last two years they've..." + + assert content == + "

Support this and our other Michigan!/usr/group videos and meetings. Learn more at http://mug.org/membership

Twenty Years in Jail: FreeBSD’s Jails, Then and Now

Jails started as a limited virtualization system, but over the last two years they’ve…

" + + assert object.data["mediaType"] == "text/html" + end + test "it remaps video URLs as attachments if necessary" do {:ok, object} = Fetcher.fetch_object_from_id( @@ -1228,19 +977,13 @@ test "it remaps video URLs as attachments if necessary" do attachment = %{ "type" => "Link", "mediaType" => "video/mp4", - "href" => - "https://peertube.moe/static/webseed/df5f464b-be8d-46fb-ad81-2d4c2d1630e3-480.mp4", - "mimeType" => "video/mp4", - "size" => 5_015_880, "url" => [ %{ "href" => "https://peertube.moe/static/webseed/df5f464b-be8d-46fb-ad81-2d4c2d1630e3-480.mp4", - "mediaType" => "video/mp4", - "type" => "Link" + "mediaType" => "video/mp4" } - ], - "width" => 480 + ] } assert object.data["url"] == @@ -1253,7 +996,7 @@ test "it accepts Flag activities" do user = insert(:user) other_user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "test post"}) + {:ok, activity} = CommonAPI.post(user, %{status: "test post"}) object = Object.normalize(activity) note_obj = %{ @@ -1397,13 +1140,13 @@ test "does NOT schedule background fetching of `replies` beyond max thread depth setup do user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "post1"}) + {:ok, activity} = CommonAPI.post(user, %{status: "post1"}) {:ok, reply1} = - CommonAPI.post(user, %{"status" => "reply1", "in_reply_to_status_id" => activity.id}) + CommonAPI.post(user, %{status: "reply1", in_reply_to_status_id: activity.id}) {:ok, reply2} = - CommonAPI.post(user, %{"status" => "reply2", "in_reply_to_status_id" => activity.id}) + CommonAPI.post(user, %{status: "reply2", in_reply_to_status_id: activity.id}) replies_uris = Enum.map([reply1, reply2], fn a -> a.object.data["id"] end) @@ -1443,7 +1186,7 @@ test "does NOT schedule background fetching of `replies` beyond max thread depth test "it inlines private announced objects" do user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "hey", "visibility" => "private"}) + {:ok, activity} = CommonAPI.post(user, %{status: "hey", visibility: "private"}) {:ok, announce_activity, _} = CommonAPI.repeat(activity.id, user) @@ -1458,7 +1201,7 @@ test "it turns mentions into tags" do other_user = insert(:user) {:ok, activity} = - CommonAPI.post(user, %{"status" => "hey, @#{other_user.nickname}, how are ya? #2hu"}) + CommonAPI.post(user, %{status: "hey, @#{other_user.nickname}, how are ya? #2hu"}) {:ok, modified} = Transmogrifier.prepare_outgoing(activity.data) object = modified["object"] @@ -1482,7 +1225,7 @@ test "it turns mentions into tags" do test "it adds the sensitive property" do user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "#nsfw hey"}) + {:ok, activity} = CommonAPI.post(user, %{status: "#nsfw hey"}) {:ok, modified} = Transmogrifier.prepare_outgoing(activity.data) assert modified["object"]["sensitive"] @@ -1491,7 +1234,7 @@ test "it adds the sensitive property" do test "it adds the json-ld context and the conversation property" do user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "hey"}) + {:ok, activity} = CommonAPI.post(user, %{status: "hey"}) {:ok, modified} = Transmogrifier.prepare_outgoing(activity.data) assert modified["@context"] == @@ -1503,7 +1246,7 @@ test "it adds the json-ld context and the conversation property" do test "it sets the 'attributedTo' property to the actor of the object if it doesn't have one" do user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "hey"}) + {:ok, activity} = CommonAPI.post(user, %{status: "hey"}) {:ok, modified} = Transmogrifier.prepare_outgoing(activity.data) assert modified["object"]["actor"] == modified["object"]["attributedTo"] @@ -1512,7 +1255,7 @@ test "it sets the 'attributedTo' property to the actor of the object if it doesn test "it strips internal hashtag data" do user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "#2hu"}) + {:ok, activity} = CommonAPI.post(user, %{status: "#2hu"}) expected_tag = %{ "href" => Pleroma.Web.Endpoint.url() <> "/tags/2hu", @@ -1528,7 +1271,7 @@ test "it strips internal hashtag data" do test "it strips internal fields" do user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "#2hu :firefox:"}) + {:ok, activity} = CommonAPI.post(user, %{status: "#2hu :firefox:"}) {:ok, modified} = Transmogrifier.prepare_outgoing(activity.data) @@ -1560,14 +1303,13 @@ test "the directMessage flag is present" do user = insert(:user) other_user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "2hu :moominmamma:"}) + {:ok, activity} = CommonAPI.post(user, %{status: "2hu :moominmamma:"}) {:ok, modified} = Transmogrifier.prepare_outgoing(activity.data) assert modified["directMessage"] == false - {:ok, activity} = - CommonAPI.post(user, %{"status" => "@#{other_user.nickname} :moominmamma:"}) + {:ok, activity} = CommonAPI.post(user, %{status: "@#{other_user.nickname} :moominmamma:"}) {:ok, modified} = Transmogrifier.prepare_outgoing(activity.data) @@ -1575,8 +1317,8 @@ test "the directMessage flag is present" do {:ok, activity} = CommonAPI.post(user, %{ - "status" => "@#{other_user.nickname} :moominmamma:", - "visibility" => "direct" + status: "@#{other_user.nickname} :moominmamma:", + visibility: "direct" }) {:ok, modified} = Transmogrifier.prepare_outgoing(activity.data) @@ -1588,8 +1330,7 @@ test "it strips BCC field" do user = insert(:user) {:ok, list} = Pleroma.List.create("foo", user) - {:ok, activity} = - CommonAPI.post(user, %{"status" => "foobar", "visibility" => "list:#{list.id}"}) + {:ok, activity} = CommonAPI.post(user, %{status: "foobar", visibility: "list:#{list.id}"}) {:ok, modified} = Transmogrifier.prepare_outgoing(activity.data) @@ -1622,10 +1363,10 @@ test "it upgrades a user to activitypub" do }) user_two = insert(:user) - Pleroma.FollowingRelationship.follow(user_two, user, "accept") + Pleroma.FollowingRelationship.follow(user_two, user, :follow_accept) - {:ok, activity} = CommonAPI.post(user, %{"status" => "test"}) - {:ok, unrelated_activity} = CommonAPI.post(user_two, %{"status" => "test"}) + {:ok, activity} = CommonAPI.post(user, %{status: "test"}) + {:ok, unrelated_activity} = CommonAPI.post(user_two, %{status: "test"}) assert "http://localhost:4001/users/rye@niu.moe/followers" in activity.recipients user = User.get_cached_by_id(user.id) @@ -1791,8 +1532,8 @@ test "Rewrites Answers to Notes" do {:ok, poll_activity} = CommonAPI.post(user, %{ - "status" => "suya...", - "poll" => %{"options" => ["suya", "suya.", "suya.."], "expires_in" => 10} + status: "suya...", + poll: %{options: ["suya", "suya.", "suya.."], expires_in: 10} }) poll_object = Object.normalize(poll_activity) @@ -2061,11 +1802,7 @@ test "returns modified object when attachment is map" do %{ "mediaType" => "video/mp4", "url" => [ - %{ - "href" => "https://peertube.moe/stat-480.mp4", - "mediaType" => "video/mp4", - "type" => "Link" - } + %{"href" => "https://peertube.moe/stat-480.mp4", "mediaType" => "video/mp4"} ] } ] @@ -2083,23 +1820,13 @@ test "returns modified object when attachment is list" do %{ "mediaType" => "video/mp4", "url" => [ - %{ - "href" => "https://pe.er/stat-480.mp4", - "mediaType" => "video/mp4", - "type" => "Link" - } + %{"href" => "https://pe.er/stat-480.mp4", "mediaType" => "video/mp4"} ] }, %{ - "href" => "https://pe.er/stat-480.mp4", "mediaType" => "video/mp4", - "mimeType" => "video/mp4", "url" => [ - %{ - "href" => "https://pe.er/stat-480.mp4", - "mediaType" => "video/mp4", - "type" => "Link" - } + %{"href" => "https://pe.er/stat-480.mp4", "mediaType" => "video/mp4"} ] } ] @@ -2149,28 +1876,27 @@ test "returns unmodified object if activity doesn't have self-replies" do test "sets `replies` collection with a limited number of self-replies" do [user, another_user] = insert_list(2, :user) - {:ok, %{id: id1} = activity} = CommonAPI.post(user, %{"status" => "1"}) + {:ok, %{id: id1} = activity} = CommonAPI.post(user, %{status: "1"}) {:ok, %{id: id2} = self_reply1} = - CommonAPI.post(user, %{"status" => "self-reply 1", "in_reply_to_status_id" => id1}) + CommonAPI.post(user, %{status: "self-reply 1", in_reply_to_status_id: id1}) {:ok, self_reply2} = - CommonAPI.post(user, %{"status" => "self-reply 2", "in_reply_to_status_id" => id1}) + CommonAPI.post(user, %{status: "self-reply 2", in_reply_to_status_id: id1}) # Assuming to _not_ be present in `replies` due to :note_replies_output_limit is set to 2 - {:ok, _} = - CommonAPI.post(user, %{"status" => "self-reply 3", "in_reply_to_status_id" => id1}) + {:ok, _} = CommonAPI.post(user, %{status: "self-reply 3", in_reply_to_status_id: id1}) {:ok, _} = CommonAPI.post(user, %{ - "status" => "self-reply to self-reply", - "in_reply_to_status_id" => id2 + status: "self-reply to self-reply", + in_reply_to_status_id: id2 }) {:ok, _} = CommonAPI.post(another_user, %{ - "status" => "another user's reply", - "in_reply_to_status_id" => id1 + status: "another user's reply", + in_reply_to_status_id: id1 }) object = Object.normalize(activity) @@ -2180,4 +1906,18 @@ test "sets `replies` collection with a limited number of self-replies" do Transmogrifier.set_replies(object.data)["replies"] end end + + test "take_emoji_tags/1" do + user = insert(:user, %{emoji: %{"firefox" => "https://example.org/firefox.png"}}) + + assert Transmogrifier.take_emoji_tags(user) == [ + %{ + "icon" => %{"type" => "Image", "url" => "https://example.org/firefox.png"}, + "id" => "https://example.org/firefox.png", + "name" => ":firefox:", + "type" => "Emoji", + "updated" => "1970-01-01T00:00:00Z" + } + ] + end end diff --git a/test/web/activity_pub/utils_test.exs b/test/web/activity_pub/utils_test.exs index e913a5148..9e0a0f1c4 100644 --- a/test/web/activity_pub/utils_test.exs +++ b/test/web/activity_pub/utils_test.exs @@ -102,34 +102,6 @@ test "works with an object has tags as map" do end end - describe "make_unlike_data/3" do - test "returns data for unlike activity" do - user = insert(:user) - like_activity = insert(:like_activity, data_attrs: %{"context" => "test context"}) - - object = Object.normalize(like_activity.data["object"]) - - assert Utils.make_unlike_data(user, like_activity, nil) == %{ - "type" => "Undo", - "actor" => user.ap_id, - "object" => like_activity.data, - "to" => [user.follower_address, object.data["actor"]], - "cc" => [Pleroma.Constants.as_public()], - "context" => like_activity.data["context"] - } - - assert Utils.make_unlike_data(user, like_activity, "9mJEZK0tky1w2xD2vY") == %{ - "type" => "Undo", - "actor" => user.ap_id, - "object" => like_activity.data, - "to" => [user.follower_address, object.data["actor"]], - "cc" => [Pleroma.Constants.as_public()], - "context" => like_activity.data["context"], - "id" => "9mJEZK0tky1w2xD2vY" - } - end - end - describe "make_like_data" do setup do user = insert(:user) @@ -148,7 +120,7 @@ test "addresses actor's follower address if the activity is public", %{ {:ok, activity} = CommonAPI.post(user, %{ - "status" => + status: "hey @#{other_user.nickname}, @#{third_user.nickname} how about beering together this weekend?" }) @@ -167,8 +139,8 @@ test "does not adress actor's follower address if the activity is not public", % {:ok, activity} = CommonAPI.post(user, %{ - "status" => "@#{other_user.nickname} @#{third_user.nickname} bought a new swimsuit!", - "visibility" => "private" + status: "@#{other_user.nickname} @#{third_user.nickname} bought a new swimsuit!", + visibility: "private" }) %{"to" => to, "cc" => cc} = Utils.make_like_data(other_user, activity, nil) @@ -196,11 +168,11 @@ test "fetches existing votes" do {:ok, activity} = CommonAPI.post(user, %{ - "status" => "How do I pronounce LaTeX?", - "poll" => %{ - "options" => ["laytekh", "lahtekh", "latex"], - "expires_in" => 20, - "multiple" => true + status: "How do I pronounce LaTeX?", + poll: %{ + options: ["laytekh", "lahtekh", "latex"], + expires_in: 20, + multiple: true } }) @@ -215,17 +187,16 @@ test "fetches only Create activities" do {:ok, activity} = CommonAPI.post(user, %{ - "status" => "Are we living in a society?", - "poll" => %{ - "options" => ["yes", "no"], - "expires_in" => 20 + status: "Are we living in a society?", + poll: %{ + options: ["yes", "no"], + expires_in: 20 } }) object = Object.normalize(activity) {:ok, [vote], object} = CommonAPI.vote(other_user, object, [0]) - vote_object = Object.normalize(vote) - {:ok, _activity, _object} = ActivityPub.like(user, vote_object) + {:ok, _activity} = CommonAPI.favorite(user, activity.id) [fetched_vote] = Utils.get_existing_votes(other_user.ap_id, object) assert fetched_vote.id == vote.id end @@ -346,7 +317,7 @@ test "fetches existing like" do user = insert(:user) refute Utils.get_existing_like(user.ap_id, object) - {:ok, like_activity, _object} = ActivityPub.like(user, object) + {:ok, like_activity} = CommonAPI.favorite(user, note_activity.id) assert ^like_activity = Utils.get_existing_like(user.ap_id, object) end @@ -498,7 +469,7 @@ test "returns empty map when params is invalid" do test "returns map with Flag object" do reporter = insert(:user) target_account = insert(:user) - {:ok, activity} = CommonAPI.post(target_account, %{"status" => "foobar"}) + {:ok, activity} = CommonAPI.post(target_account, %{status: "foobar"}) context = Utils.generate_context_id() content = "foobar" diff --git a/test/web/activity_pub/views/object_view_test.exs b/test/web/activity_pub/views/object_view_test.exs index de5ffc5b3..43f0617f0 100644 --- a/test/web/activity_pub/views/object_view_test.exs +++ b/test/web/activity_pub/views/object_view_test.exs @@ -44,7 +44,7 @@ test "renders `replies` collection for a note activity" do activity = insert(:note_activity, user: user) {:ok, self_reply1} = - CommonAPI.post(user, %{"status" => "self-reply 1", "in_reply_to_status_id" => activity.id}) + CommonAPI.post(user, %{status: "self-reply 1", in_reply_to_status_id: activity.id}) replies_uris = [self_reply1.object.data["id"]] result = ObjectView.render("object.json", %{object: refresh_record(activity)}) @@ -59,7 +59,7 @@ test "renders a like activity" do object = Object.normalize(note) user = insert(:user) - {:ok, like_activity, _} = CommonAPI.favorite(note.id, user) + {:ok, like_activity} = CommonAPI.favorite(user, note.id) result = ObjectView.render("object.json", %{object: like_activity}) diff --git a/test/web/activity_pub/views/user_view_test.exs b/test/web/activity_pub/views/user_view_test.exs index ecb2dc386..20b0f223c 100644 --- a/test/web/activity_pub/views/user_view_test.exs +++ b/test/web/activity_pub/views/user_view_test.exs @@ -29,7 +29,7 @@ test "Renders profile fields" do {:ok, user} = insert(:user) - |> User.upgrade_changeset(%{fields: fields}) + |> User.update_changeset(%{fields: fields}) |> User.update_and_set_cache() assert %{ @@ -38,7 +38,7 @@ test "Renders profile fields" do end test "Renders with emoji tags" do - user = insert(:user, emoji: [%{"bib" => "/test"}]) + user = insert(:user, emoji: %{"bib" => "/test"}) assert %{ "tag" => [ @@ -164,7 +164,7 @@ test "activity collection page aginates correctly" do posts = for i <- 0..25 do - {:ok, activity} = CommonAPI.post(user, %{"status" => "post #{i}"}) + {:ok, activity} = CommonAPI.post(user, %{status: "post #{i}"}) activity end diff --git a/test/web/activity_pub/visibilty_test.exs b/test/web/activity_pub/visibilty_test.exs index 5b91630d4..8e9354c65 100644 --- a/test/web/activity_pub/visibilty_test.exs +++ b/test/web/activity_pub/visibilty_test.exs @@ -21,21 +21,21 @@ defmodule Pleroma.Web.ActivityPub.VisibilityTest do Pleroma.List.follow(list, unrelated) {:ok, public} = - CommonAPI.post(user, %{"status" => "@#{mentioned.nickname}", "visibility" => "public"}) + CommonAPI.post(user, %{status: "@#{mentioned.nickname}", visibility: "public"}) {:ok, private} = - CommonAPI.post(user, %{"status" => "@#{mentioned.nickname}", "visibility" => "private"}) + CommonAPI.post(user, %{status: "@#{mentioned.nickname}", visibility: "private"}) {:ok, direct} = - CommonAPI.post(user, %{"status" => "@#{mentioned.nickname}", "visibility" => "direct"}) + CommonAPI.post(user, %{status: "@#{mentioned.nickname}", visibility: "direct"}) {:ok, unlisted} = - CommonAPI.post(user, %{"status" => "@#{mentioned.nickname}", "visibility" => "unlisted"}) + CommonAPI.post(user, %{status: "@#{mentioned.nickname}", visibility: "unlisted"}) {:ok, list} = CommonAPI.post(user, %{ - "status" => "@#{mentioned.nickname}", - "visibility" => "list:#{list.id}" + status: "@#{mentioned.nickname}", + visibility: "list:#{list.id}" }) %{ diff --git a/test/web/admin_api/admin_api_controller_test.exs b/test/web/admin_api/admin_api_controller_test.exs index 0a902585d..370d876d0 100644 --- a/test/web/admin_api/admin_api_controller_test.exs +++ b/test/web/admin_api/admin_api_controller_test.exs @@ -6,22 +6,24 @@ defmodule Pleroma.Web.AdminAPI.AdminAPIControllerTest do use Pleroma.Web.ConnCase use Oban.Testing, repo: Pleroma.Repo - import Pleroma.Factory import ExUnit.CaptureLog + import Mock + import Pleroma.Factory alias Pleroma.Activity alias Pleroma.Config alias Pleroma.ConfigDB alias Pleroma.HTML + alias Pleroma.MFA alias Pleroma.ModerationLog alias Pleroma.Repo alias Pleroma.ReportNote alias Pleroma.Tests.ObanHelpers alias Pleroma.User alias Pleroma.UserInviteToken + alias Pleroma.Web alias Pleroma.Web.ActivityPub.Relay alias Pleroma.Web.CommonAPI - alias Pleroma.Web.MastodonAPI.StatusView alias Pleroma.Web.MediaProxy setup_all do @@ -147,17 +149,26 @@ test "GET /api/pleroma/admin/users/:nickname requires " <> test "single user", %{admin: admin, conn: conn} do user = insert(:user) - conn = - conn - |> put_req_header("accept", "application/json") - |> delete("/api/pleroma/admin/users?nickname=#{user.nickname}") + with_mock Pleroma.Web.Federator, + publish: fn _ -> nil end do + conn = + conn + |> put_req_header("accept", "application/json") + |> delete("/api/pleroma/admin/users?nickname=#{user.nickname}") - log_entry = Repo.one(ModerationLog) + ObanHelpers.perform_all() - assert ModerationLog.get_log_entry_message(log_entry) == - "@#{admin.nickname} deleted users: @#{user.nickname}" + assert User.get_by_nickname(user.nickname).deactivated - assert json_response(conn, 200) == user.nickname + log_entry = Repo.one(ModerationLog) + + assert ModerationLog.get_log_entry_message(log_entry) == + "@#{admin.nickname} deleted users: @#{user.nickname}" + + assert json_response(conn, 200) == [user.nickname] + + assert called(Pleroma.Web.Federator.publish(:_)) + end end test "multiple users", %{admin: admin, conn: conn} do @@ -626,6 +637,39 @@ test "it returns 403 if requested by a non-admin" do assert json_response(conn, :forbidden) end + + test "email with +", %{conn: conn, admin: admin} do + recipient_email = "foo+bar@baz.com" + + conn + |> put_req_header("content-type", "application/json;charset=utf-8") + |> post("/api/pleroma/admin/users/email_invite", %{email: recipient_email}) + |> json_response(:no_content) + + token_record = + Pleroma.UserInviteToken + |> Repo.all() + |> List.last() + + assert token_record + refute token_record.used + + notify_email = Config.get([:instance, :notify_email]) + instance_name = Config.get([:instance, :name]) + + email = + Pleroma.Emails.UserEmail.user_invitation_email( + admin, + token_record, + recipient_email + ) + + Swoosh.TestAssertions.assert_email_sent( + from: {instance_name, notify_email}, + to: recipient_email, + html_body: email.html_body + ) + end end describe "POST /api/pleroma/admin/users/email_invite, with invalid config" do @@ -638,7 +682,8 @@ test "it returns 500 if `invites_enabled` is not enabled", %{conn: conn} do conn = post(conn, "/api/pleroma/admin/users/email_invite?email=foo@bar.com&name=JD") - assert json_response(conn, :internal_server_error) + assert json_response(conn, :bad_request) == + "To send invites you need to set the `invites_enabled` option to true." end test "it returns 500 if `registrations_open` is enabled", %{conn: conn} do @@ -647,7 +692,8 @@ test "it returns 500 if `registrations_open` is enabled", %{conn: conn} do conn = post(conn, "/api/pleroma/admin/users/email_invite?email=foo@bar.com&name=JD") - assert json_response(conn, :internal_server_error) + assert json_response(conn, :bad_request) == + "To send invites you need to set the `registrations_open` option to false." end end @@ -703,6 +749,39 @@ test "renders users array for the first page", %{conn: conn, admin: admin} do } end + test "pagination works correctly with service users", %{conn: conn} do + service1 = insert(:user, ap_id: Web.base_url() <> "/relay") + service2 = insert(:user, ap_id: Web.base_url() <> "/internal/fetch") + insert_list(25, :user) + + assert %{"count" => 26, "page_size" => 10, "users" => users1} = + conn + |> get("/api/pleroma/admin/users?page=1&filters=", %{page_size: "10"}) + |> json_response(200) + + assert Enum.count(users1) == 10 + assert service1 not in [users1] + assert service2 not in [users1] + + assert %{"count" => 26, "page_size" => 10, "users" => users2} = + conn + |> get("/api/pleroma/admin/users?page=2&filters=", %{page_size: "10"}) + |> json_response(200) + + assert Enum.count(users2) == 10 + assert service1 not in [users2] + assert service2 not in [users2] + + assert %{"count" => 26, "page_size" => 10, "users" => users3} = + conn + |> get("/api/pleroma/admin/users?page=3&filters=", %{page_size: "10"}) + |> json_response(200) + + assert Enum.count(users3) == 6 + assert service1 not in [users3] + assert service2 not in [users3] + end + test "renders empty array for the second page", %{conn: conn} do insert(:user) @@ -1200,6 +1279,38 @@ test "PATCH /api/pleroma/admin/users/:nickname/toggle_activation", %{admin: admi "@#{admin.nickname} deactivated users: @#{user.nickname}" end + describe "PUT disable_mfa" do + test "returns 200 and disable 2fa", %{conn: conn} do + user = + insert(:user, + multi_factor_authentication_settings: %MFA.Settings{ + enabled: true, + totp: %MFA.Settings.TOTP{secret: "otp_secret", confirmed: true} + } + ) + + response = + conn + |> put("/api/pleroma/admin/users/disable_mfa", %{nickname: user.nickname}) + |> json_response(200) + + assert response == user.nickname + mfa_settings = refresh_record(user).multi_factor_authentication_settings + + refute mfa_settings.enabled + refute mfa_settings.totp.confirmed + end + + test "returns 404 if user not found", %{conn: conn} do + response = + conn + |> put("/api/pleroma/admin/users/disable_mfa", %{nickname: "nickname"}) + |> json_response(404) + + assert response == "Not found" + end + end + describe "POST /api/pleroma/admin/users/invite_token" do test "without options", %{conn: conn} do conn = post(conn, "/api/pleroma/admin/users/invite_token") @@ -1313,9 +1424,9 @@ test "returns report by its id", %{conn: conn} do {:ok, %{id: report_id}} = CommonAPI.report(reporter, %{ - "account_id" => target_user.id, - "comment" => "I feel offended", - "status_ids" => [activity.id] + account_id: target_user.id, + comment: "I feel offended", + status_ids: [activity.id] }) response = @@ -1340,16 +1451,16 @@ test "returns 404 when report id is invalid", %{conn: conn} do {:ok, %{id: report_id}} = CommonAPI.report(reporter, %{ - "account_id" => target_user.id, - "comment" => "I feel offended", - "status_ids" => [activity.id] + account_id: target_user.id, + comment: "I feel offended", + status_ids: [activity.id] }) {:ok, %{id: second_report_id}} = CommonAPI.report(reporter, %{ - "account_id" => target_user.id, - "comment" => "I feel very offended", - "status_ids" => [activity.id] + account_id: target_user.id, + comment: "I feel very offended", + status_ids: [activity.id] }) %{ @@ -1489,9 +1600,9 @@ test "returns reports", %{conn: conn} do {:ok, %{id: report_id}} = CommonAPI.report(reporter, %{ - "account_id" => target_user.id, - "comment" => "I feel offended", - "status_ids" => [activity.id] + account_id: target_user.id, + comment: "I feel offended", + status_ids: [activity.id] }) response = @@ -1513,15 +1624,15 @@ test "returns reports with specified state", %{conn: conn} do {:ok, %{id: first_report_id}} = CommonAPI.report(reporter, %{ - "account_id" => target_user.id, - "comment" => "I feel offended", - "status_ids" => [activity.id] + account_id: target_user.id, + comment: "I feel offended", + status_ids: [activity.id] }) {:ok, %{id: second_report_id}} = CommonAPI.report(reporter, %{ - "account_id" => target_user.id, - "comment" => "I don't like this user" + account_id: target_user.id, + comment: "I don't like this user" }) CommonAPI.update_report_state(second_report_id, "closed") @@ -1586,205 +1697,22 @@ test "returns 403 when requested by anonymous" do end end - describe "GET /api/pleroma/admin/grouped_reports" do - setup do - [reporter, target_user] = insert_pair(:user) - - date1 = (DateTime.to_unix(DateTime.utc_now()) + 1000) |> DateTime.from_unix!() - date2 = (DateTime.to_unix(DateTime.utc_now()) + 2000) |> DateTime.from_unix!() - date3 = (DateTime.to_unix(DateTime.utc_now()) + 3000) |> DateTime.from_unix!() - - first_status = - insert(:note_activity, user: target_user, data_attrs: %{"published" => date1}) - - second_status = - insert(:note_activity, user: target_user, data_attrs: %{"published" => date2}) - - third_status = - insert(:note_activity, user: target_user, data_attrs: %{"published" => date3}) - - {:ok, first_report} = - CommonAPI.report(reporter, %{ - "account_id" => target_user.id, - "status_ids" => [first_status.id, second_status.id, third_status.id] - }) - - {:ok, second_report} = - CommonAPI.report(reporter, %{ - "account_id" => target_user.id, - "status_ids" => [first_status.id, second_status.id] - }) - - {:ok, third_report} = - CommonAPI.report(reporter, %{ - "account_id" => target_user.id, - "status_ids" => [first_status.id] - }) - - %{ - first_status: Activity.get_by_ap_id_with_object(first_status.data["id"]), - second_status: Activity.get_by_ap_id_with_object(second_status.data["id"]), - third_status: Activity.get_by_ap_id_with_object(third_status.data["id"]), - first_report: first_report, - first_status_reports: [first_report, second_report, third_report], - second_status_reports: [first_report, second_report], - third_status_reports: [first_report], - target_user: target_user, - reporter: reporter - } + describe "GET /api/pleroma/admin/statuses/:id" do + test "not found", %{conn: conn} do + assert conn + |> get("/api/pleroma/admin/statuses/not_found") + |> json_response(:not_found) end - test "returns reports grouped by status", %{ - conn: conn, - first_status: first_status, - second_status: second_status, - third_status: third_status, - first_status_reports: first_status_reports, - second_status_reports: second_status_reports, - third_status_reports: third_status_reports, - target_user: target_user, - reporter: reporter - } do - response = - conn - |> get("/api/pleroma/admin/grouped_reports") - |> json_response(:ok) - - assert length(response["reports"]) == 3 - - first_group = Enum.find(response["reports"], &(&1["status"]["id"] == first_status.id)) - - second_group = Enum.find(response["reports"], &(&1["status"]["id"] == second_status.id)) - - third_group = Enum.find(response["reports"], &(&1["status"]["id"] == third_status.id)) - - assert length(first_group["reports"]) == 3 - assert length(second_group["reports"]) == 2 - assert length(third_group["reports"]) == 1 - - assert first_group["date"] == - Enum.max_by(first_status_reports, fn act -> - NaiveDateTime.from_iso8601!(act.data["published"]) - end).data["published"] - - assert first_group["status"] == - Map.put( - stringify_keys(StatusView.render("show.json", %{activity: first_status})), - "deleted", - false - ) - - assert(first_group["account"]["id"] == target_user.id) - - assert length(first_group["actors"]) == 1 - assert hd(first_group["actors"])["id"] == reporter.id - - assert Enum.map(first_group["reports"], & &1["id"]) -- - Enum.map(first_status_reports, & &1.id) == [] - - assert second_group["date"] == - Enum.max_by(second_status_reports, fn act -> - NaiveDateTime.from_iso8601!(act.data["published"]) - end).data["published"] - - assert second_group["status"] == - Map.put( - stringify_keys(StatusView.render("show.json", %{activity: second_status})), - "deleted", - false - ) - - assert second_group["account"]["id"] == target_user.id - - assert length(second_group["actors"]) == 1 - assert hd(second_group["actors"])["id"] == reporter.id - - assert Enum.map(second_group["reports"], & &1["id"]) -- - Enum.map(second_status_reports, & &1.id) == [] - - assert third_group["date"] == - Enum.max_by(third_status_reports, fn act -> - NaiveDateTime.from_iso8601!(act.data["published"]) - end).data["published"] - - assert third_group["status"] == - Map.put( - stringify_keys(StatusView.render("show.json", %{activity: third_status})), - "deleted", - false - ) - - assert third_group["account"]["id"] == target_user.id - - assert length(third_group["actors"]) == 1 - assert hd(third_group["actors"])["id"] == reporter.id - - assert Enum.map(third_group["reports"], & &1["id"]) -- - Enum.map(third_status_reports, & &1.id) == [] - end - - test "reopened report renders status data", %{ - conn: conn, - first_report: first_report, - first_status: first_status - } do - {:ok, _} = CommonAPI.update_report_state(first_report.id, "resolved") + test "shows activity", %{conn: conn} do + activity = insert(:note_activity) response = conn - |> get("/api/pleroma/admin/grouped_reports") - |> json_response(:ok) + |> get("/api/pleroma/admin/statuses/#{activity.id}") + |> json_response(200) - first_group = Enum.find(response["reports"], &(&1["status"]["id"] == first_status.id)) - - assert first_group["status"] == - Map.put( - stringify_keys(StatusView.render("show.json", %{activity: first_status})), - "deleted", - false - ) - end - - test "reopened report does not render status data if status has been deleted", %{ - conn: conn, - first_report: first_report, - first_status: first_status, - target_user: target_user - } do - {:ok, _} = CommonAPI.update_report_state(first_report.id, "resolved") - {:ok, _} = CommonAPI.delete(first_status.id, target_user) - - refute Activity.get_by_ap_id(first_status.id) - - response = - conn - |> get("/api/pleroma/admin/grouped_reports") - |> json_response(:ok) - - assert Enum.find(response["reports"], &(&1["status"]["deleted"] == true))["status"][ - "deleted" - ] == true - - assert length(Enum.filter(response["reports"], &(&1["status"]["deleted"] == false))) == 2 - end - - test "account not empty if status was deleted", %{ - conn: conn, - first_report: first_report, - first_status: first_status, - target_user: target_user - } do - {:ok, _} = CommonAPI.update_report_state(first_report.id, "resolved") - {:ok, _} = CommonAPI.delete(first_status.id, target_user) - - refute Activity.get_by_ap_id(first_status.id) - - response = - conn - |> get("/api/pleroma/admin/grouped_reports") - |> json_response(:ok) - - assert Enum.find(response["reports"], &(&1["status"]["deleted"] == true))["account"] + assert response["id"] == activity.id end end @@ -1819,7 +1747,7 @@ test "toggle sensitive flag", %{conn: conn, id: id, admin: admin} do test "change visibility flag", %{conn: conn, id: id, admin: admin} do response = conn - |> put("/api/pleroma/admin/statuses/#{id}", %{"visibility" => "public"}) + |> put("/api/pleroma/admin/statuses/#{id}", %{visibility: "public"}) |> json_response(:ok) assert response["visibility"] == "public" @@ -1831,21 +1759,21 @@ test "change visibility flag", %{conn: conn, id: id, admin: admin} do response = conn - |> put("/api/pleroma/admin/statuses/#{id}", %{"visibility" => "private"}) + |> put("/api/pleroma/admin/statuses/#{id}", %{visibility: "private"}) |> json_response(:ok) assert response["visibility"] == "private" response = conn - |> put("/api/pleroma/admin/statuses/#{id}", %{"visibility" => "unlisted"}) + |> put("/api/pleroma/admin/statuses/#{id}", %{visibility: "unlisted"}) |> json_response(:ok) assert response["visibility"] == "unlisted" end test "returns 400 when visibility is unknown", %{conn: conn, id: id} do - conn = put(conn, "/api/pleroma/admin/statuses/#{id}", %{"visibility" => "test"}) + conn = put(conn, "/api/pleroma/admin/statuses/#{id}", %{visibility: "test"}) assert json_response(conn, :bad_request) == "Unsupported visibility" end @@ -2278,7 +2206,7 @@ test "saving config which need pleroma reboot", %{conn: conn} do |> get("/api/pleroma/admin/config") |> json_response(200) - refute Map.has_key?(configs, "need_reboot") + assert configs["need_reboot"] == false end test "update setting which need reboot, don't change reboot flag until reboot", %{conn: conn} do @@ -2334,7 +2262,7 @@ test "update setting which need reboot, don't change reboot flag until reboot", |> get("/api/pleroma/admin/config") |> json_response(200) - refute Map.has_key?(configs, "need_reboot") + assert configs["need_reboot"] == false end test "saving config with nested merge", %{conn: conn} do @@ -2441,13 +2369,17 @@ test "saving full setting if value is in full_key_update list", %{conn: conn} do value: :erlang.term_to_binary([]) ) + Pleroma.Config.TransferTask.load_and_update_env([], false) + + assert Application.get_env(:logger, :backends) == [] + conn = post(conn, "/api/pleroma/admin/config", %{ configs: [ %{ group: config.group, key: config.key, - value: [":console", %{"tuple" => ["ExSyslogger", ":ex_syslogger"]}] + value: [":console"] } ] }) @@ -2458,8 +2390,7 @@ test "saving full setting if value is in full_key_update list", %{conn: conn} do "group" => ":logger", "key" => ":backends", "value" => [ - ":console", - %{"tuple" => ["ExSyslogger", ":ex_syslogger"]} + ":console" ], "db" => [":backends"] } @@ -2467,14 +2398,8 @@ test "saving full setting if value is in full_key_update list", %{conn: conn} do } assert Application.get_env(:logger, :backends) == [ - :console, - {ExSyslogger, :ex_syslogger} + :console ] - - capture_log(fn -> - require Logger - Logger.warn("Ooops...") - end) =~ "Ooops..." end test "saving full setting if value is not keyword", %{conn: conn} do @@ -2572,9 +2497,6 @@ test "update config setting & delete with fallback to default value", %{ end test "common config example", %{conn: conn} do - adapter = Application.get_env(:tesla, :adapter) - on_exit(fn -> Application.put_env(:tesla, :adapter, adapter) end) - conn = post(conn, "/api/pleroma/admin/config", %{ configs: [ @@ -2594,16 +2516,10 @@ test "common config example", %{conn: conn} do %{"tuple" => [":regex4", "~r/https:\/\/example.com/s"]}, %{"tuple" => [":name", "Pleroma"]} ] - }, - %{ - "group" => ":tesla", - "key" => ":adapter", - "value" => "Tesla.Adapter.Httpc" } ] }) - assert Application.get_env(:tesla, :adapter) == Tesla.Adapter.Httpc assert Config.get([Pleroma.Captcha.NotReal, :name]) == "Pleroma" assert json_response(conn, 200) == %{ @@ -2637,12 +2553,6 @@ test "common config example", %{conn: conn} do ":regex4", ":name" ] - }, - %{ - "group" => ":tesla", - "key" => ":adapter", - "value" => "Tesla.Adapter.Httpc", - "db" => [":adapter"] } ] } @@ -2955,26 +2865,25 @@ test "proxy tuple localhost", %{conn: conn} do group: ":pleroma", key: ":http", value: [ - %{"tuple" => [":proxy_url", %{"tuple" => [":socks5", "localhost", 1234]}]}, - %{"tuple" => [":send_user_agent", false]} + %{"tuple" => [":proxy_url", %{"tuple" => [":socks5", "localhost", 1234]}]} ] } ] }) - assert json_response(conn, 200) == %{ + assert %{ "configs" => [ %{ "group" => ":pleroma", "key" => ":http", - "value" => [ - %{"tuple" => [":proxy_url", %{"tuple" => [":socks5", "localhost", 1234]}]}, - %{"tuple" => [":send_user_agent", false]} - ], - "db" => [":proxy_url", ":send_user_agent"] + "value" => value, + "db" => db } ] - } + } = json_response(conn, 200) + + assert %{"tuple" => [":proxy_url", %{"tuple" => [":socks5", "localhost", 1234]}]} in value + assert ":proxy_url" in db end test "proxy tuple domain", %{conn: conn} do @@ -2985,26 +2894,25 @@ test "proxy tuple domain", %{conn: conn} do group: ":pleroma", key: ":http", value: [ - %{"tuple" => [":proxy_url", %{"tuple" => [":socks5", "domain.com", 1234]}]}, - %{"tuple" => [":send_user_agent", false]} + %{"tuple" => [":proxy_url", %{"tuple" => [":socks5", "domain.com", 1234]}]} ] } ] }) - assert json_response(conn, 200) == %{ + assert %{ "configs" => [ %{ "group" => ":pleroma", "key" => ":http", - "value" => [ - %{"tuple" => [":proxy_url", %{"tuple" => [":socks5", "domain.com", 1234]}]}, - %{"tuple" => [":send_user_agent", false]} - ], - "db" => [":proxy_url", ":send_user_agent"] + "value" => value, + "db" => db } ] - } + } = json_response(conn, 200) + + assert %{"tuple" => [":proxy_url", %{"tuple" => [":socks5", "domain.com", 1234]}]} in value + assert ":proxy_url" in db end test "proxy tuple ip", %{conn: conn} do @@ -3015,26 +2923,52 @@ test "proxy tuple ip", %{conn: conn} do group: ":pleroma", key: ":http", value: [ - %{"tuple" => [":proxy_url", %{"tuple" => [":socks5", "127.0.0.1", 1234]}]}, - %{"tuple" => [":send_user_agent", false]} + %{"tuple" => [":proxy_url", %{"tuple" => [":socks5", "127.0.0.1", 1234]}]} ] } ] }) - assert json_response(conn, 200) == %{ + assert %{ "configs" => [ %{ "group" => ":pleroma", "key" => ":http", - "value" => [ - %{"tuple" => [":proxy_url", %{"tuple" => [":socks5", "127.0.0.1", 1234]}]}, - %{"tuple" => [":send_user_agent", false]} - ], - "db" => [":proxy_url", ":send_user_agent"] + "value" => value, + "db" => db } ] - } + } = json_response(conn, 200) + + assert %{"tuple" => [":proxy_url", %{"tuple" => [":socks5", "127.0.0.1", 1234]}]} in value + assert ":proxy_url" in db + end + + test "doesn't set keys not in the whitelist", %{conn: conn} do + clear_config(:database_config_whitelist, [ + {:pleroma, :key1}, + {:pleroma, :key2}, + {:pleroma, Pleroma.Captcha.NotReal}, + {:not_real} + ]) + + post(conn, "/api/pleroma/admin/config", %{ + configs: [ + %{group: ":pleroma", key: ":key1", value: "value1"}, + %{group: ":pleroma", key: ":key2", value: "value2"}, + %{group: ":pleroma", key: ":key3", value: "value3"}, + %{group: ":pleroma", key: "Pleroma.Web.Endpoint.NotReal", value: "value4"}, + %{group: ":pleroma", key: "Pleroma.Captcha.NotReal", value: "value5"}, + %{group: ":not_real", key: ":anything", value: "value6"} + ] + }) + + assert Application.get_env(:pleroma, :key1) == "value1" + assert Application.get_env(:pleroma, :key2) == "value2" + assert Application.get_env(:pleroma, :key3) == nil + assert Application.get_env(:pleroma, Pleroma.Web.Endpoint.NotReal) == nil + assert Application.get_env(:pleroma, Pleroma.Captcha.NotReal) == "value5" + assert Application.get_env(:not_real, :anything) == "value6" end end @@ -3050,19 +2984,32 @@ test "pleroma restarts", %{conn: conn} do end end + test "need_reboot flag", %{conn: conn} do + assert conn + |> get("/api/pleroma/admin/need_reboot") + |> json_response(200) == %{"need_reboot" => false} + + Restarter.Pleroma.need_reboot() + + assert conn + |> get("/api/pleroma/admin/need_reboot") + |> json_response(200) == %{"need_reboot" => true} + + on_exit(fn -> Restarter.Pleroma.refresh() end) + end + describe "GET /api/pleroma/admin/statuses" do test "returns all public and unlisted statuses", %{conn: conn, admin: admin} do blocked = insert(:user) user = insert(:user) User.block(admin, blocked) - {:ok, _} = - CommonAPI.post(user, %{"status" => "@#{admin.nickname}", "visibility" => "direct"}) + {:ok, _} = CommonAPI.post(user, %{status: "@#{admin.nickname}", visibility: "direct"}) - {:ok, _} = CommonAPI.post(user, %{"status" => ".", "visibility" => "unlisted"}) - {:ok, _} = CommonAPI.post(user, %{"status" => ".", "visibility" => "private"}) - {:ok, _} = CommonAPI.post(user, %{"status" => ".", "visibility" => "public"}) - {:ok, _} = CommonAPI.post(blocked, %{"status" => ".", "visibility" => "public"}) + {:ok, _} = CommonAPI.post(user, %{status: ".", visibility: "unlisted"}) + {:ok, _} = CommonAPI.post(user, %{status: ".", visibility: "private"}) + {:ok, _} = CommonAPI.post(user, %{status: ".", visibility: "public"}) + {:ok, _} = CommonAPI.post(blocked, %{status: ".", visibility: "public"}) response = conn @@ -3090,11 +3037,10 @@ test "returns only local statuses with local_only on", %{conn: conn} do test "returns private and direct statuses with godmode on", %{conn: conn, admin: admin} do user = insert(:user) - {:ok, _} = - CommonAPI.post(user, %{"status" => "@#{admin.nickname}", "visibility" => "direct"}) + {:ok, _} = CommonAPI.post(user, %{status: "@#{admin.nickname}", visibility: "direct"}) - {:ok, _} = CommonAPI.post(user, %{"status" => ".", "visibility" => "private"}) - {:ok, _} = CommonAPI.post(user, %{"status" => ".", "visibility" => "public"}) + {:ok, _} = CommonAPI.post(user, %{status: ".", visibility: "private"}) + {:ok, _} = CommonAPI.post(user, %{status: ".", visibility: "public"}) conn = get(conn, "/api/pleroma/admin/statuses?godmode=true") assert json_response(conn, 200) |> length() == 3 end @@ -3128,11 +3074,9 @@ test "renders user's statuses with a limit", %{conn: conn, user: user} do end test "doesn't return private statuses by default", %{conn: conn, user: user} do - {:ok, _private_status} = - CommonAPI.post(user, %{"status" => "private", "visibility" => "private"}) + {:ok, _private_status} = CommonAPI.post(user, %{status: "private", visibility: "private"}) - {:ok, _public_status} = - CommonAPI.post(user, %{"status" => "public", "visibility" => "public"}) + {:ok, _public_status} = CommonAPI.post(user, %{status: "public", visibility: "public"}) conn = get(conn, "/api/pleroma/admin/users/#{user.nickname}/statuses") @@ -3140,11 +3084,9 @@ test "doesn't return private statuses by default", %{conn: conn, user: user} do end test "returns private statuses with godmode on", %{conn: conn, user: user} do - {:ok, _private_status} = - CommonAPI.post(user, %{"status" => "private", "visibility" => "private"}) + {:ok, _private_status} = CommonAPI.post(user, %{status: "private", visibility: "private"}) - {:ok, _public_status} = - CommonAPI.post(user, %{"status" => "public", "visibility" => "public"}) + {:ok, _public_status} = CommonAPI.post(user, %{status: "public", visibility: "public"}) conn = get(conn, "/api/pleroma/admin/users/#{user.nickname}/statuses?godmode=true") @@ -3153,7 +3095,7 @@ test "returns private statuses with godmode on", %{conn: conn, user: user} do test "excludes reblogs by default", %{conn: conn, user: user} do other_user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "."}) + {:ok, activity} = CommonAPI.post(user, %{status: "."}) {:ok, %Activity{}, _} = CommonAPI.repeat(activity.id, other_user) conn_res = get(conn, "/api/pleroma/admin/users/#{other_user.nickname}/statuses") @@ -3374,6 +3316,75 @@ test "returns log filtered by search", %{conn: conn, moderator: moderator} do end end + describe "GET /users/:nickname/credentials" do + test "gets the user credentials", %{conn: conn} do + user = insert(:user) + conn = get(conn, "/api/pleroma/admin/users/#{user.nickname}/credentials") + + response = assert json_response(conn, 200) + assert response["email"] == user.email + end + + test "returns 403 if requested by a non-admin" do + user = insert(:user) + + conn = + build_conn() + |> assign(:user, user) + |> get("/api/pleroma/admin/users/#{user.nickname}/credentials") + + assert json_response(conn, :forbidden) + end + end + + describe "PATCH /users/:nickname/credentials" do + test "changes password and email", %{conn: conn, admin: admin} do + user = insert(:user) + assert user.password_reset_pending == false + + conn = + patch(conn, "/api/pleroma/admin/users/#{user.nickname}/credentials", %{ + "password" => "new_password", + "email" => "new_email@example.com", + "name" => "new_name" + }) + + assert json_response(conn, 200) == %{"status" => "success"} + + ObanHelpers.perform_all() + + updated_user = User.get_by_id(user.id) + + assert updated_user.email == "new_email@example.com" + assert updated_user.name == "new_name" + assert updated_user.password_hash != user.password_hash + assert updated_user.password_reset_pending == true + + [log_entry2, log_entry1] = ModerationLog |> Repo.all() |> Enum.sort() + + assert ModerationLog.get_log_entry_message(log_entry1) == + "@#{admin.nickname} updated users: @#{user.nickname}" + + assert ModerationLog.get_log_entry_message(log_entry2) == + "@#{admin.nickname} forced password reset for users: @#{user.nickname}" + end + + test "returns 403 if requested by a non-admin" do + user = insert(:user) + + conn = + build_conn() + |> assign(:user, user) + |> patch("/api/pleroma/admin/users/#{user.nickname}/credentials", %{ + "password" => "new_password", + "email" => "new_email@example.com", + "name" => "new_name" + }) + + assert json_response(conn, :forbidden) + end + end + describe "PATCH /users/:nickname/force_password_reset" do test "sets password_reset_pending to true", %{conn: conn} do user = insert(:user) @@ -3537,9 +3548,9 @@ test "it resend emails for two users", %{conn: conn, admin: admin} do {:ok, %{id: report_id}} = CommonAPI.report(reporter, %{ - "account_id" => target_user.id, - "comment" => "I feel offended", - "status_ids" => [activity.id] + account_id: target_user.id, + comment: "I feel offended", + status_ids: [activity.id] }) post(conn, "/api/pleroma/admin/reports/#{report_id}/notes", %{ @@ -3590,28 +3601,63 @@ test "it deletes the note", %{conn: conn, report_id: report_id} do end end - test "GET /api/pleroma/admin/config/descriptions", %{conn: conn} do - admin = insert(:user, is_admin: true) + describe "GET /api/pleroma/admin/config/descriptions" do + test "structure", %{conn: conn} do + admin = insert(:user, is_admin: true) - conn = - assign(conn, :user, admin) - |> get("/api/pleroma/admin/config/descriptions") + conn = + assign(conn, :user, admin) + |> get("/api/pleroma/admin/config/descriptions") - assert [child | _others] = json_response(conn, 200) + assert [child | _others] = json_response(conn, 200) - assert child["children"] - assert child["key"] - assert String.starts_with?(child["group"], ":") - assert child["description"] + assert child["children"] + assert child["key"] + assert String.starts_with?(child["group"], ":") + assert child["description"] + end + + test "filters by database configuration whitelist", %{conn: conn} do + clear_config(:database_config_whitelist, [ + {:pleroma, :instance}, + {:pleroma, :activitypub}, + {:pleroma, Pleroma.Upload}, + {:esshd} + ]) + + admin = insert(:user, is_admin: true) + + conn = + assign(conn, :user, admin) + |> get("/api/pleroma/admin/config/descriptions") + + children = json_response(conn, 200) + + assert length(children) == 4 + + assert Enum.count(children, fn c -> c["group"] == ":pleroma" end) == 3 + + instance = Enum.find(children, fn c -> c["key"] == ":instance" end) + assert instance["children"] + + activitypub = Enum.find(children, fn c -> c["key"] == ":activitypub" end) + assert activitypub["children"] + + web_endpoint = Enum.find(children, fn c -> c["key"] == "Pleroma.Upload" end) + assert web_endpoint["children"] + + esshd = Enum.find(children, fn c -> c["group"] == ":esshd" end) + assert esshd["children"] + end end describe "/api/pleroma/admin/stats" do test "status visibility count", %{conn: conn} do admin = insert(:user, is_admin: true) user = insert(:user) - CommonAPI.post(user, %{"visibility" => "public", "status" => "hey"}) - CommonAPI.post(user, %{"visibility" => "unlisted", "status" => "hey"}) - CommonAPI.post(user, %{"visibility" => "unlisted", "status" => "hey"}) + CommonAPI.post(user, %{visibility: "public", status: "hey"}) + CommonAPI.post(user, %{visibility: "unlisted", status: "hey"}) + CommonAPI.post(user, %{visibility: "unlisted", status: "hey"}) response = conn @@ -3623,6 +3669,191 @@ test "status visibility count", %{conn: conn} do response["status_visibility"] end end + + describe "POST /api/pleroma/admin/oauth_app" do + test "errors", %{conn: conn} do + response = conn |> post("/api/pleroma/admin/oauth_app", %{}) |> json_response(200) + + assert response == %{"name" => "can't be blank", "redirect_uris" => "can't be blank"} + end + + test "success", %{conn: conn} do + base_url = Web.base_url() + app_name = "Trusted app" + + response = + conn + |> post("/api/pleroma/admin/oauth_app", %{ + name: app_name, + redirect_uris: base_url + }) + |> json_response(200) + + assert %{ + "client_id" => _, + "client_secret" => _, + "name" => ^app_name, + "redirect_uri" => ^base_url, + "trusted" => false + } = response + end + + test "with trusted", %{conn: conn} do + base_url = Web.base_url() + app_name = "Trusted app" + + response = + conn + |> post("/api/pleroma/admin/oauth_app", %{ + name: app_name, + redirect_uris: base_url, + trusted: true + }) + |> json_response(200) + + assert %{ + "client_id" => _, + "client_secret" => _, + "name" => ^app_name, + "redirect_uri" => ^base_url, + "trusted" => true + } = response + end + end + + describe "GET /api/pleroma/admin/oauth_app" do + setup do + app = insert(:oauth_app) + {:ok, app: app} + end + + test "list", %{conn: conn} do + response = + conn + |> get("/api/pleroma/admin/oauth_app") + |> json_response(200) + + assert %{"apps" => apps, "count" => count, "page_size" => _} = response + + assert length(apps) == count + end + + test "with page size", %{conn: conn} do + insert(:oauth_app) + page_size = 1 + + response = + conn + |> get("/api/pleroma/admin/oauth_app", %{page_size: to_string(page_size)}) + |> json_response(200) + + assert %{"apps" => apps, "count" => _, "page_size" => ^page_size} = response + + assert length(apps) == page_size + end + + test "search by client name", %{conn: conn, app: app} do + response = + conn + |> get("/api/pleroma/admin/oauth_app", %{name: app.client_name}) + |> json_response(200) + + assert %{"apps" => [returned], "count" => _, "page_size" => _} = response + + assert returned["client_id"] == app.client_id + assert returned["name"] == app.client_name + end + + test "search by client id", %{conn: conn, app: app} do + response = + conn + |> get("/api/pleroma/admin/oauth_app", %{client_id: app.client_id}) + |> json_response(200) + + assert %{"apps" => [returned], "count" => _, "page_size" => _} = response + + assert returned["client_id"] == app.client_id + assert returned["name"] == app.client_name + end + + test "only trusted", %{conn: conn} do + app = insert(:oauth_app, trusted: true) + + response = + conn + |> get("/api/pleroma/admin/oauth_app", %{trusted: true}) + |> json_response(200) + + assert %{"apps" => [returned], "count" => _, "page_size" => _} = response + + assert returned["client_id"] == app.client_id + assert returned["name"] == app.client_name + end + end + + describe "DELETE /api/pleroma/admin/oauth_app/:id" do + test "with id", %{conn: conn} do + app = insert(:oauth_app) + + response = + conn + |> delete("/api/pleroma/admin/oauth_app/" <> to_string(app.id)) + |> json_response(:no_content) + + assert response == "" + end + + test "with non existance id", %{conn: conn} do + response = + conn + |> delete("/api/pleroma/admin/oauth_app/0") + |> json_response(:bad_request) + + assert response == "" + end + end + + describe "PATCH /api/pleroma/admin/oauth_app/:id" do + test "with id", %{conn: conn} do + app = insert(:oauth_app) + + name = "another name" + url = "https://example.com" + scopes = ["admin"] + id = app.id + website = "http://website.com" + + response = + conn + |> patch("/api/pleroma/admin/oauth_app/" <> to_string(app.id), %{ + name: name, + trusted: true, + redirect_uris: url, + scopes: scopes, + website: website + }) + |> json_response(200) + + assert %{ + "client_id" => _, + "client_secret" => _, + "id" => ^id, + "name" => ^name, + "redirect_uri" => ^url, + "trusted" => true, + "website" => ^website + } = response + end + + test "without id", %{conn: conn} do + response = + conn + |> patch("/api/pleroma/admin/oauth_app/0") + |> json_response(:bad_request) + + assert response == "" + end + end end # Needed for testing diff --git a/test/web/admin_api/views/report_view_test.exs b/test/web/admin_api/views/report_view_test.exs index 5db6629f2..f00b0afb2 100644 --- a/test/web/admin_api/views/report_view_test.exs +++ b/test/web/admin_api/views/report_view_test.exs @@ -15,7 +15,7 @@ test "renders a report" do user = insert(:user) other_user = insert(:user) - {:ok, activity} = CommonAPI.report(user, %{"account_id" => other_user.id}) + {:ok, activity} = CommonAPI.report(user, %{account_id: other_user.id}) expected = %{ content: nil, @@ -45,10 +45,10 @@ test "renders a report" do test "includes reported statuses" do user = insert(:user) other_user = insert(:user) - {:ok, activity} = CommonAPI.post(other_user, %{"status" => "toot"}) + {:ok, activity} = CommonAPI.post(other_user, %{status: "toot"}) {:ok, report_activity} = - CommonAPI.report(user, %{"account_id" => other_user.id, "status_ids" => [activity.id]}) + CommonAPI.report(user, %{account_id: other_user.id, status_ids: [activity.id]}) other_user = Pleroma.User.get_by_id(other_user.id) @@ -81,7 +81,7 @@ test "renders report's state" do user = insert(:user) other_user = insert(:user) - {:ok, activity} = CommonAPI.report(user, %{"account_id" => other_user.id}) + {:ok, activity} = CommonAPI.report(user, %{account_id: other_user.id}) {:ok, activity} = CommonAPI.update_report_state(activity.id, "closed") assert %{state: "closed"} = @@ -94,8 +94,8 @@ test "renders report description" do {:ok, activity} = CommonAPI.report(user, %{ - "account_id" => other_user.id, - "comment" => "posts are too good for this instance" + account_id: other_user.id, + comment: "posts are too good for this instance" }) assert %{content: "posts are too good for this instance"} = @@ -108,8 +108,8 @@ test "sanitizes report description" do {:ok, activity} = CommonAPI.report(user, %{ - "account_id" => other_user.id, - "comment" => "" + account_id: other_user.id, + comment: "" }) data = Map.put(activity.data, "content", "") @@ -125,8 +125,8 @@ test "doesn't error out when the user doesn't exists" do {:ok, activity} = CommonAPI.report(user, %{ - "account_id" => other_user.id, - "comment" => "" + account_id: other_user.id, + comment: "" }) Pleroma.User.delete(other_user) diff --git a/test/web/api_spec/schema_examples_test.exs b/test/web/api_spec/schema_examples_test.exs new file mode 100644 index 000000000..88b6f07cb --- /dev/null +++ b/test/web/api_spec/schema_examples_test.exs @@ -0,0 +1,43 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.SchemaExamplesTest do + use ExUnit.Case, async: true + import Pleroma.Tests.ApiSpecHelpers + + @content_type "application/json" + + for operation <- api_operations() do + describe operation.operationId <> " Request Body" do + if operation.requestBody do + @media_type operation.requestBody.content[@content_type] + @schema resolve_schema(@media_type.schema) + + if @media_type.example do + test "request body media type example matches schema" do + assert_schema(@media_type.example, @schema) + end + end + + if @schema.example do + test "request body schema example matches schema" do + assert_schema(@schema.example, @schema) + end + end + end + end + + for {status, response} <- operation.responses do + describe "#{operation.operationId} - #{status} Response" do + @schema resolve_schema(response.content[@content_type].schema) + + if @schema.example do + test "example matches schema" do + assert_schema(@schema.example, @schema) + end + end + end + end + end +end diff --git a/test/web/auth/auth_test_controller_test.exs b/test/web/auth/auth_test_controller_test.exs new file mode 100644 index 000000000..fed52b7f3 --- /dev/null +++ b/test/web/auth/auth_test_controller_test.exs @@ -0,0 +1,242 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Tests.AuthTestControllerTest do + use Pleroma.Web.ConnCase + + import Pleroma.Factory + + describe "do_oauth_check" do + test "serves with proper OAuth token (fulfilling requested scopes)" do + %{conn: good_token_conn, user: user} = oauth_access(["read"]) + + assert %{"user_id" => user.id} == + good_token_conn + |> get("/test/authenticated_api/do_oauth_check") + |> json_response(200) + + # Unintended usage (:api) — use with :authenticated_api instead + assert %{"user_id" => user.id} == + good_token_conn + |> get("/test/api/do_oauth_check") + |> json_response(200) + end + + test "fails on no token / missing scope(s)" do + %{conn: bad_token_conn} = oauth_access(["irrelevant_scope"]) + + bad_token_conn + |> get("/test/authenticated_api/do_oauth_check") + |> json_response(403) + + bad_token_conn + |> assign(:token, nil) + |> get("/test/api/do_oauth_check") + |> json_response(403) + end + end + + describe "fallback_oauth_check" do + test "serves with proper OAuth token (fulfilling requested scopes)" do + %{conn: good_token_conn, user: user} = oauth_access(["read"]) + + assert %{"user_id" => user.id} == + good_token_conn + |> get("/test/api/fallback_oauth_check") + |> json_response(200) + + # Unintended usage (:authenticated_api) — use with :api instead + assert %{"user_id" => user.id} == + good_token_conn + |> get("/test/authenticated_api/fallback_oauth_check") + |> json_response(200) + end + + test "for :api on public instance, drops :user and renders on no token / missing scope(s)" do + clear_config([:instance, :public], true) + + %{conn: bad_token_conn} = oauth_access(["irrelevant_scope"]) + + assert %{"user_id" => nil} == + bad_token_conn + |> get("/test/api/fallback_oauth_check") + |> json_response(200) + + assert %{"user_id" => nil} == + bad_token_conn + |> assign(:token, nil) + |> get("/test/api/fallback_oauth_check") + |> json_response(200) + end + + test "for :api on private instance, fails on no token / missing scope(s)" do + clear_config([:instance, :public], false) + + %{conn: bad_token_conn} = oauth_access(["irrelevant_scope"]) + + bad_token_conn + |> get("/test/api/fallback_oauth_check") + |> json_response(403) + + bad_token_conn + |> assign(:token, nil) + |> get("/test/api/fallback_oauth_check") + |> json_response(403) + end + end + + describe "skip_oauth_check" do + test "for :authenticated_api, serves if :user is set (regardless of token / token scopes)" do + user = insert(:user) + + assert %{"user_id" => user.id} == + build_conn() + |> assign(:user, user) + |> get("/test/authenticated_api/skip_oauth_check") + |> json_response(200) + + %{conn: bad_token_conn, user: user} = oauth_access(["irrelevant_scope"]) + + assert %{"user_id" => user.id} == + bad_token_conn + |> get("/test/authenticated_api/skip_oauth_check") + |> json_response(200) + end + + test "serves via :api on public instance if :user is not set" do + clear_config([:instance, :public], true) + + assert %{"user_id" => nil} == + build_conn() + |> get("/test/api/skip_oauth_check") + |> json_response(200) + + build_conn() + |> get("/test/authenticated_api/skip_oauth_check") + |> json_response(403) + end + + test "fails on private instance if :user is not set" do + clear_config([:instance, :public], false) + + build_conn() + |> get("/test/api/skip_oauth_check") + |> json_response(403) + + build_conn() + |> get("/test/authenticated_api/skip_oauth_check") + |> json_response(403) + end + end + + describe "fallback_oauth_skip_publicity_check" do + test "serves with proper OAuth token (fulfilling requested scopes)" do + %{conn: good_token_conn, user: user} = oauth_access(["read"]) + + assert %{"user_id" => user.id} == + good_token_conn + |> get("/test/api/fallback_oauth_skip_publicity_check") + |> json_response(200) + + # Unintended usage (:authenticated_api) + assert %{"user_id" => user.id} == + good_token_conn + |> get("/test/authenticated_api/fallback_oauth_skip_publicity_check") + |> json_response(200) + end + + test "for :api on private / public instance, drops :user and renders on token issue" do + %{conn: bad_token_conn} = oauth_access(["irrelevant_scope"]) + + for is_public <- [true, false] do + clear_config([:instance, :public], is_public) + + assert %{"user_id" => nil} == + bad_token_conn + |> get("/test/api/fallback_oauth_skip_publicity_check") + |> json_response(200) + + assert %{"user_id" => nil} == + bad_token_conn + |> assign(:token, nil) + |> get("/test/api/fallback_oauth_skip_publicity_check") + |> json_response(200) + end + end + end + + describe "skip_oauth_skip_publicity_check" do + test "for :authenticated_api, serves if :user is set (regardless of token / token scopes)" do + user = insert(:user) + + assert %{"user_id" => user.id} == + build_conn() + |> assign(:user, user) + |> get("/test/authenticated_api/skip_oauth_skip_publicity_check") + |> json_response(200) + + %{conn: bad_token_conn, user: user} = oauth_access(["irrelevant_scope"]) + + assert %{"user_id" => user.id} == + bad_token_conn + |> get("/test/authenticated_api/skip_oauth_skip_publicity_check") + |> json_response(200) + end + + test "for :api, serves on private and public instances regardless of whether :user is set" do + user = insert(:user) + + for is_public <- [true, false] do + clear_config([:instance, :public], is_public) + + assert %{"user_id" => nil} == + build_conn() + |> get("/test/api/skip_oauth_skip_publicity_check") + |> json_response(200) + + assert %{"user_id" => user.id} == + build_conn() + |> assign(:user, user) + |> get("/test/api/skip_oauth_skip_publicity_check") + |> json_response(200) + end + end + end + + describe "missing_oauth_check_definition" do + def test_missing_oauth_check_definition_failure(endpoint, expected_error) do + %{conn: conn} = oauth_access(["read", "write", "follow", "push", "admin"]) + + assert %{"error" => expected_error} == + conn + |> get(endpoint) + |> json_response(403) + end + + test "fails if served via :authenticated_api" do + test_missing_oauth_check_definition_failure( + "/test/authenticated_api/missing_oauth_check_definition", + "Security violation: OAuth scopes check was neither handled nor explicitly skipped." + ) + end + + test "fails if served via :api and the instance is private" do + clear_config([:instance, :public], false) + + test_missing_oauth_check_definition_failure( + "/test/api/missing_oauth_check_definition", + "This resource requires authentication." + ) + end + + test "succeeds with dropped :user if served via :api on public instance" do + %{conn: conn} = oauth_access(["read", "write", "follow", "push", "admin"]) + + assert %{"user_id" => nil} == + conn + |> get("/test/api/missing_oauth_check_definition") + |> json_response(200) + end + end +end diff --git a/test/web/auth/basic_auth_test.exs b/test/web/auth/basic_auth_test.exs new file mode 100644 index 000000000..bf6e3d2fc --- /dev/null +++ b/test/web/auth/basic_auth_test.exs @@ -0,0 +1,46 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.Auth.BasicAuthTest do + use Pleroma.Web.ConnCase + + import Pleroma.Factory + + test "with HTTP Basic Auth used, grants access to OAuth scope-restricted endpoints", %{ + conn: conn + } do + user = insert(:user) + assert Pbkdf2.verify_pass("test", user.password_hash) + + basic_auth_contents = + (URI.encode_www_form(user.nickname) <> ":" <> URI.encode_www_form("test")) + |> Base.encode64() + + # Succeeds with HTTP Basic Auth + response = + conn + |> put_req_header("authorization", "Basic " <> basic_auth_contents) + |> get("/api/v1/accounts/verify_credentials") + |> json_response(200) + + user_nickname = user.nickname + assert %{"username" => ^user_nickname} = response + + # Succeeds with a properly scoped OAuth token + valid_token = insert(:oauth_token, scopes: ["read:accounts"]) + + conn + |> put_req_header("authorization", "Bearer #{valid_token.token}") + |> get("/api/v1/accounts/verify_credentials") + |> json_response(200) + + # Fails with a wrong-scoped OAuth token (proof of restriction) + invalid_token = insert(:oauth_token, scopes: ["read:something"]) + + conn + |> put_req_header("authorization", "Bearer #{invalid_token.token}") + |> get("/api/v1/accounts/verify_credentials") + |> json_response(403) + end +end diff --git a/test/web/auth/pleroma_authenticator_test.exs b/test/web/auth/pleroma_authenticator_test.exs new file mode 100644 index 000000000..5a421e5ed --- /dev/null +++ b/test/web/auth/pleroma_authenticator_test.exs @@ -0,0 +1,43 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2019 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.Auth.PleromaAuthenticatorTest do + use Pleroma.Web.ConnCase + + alias Pleroma.Web.Auth.PleromaAuthenticator + import Pleroma.Factory + + setup do + password = "testpassword" + name = "AgentSmith" + user = insert(:user, nickname: name, password_hash: Pbkdf2.hash_pwd_salt(password)) + {:ok, [user: user, name: name, password: password]} + end + + test "get_user/authorization", %{user: user, name: name, password: password} do + params = %{"authorization" => %{"name" => name, "password" => password}} + res = PleromaAuthenticator.get_user(%Plug.Conn{params: params}) + + assert {:ok, user} == res + end + + test "get_user/authorization with invalid password", %{name: name} do + params = %{"authorization" => %{"name" => name, "password" => "password"}} + res = PleromaAuthenticator.get_user(%Plug.Conn{params: params}) + + assert {:error, {:checkpw, false}} == res + end + + test "get_user/grant_type_password", %{user: user, name: name, password: password} do + params = %{"grant_type" => "password", "username" => name, "password" => password} + res = PleromaAuthenticator.get_user(%Plug.Conn{params: params}) + + assert {:ok, user} == res + end + + test "error credintails" do + res = PleromaAuthenticator.get_user(%Plug.Conn{params: %{}}) + assert {:error, :invalid_credentials} == res + end +end diff --git a/test/web/auth/totp_authenticator_test.exs b/test/web/auth/totp_authenticator_test.exs new file mode 100644 index 000000000..e502e0ae8 --- /dev/null +++ b/test/web/auth/totp_authenticator_test.exs @@ -0,0 +1,51 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2019 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.Auth.TOTPAuthenticatorTest do + use Pleroma.Web.ConnCase + + alias Pleroma.MFA + alias Pleroma.MFA.BackupCodes + alias Pleroma.MFA.TOTP + alias Pleroma.Web.Auth.TOTPAuthenticator + + import Pleroma.Factory + + test "verify token" do + otp_secret = TOTP.generate_secret() + otp_token = TOTP.generate_token(otp_secret) + + user = + insert(:user, + multi_factor_authentication_settings: %MFA.Settings{ + enabled: true, + totp: %MFA.Settings.TOTP{secret: otp_secret, confirmed: true} + } + ) + + assert TOTPAuthenticator.verify(otp_token, user) == {:ok, :pass} + assert TOTPAuthenticator.verify(nil, user) == {:error, :invalid_token} + assert TOTPAuthenticator.verify("", user) == {:error, :invalid_token} + end + + test "checks backup codes" do + [code | _] = backup_codes = BackupCodes.generate() + + hashed_codes = + backup_codes + |> Enum.map(&Pbkdf2.hash_pwd_salt(&1)) + + user = + insert(:user, + multi_factor_authentication_settings: %MFA.Settings{ + enabled: true, + backup_codes: hashed_codes, + totp: %MFA.Settings.TOTP{secret: "otp_secret", confirmed: true} + } + ) + + assert TOTPAuthenticator.verify_recovery_code(user, code) == {:ok, :pass} + refute TOTPAuthenticator.verify_recovery_code(code, refresh_record(user)) == {:ok, :pass} + end +end diff --git a/test/web/common_api/common_api_test.exs b/test/web/common_api/common_api_test.exs index 0da0bd2e2..fd8299013 100644 --- a/test/web/common_api/common_api_test.exs +++ b/test/web/common_api/common_api_test.exs @@ -9,11 +9,13 @@ defmodule Pleroma.Web.CommonAPITest do alias Pleroma.Object alias Pleroma.User alias Pleroma.Web.ActivityPub.ActivityPub + alias Pleroma.Web.ActivityPub.Transmogrifier alias Pleroma.Web.ActivityPub.Visibility alias Pleroma.Web.AdminAPI.AccountView alias Pleroma.Web.CommonAPI import Pleroma.Factory + import Mock require Pleroma.Constants @@ -21,14 +23,176 @@ defmodule Pleroma.Web.CommonAPITest do setup do: clear_config([:instance, :limit]) setup do: clear_config([:instance, :max_pinned_statuses]) + describe "unblocking" do + test "it works even without an existing block activity" do + blocked = insert(:user) + blocker = insert(:user) + User.block(blocker, blocked) + + assert User.blocks?(blocker, blocked) + assert {:ok, :no_activity} == CommonAPI.unblock(blocker, blocked) + refute User.blocks?(blocker, blocked) + end + end + + describe "deletion" do + test "it works with pruned objects" do + user = insert(:user) + + {:ok, post} = CommonAPI.post(user, %{status: "namu amida butsu"}) + + Object.normalize(post, false) + |> Object.prune() + + with_mock Pleroma.Web.Federator, + publish: fn _ -> nil end do + assert {:ok, delete} = CommonAPI.delete(post.id, user) + assert delete.local + assert called(Pleroma.Web.Federator.publish(delete)) + end + + refute Activity.get_by_id(post.id) + end + + test "it allows users to delete their posts" do + user = insert(:user) + + {:ok, post} = CommonAPI.post(user, %{status: "namu amida butsu"}) + + with_mock Pleroma.Web.Federator, + publish: fn _ -> nil end do + assert {:ok, delete} = CommonAPI.delete(post.id, user) + assert delete.local + assert called(Pleroma.Web.Federator.publish(delete)) + end + + refute Activity.get_by_id(post.id) + end + + test "it does not allow a user to delete their posts" do + user = insert(:user) + other_user = insert(:user) + + {:ok, post} = CommonAPI.post(user, %{status: "namu amida butsu"}) + + assert {:error, "Could not delete"} = CommonAPI.delete(post.id, other_user) + assert Activity.get_by_id(post.id) + end + + test "it allows moderators to delete other user's posts" do + user = insert(:user) + moderator = insert(:user, is_moderator: true) + + {:ok, post} = CommonAPI.post(user, %{status: "namu amida butsu"}) + + assert {:ok, delete} = CommonAPI.delete(post.id, moderator) + assert delete.local + + refute Activity.get_by_id(post.id) + end + + test "it allows admins to delete other user's posts" do + user = insert(:user) + moderator = insert(:user, is_admin: true) + + {:ok, post} = CommonAPI.post(user, %{status: "namu amida butsu"}) + + assert {:ok, delete} = CommonAPI.delete(post.id, moderator) + assert delete.local + + refute Activity.get_by_id(post.id) + end + + test "superusers deleting non-local posts won't federate the delete" do + # This is the user of the ingested activity + _user = + insert(:user, + local: false, + ap_id: "http://mastodon.example.org/users/admin", + last_refreshed_at: NaiveDateTime.utc_now() + ) + + moderator = insert(:user, is_admin: true) + + data = + File.read!("test/fixtures/mastodon-post-activity.json") + |> Jason.decode!() + + {:ok, post} = Transmogrifier.handle_incoming(data) + + with_mock Pleroma.Web.Federator, + publish: fn _ -> nil end do + assert {:ok, delete} = CommonAPI.delete(post.id, moderator) + assert delete.local + refute called(Pleroma.Web.Federator.publish(:_)) + end + + refute Activity.get_by_id(post.id) + end + end + + test "favoriting race condition" do + user = insert(:user) + users_serial = insert_list(10, :user) + users = insert_list(10, :user) + + {:ok, activity} = CommonAPI.post(user, %{status: "."}) + + users_serial + |> Enum.map(fn user -> + CommonAPI.favorite(user, activity.id) + end) + + object = Object.get_by_ap_id(activity.data["object"]) + assert object.data["like_count"] == 10 + + users + |> Enum.map(fn user -> + Task.async(fn -> + CommonAPI.favorite(user, activity.id) + end) + end) + |> Enum.map(&Task.await/1) + + object = Object.get_by_ap_id(activity.data["object"]) + assert object.data["like_count"] == 20 + end + + test "repeating race condition" do + user = insert(:user) + users_serial = insert_list(10, :user) + users = insert_list(10, :user) + + {:ok, activity} = CommonAPI.post(user, %{status: "."}) + + users_serial + |> Enum.map(fn user -> + CommonAPI.repeat(activity.id, user) + end) + + object = Object.get_by_ap_id(activity.data["object"]) + assert object.data["announcement_count"] == 10 + + users + |> Enum.map(fn user -> + Task.async(fn -> + CommonAPI.repeat(activity.id, user) + end) + end) + |> Enum.map(&Task.await/1) + + object = Object.get_by_ap_id(activity.data["object"]) + assert object.data["announcement_count"] == 20 + end + test "when replying to a conversation / participation, it will set the correct context id even if no explicit reply_to is given" do user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => ".", "visibility" => "direct"}) + {:ok, activity} = CommonAPI.post(user, %{status: ".", visibility: "direct"}) [participation] = Participation.for_user(user) {:ok, convo_reply} = - CommonAPI.post(user, %{"status" => ".", "in_reply_to_conversation_id" => participation.id}) + CommonAPI.post(user, %{status: ".", in_reply_to_conversation_id: participation.id}) assert Visibility.is_direct?(convo_reply) @@ -42,8 +206,8 @@ test "when replying to a conversation / participation, it only mentions the reci {:ok, activity} = CommonAPI.post(har, %{ - "status" => "@#{jafnhar.nickname} hey", - "visibility" => "direct" + status: "@#{jafnhar.nickname} hey", + visibility: "direct" }) assert har.ap_id in activity.recipients @@ -53,10 +217,10 @@ test "when replying to a conversation / participation, it only mentions the reci {:ok, activity} = CommonAPI.post(har, %{ - "status" => "I don't really like @#{tridi.nickname}", - "visibility" => "direct", - "in_reply_to_status_id" => activity.id, - "in_reply_to_conversation_id" => participation.id + status: "I don't really like @#{tridi.nickname}", + visibility: "direct", + in_reply_to_status_id: activity.id, + in_reply_to_conversation_id: participation.id }) assert har.ap_id in activity.recipients @@ -73,8 +237,8 @@ test "with the safe_dm_mention option set, it does not mention people beyond the {:ok, activity} = CommonAPI.post(har, %{ - "status" => "@#{jafnhar.nickname} hey, i never want to see @#{tridi.nickname} again", - "visibility" => "direct" + status: "@#{jafnhar.nickname} hey, i never want to see @#{tridi.nickname} again", + visibility: "direct" }) refute tridi.ap_id in activity.recipients @@ -83,7 +247,7 @@ test "with the safe_dm_mention option set, it does not mention people beyond the test "it de-duplicates tags" do user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "#2hu #2HU"}) + {:ok, activity} = CommonAPI.post(user, %{status: "#2hu #2HU"}) object = Object.normalize(activity) @@ -92,23 +256,11 @@ test "it de-duplicates tags" do test "it adds emoji in the object" do user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => ":firefox:"}) + {:ok, activity} = CommonAPI.post(user, %{status: ":firefox:"}) assert Object.normalize(activity).data["emoji"]["firefox"] end - test "it adds emoji when updating profiles" do - user = insert(:user, %{name: ":firefox:"}) - - {:ok, activity} = CommonAPI.update(user) - user = User.get_cached_by_ap_id(user.ap_id) - [firefox] = user.source_data["tag"] - - assert firefox["name"] == ":firefox:" - - assert Pleroma.Constants.as_public() in activity.recipients - end - describe "posting" do test "it supports explicit addressing" do user = insert(:user) @@ -118,9 +270,9 @@ test "it supports explicit addressing" do {:ok, activity} = CommonAPI.post(user, %{ - "status" => + status: "Hey, I think @#{user_three.nickname} is ugly. @#{user_four.nickname} is alright though.", - "to" => [user_two.nickname, user_four.nickname, "nonexistent"] + to: [user_two.nickname, user_four.nickname, "nonexistent"] }) assert user.ap_id in activity.recipients @@ -136,8 +288,8 @@ test "it filters out obviously bad tags when accepting a post as HTML" do {:ok, activity} = CommonAPI.post(user, %{ - "status" => post, - "content_type" => "text/html" + status: post, + content_type: "text/html" }) object = Object.normalize(activity) @@ -152,8 +304,8 @@ test "it filters out obviously bad tags when accepting a post as Markdown" do {:ok, activity} = CommonAPI.post(user, %{ - "status" => post, - "content_type" => "text/markdown" + status: post, + content_type: "text/markdown" }) object = Object.normalize(activity) @@ -164,21 +316,21 @@ test "it filters out obviously bad tags when accepting a post as Markdown" do test "it does not allow replies to direct messages that are not direct messages themselves" do user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "suya..", "visibility" => "direct"}) + {:ok, activity} = CommonAPI.post(user, %{status: "suya..", visibility: "direct"}) assert {:ok, _} = CommonAPI.post(user, %{ - "status" => "suya..", - "visibility" => "direct", - "in_reply_to_status_id" => activity.id + status: "suya..", + visibility: "direct", + in_reply_to_status_id: activity.id }) Enum.each(["public", "private", "unlisted"], fn visibility -> assert {:error, "The message visibility must be direct"} = CommonAPI.post(user, %{ - "status" => "suya..", - "visibility" => visibility, - "in_reply_to_status_id" => activity.id + status: "suya..", + visibility: visibility, + in_reply_to_status_id: activity.id }) end) end @@ -187,8 +339,7 @@ test "it allows to address a list" do user = insert(:user) {:ok, list} = Pleroma.List.create("foo", user) - {:ok, activity} = - CommonAPI.post(user, %{"status" => "foobar", "visibility" => "list:#{list.id}"}) + {:ok, activity} = CommonAPI.post(user, %{status: "foobar", visibility: "list:#{list.id}"}) assert activity.data["bcc"] == [list.ap_id] assert activity.recipients == [list.ap_id, user.ap_id] @@ -199,7 +350,7 @@ test "it returns error when status is empty and no attachments" do user = insert(:user) assert {:error, "Cannot post an empty status without attachments"} = - CommonAPI.post(user, %{"status" => ""}) + CommonAPI.post(user, %{status: ""}) end test "it validates character limits are correctly enforced" do @@ -208,9 +359,9 @@ test "it validates character limits are correctly enforced" do user = insert(:user) assert {:error, "The status is over the character limit"} = - CommonAPI.post(user, %{"status" => "foobar"}) + CommonAPI.post(user, %{status: "foobar"}) - assert {:ok, activity} = CommonAPI.post(user, %{"status" => "12345"}) + assert {:ok, activity} = CommonAPI.post(user, %{status: "12345"}) end test "it can handle activities that expire" do @@ -221,8 +372,7 @@ test "it can handle activities that expire" do |> NaiveDateTime.truncate(:second) |> NaiveDateTime.add(1_000_000, :second) - assert {:ok, activity} = - CommonAPI.post(user, %{"status" => "chai", "expires_in" => 1_000_000}) + assert {:ok, activity} = CommonAPI.post(user, %{status: "chai", expires_in: 1_000_000}) assert expiration = Pleroma.ActivityExpiration.get_by_activity_id(activity.id) assert expiration.scheduled_at == expires_at @@ -234,14 +384,14 @@ test "reacting to a status with an emoji" do user = insert(:user) other_user = insert(:user) - {:ok, activity} = CommonAPI.post(other_user, %{"status" => "cofe"}) + {:ok, activity} = CommonAPI.post(other_user, %{status: "cofe"}) - {:ok, reaction, _} = CommonAPI.react_with_emoji(activity.id, user, "👍") + {:ok, reaction} = CommonAPI.react_with_emoji(activity.id, user, "👍") assert reaction.data["actor"] == user.ap_id assert reaction.data["content"] == "👍" - {:ok, activity} = CommonAPI.post(other_user, %{"status" => "cofe"}) + {:ok, activity} = CommonAPI.post(other_user, %{status: "cofe"}) {:error, _} = CommonAPI.react_with_emoji(activity.id, user, ".") end @@ -250,32 +400,43 @@ test "unreacting to a status with an emoji" do user = insert(:user) other_user = insert(:user) - {:ok, activity} = CommonAPI.post(other_user, %{"status" => "cofe"}) - {:ok, reaction, _} = CommonAPI.react_with_emoji(activity.id, user, "👍") + {:ok, activity} = CommonAPI.post(other_user, %{status: "cofe"}) + {:ok, reaction} = CommonAPI.react_with_emoji(activity.id, user, "👍") - {:ok, unreaction, _} = CommonAPI.unreact_with_emoji(activity.id, user, "👍") + {:ok, unreaction} = CommonAPI.unreact_with_emoji(activity.id, user, "👍") assert unreaction.data["type"] == "Undo" assert unreaction.data["object"] == reaction.data["id"] + assert unreaction.local end test "repeating a status" do user = insert(:user) other_user = insert(:user) - {:ok, activity} = CommonAPI.post(other_user, %{"status" => "cofe"}) + {:ok, activity} = CommonAPI.post(other_user, %{status: "cofe"}) {:ok, %Activity{}, _} = CommonAPI.repeat(activity.id, user) end + test "can't repeat a repeat" do + user = insert(:user) + other_user = insert(:user) + {:ok, activity} = CommonAPI.post(other_user, %{status: "cofe"}) + + {:ok, %Activity{} = announce, _} = CommonAPI.repeat(activity.id, other_user) + + refute match?({:ok, %Activity{}, _}, CommonAPI.repeat(announce.id, user)) + end + test "repeating a status privately" do user = insert(:user) other_user = insert(:user) - {:ok, activity} = CommonAPI.post(other_user, %{"status" => "cofe"}) + {:ok, activity} = CommonAPI.post(other_user, %{status: "cofe"}) {:ok, %Activity{} = announce_activity, _} = - CommonAPI.repeat(activity.id, user, %{"visibility" => "private"}) + CommonAPI.repeat(activity.id, user, %{visibility: "private"}) assert Visibility.is_private?(announce_activity) end @@ -284,27 +445,30 @@ test "favoriting a status" do user = insert(:user) other_user = insert(:user) - {:ok, activity} = CommonAPI.post(other_user, %{"status" => "cofe"}) + {:ok, post_activity} = CommonAPI.post(other_user, %{status: "cofe"}) - {:ok, %Activity{}, _} = CommonAPI.favorite(activity.id, user) + {:ok, %Activity{data: data}} = CommonAPI.favorite(user, post_activity.id) + assert data["type"] == "Like" + assert data["actor"] == user.ap_id + assert data["object"] == post_activity.data["object"] end test "retweeting a status twice returns the status" do user = insert(:user) other_user = insert(:user) - {:ok, activity} = CommonAPI.post(other_user, %{"status" => "cofe"}) - {:ok, %Activity{} = activity, object} = CommonAPI.repeat(activity.id, user) - {:ok, ^activity, ^object} = CommonAPI.repeat(activity.id, user) + {:ok, activity} = CommonAPI.post(other_user, %{status: "cofe"}) + {:ok, %Activity{} = announce, object} = CommonAPI.repeat(activity.id, user) + {:ok, ^announce, ^object} = CommonAPI.repeat(activity.id, user) end - test "favoriting a status twice returns the status" do + test "favoriting a status twice returns ok, but without the like activity" do user = insert(:user) other_user = insert(:user) - {:ok, activity} = CommonAPI.post(other_user, %{"status" => "cofe"}) - {:ok, %Activity{} = activity, object} = CommonAPI.favorite(activity.id, user) - {:ok, ^activity, ^object} = CommonAPI.favorite(activity.id, user) + {:ok, activity} = CommonAPI.post(other_user, %{status: "cofe"}) + {:ok, %Activity{}} = CommonAPI.favorite(user, activity.id) + assert {:ok, :already_liked} = CommonAPI.favorite(user, activity.id) end end @@ -313,7 +477,7 @@ test "favoriting a status twice returns the status" do Pleroma.Config.put([:instance, :max_pinned_statuses], 1) user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "HI!!!"}) + {:ok, activity} = CommonAPI.post(user, %{status: "HI!!!"}) [user: user, activity: activity] end @@ -330,8 +494,8 @@ test "pin status", %{user: user, activity: activity} do test "pin poll", %{user: user} do {:ok, activity} = CommonAPI.post(user, %{ - "status" => "How is fediverse today?", - "poll" => %{"options" => ["Absolutely outstanding", "Not good"], "expires_in" => 20} + status: "How is fediverse today?", + poll: %{options: ["Absolutely outstanding", "Not good"], expires_in: 20} }) assert {:ok, ^activity} = CommonAPI.pin(activity.id, user) @@ -343,7 +507,7 @@ test "pin poll", %{user: user} do end test "unlisted statuses can be pinned", %{user: user} do - {:ok, activity} = CommonAPI.post(user, %{"status" => "HI!!!", "visibility" => "unlisted"}) + {:ok, activity} = CommonAPI.post(user, %{status: "HI!!!", visibility: "unlisted"}) assert {:ok, ^activity} = CommonAPI.pin(activity.id, user) end @@ -354,7 +518,7 @@ test "only self-authored can be pinned", %{activity: activity} do end test "max pinned statuses", %{user: user, activity: activity_one} do - {:ok, activity_two} = CommonAPI.post(user, %{"status" => "HI!!!"}) + {:ok, activity_two} = CommonAPI.post(user, %{status: "HI!!!"}) assert {:ok, ^activity_one} = CommonAPI.pin(activity_one.id, user) @@ -369,7 +533,9 @@ test "unpin status", %{user: user, activity: activity} do user = refresh_record(user) - assert {:ok, ^activity} = CommonAPI.unpin(activity.id, user) + id = activity.id + + assert match?({:ok, %{id: ^id}}, CommonAPI.unpin(activity.id, user)) user = refresh_record(user) @@ -420,7 +586,7 @@ test "creates a report" do reporter = insert(:user) target_user = insert(:user) - {:ok, activity} = CommonAPI.post(target_user, %{"status" => "foobar"}) + {:ok, activity} = CommonAPI.post(target_user, %{status: "foobar"}) reporter_ap_id = reporter.ap_id target_ap_id = target_user.ap_id @@ -428,9 +594,9 @@ test "creates a report" do comment = "foobar" report_data = %{ - "account_id" => target_user.id, - "comment" => comment, - "status_ids" => [activity.id] + account_id: target_user.id, + comment: comment, + status_ids: [activity.id] } note_obj = %{ @@ -460,9 +626,9 @@ test "updates report state" do {:ok, %Activity{id: report_id}} = CommonAPI.report(reporter, %{ - "account_id" => target_user.id, - "comment" => "I feel offended", - "status_ids" => [activity.id] + account_id: target_user.id, + comment: "I feel offended", + status_ids: [activity.id] }) {:ok, report} = CommonAPI.update_report_state(report_id, "resolved") @@ -481,9 +647,9 @@ test "does not update report state when state is unsupported" do {:ok, %Activity{id: report_id}} = CommonAPI.report(reporter, %{ - "account_id" => target_user.id, - "comment" => "I feel offended", - "status_ids" => [activity.id] + account_id: target_user.id, + comment: "I feel offended", + status_ids: [activity.id] }) assert CommonAPI.update_report_state(report_id, "test") == {:error, "Unsupported state"} @@ -495,16 +661,16 @@ test "updates state of multiple reports" do {:ok, %Activity{id: first_report_id}} = CommonAPI.report(reporter, %{ - "account_id" => target_user.id, - "comment" => "I feel offended", - "status_ids" => [activity.id] + account_id: target_user.id, + comment: "I feel offended", + status_ids: [activity.id] }) {:ok, %Activity{id: second_report_id}} = CommonAPI.report(reporter, %{ - "account_id" => target_user.id, - "comment" => "I feel very offended!", - "status_ids" => [activity.id] + account_id: target_user.id, + comment: "I feel very offended!", + status_ids: [activity.id] }) {:ok, report_ids} = @@ -562,7 +728,7 @@ test "cancels a pending follow for a local user" do assert {:ok, follower, followed, %{id: activity_id, data: %{"state" => "pending"}}} = CommonAPI.follow(follower, followed) - assert User.get_follow_state(follower, followed) == "pending" + assert User.get_follow_state(follower, followed) == :follow_pending assert {:ok, follower} = CommonAPI.unfollow(follower, followed) assert User.get_follow_state(follower, followed) == nil @@ -584,7 +750,7 @@ test "cancels a pending follow for a remote user" do assert {:ok, follower, followed, %{id: activity_id, data: %{"state" => "pending"}}} = CommonAPI.follow(follower, followed) - assert User.get_follow_state(follower, followed) == "pending" + assert User.get_follow_state(follower, followed) == :follow_pending assert {:ok, follower} = CommonAPI.unfollow(follower, followed) assert User.get_follow_state(follower, followed) == nil @@ -640,6 +806,14 @@ test "after rejection, it sets all existing pending follow request states to 're assert Repo.get(Activity, follow_activity_two.id).data["state"] == "reject" assert Repo.get(Activity, follow_activity_three.id).data["state"] == "pending" end + + test "doesn't create a following relationship if the corresponding follow request doesn't exist" do + user = insert(:user, locked: true) + not_follower = insert(:user) + CommonAPI.accept_follow_request(not_follower, user) + + assert Pleroma.FollowingRelationship.following?(not_follower, user) == false + end end describe "vote/3" do @@ -649,8 +823,8 @@ test "does not allow to vote twice" do {:ok, activity} = CommonAPI.post(user, %{ - "status" => "Am I cute?", - "poll" => %{"options" => ["Yes", "No"], "expires_in" => 20} + status: "Am I cute?", + poll: %{options: ["Yes", "No"], expires_in: 20} }) object = Object.normalize(activity) diff --git a/test/web/common_api/common_api_utils_test.exs b/test/web/common_api/common_api_utils_test.exs index 45fc94522..5708db6a4 100644 --- a/test/web/common_api/common_api_utils_test.exs +++ b/test/web/common_api/common_api_utils_test.exs @@ -7,7 +7,6 @@ defmodule Pleroma.Web.CommonAPI.UtilsTest do alias Pleroma.Object alias Pleroma.Web.CommonAPI alias Pleroma.Web.CommonAPI.Utils - alias Pleroma.Web.Endpoint use Pleroma.DataCase import ExUnit.CaptureLog @@ -42,28 +41,6 @@ test "correct password given" do end end - test "parses emoji from name and bio" do - {:ok, user} = UserBuilder.insert(%{name: ":blank:", bio: ":firefox:"}) - - expected = [ - %{ - "type" => "Emoji", - "icon" => %{"type" => "Image", "url" => "#{Endpoint.url()}/emoji/Firefox.gif"}, - "name" => ":firefox:" - }, - %{ - "type" => "Emoji", - "icon" => %{ - "type" => "Image", - "url" => "#{Endpoint.url()}/emoji/blank.png" - }, - "name" => ":blank:" - } - ] - - assert expected == Utils.emoji_from_profile(user) - end - describe "format_input/3" do test "works for bare text/plain" do text = "hello world!" @@ -159,11 +136,11 @@ test "works for text/markdown with mentions" do {output, _, _} = Utils.format_input(text, "text/markdown") assert output == - ~s(

hello world

another @user__test and @user__test and @user__test google.com paragraph

) + }" href="http://foo.com/user__test" rel="ugc">@user__test google.com paragraph

) end end @@ -251,7 +228,7 @@ test "for public posts, a reply" do user = insert(:user) mentioned_user = insert(:user) third_user = insert(:user) - {:ok, activity} = CommonAPI.post(third_user, %{"status" => "uguu"}) + {:ok, activity} = CommonAPI.post(third_user, %{status: "uguu"}) mentions = [mentioned_user.ap_id] {to, cc} = Utils.get_to_and_cc(user, mentions, activity, "public", nil) @@ -284,7 +261,7 @@ test "for unlisted posts, a reply" do user = insert(:user) mentioned_user = insert(:user) third_user = insert(:user) - {:ok, activity} = CommonAPI.post(third_user, %{"status" => "uguu"}) + {:ok, activity} = CommonAPI.post(third_user, %{status: "uguu"}) mentions = [mentioned_user.ap_id] {to, cc} = Utils.get_to_and_cc(user, mentions, activity, "unlisted", nil) @@ -315,7 +292,7 @@ test "for private posts, a reply" do user = insert(:user) mentioned_user = insert(:user) third_user = insert(:user) - {:ok, activity} = CommonAPI.post(third_user, %{"status" => "uguu"}) + {:ok, activity} = CommonAPI.post(third_user, %{status: "uguu"}) mentions = [mentioned_user.ap_id] {to, cc} = Utils.get_to_and_cc(user, mentions, activity, "private", nil) @@ -345,7 +322,7 @@ test "for direct posts, a reply" do user = insert(:user) mentioned_user = insert(:user) third_user = insert(:user) - {:ok, activity} = CommonAPI.post(third_user, %{"status" => "uguu"}) + {:ok, activity} = CommonAPI.post(third_user, %{status: "uguu"}) mentions = [mentioned_user.ap_id] {to, cc} = Utils.get_to_and_cc(user, mentions, activity, "direct", nil) @@ -358,26 +335,6 @@ test "for direct posts, a reply" do end end - describe "get_by_id_or_ap_id/1" do - test "get activity by id" do - activity = insert(:note_activity) - %Pleroma.Activity{} = note = Utils.get_by_id_or_ap_id(activity.id) - assert note.id == activity.id - end - - test "get activity by ap_id" do - activity = insert(:note_activity) - %Pleroma.Activity{} = note = Utils.get_by_id_or_ap_id(activity.data["object"]) - assert note.id == activity.id - end - - test "get activity by object when type isn't `Create` " do - activity = insert(:like_activity) - %Pleroma.Activity{} = like = Utils.get_by_id_or_ap_id(activity.id) - assert like.data["object"] == activity.data["object"] - end - end - describe "to_master_date/1" do test "removes microseconds from date (NaiveDateTime)" do assert Utils.to_masto_date(~N[2015-01-23 23:50:07.123]) == "2015-01-23T23:50:07.000Z" @@ -472,6 +429,13 @@ test "returns recipients when object not found" do activity = insert(:note_activity, user: user, note: object) Pleroma.Repo.delete(object) + obj_url = activity.data["object"] + + Tesla.Mock.mock(fn + %{method: :get, url: ^obj_url} -> + %Tesla.Env{status: 404, body: ""} + end) + assert Utils.maybe_notify_mentioned_recipients(["test-test"], activity) == [ "test-test" ] @@ -499,8 +463,8 @@ test "returns attachments with descs" do desc = Jason.encode!(%{object.id => "test-desc"}) assert Utils.attachments_from_ids(%{ - "media_ids" => ["#{object.id}"], - "descriptions" => desc + media_ids: ["#{object.id}"], + descriptions: desc }) == [ Map.merge(object.data, %{"name" => "test-desc"}) ] @@ -508,7 +472,7 @@ test "returns attachments with descs" do test "returns attachments without descs" do object = insert(:note) - assert Utils.attachments_from_ids(%{"media_ids" => ["#{object.id}"]}) == [object.data] + assert Utils.attachments_from_ids(%{media_ids: ["#{object.id}"]}) == [object.data] end test "returns [] when not pass media_ids" do diff --git a/test/web/federator_test.exs b/test/web/federator_test.exs index da844c24c..de90aa6e0 100644 --- a/test/web/federator_test.exs +++ b/test/web/federator_test.exs @@ -29,7 +29,7 @@ defmodule Pleroma.Web.FederatorTest do describe "Publish an activity" do setup do user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "HI"}) + {:ok, activity} = CommonAPI.post(user, %{status: "HI"}) relay_mock = { Pleroma.Web.ActivityPub.Relay, @@ -78,7 +78,7 @@ test "it federates only to reachable instances via AP" do local: false, nickname: "nick1@domain.com", ap_id: "https://domain.com/users/nick1", - source_data: %{"inbox" => inbox1}, + inbox: inbox1, ap_enabled: true }) @@ -86,7 +86,7 @@ test "it federates only to reachable instances via AP" do local: false, nickname: "nick2@domain2.com", ap_id: "https://domain2.com/users/nick2", - source_data: %{"inbox" => inbox2}, + inbox: inbox2, ap_enabled: true }) @@ -96,7 +96,7 @@ test "it federates only to reachable instances via AP" do Instances.set_consistently_unreachable(URI.parse(inbox2).host) {:ok, _activity} = - CommonAPI.post(user, %{"status" => "HI @nick1@domain.com, @nick2@domain2.com!"}) + CommonAPI.post(user, %{status: "HI @nick1@domain.com, @nick2@domain2.com!"}) expected_dt = NaiveDateTime.to_iso8601(dt) @@ -130,6 +130,9 @@ test "successfully processes incoming AP docs with correct origin" do assert {:ok, job} = Federator.incoming_ap_doc(params) assert {:ok, _activity} = ObanHelpers.perform(job) + + assert {:ok, job} = Federator.incoming_ap_doc(params) + assert {:error, :already_present} = ObanHelpers.perform(job) end test "rejects incoming AP docs with incorrect origin" do @@ -148,7 +151,7 @@ test "rejects incoming AP docs with incorrect origin" do } assert {:ok, job} = Federator.incoming_ap_doc(params) - assert :error = ObanHelpers.perform(job) + assert {:error, :origin_containment_failed} = ObanHelpers.perform(job) end test "it does not crash if MRF rejects the post" do @@ -164,7 +167,7 @@ test "it does not crash if MRF rejects the post" do |> Poison.decode!() assert {:ok, job} = Federator.incoming_ap_doc(params) - assert :error = ObanHelpers.perform(job) + assert {:error, _} = ObanHelpers.perform(job) end end end diff --git a/test/web/feed/tag_controller_test.exs b/test/web/feed/tag_controller_test.exs index e863df86b..3c29cd94f 100644 --- a/test/web/feed/tag_controller_test.exs +++ b/test/web/feed/tag_controller_test.exs @@ -21,7 +21,7 @@ test "gets a feed (ATOM)", %{conn: conn} do ) user = insert(:user) - {:ok, activity1} = CommonAPI.post(user, %{"status" => "yeah #PleromaArt"}) + {:ok, activity1} = CommonAPI.post(user, %{status: "yeah #PleromaArt"}) object = Object.normalize(activity1) @@ -43,9 +43,9 @@ test "gets a feed (ATOM)", %{conn: conn} do |> Ecto.Changeset.change(data: object_data) |> Pleroma.Repo.update() - {:ok, activity2} = CommonAPI.post(user, %{"status" => "42 This is :moominmamma #PleromaArt"}) + {:ok, activity2} = CommonAPI.post(user, %{status: "42 This is :moominmamma #PleromaArt"}) - {:ok, _activity3} = CommonAPI.post(user, %{"status" => "This is :moominmamma"}) + {:ok, _activity3} = CommonAPI.post(user, %{status: "This is :moominmamma"}) response = conn @@ -88,7 +88,7 @@ test "gets a feed (RSS)", %{conn: conn} do ) user = insert(:user) - {:ok, activity1} = CommonAPI.post(user, %{"status" => "yeah #PleromaArt"}) + {:ok, activity1} = CommonAPI.post(user, %{status: "yeah #PleromaArt"}) object = Object.normalize(activity1) @@ -110,9 +110,9 @@ test "gets a feed (RSS)", %{conn: conn} do |> Ecto.Changeset.change(data: object_data) |> Pleroma.Repo.update() - {:ok, activity2} = CommonAPI.post(user, %{"status" => "42 This is :moominmamma #PleromaArt"}) + {:ok, activity2} = CommonAPI.post(user, %{status: "42 This is :moominmamma #PleromaArt"}) - {:ok, _activity3} = CommonAPI.post(user, %{"status" => "This is :moominmamma"}) + {:ok, _activity3} = CommonAPI.post(user, %{status: "This is :moominmamma"}) response = conn @@ -138,8 +138,8 @@ test "gets a feed (RSS)", %{conn: conn} do ] assert xpath(xml, ~x"//channel/item/pubDate/text()"sl) == [ - FeedView.pub_date(activity1.data["published"]), - FeedView.pub_date(activity2.data["published"]) + FeedView.pub_date(activity2.data["published"]), + FeedView.pub_date(activity1.data["published"]) ] assert xpath(xml, ~x"//channel/item/enclosure/@url"sl) == [ @@ -150,8 +150,8 @@ test "gets a feed (RSS)", %{conn: conn} do obj2 = Object.normalize(activity2) assert xpath(xml, ~x"//channel/item/description/text()"sl) == [ - HtmlEntities.decode(FeedView.activity_content(obj2)), - HtmlEntities.decode(FeedView.activity_content(obj1)) + HtmlEntities.decode(FeedView.activity_content(obj2.data)), + HtmlEntities.decode(FeedView.activity_content(obj1.data)) ] response = diff --git a/test/web/mastodon_api/controllers/account_controller/update_credentials_test.exs b/test/web/mastodon_api/controllers/account_controller/update_credentials_test.exs index 51cebe567..fdb6d4c5d 100644 --- a/test/web/mastodon_api/controllers/account_controller/update_credentials_test.exs +++ b/test/web/mastodon_api/controllers/account_controller/update_credentials_test.exs @@ -14,6 +14,7 @@ defmodule Pleroma.Web.MastodonAPI.MastodonAPIController.UpdateCredentialsTest do describe "updating credentials" do setup do: oauth_access(["write:accounts"]) + setup :request_content_type test "sets user settings in a generic way", %{conn: conn} do res_conn = @@ -25,7 +26,7 @@ test "sets user settings in a generic way", %{conn: conn} do } }) - assert user_data = json_response(res_conn, 200) + assert user_data = json_response_and_validate_schema(res_conn, 200) assert user_data["pleroma"]["settings_store"] == %{"pleroma_fe" => %{"theme" => "bla"}} user = Repo.get(User, user_data["id"]) @@ -41,7 +42,7 @@ test "sets user settings in a generic way", %{conn: conn} do } }) - assert user_data = json_response(res_conn, 200) + assert user_data = json_response_and_validate_schema(res_conn, 200) assert user_data["pleroma"]["settings_store"] == %{ @@ -62,7 +63,7 @@ test "sets user settings in a generic way", %{conn: conn} do } }) - assert user_data = json_response(res_conn, 200) + assert user_data = json_response_and_validate_schema(res_conn, 200) assert user_data["pleroma"]["settings_store"] == %{ @@ -79,18 +80,18 @@ test "updates the user's bio", %{conn: conn} do "note" => "I drink #cofe with @#{user2.nickname}\n\nsuya.." }) - assert user_data = json_response(conn, 200) + assert user_data = json_response_and_validate_schema(conn, 200) assert user_data["note"] == - ~s(I drink #cofe with #cofe with @#{user2.nickname}

suya..) + }" href="#{user2.ap_id}" rel="ugc">@#{user2.nickname}

suya..) end test "updates the user's locking status", %{conn: conn} do conn = patch(conn, "/api/v1/accounts/update_credentials", %{locked: "true"}) - assert user_data = json_response(conn, 200) + assert user_data = json_response_and_validate_schema(conn, 200) assert user_data["locked"] == true end @@ -100,24 +101,36 @@ test "updates the user's allow_following_move", %{user: user, conn: conn} do conn = patch(conn, "/api/v1/accounts/update_credentials", %{allow_following_move: "false"}) assert refresh_record(user).allow_following_move == false - assert user_data = json_response(conn, 200) + assert user_data = json_response_and_validate_schema(conn, 200) assert user_data["pleroma"]["allow_following_move"] == false end test "updates the user's default scope", %{conn: conn} do - conn = patch(conn, "/api/v1/accounts/update_credentials", %{default_scope: "cofe"}) + conn = patch(conn, "/api/v1/accounts/update_credentials", %{default_scope: "unlisted"}) - assert user_data = json_response(conn, 200) - assert user_data["source"]["privacy"] == "cofe" + assert user_data = json_response_and_validate_schema(conn, 200) + assert user_data["source"]["privacy"] == "unlisted" end test "updates the user's hide_followers status", %{conn: conn} do conn = patch(conn, "/api/v1/accounts/update_credentials", %{hide_followers: "true"}) - assert user_data = json_response(conn, 200) + assert user_data = json_response_and_validate_schema(conn, 200) assert user_data["pleroma"]["hide_followers"] == true end + test "updates the user's discoverable status", %{conn: conn} do + assert %{"source" => %{"pleroma" => %{"discoverable" => true}}} = + conn + |> patch("/api/v1/accounts/update_credentials", %{discoverable: "true"}) + |> json_response_and_validate_schema(:ok) + + assert %{"source" => %{"pleroma" => %{"discoverable" => false}}} = + conn + |> patch("/api/v1/accounts/update_credentials", %{discoverable: "false"}) + |> json_response_and_validate_schema(:ok) + end + test "updates the user's hide_followers_count and hide_follows_count", %{conn: conn} do conn = patch(conn, "/api/v1/accounts/update_credentials", %{ @@ -125,7 +138,7 @@ test "updates the user's hide_followers_count and hide_follows_count", %{conn: c hide_follows_count: "true" }) - assert user_data = json_response(conn, 200) + assert user_data = json_response_and_validate_schema(conn, 200) assert user_data["pleroma"]["hide_followers_count"] == true assert user_data["pleroma"]["hide_follows_count"] == true end @@ -134,7 +147,7 @@ test "updates the user's skip_thread_containment option", %{user: user, conn: co response = conn |> patch("/api/v1/accounts/update_credentials", %{skip_thread_containment: "true"}) - |> json_response(200) + |> json_response_and_validate_schema(200) assert response["pleroma"]["skip_thread_containment"] == true assert refresh_record(user).skip_thread_containment @@ -143,28 +156,28 @@ test "updates the user's skip_thread_containment option", %{user: user, conn: co test "updates the user's hide_follows status", %{conn: conn} do conn = patch(conn, "/api/v1/accounts/update_credentials", %{hide_follows: "true"}) - assert user_data = json_response(conn, 200) + assert user_data = json_response_and_validate_schema(conn, 200) assert user_data["pleroma"]["hide_follows"] == true end test "updates the user's hide_favorites status", %{conn: conn} do conn = patch(conn, "/api/v1/accounts/update_credentials", %{hide_favorites: "true"}) - assert user_data = json_response(conn, 200) + assert user_data = json_response_and_validate_schema(conn, 200) assert user_data["pleroma"]["hide_favorites"] == true end test "updates the user's show_role status", %{conn: conn} do conn = patch(conn, "/api/v1/accounts/update_credentials", %{show_role: "false"}) - assert user_data = json_response(conn, 200) + assert user_data = json_response_and_validate_schema(conn, 200) assert user_data["source"]["pleroma"]["show_role"] == false end test "updates the user's no_rich_text status", %{conn: conn} do conn = patch(conn, "/api/v1/accounts/update_credentials", %{no_rich_text: "true"}) - assert user_data = json_response(conn, 200) + assert user_data = json_response_and_validate_schema(conn, 200) assert user_data["source"]["pleroma"]["no_rich_text"] == true end @@ -172,7 +185,7 @@ test "updates the user's name", %{conn: conn} do conn = patch(conn, "/api/v1/accounts/update_credentials", %{"display_name" => "markorepairs"}) - assert user_data = json_response(conn, 200) + assert user_data = json_response_and_validate_schema(conn, 200) assert user_data["display_name"] == "markorepairs" end @@ -185,7 +198,7 @@ test "updates the user's avatar", %{user: user, conn: conn} do conn = patch(conn, "/api/v1/accounts/update_credentials", %{"avatar" => new_avatar}) - assert user_response = json_response(conn, 200) + assert user_response = json_response_and_validate_schema(conn, 200) assert user_response["avatar"] != User.avatar_url(user) end @@ -198,7 +211,7 @@ test "updates the user's banner", %{user: user, conn: conn} do conn = patch(conn, "/api/v1/accounts/update_credentials", %{"header" => new_header}) - assert user_response = json_response(conn, 200) + assert user_response = json_response_and_validate_schema(conn, 200) assert user_response["header"] != User.banner_url(user) end @@ -214,7 +227,7 @@ test "updates the user's background", %{conn: conn} do "pleroma_background_image" => new_header }) - assert user_response = json_response(conn, 200) + assert user_response = json_response_and_validate_schema(conn, 200) assert user_response["pleroma"]["background_image"] end @@ -225,14 +238,15 @@ test "requires 'write:accounts' permission" do for token <- [token1, token2] do conn = build_conn() + |> put_req_header("content-type", "multipart/form-data") |> put_req_header("authorization", "Bearer #{token.token}") |> patch("/api/v1/accounts/update_credentials", %{}) if token == token1 do assert %{"error" => "Insufficient permissions: write:accounts."} == - json_response(conn, 403) + json_response_and_validate_schema(conn, 403) else - assert json_response(conn, 200) + assert json_response_and_validate_schema(conn, 200) end end end @@ -247,11 +261,11 @@ test "updates profile emojos", %{user: user, conn: conn} do "display_name" => name }) - assert json_response(ret_conn, 200) + assert json_response_and_validate_schema(ret_conn, 200) conn = get(conn, "/api/v1/accounts/#{user.id}") - assert user_data = json_response(conn, 200) + assert user_data = json_response_and_validate_schema(conn, 200) assert user_data["note"] == note assert user_data["display_name"] == name @@ -261,17 +275,20 @@ test "updates profile emojos", %{user: user, conn: conn} do test "update fields", %{conn: conn} do fields = [ %{"name" => "foo", "value" => ""}, - %{"name" => "link", "value" => "cofe.io"} + %{"name" => "link.io", "value" => "cofe.io"} ] account_data = conn |> patch("/api/v1/accounts/update_credentials", %{"fields_attributes" => fields}) - |> json_response(200) + |> json_response_and_validate_schema(200) assert account_data["fields"] == [ %{"name" => "foo", "value" => "bar"}, - %{"name" => "link", "value" => ~S(cofe.io)} + %{ + "name" => "link.io", + "value" => ~S(cofe.io) + } ] assert account_data["source"]["fields"] == [ @@ -279,14 +296,16 @@ test "update fields", %{conn: conn} do "name" => "foo", "value" => "" }, - %{"name" => "link", "value" => "cofe.io"} + %{"name" => "link.io", "value" => "cofe.io"} ] + end + test "update fields via x-www-form-urlencoded", %{conn: conn} do fields = [ "fields_attributes[1][name]=link", - "fields_attributes[1][value]=cofe.io", - "fields_attributes[0][name]=foo", + "fields_attributes[1][value]=http://cofe.io", + "fields_attributes[0][name]=foo", "fields_attributes[0][value]=bar" ] |> Enum.join("&") @@ -295,54 +314,23 @@ test "update fields", %{conn: conn} do conn |> put_req_header("content-type", "application/x-www-form-urlencoded") |> patch("/api/v1/accounts/update_credentials", fields) - |> json_response(200) + |> json_response_and_validate_schema(200) assert account["fields"] == [ - %{"name" => "foo", "value" => "bar"}, - %{"name" => "link", "value" => ~S(cofe.io)} + %{"name" => "foo", "value" => "bar"}, + %{ + "name" => "link", + "value" => ~S(http://cofe.io) + } ] assert account["source"]["fields"] == [ - %{ - "name" => "foo", - "value" => "bar" - }, - %{"name" => "link", "value" => "cofe.io"} + %{"name" => "foo", "value" => "bar"}, + %{"name" => "link", "value" => "http://cofe.io"} ] + end - name_limit = Pleroma.Config.get([:instance, :account_field_name_length]) - value_limit = Pleroma.Config.get([:instance, :account_field_value_length]) - - long_value = Enum.map(0..value_limit, fn _ -> "x" end) |> Enum.join() - - fields = [%{"name" => "foo", "value" => long_value}] - - assert %{"error" => "Invalid request"} == - conn - |> patch("/api/v1/accounts/update_credentials", %{"fields_attributes" => fields}) - |> json_response(403) - - long_name = Enum.map(0..name_limit, fn _ -> "x" end) |> Enum.join() - - fields = [%{"name" => long_name, "value" => "bar"}] - - assert %{"error" => "Invalid request"} == - conn - |> patch("/api/v1/accounts/update_credentials", %{"fields_attributes" => fields}) - |> json_response(403) - - Pleroma.Config.put([:instance, :max_account_fields], 1) - - fields = [ - %{"name" => "foo", "value" => "bar"}, - %{"name" => "link", "value" => "cofe.io"} - ] - - assert %{"error" => "Invalid request"} == - conn - |> patch("/api/v1/accounts/update_credentials", %{"fields_attributes" => fields}) - |> json_response(403) - + test "update fields with empty name", %{conn: conn} do fields = [ %{"name" => "foo", "value" => ""}, %{"name" => "", "value" => "bar"} @@ -351,11 +339,45 @@ test "update fields", %{conn: conn} do account = conn |> patch("/api/v1/accounts/update_credentials", %{"fields_attributes" => fields}) - |> json_response(200) + |> json_response_and_validate_schema(200) assert account["fields"] == [ %{"name" => "foo", "value" => ""} ] end + + test "update fields when invalid request", %{conn: conn} do + name_limit = Pleroma.Config.get([:instance, :account_field_name_length]) + value_limit = Pleroma.Config.get([:instance, :account_field_value_length]) + + long_name = Enum.map(0..name_limit, fn _ -> "x" end) |> Enum.join() + long_value = Enum.map(0..value_limit, fn _ -> "x" end) |> Enum.join() + + fields = [%{"name" => "foo", "value" => long_value}] + + assert %{"error" => "Invalid request"} == + conn + |> patch("/api/v1/accounts/update_credentials", %{"fields_attributes" => fields}) + |> json_response_and_validate_schema(403) + + fields = [%{"name" => long_name, "value" => "bar"}] + + assert %{"error" => "Invalid request"} == + conn + |> patch("/api/v1/accounts/update_credentials", %{"fields_attributes" => fields}) + |> json_response_and_validate_schema(403) + + Pleroma.Config.put([:instance, :max_account_fields], 1) + + fields = [ + %{"name" => "foo", "value" => "bar"}, + %{"name" => "link", "value" => "cofe.io"} + ] + + assert %{"error" => "Invalid request"} == + conn + |> patch("/api/v1/accounts/update_credentials", %{"fields_attributes" => fields}) + |> json_response_and_validate_schema(403) + end end end diff --git a/test/web/mastodon_api/controllers/account_controller_test.exs b/test/web/mastodon_api/controllers/account_controller_test.exs index a9fa0ce48..280bd6aca 100644 --- a/test/web/mastodon_api/controllers/account_controller_test.exs +++ b/test/web/mastodon_api/controllers/account_controller_test.exs @@ -19,43 +19,37 @@ defmodule Pleroma.Web.MastodonAPI.AccountControllerTest do setup do: clear_config([:instance, :limit_to_local_content]) test "works by id" do - user = insert(:user) + %User{id: user_id} = insert(:user) - conn = - build_conn() - |> get("/api/v1/accounts/#{user.id}") + assert %{"id" => ^user_id} = + build_conn() + |> get("/api/v1/accounts/#{user_id}") + |> json_response_and_validate_schema(200) - assert %{"id" => id} = json_response(conn, 200) - assert id == to_string(user.id) - - conn = - build_conn() - |> get("/api/v1/accounts/-1") - - assert %{"error" => "Can't find user"} = json_response(conn, 404) + assert %{"error" => "Can't find user"} = + build_conn() + |> get("/api/v1/accounts/-1") + |> json_response_and_validate_schema(404) end test "works by nickname" do user = insert(:user) - conn = - build_conn() - |> get("/api/v1/accounts/#{user.nickname}") - - assert %{"id" => id} = json_response(conn, 200) - assert id == user.id + assert %{"id" => user_id} = + build_conn() + |> get("/api/v1/accounts/#{user.nickname}") + |> json_response_and_validate_schema(200) end test "works by nickname for remote users" do Config.put([:instance, :limit_to_local_content], false) + user = insert(:user, nickname: "user@example.com", local: false) - conn = - build_conn() - |> get("/api/v1/accounts/#{user.nickname}") - - assert %{"id" => id} = json_response(conn, 200) - assert id == user.id + assert %{"id" => user_id} = + build_conn() + |> get("/api/v1/accounts/#{user.nickname}") + |> json_response_and_validate_schema(200) end test "respects limit_to_local_content == :all for remote user nicknames" do @@ -63,11 +57,9 @@ test "respects limit_to_local_content == :all for remote user nicknames" do user = insert(:user, nickname: "user@example.com", local: false) - conn = - build_conn() - |> get("/api/v1/accounts/#{user.nickname}") - - assert json_response(conn, 404) + assert build_conn() + |> get("/api/v1/accounts/#{user.nickname}") + |> json_response_and_validate_schema(404) end test "respects limit_to_local_content == :unauthenticated for remote user nicknames" do @@ -80,7 +72,7 @@ test "respects limit_to_local_content == :unauthenticated for remote user nickna build_conn() |> get("/api/v1/accounts/#{user.nickname}") - assert json_response(conn, 404) + assert json_response_and_validate_schema(conn, 404) conn = build_conn() @@ -88,7 +80,7 @@ test "respects limit_to_local_content == :unauthenticated for remote user nickna |> assign(:token, insert(:oauth_token, user: reading_user, scopes: ["read:accounts"])) |> get("/api/v1/accounts/#{user.nickname}") - assert %{"id" => id} = json_response(conn, 200) + assert %{"id" => id} = json_response_and_validate_schema(conn, 200) assert id == user.id end @@ -99,21 +91,21 @@ test "accounts fetches correct account for nicknames beginning with numbers", %{ user_one = insert(:user, %{id: 1212}) user_two = insert(:user, %{nickname: "#{user_one.id}garbage"}) - resp_one = + acc_one = conn |> get("/api/v1/accounts/#{user_one.id}") + |> json_response_and_validate_schema(:ok) - resp_two = + acc_two = conn |> get("/api/v1/accounts/#{user_two.nickname}") + |> json_response_and_validate_schema(:ok) - resp_three = + acc_three = conn |> get("/api/v1/accounts/#{user_two.id}") + |> json_response_and_validate_schema(:ok) - acc_one = json_response(resp_one, 200) - acc_two = json_response(resp_two, 200) - acc_three = json_response(resp_three, 200) refute acc_one == acc_two assert acc_two == acc_three end @@ -121,23 +113,19 @@ test "accounts fetches correct account for nicknames beginning with numbers", %{ test "returns 404 when user is invisible", %{conn: conn} do user = insert(:user, %{invisible: true}) - resp = - conn - |> get("/api/v1/accounts/#{user.nickname}") - |> json_response(404) - - assert %{"error" => "Can't find user"} = resp + assert %{"error" => "Can't find user"} = + conn + |> get("/api/v1/accounts/#{user.nickname}") + |> json_response_and_validate_schema(404) end test "returns 404 for internal.fetch actor", %{conn: conn} do %User{nickname: "internal.fetch"} = InternalFetchActor.get_actor() - resp = - conn - |> get("/api/v1/accounts/internal.fetch") - |> json_response(404) - - assert %{"error" => "Can't find user"} = resp + assert %{"error" => "Can't find user"} = + conn + |> get("/api/v1/accounts/internal.fetch") + |> json_response_and_validate_schema(404) end end @@ -155,27 +143,25 @@ defp local_and_remote_users do setup do: clear_config([:restrict_unauthenticated, :profiles, :remote], true) test "if user is unauthenticated", %{conn: conn, local: local, remote: remote} do - res_conn = get(conn, "/api/v1/accounts/#{local.id}") + assert %{"error" => "Can't find user"} == + conn + |> get("/api/v1/accounts/#{local.id}") + |> json_response_and_validate_schema(:not_found) - assert json_response(res_conn, :not_found) == %{ - "error" => "Can't find user" - } - - res_conn = get(conn, "/api/v1/accounts/#{remote.id}") - - assert json_response(res_conn, :not_found) == %{ - "error" => "Can't find user" - } + assert %{"error" => "Can't find user"} == + conn + |> get("/api/v1/accounts/#{remote.id}") + |> json_response_and_validate_schema(:not_found) end test "if user is authenticated", %{local: local, remote: remote} do %{conn: conn} = oauth_access(["read"]) res_conn = get(conn, "/api/v1/accounts/#{local.id}") - assert %{"id" => _} = json_response(res_conn, 200) + assert %{"id" => _} = json_response_and_validate_schema(res_conn, 200) res_conn = get(conn, "/api/v1/accounts/#{remote.id}") - assert %{"id" => _} = json_response(res_conn, 200) + assert %{"id" => _} = json_response_and_validate_schema(res_conn, 200) end end @@ -187,22 +173,22 @@ test "if user is authenticated", %{local: local, remote: remote} do test "if user is unauthenticated", %{conn: conn, local: local, remote: remote} do res_conn = get(conn, "/api/v1/accounts/#{local.id}") - assert json_response(res_conn, :not_found) == %{ + assert json_response_and_validate_schema(res_conn, :not_found) == %{ "error" => "Can't find user" } res_conn = get(conn, "/api/v1/accounts/#{remote.id}") - assert %{"id" => _} = json_response(res_conn, 200) + assert %{"id" => _} = json_response_and_validate_schema(res_conn, 200) end test "if user is authenticated", %{local: local, remote: remote} do %{conn: conn} = oauth_access(["read"]) res_conn = get(conn, "/api/v1/accounts/#{local.id}") - assert %{"id" => _} = json_response(res_conn, 200) + assert %{"id" => _} = json_response_and_validate_schema(res_conn, 200) res_conn = get(conn, "/api/v1/accounts/#{remote.id}") - assert %{"id" => _} = json_response(res_conn, 200) + assert %{"id" => _} = json_response_and_validate_schema(res_conn, 200) end end @@ -213,11 +199,11 @@ test "if user is authenticated", %{local: local, remote: remote} do test "if user is unauthenticated", %{conn: conn, local: local, remote: remote} do res_conn = get(conn, "/api/v1/accounts/#{local.id}") - assert %{"id" => _} = json_response(res_conn, 200) + assert %{"id" => _} = json_response_and_validate_schema(res_conn, 200) res_conn = get(conn, "/api/v1/accounts/#{remote.id}") - assert json_response(res_conn, :not_found) == %{ + assert json_response_and_validate_schema(res_conn, :not_found) == %{ "error" => "Can't find user" } end @@ -226,46 +212,83 @@ test "if user is authenticated", %{local: local, remote: remote} do %{conn: conn} = oauth_access(["read"]) res_conn = get(conn, "/api/v1/accounts/#{local.id}") - assert %{"id" => _} = json_response(res_conn, 200) + assert %{"id" => _} = json_response_and_validate_schema(res_conn, 200) res_conn = get(conn, "/api/v1/accounts/#{remote.id}") - assert %{"id" => _} = json_response(res_conn, 200) + assert %{"id" => _} = json_response_and_validate_schema(res_conn, 200) end end describe "user timelines" do setup do: oauth_access(["read:statuses"]) + test "works with announces that are just addressed to public", %{conn: conn} do + user = insert(:user, ap_id: "https://honktest/u/test", local: false) + other_user = insert(:user) + + {:ok, post} = CommonAPI.post(other_user, %{status: "bonkeronk"}) + + {:ok, announce, _} = + %{ + "@context" => "https://www.w3.org/ns/activitystreams", + "actor" => "https://honktest/u/test", + "id" => "https://honktest/u/test/bonk/1793M7B9MQ48847vdx", + "object" => post.data["object"], + "published" => "2019-06-25T19:33:58Z", + "to" => ["https://www.w3.org/ns/activitystreams#Public"], + "type" => "Announce" + } + |> ActivityPub.persist(local: false) + + assert resp = + conn + |> get("/api/v1/accounts/#{user.id}/statuses") + |> json_response_and_validate_schema(200) + + assert [%{"id" => id}] = resp + assert id == announce.id + end + test "respects blocks", %{user: user_one, conn: conn} do user_two = insert(:user) user_three = insert(:user) User.block(user_one, user_two) - {:ok, activity} = CommonAPI.post(user_two, %{"status" => "User one sux0rz"}) + {:ok, activity} = CommonAPI.post(user_two, %{status: "User one sux0rz"}) {:ok, repeat, _} = CommonAPI.repeat(activity.id, user_three) - resp = get(conn, "/api/v1/accounts/#{user_two.id}/statuses") + assert resp = + conn + |> get("/api/v1/accounts/#{user_two.id}/statuses") + |> json_response_and_validate_schema(200) - assert [%{"id" => id}] = json_response(resp, 200) + assert [%{"id" => id}] = resp assert id == activity.id # Even a blocked user will deliver the full user timeline, there would be # no point in looking at a blocked users timeline otherwise - resp = get(conn, "/api/v1/accounts/#{user_two.id}/statuses") + assert resp = + conn + |> get("/api/v1/accounts/#{user_two.id}/statuses") + |> json_response_and_validate_schema(200) - assert [%{"id" => id}] = json_response(resp, 200) + assert [%{"id" => id}] = resp assert id == activity.id # Third user's timeline includes the repeat when viewed by unauthenticated user - resp = get(build_conn(), "/api/v1/accounts/#{user_three.id}/statuses") - assert [%{"id" => id}] = json_response(resp, 200) + resp = + build_conn() + |> get("/api/v1/accounts/#{user_three.id}/statuses") + |> json_response_and_validate_schema(200) + + assert [%{"id" => id}] = resp assert id == repeat.id # When viewing a third user's timeline, the blocked users' statuses will NOT be shown resp = get(conn, "/api/v1/accounts/#{user_three.id}/statuses") - assert [] = json_response(resp, 200) + assert [] == json_response_and_validate_schema(resp, 200) end test "gets users statuses", %{conn: conn} do @@ -275,20 +298,24 @@ test "gets users statuses", %{conn: conn} do {:ok, _user_three} = User.follow(user_three, user_one) - {:ok, activity} = CommonAPI.post(user_one, %{"status" => "HI!!!"}) + {:ok, activity} = CommonAPI.post(user_one, %{status: "HI!!!"}) {:ok, direct_activity} = CommonAPI.post(user_one, %{ - "status" => "Hi, @#{user_two.nickname}.", - "visibility" => "direct" + status: "Hi, @#{user_two.nickname}.", + visibility: "direct" }) {:ok, private_activity} = - CommonAPI.post(user_one, %{"status" => "private", "visibility" => "private"}) + CommonAPI.post(user_one, %{status: "private", visibility: "private"}) - resp = get(conn, "/api/v1/accounts/#{user_one.id}/statuses") + # TODO!!! + resp = + conn + |> get("/api/v1/accounts/#{user_one.id}/statuses") + |> json_response_and_validate_schema(200) - assert [%{"id" => id}] = json_response(resp, 200) + assert [%{"id" => id}] = resp assert id == to_string(activity.id) resp = @@ -296,8 +323,9 @@ test "gets users statuses", %{conn: conn} do |> assign(:user, user_two) |> assign(:token, insert(:oauth_token, user: user_two, scopes: ["read:statuses"])) |> get("/api/v1/accounts/#{user_one.id}/statuses") + |> json_response_and_validate_schema(200) - assert [%{"id" => id_one}, %{"id" => id_two}] = json_response(resp, 200) + assert [%{"id" => id_one}, %{"id" => id_two}] = resp assert id_one == to_string(direct_activity.id) assert id_two == to_string(activity.id) @@ -306,8 +334,9 @@ test "gets users statuses", %{conn: conn} do |> assign(:user, user_three) |> assign(:token, insert(:oauth_token, user: user_three, scopes: ["read:statuses"])) |> get("/api/v1/accounts/#{user_one.id}/statuses") + |> json_response_and_validate_schema(200) - assert [%{"id" => id_one}, %{"id" => id_two}] = json_response(resp, 200) + assert [%{"id" => id_one}, %{"id" => id_two}] = resp assert id_one == to_string(private_activity.id) assert id_two == to_string(activity.id) end @@ -318,7 +347,7 @@ test "unimplemented pinned statuses feature", %{conn: conn} do conn = get(conn, "/api/v1/accounts/#{user.id}/statuses?pinned=true") - assert json_response(conn, 200) == [] + assert json_response_and_validate_schema(conn, 200) == [] end test "gets an users media", %{conn: conn} do @@ -333,56 +362,47 @@ test "gets an users media", %{conn: conn} do {:ok, %{id: media_id}} = ActivityPub.upload(file, actor: user.ap_id) - {:ok, image_post} = CommonAPI.post(user, %{"status" => "cofe", "media_ids" => [media_id]}) + {:ok, %{id: image_post_id}} = CommonAPI.post(user, %{status: "cofe", media_ids: [media_id]}) - conn = get(conn, "/api/v1/accounts/#{user.id}/statuses", %{"only_media" => "true"}) + conn = get(conn, "/api/v1/accounts/#{user.id}/statuses?only_media=true") - assert [%{"id" => id}] = json_response(conn, 200) - assert id == to_string(image_post.id) + assert [%{"id" => ^image_post_id}] = json_response_and_validate_schema(conn, 200) - conn = get(build_conn(), "/api/v1/accounts/#{user.id}/statuses", %{"only_media" => "1"}) + conn = get(build_conn(), "/api/v1/accounts/#{user.id}/statuses?only_media=1") - assert [%{"id" => id}] = json_response(conn, 200) - assert id == to_string(image_post.id) + assert [%{"id" => ^image_post_id}] = json_response_and_validate_schema(conn, 200) end test "gets a user's statuses without reblogs", %{user: user, conn: conn} do - {:ok, post} = CommonAPI.post(user, %{"status" => "HI!!!"}) - {:ok, _, _} = CommonAPI.repeat(post.id, user) + {:ok, %{id: post_id}} = CommonAPI.post(user, %{status: "HI!!!"}) + {:ok, _, _} = CommonAPI.repeat(post_id, user) - conn = get(conn, "/api/v1/accounts/#{user.id}/statuses", %{"exclude_reblogs" => "true"}) + conn = get(conn, "/api/v1/accounts/#{user.id}/statuses?exclude_reblogs=true") + assert [%{"id" => ^post_id}] = json_response_and_validate_schema(conn, 200) - assert [%{"id" => id}] = json_response(conn, 200) - assert id == to_string(post.id) - - conn = get(conn, "/api/v1/accounts/#{user.id}/statuses", %{"exclude_reblogs" => "1"}) - - assert [%{"id" => id}] = json_response(conn, 200) - assert id == to_string(post.id) + conn = get(conn, "/api/v1/accounts/#{user.id}/statuses?exclude_reblogs=1") + assert [%{"id" => ^post_id}] = json_response_and_validate_schema(conn, 200) end test "filters user's statuses by a hashtag", %{user: user, conn: conn} do - {:ok, post} = CommonAPI.post(user, %{"status" => "#hashtag"}) - {:ok, _post} = CommonAPI.post(user, %{"status" => "hashtag"}) + {:ok, %{id: post_id}} = CommonAPI.post(user, %{status: "#hashtag"}) + {:ok, _post} = CommonAPI.post(user, %{status: "hashtag"}) - conn = get(conn, "/api/v1/accounts/#{user.id}/statuses", %{"tagged" => "hashtag"}) - - assert [%{"id" => id}] = json_response(conn, 200) - assert id == to_string(post.id) + conn = get(conn, "/api/v1/accounts/#{user.id}/statuses?tagged=hashtag") + assert [%{"id" => ^post_id}] = json_response_and_validate_schema(conn, 200) end test "the user views their own timelines and excludes direct messages", %{ user: user, conn: conn } do - {:ok, public_activity} = CommonAPI.post(user, %{"status" => ".", "visibility" => "public"}) - {:ok, _direct_activity} = CommonAPI.post(user, %{"status" => ".", "visibility" => "direct"}) + {:ok, %{id: public_activity_id}} = + CommonAPI.post(user, %{status: ".", visibility: "public"}) - conn = - get(conn, "/api/v1/accounts/#{user.id}/statuses", %{"exclude_visibilities" => ["direct"]}) + {:ok, _direct_activity} = CommonAPI.post(user, %{status: ".", visibility: "direct"}) - assert [%{"id" => id}] = json_response(conn, 200) - assert id == to_string(public_activity.id) + conn = get(conn, "/api/v1/accounts/#{user.id}/statuses?exclude_visibilities[]=direct") + assert [%{"id" => ^public_activity_id}] = json_response_and_validate_schema(conn, 200) end end @@ -402,27 +422,25 @@ defp local_and_remote_activities(%{local: local, remote: remote}) do setup do: clear_config([:restrict_unauthenticated, :profiles, :remote], true) test "if user is unauthenticated", %{conn: conn, local: local, remote: remote} do - res_conn = get(conn, "/api/v1/accounts/#{local.id}/statuses") + assert %{"error" => "Can't find user"} == + conn + |> get("/api/v1/accounts/#{local.id}/statuses") + |> json_response_and_validate_schema(:not_found) - assert json_response(res_conn, :not_found) == %{ - "error" => "Can't find user" - } - - res_conn = get(conn, "/api/v1/accounts/#{remote.id}/statuses") - - assert json_response(res_conn, :not_found) == %{ - "error" => "Can't find user" - } + assert %{"error" => "Can't find user"} == + conn + |> get("/api/v1/accounts/#{remote.id}/statuses") + |> json_response_and_validate_schema(:not_found) end test "if user is authenticated", %{local: local, remote: remote} do %{conn: conn} = oauth_access(["read"]) res_conn = get(conn, "/api/v1/accounts/#{local.id}/statuses") - assert length(json_response(res_conn, 200)) == 1 + assert length(json_response_and_validate_schema(res_conn, 200)) == 1 res_conn = get(conn, "/api/v1/accounts/#{remote.id}/statuses") - assert length(json_response(res_conn, 200)) == 1 + assert length(json_response_and_validate_schema(res_conn, 200)) == 1 end end @@ -433,24 +451,23 @@ test "if user is authenticated", %{local: local, remote: remote} do setup do: clear_config([:restrict_unauthenticated, :profiles, :local], true) test "if user is unauthenticated", %{conn: conn, local: local, remote: remote} do - res_conn = get(conn, "/api/v1/accounts/#{local.id}/statuses") - - assert json_response(res_conn, :not_found) == %{ - "error" => "Can't find user" - } + assert %{"error" => "Can't find user"} == + conn + |> get("/api/v1/accounts/#{local.id}/statuses") + |> json_response_and_validate_schema(:not_found) res_conn = get(conn, "/api/v1/accounts/#{remote.id}/statuses") - assert length(json_response(res_conn, 200)) == 1 + assert length(json_response_and_validate_schema(res_conn, 200)) == 1 end test "if user is authenticated", %{local: local, remote: remote} do %{conn: conn} = oauth_access(["read"]) res_conn = get(conn, "/api/v1/accounts/#{local.id}/statuses") - assert length(json_response(res_conn, 200)) == 1 + assert length(json_response_and_validate_schema(res_conn, 200)) == 1 res_conn = get(conn, "/api/v1/accounts/#{remote.id}/statuses") - assert length(json_response(res_conn, 200)) == 1 + assert length(json_response_and_validate_schema(res_conn, 200)) == 1 end end @@ -462,23 +479,22 @@ test "if user is authenticated", %{local: local, remote: remote} do test "if user is unauthenticated", %{conn: conn, local: local, remote: remote} do res_conn = get(conn, "/api/v1/accounts/#{local.id}/statuses") - assert length(json_response(res_conn, 200)) == 1 + assert length(json_response_and_validate_schema(res_conn, 200)) == 1 - res_conn = get(conn, "/api/v1/accounts/#{remote.id}/statuses") - - assert json_response(res_conn, :not_found) == %{ - "error" => "Can't find user" - } + assert %{"error" => "Can't find user"} == + conn + |> get("/api/v1/accounts/#{remote.id}/statuses") + |> json_response_and_validate_schema(:not_found) end test "if user is authenticated", %{local: local, remote: remote} do %{conn: conn} = oauth_access(["read"]) res_conn = get(conn, "/api/v1/accounts/#{local.id}/statuses") - assert length(json_response(res_conn, 200)) == 1 + assert length(json_response_and_validate_schema(res_conn, 200)) == 1 res_conn = get(conn, "/api/v1/accounts/#{remote.id}/statuses") - assert length(json_response(res_conn, 200)) == 1 + assert length(json_response_and_validate_schema(res_conn, 200)) == 1 end end @@ -487,12 +503,11 @@ test "if user is authenticated", %{local: local, remote: remote} do test "getting followers", %{user: user, conn: conn} do other_user = insert(:user) - {:ok, user} = User.follow(user, other_user) + {:ok, %{id: user_id}} = User.follow(user, other_user) conn = get(conn, "/api/v1/accounts/#{other_user.id}/followers") - assert [%{"id" => id}] = json_response(conn, 200) - assert id == to_string(user.id) + assert [%{"id" => ^user_id}] = json_response_and_validate_schema(conn, 200) end test "getting followers, hide_followers", %{user: user, conn: conn} do @@ -501,7 +516,7 @@ test "getting followers, hide_followers", %{user: user, conn: conn} do conn = get(conn, "/api/v1/accounts/#{other_user.id}/followers") - assert [] == json_response(conn, 200) + assert [] == json_response_and_validate_schema(conn, 200) end test "getting followers, hide_followers, same user requesting" do @@ -515,37 +530,31 @@ test "getting followers, hide_followers, same user requesting" do |> assign(:token, insert(:oauth_token, user: other_user, scopes: ["read:accounts"])) |> get("/api/v1/accounts/#{other_user.id}/followers") - refute [] == json_response(conn, 200) + refute [] == json_response_and_validate_schema(conn, 200) end test "getting followers, pagination", %{user: user, conn: conn} do - follower1 = insert(:user) - follower2 = insert(:user) - follower3 = insert(:user) - {:ok, _} = User.follow(follower1, user) - {:ok, _} = User.follow(follower2, user) - {:ok, _} = User.follow(follower3, user) + {:ok, %User{id: follower1_id}} = :user |> insert() |> User.follow(user) + {:ok, %User{id: follower2_id}} = :user |> insert() |> User.follow(user) + {:ok, %User{id: follower3_id}} = :user |> insert() |> User.follow(user) - res_conn = get(conn, "/api/v1/accounts/#{user.id}/followers?since_id=#{follower1.id}") + assert [%{"id" => ^follower3_id}, %{"id" => ^follower2_id}] = + conn + |> get("/api/v1/accounts/#{user.id}/followers?since_id=#{follower1_id}") + |> json_response_and_validate_schema(200) - assert [%{"id" => id3}, %{"id" => id2}] = json_response(res_conn, 200) - assert id3 == follower3.id - assert id2 == follower2.id + assert [%{"id" => ^follower2_id}, %{"id" => ^follower1_id}] = + conn + |> get("/api/v1/accounts/#{user.id}/followers?max_id=#{follower3_id}") + |> json_response_and_validate_schema(200) - res_conn = get(conn, "/api/v1/accounts/#{user.id}/followers?max_id=#{follower3.id}") + res_conn = get(conn, "/api/v1/accounts/#{user.id}/followers?limit=1&max_id=#{follower3_id}") - assert [%{"id" => id2}, %{"id" => id1}] = json_response(res_conn, 200) - assert id2 == follower2.id - assert id1 == follower1.id - - res_conn = get(conn, "/api/v1/accounts/#{user.id}/followers?limit=1&max_id=#{follower3.id}") - - assert [%{"id" => id2}] = json_response(res_conn, 200) - assert id2 == follower2.id + assert [%{"id" => ^follower2_id}] = json_response_and_validate_schema(res_conn, 200) assert [link_header] = get_resp_header(res_conn, "link") - assert link_header =~ ~r/min_id=#{follower2.id}/ - assert link_header =~ ~r/max_id=#{follower2.id}/ + assert link_header =~ ~r/min_id=#{follower2_id}/ + assert link_header =~ ~r/max_id=#{follower2_id}/ end end @@ -558,7 +567,7 @@ test "getting following", %{user: user, conn: conn} do conn = get(conn, "/api/v1/accounts/#{user.id}/following") - assert [%{"id" => id}] = json_response(conn, 200) + assert [%{"id" => id}] = json_response_and_validate_schema(conn, 200) assert id == to_string(other_user.id) end @@ -573,7 +582,7 @@ test "getting following, hide_follows, other user requesting" do |> assign(:token, insert(:oauth_token, user: other_user, scopes: ["read:accounts"])) |> get("/api/v1/accounts/#{user.id}/following") - assert [] == json_response(conn, 200) + assert [] == json_response_and_validate_schema(conn, 200) end test "getting following, hide_follows, same user requesting" do @@ -587,7 +596,7 @@ test "getting following, hide_follows, same user requesting" do |> assign(:token, insert(:oauth_token, user: user, scopes: ["read:accounts"])) |> get("/api/v1/accounts/#{user.id}/following") - refute [] == json_response(conn, 200) + refute [] == json_response_and_validate_schema(conn, 200) end test "getting following, pagination", %{user: user, conn: conn} do @@ -600,20 +609,20 @@ test "getting following, pagination", %{user: user, conn: conn} do res_conn = get(conn, "/api/v1/accounts/#{user.id}/following?since_id=#{following1.id}") - assert [%{"id" => id3}, %{"id" => id2}] = json_response(res_conn, 200) + assert [%{"id" => id3}, %{"id" => id2}] = json_response_and_validate_schema(res_conn, 200) assert id3 == following3.id assert id2 == following2.id res_conn = get(conn, "/api/v1/accounts/#{user.id}/following?max_id=#{following3.id}") - assert [%{"id" => id2}, %{"id" => id1}] = json_response(res_conn, 200) + assert [%{"id" => id2}, %{"id" => id1}] = json_response_and_validate_schema(res_conn, 200) assert id2 == following2.id assert id1 == following1.id res_conn = get(conn, "/api/v1/accounts/#{user.id}/following?limit=1&max_id=#{following3.id}") - assert [%{"id" => id2}] = json_response(res_conn, 200) + assert [%{"id" => id2}] = json_response_and_validate_schema(res_conn, 200) assert id2 == following2.id assert [link_header] = get_resp_header(res_conn, "link") @@ -626,30 +635,37 @@ test "getting following, pagination", %{user: user, conn: conn} do setup do: oauth_access(["follow"]) test "following / unfollowing a user", %{conn: conn} do - other_user = insert(:user) + %{id: other_user_id, nickname: other_user_nickname} = insert(:user) - ret_conn = post(conn, "/api/v1/accounts/#{other_user.id}/follow") + assert %{"id" => _id, "following" => true} = + conn + |> post("/api/v1/accounts/#{other_user_id}/follow") + |> json_response_and_validate_schema(200) - assert %{"id" => _id, "following" => true} = json_response(ret_conn, 200) + assert %{"id" => _id, "following" => false} = + conn + |> post("/api/v1/accounts/#{other_user_id}/unfollow") + |> json_response_and_validate_schema(200) - ret_conn = post(conn, "/api/v1/accounts/#{other_user.id}/unfollow") - - assert %{"id" => _id, "following" => false} = json_response(ret_conn, 200) - - conn = post(conn, "/api/v1/follows", %{"uri" => other_user.nickname}) - - assert %{"id" => id} = json_response(conn, 200) - assert id == to_string(other_user.id) + assert %{"id" => ^other_user_id} = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/follows", %{"uri" => other_user_nickname}) + |> json_response_and_validate_schema(200) end test "cancelling follow request", %{conn: conn} do %{id: other_user_id} = insert(:user, %{locked: true}) assert %{"id" => ^other_user_id, "following" => false, "requested" => true} = - conn |> post("/api/v1/accounts/#{other_user_id}/follow") |> json_response(:ok) + conn + |> post("/api/v1/accounts/#{other_user_id}/follow") + |> json_response_and_validate_schema(:ok) assert %{"id" => ^other_user_id, "following" => false, "requested" => false} = - conn |> post("/api/v1/accounts/#{other_user_id}/unfollow") |> json_response(:ok) + conn + |> post("/api/v1/accounts/#{other_user_id}/unfollow") + |> json_response_and_validate_schema(:ok) end test "following without reblogs" do @@ -659,51 +675,65 @@ test "following without reblogs" do ret_conn = post(conn, "/api/v1/accounts/#{followed.id}/follow?reblogs=false") - assert %{"showing_reblogs" => false} = json_response(ret_conn, 200) + assert %{"showing_reblogs" => false} = json_response_and_validate_schema(ret_conn, 200) - {:ok, activity} = CommonAPI.post(other_user, %{"status" => "hey"}) - {:ok, reblog, _} = CommonAPI.repeat(activity.id, followed) + {:ok, activity} = CommonAPI.post(other_user, %{status: "hey"}) + {:ok, %{id: reblog_id}, _} = CommonAPI.repeat(activity.id, followed) - ret_conn = get(conn, "/api/v1/timelines/home") + assert [] == + conn + |> get("/api/v1/timelines/home") + |> json_response(200) - assert [] == json_response(ret_conn, 200) + assert %{"showing_reblogs" => true} = + conn + |> post("/api/v1/accounts/#{followed.id}/follow?reblogs=true") + |> json_response_and_validate_schema(200) - ret_conn = post(conn, "/api/v1/accounts/#{followed.id}/follow?reblogs=true") - - assert %{"showing_reblogs" => true} = json_response(ret_conn, 200) - - conn = get(conn, "/api/v1/timelines/home") - - expected_activity_id = reblog.id - assert [%{"id" => ^expected_activity_id}] = json_response(conn, 200) + assert [%{"id" => ^reblog_id}] = + conn + |> get("/api/v1/timelines/home") + |> json_response(200) end test "following / unfollowing errors", %{user: user, conn: conn} do # self follow conn_res = post(conn, "/api/v1/accounts/#{user.id}/follow") - assert %{"error" => "Record not found"} = json_response(conn_res, 404) + + assert %{"error" => "Can not follow yourself"} = + json_response_and_validate_schema(conn_res, 400) # self unfollow user = User.get_cached_by_id(user.id) conn_res = post(conn, "/api/v1/accounts/#{user.id}/unfollow") - assert %{"error" => "Record not found"} = json_response(conn_res, 404) + + assert %{"error" => "Can not unfollow yourself"} = + json_response_and_validate_schema(conn_res, 400) # self follow via uri user = User.get_cached_by_id(user.id) - conn_res = post(conn, "/api/v1/follows", %{"uri" => user.nickname}) - assert %{"error" => "Record not found"} = json_response(conn_res, 404) + + assert %{"error" => "Can not follow yourself"} = + conn + |> put_req_header("content-type", "multipart/form-data") + |> post("/api/v1/follows", %{"uri" => user.nickname}) + |> json_response_and_validate_schema(400) # follow non existing user conn_res = post(conn, "/api/v1/accounts/doesntexist/follow") - assert %{"error" => "Record not found"} = json_response(conn_res, 404) + assert %{"error" => "Record not found"} = json_response_and_validate_schema(conn_res, 404) # follow non existing user via uri - conn_res = post(conn, "/api/v1/follows", %{"uri" => "doesntexist"}) - assert %{"error" => "Record not found"} = json_response(conn_res, 404) + conn_res = + conn + |> put_req_header("content-type", "multipart/form-data") + |> post("/api/v1/follows", %{"uri" => "doesntexist"}) + + assert %{"error" => "Record not found"} = json_response_and_validate_schema(conn_res, 404) # unfollow non existing user conn_res = post(conn, "/api/v1/accounts/doesntexist/unfollow") - assert %{"error" => "Record not found"} = json_response(conn_res, 404) + assert %{"error" => "Record not found"} = json_response_and_validate_schema(conn_res, 404) end end @@ -713,55 +743,52 @@ test "following / unfollowing errors", %{user: user, conn: conn} do test "with notifications", %{conn: conn} do other_user = insert(:user) - ret_conn = post(conn, "/api/v1/accounts/#{other_user.id}/mute") - - response = json_response(ret_conn, 200) - - assert %{"id" => _id, "muting" => true, "muting_notifications" => true} = response + assert %{"id" => _id, "muting" => true, "muting_notifications" => true} = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/accounts/#{other_user.id}/mute") + |> json_response_and_validate_schema(200) conn = post(conn, "/api/v1/accounts/#{other_user.id}/unmute") - response = json_response(conn, 200) - assert %{"id" => _id, "muting" => false, "muting_notifications" => false} = response + assert %{"id" => _id, "muting" => false, "muting_notifications" => false} = + json_response_and_validate_schema(conn, 200) end test "without notifications", %{conn: conn} do other_user = insert(:user) ret_conn = - post(conn, "/api/v1/accounts/#{other_user.id}/mute", %{"notifications" => "false"}) + conn + |> put_req_header("content-type", "multipart/form-data") + |> post("/api/v1/accounts/#{other_user.id}/mute", %{"notifications" => "false"}) - response = json_response(ret_conn, 200) - - assert %{"id" => _id, "muting" => true, "muting_notifications" => false} = response + assert %{"id" => _id, "muting" => true, "muting_notifications" => false} = + json_response_and_validate_schema(ret_conn, 200) conn = post(conn, "/api/v1/accounts/#{other_user.id}/unmute") - response = json_response(conn, 200) - assert %{"id" => _id, "muting" => false, "muting_notifications" => false} = response + assert %{"id" => _id, "muting" => false, "muting_notifications" => false} = + json_response_and_validate_schema(conn, 200) end end describe "pinned statuses" do setup do user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "HI!!!"}) + {:ok, activity} = CommonAPI.post(user, %{status: "HI!!!"}) %{conn: conn} = oauth_access(["read:statuses"], user: user) [conn: conn, user: user, activity: activity] end - test "returns pinned statuses", %{conn: conn, user: user, activity: activity} do - {:ok, _} = CommonAPI.pin(activity.id, user) + test "returns pinned statuses", %{conn: conn, user: user, activity: %{id: activity_id}} do + {:ok, _} = CommonAPI.pin(activity_id, user) - result = - conn - |> get("/api/v1/accounts/#{user.id}/statuses?pinned=true") - |> json_response(200) - - id_str = to_string(activity.id) - - assert [%{"id" => ^id_str, "pinned" => true}] = result + assert [%{"id" => ^activity_id, "pinned" => true}] = + conn + |> get("/api/v1/accounts/#{user.id}/statuses?pinned=true") + |> json_response_and_validate_schema(200) end end @@ -771,11 +798,11 @@ test "blocking / unblocking a user" do ret_conn = post(conn, "/api/v1/accounts/#{other_user.id}/block") - assert %{"id" => _id, "blocking" => true} = json_response(ret_conn, 200) + assert %{"id" => _id, "blocking" => true} = json_response_and_validate_schema(ret_conn, 200) conn = post(conn, "/api/v1/accounts/#{other_user.id}/unblock") - assert %{"id" => _id, "blocking" => false} = json_response(conn, 200) + assert %{"id" => _id, "blocking" => false} = json_response_and_validate_schema(conn, 200) end describe "create account by app" do @@ -794,21 +821,23 @@ test "blocking / unblocking a user" do test "Account registration via Application", %{conn: conn} do conn = - post(conn, "/api/v1/apps", %{ + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/apps", %{ client_name: "client_name", redirect_uris: "urn:ietf:wg:oauth:2.0:oob", scopes: "read, write, follow" }) - %{ - "client_id" => client_id, - "client_secret" => client_secret, - "id" => _, - "name" => "client_name", - "redirect_uri" => "urn:ietf:wg:oauth:2.0:oob", - "vapid_key" => _, - "website" => nil - } = json_response(conn, 200) + assert %{ + "client_id" => client_id, + "client_secret" => client_secret, + "id" => _, + "name" => "client_name", + "redirect_uri" => "urn:ietf:wg:oauth:2.0:oob", + "vapid_key" => _, + "website" => nil + } = json_response_and_validate_schema(conn, 200) conn = post(conn, "/oauth/token", %{ @@ -828,6 +857,7 @@ test "Account registration via Application", %{conn: conn} do conn = build_conn() + |> put_req_header("content-type", "multipart/form-data") |> put_req_header("authorization", "Bearer " <> token) |> post("/api/v1/accounts", %{ username: "lain", @@ -842,7 +872,7 @@ test "Account registration via Application", %{conn: conn} do "created_at" => _created_at, "scope" => _scope, "token_type" => "Bearer" - } = json_response(conn, 200) + } = json_response_and_validate_schema(conn, 200) token_from_db = Repo.get_by(Token, token: token) assert token_from_db @@ -856,12 +886,15 @@ test "returns error when user already registred", %{conn: conn, valid_params: va _user = insert(:user, email: "lain@example.org") app_token = insert(:oauth_token, user: nil) - conn = + res = conn |> put_req_header("authorization", "Bearer " <> app_token.token) + |> put_req_header("content-type", "application/json") + |> post("/api/v1/accounts", valid_params) - res = post(conn, "/api/v1/accounts", valid_params) - assert json_response(res, 400) == %{"error" => "{\"email\":[\"has already been taken\"]}"} + assert json_response_and_validate_schema(res, 400) == %{ + "error" => "{\"email\":[\"has already been taken\"]}" + } end test "returns bad_request if missing required params", %{ @@ -870,10 +903,13 @@ test "returns bad_request if missing required params", %{ } do app_token = insert(:oauth_token, user: nil) - conn = put_req_header(conn, "authorization", "Bearer " <> app_token.token) + conn = + conn + |> put_req_header("authorization", "Bearer " <> app_token.token) + |> put_req_header("content-type", "application/json") res = post(conn, "/api/v1/accounts", valid_params) - assert json_response(res, 200) + assert json_response_and_validate_schema(res, 200) [{127, 0, 0, 1}, {127, 0, 0, 2}, {127, 0, 0, 3}, {127, 0, 0, 4}] |> Stream.zip(Map.delete(valid_params, :email)) @@ -882,9 +918,18 @@ test "returns bad_request if missing required params", %{ conn |> Map.put(:remote_ip, ip) |> post("/api/v1/accounts", Map.delete(valid_params, attr)) - |> json_response(400) + |> json_response_and_validate_schema(400) - assert res == %{"error" => "Missing parameters"} + assert res == %{ + "error" => "Missing field: #{attr}.", + "errors" => [ + %{ + "message" => "Missing field: #{attr}", + "source" => %{"pointer" => "/#{attr}"}, + "title" => "Invalid value" + } + ] + } end) end @@ -895,21 +940,28 @@ test "returns bad_request if missing email params when :account_activation_requi Pleroma.Config.put([:instance, :account_activation_required], true) app_token = insert(:oauth_token, user: nil) - conn = put_req_header(conn, "authorization", "Bearer " <> app_token.token) + + conn = + conn + |> put_req_header("authorization", "Bearer " <> app_token.token) + |> put_req_header("content-type", "application/json") res = conn |> Map.put(:remote_ip, {127, 0, 0, 5}) |> post("/api/v1/accounts", Map.delete(valid_params, :email)) - assert json_response(res, 400) == %{"error" => "Missing parameters"} + assert json_response_and_validate_schema(res, 400) == + %{"error" => "Missing parameter: email"} res = conn |> Map.put(:remote_ip, {127, 0, 0, 6}) |> post("/api/v1/accounts", Map.put(valid_params, :email, "")) - assert json_response(res, 400) == %{"error" => "{\"email\":[\"can't be blank\"]}"} + assert json_response_and_validate_schema(res, 400) == %{ + "error" => "{\"email\":[\"can't be blank\"]}" + } end test "allow registration without an email", %{conn: conn, valid_params: valid_params} do @@ -918,10 +970,11 @@ test "allow registration without an email", %{conn: conn, valid_params: valid_pa res = conn + |> put_req_header("content-type", "application/json") |> Map.put(:remote_ip, {127, 0, 0, 7}) |> post("/api/v1/accounts", Map.delete(valid_params, :email)) - assert json_response(res, 200) + assert json_response_and_validate_schema(res, 200) end test "allow registration with an empty email", %{conn: conn, valid_params: valid_params} do @@ -930,17 +983,89 @@ test "allow registration with an empty email", %{conn: conn, valid_params: valid res = conn + |> put_req_header("content-type", "application/json") |> Map.put(:remote_ip, {127, 0, 0, 8}) |> post("/api/v1/accounts", Map.put(valid_params, :email, "")) - assert json_response(res, 200) + assert json_response_and_validate_schema(res, 200) end test "returns forbidden if token is invalid", %{conn: conn, valid_params: valid_params} do - conn = put_req_header(conn, "authorization", "Bearer " <> "invalid-token") + res = + conn + |> put_req_header("authorization", "Bearer " <> "invalid-token") + |> put_req_header("content-type", "multipart/form-data") + |> post("/api/v1/accounts", valid_params) - res = post(conn, "/api/v1/accounts", valid_params) - assert json_response(res, 403) == %{"error" => "Invalid credentials"} + assert json_response_and_validate_schema(res, 403) == %{"error" => "Invalid credentials"} + end + + test "registration from trusted app" do + clear_config([Pleroma.Captcha, :enabled], true) + app = insert(:oauth_app, trusted: true, scopes: ["read", "write", "follow", "push"]) + + conn = + build_conn() + |> post("/oauth/token", %{ + "grant_type" => "client_credentials", + "client_id" => app.client_id, + "client_secret" => app.client_secret + }) + + assert %{"access_token" => token, "token_type" => "Bearer"} = json_response(conn, 200) + + response = + build_conn() + |> Plug.Conn.put_req_header("authorization", "Bearer " <> token) + |> put_req_header("content-type", "multipart/form-data") + |> post("/api/v1/accounts", %{ + nickname: "nickanme", + agreement: true, + email: "email@example.com", + fullname: "Lain", + username: "Lain", + password: "some_password", + confirm: "some_password" + }) + |> json_response_and_validate_schema(200) + + assert %{ + "access_token" => access_token, + "created_at" => _, + "scope" => ["read", "write", "follow", "push"], + "token_type" => "Bearer" + } = response + + response = + build_conn() + |> Plug.Conn.put_req_header("authorization", "Bearer " <> access_token) + |> get("/api/v1/accounts/verify_credentials") + |> json_response_and_validate_schema(200) + + assert %{ + "acct" => "Lain", + "bot" => false, + "display_name" => "Lain", + "follow_requests_count" => 0, + "followers_count" => 0, + "following_count" => 0, + "locked" => false, + "note" => "", + "source" => %{ + "fields" => [], + "note" => "", + "pleroma" => %{ + "actor_type" => "Person", + "discoverable" => false, + "no_rich_text" => false, + "show_role" => true + }, + "privacy" => "public", + "sensitive" => false + }, + "statuses_count" => 0, + "username" => "Lain" + } = response end end @@ -954,10 +1079,12 @@ test "respects rate limit setting", %{conn: conn} do conn |> put_req_header("authorization", "Bearer " <> app_token.token) |> Map.put(:remote_ip, {15, 15, 15, 15}) + |> put_req_header("content-type", "multipart/form-data") for i <- 1..2 do conn = - post(conn, "/api/v1/accounts", %{ + conn + |> post("/api/v1/accounts", %{ username: "#{i}lain", email: "#{i}lain@example.org", password: "PlzDontHackLain", @@ -969,7 +1096,7 @@ test "respects rate limit setting", %{conn: conn} do "created_at" => _created_at, "scope" => _scope, "token_type" => "Bearer" - } = json_response(conn, 200) + } = json_response_and_validate_schema(conn, 200) token_from_db = Repo.get_by(Token, token: token) assert token_from_db @@ -987,7 +1114,94 @@ test "respects rate limit setting", %{conn: conn} do agreement: true }) - assert json_response(conn, :too_many_requests) == %{"error" => "Throttled"} + assert json_response_and_validate_schema(conn, :too_many_requests) == %{ + "error" => "Throttled" + } + end + end + + describe "create account with enabled captcha" do + setup %{conn: conn} do + app_token = insert(:oauth_token, user: nil) + + conn = + conn + |> put_req_header("authorization", "Bearer " <> app_token.token) + |> put_req_header("content-type", "multipart/form-data") + + [conn: conn] + end + + setup do: clear_config([Pleroma.Captcha, :enabled], true) + + test "creates an account and returns 200 if captcha is valid", %{conn: conn} do + %{token: token, answer_data: answer_data} = Pleroma.Captcha.new() + + params = %{ + username: "lain", + email: "lain@example.org", + password: "PlzDontHackLain", + agreement: true, + captcha_solution: Pleroma.Captcha.Mock.solution(), + captcha_token: token, + captcha_answer_data: answer_data + } + + assert %{ + "access_token" => access_token, + "created_at" => _, + "scope" => ["read"], + "token_type" => "Bearer" + } = + conn + |> post("/api/v1/accounts", params) + |> json_response_and_validate_schema(:ok) + + assert Token |> Repo.get_by(token: access_token) |> Repo.preload(:user) |> Map.get(:user) + + Cachex.del(:used_captcha_cache, token) + end + + test "returns 400 if any captcha field is not provided", %{conn: conn} do + captcha_fields = [:captcha_solution, :captcha_token, :captcha_answer_data] + + valid_params = %{ + username: "lain", + email: "lain@example.org", + password: "PlzDontHackLain", + agreement: true, + captcha_solution: "xx", + captcha_token: "xx", + captcha_answer_data: "xx" + } + + for field <- captcha_fields do + expected = %{ + "error" => "{\"captcha\":[\"Invalid CAPTCHA (Missing parameter: #{field})\"]}" + } + + assert expected == + conn + |> post("/api/v1/accounts", Map.delete(valid_params, field)) + |> json_response_and_validate_schema(:bad_request) + end + end + + test "returns an error if captcha is invalid", %{conn: conn} do + params = %{ + username: "lain", + email: "lain@example.org", + password: "PlzDontHackLain", + agreement: true, + captcha_solution: "cofe", + captcha_token: "cofe", + captcha_answer_data: "cofe" + } + + assert %{"error" => "{\"captcha\":[\"Invalid answer data\"]}"} == + conn + |> post("/api/v1/accounts", params) + |> json_response_and_validate_schema(:bad_request) end end @@ -995,27 +1209,28 @@ test "respects rate limit setting", %{conn: conn} do test "returns lists to which the account belongs" do %{user: user, conn: conn} = oauth_access(["read:lists"]) other_user = insert(:user) - assert {:ok, %Pleroma.List{} = list} = Pleroma.List.create("Test List", user) + assert {:ok, %Pleroma.List{id: list_id} = list} = Pleroma.List.create("Test List", user) {:ok, %{following: _following}} = Pleroma.List.follow(list, other_user) - res = - conn - |> get("/api/v1/accounts/#{other_user.id}/lists") - |> json_response(200) - - assert res == [%{"id" => to_string(list.id), "title" => "Test List"}] + assert [%{"id" => list_id, "title" => "Test List"}] = + conn + |> get("/api/v1/accounts/#{other_user.id}/lists") + |> json_response_and_validate_schema(200) end end describe "verify_credentials" do test "verify_credentials" do %{user: user, conn: conn} = oauth_access(["read:accounts"]) + [notification | _] = insert_list(7, :notification, user: user) + Pleroma.Notification.set_read_up_to(user, notification.id) conn = get(conn, "/api/v1/accounts/verify_credentials") - response = json_response(conn, 200) + response = json_response_and_validate_schema(conn, 200) assert %{"id" => id, "source" => %{"privacy" => "public"}} = response assert response["pleroma"]["chat_token"] + assert response["pleroma"]["unread_notifications_count"] == 6 assert id == to_string(user.id) end @@ -1025,7 +1240,9 @@ test "verify_credentials default scope unlisted" do conn = get(conn, "/api/v1/accounts/verify_credentials") - assert %{"id" => id, "source" => %{"privacy" => "unlisted"}} = json_response(conn, 200) + assert %{"id" => id, "source" => %{"privacy" => "unlisted"}} = + json_response_and_validate_schema(conn, 200) + assert id == to_string(user.id) end @@ -1035,7 +1252,9 @@ test "locked accounts" do conn = get(conn, "/api/v1/accounts/verify_credentials") - assert %{"id" => id, "source" => %{"privacy" => "private"}} = json_response(conn, 200) + assert %{"id" => id, "source" => %{"privacy" => "private"}} = + json_response_and_validate_schema(conn, 200) + assert id == to_string(user.id) end end @@ -1044,20 +1263,24 @@ test "locked accounts" do setup do: oauth_access(["read:follows"]) test "returns the relationships for the current user", %{user: user, conn: conn} do - other_user = insert(:user) + %{id: other_user_id} = other_user = insert(:user) {:ok, _user} = User.follow(user, other_user) - conn = get(conn, "/api/v1/accounts/relationships", %{"id" => [other_user.id]}) + assert [%{"id" => ^other_user_id}] = + conn + |> get("/api/v1/accounts/relationships?id=#{other_user.id}") + |> json_response_and_validate_schema(200) - assert [relationship] = json_response(conn, 200) - - assert to_string(other_user.id) == relationship["id"] + assert [%{"id" => ^other_user_id}] = + conn + |> get("/api/v1/accounts/relationships?id[]=#{other_user.id}") + |> json_response_and_validate_schema(200) end test "returns an empty list on a bad request", %{conn: conn} do conn = get(conn, "/api/v1/accounts/relationships", %{}) - assert [] = json_response(conn, 200) + assert [] = json_response_and_validate_schema(conn, 200) end end @@ -1070,7 +1293,7 @@ test "getting a list of mutes" do conn = get(conn, "/api/v1/mutes") other_user_id = to_string(other_user.id) - assert [%{"id" => ^other_user_id}] = json_response(conn, 200) + assert [%{"id" => ^other_user_id}] = json_response_and_validate_schema(conn, 200) end test "getting a list of blocks" do @@ -1085,6 +1308,6 @@ test "getting a list of blocks" do |> get("/api/v1/blocks") other_user_id = to_string(other_user.id) - assert [%{"id" => ^other_user_id}] = json_response(conn, 200) + assert [%{"id" => ^other_user_id}] = json_response_and_validate_schema(conn, 200) end end diff --git a/test/web/mastodon_api/controllers/app_controller_test.exs b/test/web/mastodon_api/controllers/app_controller_test.exs index 77d234d67..a0b8b126c 100644 --- a/test/web/mastodon_api/controllers/app_controller_test.exs +++ b/test/web/mastodon_api/controllers/app_controller_test.exs @@ -16,8 +16,7 @@ test "apps/verify_credentials", %{conn: conn} do conn = conn - |> assign(:user, token.user) - |> assign(:token, token) + |> put_req_header("authorization", "Bearer #{token.token}") |> get("/api/v1/apps/verify_credentials") app = Repo.preload(token, :app).app @@ -28,7 +27,7 @@ test "apps/verify_credentials", %{conn: conn} do "vapid_key" => Push.vapid_config() |> Keyword.get(:public_key) } - assert expected == json_response(conn, 200) + assert expected == json_response_and_validate_schema(conn, 200) end test "creates an oauth app", %{conn: conn} do @@ -37,6 +36,7 @@ test "creates an oauth app", %{conn: conn} do conn = conn + |> put_req_header("content-type", "application/json") |> assign(:user, user) |> post("/api/v1/apps", %{ client_name: app_attrs.client_name, @@ -55,6 +55,6 @@ test "creates an oauth app", %{conn: conn} do "vapid_key" => Push.vapid_config() |> Keyword.get(:public_key) } - assert expected == json_response(conn, 200) + assert expected == json_response_and_validate_schema(conn, 200) end end diff --git a/test/web/mastodon_api/controllers/conversation_controller_test.exs b/test/web/mastodon_api/controllers/conversation_controller_test.exs index 801b0259b..693ba51e5 100644 --- a/test/web/mastodon_api/controllers/conversation_controller_test.exs +++ b/test/web/mastodon_api/controllers/conversation_controller_test.exs @@ -22,21 +22,21 @@ test "returns a list of conversations", %{user: user_one, conn: conn} do {:ok, direct} = CommonAPI.post(user_one, %{ - "status" => "Hi @#{user_two.nickname}, @#{user_three.nickname}!", - "visibility" => "direct" + status: "Hi @#{user_two.nickname}, @#{user_three.nickname}!", + visibility: "direct" }) assert User.get_cached_by_id(user_two.id).unread_conversation_count == 1 {:ok, _follower_only} = CommonAPI.post(user_one, %{ - "status" => "Hi @#{user_two.nickname}!", - "visibility" => "private" + status: "Hi @#{user_two.nickname}!", + visibility: "private" }) res_conn = get(conn, "/api/v1/conversations") - assert response = json_response(res_conn, 200) + assert response = json_response_and_validate_schema(res_conn, 200) assert [ %{ @@ -63,46 +63,46 @@ test "filters conversations by recipients", %{user: user_one, conn: conn} do {:ok, direct1} = CommonAPI.post(user_one, %{ - "status" => "Hi @#{user_two.nickname}!", - "visibility" => "direct" + status: "Hi @#{user_two.nickname}!", + visibility: "direct" }) {:ok, _direct2} = CommonAPI.post(user_one, %{ - "status" => "Hi @#{user_three.nickname}!", - "visibility" => "direct" + status: "Hi @#{user_three.nickname}!", + visibility: "direct" }) {:ok, direct3} = CommonAPI.post(user_one, %{ - "status" => "Hi @#{user_two.nickname}, @#{user_three.nickname}!", - "visibility" => "direct" + status: "Hi @#{user_two.nickname}, @#{user_three.nickname}!", + visibility: "direct" }) {:ok, _direct4} = CommonAPI.post(user_two, %{ - "status" => "Hi @#{user_three.nickname}!", - "visibility" => "direct" + status: "Hi @#{user_three.nickname}!", + visibility: "direct" }) {:ok, direct5} = CommonAPI.post(user_two, %{ - "status" => "Hi @#{user_one.nickname}!", - "visibility" => "direct" + status: "Hi @#{user_one.nickname}!", + visibility: "direct" }) - [conversation1, conversation2] = - conn - |> get("/api/v1/conversations", %{"recipients" => [user_two.id]}) - |> json_response(200) + assert [conversation1, conversation2] = + conn + |> get("/api/v1/conversations?recipients[]=#{user_two.id}") + |> json_response_and_validate_schema(200) assert conversation1["last_status"]["id"] == direct5.id assert conversation2["last_status"]["id"] == direct1.id [conversation1] = conn - |> get("/api/v1/conversations", %{"recipients" => [user_two.id, user_three.id]}) - |> json_response(200) + |> get("/api/v1/conversations?recipients[]=#{user_two.id}&recipients[]=#{user_three.id}") + |> json_response_and_validate_schema(200) assert conversation1["last_status"]["id"] == direct3.id end @@ -112,21 +112,21 @@ test "updates the last_status on reply", %{user: user_one, conn: conn} do {:ok, direct} = CommonAPI.post(user_one, %{ - "status" => "Hi @#{user_two.nickname}", - "visibility" => "direct" + status: "Hi @#{user_two.nickname}", + visibility: "direct" }) {:ok, direct_reply} = CommonAPI.post(user_two, %{ - "status" => "reply", - "visibility" => "direct", - "in_reply_to_status_id" => direct.id + status: "reply", + visibility: "direct", + in_reply_to_status_id: direct.id }) [%{"last_status" => res_last_status}] = conn |> get("/api/v1/conversations") - |> json_response(200) + |> json_response_and_validate_schema(200) assert res_last_status["id"] == direct_reply.id end @@ -136,8 +136,8 @@ test "the user marks a conversation as read", %{user: user_one, conn: conn} do {:ok, direct} = CommonAPI.post(user_one, %{ - "status" => "Hi @#{user_two.nickname}", - "visibility" => "direct" + status: "Hi @#{user_two.nickname}", + visibility: "direct" }) assert User.get_cached_by_id(user_one.id).unread_conversation_count == 0 @@ -154,12 +154,12 @@ test "the user marks a conversation as read", %{user: user_one, conn: conn} do [%{"id" => direct_conversation_id, "unread" => true}] = user_two_conn |> get("/api/v1/conversations") - |> json_response(200) + |> json_response_and_validate_schema(200) %{"unread" => false} = user_two_conn |> post("/api/v1/conversations/#{direct_conversation_id}/read") - |> json_response(200) + |> json_response_and_validate_schema(200) assert User.get_cached_by_id(user_one.id).unread_conversation_count == 0 assert User.get_cached_by_id(user_two.id).unread_conversation_count == 0 @@ -167,15 +167,15 @@ test "the user marks a conversation as read", %{user: user_one, conn: conn} do # The conversation is marked as unread on reply {:ok, _} = CommonAPI.post(user_two, %{ - "status" => "reply", - "visibility" => "direct", - "in_reply_to_status_id" => direct.id + status: "reply", + visibility: "direct", + in_reply_to_status_id: direct.id }) [%{"unread" => true}] = conn |> get("/api/v1/conversations") - |> json_response(200) + |> json_response_and_validate_schema(200) assert User.get_cached_by_id(user_one.id).unread_conversation_count == 1 assert User.get_cached_by_id(user_two.id).unread_conversation_count == 0 @@ -183,9 +183,9 @@ test "the user marks a conversation as read", %{user: user_one, conn: conn} do # A reply doesn't increment the user's unread_conversation_count if the conversation is unread {:ok, _} = CommonAPI.post(user_two, %{ - "status" => "reply", - "visibility" => "direct", - "in_reply_to_status_id" => direct.id + status: "reply", + visibility: "direct", + in_reply_to_status_id: direct.id }) assert User.get_cached_by_id(user_one.id).unread_conversation_count == 1 @@ -197,8 +197,8 @@ test "(vanilla) Mastodon frontend behaviour", %{user: user_one, conn: conn} do {:ok, direct} = CommonAPI.post(user_one, %{ - "status" => "Hi @#{user_two.nickname}!", - "visibility" => "direct" + status: "Hi @#{user_two.nickname}!", + visibility: "direct" }) res_conn = get(conn, "/api/v1/statuses/#{direct.id}/context") diff --git a/test/web/mastodon_api/controllers/custom_emoji_controller_test.exs b/test/web/mastodon_api/controllers/custom_emoji_controller_test.exs index 6567a0667..ab0027f90 100644 --- a/test/web/mastodon_api/controllers/custom_emoji_controller_test.exs +++ b/test/web/mastodon_api/controllers/custom_emoji_controller_test.exs @@ -6,11 +6,12 @@ defmodule Pleroma.Web.MastodonAPI.CustomEmojiControllerTest do use Pleroma.Web.ConnCase, async: true test "with tags", %{conn: conn} do - [emoji | _body] = - conn - |> get("/api/v1/custom_emojis") - |> json_response(200) + assert resp = + conn + |> get("/api/v1/custom_emojis") + |> json_response_and_validate_schema(200) + assert [emoji | _body] = resp assert Map.has_key?(emoji, "shortcode") assert Map.has_key?(emoji, "static_url") assert Map.has_key?(emoji, "tags") diff --git a/test/web/mastodon_api/controllers/domain_block_controller_test.exs b/test/web/mastodon_api/controllers/domain_block_controller_test.exs index 8d24b3b88..01a24afcf 100644 --- a/test/web/mastodon_api/controllers/domain_block_controller_test.exs +++ b/test/web/mastodon_api/controllers/domain_block_controller_test.exs @@ -13,15 +13,21 @@ test "blocking / unblocking a domain" do %{user: user, conn: conn} = oauth_access(["write:blocks"]) other_user = insert(:user, %{ap_id: "https://dogwhistle.zone/@pundit"}) - ret_conn = post(conn, "/api/v1/domain_blocks", %{"domain" => "dogwhistle.zone"}) + ret_conn = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/domain_blocks", %{"domain" => "dogwhistle.zone"}) - assert %{} = json_response(ret_conn, 200) + assert %{} == json_response_and_validate_schema(ret_conn, 200) user = User.get_cached_by_ap_id(user.ap_id) assert User.blocks?(user, other_user) - ret_conn = delete(conn, "/api/v1/domain_blocks", %{"domain" => "dogwhistle.zone"}) + ret_conn = + conn + |> put_req_header("content-type", "application/json") + |> delete("/api/v1/domain_blocks", %{"domain" => "dogwhistle.zone"}) - assert %{} = json_response(ret_conn, 200) + assert %{} == json_response_and_validate_schema(ret_conn, 200) user = User.get_cached_by_ap_id(user.ap_id) refute User.blocks?(user, other_user) end @@ -32,14 +38,10 @@ test "getting a list of domain blocks" do {:ok, user} = User.block_domain(user, "bad.site") {:ok, user} = User.block_domain(user, "even.worse.site") - conn = - conn - |> assign(:user, user) - |> get("/api/v1/domain_blocks") - - domain_blocks = json_response(conn, 200) - - assert "bad.site" in domain_blocks - assert "even.worse.site" in domain_blocks + assert ["even.worse.site", "bad.site"] == + conn + |> assign(:user, user) + |> get("/api/v1/domain_blocks") + |> json_response_and_validate_schema(200) end end diff --git a/test/web/mastodon_api/controllers/filter_controller_test.exs b/test/web/mastodon_api/controllers/filter_controller_test.exs index 97ab005e0..f29547d13 100644 --- a/test/web/mastodon_api/controllers/filter_controller_test.exs +++ b/test/web/mastodon_api/controllers/filter_controller_test.exs @@ -15,9 +15,12 @@ test "creating a filter" do context: ["home"] } - conn = post(conn, "/api/v1/filters", %{"phrase" => filter.phrase, context: filter.context}) + conn = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/filters", %{"phrase" => filter.phrase, context: filter.context}) - assert response = json_response(conn, 200) + assert response = json_response_and_validate_schema(conn, 200) assert response["phrase"] == filter.phrase assert response["context"] == filter.context assert response["irreversible"] == false @@ -48,12 +51,12 @@ test "fetching a list of filters" do response = conn |> get("/api/v1/filters") - |> json_response(200) + |> json_response_and_validate_schema(200) assert response == render_json( FilterView, - "filters.json", + "index.json", filters: [filter_two, filter_one] ) end @@ -72,7 +75,7 @@ test "get a filter" do conn = get(conn, "/api/v1/filters/#{filter.filter_id}") - assert _response = json_response(conn, 200) + assert response = json_response_and_validate_schema(conn, 200) end test "update a filter" do @@ -82,7 +85,8 @@ test "update a filter" do user_id: user.id, filter_id: 2, phrase: "knight", - context: ["home"] + context: ["home"], + hide: true } {:ok, _filter} = Pleroma.Filter.create(query) @@ -93,14 +97,17 @@ test "update a filter" do } conn = - put(conn, "/api/v1/filters/#{query.filter_id}", %{ + conn + |> put_req_header("content-type", "application/json") + |> put("/api/v1/filters/#{query.filter_id}", %{ phrase: new.phrase, context: new.context }) - assert response = json_response(conn, 200) + assert response = json_response_and_validate_schema(conn, 200) assert response["phrase"] == new.phrase assert response["context"] == new.context + assert response["irreversible"] == true end test "delete a filter" do @@ -117,7 +124,6 @@ test "delete a filter" do conn = delete(conn, "/api/v1/filters/#{filter.filter_id}") - assert response = json_response(conn, 200) - assert response == %{} + assert json_response_and_validate_schema(conn, 200) == %{} end end diff --git a/test/web/mastodon_api/controllers/follow_request_controller_test.exs b/test/web/mastodon_api/controllers/follow_request_controller_test.exs index dd848821a..44e12d15a 100644 --- a/test/web/mastodon_api/controllers/follow_request_controller_test.exs +++ b/test/web/mastodon_api/controllers/follow_request_controller_test.exs @@ -21,13 +21,13 @@ test "/api/v1/follow_requests works", %{user: user, conn: conn} do other_user = insert(:user) {:ok, _activity} = ActivityPub.follow(other_user, user) - {:ok, other_user} = User.follow(other_user, user, "pending") + {:ok, other_user} = User.follow(other_user, user, :follow_pending) assert User.following?(other_user, user) == false conn = get(conn, "/api/v1/follow_requests") - assert [relationship] = json_response(conn, 200) + assert [relationship] = json_response_and_validate_schema(conn, 200) assert to_string(other_user.id) == relationship["id"] end @@ -35,7 +35,7 @@ test "/api/v1/follow_requests/:id/authorize works", %{user: user, conn: conn} do other_user = insert(:user) {:ok, _activity} = ActivityPub.follow(other_user, user) - {:ok, other_user} = User.follow(other_user, user, "pending") + {:ok, other_user} = User.follow(other_user, user, :follow_pending) user = User.get_cached_by_id(user.id) other_user = User.get_cached_by_id(other_user.id) @@ -44,7 +44,7 @@ test "/api/v1/follow_requests/:id/authorize works", %{user: user, conn: conn} do conn = post(conn, "/api/v1/follow_requests/#{other_user.id}/authorize") - assert relationship = json_response(conn, 200) + assert relationship = json_response_and_validate_schema(conn, 200) assert to_string(other_user.id) == relationship["id"] user = User.get_cached_by_id(user.id) @@ -62,7 +62,7 @@ test "/api/v1/follow_requests/:id/reject works", %{user: user, conn: conn} do conn = post(conn, "/api/v1/follow_requests/#{other_user.id}/reject") - assert relationship = json_response(conn, 200) + assert relationship = json_response_and_validate_schema(conn, 200) assert to_string(other_user.id) == relationship["id"] user = User.get_cached_by_id(user.id) diff --git a/test/web/mastodon_api/controllers/instance_controller_test.exs b/test/web/mastodon_api/controllers/instance_controller_test.exs index 2737dcaba..2c61dc5ba 100644 --- a/test/web/mastodon_api/controllers/instance_controller_test.exs +++ b/test/web/mastodon_api/controllers/instance_controller_test.exs @@ -10,7 +10,7 @@ defmodule Pleroma.Web.MastodonAPI.InstanceControllerTest do test "get instance information", %{conn: conn} do conn = get(conn, "/api/v1/instance") - assert result = json_response(conn, 200) + assert result = json_response_and_validate_schema(conn, 200) email = Pleroma.Config.get([:instance, :email]) # Note: not checking for "max_toot_chars" since it's optional @@ -34,6 +34,10 @@ test "get instance information", %{conn: conn} do "banner_upload_limit" => _ } = result + assert result["pleroma"]["metadata"]["features"] + assert result["pleroma"]["metadata"]["federation"] + assert result["pleroma"]["vapid_public_key"] + assert email == from_config_email end @@ -46,13 +50,13 @@ test "get instance stats", %{conn: conn} do insert(:user, %{local: false, nickname: "u@peer1.com"}) insert(:user, %{local: false, nickname: "u@peer2.com"}) - {:ok, _} = Pleroma.Web.CommonAPI.post(user, %{"status" => "cofe"}) + {:ok, _} = Pleroma.Web.CommonAPI.post(user, %{status: "cofe"}) Pleroma.Stats.force_update() conn = get(conn, "/api/v1/instance") - assert result = json_response(conn, 200) + assert result = json_response_and_validate_schema(conn, 200) stats = result["stats"] @@ -70,7 +74,7 @@ test "get peers", %{conn: conn} do conn = get(conn, "/api/v1/instance/peers") - assert result = json_response(conn, 200) + assert result = json_response_and_validate_schema(conn, 200) assert ["peer1.com", "peer2.com"] == Enum.sort(result) end diff --git a/test/web/mastodon_api/controllers/list_controller_test.exs b/test/web/mastodon_api/controllers/list_controller_test.exs index c9c4cbb49..57a9ef4a4 100644 --- a/test/web/mastodon_api/controllers/list_controller_test.exs +++ b/test/web/mastodon_api/controllers/list_controller_test.exs @@ -12,37 +12,44 @@ defmodule Pleroma.Web.MastodonAPI.ListControllerTest do test "creating a list" do %{conn: conn} = oauth_access(["write:lists"]) - conn = post(conn, "/api/v1/lists", %{"title" => "cuties"}) - - assert %{"title" => title} = json_response(conn, 200) - assert title == "cuties" + assert %{"title" => "cuties"} = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/lists", %{"title" => "cuties"}) + |> json_response_and_validate_schema(:ok) end test "renders error for invalid params" do %{conn: conn} = oauth_access(["write:lists"]) - conn = post(conn, "/api/v1/lists", %{"title" => nil}) + conn = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/lists", %{"title" => nil}) - assert %{"error" => "can't be blank"} == json_response(conn, :unprocessable_entity) + assert %{"error" => "title - null value where string expected."} = + json_response_and_validate_schema(conn, 400) end test "listing a user's lists" do %{conn: conn} = oauth_access(["read:lists", "write:lists"]) conn + |> put_req_header("content-type", "application/json") |> post("/api/v1/lists", %{"title" => "cuties"}) - |> json_response(:ok) + |> json_response_and_validate_schema(:ok) conn + |> put_req_header("content-type", "application/json") |> post("/api/v1/lists", %{"title" => "cofe"}) - |> json_response(:ok) + |> json_response_and_validate_schema(:ok) conn = get(conn, "/api/v1/lists") assert [ %{"id" => _, "title" => "cofe"}, %{"id" => _, "title" => "cuties"} - ] = json_response(conn, :ok) + ] = json_response_and_validate_schema(conn, :ok) end test "adding users to a list" do @@ -50,9 +57,12 @@ test "adding users to a list" do other_user = insert(:user) {:ok, list} = Pleroma.List.create("name", user) - conn = post(conn, "/api/v1/lists/#{list.id}/accounts", %{"account_ids" => [other_user.id]}) + assert %{} == + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/lists/#{list.id}/accounts", %{"account_ids" => [other_user.id]}) + |> json_response_and_validate_schema(:ok) - assert %{} == json_response(conn, 200) %Pleroma.List{following: following} = Pleroma.List.get(list.id, user) assert following == [other_user.follower_address] end @@ -65,9 +75,12 @@ test "removing users from a list" do {:ok, list} = Pleroma.List.follow(list, other_user) {:ok, list} = Pleroma.List.follow(list, third_user) - conn = delete(conn, "/api/v1/lists/#{list.id}/accounts", %{"account_ids" => [other_user.id]}) + assert %{} == + conn + |> put_req_header("content-type", "application/json") + |> delete("/api/v1/lists/#{list.id}/accounts", %{"account_ids" => [other_user.id]}) + |> json_response_and_validate_schema(:ok) - assert %{} == json_response(conn, 200) %Pleroma.List{following: following} = Pleroma.List.get(list.id, user) assert following == [third_user.follower_address] end @@ -83,7 +96,7 @@ test "listing users in a list" do |> assign(:user, user) |> get("/api/v1/lists/#{list.id}/accounts", %{"account_ids" => [other_user.id]}) - assert [%{"id" => id}] = json_response(conn, 200) + assert [%{"id" => id}] = json_response_and_validate_schema(conn, 200) assert id == to_string(other_user.id) end @@ -96,7 +109,7 @@ test "retrieving a list" do |> assign(:user, user) |> get("/api/v1/lists/#{list.id}") - assert %{"id" => id} = json_response(conn, 200) + assert %{"id" => id} = json_response_and_validate_schema(conn, 200) assert id == to_string(list.id) end @@ -105,17 +118,18 @@ test "renders 404 if list is not found" do conn = get(conn, "/api/v1/lists/666") - assert %{"error" => "List not found"} = json_response(conn, :not_found) + assert %{"error" => "List not found"} = json_response_and_validate_schema(conn, :not_found) end test "renaming a list" do %{user: user, conn: conn} = oauth_access(["write:lists"]) {:ok, list} = Pleroma.List.create("name", user) - conn = put(conn, "/api/v1/lists/#{list.id}", %{"title" => "newname"}) - - assert %{"title" => name} = json_response(conn, 200) - assert name == "newname" + assert %{"title" => "newname"} = + conn + |> put_req_header("content-type", "application/json") + |> put("/api/v1/lists/#{list.id}", %{"title" => "newname"}) + |> json_response_and_validate_schema(:ok) end test "validates title when renaming a list" do @@ -125,9 +139,11 @@ test "validates title when renaming a list" do conn = conn |> assign(:user, user) + |> put_req_header("content-type", "application/json") |> put("/api/v1/lists/#{list.id}", %{"title" => " "}) - assert %{"error" => "can't be blank"} == json_response(conn, :unprocessable_entity) + assert %{"error" => "can't be blank"} == + json_response_and_validate_schema(conn, :unprocessable_entity) end test "deleting a list" do @@ -136,7 +152,7 @@ test "deleting a list" do conn = delete(conn, "/api/v1/lists/#{list.id}") - assert %{} = json_response(conn, 200) + assert %{} = json_response_and_validate_schema(conn, 200) assert is_nil(Repo.get(Pleroma.List, list.id)) end end diff --git a/test/web/mastodon_api/controllers/marker_controller_test.exs b/test/web/mastodon_api/controllers/marker_controller_test.exs index 919f295bd..6dd40fb4a 100644 --- a/test/web/mastodon_api/controllers/marker_controller_test.exs +++ b/test/web/mastodon_api/controllers/marker_controller_test.exs @@ -11,6 +11,7 @@ defmodule Pleroma.Web.MastodonAPI.MarkerControllerTest do test "gets markers with correct scopes", %{conn: conn} do user = insert(:user) token = insert(:oauth_token, user: user, scopes: ["read:statuses"]) + insert_list(7, :notification, user: user) {:ok, %{"notifications" => marker}} = Pleroma.Marker.upsert( @@ -22,14 +23,15 @@ test "gets markers with correct scopes", %{conn: conn} do conn |> assign(:user, user) |> assign(:token, token) - |> get("/api/v1/markers", %{timeline: ["notifications"]}) - |> json_response(200) + |> get("/api/v1/markers?timeline[]=notifications") + |> json_response_and_validate_schema(200) assert response == %{ "notifications" => %{ "last_read_id" => "69420", "updated_at" => NaiveDateTime.to_iso8601(marker.updated_at), - "version" => 0 + "version" => 0, + "pleroma" => %{"unread_count" => 7} } } end @@ -45,7 +47,7 @@ test "gets markers with missed scopes", %{conn: conn} do |> assign(:user, user) |> assign(:token, token) |> get("/api/v1/markers", %{timeline: ["notifications"]}) - |> json_response(403) + |> json_response_and_validate_schema(403) assert response == %{"error" => "Insufficient permissions: read:statuses."} end @@ -60,17 +62,19 @@ test "creates a marker with correct scopes", %{conn: conn} do conn |> assign(:user, user) |> assign(:token, token) + |> put_req_header("content-type", "application/json") |> post("/api/v1/markers", %{ home: %{last_read_id: "777"}, notifications: %{"last_read_id" => "69420"} }) - |> json_response(200) + |> json_response_and_validate_schema(200) assert %{ "notifications" => %{ "last_read_id" => "69420", "updated_at" => _, - "version" => 0 + "version" => 0, + "pleroma" => %{"unread_count" => 0} } } = response end @@ -89,17 +93,19 @@ test "updates exist marker", %{conn: conn} do conn |> assign(:user, user) |> assign(:token, token) + |> put_req_header("content-type", "application/json") |> post("/api/v1/markers", %{ home: %{last_read_id: "777"}, notifications: %{"last_read_id" => "69888"} }) - |> json_response(200) + |> json_response_and_validate_schema(200) assert response == %{ "notifications" => %{ "last_read_id" => "69888", "updated_at" => NaiveDateTime.to_iso8601(marker.updated_at), - "version" => 0 + "version" => 0, + "pleroma" => %{"unread_count" => 0} } } end @@ -112,11 +118,12 @@ test "creates a marker with missed scopes", %{conn: conn} do conn |> assign(:user, user) |> assign(:token, token) + |> put_req_header("content-type", "application/json") |> post("/api/v1/markers", %{ home: %{last_read_id: "777"}, notifications: %{"last_read_id" => "69420"} }) - |> json_response(403) + |> json_response_and_validate_schema(403) assert response == %{"error" => "Insufficient permissions: write:statuses."} end diff --git a/test/web/mastodon_api/controllers/notification_controller_test.exs b/test/web/mastodon_api/controllers/notification_controller_test.exs index 7a0011646..d9356a844 100644 --- a/test/web/mastodon_api/controllers/notification_controller_test.exs +++ b/test/web/mastodon_api/controllers/notification_controller_test.exs @@ -12,11 +12,31 @@ defmodule Pleroma.Web.MastodonAPI.NotificationControllerTest do import Pleroma.Factory + test "does NOT render account/pleroma/relationship if this is disabled by default" do + clear_config([:extensions, :output_relationships_in_statuses_by_default], false) + + %{user: user, conn: conn} = oauth_access(["read:notifications"]) + other_user = insert(:user) + + {:ok, activity} = CommonAPI.post(other_user, %{status: "hi @#{user.nickname}"}) + {:ok, [_notification]} = Notification.create_notifications(activity) + + response = + conn + |> assign(:user, user) + |> get("/api/v1/notifications") + |> json_response_and_validate_schema(200) + + assert Enum.all?(response, fn n -> + get_in(n, ["account", "pleroma", "relationship"]) == %{} + end) + end + test "list of notifications" do %{user: user, conn: conn} = oauth_access(["read:notifications"]) other_user = insert(:user) - {:ok, activity} = CommonAPI.post(other_user, %{"status" => "hi @#{user.nickname}"}) + {:ok, activity} = CommonAPI.post(other_user, %{status: "hi @#{user.nickname}"}) {:ok, [_notification]} = Notification.create_notifications(activity) @@ -26,11 +46,13 @@ test "list of notifications" do |> get("/api/v1/notifications") expected_response = - "hi @#{user.nickname}" - assert [%{"status" => %{"content" => response}} | _rest] = json_response(conn, 200) + assert [%{"status" => %{"content" => response}} | _rest] = + json_response_and_validate_schema(conn, 200) + assert response == expected_response end @@ -38,52 +60,69 @@ test "getting a single notification" do %{user: user, conn: conn} = oauth_access(["read:notifications"]) other_user = insert(:user) - {:ok, activity} = CommonAPI.post(other_user, %{"status" => "hi @#{user.nickname}"}) + {:ok, activity} = CommonAPI.post(other_user, %{status: "hi @#{user.nickname}"}) {:ok, [notification]} = Notification.create_notifications(activity) conn = get(conn, "/api/v1/notifications/#{notification.id}") expected_response = - "hi @#{user.nickname}" - assert %{"status" => %{"content" => response}} = json_response(conn, 200) + assert %{"status" => %{"content" => response}} = json_response_and_validate_schema(conn, 200) assert response == expected_response end - test "dismissing a single notification" do + test "dismissing a single notification (deprecated endpoint)" do %{user: user, conn: conn} = oauth_access(["write:notifications"]) other_user = insert(:user) - {:ok, activity} = CommonAPI.post(other_user, %{"status" => "hi @#{user.nickname}"}) + {:ok, activity} = CommonAPI.post(other_user, %{status: "hi @#{user.nickname}"}) {:ok, [notification]} = Notification.create_notifications(activity) conn = conn |> assign(:user, user) - |> post("/api/v1/notifications/dismiss", %{"id" => notification.id}) + |> put_req_header("content-type", "application/json") + |> post("/api/v1/notifications/dismiss", %{"id" => to_string(notification.id)}) - assert %{} = json_response(conn, 200) + assert %{} = json_response_and_validate_schema(conn, 200) + end + + test "dismissing a single notification" do + %{user: user, conn: conn} = oauth_access(["write:notifications"]) + other_user = insert(:user) + + {:ok, activity} = CommonAPI.post(other_user, %{status: "hi @#{user.nickname}"}) + + {:ok, [notification]} = Notification.create_notifications(activity) + + conn = + conn + |> assign(:user, user) + |> post("/api/v1/notifications/#{notification.id}/dismiss") + + assert %{} = json_response_and_validate_schema(conn, 200) end test "clearing all notifications" do %{user: user, conn: conn} = oauth_access(["write:notifications", "read:notifications"]) other_user = insert(:user) - {:ok, activity} = CommonAPI.post(other_user, %{"status" => "hi @#{user.nickname}"}) + {:ok, activity} = CommonAPI.post(other_user, %{status: "hi @#{user.nickname}"}) {:ok, [_notification]} = Notification.create_notifications(activity) ret_conn = post(conn, "/api/v1/notifications/clear") - assert %{} = json_response(ret_conn, 200) + assert %{} = json_response_and_validate_schema(ret_conn, 200) ret_conn = get(conn, "/api/v1/notifications") - assert all = json_response(ret_conn, 200) + assert all = json_response_and_validate_schema(ret_conn, 200) assert all == [] end @@ -91,10 +130,10 @@ test "paginates notifications using min_id, since_id, max_id, and limit" do %{user: user, conn: conn} = oauth_access(["read:notifications"]) other_user = insert(:user) - {:ok, activity1} = CommonAPI.post(other_user, %{"status" => "hi @#{user.nickname}"}) - {:ok, activity2} = CommonAPI.post(other_user, %{"status" => "hi @#{user.nickname}"}) - {:ok, activity3} = CommonAPI.post(other_user, %{"status" => "hi @#{user.nickname}"}) - {:ok, activity4} = CommonAPI.post(other_user, %{"status" => "hi @#{user.nickname}"}) + {:ok, activity1} = CommonAPI.post(other_user, %{status: "hi @#{user.nickname}"}) + {:ok, activity2} = CommonAPI.post(other_user, %{status: "hi @#{user.nickname}"}) + {:ok, activity3} = CommonAPI.post(other_user, %{status: "hi @#{user.nickname}"}) + {:ok, activity4} = CommonAPI.post(other_user, %{status: "hi @#{user.nickname}"}) notification1_id = get_notification_id_by_activity(activity1) notification2_id = get_notification_id_by_activity(activity2) @@ -107,7 +146,7 @@ test "paginates notifications using min_id, since_id, max_id, and limit" do result = conn |> get("/api/v1/notifications?limit=2&min_id=#{notification1_id}") - |> json_response(:ok) + |> json_response_and_validate_schema(:ok) assert [%{"id" => ^notification3_id}, %{"id" => ^notification2_id}] = result @@ -115,7 +154,7 @@ test "paginates notifications using min_id, since_id, max_id, and limit" do result = conn |> get("/api/v1/notifications?limit=2&since_id=#{notification1_id}") - |> json_response(:ok) + |> json_response_and_validate_schema(:ok) assert [%{"id" => ^notification4_id}, %{"id" => ^notification3_id}] = result @@ -123,7 +162,7 @@ test "paginates notifications using min_id, since_id, max_id, and limit" do result = conn |> get("/api/v1/notifications?limit=2&max_id=#{notification4_id}") - |> json_response(:ok) + |> json_response_and_validate_schema(:ok) assert [%{"id" => ^notification3_id}, %{"id" => ^notification2_id}] = result end @@ -134,47 +173,39 @@ test "filters notifications for mentions" do other_user = insert(:user) {:ok, public_activity} = - CommonAPI.post(other_user, %{"status" => "@#{user.nickname}", "visibility" => "public"}) + CommonAPI.post(other_user, %{status: "@#{user.nickname}", visibility: "public"}) {:ok, direct_activity} = - CommonAPI.post(other_user, %{"status" => "@#{user.nickname}", "visibility" => "direct"}) + CommonAPI.post(other_user, %{status: "@#{user.nickname}", visibility: "direct"}) {:ok, unlisted_activity} = - CommonAPI.post(other_user, %{"status" => "@#{user.nickname}", "visibility" => "unlisted"}) + CommonAPI.post(other_user, %{status: "@#{user.nickname}", visibility: "unlisted"}) {:ok, private_activity} = - CommonAPI.post(other_user, %{"status" => "@#{user.nickname}", "visibility" => "private"}) + CommonAPI.post(other_user, %{status: "@#{user.nickname}", visibility: "private"}) - conn_res = - get(conn, "/api/v1/notifications", %{ - exclude_visibilities: ["public", "unlisted", "private"] - }) + query = params_to_query(%{exclude_visibilities: ["public", "unlisted", "private"]}) + conn_res = get(conn, "/api/v1/notifications?" <> query) - assert [%{"status" => %{"id" => id}}] = json_response(conn_res, 200) + assert [%{"status" => %{"id" => id}}] = json_response_and_validate_schema(conn_res, 200) assert id == direct_activity.id - conn_res = - get(conn, "/api/v1/notifications", %{ - exclude_visibilities: ["public", "unlisted", "direct"] - }) + query = params_to_query(%{exclude_visibilities: ["public", "unlisted", "direct"]}) + conn_res = get(conn, "/api/v1/notifications?" <> query) - assert [%{"status" => %{"id" => id}}] = json_response(conn_res, 200) + assert [%{"status" => %{"id" => id}}] = json_response_and_validate_schema(conn_res, 200) assert id == private_activity.id - conn_res = - get(conn, "/api/v1/notifications", %{ - exclude_visibilities: ["public", "private", "direct"] - }) + query = params_to_query(%{exclude_visibilities: ["public", "private", "direct"]}) + conn_res = get(conn, "/api/v1/notifications?" <> query) - assert [%{"status" => %{"id" => id}}] = json_response(conn_res, 200) + assert [%{"status" => %{"id" => id}}] = json_response_and_validate_schema(conn_res, 200) assert id == unlisted_activity.id - conn_res = - get(conn, "/api/v1/notifications", %{ - exclude_visibilities: ["unlisted", "private", "direct"] - }) + query = params_to_query(%{exclude_visibilities: ["unlisted", "private", "direct"]}) + conn_res = get(conn, "/api/v1/notifications?" <> query) - assert [%{"status" => %{"id" => id}}] = json_response(conn_res, 200) + assert [%{"status" => %{"id" => id}}] = json_response_and_validate_schema(conn_res, 200) assert id == public_activity.id end @@ -182,27 +213,25 @@ test "filters notifications for Like activities" do user = insert(:user) %{user: other_user, conn: conn} = oauth_access(["read:notifications"]) - {:ok, public_activity} = - CommonAPI.post(other_user, %{"status" => ".", "visibility" => "public"}) + {:ok, public_activity} = CommonAPI.post(other_user, %{status: ".", visibility: "public"}) {:ok, direct_activity} = - CommonAPI.post(other_user, %{"status" => "@#{user.nickname}", "visibility" => "direct"}) + CommonAPI.post(other_user, %{status: "@#{user.nickname}", visibility: "direct"}) {:ok, unlisted_activity} = - CommonAPI.post(other_user, %{"status" => ".", "visibility" => "unlisted"}) + CommonAPI.post(other_user, %{status: ".", visibility: "unlisted"}) - {:ok, private_activity} = - CommonAPI.post(other_user, %{"status" => ".", "visibility" => "private"}) + {:ok, private_activity} = CommonAPI.post(other_user, %{status: ".", visibility: "private"}) - {:ok, _, _} = CommonAPI.favorite(public_activity.id, user) - {:ok, _, _} = CommonAPI.favorite(direct_activity.id, user) - {:ok, _, _} = CommonAPI.favorite(unlisted_activity.id, user) - {:ok, _, _} = CommonAPI.favorite(private_activity.id, user) + {:ok, _} = CommonAPI.favorite(user, public_activity.id) + {:ok, _} = CommonAPI.favorite(user, direct_activity.id) + {:ok, _} = CommonAPI.favorite(user, unlisted_activity.id) + {:ok, _} = CommonAPI.favorite(user, private_activity.id) activity_ids = conn - |> get("/api/v1/notifications", %{exclude_visibilities: ["direct"]}) - |> json_response(200) + |> get("/api/v1/notifications?exclude_visibilities[]=direct") + |> json_response_and_validate_schema(200) |> Enum.map(& &1["status"]["id"]) assert public_activity.id in activity_ids @@ -212,8 +241,8 @@ test "filters notifications for Like activities" do activity_ids = conn - |> get("/api/v1/notifications", %{exclude_visibilities: ["unlisted"]}) - |> json_response(200) + |> get("/api/v1/notifications?exclude_visibilities[]=unlisted") + |> json_response_and_validate_schema(200) |> Enum.map(& &1["status"]["id"]) assert public_activity.id in activity_ids @@ -223,8 +252,8 @@ test "filters notifications for Like activities" do activity_ids = conn - |> get("/api/v1/notifications", %{exclude_visibilities: ["private"]}) - |> json_response(200) + |> get("/api/v1/notifications?exclude_visibilities[]=private") + |> json_response_and_validate_schema(200) |> Enum.map(& &1["status"]["id"]) assert public_activity.id in activity_ids @@ -234,8 +263,8 @@ test "filters notifications for Like activities" do activity_ids = conn - |> get("/api/v1/notifications", %{exclude_visibilities: ["public"]}) - |> json_response(200) + |> get("/api/v1/notifications?exclude_visibilities[]=public") + |> json_response_and_validate_schema(200) |> Enum.map(& &1["status"]["id"]) refute public_activity.id in activity_ids @@ -248,19 +277,18 @@ test "filters notifications for Announce activities" do user = insert(:user) %{user: other_user, conn: conn} = oauth_access(["read:notifications"]) - {:ok, public_activity} = - CommonAPI.post(other_user, %{"status" => ".", "visibility" => "public"}) + {:ok, public_activity} = CommonAPI.post(other_user, %{status: ".", visibility: "public"}) {:ok, unlisted_activity} = - CommonAPI.post(other_user, %{"status" => ".", "visibility" => "unlisted"}) + CommonAPI.post(other_user, %{status: ".", visibility: "unlisted"}) {:ok, _, _} = CommonAPI.repeat(public_activity.id, user) {:ok, _, _} = CommonAPI.repeat(unlisted_activity.id, user) activity_ids = conn - |> get("/api/v1/notifications", %{exclude_visibilities: ["unlisted"]}) - |> json_response(200) + |> get("/api/v1/notifications?exclude_visibilities[]=unlisted") + |> json_response_and_validate_schema(200) |> Enum.map(& &1["status"]["id"]) assert public_activity.id in activity_ids @@ -272,9 +300,9 @@ test "filters notifications using exclude_types" do %{user: user, conn: conn} = oauth_access(["read:notifications"]) other_user = insert(:user) - {:ok, mention_activity} = CommonAPI.post(other_user, %{"status" => "hey @#{user.nickname}"}) - {:ok, create_activity} = CommonAPI.post(user, %{"status" => "hey"}) - {:ok, favorite_activity, _} = CommonAPI.favorite(create_activity.id, other_user) + {:ok, mention_activity} = CommonAPI.post(other_user, %{status: "hey @#{user.nickname}"}) + {:ok, create_activity} = CommonAPI.post(user, %{status: "hey"}) + {:ok, favorite_activity} = CommonAPI.favorite(other_user, create_activity.id) {:ok, reblog_activity, _} = CommonAPI.repeat(create_activity.id, other_user) {:ok, _, _, follow_activity} = CommonAPI.follow(other_user, user) @@ -283,34 +311,36 @@ test "filters notifications using exclude_types" do reblog_notification_id = get_notification_id_by_activity(reblog_activity) follow_notification_id = get_notification_id_by_activity(follow_activity) - conn_res = - get(conn, "/api/v1/notifications", %{exclude_types: ["mention", "favourite", "reblog"]}) + query = params_to_query(%{exclude_types: ["mention", "favourite", "reblog"]}) + conn_res = get(conn, "/api/v1/notifications?" <> query) - assert [%{"id" => ^follow_notification_id}] = json_response(conn_res, 200) + assert [%{"id" => ^follow_notification_id}] = json_response_and_validate_schema(conn_res, 200) - conn_res = - get(conn, "/api/v1/notifications", %{exclude_types: ["favourite", "reblog", "follow"]}) + query = params_to_query(%{exclude_types: ["favourite", "reblog", "follow"]}) + conn_res = get(conn, "/api/v1/notifications?" <> query) - assert [%{"id" => ^mention_notification_id}] = json_response(conn_res, 200) + assert [%{"id" => ^mention_notification_id}] = + json_response_and_validate_schema(conn_res, 200) - conn_res = - get(conn, "/api/v1/notifications", %{exclude_types: ["reblog", "follow", "mention"]}) + query = params_to_query(%{exclude_types: ["reblog", "follow", "mention"]}) + conn_res = get(conn, "/api/v1/notifications?" <> query) - assert [%{"id" => ^favorite_notification_id}] = json_response(conn_res, 200) + assert [%{"id" => ^favorite_notification_id}] = + json_response_and_validate_schema(conn_res, 200) - conn_res = - get(conn, "/api/v1/notifications", %{exclude_types: ["follow", "mention", "favourite"]}) + query = params_to_query(%{exclude_types: ["follow", "mention", "favourite"]}) + conn_res = get(conn, "/api/v1/notifications?" <> query) - assert [%{"id" => ^reblog_notification_id}] = json_response(conn_res, 200) + assert [%{"id" => ^reblog_notification_id}] = json_response_and_validate_schema(conn_res, 200) end test "filters notifications using include_types" do %{user: user, conn: conn} = oauth_access(["read:notifications"]) other_user = insert(:user) - {:ok, mention_activity} = CommonAPI.post(other_user, %{"status" => "hey @#{user.nickname}"}) - {:ok, create_activity} = CommonAPI.post(user, %{"status" => "hey"}) - {:ok, favorite_activity, _} = CommonAPI.favorite(create_activity.id, other_user) + {:ok, mention_activity} = CommonAPI.post(other_user, %{status: "hey @#{user.nickname}"}) + {:ok, create_activity} = CommonAPI.post(user, %{status: "hey"}) + {:ok, favorite_activity} = CommonAPI.favorite(other_user, create_activity.id) {:ok, reblog_activity, _} = CommonAPI.repeat(create_activity.id, other_user) {:ok, _, _, follow_activity} = CommonAPI.follow(other_user, user) @@ -319,32 +349,34 @@ test "filters notifications using include_types" do reblog_notification_id = get_notification_id_by_activity(reblog_activity) follow_notification_id = get_notification_id_by_activity(follow_activity) - conn_res = get(conn, "/api/v1/notifications", %{include_types: ["follow"]}) + conn_res = get(conn, "/api/v1/notifications?include_types[]=follow") - assert [%{"id" => ^follow_notification_id}] = json_response(conn_res, 200) + assert [%{"id" => ^follow_notification_id}] = json_response_and_validate_schema(conn_res, 200) - conn_res = get(conn, "/api/v1/notifications", %{include_types: ["mention"]}) + conn_res = get(conn, "/api/v1/notifications?include_types[]=mention") - assert [%{"id" => ^mention_notification_id}] = json_response(conn_res, 200) + assert [%{"id" => ^mention_notification_id}] = + json_response_and_validate_schema(conn_res, 200) - conn_res = get(conn, "/api/v1/notifications", %{include_types: ["favourite"]}) + conn_res = get(conn, "/api/v1/notifications?include_types[]=favourite") - assert [%{"id" => ^favorite_notification_id}] = json_response(conn_res, 200) + assert [%{"id" => ^favorite_notification_id}] = + json_response_and_validate_schema(conn_res, 200) - conn_res = get(conn, "/api/v1/notifications", %{include_types: ["reblog"]}) + conn_res = get(conn, "/api/v1/notifications?include_types[]=reblog") - assert [%{"id" => ^reblog_notification_id}] = json_response(conn_res, 200) + assert [%{"id" => ^reblog_notification_id}] = json_response_and_validate_schema(conn_res, 200) - result = conn |> get("/api/v1/notifications") |> json_response(200) + result = conn |> get("/api/v1/notifications") |> json_response_and_validate_schema(200) assert length(result) == 4 + query = params_to_query(%{include_types: ["follow", "mention", "favourite", "reblog"]}) + result = conn - |> get("/api/v1/notifications", %{ - include_types: ["follow", "mention", "favourite", "reblog"] - }) - |> json_response(200) + |> get("/api/v1/notifications?" <> query) + |> json_response_and_validate_schema(200) assert length(result) == 4 end @@ -353,10 +385,10 @@ test "destroy multiple" do %{user: user, conn: conn} = oauth_access(["read:notifications", "write:notifications"]) other_user = insert(:user) - {:ok, activity1} = CommonAPI.post(other_user, %{"status" => "hi @#{user.nickname}"}) - {:ok, activity2} = CommonAPI.post(other_user, %{"status" => "hi @#{user.nickname}"}) - {:ok, activity3} = CommonAPI.post(user, %{"status" => "hi @#{other_user.nickname}"}) - {:ok, activity4} = CommonAPI.post(user, %{"status" => "hi @#{other_user.nickname}"}) + {:ok, activity1} = CommonAPI.post(other_user, %{status: "hi @#{user.nickname}"}) + {:ok, activity2} = CommonAPI.post(other_user, %{status: "hi @#{user.nickname}"}) + {:ok, activity3} = CommonAPI.post(user, %{status: "hi @#{other_user.nickname}"}) + {:ok, activity4} = CommonAPI.post(user, %{status: "hi @#{other_user.nickname}"}) notification1_id = get_notification_id_by_activity(activity1) notification2_id = get_notification_id_by_activity(activity2) @@ -366,7 +398,7 @@ test "destroy multiple" do result = conn |> get("/api/v1/notifications") - |> json_response(:ok) + |> json_response_and_validate_schema(:ok) assert [%{"id" => ^notification2_id}, %{"id" => ^notification1_id}] = result @@ -378,22 +410,19 @@ test "destroy multiple" do result = conn2 |> get("/api/v1/notifications") - |> json_response(:ok) + |> json_response_and_validate_schema(:ok) assert [%{"id" => ^notification4_id}, %{"id" => ^notification3_id}] = result - conn_destroy = - conn - |> delete("/api/v1/notifications/destroy_multiple", %{ - "ids" => [notification1_id, notification2_id] - }) + query = params_to_query(%{ids: [notification1_id, notification2_id]}) + conn_destroy = delete(conn, "/api/v1/notifications/destroy_multiple?" <> query) - assert json_response(conn_destroy, 200) == %{} + assert json_response_and_validate_schema(conn_destroy, 200) == %{} result = conn2 |> get("/api/v1/notifications") - |> json_response(:ok) + |> json_response_and_validate_schema(:ok) assert [%{"id" => ^notification4_id}, %{"id" => ^notification3_id}] = result end @@ -403,17 +432,17 @@ test "doesn't see notifications after muting user with notifications" do user2 = insert(:user) {:ok, _, _, _} = CommonAPI.follow(user, user2) - {:ok, _} = CommonAPI.post(user2, %{"status" => "hey @#{user.nickname}"}) + {:ok, _} = CommonAPI.post(user2, %{status: "hey @#{user.nickname}"}) ret_conn = get(conn, "/api/v1/notifications") - assert length(json_response(ret_conn, 200)) == 1 + assert length(json_response_and_validate_schema(ret_conn, 200)) == 1 {:ok, _user_relationships} = User.mute(user, user2) conn = get(conn, "/api/v1/notifications") - assert json_response(conn, 200) == [] + assert json_response_and_validate_schema(conn, 200) == [] end test "see notifications after muting user without notifications" do @@ -421,17 +450,17 @@ test "see notifications after muting user without notifications" do user2 = insert(:user) {:ok, _, _, _} = CommonAPI.follow(user, user2) - {:ok, _} = CommonAPI.post(user2, %{"status" => "hey @#{user.nickname}"}) + {:ok, _} = CommonAPI.post(user2, %{status: "hey @#{user.nickname}"}) ret_conn = get(conn, "/api/v1/notifications") - assert length(json_response(ret_conn, 200)) == 1 + assert length(json_response_and_validate_schema(ret_conn, 200)) == 1 {:ok, _user_relationships} = User.mute(user, user2, false) conn = get(conn, "/api/v1/notifications") - assert length(json_response(conn, 200)) == 1 + assert length(json_response_and_validate_schema(conn, 200)) == 1 end test "see notifications after muting user with notifications and with_muted parameter" do @@ -439,31 +468,44 @@ test "see notifications after muting user with notifications and with_muted para user2 = insert(:user) {:ok, _, _, _} = CommonAPI.follow(user, user2) - {:ok, _} = CommonAPI.post(user2, %{"status" => "hey @#{user.nickname}"}) + {:ok, _} = CommonAPI.post(user2, %{status: "hey @#{user.nickname}"}) ret_conn = get(conn, "/api/v1/notifications") - assert length(json_response(ret_conn, 200)) == 1 + assert length(json_response_and_validate_schema(ret_conn, 200)) == 1 {:ok, _user_relationships} = User.mute(user, user2) - conn = get(conn, "/api/v1/notifications", %{"with_muted" => "true"}) + conn = get(conn, "/api/v1/notifications?with_muted=true") - assert length(json_response(conn, 200)) == 1 + assert length(json_response_and_validate_schema(conn, 200)) == 1 end + @tag capture_log: true test "see move notifications" do old_user = insert(:user) new_user = insert(:user, also_known_as: [old_user.ap_id]) %{user: follower, conn: conn} = oauth_access(["read:notifications"]) + old_user_url = old_user.ap_id + + body = + File.read!("test/fixtures/users_mock/localhost.json") + |> String.replace("{{nickname}}", old_user.nickname) + |> Jason.encode!() + + Tesla.Mock.mock(fn + %{method: :get, url: ^old_user_url} -> + %Tesla.Env{status: 200, body: body} + end) + User.follow(follower, old_user) Pleroma.Web.ActivityPub.ActivityPub.move(old_user, new_user) Pleroma.Tests.ObanHelpers.perform_all() conn = get(conn, "/api/v1/notifications") - assert length(json_response(conn, 200)) == 1 + assert length(json_response_and_validate_schema(conn, 200)) == 1 end describe "link headers" do @@ -473,14 +515,14 @@ test "preserves parameters in link headers" do {:ok, activity1} = CommonAPI.post(other_user, %{ - "status" => "hi @#{user.nickname}", - "visibility" => "public" + status: "hi @#{user.nickname}", + visibility: "public" }) {:ok, activity2} = CommonAPI.post(other_user, %{ - "status" => "hi @#{user.nickname}", - "visibility" => "public" + status: "hi @#{user.nickname}", + visibility: "public" }) notification1 = Repo.get_by(Notification, activity_id: activity1.id) @@ -489,10 +531,10 @@ test "preserves parameters in link headers" do conn = conn |> assign(:user, user) - |> get("/api/v1/notifications", %{media_only: true}) + |> get("/api/v1/notifications?limit=5") assert [link_header] = get_resp_header(conn, "link") - assert link_header =~ ~r/media_only=true/ + assert link_header =~ ~r/limit=5/ assert link_header =~ ~r/min_id=#{notification2.id}/ assert link_header =~ ~r/max_id=#{notification1.id}/ end @@ -505,20 +547,20 @@ test "account_id" do %{id: account_id} = other_user1 = insert(:user) other_user2 = insert(:user) - {:ok, _activity} = CommonAPI.post(other_user1, %{"status" => "hi @#{user.nickname}"}) - {:ok, _activity} = CommonAPI.post(other_user2, %{"status" => "bye @#{user.nickname}"}) + {:ok, _activity} = CommonAPI.post(other_user1, %{status: "hi @#{user.nickname}"}) + {:ok, _activity} = CommonAPI.post(other_user2, %{status: "bye @#{user.nickname}"}) assert [%{"account" => %{"id" => ^account_id}}] = conn |> assign(:user, user) - |> get("/api/v1/notifications", %{account_id: account_id}) - |> json_response(200) + |> get("/api/v1/notifications?account_id=#{account_id}") + |> json_response_and_validate_schema(200) assert %{"error" => "Account is not found"} = conn |> assign(:user, user) - |> get("/api/v1/notifications", %{account_id: "cofe"}) - |> json_response(404) + |> get("/api/v1/notifications?account_id=cofe") + |> json_response_and_validate_schema(404) end end @@ -528,4 +570,11 @@ defp get_notification_id_by_activity(%{id: id}) do |> Map.get(:id) |> to_string() end + + defp params_to_query(%{} = params) do + Enum.map_join(params, "&", fn + {k, v} when is_list(v) -> Enum.map_join(v, "&", &"#{k}[]=#{&1}") + {k, v} -> k <> "=" <> v + end) + end end diff --git a/test/web/mastodon_api/controllers/poll_controller_test.exs b/test/web/mastodon_api/controllers/poll_controller_test.exs index 88b13a25a..f41de6448 100644 --- a/test/web/mastodon_api/controllers/poll_controller_test.exs +++ b/test/web/mastodon_api/controllers/poll_controller_test.exs @@ -16,15 +16,15 @@ defmodule Pleroma.Web.MastodonAPI.PollControllerTest do test "returns poll entity for object id", %{user: user, conn: conn} do {:ok, activity} = CommonAPI.post(user, %{ - "status" => "Pleroma does", - "poll" => %{"options" => ["what Mastodon't", "n't what Mastodoes"], "expires_in" => 20} + status: "Pleroma does", + poll: %{options: ["what Mastodon't", "n't what Mastodoes"], expires_in: 20} }) object = Object.normalize(activity) conn = get(conn, "/api/v1/polls/#{object.id}") - response = json_response(conn, 200) + response = json_response_and_validate_schema(conn, 200) id = to_string(object.id) assert %{"id" => ^id, "expired" => false, "multiple" => false} = response end @@ -34,16 +34,16 @@ test "does not expose polls for private statuses", %{conn: conn} do {:ok, activity} = CommonAPI.post(other_user, %{ - "status" => "Pleroma does", - "poll" => %{"options" => ["what Mastodon't", "n't what Mastodoes"], "expires_in" => 20}, - "visibility" => "private" + status: "Pleroma does", + poll: %{options: ["what Mastodon't", "n't what Mastodoes"], expires_in: 20}, + visibility: "private" }) object = Object.normalize(activity) conn = get(conn, "/api/v1/polls/#{object.id}") - assert json_response(conn, 404) + assert json_response_and_validate_schema(conn, 404) end end @@ -55,19 +55,22 @@ test "votes are added to the poll", %{conn: conn} do {:ok, activity} = CommonAPI.post(other_user, %{ - "status" => "A very delicious sandwich", - "poll" => %{ - "options" => ["Lettuce", "Grilled Bacon", "Tomato"], - "expires_in" => 20, - "multiple" => true + status: "A very delicious sandwich", + poll: %{ + options: ["Lettuce", "Grilled Bacon", "Tomato"], + expires_in: 20, + multiple: true } }) object = Object.normalize(activity) - conn = post(conn, "/api/v1/polls/#{object.id}/votes", %{"choices" => [0, 1, 2]}) + conn = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/polls/#{object.id}/votes", %{"choices" => [0, 1, 2]}) - assert json_response(conn, 200) + assert json_response_and_validate_schema(conn, 200) object = Object.get_by_id(object.id) assert Enum.all?(object.data["anyOf"], fn %{"replies" => %{"totalItems" => total_items}} -> @@ -78,15 +81,16 @@ test "votes are added to the poll", %{conn: conn} do test "author can't vote", %{user: user, conn: conn} do {:ok, activity} = CommonAPI.post(user, %{ - "status" => "Am I cute?", - "poll" => %{"options" => ["Yes", "No"], "expires_in" => 20} + status: "Am I cute?", + poll: %{options: ["Yes", "No"], expires_in: 20} }) object = Object.normalize(activity) assert conn + |> put_req_header("content-type", "application/json") |> post("/api/v1/polls/#{object.id}/votes", %{"choices" => [1]}) - |> json_response(422) == %{"error" => "Poll's author can't vote"} + |> json_response_and_validate_schema(422) == %{"error" => "Poll's author can't vote"} object = Object.get_by_id(object.id) @@ -98,15 +102,16 @@ test "does not allow multiple choices on a single-choice question", %{conn: conn {:ok, activity} = CommonAPI.post(other_user, %{ - "status" => "The glass is", - "poll" => %{"options" => ["half empty", "half full"], "expires_in" => 20} + status: "The glass is", + poll: %{options: ["half empty", "half full"], expires_in: 20} }) object = Object.normalize(activity) assert conn + |> put_req_header("content-type", "application/json") |> post("/api/v1/polls/#{object.id}/votes", %{"choices" => [0, 1]}) - |> json_response(422) == %{"error" => "Too many choices"} + |> json_response_and_validate_schema(422) == %{"error" => "Too many choices"} object = Object.get_by_id(object.id) @@ -120,21 +125,27 @@ test "does not allow choice index to be greater than options count", %{conn: con {:ok, activity} = CommonAPI.post(other_user, %{ - "status" => "Am I cute?", - "poll" => %{"options" => ["Yes", "No"], "expires_in" => 20} + status: "Am I cute?", + poll: %{options: ["Yes", "No"], expires_in: 20} }) object = Object.normalize(activity) - conn = post(conn, "/api/v1/polls/#{object.id}/votes", %{"choices" => [2]}) + conn = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/polls/#{object.id}/votes", %{"choices" => [2]}) - assert json_response(conn, 422) == %{"error" => "Invalid indices"} + assert json_response_and_validate_schema(conn, 422) == %{"error" => "Invalid indices"} end test "returns 404 error when object is not exist", %{conn: conn} do - conn = post(conn, "/api/v1/polls/1/votes", %{"choices" => [0]}) + conn = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/polls/1/votes", %{"choices" => [0]}) - assert json_response(conn, 404) == %{"error" => "Record not found"} + assert json_response_and_validate_schema(conn, 404) == %{"error" => "Record not found"} end test "returns 404 when poll is private and not available for user", %{conn: conn} do @@ -142,16 +153,19 @@ test "returns 404 when poll is private and not available for user", %{conn: conn {:ok, activity} = CommonAPI.post(other_user, %{ - "status" => "Am I cute?", - "poll" => %{"options" => ["Yes", "No"], "expires_in" => 20}, - "visibility" => "private" + status: "Am I cute?", + poll: %{options: ["Yes", "No"], expires_in: 20}, + visibility: "private" }) object = Object.normalize(activity) - conn = post(conn, "/api/v1/polls/#{object.id}/votes", %{"choices" => [0]}) + conn = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/polls/#{object.id}/votes", %{"choices" => [0]}) - assert json_response(conn, 404) == %{"error" => "Record not found"} + assert json_response_and_validate_schema(conn, 404) == %{"error" => "Record not found"} end end end diff --git a/test/web/mastodon_api/controllers/report_controller_test.exs b/test/web/mastodon_api/controllers/report_controller_test.exs index 34ec8119e..6636cff96 100644 --- a/test/web/mastodon_api/controllers/report_controller_test.exs +++ b/test/web/mastodon_api/controllers/report_controller_test.exs @@ -14,7 +14,7 @@ defmodule Pleroma.Web.MastodonAPI.ReportControllerTest do setup do target_user = insert(:user) - {:ok, activity} = CommonAPI.post(target_user, %{"status" => "foobar"}) + {:ok, activity} = CommonAPI.post(target_user, %{status: "foobar"}) [target_user: target_user, activity: activity] end @@ -22,8 +22,9 @@ defmodule Pleroma.Web.MastodonAPI.ReportControllerTest do test "submit a basic report", %{conn: conn, target_user: target_user} do assert %{"action_taken" => false, "id" => _} = conn + |> put_req_header("content-type", "application/json") |> post("/api/v1/reports", %{"account_id" => target_user.id}) - |> json_response(200) + |> json_response_and_validate_schema(200) end test "submit a report with statuses and comment", %{ @@ -33,23 +34,25 @@ test "submit a report with statuses and comment", %{ } do assert %{"action_taken" => false, "id" => _} = conn + |> put_req_header("content-type", "application/json") |> post("/api/v1/reports", %{ "account_id" => target_user.id, "status_ids" => [activity.id], "comment" => "bad status!", "forward" => "false" }) - |> json_response(200) + |> json_response_and_validate_schema(200) end test "account_id is required", %{ conn: conn, activity: activity } do - assert %{"error" => "Valid `account_id` required"} = + assert %{"error" => "Missing field: account_id."} = conn + |> put_req_header("content-type", "application/json") |> post("/api/v1/reports", %{"status_ids" => [activity.id]}) - |> json_response(400) + |> json_response_and_validate_schema(400) end test "comment must be up to the size specified in the config", %{ @@ -63,17 +66,21 @@ test "comment must be up to the size specified in the config", %{ assert ^error = conn + |> put_req_header("content-type", "application/json") |> post("/api/v1/reports", %{"account_id" => target_user.id, "comment" => comment}) - |> json_response(400) + |> json_response_and_validate_schema(400) end test "returns error when account is not exist", %{ conn: conn, activity: activity } do - conn = post(conn, "/api/v1/reports", %{"status_ids" => [activity.id], "account_id" => "foo"}) + conn = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/reports", %{"status_ids" => [activity.id], "account_id" => "foo"}) - assert json_response(conn, 400) == %{"error" => "Account not found"} + assert json_response_and_validate_schema(conn, 400) == %{"error" => "Account not found"} end test "doesn't fail if an admin has no email", %{conn: conn, target_user: target_user} do @@ -81,7 +88,8 @@ test "doesn't fail if an admin has no email", %{conn: conn, target_user: target_ assert %{"action_taken" => false, "id" => _} = conn + |> put_req_header("content-type", "application/json") |> post("/api/v1/reports", %{"account_id" => target_user.id}) - |> json_response(200) + |> json_response_and_validate_schema(200) end end diff --git a/test/web/mastodon_api/controllers/scheduled_activity_controller_test.exs b/test/web/mastodon_api/controllers/scheduled_activity_controller_test.exs index f86274d57..1ff871c89 100644 --- a/test/web/mastodon_api/controllers/scheduled_activity_controller_test.exs +++ b/test/web/mastodon_api/controllers/scheduled_activity_controller_test.exs @@ -24,19 +24,19 @@ test "shows scheduled activities" do # min_id conn_res = get(conn, "/api/v1/scheduled_statuses?limit=2&min_id=#{scheduled_activity_id1}") - result = json_response(conn_res, 200) + result = json_response_and_validate_schema(conn_res, 200) assert [%{"id" => ^scheduled_activity_id3}, %{"id" => ^scheduled_activity_id2}] = result # since_id conn_res = get(conn, "/api/v1/scheduled_statuses?limit=2&since_id=#{scheduled_activity_id1}") - result = json_response(conn_res, 200) + result = json_response_and_validate_schema(conn_res, 200) assert [%{"id" => ^scheduled_activity_id4}, %{"id" => ^scheduled_activity_id3}] = result # max_id conn_res = get(conn, "/api/v1/scheduled_statuses?limit=2&max_id=#{scheduled_activity_id4}") - result = json_response(conn_res, 200) + result = json_response_and_validate_schema(conn_res, 200) assert [%{"id" => ^scheduled_activity_id3}, %{"id" => ^scheduled_activity_id2}] = result end @@ -46,12 +46,12 @@ test "shows a scheduled activity" do res_conn = get(conn, "/api/v1/scheduled_statuses/#{scheduled_activity.id}") - assert %{"id" => scheduled_activity_id} = json_response(res_conn, 200) + assert %{"id" => scheduled_activity_id} = json_response_and_validate_schema(res_conn, 200) assert scheduled_activity_id == scheduled_activity.id |> to_string() res_conn = get(conn, "/api/v1/scheduled_statuses/404") - assert %{"error" => "Record not found"} = json_response(res_conn, 404) + assert %{"error" => "Record not found"} = json_response_and_validate_schema(res_conn, 404) end test "updates a scheduled activity" do @@ -74,22 +74,32 @@ test "updates a scheduled activity" do assert job.args == %{"activity_id" => scheduled_activity.id} assert DateTime.truncate(job.scheduled_at, :second) == to_datetime(scheduled_at) - new_scheduled_at = Timex.shift(NaiveDateTime.utc_now(), minutes: 120) + new_scheduled_at = + NaiveDateTime.utc_now() + |> Timex.shift(minutes: 120) + |> Timex.format!("%Y-%m-%dT%H:%M:%S.%fZ", :strftime) res_conn = - put(conn, "/api/v1/scheduled_statuses/#{scheduled_activity.id}", %{ + conn + |> put_req_header("content-type", "application/json") + |> put("/api/v1/scheduled_statuses/#{scheduled_activity.id}", %{ scheduled_at: new_scheduled_at }) - assert %{"scheduled_at" => expected_scheduled_at} = json_response(res_conn, 200) + assert %{"scheduled_at" => expected_scheduled_at} = + json_response_and_validate_schema(res_conn, 200) + assert expected_scheduled_at == Pleroma.Web.CommonAPI.Utils.to_masto_date(new_scheduled_at) job = refresh_record(job) assert DateTime.truncate(job.scheduled_at, :second) == to_datetime(new_scheduled_at) - res_conn = put(conn, "/api/v1/scheduled_statuses/404", %{scheduled_at: new_scheduled_at}) + res_conn = + conn + |> put_req_header("content-type", "application/json") + |> put("/api/v1/scheduled_statuses/404", %{scheduled_at: new_scheduled_at}) - assert %{"error" => "Record not found"} = json_response(res_conn, 404) + assert %{"error" => "Record not found"} = json_response_and_validate_schema(res_conn, 404) end test "deletes a scheduled activity" do @@ -115,7 +125,7 @@ test "deletes a scheduled activity" do |> assign(:user, user) |> delete("/api/v1/scheduled_statuses/#{scheduled_activity.id}") - assert %{} = json_response(res_conn, 200) + assert %{} = json_response_and_validate_schema(res_conn, 200) refute Repo.get(ScheduledActivity, scheduled_activity.id) refute Repo.get(Oban.Job, job.id) @@ -124,6 +134,6 @@ test "deletes a scheduled activity" do |> assign(:user, user) |> delete("/api/v1/scheduled_statuses/#{scheduled_activity.id}") - assert %{"error" => "Record not found"} = json_response(res_conn, 404) + assert %{"error" => "Record not found"} = json_response_and_validate_schema(res_conn, 404) end end diff --git a/test/web/mastodon_api/controllers/search_controller_test.exs b/test/web/mastodon_api/controllers/search_controller_test.exs index 11133ff66..7d0cafccc 100644 --- a/test/web/mastodon_api/controllers/search_controller_test.exs +++ b/test/web/mastodon_api/controllers/search_controller_test.exs @@ -13,7 +13,7 @@ defmodule Pleroma.Web.MastodonAPI.SearchControllerTest do import Tesla.Mock import Mock - setup do + setup_all do mock_global(fn env -> apply(HttpRequestMock, :request, [env]) end) :ok end @@ -27,8 +27,8 @@ test "it returns empty result if user or status search return undefined error", capture_log(fn -> results = conn - |> get("/api/v2/search", %{"q" => "2hu"}) - |> json_response(200) + |> get("/api/v2/search?q=2hu") + |> json_response_and_validate_schema(200) assert results["accounts"] == [] assert results["statuses"] == [] @@ -42,20 +42,20 @@ test "search", %{conn: conn} do user_two = insert(:user, %{nickname: "shp@shitposter.club"}) user_three = insert(:user, %{nickname: "shp@heldscal.la", name: "I love 2hu"}) - {:ok, activity} = CommonAPI.post(user, %{"status" => "This is about 2hu private 天子"}) + {:ok, activity} = CommonAPI.post(user, %{status: "This is about 2hu private 天子"}) {:ok, _activity} = CommonAPI.post(user, %{ - "status" => "This is about 2hu, but private", - "visibility" => "private" + status: "This is about 2hu, but private", + visibility: "private" }) - {:ok, _} = CommonAPI.post(user_two, %{"status" => "This isn't"}) + {:ok, _} = CommonAPI.post(user_two, %{status: "This isn't"}) results = conn - |> get("/api/v2/search", %{"q" => "2hu #private"}) - |> json_response(200) + |> get("/api/v2/search?#{URI.encode_query(%{q: "2hu #private"})}") + |> json_response_and_validate_schema(200) [account | _] = results["accounts"] assert account["id"] == to_string(user_three.id) @@ -68,8 +68,8 @@ test "search", %{conn: conn} do assert status["id"] == to_string(activity.id) results = - get(conn, "/api/v2/search", %{"q" => "天子"}) - |> json_response(200) + get(conn, "/api/v2/search?q=天子") + |> json_response_and_validate_schema(200) [status] = results["statuses"] assert status["id"] == to_string(activity.id) @@ -80,17 +80,17 @@ test "excludes a blocked users from search results", %{conn: conn} do user_smith = insert(:user, %{nickname: "Agent", name: "I love 2hu"}) user_neo = insert(:user, %{nickname: "Agent Neo", name: "Agent"}) - {:ok, act1} = CommonAPI.post(user, %{"status" => "This is about 2hu private 天子"}) - {:ok, act2} = CommonAPI.post(user_smith, %{"status" => "Agent Smith"}) - {:ok, act3} = CommonAPI.post(user_neo, %{"status" => "Agent Smith"}) + {:ok, act1} = CommonAPI.post(user, %{status: "This is about 2hu private 天子"}) + {:ok, act2} = CommonAPI.post(user_smith, %{status: "Agent Smith"}) + {:ok, act3} = CommonAPI.post(user_neo, %{status: "Agent Smith"}) Pleroma.User.block(user, user_smith) results = conn |> assign(:user, user) |> assign(:token, insert(:oauth_token, user: user, scopes: ["read"])) - |> get("/api/v2/search", %{"q" => "Agent"}) - |> json_response(200) + |> get("/api/v2/search?q=Agent") + |> json_response_and_validate_schema(200) status_ids = Enum.map(results["statuses"], fn g -> g["id"] end) @@ -107,8 +107,8 @@ test "account search", %{conn: conn} do results = conn - |> get("/api/v1/accounts/search", %{"q" => "shp"}) - |> json_response(200) + |> get("/api/v1/accounts/search?q=shp") + |> json_response_and_validate_schema(200) result_ids = for result <- results, do: result["acct"] @@ -117,8 +117,8 @@ test "account search", %{conn: conn} do results = conn - |> get("/api/v1/accounts/search", %{"q" => "2hu"}) - |> json_response(200) + |> get("/api/v1/accounts/search?q=2hu") + |> json_response_and_validate_schema(200) result_ids = for result <- results, do: result["acct"] @@ -130,8 +130,8 @@ test "returns account if query contains a space", %{conn: conn} do results = conn - |> get("/api/v1/accounts/search", %{"q" => "shp@shitposter.club xxx "}) - |> json_response(200) + |> get("/api/v1/accounts/search?q=shp@shitposter.club xxx") + |> json_response_and_validate_schema(200) assert length(results) == 1 end @@ -146,8 +146,8 @@ test "it returns empty result if user or status search return undefined error", capture_log(fn -> results = conn - |> get("/api/v1/search", %{"q" => "2hu"}) - |> json_response(200) + |> get("/api/v1/search?q=2hu") + |> json_response_and_validate_schema(200) assert results["accounts"] == [] assert results["statuses"] == [] @@ -161,20 +161,20 @@ test "search", %{conn: conn} do user_two = insert(:user, %{nickname: "shp@shitposter.club"}) user_three = insert(:user, %{nickname: "shp@heldscal.la", name: "I love 2hu"}) - {:ok, activity} = CommonAPI.post(user, %{"status" => "This is about 2hu"}) + {:ok, activity} = CommonAPI.post(user, %{status: "This is about 2hu"}) {:ok, _activity} = CommonAPI.post(user, %{ - "status" => "This is about 2hu, but private", - "visibility" => "private" + status: "This is about 2hu, but private", + visibility: "private" }) - {:ok, _} = CommonAPI.post(user_two, %{"status" => "This isn't"}) + {:ok, _} = CommonAPI.post(user_two, %{status: "This isn't"}) results = conn - |> get("/api/v1/search", %{"q" => "2hu"}) - |> json_response(200) + |> get("/api/v1/search?q=2hu") + |> json_response_and_validate_schema(200) [account | _] = results["accounts"] assert account["id"] == to_string(user_three.id) @@ -189,13 +189,13 @@ test "search fetches remote statuses and prefers them over other results", %{con capture_log(fn -> {:ok, %{id: activity_id}} = CommonAPI.post(insert(:user), %{ - "status" => "check out https://shitposter.club/notice/2827873" + status: "check out https://shitposter.club/notice/2827873" }) results = conn - |> get("/api/v1/search", %{"q" => "https://shitposter.club/notice/2827873"}) - |> json_response(200) + |> get("/api/v1/search?q=https://shitposter.club/notice/2827873") + |> json_response_and_validate_schema(200) [status, %{"id" => ^activity_id}] = results["statuses"] @@ -207,15 +207,17 @@ test "search fetches remote statuses and prefers them over other results", %{con test "search doesn't show statuses that it shouldn't", %{conn: conn} do {:ok, activity} = CommonAPI.post(insert(:user), %{ - "status" => "This is about 2hu, but private", - "visibility" => "private" + status: "This is about 2hu, but private", + visibility: "private" }) capture_log(fn -> + q = Object.normalize(activity).data["id"] + results = conn - |> get("/api/v1/search", %{"q" => Object.normalize(activity).data["id"]}) - |> json_response(200) + |> get("/api/v1/search?q=#{q}") + |> json_response_and_validate_schema(200) [] = results["statuses"] end) @@ -228,8 +230,8 @@ test "search fetches remote accounts", %{conn: conn} do conn |> assign(:user, user) |> assign(:token, insert(:oauth_token, user: user, scopes: ["read"])) - |> get("/api/v1/search", %{"q" => "mike@osada.macgirvin.com", "resolve" => "true"}) - |> json_response(200) + |> get("/api/v1/search?q=mike@osada.macgirvin.com&resolve=true") + |> json_response_and_validate_schema(200) [account] = results["accounts"] assert account["acct"] == "mike@osada.macgirvin.com" @@ -238,8 +240,8 @@ test "search fetches remote accounts", %{conn: conn} do test "search doesn't fetch remote accounts if resolve is false", %{conn: conn} do results = conn - |> get("/api/v1/search", %{"q" => "mike@osada.macgirvin.com", "resolve" => "false"}) - |> json_response(200) + |> get("/api/v1/search?q=mike@osada.macgirvin.com&resolve=false") + |> json_response_and_validate_schema(200) assert [] == results["accounts"] end @@ -249,21 +251,21 @@ test "search with limit and offset", %{conn: conn} do _user_two = insert(:user, %{nickname: "shp@shitposter.club"}) _user_three = insert(:user, %{nickname: "shp@heldscal.la", name: "I love 2hu"}) - {:ok, _activity1} = CommonAPI.post(user, %{"status" => "This is about 2hu"}) - {:ok, _activity2} = CommonAPI.post(user, %{"status" => "This is also about 2hu"}) + {:ok, _activity1} = CommonAPI.post(user, %{status: "This is about 2hu"}) + {:ok, _activity2} = CommonAPI.post(user, %{status: "This is also about 2hu"}) result = conn - |> get("/api/v1/search", %{"q" => "2hu", "limit" => 1}) + |> get("/api/v1/search?q=2hu&limit=1") - assert results = json_response(result, 200) + assert results = json_response_and_validate_schema(result, 200) assert [%{"id" => activity_id1}] = results["statuses"] assert [_] = results["accounts"] results = conn - |> get("/api/v1/search", %{"q" => "2hu", "limit" => 1, "offset" => 1}) - |> json_response(200) + |> get("/api/v1/search?q=2hu&limit=1&offset=1") + |> json_response_and_validate_schema(200) assert [%{"id" => activity_id2}] = results["statuses"] assert [] = results["accounts"] @@ -275,30 +277,30 @@ test "search returns results only for the given type", %{conn: conn} do user = insert(:user) _user_two = insert(:user, %{nickname: "shp@heldscal.la", name: "I love 2hu"}) - {:ok, _activity} = CommonAPI.post(user, %{"status" => "This is about 2hu"}) + {:ok, _activity} = CommonAPI.post(user, %{status: "This is about 2hu"}) assert %{"statuses" => [_activity], "accounts" => [], "hashtags" => []} = conn - |> get("/api/v1/search", %{"q" => "2hu", "type" => "statuses"}) - |> json_response(200) + |> get("/api/v1/search?q=2hu&type=statuses") + |> json_response_and_validate_schema(200) assert %{"statuses" => [], "accounts" => [_user_two], "hashtags" => []} = conn - |> get("/api/v1/search", %{"q" => "2hu", "type" => "accounts"}) - |> json_response(200) + |> get("/api/v1/search?q=2hu&type=accounts") + |> json_response_and_validate_schema(200) end test "search uses account_id to filter statuses by the author", %{conn: conn} do user = insert(:user, %{nickname: "shp@shitposter.club"}) user_two = insert(:user, %{nickname: "shp@heldscal.la", name: "I love 2hu"}) - {:ok, activity1} = CommonAPI.post(user, %{"status" => "This is about 2hu"}) - {:ok, activity2} = CommonAPI.post(user_two, %{"status" => "This is also about 2hu"}) + {:ok, activity1} = CommonAPI.post(user, %{status: "This is about 2hu"}) + {:ok, activity2} = CommonAPI.post(user_two, %{status: "This is also about 2hu"}) results = conn - |> get("/api/v1/search", %{"q" => "2hu", "account_id" => user.id}) - |> json_response(200) + |> get("/api/v1/search?q=2hu&account_id=#{user.id}") + |> json_response_and_validate_schema(200) assert [%{"id" => activity_id1}] = results["statuses"] assert activity_id1 == activity1.id @@ -306,8 +308,8 @@ test "search uses account_id to filter statuses by the author", %{conn: conn} do results = conn - |> get("/api/v1/search", %{"q" => "2hu", "account_id" => user_two.id}) - |> json_response(200) + |> get("/api/v1/search?q=2hu&account_id=#{user_two.id}") + |> json_response_and_validate_schema(200) assert [%{"id" => activity_id2}] = results["statuses"] assert activity_id2 == activity2.id diff --git a/test/web/mastodon_api/controllers/status_controller_test.exs b/test/web/mastodon_api/controllers/status_controller_test.exs index d59974d50..a4403132c 100644 --- a/test/web/mastodon_api/controllers/status_controller_test.exs +++ b/test/web/mastodon_api/controllers/status_controller_test.exs @@ -32,13 +32,14 @@ test "posting a status does not increment reblog_count when relaying", %{conn: c response = conn + |> put_req_header("content-type", "application/json") |> post("api/v1/statuses", %{ "content_type" => "text/plain", "source" => "Pleroma FE", "status" => "Hello world", "visibility" => "public" }) - |> json_response(200) + |> json_response_and_validate_schema(200) assert response["reblogs_count"] == 0 ObanHelpers.perform_all() @@ -46,7 +47,7 @@ test "posting a status does not increment reblog_count when relaying", %{conn: c response = conn |> get("api/v1/statuses/#{response["id"]}", %{}) - |> json_response(200) + |> json_response_and_validate_schema(200) assert response["reblogs_count"] == 0 end @@ -56,6 +57,7 @@ test "posting a status", %{conn: conn} do conn_one = conn + |> put_req_header("content-type", "application/json") |> put_req_header("idempotency-key", idempotency_key) |> post("/api/v1/statuses", %{ "status" => "cofe", @@ -68,12 +70,13 @@ test "posting a status", %{conn: conn} do assert ttl > :timer.seconds(6 * 60 * 60 - 1) assert %{"content" => "cofe", "id" => id, "spoiler_text" => "2hu", "sensitive" => false} = - json_response(conn_one, 200) + json_response_and_validate_schema(conn_one, 200) assert Activity.get_by_id(id) conn_two = conn + |> put_req_header("content-type", "application/json") |> put_req_header("idempotency-key", idempotency_key) |> post("/api/v1/statuses", %{ "status" => "cofe", @@ -86,13 +89,14 @@ test "posting a status", %{conn: conn} do conn_three = conn + |> put_req_header("content-type", "application/json") |> post("/api/v1/statuses", %{ "status" => "cofe", "spoiler_text" => "2hu", "sensitive" => "false" }) - assert %{"id" => third_id} = json_response(conn_three, 200) + assert %{"id" => third_id} = json_response_and_validate_schema(conn_three, 200) refute id == third_id # An activity that will expire: @@ -101,12 +105,15 @@ test "posting a status", %{conn: conn} do conn_four = conn + |> put_req_header("content-type", "application/json") |> post("api/v1/statuses", %{ "status" => "oolong", "expires_in" => expires_in }) - assert fourth_response = %{"id" => fourth_id} = json_response(conn_four, 200) + assert fourth_response = + %{"id" => fourth_id} = json_response_and_validate_schema(conn_four, 200) + assert activity = Activity.get_by_id(fourth_id) assert expiration = ActivityExpiration.get_by_activity_id(fourth_id) @@ -130,22 +137,24 @@ test "it fails to create a status if `expires_in` is less or equal than an hour" assert %{"error" => "Expiry date is too soon"} = conn + |> put_req_header("content-type", "application/json") |> post("api/v1/statuses", %{ "status" => "oolong", "expires_in" => expires_in }) - |> json_response(422) + |> json_response_and_validate_schema(422) # 30 minutes expires_in = 30 * 60 assert %{"error" => "Expiry date is too soon"} = conn + |> put_req_header("content-type", "application/json") |> post("api/v1/statuses", %{ "status" => "oolong", "expires_in" => expires_in }) - |> json_response(422) + |> json_response_and_validate_schema(422) end test "posting an undefined status with an attachment", %{user: user, conn: conn} do @@ -158,21 +167,24 @@ test "posting an undefined status with an attachment", %{user: user, conn: conn} {:ok, upload} = ActivityPub.upload(file, actor: user.ap_id) conn = - post(conn, "/api/v1/statuses", %{ + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses", %{ "media_ids" => [to_string(upload.id)] }) - assert json_response(conn, 200) + assert json_response_and_validate_schema(conn, 200) end test "replying to a status", %{user: user, conn: conn} do - {:ok, replied_to} = CommonAPI.post(user, %{"status" => "cofe"}) + {:ok, replied_to} = CommonAPI.post(user, %{status: "cofe"}) conn = conn + |> put_req_header("content-type", "application/json") |> post("/api/v1/statuses", %{"status" => "xD", "in_reply_to_id" => replied_to.id}) - assert %{"content" => "xD", "id" => id} = json_response(conn, 200) + assert %{"content" => "xD", "id" => id} = json_response_and_validate_schema(conn, 200) activity = Activity.get_by_id(id) @@ -184,43 +196,56 @@ test "replying to a direct message with visibility other than direct", %{ user: user, conn: conn } do - {:ok, replied_to} = CommonAPI.post(user, %{"status" => "suya..", "visibility" => "direct"}) + {:ok, replied_to} = CommonAPI.post(user, %{status: "suya..", visibility: "direct"}) Enum.each(["public", "private", "unlisted"], fn visibility -> conn = conn + |> put_req_header("content-type", "application/json") |> post("/api/v1/statuses", %{ "status" => "@#{user.nickname} hey", "in_reply_to_id" => replied_to.id, "visibility" => visibility }) - assert json_response(conn, 422) == %{"error" => "The message visibility must be direct"} + assert json_response_and_validate_schema(conn, 422) == %{ + "error" => "The message visibility must be direct" + } end) end test "posting a status with an invalid in_reply_to_id", %{conn: conn} do - conn = post(conn, "/api/v1/statuses", %{"status" => "xD", "in_reply_to_id" => ""}) + conn = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses", %{"status" => "xD", "in_reply_to_id" => ""}) - assert %{"content" => "xD", "id" => id} = json_response(conn, 200) + assert %{"content" => "xD", "id" => id} = json_response_and_validate_schema(conn, 200) assert Activity.get_by_id(id) end test "posting a sensitive status", %{conn: conn} do - conn = post(conn, "/api/v1/statuses", %{"status" => "cofe", "sensitive" => true}) + conn = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses", %{"status" => "cofe", "sensitive" => true}) + + assert %{"content" => "cofe", "id" => id, "sensitive" => true} = + json_response_and_validate_schema(conn, 200) - assert %{"content" => "cofe", "id" => id, "sensitive" => true} = json_response(conn, 200) assert Activity.get_by_id(id) end test "posting a fake status", %{conn: conn} do real_conn = - post(conn, "/api/v1/statuses", %{ + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses", %{ "status" => "\"Tenshi Eating a Corndog\" is a much discussed concept on /jp/. The significance of it is disputed, so I will focus on one core concept: the symbolism behind it" }) - real_status = json_response(real_conn, 200) + real_status = json_response_and_validate_schema(real_conn, 200) assert real_status assert Object.get_by_ap_id(real_status["uri"]) @@ -234,13 +259,15 @@ test "posting a fake status", %{conn: conn} do |> Kernel.put_in(["pleroma", "conversation_id"], nil) fake_conn = - post(conn, "/api/v1/statuses", %{ + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses", %{ "status" => "\"Tenshi Eating a Corndog\" is a much discussed concept on /jp/. The significance of it is disputed, so I will focus on one core concept: the symbolism behind it", "preview" => true }) - fake_status = json_response(fake_conn, 200) + fake_status = json_response_and_validate_schema(fake_conn, 200) assert fake_status refute Object.get_by_ap_id(fake_status["uri"]) @@ -261,11 +288,15 @@ test "posting a status with OGP link preview", %{conn: conn} do Config.put([:rich_media, :enabled], true) conn = - post(conn, "/api/v1/statuses", %{ + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses", %{ "status" => "https://example.com/ogp" }) - assert %{"id" => id, "card" => %{"title" => "The Rock"}} = json_response(conn, 200) + assert %{"id" => id, "card" => %{"title" => "The Rock"}} = + json_response_and_validate_schema(conn, 200) + assert Activity.get_by_id(id) end @@ -273,9 +304,12 @@ test "posting a direct status", %{conn: conn} do user2 = insert(:user) content = "direct cofe @#{user2.nickname}" - conn = post(conn, "api/v1/statuses", %{"status" => content, "visibility" => "direct"}) + conn = + conn + |> put_req_header("content-type", "application/json") + |> post("api/v1/statuses", %{"status" => content, "visibility" => "direct"}) - assert %{"id" => id} = response = json_response(conn, 200) + assert %{"id" => id} = response = json_response_and_validate_schema(conn, 200) assert response["visibility"] == "direct" assert response["pleroma"]["direct_conversation_id"] assert activity = Activity.get_by_id(id) @@ -289,21 +323,45 @@ test "posting a direct status", %{conn: conn} do setup do: oauth_access(["write:statuses"]) test "creates a scheduled activity", %{conn: conn} do - scheduled_at = NaiveDateTime.add(NaiveDateTime.utc_now(), :timer.minutes(120), :millisecond) + scheduled_at = + NaiveDateTime.add(NaiveDateTime.utc_now(), :timer.minutes(120), :millisecond) + |> NaiveDateTime.to_iso8601() + |> Kernel.<>("Z") conn = - post(conn, "/api/v1/statuses", %{ + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses", %{ "status" => "scheduled", "scheduled_at" => scheduled_at }) - assert %{"scheduled_at" => expected_scheduled_at} = json_response(conn, 200) + assert %{"scheduled_at" => expected_scheduled_at} = + json_response_and_validate_schema(conn, 200) + assert expected_scheduled_at == CommonAPI.Utils.to_masto_date(scheduled_at) assert [] == Repo.all(Activity) end + test "ignores nil values", %{conn: conn} do + conn = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses", %{ + "status" => "not scheduled", + "scheduled_at" => nil + }) + + assert result = json_response_and_validate_schema(conn, 200) + assert Activity.get_by_id(result["id"]) + end + test "creates a scheduled activity with a media attachment", %{user: user, conn: conn} do - scheduled_at = NaiveDateTime.add(NaiveDateTime.utc_now(), :timer.minutes(120), :millisecond) + scheduled_at = + NaiveDateTime.utc_now() + |> NaiveDateTime.add(:timer.minutes(120), :millisecond) + |> NaiveDateTime.to_iso8601() + |> Kernel.<>("Z") file = %Plug.Upload{ content_type: "image/jpg", @@ -314,13 +372,17 @@ test "creates a scheduled activity with a media attachment", %{user: user, conn: {:ok, upload} = ActivityPub.upload(file, actor: user.ap_id) conn = - post(conn, "/api/v1/statuses", %{ + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses", %{ "media_ids" => [to_string(upload.id)], "status" => "scheduled", "scheduled_at" => scheduled_at }) - assert %{"media_attachments" => [media_attachment]} = json_response(conn, 200) + assert %{"media_attachments" => [media_attachment]} = + json_response_and_validate_schema(conn, 200) + assert %{"type" => "image"} = media_attachment end @@ -328,14 +390,18 @@ test "skips the scheduling and creates the activity if scheduled_at is earlier t %{conn: conn} do scheduled_at = NaiveDateTime.add(NaiveDateTime.utc_now(), :timer.minutes(5) - 1, :millisecond) + |> NaiveDateTime.to_iso8601() + |> Kernel.<>("Z") conn = - post(conn, "/api/v1/statuses", %{ + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses", %{ "status" => "not scheduled", "scheduled_at" => scheduled_at }) - assert %{"content" => "not scheduled"} = json_response(conn, 200) + assert %{"content" => "not scheduled"} = json_response_and_validate_schema(conn, 200) assert [] == Repo.all(ScheduledActivity) end @@ -344,14 +410,19 @@ test "returns error when daily user limit is exceeded", %{user: user, conn: conn NaiveDateTime.utc_now() |> NaiveDateTime.add(:timer.minutes(6), :millisecond) |> NaiveDateTime.to_iso8601() + # TODO + |> Kernel.<>("Z") attrs = %{params: %{}, scheduled_at: today} {:ok, _} = ScheduledActivity.create(user, attrs) {:ok, _} = ScheduledActivity.create(user, attrs) - conn = post(conn, "/api/v1/statuses", %{"status" => "scheduled", "scheduled_at" => today}) + conn = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses", %{"status" => "scheduled", "scheduled_at" => today}) - assert %{"error" => "daily limit exceeded"} == json_response(conn, 422) + assert %{"error" => "daily limit exceeded"} == json_response_and_validate_schema(conn, 422) end test "returns error when total user limit is exceeded", %{user: user, conn: conn} do @@ -359,11 +430,13 @@ test "returns error when total user limit is exceeded", %{user: user, conn: conn NaiveDateTime.utc_now() |> NaiveDateTime.add(:timer.minutes(6), :millisecond) |> NaiveDateTime.to_iso8601() + |> Kernel.<>("Z") tomorrow = NaiveDateTime.utc_now() |> NaiveDateTime.add(:timer.hours(36), :millisecond) |> NaiveDateTime.to_iso8601() + |> Kernel.<>("Z") attrs = %{params: %{}, scheduled_at: today} {:ok, _} = ScheduledActivity.create(user, attrs) @@ -371,9 +444,11 @@ test "returns error when total user limit is exceeded", %{user: user, conn: conn {:ok, _} = ScheduledActivity.create(user, %{params: %{}, scheduled_at: tomorrow}) conn = - post(conn, "/api/v1/statuses", %{"status" => "scheduled", "scheduled_at" => tomorrow}) + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses", %{"status" => "scheduled", "scheduled_at" => tomorrow}) - assert %{"error" => "total limit exceeded"} == json_response(conn, 422) + assert %{"error" => "total limit exceeded"} == json_response_and_validate_schema(conn, 422) end end @@ -384,12 +459,17 @@ test "posting a poll", %{conn: conn} do time = NaiveDateTime.utc_now() conn = - post(conn, "/api/v1/statuses", %{ + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses", %{ "status" => "Who is the #bestgrill?", - "poll" => %{"options" => ["Rei", "Asuka", "Misato"], "expires_in" => 420} + "poll" => %{ + "options" => ["Rei", "Asuka", "Misato"], + "expires_in" => 420 + } }) - response = json_response(conn, 200) + response = json_response_and_validate_schema(conn, 200) assert Enum.all?(response["poll"]["options"], fn %{"title" => title} -> title in ["Rei", "Asuka", "Misato"] @@ -408,12 +488,14 @@ test "option limit is enforced", %{conn: conn} do limit = Config.get([:instance, :poll_limits, :max_options]) conn = - post(conn, "/api/v1/statuses", %{ + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses", %{ "status" => "desu~", "poll" => %{"options" => Enum.map(0..limit, fn _ -> "desu" end), "expires_in" => 1} }) - %{"error" => error} = json_response(conn, 422) + %{"error" => error} = json_response_and_validate_schema(conn, 422) assert error == "Poll can't contain more than #{limit} options" end @@ -421,7 +503,9 @@ test "option character limit is enforced", %{conn: conn} do limit = Config.get([:instance, :poll_limits, :max_option_chars]) conn = - post(conn, "/api/v1/statuses", %{ + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses", %{ "status" => "...", "poll" => %{ "options" => [Enum.reduce(0..limit, "", fn _, acc -> acc <> "." end)], @@ -429,7 +513,7 @@ test "option character limit is enforced", %{conn: conn} do } }) - %{"error" => error} = json_response(conn, 422) + %{"error" => error} = json_response_and_validate_schema(conn, 422) assert error == "Poll options cannot be longer than #{limit} characters each" end @@ -437,7 +521,9 @@ test "minimal date limit is enforced", %{conn: conn} do limit = Config.get([:instance, :poll_limits, :min_expiration]) conn = - post(conn, "/api/v1/statuses", %{ + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses", %{ "status" => "imagine arbitrary limits", "poll" => %{ "options" => ["this post was made by pleroma gang"], @@ -445,7 +531,7 @@ test "minimal date limit is enforced", %{conn: conn} do } }) - %{"error" => error} = json_response(conn, 422) + %{"error" => error} = json_response_and_validate_schema(conn, 422) assert error == "Expiration date is too soon" end @@ -453,7 +539,9 @@ test "maximum date limit is enforced", %{conn: conn} do limit = Config.get([:instance, :poll_limits, :max_expiration]) conn = - post(conn, "/api/v1/statuses", %{ + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses", %{ "status" => "imagine arbitrary limits", "poll" => %{ "options" => ["this post was made by pleroma gang"], @@ -461,7 +549,7 @@ test "maximum date limit is enforced", %{conn: conn} do } }) - %{"error" => error} = json_response(conn, 422) + %{"error" => error} = json_response_and_validate_schema(conn, 422) assert error == "Expiration date is too far in the future" end end @@ -472,7 +560,7 @@ test "get a status" do conn = get(conn, "/api/v1/statuses/#{activity.id}") - assert %{"id" => id} = json_response(conn, 200) + assert %{"id" => id} = json_response_and_validate_schema(conn, 200) assert id == to_string(activity.id) end @@ -492,13 +580,13 @@ defp local_and_remote_activities do test "if user is unauthenticated", %{conn: conn, local: local, remote: remote} do res_conn = get(conn, "/api/v1/statuses/#{local.id}") - assert json_response(res_conn, :not_found) == %{ + assert json_response_and_validate_schema(res_conn, :not_found) == %{ "error" => "Record not found" } res_conn = get(conn, "/api/v1/statuses/#{remote.id}") - assert json_response(res_conn, :not_found) == %{ + assert json_response_and_validate_schema(res_conn, :not_found) == %{ "error" => "Record not found" } end @@ -506,10 +594,10 @@ test "if user is unauthenticated", %{conn: conn, local: local, remote: remote} d test "if user is authenticated", %{local: local, remote: remote} do %{conn: conn} = oauth_access(["read"]) res_conn = get(conn, "/api/v1/statuses/#{local.id}") - assert %{"id" => _} = json_response(res_conn, 200) + assert %{"id" => _} = json_response_and_validate_schema(res_conn, 200) res_conn = get(conn, "/api/v1/statuses/#{remote.id}") - assert %{"id" => _} = json_response(res_conn, 200) + assert %{"id" => _} = json_response_and_validate_schema(res_conn, 200) end end @@ -521,21 +609,21 @@ test "if user is authenticated", %{local: local, remote: remote} do test "if user is unauthenticated", %{conn: conn, local: local, remote: remote} do res_conn = get(conn, "/api/v1/statuses/#{local.id}") - assert json_response(res_conn, :not_found) == %{ + assert json_response_and_validate_schema(res_conn, :not_found) == %{ "error" => "Record not found" } res_conn = get(conn, "/api/v1/statuses/#{remote.id}") - assert %{"id" => _} = json_response(res_conn, 200) + assert %{"id" => _} = json_response_and_validate_schema(res_conn, 200) end test "if user is authenticated", %{local: local, remote: remote} do %{conn: conn} = oauth_access(["read"]) res_conn = get(conn, "/api/v1/statuses/#{local.id}") - assert %{"id" => _} = json_response(res_conn, 200) + assert %{"id" => _} = json_response_and_validate_schema(res_conn, 200) res_conn = get(conn, "/api/v1/statuses/#{remote.id}") - assert %{"id" => _} = json_response(res_conn, 200) + assert %{"id" => _} = json_response_and_validate_schema(res_conn, 200) end end @@ -546,11 +634,11 @@ test "if user is authenticated", %{local: local, remote: remote} do test "if user is unauthenticated", %{conn: conn, local: local, remote: remote} do res_conn = get(conn, "/api/v1/statuses/#{local.id}") - assert %{"id" => _} = json_response(res_conn, 200) + assert %{"id" => _} = json_response_and_validate_schema(res_conn, 200) res_conn = get(conn, "/api/v1/statuses/#{remote.id}") - assert json_response(res_conn, :not_found) == %{ + assert json_response_and_validate_schema(res_conn, :not_found) == %{ "error" => "Record not found" } end @@ -558,10 +646,10 @@ test "if user is unauthenticated", %{conn: conn, local: local, remote: remote} d test "if user is authenticated", %{local: local, remote: remote} do %{conn: conn} = oauth_access(["read"]) res_conn = get(conn, "/api/v1/statuses/#{local.id}") - assert %{"id" => _} = json_response(res_conn, 200) + assert %{"id" => _} = json_response_and_validate_schema(res_conn, 200) res_conn = get(conn, "/api/v1/statuses/#{remote.id}") - assert %{"id" => _} = json_response(res_conn, 200) + assert %{"id" => _} = json_response_and_validate_schema(res_conn, 200) end end @@ -571,7 +659,7 @@ test "getting a status that doesn't exist returns 404" do conn = get(conn, "/api/v1/statuses/#{String.downcase(activity.id)}") - assert json_response(conn, 404) == %{"error" => "Record not found"} + assert json_response_and_validate_schema(conn, 404) == %{"error" => "Record not found"} end test "get a direct status" do @@ -579,7 +667,7 @@ test "get a direct status" do other_user = insert(:user) {:ok, activity} = - CommonAPI.post(user, %{"status" => "@#{other_user.nickname}", "visibility" => "direct"}) + CommonAPI.post(user, %{status: "@#{other_user.nickname}", visibility: "direct"}) conn = conn @@ -588,7 +676,7 @@ test "get a direct status" do [participation] = Participation.for_user(user) - res = json_response(conn, 200) + res = json_response_and_validate_schema(conn, 200) assert res["pleroma"]["direct_conversation_id"] == participation.id end @@ -600,7 +688,8 @@ test "get statuses by IDs" do query_string = "ids[]=#{id1}&ids[]=#{id2}" conn = get(conn, "/api/v1/statuses/?#{query_string}") - assert [%{"id" => ^id1}, %{"id" => ^id2}] = Enum.sort_by(json_response(conn, :ok), & &1["id"]) + assert [%{"id" => ^id1}, %{"id" => ^id2}] = + Enum.sort_by(json_response_and_validate_schema(conn, :ok), & &1["id"]) end describe "getting statuses by ids with restricted unauthenticated for local and remote" do @@ -611,17 +700,17 @@ test "get statuses by IDs" do setup do: clear_config([:restrict_unauthenticated, :activities, :remote], true) test "if user is unauthenticated", %{conn: conn, local: local, remote: remote} do - res_conn = get(conn, "/api/v1/statuses", %{ids: [local.id, remote.id]}) + res_conn = get(conn, "/api/v1/statuses?ids[]=#{local.id}&ids[]=#{remote.id}") - assert json_response(res_conn, 200) == [] + assert json_response_and_validate_schema(res_conn, 200) == [] end test "if user is authenticated", %{local: local, remote: remote} do %{conn: conn} = oauth_access(["read"]) - res_conn = get(conn, "/api/v1/statuses", %{ids: [local.id, remote.id]}) + res_conn = get(conn, "/api/v1/statuses?ids[]=#{local.id}&ids[]=#{remote.id}") - assert length(json_response(res_conn, 200)) == 2 + assert length(json_response_and_validate_schema(res_conn, 200)) == 2 end end @@ -631,18 +720,18 @@ test "if user is authenticated", %{local: local, remote: remote} do setup do: clear_config([:restrict_unauthenticated, :activities, :local], true) test "if user is unauthenticated", %{conn: conn, local: local, remote: remote} do - res_conn = get(conn, "/api/v1/statuses", %{ids: [local.id, remote.id]}) + res_conn = get(conn, "/api/v1/statuses?ids[]=#{local.id}&ids[]=#{remote.id}") remote_id = remote.id - assert [%{"id" => ^remote_id}] = json_response(res_conn, 200) + assert [%{"id" => ^remote_id}] = json_response_and_validate_schema(res_conn, 200) end test "if user is authenticated", %{local: local, remote: remote} do %{conn: conn} = oauth_access(["read"]) - res_conn = get(conn, "/api/v1/statuses", %{ids: [local.id, remote.id]}) + res_conn = get(conn, "/api/v1/statuses?ids[]=#{local.id}&ids[]=#{remote.id}") - assert length(json_response(res_conn, 200)) == 2 + assert length(json_response_and_validate_schema(res_conn, 200)) == 2 end end @@ -652,18 +741,18 @@ test "if user is authenticated", %{local: local, remote: remote} do setup do: clear_config([:restrict_unauthenticated, :activities, :remote], true) test "if user is unauthenticated", %{conn: conn, local: local, remote: remote} do - res_conn = get(conn, "/api/v1/statuses", %{ids: [local.id, remote.id]}) + res_conn = get(conn, "/api/v1/statuses?ids[]=#{local.id}&ids[]=#{remote.id}") local_id = local.id - assert [%{"id" => ^local_id}] = json_response(res_conn, 200) + assert [%{"id" => ^local_id}] = json_response_and_validate_schema(res_conn, 200) end test "if user is authenticated", %{local: local, remote: remote} do %{conn: conn} = oauth_access(["read"]) - res_conn = get(conn, "/api/v1/statuses", %{ids: [local.id, remote.id]}) + res_conn = get(conn, "/api/v1/statuses?ids[]=#{local.id}&ids[]=#{remote.id}") - assert length(json_response(res_conn, 200)) == 2 + assert length(json_response_and_validate_schema(res_conn, 200)) == 2 end end @@ -677,7 +766,7 @@ test "when you created it" do |> assign(:user, author) |> delete("/api/v1/statuses/#{activity.id}") - assert %{} = json_response(conn, 200) + assert %{} = json_response_and_validate_schema(conn, 200) refute Activity.get_by_id(activity.id) end @@ -691,7 +780,7 @@ test "when it doesn't exist" do |> assign(:user, author) |> delete("/api/v1/statuses/#{String.downcase(activity.id)}") - assert %{"error" => "Record not found"} == json_response(conn, 404) + assert %{"error" => "Record not found"} == json_response_and_validate_schema(conn, 404) end test "when you didn't create it" do @@ -700,7 +789,7 @@ test "when you didn't create it" do conn = delete(conn, "/api/v1/statuses/#{activity.id}") - assert %{"error" => _} = json_response(conn, 403) + assert %{"error" => _} = json_response_and_validate_schema(conn, 403) assert Activity.get_by_id(activity.id) == activity end @@ -717,7 +806,7 @@ test "when you're an admin or moderator", %{conn: conn} do |> assign(:token, insert(:oauth_token, user: admin, scopes: ["write:statuses"])) |> delete("/api/v1/statuses/#{activity1.id}") - assert %{} = json_response(res_conn, 200) + assert %{} = json_response_and_validate_schema(res_conn, 200) res_conn = conn @@ -725,7 +814,7 @@ test "when you're an admin or moderator", %{conn: conn} do |> assign(:token, insert(:oauth_token, user: moderator, scopes: ["write:statuses"])) |> delete("/api/v1/statuses/#{activity2.id}") - assert %{} = json_response(res_conn, 200) + assert %{} = json_response_and_validate_schema(res_conn, 200) refute Activity.get_by_id(activity1.id) refute Activity.get_by_id(activity2.id) @@ -738,12 +827,15 @@ test "when you're an admin or moderator", %{conn: conn} do test "reblogs and returns the reblogged status", %{conn: conn} do activity = insert(:note_activity) - conn = post(conn, "/api/v1/statuses/#{activity.id}/reblog") + conn = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses/#{activity.id}/reblog") assert %{ "reblog" => %{"id" => id, "reblogged" => true, "reblogs_count" => 1}, "reblogged" => true - } = json_response(conn, 200) + } = json_response_and_validate_schema(conn, 200) assert to_string(activity.id) == id end @@ -751,21 +843,30 @@ test "reblogs and returns the reblogged status", %{conn: conn} do test "returns 404 if the reblogged status doesn't exist", %{conn: conn} do activity = insert(:note_activity) - conn = post(conn, "/api/v1/statuses/#{String.downcase(activity.id)}/reblog") + conn = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses/#{String.downcase(activity.id)}/reblog") - assert %{"error" => "Record not found"} = json_response(conn, 404) + assert %{"error" => "Record not found"} = json_response_and_validate_schema(conn, 404) end test "reblogs privately and returns the reblogged status", %{conn: conn} do activity = insert(:note_activity) - conn = post(conn, "/api/v1/statuses/#{activity.id}/reblog", %{"visibility" => "private"}) + conn = + conn + |> put_req_header("content-type", "application/json") + |> post( + "/api/v1/statuses/#{activity.id}/reblog", + %{"visibility" => "private"} + ) assert %{ "reblog" => %{"id" => id, "reblogged" => true, "reblogs_count" => 1}, "reblogged" => true, "visibility" => "private" - } = json_response(conn, 200) + } = json_response_and_validate_schema(conn, 200) assert to_string(activity.id) == id end @@ -775,7 +876,7 @@ test "reblogged status for another user" do user1 = insert(:user) user2 = insert(:user) user3 = insert(:user) - CommonAPI.favorite(activity.id, user2) + {:ok, _} = CommonAPI.favorite(user2, activity.id) {:ok, _bookmark} = Pleroma.Bookmark.create(user2.id, activity.id) {:ok, reblog_activity1, _object} = CommonAPI.repeat(activity.id, user1) {:ok, _, _object} = CommonAPI.repeat(activity.id, user2) @@ -791,7 +892,7 @@ test "reblogged status for another user" do "reblogged" => false, "favourited" => false, "bookmarked" => false - } = json_response(conn_res, 200) + } = json_response_and_validate_schema(conn_res, 200) conn_res = build_conn() @@ -804,7 +905,7 @@ test "reblogged status for another user" do "reblogged" => true, "favourited" => true, "bookmarked" => true - } = json_response(conn_res, 200) + } = json_response_and_validate_schema(conn_res, 200) assert to_string(activity.id) == id end @@ -818,17 +919,24 @@ test "unreblogs and returns the unreblogged status", %{user: user, conn: conn} d {:ok, _, _} = CommonAPI.repeat(activity.id, user) - conn = post(conn, "/api/v1/statuses/#{activity.id}/unreblog") + conn = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses/#{activity.id}/unreblog") - assert %{"id" => id, "reblogged" => false, "reblogs_count" => 0} = json_response(conn, 200) + assert %{"id" => id, "reblogged" => false, "reblogs_count" => 0} = + json_response_and_validate_schema(conn, 200) assert to_string(activity.id) == id end test "returns 404 error when activity does not exist", %{conn: conn} do - conn = post(conn, "/api/v1/statuses/foo/unreblog") + conn = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses/foo/unreblog") - assert json_response(conn, 404) == %{"error" => "Record not found"} + assert json_response_and_validate_schema(conn, 404) == %{"error" => "Record not found"} end end @@ -838,10 +946,13 @@ test "returns 404 error when activity does not exist", %{conn: conn} do test "favs a status and returns it", %{conn: conn} do activity = insert(:note_activity) - conn = post(conn, "/api/v1/statuses/#{activity.id}/favourite") + conn = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses/#{activity.id}/favourite") assert %{"id" => id, "favourites_count" => 1, "favourited" => true} = - json_response(conn, 200) + json_response_and_validate_schema(conn, 200) assert to_string(activity.id) == id end @@ -849,14 +960,23 @@ test "favs a status and returns it", %{conn: conn} do test "favoriting twice will just return 200", %{conn: conn} do activity = insert(:note_activity) - post(conn, "/api/v1/statuses/#{activity.id}/favourite") - assert post(conn, "/api/v1/statuses/#{activity.id}/favourite") |> json_response(200) + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses/#{activity.id}/favourite") + + assert conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses/#{activity.id}/favourite") + |> json_response_and_validate_schema(200) end test "returns 404 error for a wrong id", %{conn: conn} do - conn = post(conn, "/api/v1/statuses/1/favourite") + conn = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses/1/favourite") - assert json_response(conn, 404) == %{"error" => "Record not found"} + assert json_response_and_validate_schema(conn, 404) == %{"error" => "Record not found"} end end @@ -866,20 +986,26 @@ test "returns 404 error for a wrong id", %{conn: conn} do test "unfavorites a status and returns it", %{user: user, conn: conn} do activity = insert(:note_activity) - {:ok, _, _} = CommonAPI.favorite(activity.id, user) + {:ok, _} = CommonAPI.favorite(user, activity.id) - conn = post(conn, "/api/v1/statuses/#{activity.id}/unfavourite") + conn = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses/#{activity.id}/unfavourite") assert %{"id" => id, "favourites_count" => 0, "favourited" => false} = - json_response(conn, 200) + json_response_and_validate_schema(conn, 200) assert to_string(activity.id) == id end test "returns 404 error for a wrong id", %{conn: conn} do - conn = post(conn, "/api/v1/statuses/1/unfavourite") + conn = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses/1/unfavourite") - assert json_response(conn, 404) == %{"error" => "Record not found"} + assert json_response_and_validate_schema(conn, 404) == %{"error" => "Record not found"} end end @@ -887,7 +1013,7 @@ test "returns 404 error for a wrong id", %{conn: conn} do setup do: oauth_access(["write:accounts"]) setup %{user: user} do - {:ok, activity} = CommonAPI.post(user, %{"status" => "HI!!!"}) + {:ok, activity} = CommonAPI.post(user, %{status: "HI!!!"}) %{activity: activity} end @@ -899,21 +1025,25 @@ test "pin status", %{conn: conn, user: user, activity: activity} do assert %{"id" => ^id_str, "pinned" => true} = conn + |> put_req_header("content-type", "application/json") |> post("/api/v1/statuses/#{activity.id}/pin") - |> json_response(200) + |> json_response_and_validate_schema(200) assert [%{"id" => ^id_str, "pinned" => true}] = conn |> get("/api/v1/accounts/#{user.id}/statuses?pinned=true") - |> json_response(200) + |> json_response_and_validate_schema(200) end test "/pin: returns 400 error when activity is not public", %{conn: conn, user: user} do - {:ok, dm} = CommonAPI.post(user, %{"status" => "test", "visibility" => "direct"}) + {:ok, dm} = CommonAPI.post(user, %{status: "test", visibility: "direct"}) - conn = post(conn, "/api/v1/statuses/#{dm.id}/pin") + conn = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses/#{dm.id}/pin") - assert json_response(conn, 400) == %{"error" => "Could not pin"} + assert json_response_and_validate_schema(conn, 400) == %{"error" => "Could not pin"} end test "unpin status", %{conn: conn, user: user, activity: activity} do @@ -926,29 +1056,33 @@ test "unpin status", %{conn: conn, user: user, activity: activity} do conn |> assign(:user, user) |> post("/api/v1/statuses/#{activity.id}/unpin") - |> json_response(200) + |> json_response_and_validate_schema(200) assert [] = conn |> get("/api/v1/accounts/#{user.id}/statuses?pinned=true") - |> json_response(200) + |> json_response_and_validate_schema(200) end test "/unpin: returns 400 error when activity is not exist", %{conn: conn} do - conn = post(conn, "/api/v1/statuses/1/unpin") + conn = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses/1/unpin") - assert json_response(conn, 400) == %{"error" => "Could not unpin"} + assert json_response_and_validate_schema(conn, 400) == %{"error" => "Could not unpin"} end test "max pinned statuses", %{conn: conn, user: user, activity: activity_one} do - {:ok, activity_two} = CommonAPI.post(user, %{"status" => "HI!!!"}) + {:ok, activity_two} = CommonAPI.post(user, %{status: "HI!!!"}) id_str_one = to_string(activity_one.id) assert %{"id" => ^id_str_one, "pinned" => true} = conn + |> put_req_header("content-type", "application/json") |> post("/api/v1/statuses/#{id_str_one}/pin") - |> json_response(200) + |> json_response_and_validate_schema(200) user = refresh_record(user) @@ -956,7 +1090,7 @@ test "max pinned statuses", %{conn: conn, user: user, activity: activity_one} do conn |> assign(:user, user) |> post("/api/v1/statuses/#{activity_two.id}/pin") - |> json_response(400) + |> json_response_and_validate_schema(400) end end @@ -970,7 +1104,7 @@ test "max pinned statuses", %{conn: conn, user: user, activity: activity_one} do test "returns rich-media card", %{conn: conn, user: user} do Tesla.Mock.mock(fn env -> apply(HttpRequestMock, :request, [env]) end) - {:ok, activity} = CommonAPI.post(user, %{"status" => "https://example.com/ogp"}) + {:ok, activity} = CommonAPI.post(user, %{status: "https://example.com/ogp"}) card_data = %{ "image" => "http://ia.media-imdb.com/images/rock.jpg", @@ -996,18 +1130,18 @@ test "returns rich-media card", %{conn: conn, user: user} do response = conn |> get("/api/v1/statuses/#{activity.id}/card") - |> json_response(200) + |> json_response_and_validate_schema(200) assert response == card_data # works with private posts {:ok, activity} = - CommonAPI.post(user, %{"status" => "https://example.com/ogp", "visibility" => "direct"}) + CommonAPI.post(user, %{status: "https://example.com/ogp", visibility: "direct"}) response_two = conn |> get("/api/v1/statuses/#{activity.id}/card") - |> json_response(200) + |> json_response_and_validate_schema(200) assert response_two == card_data end @@ -1015,13 +1149,12 @@ test "returns rich-media card", %{conn: conn, user: user} do test "replaces missing description with an empty string", %{conn: conn, user: user} do Tesla.Mock.mock(fn env -> apply(HttpRequestMock, :request, [env]) end) - {:ok, activity} = - CommonAPI.post(user, %{"status" => "https://example.com/ogp-missing-data"}) + {:ok, activity} = CommonAPI.post(user, %{status: "https://example.com/ogp-missing-data"}) response = conn |> get("/api/v1/statuses/#{activity.id}/card") - |> json_response(:ok) + |> json_response_and_validate_schema(:ok) assert response == %{ "type" => "link", @@ -1043,39 +1176,47 @@ test "replaces missing description with an empty string", %{conn: conn, user: us end test "bookmarks" do + bookmarks_uri = "/api/v1/bookmarks?with_relationships=true" + %{conn: conn} = oauth_access(["write:bookmarks", "read:bookmarks"]) author = insert(:user) - {:ok, activity1} = - CommonAPI.post(author, %{ - "status" => "heweoo?" - }) + {:ok, activity1} = CommonAPI.post(author, %{status: "heweoo?"}) + {:ok, activity2} = CommonAPI.post(author, %{status: "heweoo!"}) - {:ok, activity2} = - CommonAPI.post(author, %{ - "status" => "heweoo!" - }) + response1 = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses/#{activity1.id}/bookmark") - response1 = post(conn, "/api/v1/statuses/#{activity1.id}/bookmark") + assert json_response_and_validate_schema(response1, 200)["bookmarked"] == true - assert json_response(response1, 200)["bookmarked"] == true + response2 = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses/#{activity2.id}/bookmark") - response2 = post(conn, "/api/v1/statuses/#{activity2.id}/bookmark") + assert json_response_and_validate_schema(response2, 200)["bookmarked"] == true - assert json_response(response2, 200)["bookmarked"] == true + bookmarks = get(conn, bookmarks_uri) - bookmarks = get(conn, "/api/v1/bookmarks") + assert [ + json_response_and_validate_schema(response2, 200), + json_response_and_validate_schema(response1, 200) + ] == + json_response_and_validate_schema(bookmarks, 200) - assert [json_response(response2, 200), json_response(response1, 200)] == - json_response(bookmarks, 200) + response1 = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses/#{activity1.id}/unbookmark") - response1 = post(conn, "/api/v1/statuses/#{activity1.id}/unbookmark") + assert json_response_and_validate_schema(response1, 200)["bookmarked"] == false - assert json_response(response1, 200)["bookmarked"] == false + bookmarks = get(conn, bookmarks_uri) - bookmarks = get(conn, "/api/v1/bookmarks") - - assert [json_response(response2, 200)] == json_response(bookmarks, 200) + assert [json_response_and_validate_schema(response2, 200)] == + json_response_and_validate_schema(bookmarks, 200) end describe "conversation muting" do @@ -1083,7 +1224,7 @@ test "bookmarks" do setup do post_user = insert(:user) - {:ok, activity} = CommonAPI.post(post_user, %{"status" => "HIE"}) + {:ok, activity} = CommonAPI.post(post_user, %{status: "HIE"}) %{activity: activity} end @@ -1092,16 +1233,22 @@ test "mute conversation", %{conn: conn, activity: activity} do assert %{"id" => ^id_str, "muted" => true} = conn + |> put_req_header("content-type", "application/json") |> post("/api/v1/statuses/#{activity.id}/mute") - |> json_response(200) + |> json_response_and_validate_schema(200) end test "cannot mute already muted conversation", %{conn: conn, user: user, activity: activity} do {:ok, _} = CommonAPI.add_mute(user, activity) - conn = post(conn, "/api/v1/statuses/#{activity.id}/mute") + conn = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses/#{activity.id}/mute") - assert json_response(conn, 400) == %{"error" => "conversation is already muted"} + assert json_response_and_validate_schema(conn, 400) == %{ + "error" => "conversation is already muted" + } end test "unmute conversation", %{conn: conn, user: user, activity: activity} do @@ -1113,7 +1260,7 @@ test "unmute conversation", %{conn: conn, user: user, activity: activity} do conn # |> assign(:user, user) |> post("/api/v1/statuses/#{activity.id}/unmute") - |> json_response(200) + |> json_response_and_validate_schema(200) end end @@ -1122,16 +1269,17 @@ test "Repeated posts that are replies incorrectly have in_reply_to_id null", %{c user2 = insert(:user) user3 = insert(:user) - {:ok, replied_to} = CommonAPI.post(user1, %{"status" => "cofe"}) + {:ok, replied_to} = CommonAPI.post(user1, %{status: "cofe"}) # Reply to status from another user conn1 = conn |> assign(:user, user2) |> assign(:token, insert(:oauth_token, user: user2, scopes: ["write:statuses"])) + |> put_req_header("content-type", "application/json") |> post("/api/v1/statuses", %{"status" => "xD", "in_reply_to_id" => replied_to.id}) - assert %{"content" => "xD", "id" => id} = json_response(conn1, 200) + assert %{"content" => "xD", "id" => id} = json_response_and_validate_schema(conn1, 200) activity = Activity.get_by_id_with_object(id) @@ -1143,10 +1291,11 @@ test "Repeated posts that are replies incorrectly have in_reply_to_id null", %{c conn |> assign(:user, user3) |> assign(:token, insert(:oauth_token, user: user3, scopes: ["write:statuses"])) + |> put_req_header("content-type", "application/json") |> post("/api/v1/statuses/#{activity.id}/reblog") assert %{"reblog" => %{"id" => id, "reblogged" => true, "reblogs_count" => 1}} = - json_response(conn2, 200) + json_response_and_validate_schema(conn2, 200) assert to_string(activity.id) == id @@ -1169,19 +1318,19 @@ test "Repeated posts that are replies incorrectly have in_reply_to_id null", %{c setup do: oauth_access(["read:accounts"]) setup %{user: user} do - {:ok, activity} = CommonAPI.post(user, %{"status" => "test"}) + {:ok, activity} = CommonAPI.post(user, %{status: "test"}) %{activity: activity} end test "returns users who have favorited the status", %{conn: conn, activity: activity} do other_user = insert(:user) - {:ok, _, _} = CommonAPI.favorite(activity.id, other_user) + {:ok, _} = CommonAPI.favorite(other_user, activity.id) response = conn |> get("/api/v1/statuses/#{activity.id}/favourited_by") - |> json_response(:ok) + |> json_response_and_validate_schema(:ok) [%{"id" => id}] = response @@ -1195,7 +1344,7 @@ test "returns empty array when status has not been favorited yet", %{ response = conn |> get("/api/v1/statuses/#{activity.id}/favourited_by") - |> json_response(:ok) + |> json_response_and_validate_schema(:ok) assert Enum.empty?(response) end @@ -1207,24 +1356,24 @@ test "does not return users who have favorited the status but are blocked", %{ other_user = insert(:user) {:ok, _user_relationship} = User.block(user, other_user) - {:ok, _, _} = CommonAPI.favorite(activity.id, other_user) + {:ok, _} = CommonAPI.favorite(other_user, activity.id) response = conn |> get("/api/v1/statuses/#{activity.id}/favourited_by") - |> json_response(:ok) + |> json_response_and_validate_schema(:ok) assert Enum.empty?(response) end test "does not fail on an unauthenticated request", %{activity: activity} do other_user = insert(:user) - {:ok, _, _} = CommonAPI.favorite(activity.id, other_user) + {:ok, _} = CommonAPI.favorite(other_user, activity.id) response = build_conn() |> get("/api/v1/statuses/#{activity.id}/favourited_by") - |> json_response(:ok) + |> json_response_and_validate_schema(:ok) [%{"id" => id}] = response assert id == other_user.id @@ -1235,17 +1384,17 @@ test "requires authentication for private posts", %{user: user} do {:ok, activity} = CommonAPI.post(user, %{ - "status" => "@#{other_user.nickname} wanna get some #cofe together?", - "visibility" => "direct" + status: "@#{other_user.nickname} wanna get some #cofe together?", + visibility: "direct" }) - {:ok, _, _} = CommonAPI.favorite(activity.id, other_user) + {:ok, _} = CommonAPI.favorite(other_user, activity.id) favourited_by_url = "/api/v1/statuses/#{activity.id}/favourited_by" build_conn() |> get(favourited_by_url) - |> json_response(404) + |> json_response_and_validate_schema(404) conn = build_conn() @@ -1255,12 +1404,12 @@ test "requires authentication for private posts", %{user: user} do conn |> assign(:token, nil) |> get(favourited_by_url) - |> json_response(404) + |> json_response_and_validate_schema(404) response = conn |> get(favourited_by_url) - |> json_response(200) + |> json_response_and_validate_schema(200) [%{"id" => id}] = response assert id == other_user.id @@ -1271,7 +1420,7 @@ test "requires authentication for private posts", %{user: user} do setup do: oauth_access(["read:accounts"]) setup %{user: user} do - {:ok, activity} = CommonAPI.post(user, %{"status" => "test"}) + {:ok, activity} = CommonAPI.post(user, %{status: "test"}) %{activity: activity} end @@ -1283,7 +1432,7 @@ test "returns users who have reblogged the status", %{conn: conn, activity: acti response = conn |> get("/api/v1/statuses/#{activity.id}/reblogged_by") - |> json_response(:ok) + |> json_response_and_validate_schema(:ok) [%{"id" => id}] = response @@ -1297,7 +1446,7 @@ test "returns empty array when status has not been reblogged yet", %{ response = conn |> get("/api/v1/statuses/#{activity.id}/reblogged_by") - |> json_response(:ok) + |> json_response_and_validate_schema(:ok) assert Enum.empty?(response) end @@ -1314,7 +1463,7 @@ test "does not return users who have reblogged the status but are blocked", %{ response = conn |> get("/api/v1/statuses/#{activity.id}/reblogged_by") - |> json_response(:ok) + |> json_response_and_validate_schema(:ok) assert Enum.empty?(response) end @@ -1325,12 +1474,12 @@ test "does not return users who have reblogged the status privately", %{ } do other_user = insert(:user) - {:ok, _, _} = CommonAPI.repeat(activity.id, other_user, %{"visibility" => "private"}) + {:ok, _, _} = CommonAPI.repeat(activity.id, other_user, %{visibility: "private"}) response = conn |> get("/api/v1/statuses/#{activity.id}/reblogged_by") - |> json_response(:ok) + |> json_response_and_validate_schema(:ok) assert Enum.empty?(response) end @@ -1342,7 +1491,7 @@ test "does not fail on an unauthenticated request", %{activity: activity} do response = build_conn() |> get("/api/v1/statuses/#{activity.id}/reblogged_by") - |> json_response(:ok) + |> json_response_and_validate_schema(:ok) [%{"id" => id}] = response assert id == other_user.id @@ -1353,20 +1502,20 @@ test "requires authentication for private posts", %{user: user} do {:ok, activity} = CommonAPI.post(user, %{ - "status" => "@#{other_user.nickname} wanna get some #cofe together?", - "visibility" => "direct" + status: "@#{other_user.nickname} wanna get some #cofe together?", + visibility: "direct" }) build_conn() |> get("/api/v1/statuses/#{activity.id}/reblogged_by") - |> json_response(404) + |> json_response_and_validate_schema(404) response = build_conn() |> assign(:user, other_user) |> assign(:token, insert(:oauth_token, user: other_user, scopes: ["read:accounts"])) |> get("/api/v1/statuses/#{activity.id}/reblogged_by") - |> json_response(200) + |> json_response_and_validate_schema(200) assert [] == response end @@ -1375,16 +1524,16 @@ test "requires authentication for private posts", %{user: user} do test "context" do user = insert(:user) - {:ok, %{id: id1}} = CommonAPI.post(user, %{"status" => "1"}) - {:ok, %{id: id2}} = CommonAPI.post(user, %{"status" => "2", "in_reply_to_status_id" => id1}) - {:ok, %{id: id3}} = CommonAPI.post(user, %{"status" => "3", "in_reply_to_status_id" => id2}) - {:ok, %{id: id4}} = CommonAPI.post(user, %{"status" => "4", "in_reply_to_status_id" => id3}) - {:ok, %{id: id5}} = CommonAPI.post(user, %{"status" => "5", "in_reply_to_status_id" => id4}) + {:ok, %{id: id1}} = CommonAPI.post(user, %{status: "1"}) + {:ok, %{id: id2}} = CommonAPI.post(user, %{status: "2", in_reply_to_status_id: id1}) + {:ok, %{id: id3}} = CommonAPI.post(user, %{status: "3", in_reply_to_status_id: id2}) + {:ok, %{id: id4}} = CommonAPI.post(user, %{status: "4", in_reply_to_status_id: id3}) + {:ok, %{id: id5}} = CommonAPI.post(user, %{status: "5", in_reply_to_status_id: id4}) response = build_conn() |> get("/api/v1/statuses/#{id3}/context") - |> json_response(:ok) + |> json_response_and_validate_schema(:ok) assert %{ "ancestors" => [%{"id" => ^id1}, %{"id" => ^id2}], @@ -1396,14 +1545,14 @@ test "returns the favorites of a user" do %{user: user, conn: conn} = oauth_access(["read:favourites"]) other_user = insert(:user) - {:ok, _} = CommonAPI.post(other_user, %{"status" => "bla"}) - {:ok, activity} = CommonAPI.post(other_user, %{"status" => "traps are happy"}) + {:ok, _} = CommonAPI.post(other_user, %{status: "bla"}) + {:ok, activity} = CommonAPI.post(other_user, %{status: "traps are happy"}) - {:ok, _, _} = CommonAPI.favorite(activity.id, user) + {:ok, _} = CommonAPI.favorite(user, activity.id) first_conn = get(conn, "/api/v1/favourites") - assert [status] = json_response(first_conn, 200) + assert [status] = json_response_and_validate_schema(first_conn, 200) assert status["id"] == to_string(activity.id) assert [{"link", _link_header}] = @@ -1412,27 +1561,26 @@ test "returns the favorites of a user" do # Honours query params {:ok, second_activity} = CommonAPI.post(other_user, %{ - "status" => - "Trees Are Never Sad Look At Them Every Once In Awhile They're Quite Beautiful." + status: "Trees Are Never Sad Look At Them Every Once In Awhile They're Quite Beautiful." }) - {:ok, _, _} = CommonAPI.favorite(second_activity.id, user) + {:ok, _} = CommonAPI.favorite(user, second_activity.id) last_like = status["id"] second_conn = get(conn, "/api/v1/favourites?since_id=#{last_like}") - assert [second_status] = json_response(second_conn, 200) + assert [second_status] = json_response_and_validate_schema(second_conn, 200) assert second_status["id"] == to_string(second_activity.id) third_conn = get(conn, "/api/v1/favourites?limit=0") - assert [] = json_response(third_conn, 200) + assert [] = json_response_and_validate_schema(third_conn, 200) end test "expires_at is nil for another user" do %{conn: conn, user: user} = oauth_access(["read:statuses"]) - {:ok, activity} = CommonAPI.post(user, %{"status" => "foobar", "expires_in" => 1_000_000}) + {:ok, activity} = CommonAPI.post(user, %{status: "foobar", expires_in: 1_000_000}) expires_at = activity.id @@ -1441,11 +1589,15 @@ test "expires_at is nil for another user" do |> NaiveDateTime.to_iso8601() assert %{"pleroma" => %{"expires_at" => ^expires_at}} = - conn |> get("/api/v1/statuses/#{activity.id}") |> json_response(:ok) + conn + |> get("/api/v1/statuses/#{activity.id}") + |> json_response_and_validate_schema(:ok) %{conn: conn} = oauth_access(["read:statuses"]) assert %{"pleroma" => %{"expires_at" => nil}} = - conn |> get("/api/v1/statuses/#{activity.id}") |> json_response(:ok) + conn + |> get("/api/v1/statuses/#{activity.id}") + |> json_response_and_validate_schema(:ok) end end diff --git a/test/web/mastodon_api/controllers/subscription_controller_test.exs b/test/web/mastodon_api/controllers/subscription_controller_test.exs index 987158a74..4aa260663 100644 --- a/test/web/mastodon_api/controllers/subscription_controller_test.exs +++ b/test/web/mastodon_api/controllers/subscription_controller_test.exs @@ -6,6 +6,7 @@ defmodule Pleroma.Web.MastodonAPI.SubscriptionControllerTest do use Pleroma.Web.ConnCase import Pleroma.Factory + alias Pleroma.Web.Push alias Pleroma.Web.Push.Subscription @@ -27,6 +28,7 @@ defmodule Pleroma.Web.MastodonAPI.SubscriptionControllerTest do build_conn() |> assign(:user, user) |> assign(:token, token) + |> put_req_header("content-type", "application/json") %{conn: conn, user: user, token: token} end @@ -35,7 +37,10 @@ defmacro assert_error_when_disable_push(do: yield) do quote do vapid_details = Application.get_env(:web_push_encryption, :vapid_details, []) Application.put_env(:web_push_encryption, :vapid_details, []) - assert "Something went wrong" == unquote(yield) + + assert %{"error" => "Web push subscription is disabled on this Pleroma instance"} == + unquote(yield) + Application.put_env(:web_push_encryption, :vapid_details, vapid_details) end end @@ -44,8 +49,8 @@ defmacro assert_error_when_disable_push(do: yield) do test "returns error when push disabled ", %{conn: conn} do assert_error_when_disable_push do conn - |> post("/api/v1/push/subscription", %{}) - |> json_response(500) + |> post("/api/v1/push/subscription", %{subscription: @sub}) + |> json_response_and_validate_schema(403) end end @@ -56,7 +61,7 @@ test "successful creation", %{conn: conn} do "data" => %{"alerts" => %{"mention" => true, "test" => true}}, "subscription" => @sub }) - |> json_response(200) + |> json_response_and_validate_schema(200) [subscription] = Pleroma.Repo.all(Subscription) @@ -74,7 +79,7 @@ test "returns error when push disabled ", %{conn: conn} do assert_error_when_disable_push do conn |> get("/api/v1/push/subscription", %{}) - |> json_response(500) + |> json_response_and_validate_schema(403) end end @@ -82,9 +87,9 @@ test "returns error when user hasn't subscription", %{conn: conn} do res = conn |> get("/api/v1/push/subscription", %{}) - |> json_response(404) + |> json_response_and_validate_schema(404) - assert "Not found" == res + assert %{"error" => "Record not found"} == res end test "returns a user subsciption", %{conn: conn, user: user, token: token} do @@ -98,7 +103,7 @@ test "returns a user subsciption", %{conn: conn, user: user, token: token} do res = conn |> get("/api/v1/push/subscription", %{}) - |> json_response(200) + |> json_response_and_validate_schema(200) expect = %{ "alerts" => %{"mention" => true}, @@ -127,7 +132,7 @@ test "returns error when push disabled ", %{conn: conn} do assert_error_when_disable_push do conn |> put("/api/v1/push/subscription", %{data: %{"alerts" => %{"mention" => false}}}) - |> json_response(500) + |> json_response_and_validate_schema(403) end end @@ -137,7 +142,7 @@ test "returns updated subsciption", %{conn: conn, subscription: subscription} do |> put("/api/v1/push/subscription", %{ data: %{"alerts" => %{"mention" => false, "follow" => true}} }) - |> json_response(200) + |> json_response_and_validate_schema(200) expect = %{ "alerts" => %{"follow" => true, "mention" => false}, @@ -155,7 +160,7 @@ test "returns error when push disabled ", %{conn: conn} do assert_error_when_disable_push do conn |> delete("/api/v1/push/subscription", %{}) - |> json_response(500) + |> json_response_and_validate_schema(403) end end @@ -163,9 +168,9 @@ test "returns error when user hasn't subscription", %{conn: conn} do res = conn |> delete("/api/v1/push/subscription", %{}) - |> json_response(404) + |> json_response_and_validate_schema(404) - assert "Not found" == res + assert %{"error" => "Record not found"} == res end test "returns empty result and delete user subsciption", %{ @@ -183,7 +188,7 @@ test "returns empty result and delete user subsciption", %{ res = conn |> delete("/api/v1/push/subscription", %{}) - |> json_response(200) + |> json_response_and_validate_schema(200) assert %{} == res refute Pleroma.Repo.get(Subscription, subscription.id) diff --git a/test/web/mastodon_api/controllers/suggestion_controller_test.exs b/test/web/mastodon_api/controllers/suggestion_controller_test.exs index c697a39f8..7f08e187c 100644 --- a/test/web/mastodon_api/controllers/suggestion_controller_test.exs +++ b/test/web/mastodon_api/controllers/suggestion_controller_test.exs @@ -5,41 +5,13 @@ defmodule Pleroma.Web.MastodonAPI.SuggestionControllerTest do use Pleroma.Web.ConnCase - alias Pleroma.Config - - import Pleroma.Factory - import Tesla.Mock - setup do: oauth_access(["read"]) - setup %{user: user} do - other_user = insert(:user) - host = Config.get([Pleroma.Web.Endpoint, :url, :host]) - url500 = "http://test500?#{host}&#{user.nickname}" - url200 = "http://test200?#{host}&#{user.nickname}" - - mock(fn - %{method: :get, url: ^url500} -> - %Tesla.Env{status: 500, body: "bad request"} - - %{method: :get, url: ^url200} -> - %Tesla.Env{ - status: 200, - body: - ~s([{"acct":"yj455","avatar":"https://social.heldscal.la/avatar/201.jpeg","avatar_static":"https://social.heldscal.la/avatar/s/201.jpeg"}, {"acct":"#{ - other_user.ap_id - }","avatar":"https://social.heldscal.la/avatar/202.jpeg","avatar_static":"https://social.heldscal.la/avatar/s/202.jpeg"}]) - } - end) - - [other_user: other_user] - end - test "returns empty result", %{conn: conn} do res = conn |> get("/api/v1/suggestions") - |> json_response(200) + |> json_response_and_validate_schema(200) assert res == [] end diff --git a/test/web/mastodon_api/controllers/timeline_controller_test.exs b/test/web/mastodon_api/controllers/timeline_controller_test.exs index 6fedb4223..f8b9289f3 100644 --- a/test/web/mastodon_api/controllers/timeline_controller_test.exs +++ b/test/web/mastodon_api/controllers/timeline_controller_test.exs @@ -20,35 +20,104 @@ defmodule Pleroma.Web.MastodonAPI.TimelineControllerTest do describe "home" do setup do: oauth_access(["read:statuses"]) + test "does NOT render account/pleroma/relationship if this is disabled by default", %{ + user: user, + conn: conn + } do + clear_config([:extensions, :output_relationships_in_statuses_by_default], false) + + other_user = insert(:user) + + {:ok, _} = CommonAPI.post(other_user, %{status: "hi @#{user.nickname}"}) + + response = + conn + |> assign(:user, user) + |> get("/api/v1/timelines/home") + |> json_response_and_validate_schema(200) + + assert Enum.all?(response, fn n -> + get_in(n, ["account", "pleroma", "relationship"]) == %{} + end) + end + test "the home timeline", %{user: user, conn: conn} do - following = insert(:user) + uri = "/api/v1/timelines/home?with_relationships=1" - {:ok, _activity} = CommonAPI.post(following, %{"status" => "test"}) + following = insert(:user, nickname: "followed") + third_user = insert(:user, nickname: "repeated") - ret_conn = get(conn, "/api/v1/timelines/home") + {:ok, _activity} = CommonAPI.post(following, %{status: "post"}) + {:ok, activity} = CommonAPI.post(third_user, %{status: "repeated post"}) + {:ok, _, _} = CommonAPI.repeat(activity.id, following) - assert Enum.empty?(json_response(ret_conn, :ok)) + ret_conn = get(conn, uri) + + assert Enum.empty?(json_response_and_validate_schema(ret_conn, :ok)) {:ok, _user} = User.follow(user, following) - conn = get(conn, "/api/v1/timelines/home") + ret_conn = get(conn, uri) - assert [%{"content" => "test"}] = json_response(conn, :ok) + assert [ + %{ + "reblog" => %{ + "content" => "repeated post", + "account" => %{ + "pleroma" => %{ + "relationship" => %{"following" => false, "followed_by" => false} + } + } + }, + "account" => %{"pleroma" => %{"relationship" => %{"following" => true}}} + }, + %{ + "content" => "post", + "account" => %{ + "acct" => "followed", + "pleroma" => %{"relationship" => %{"following" => true}} + } + } + ] = json_response_and_validate_schema(ret_conn, :ok) + + {:ok, _user} = User.follow(third_user, user) + + ret_conn = get(conn, uri) + + assert [ + %{ + "reblog" => %{ + "content" => "repeated post", + "account" => %{ + "acct" => "repeated", + "pleroma" => %{ + "relationship" => %{"following" => false, "followed_by" => true} + } + } + }, + "account" => %{"pleroma" => %{"relationship" => %{"following" => true}}} + }, + %{ + "content" => "post", + "account" => %{ + "acct" => "followed", + "pleroma" => %{"relationship" => %{"following" => true}} + } + } + ] = json_response_and_validate_schema(ret_conn, :ok) end test "the home timeline when the direct messages are excluded", %{user: user, conn: conn} do - {:ok, public_activity} = CommonAPI.post(user, %{"status" => ".", "visibility" => "public"}) - {:ok, direct_activity} = CommonAPI.post(user, %{"status" => ".", "visibility" => "direct"}) + {:ok, public_activity} = CommonAPI.post(user, %{status: ".", visibility: "public"}) + {:ok, direct_activity} = CommonAPI.post(user, %{status: ".", visibility: "direct"}) - {:ok, unlisted_activity} = - CommonAPI.post(user, %{"status" => ".", "visibility" => "unlisted"}) + {:ok, unlisted_activity} = CommonAPI.post(user, %{status: ".", visibility: "unlisted"}) - {:ok, private_activity} = - CommonAPI.post(user, %{"status" => ".", "visibility" => "private"}) + {:ok, private_activity} = CommonAPI.post(user, %{status: ".", visibility: "private"}) - conn = get(conn, "/api/v1/timelines/home", %{"exclude_visibilities" => ["direct"]}) + conn = get(conn, "/api/v1/timelines/home?exclude_visibilities[]=direct") - assert status_ids = json_response(conn, :ok) |> Enum.map(& &1["id"]) + assert status_ids = json_response_and_validate_schema(conn, :ok) |> Enum.map(& &1["id"]) assert public_activity.id in status_ids assert unlisted_activity.id in status_ids assert private_activity.id in status_ids @@ -61,33 +130,33 @@ test "the home timeline when the direct messages are excluded", %{user: user, co test "the public timeline", %{conn: conn} do following = insert(:user) - {:ok, _activity} = CommonAPI.post(following, %{"status" => "test"}) + {:ok, _activity} = CommonAPI.post(following, %{status: "test"}) _activity = insert(:note_activity, local: false) - conn = get(conn, "/api/v1/timelines/public", %{"local" => "False"}) + conn = get(conn, "/api/v1/timelines/public?local=False") - assert length(json_response(conn, :ok)) == 2 + assert length(json_response_and_validate_schema(conn, :ok)) == 2 - conn = get(build_conn(), "/api/v1/timelines/public", %{"local" => "True"}) + conn = get(build_conn(), "/api/v1/timelines/public?local=True") - assert [%{"content" => "test"}] = json_response(conn, :ok) + assert [%{"content" => "test"}] = json_response_and_validate_schema(conn, :ok) - conn = get(build_conn(), "/api/v1/timelines/public", %{"local" => "1"}) + conn = get(build_conn(), "/api/v1/timelines/public?local=1") - assert [%{"content" => "test"}] = json_response(conn, :ok) + assert [%{"content" => "test"}] = json_response_and_validate_schema(conn, :ok) end test "the public timeline includes only public statuses for an authenticated user" do %{user: user, conn: conn} = oauth_access(["read:statuses"]) - {:ok, _activity} = CommonAPI.post(user, %{"status" => "test"}) - {:ok, _activity} = CommonAPI.post(user, %{"status" => "test", "visibility" => "private"}) - {:ok, _activity} = CommonAPI.post(user, %{"status" => "test", "visibility" => "unlisted"}) - {:ok, _activity} = CommonAPI.post(user, %{"status" => "test", "visibility" => "direct"}) + {:ok, _activity} = CommonAPI.post(user, %{status: "test"}) + {:ok, _activity} = CommonAPI.post(user, %{status: "test", visibility: "private"}) + {:ok, _activity} = CommonAPI.post(user, %{status: "test", visibility: "unlisted"}) + {:ok, _activity} = CommonAPI.post(user, %{status: "test", visibility: "direct"}) res_conn = get(conn, "/api/v1/timelines/public") - assert length(json_response(res_conn, 200)) == 1 + assert length(json_response_and_validate_schema(res_conn, 200)) == 1 end end @@ -105,15 +174,15 @@ defp local_and_remote_activities do setup do: clear_config([:restrict_unauthenticated, :timelines, :federated], true) test "if user is unauthenticated", %{conn: conn} do - res_conn = get(conn, "/api/v1/timelines/public", %{"local" => "true"}) + res_conn = get(conn, "/api/v1/timelines/public?local=true") - assert json_response(res_conn, :unauthorized) == %{ + assert json_response_and_validate_schema(res_conn, :unauthorized) == %{ "error" => "authorization required for timeline view" } - res_conn = get(conn, "/api/v1/timelines/public", %{"local" => "false"}) + res_conn = get(conn, "/api/v1/timelines/public?local=false") - assert json_response(res_conn, :unauthorized) == %{ + assert json_response_and_validate_schema(res_conn, :unauthorized) == %{ "error" => "authorization required for timeline view" } end @@ -121,11 +190,11 @@ test "if user is unauthenticated", %{conn: conn} do test "if user is authenticated" do %{conn: conn} = oauth_access(["read:statuses"]) - res_conn = get(conn, "/api/v1/timelines/public", %{"local" => "true"}) - assert length(json_response(res_conn, 200)) == 1 + res_conn = get(conn, "/api/v1/timelines/public?local=true") + assert length(json_response_and_validate_schema(res_conn, 200)) == 1 - res_conn = get(conn, "/api/v1/timelines/public", %{"local" => "false"}) - assert length(json_response(res_conn, 200)) == 2 + res_conn = get(conn, "/api/v1/timelines/public?local=false") + assert length(json_response_and_validate_schema(res_conn, 200)) == 2 end end @@ -135,24 +204,24 @@ test "if user is authenticated" do setup do: clear_config([:restrict_unauthenticated, :timelines, :local], true) test "if user is unauthenticated", %{conn: conn} do - res_conn = get(conn, "/api/v1/timelines/public", %{"local" => "true"}) + res_conn = get(conn, "/api/v1/timelines/public?local=true") - assert json_response(res_conn, :unauthorized) == %{ + assert json_response_and_validate_schema(res_conn, :unauthorized) == %{ "error" => "authorization required for timeline view" } - res_conn = get(conn, "/api/v1/timelines/public", %{"local" => "false"}) - assert length(json_response(res_conn, 200)) == 2 + res_conn = get(conn, "/api/v1/timelines/public?local=false") + assert length(json_response_and_validate_schema(res_conn, 200)) == 2 end test "if user is authenticated", %{conn: _conn} do %{conn: conn} = oauth_access(["read:statuses"]) - res_conn = get(conn, "/api/v1/timelines/public", %{"local" => "true"}) - assert length(json_response(res_conn, 200)) == 1 + res_conn = get(conn, "/api/v1/timelines/public?local=true") + assert length(json_response_and_validate_schema(res_conn, 200)) == 1 - res_conn = get(conn, "/api/v1/timelines/public", %{"local" => "false"}) - assert length(json_response(res_conn, 200)) == 2 + res_conn = get(conn, "/api/v1/timelines/public?local=false") + assert length(json_response_and_validate_schema(res_conn, 200)) == 2 end end @@ -162,12 +231,12 @@ test "if user is authenticated", %{conn: _conn} do setup do: clear_config([:restrict_unauthenticated, :timelines, :federated], true) test "if user is unauthenticated", %{conn: conn} do - res_conn = get(conn, "/api/v1/timelines/public", %{"local" => "true"}) - assert length(json_response(res_conn, 200)) == 1 + res_conn = get(conn, "/api/v1/timelines/public?local=true") + assert length(json_response_and_validate_schema(res_conn, 200)) == 1 - res_conn = get(conn, "/api/v1/timelines/public", %{"local" => "false"}) + res_conn = get(conn, "/api/v1/timelines/public?local=false") - assert json_response(res_conn, :unauthorized) == %{ + assert json_response_and_validate_schema(res_conn, :unauthorized) == %{ "error" => "authorization required for timeline view" } end @@ -175,11 +244,11 @@ test "if user is unauthenticated", %{conn: conn} do test "if user is authenticated", %{conn: _conn} do %{conn: conn} = oauth_access(["read:statuses"]) - res_conn = get(conn, "/api/v1/timelines/public", %{"local" => "true"}) - assert length(json_response(res_conn, 200)) == 1 + res_conn = get(conn, "/api/v1/timelines/public?local=true") + assert length(json_response_and_validate_schema(res_conn, 200)) == 1 - res_conn = get(conn, "/api/v1/timelines/public", %{"local" => "false"}) - assert length(json_response(res_conn, 200)) == 2 + res_conn = get(conn, "/api/v1/timelines/public?local=false") + assert length(json_response_and_validate_schema(res_conn, 200)) == 2 end end @@ -192,14 +261,14 @@ test "direct timeline", %{conn: conn} do {:ok, direct} = CommonAPI.post(user_one, %{ - "status" => "Hi @#{user_two.nickname}!", - "visibility" => "direct" + status: "Hi @#{user_two.nickname}!", + visibility: "direct" }) {:ok, _follower_only} = CommonAPI.post(user_one, %{ - "status" => "Hi @#{user_two.nickname}!", - "visibility" => "private" + status: "Hi @#{user_two.nickname}!", + visibility: "private" }) conn_user_two = @@ -210,7 +279,7 @@ test "direct timeline", %{conn: conn} do # Only direct should be visible here res_conn = get(conn_user_two, "api/v1/timelines/direct") - [status] = json_response(res_conn, :ok) + assert [status] = json_response_and_validate_schema(res_conn, :ok) assert %{"visibility" => "direct"} = status assert status["url"] != direct.data["id"] @@ -222,33 +291,34 @@ test "direct timeline", %{conn: conn} do |> assign(:token, insert(:oauth_token, user: user_one, scopes: ["read:statuses"])) |> get("api/v1/timelines/direct") - [status] = json_response(res_conn, :ok) + [status] = json_response_and_validate_schema(res_conn, :ok) assert %{"visibility" => "direct"} = status # Both should be visible here res_conn = get(conn_user_two, "api/v1/timelines/home") - [_s1, _s2] = json_response(res_conn, :ok) + [_s1, _s2] = json_response_and_validate_schema(res_conn, :ok) # Test pagination Enum.each(1..20, fn _ -> {:ok, _} = CommonAPI.post(user_one, %{ - "status" => "Hi @#{user_two.nickname}!", - "visibility" => "direct" + status: "Hi @#{user_two.nickname}!", + visibility: "direct" }) end) res_conn = get(conn_user_two, "api/v1/timelines/direct") - statuses = json_response(res_conn, :ok) + statuses = json_response_and_validate_schema(res_conn, :ok) assert length(statuses) == 20 - res_conn = - get(conn_user_two, "api/v1/timelines/direct", %{max_id: List.last(statuses)["id"]}) + max_id = List.last(statuses)["id"] - [status] = json_response(res_conn, :ok) + res_conn = get(conn_user_two, "api/v1/timelines/direct?max_id=#{max_id}") + + assert [status] = json_response_and_validate_schema(res_conn, :ok) assert status["url"] != direct.data["id"] end @@ -261,19 +331,19 @@ test "doesn't include DMs from blocked users" do {:ok, _blocked_direct} = CommonAPI.post(blocked, %{ - "status" => "Hi @#{blocker.nickname}!", - "visibility" => "direct" + status: "Hi @#{blocker.nickname}!", + visibility: "direct" }) {:ok, direct} = CommonAPI.post(other_user, %{ - "status" => "Hi @#{blocker.nickname}!", - "visibility" => "direct" + status: "Hi @#{blocker.nickname}!", + visibility: "direct" }) res_conn = get(conn, "api/v1/timelines/direct") - [status] = json_response(res_conn, :ok) + [status] = json_response_and_validate_schema(res_conn, :ok) assert status["id"] == direct.id end end @@ -283,14 +353,14 @@ test "doesn't include DMs from blocked users" do test "list timeline", %{user: user, conn: conn} do other_user = insert(:user) - {:ok, _activity_one} = CommonAPI.post(user, %{"status" => "Marisa is cute."}) - {:ok, activity_two} = CommonAPI.post(other_user, %{"status" => "Marisa is cute."}) + {:ok, _activity_one} = CommonAPI.post(user, %{status: "Marisa is cute."}) + {:ok, activity_two} = CommonAPI.post(other_user, %{status: "Marisa is cute."}) {:ok, list} = Pleroma.List.create("name", user) {:ok, list} = Pleroma.List.follow(list, other_user) conn = get(conn, "/api/v1/timelines/list/#{list.id}") - assert [%{"id" => id}] = json_response(conn, :ok) + assert [%{"id" => id}] = json_response_and_validate_schema(conn, :ok) assert id == to_string(activity_two.id) end @@ -300,12 +370,12 @@ test "list timeline does not leak non-public statuses for unfollowed users", %{ conn: conn } do other_user = insert(:user) - {:ok, activity_one} = CommonAPI.post(other_user, %{"status" => "Marisa is cute."}) + {:ok, activity_one} = CommonAPI.post(other_user, %{status: "Marisa is cute."}) {:ok, _activity_two} = CommonAPI.post(other_user, %{ - "status" => "Marisa is cute.", - "visibility" => "private" + status: "Marisa is cute.", + visibility: "private" }) {:ok, list} = Pleroma.List.create("name", user) @@ -313,7 +383,7 @@ test "list timeline does not leak non-public statuses for unfollowed users", %{ conn = get(conn, "/api/v1/timelines/list/#{list.id}") - assert [%{"id" => id}] = json_response(conn, :ok) + assert [%{"id" => id}] = json_response_and_validate_schema(conn, :ok) assert id == to_string(activity_one.id) end @@ -326,18 +396,18 @@ test "list timeline does not leak non-public statuses for unfollowed users", %{ test "hashtag timeline", %{conn: conn} do following = insert(:user) - {:ok, activity} = CommonAPI.post(following, %{"status" => "test #2hu"}) + {:ok, activity} = CommonAPI.post(following, %{status: "test #2hu"}) nconn = get(conn, "/api/v1/timelines/tag/2hu") - assert [%{"id" => id}] = json_response(nconn, :ok) + assert [%{"id" => id}] = json_response_and_validate_schema(nconn, :ok) assert id == to_string(activity.id) # works for different capitalization too nconn = get(conn, "/api/v1/timelines/tag/2HU") - assert [%{"id" => id}] = json_response(nconn, :ok) + assert [%{"id" => id}] = json_response_and_validate_schema(nconn, :ok) assert id == to_string(activity.id) end @@ -345,26 +415,25 @@ test "hashtag timeline", %{conn: conn} do test "multi-hashtag timeline", %{conn: conn} do user = insert(:user) - {:ok, activity_test} = CommonAPI.post(user, %{"status" => "#test"}) - {:ok, activity_test1} = CommonAPI.post(user, %{"status" => "#test #test1"}) - {:ok, activity_none} = CommonAPI.post(user, %{"status" => "#test #none"}) + {:ok, activity_test} = CommonAPI.post(user, %{status: "#test"}) + {:ok, activity_test1} = CommonAPI.post(user, %{status: "#test #test1"}) + {:ok, activity_none} = CommonAPI.post(user, %{status: "#test #none"}) - any_test = get(conn, "/api/v1/timelines/tag/test", %{"any" => ["test1"]}) + any_test = get(conn, "/api/v1/timelines/tag/test?any[]=test1") - [status_none, status_test1, status_test] = json_response(any_test, :ok) + [status_none, status_test1, status_test] = json_response_and_validate_schema(any_test, :ok) assert to_string(activity_test.id) == status_test["id"] assert to_string(activity_test1.id) == status_test1["id"] assert to_string(activity_none.id) == status_none["id"] - restricted_test = - get(conn, "/api/v1/timelines/tag/test", %{"all" => ["test1"], "none" => ["none"]}) + restricted_test = get(conn, "/api/v1/timelines/tag/test?all[]=test1&none[]=none") - assert [status_test1] == json_response(restricted_test, :ok) + assert [status_test1] == json_response_and_validate_schema(restricted_test, :ok) - all_test = get(conn, "/api/v1/timelines/tag/test", %{"all" => ["none"]}) + all_test = get(conn, "/api/v1/timelines/tag/test?all[]=none") - assert [status_none] == json_response(all_test, :ok) + assert [status_none] == json_response_and_validate_schema(all_test, :ok) end end end diff --git a/test/web/mastodon_api/mastodon_api_controller_test.exs b/test/web/mastodon_api/mastodon_api_controller_test.exs index 75f184242..bb4bc4396 100644 --- a/test/web/mastodon_api/mastodon_api_controller_test.exs +++ b/test/web/mastodon_api/mastodon_api_controller_test.exs @@ -7,35 +7,28 @@ defmodule Pleroma.Web.MastodonAPI.MastodonAPIControllerTest do describe "empty_array/2 (stubs)" do test "GET /api/v1/accounts/:id/identity_proofs" do - %{user: user, conn: conn} = oauth_access(["n/a"]) + %{user: user, conn: conn} = oauth_access(["read:accounts"]) - res = - conn - |> assign(:user, user) - |> get("/api/v1/accounts/#{user.id}/identity_proofs") - |> json_response(200) - - assert res == [] + assert [] == + conn + |> get("/api/v1/accounts/#{user.id}/identity_proofs") + |> json_response(200) end test "GET /api/v1/endorsements" do %{conn: conn} = oauth_access(["read:accounts"]) - res = - conn - |> get("/api/v1/endorsements") - |> json_response(200) - - assert res == [] + assert [] == + conn + |> get("/api/v1/endorsements") + |> json_response(200) end test "GET /api/v1/trends", %{conn: conn} do - res = - conn - |> get("/api/v1/trends") - |> json_response(200) - - assert res == [] + assert [] == + conn + |> get("/api/v1/trends") + |> json_response(200) end end end diff --git a/test/web/mastodon_api/mastodon_api_test.exs b/test/web/mastodon_api/mastodon_api_test.exs index cb971806a..a7f9c5205 100644 --- a/test/web/mastodon_api/mastodon_api_test.exs +++ b/test/web/mastodon_api/mastodon_api_test.exs @@ -75,9 +75,9 @@ test "returns notifications for user" do User.subscribe(subscriber, user) - {:ok, status} = CommonAPI.post(user, %{"status" => "Akariiiin"}) + {:ok, status} = CommonAPI.post(user, %{status: "Akariiiin"}) - {:ok, status1} = CommonAPI.post(user, %{"status" => "Magi"}) + {:ok, status1} = CommonAPI.post(user, %{status: "Magi"}) {:ok, [notification]} = Notification.create_notifications(status) {:ok, [notification1]} = Notification.create_notifications(status1) res = MastodonAPI.get_notifications(subscriber) diff --git a/test/web/mastodon_api/views/account_view_test.exs b/test/web/mastodon_api/views/account_view_test.exs index 983886c6b..69ddbb5d4 100644 --- a/test/web/mastodon_api/views/account_view_test.exs +++ b/test/web/mastodon_api/views/account_view_test.exs @@ -4,22 +4,21 @@ defmodule Pleroma.Web.MastodonAPI.AccountViewTest do use Pleroma.DataCase - import Pleroma.Factory + alias Pleroma.User + alias Pleroma.UserRelationship alias Pleroma.Web.CommonAPI alias Pleroma.Web.MastodonAPI.AccountView - test "Represent a user account" do - source_data = %{ - "tag" => [ - %{ - "type" => "Emoji", - "icon" => %{"url" => "/file.png"}, - "name" => ":karjalanpiirakka:" - } - ] - } + import Pleroma.Factory + import Tesla.Mock + setup do + mock(fn env -> apply(HttpRequestMock, :request, [env]) end) + :ok + end + + test "Represent a user account" do background_image = %{ "url" => [%{"href" => "https://example.com/images/asuka_hospital.png"}] } @@ -28,13 +27,13 @@ test "Represent a user account" do insert(:user, %{ follower_count: 3, note_count: 5, - source_data: source_data, background: background_image, nickname: "shp@shitposter.club", name: ":karjalanpiirakka: shp", bio: - "valid html. a
b
c
d
f", - inserted_at: ~N[2017-08-15 15:47:06.597036] + "valid html. a
b
c
d
f '&<>\"", + inserted_at: ~N[2017-08-15 15:47:06.597036], + emoji: %{"karjalanpiirakka" => "/file.png"} }) expected = %{ @@ -47,7 +46,7 @@ test "Represent a user account" do followers_count: 3, following_count: 0, statuses_count: 5, - note: "valid html. a
b
c
d
f", + note: "valid html. a
b
c
d
f '&<>"", url: user.ap_id, avatar: "http://localhost:4001/images/avi.png", avatar_static: "http://localhost:4001/images/avi.png", @@ -64,7 +63,7 @@ test "Represent a user account" do fields: [], bot: false, source: %{ - note: "valid html. a\nb\nc\nd\nf", + note: "valid html. a\nb\nc\nd\nf '&<>\"", sensitive: false, pleroma: %{ actor_type: "Person", @@ -94,7 +93,14 @@ test "Represent a user account" do test "Represent the user account for the account owner" do user = insert(:user) - notification_settings = %Pleroma.User.NotificationSetting{} + notification_settings = %{ + followers: true, + follows: true, + non_followers: true, + non_follows: true, + privacy_option: false + } + privacy = user.default_scope assert %{ @@ -108,7 +114,6 @@ test "Represent a Service(bot) account" do insert(:user, %{ follower_count: 3, note_count: 5, - source_data: %{}, actor_type: "Service", nickname: "shp@shitposter.club", inserted_at: ~N[2017-08-15 15:47:06.597036] @@ -161,6 +166,17 @@ test "Represent a Service(bot) account" do assert expected == AccountView.render("show.json", %{user: user}) end + test "Represent a Funkwhale channel" do + {:ok, user} = + User.get_or_fetch_by_ap_id( + "https://channels.tests.funkwhale.audio/federation/actors/compositions" + ) + + assert represented = AccountView.render("show.json", %{user: user}) + assert represented.acct == "compositions@channels.tests.funkwhale.audio" + assert represented.url == "https://channels.tests.funkwhale.audio/channels/compositions" + end + test "Represent a deactivated user for an admin" do admin = insert(:user, is_admin: true) deactivated_user = insert(:user, deactivated: true) @@ -182,6 +198,32 @@ test "Represent a smaller mention" do end describe "relationship" do + defp test_relationship_rendering(user, other_user, expected_result) do + opts = %{user: user, target: other_user, relationships: nil} + assert expected_result == AccountView.render("relationship.json", opts) + + relationships_opt = UserRelationship.view_relationships_option(user, [other_user]) + opts = Map.put(opts, :relationships, relationships_opt) + assert expected_result == AccountView.render("relationship.json", opts) + + assert [expected_result] == + AccountView.render("relationships.json", %{user: user, targets: [other_user]}) + end + + @blank_response %{ + following: false, + followed_by: false, + blocking: false, + blocked_by: false, + muting: false, + muting_notifications: false, + subscribing: false, + requested: false, + domain_blocking: false, + showing_reblogs: true, + endorsed: false + } + test "represent a relationship for the following and followed user" do user = insert(:user) other_user = insert(:user) @@ -192,23 +234,21 @@ test "represent a relationship for the following and followed user" do {:ok, _user_relationships} = User.mute(user, other_user, true) {:ok, _reblog_mute} = CommonAPI.hide_reblogs(user, other_user) - expected = %{ - id: to_string(other_user.id), - following: true, - followed_by: true, - blocking: false, - blocked_by: false, - muting: true, - muting_notifications: true, - subscribing: true, - requested: false, - domain_blocking: false, - showing_reblogs: false, - endorsed: false - } + expected = + Map.merge( + @blank_response, + %{ + following: true, + followed_by: true, + muting: true, + muting_notifications: true, + subscribing: true, + showing_reblogs: false, + id: to_string(other_user.id) + } + ) - assert expected == - AccountView.render("relationship.json", %{user: user, target: other_user}) + test_relationship_rendering(user, other_user, expected) end test "represent a relationship for the blocking and blocked user" do @@ -220,23 +260,13 @@ test "represent a relationship for the blocking and blocked user" do {:ok, _user_relationship} = User.block(user, other_user) {:ok, _user_relationship} = User.block(other_user, user) - expected = %{ - id: to_string(other_user.id), - following: false, - followed_by: false, - blocking: true, - blocked_by: true, - muting: false, - muting_notifications: false, - subscribing: false, - requested: false, - domain_blocking: false, - showing_reblogs: true, - endorsed: false - } + expected = + Map.merge( + @blank_response, + %{following: false, blocking: true, blocked_by: true, id: to_string(other_user.id)} + ) - assert expected == - AccountView.render("relationship.json", %{user: user, target: other_user}) + test_relationship_rendering(user, other_user, expected) end test "represent a relationship for the user blocking a domain" do @@ -245,8 +275,13 @@ test "represent a relationship for the user blocking a domain" do {:ok, user} = User.block_domain(user, "bad.site") - assert %{domain_blocking: true, blocking: false} = - AccountView.render("relationship.json", %{user: user, target: other_user}) + expected = + Map.merge( + @blank_response, + %{domain_blocking: true, blocking: false, id: to_string(other_user.id)} + ) + + test_relationship_rendering(user, other_user, expected) end test "represent a relationship for the user with a pending follow request" do @@ -257,23 +292,13 @@ test "represent a relationship for the user with a pending follow request" do user = User.get_cached_by_id(user.id) other_user = User.get_cached_by_id(other_user.id) - expected = %{ - id: to_string(other_user.id), - following: false, - followed_by: false, - blocking: false, - blocked_by: false, - muting: false, - muting_notifications: false, - subscribing: false, - requested: true, - domain_blocking: false, - showing_reblogs: true, - endorsed: false - } + expected = + Map.merge( + @blank_response, + %{requested: true, following: false, id: to_string(other_user.id)} + ) - assert expected == - AccountView.render("relationship.json", %{user: user, target: other_user}) + test_relationship_rendering(user, other_user, expected) end end @@ -282,7 +307,6 @@ test "represent an embedded relationship" do insert(:user, %{ follower_count: 0, note_count: 5, - source_data: %{}, actor_type: "Service", nickname: "shp@shitposter.club", inserted_at: ~N[2017-08-15 15:47:06.597036] @@ -435,8 +459,8 @@ test "shows unread_conversation_count only to the account owner" do {:ok, _activity} = CommonAPI.post(other_user, %{ - "status" => "Hey @#{user.nickname}.", - "visibility" => "direct" + status: "Hey @#{user.nickname}.", + visibility: "direct" }) user = User.get_cached_by_ap_id(user.ap_id) @@ -449,6 +473,24 @@ test "shows unread_conversation_count only to the account owner" do :unread_conversation_count ] == 1 end + + test "shows unread_count only to the account owner" do + user = insert(:user) + insert_list(7, :notification, user: user) + other_user = insert(:user) + + user = User.get_cached_by_ap_id(user.ap_id) + + assert AccountView.render( + "show.json", + %{user: user, for: other_user} + )[:pleroma][:unread_notifications_count] == nil + + assert AccountView.render( + "show.json", + %{user: user, for: user} + )[:pleroma][:unread_notifications_count] == 7 + end end describe "follow requests counter" do diff --git a/test/web/mastodon_api/views/conversation_view_test.exs b/test/web/mastodon_api/views/conversation_view_test.exs index dbf3c51e2..6f84366f8 100644 --- a/test/web/mastodon_api/views/conversation_view_test.exs +++ b/test/web/mastodon_api/views/conversation_view_test.exs @@ -16,7 +16,7 @@ test "represents a Mastodon Conversation entity" do other_user = insert(:user) {:ok, activity} = - CommonAPI.post(user, %{"status" => "hey @#{other_user.nickname}", "visibility" => "direct"}) + CommonAPI.post(user, %{status: "hey @#{other_user.nickname}", visibility: "direct"}) [participation] = Participation.for_user_with_last_activity_id(user) diff --git a/test/web/mastodon_api/views/marker_view_test.exs b/test/web/mastodon_api/views/marker_view_test.exs index 893cf8857..48a0a6d33 100644 --- a/test/web/mastodon_api/views/marker_view_test.exs +++ b/test/web/mastodon_api/views/marker_view_test.exs @@ -8,19 +8,21 @@ defmodule Pleroma.Web.MastodonAPI.MarkerViewTest do import Pleroma.Factory test "returns markers" do - marker1 = insert(:marker, timeline: "notifications", last_read_id: "17") + marker1 = insert(:marker, timeline: "notifications", last_read_id: "17", unread_count: 5) marker2 = insert(:marker, timeline: "home", last_read_id: "42") assert MarkerView.render("markers.json", %{markers: [marker1, marker2]}) == %{ "home" => %{ last_read_id: "42", updated_at: NaiveDateTime.to_iso8601(marker2.updated_at), - version: 0 + version: 0, + pleroma: %{unread_count: 0} }, "notifications" => %{ last_read_id: "17", updated_at: NaiveDateTime.to_iso8601(marker1.updated_at), - version: 0 + version: 0, + pleroma: %{unread_count: 5} } } end diff --git a/test/web/mastodon_api/views/notification_view_test.exs b/test/web/mastodon_api/views/notification_view_test.exs index d04c3022f..04a774d17 100644 --- a/test/web/mastodon_api/views/notification_view_test.exs +++ b/test/web/mastodon_api/views/notification_view_test.exs @@ -16,10 +16,25 @@ defmodule Pleroma.Web.MastodonAPI.NotificationViewTest do alias Pleroma.Web.MastodonAPI.StatusView import Pleroma.Factory + defp test_notifications_rendering(notifications, user, expected_result) do + result = NotificationView.render("index.json", %{notifications: notifications, for: user}) + + assert expected_result == result + + result = + NotificationView.render("index.json", %{ + notifications: notifications, + for: user, + relationships: nil + }) + + assert expected_result == result + end + test "Mention notification" do user = insert(:user) mentioned_user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "hey @#{mentioned_user.nickname}"}) + {:ok, activity} = CommonAPI.post(user, %{status: "hey @#{mentioned_user.nickname}"}) {:ok, [notification]} = Notification.create_notifications(activity) user = User.get_cached_by_id(user.id) @@ -32,17 +47,14 @@ test "Mention notification" do created_at: Utils.to_masto_date(notification.inserted_at) } - result = - NotificationView.render("index.json", %{notifications: [notification], for: mentioned_user}) - - assert [expected] == result + test_notifications_rendering([notification], mentioned_user, [expected]) end test "Favourite notification" do user = insert(:user) another_user = insert(:user) - {:ok, create_activity} = CommonAPI.post(user, %{"status" => "hey"}) - {:ok, favorite_activity, _object} = CommonAPI.favorite(create_activity.id, another_user) + {:ok, create_activity} = CommonAPI.post(user, %{status: "hey"}) + {:ok, favorite_activity} = CommonAPI.favorite(another_user, create_activity.id) {:ok, [notification]} = Notification.create_notifications(favorite_activity) create_activity = Activity.get_by_id(create_activity.id) @@ -55,15 +67,13 @@ test "Favourite notification" do created_at: Utils.to_masto_date(notification.inserted_at) } - result = NotificationView.render("index.json", %{notifications: [notification], for: user}) - - assert [expected] == result + test_notifications_rendering([notification], user, [expected]) end test "Reblog notification" do user = insert(:user) another_user = insert(:user) - {:ok, create_activity} = CommonAPI.post(user, %{"status" => "hey"}) + {:ok, create_activity} = CommonAPI.post(user, %{status: "hey"}) {:ok, reblog_activity, _object} = CommonAPI.repeat(create_activity.id, another_user) {:ok, [notification]} = Notification.create_notifications(reblog_activity) reblog_activity = Activity.get_by_id(create_activity.id) @@ -77,9 +87,7 @@ test "Reblog notification" do created_at: Utils.to_masto_date(notification.inserted_at) } - result = NotificationView.render("index.json", %{notifications: [notification], for: user}) - - assert [expected] == result + test_notifications_rendering([notification], user, [expected]) end test "Follow notification" do @@ -96,23 +104,32 @@ test "Follow notification" do created_at: Utils.to_masto_date(notification.inserted_at) } - result = - NotificationView.render("index.json", %{notifications: [notification], for: followed}) - - assert [expected] == result + test_notifications_rendering([notification], followed, [expected]) User.perform(:delete, follower) notification = Notification |> Repo.one() |> Repo.preload(:activity) - assert [] == - NotificationView.render("index.json", %{notifications: [notification], for: followed}) + test_notifications_rendering([notification], followed, []) end + @tag capture_log: true test "Move notification" do old_user = insert(:user) new_user = insert(:user, also_known_as: [old_user.ap_id]) follower = insert(:user) + old_user_url = old_user.ap_id + + body = + File.read!("test/fixtures/users_mock/localhost.json") + |> String.replace("{{nickname}}", old_user.nickname) + |> Jason.encode!() + + Tesla.Mock.mock(fn + %{method: :get, url: ^old_user_url} -> + %Tesla.Env{status: 200, body: body} + end) + User.follow(follower, old_user) Pleroma.Web.ActivityPub.ActivityPub.move(old_user, new_user) Pleroma.Tests.ObanHelpers.perform_all() @@ -131,16 +148,15 @@ test "Move notification" do created_at: Utils.to_masto_date(notification.inserted_at) } - assert [expected] == - NotificationView.render("index.json", %{notifications: [notification], for: follower}) + test_notifications_rendering([notification], follower, [expected]) end test "EmojiReact notification" do user = insert(:user) other_user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "#cofe"}) - {:ok, _activity, _} = CommonAPI.react_with_emoji(activity.id, other_user, "☕") + {:ok, activity} = CommonAPI.post(user, %{status: "#cofe"}) + {:ok, _activity} = CommonAPI.react_with_emoji(activity.id, other_user, "☕") activity = Repo.get(Activity, activity.id) @@ -158,7 +174,6 @@ test "EmojiReact notification" do created_at: Utils.to_masto_date(notification.inserted_at) } - assert expected == - NotificationView.render("show.json", %{notification: notification, for: user}) + test_notifications_rendering([notification], user, [expected]) end end diff --git a/test/web/mastodon_api/views/poll_view_test.exs b/test/web/mastodon_api/views/poll_view_test.exs index 6211fa888..76672f36c 100644 --- a/test/web/mastodon_api/views/poll_view_test.exs +++ b/test/web/mastodon_api/views/poll_view_test.exs @@ -22,10 +22,10 @@ test "renders a poll" do {:ok, activity} = CommonAPI.post(user, %{ - "status" => "Is Tenshi eating a corndog cute?", - "poll" => %{ - "options" => ["absolutely!", "sure", "yes", "why are you even asking?"], - "expires_in" => 20 + status: "Is Tenshi eating a corndog cute?", + poll: %{ + options: ["absolutely!", "sure", "yes", "why are you even asking?"], + expires_in: 20 } }) @@ -43,7 +43,8 @@ test "renders a poll" do %{title: "why are you even asking?", votes_count: 0} ], voted: false, - votes_count: 0 + votes_count: 0, + voters_count: nil } result = PollView.render("show.json", %{object: object}) @@ -61,17 +62,28 @@ test "detects if it is multiple choice" do {:ok, activity} = CommonAPI.post(user, %{ - "status" => "Which Mastodon developer is your favourite?", - "poll" => %{ - "options" => ["Gargron", "Eugen"], - "expires_in" => 20, - "multiple" => true + status: "Which Mastodon developer is your favourite?", + poll: %{ + options: ["Gargron", "Eugen"], + expires_in: 20, + multiple: true } }) + voter = insert(:user) + object = Object.normalize(activity) - assert %{multiple: true} = PollView.render("show.json", %{object: object}) + {:ok, _votes, object} = CommonAPI.vote(voter, object, [0, 1]) + + assert match?( + %{ + multiple: true, + voters_count: 1, + votes_count: 2 + }, + PollView.render("show.json", %{object: object}) + ) end test "detects emoji" do @@ -79,10 +91,10 @@ test "detects emoji" do {:ok, activity} = CommonAPI.post(user, %{ - "status" => "What's with the smug face?", - "poll" => %{ - "options" => [":blank: sip", ":blank::blank: sip", ":blank::blank::blank: sip"], - "expires_in" => 20 + status: "What's with the smug face?", + poll: %{ + options: [":blank: sip", ":blank::blank: sip", ":blank::blank::blank: sip"], + expires_in: 20 } }) @@ -97,11 +109,11 @@ test "detects vote status" do {:ok, activity} = CommonAPI.post(user, %{ - "status" => "Which input devices do you use?", - "poll" => %{ - "options" => ["mouse", "trackball", "trackpoint"], - "multiple" => true, - "expires_in" => 20 + status: "Which input devices do you use?", + poll: %{ + options: ["mouse", "trackball", "trackpoint"], + multiple: true, + expires_in: 20 } }) diff --git a/test/web/mastodon_api/views/scheduled_activity_view_test.exs b/test/web/mastodon_api/views/scheduled_activity_view_test.exs index 0c0987593..fbfd873ef 100644 --- a/test/web/mastodon_api/views/scheduled_activity_view_test.exs +++ b/test/web/mastodon_api/views/scheduled_activity_view_test.exs @@ -14,7 +14,7 @@ defmodule Pleroma.Web.MastodonAPI.ScheduledActivityViewTest do test "A scheduled activity with a media attachment" do user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "hi"}) + {:ok, activity} = CommonAPI.post(user, %{status: "hi"}) scheduled_at = NaiveDateTime.utc_now() @@ -47,7 +47,7 @@ test "A scheduled activity with a media attachment" do expected = %{ id: to_string(scheduled_activity.id), media_attachments: - %{"media_ids" => [upload.id]} + %{media_ids: [upload.id]} |> Utils.attachments_from_ids() |> Enum.map(&StatusView.render("attachment.json", %{attachment: &1})), params: %{ diff --git a/test/web/mastodon_api/views/status_view_test.exs b/test/web/mastodon_api/views/status_view_test.exs index 191895c6f..ffad65b01 100644 --- a/test/web/mastodon_api/views/status_view_test.exs +++ b/test/web/mastodon_api/views/status_view_test.exs @@ -12,12 +12,15 @@ defmodule Pleroma.Web.MastodonAPI.StatusViewTest do alias Pleroma.Object alias Pleroma.Repo alias Pleroma.User + alias Pleroma.UserRelationship alias Pleroma.Web.CommonAPI alias Pleroma.Web.CommonAPI.Utils alias Pleroma.Web.MastodonAPI.AccountView alias Pleroma.Web.MastodonAPI.StatusView + import Pleroma.Factory import Tesla.Mock + import OpenApiSpex.TestAssertions setup do mock(fn env -> apply(HttpRequestMock, :request, [env]) end) @@ -28,14 +31,16 @@ test "has an emoji reaction list" do user = insert(:user) other_user = insert(:user) third_user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "dae cofe??"}) + {:ok, activity} = CommonAPI.post(user, %{status: "dae cofe??"}) - {:ok, _, _} = CommonAPI.react_with_emoji(activity.id, user, "☕") - {:ok, _, _} = CommonAPI.react_with_emoji(activity.id, third_user, "🍵") - {:ok, _, _} = CommonAPI.react_with_emoji(activity.id, other_user, "☕") + {:ok, _} = CommonAPI.react_with_emoji(activity.id, user, "☕") + {:ok, _} = CommonAPI.react_with_emoji(activity.id, third_user, "🍵") + {:ok, _} = CommonAPI.react_with_emoji(activity.id, other_user, "☕") activity = Repo.get(Activity, activity.id) status = StatusView.render("show.json", activity: activity) + assert_schema(status, "Status", Pleroma.Web.ApiSpec.spec()) + assert status[:pleroma][:emoji_reactions] == [ %{name: "☕", count: 2, me: false}, %{name: "🍵", count: 1, me: false} @@ -43,6 +48,8 @@ test "has an emoji reaction list" do status = StatusView.render("show.json", activity: activity, for: user) + assert_schema(status, "Status", Pleroma.Web.ApiSpec.spec()) + assert status[:pleroma][:emoji_reactions] == [ %{name: "☕", count: 2, me: true}, %{name: "🍵", count: 1, me: false} @@ -52,7 +59,7 @@ test "has an emoji reaction list" do test "loads and returns the direct conversation id when given the `with_direct_conversation_id` option" do user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "Hey @shp!", "visibility" => "direct"}) + {:ok, activity} = CommonAPI.post(user, %{status: "Hey @shp!", visibility: "direct"}) [participation] = Participation.for_user(user) status = @@ -66,12 +73,13 @@ test "loads and returns the direct conversation id when given the `with_direct_c status = StatusView.render("show.json", activity: activity, for: user) assert status[:pleroma][:direct_conversation_id] == nil + assert_schema(status, "Status", Pleroma.Web.ApiSpec.spec()) end test "returns the direct conversation id when given the `direct_conversation_id` option" do user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "Hey @shp!", "visibility" => "direct"}) + {:ok, activity} = CommonAPI.post(user, %{status: "Hey @shp!", visibility: "direct"}) [participation] = Participation.for_user(user) status = @@ -82,16 +90,34 @@ test "returns the direct conversation id when given the `direct_conversation_id` ) assert status[:pleroma][:direct_conversation_id] == participation.id + assert_schema(status, "Status", Pleroma.Web.ApiSpec.spec()) end test "returns a temporary ap_id based user for activities missing db users" do user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "Hey @shp!", "visibility" => "direct"}) + {:ok, activity} = CommonAPI.post(user, %{status: "Hey @shp!", visibility: "direct"}) Repo.delete(user) Cachex.clear(:user_cache) + finger_url = + "https://localhost/.well-known/webfinger?resource=acct:#{user.nickname}@localhost" + + Tesla.Mock.mock_global(fn + %{method: :get, url: "http://localhost/.well-known/host-meta"} -> + %Tesla.Env{status: 404, body: ""} + + %{method: :get, url: "https://localhost/.well-known/host-meta"} -> + %Tesla.Env{status: 404, body: ""} + + %{ + method: :get, + url: ^finger_url + } -> + %Tesla.Env{status: 404, body: ""} + end) + %{account: ms_user} = StatusView.render("show.json", activity: activity) assert ms_user.acct == "erroruser@example.com" @@ -100,7 +126,7 @@ test "returns a temporary ap_id based user for activities missing db users" do test "tries to get a user by nickname if fetching by ap_id doesn't work" do user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "Hey @shp!", "visibility" => "direct"}) + {:ok, activity} = CommonAPI.post(user, %{status: "Hey @shp!", visibility: "direct"}) {:ok, user} = user @@ -112,6 +138,7 @@ test "tries to get a user by nickname if fetching by ap_id doesn't work" do result = StatusView.render("show.json", activity: activity) assert result[:account][:id] == to_string(user.id) + assert_schema(result, "Status", Pleroma.Web.ApiSpec.spec()) end test "a note with null content" do @@ -130,6 +157,7 @@ test "a note with null content" do status = StatusView.render("show.json", %{activity: note}) assert status.content == "" + assert_schema(status, "Status", Pleroma.Web.ApiSpec.spec()) end test "a note activity" do @@ -203,6 +231,7 @@ test "a note activity" do } assert status == expected + assert_schema(status, "Status", Pleroma.Web.ApiSpec.spec()) end test "tells if the message is muted for some reason" do @@ -211,14 +240,25 @@ test "tells if the message is muted for some reason" do {:ok, _user_relationships} = User.mute(user, other_user) - {:ok, activity} = CommonAPI.post(other_user, %{"status" => "test"}) - status = StatusView.render("show.json", %{activity: activity}) + {:ok, activity} = CommonAPI.post(other_user, %{status: "test"}) + relationships_opt = UserRelationship.view_relationships_option(user, [other_user]) + + opts = %{activity: activity} + status = StatusView.render("show.json", opts) + assert status.muted == false + assert_schema(status, "Status", Pleroma.Web.ApiSpec.spec()) + + status = StatusView.render("show.json", Map.put(opts, :relationships, relationships_opt)) assert status.muted == false - status = StatusView.render("show.json", %{activity: activity, for: user}) - + for_opts = %{activity: activity, for: user} + status = StatusView.render("show.json", for_opts) assert status.muted == true + + status = StatusView.render("show.json", Map.put(for_opts, :relationships, relationships_opt)) + assert status.muted == true + assert_schema(status, "Status", Pleroma.Web.ApiSpec.spec()) end test "tells if the message is thread muted" do @@ -227,7 +267,7 @@ test "tells if the message is thread muted" do {:ok, _user_relationships} = User.mute(user, other_user) - {:ok, activity} = CommonAPI.post(other_user, %{"status" => "test"}) + {:ok, activity} = CommonAPI.post(other_user, %{status: "test"}) status = StatusView.render("show.json", %{activity: activity, for: user}) assert status.pleroma.thread_muted == false @@ -242,7 +282,7 @@ test "tells if the message is thread muted" do test "tells if the status is bookmarked" do user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "Cute girls doing cute things"}) + {:ok, activity} = CommonAPI.post(user, %{status: "Cute girls doing cute things"}) status = StatusView.render("show.json", %{activity: activity}) assert status.bookmarked == false @@ -264,8 +304,7 @@ test "a reply" do note = insert(:note_activity) user = insert(:user) - {:ok, activity} = - CommonAPI.post(user, %{"status" => "he", "in_reply_to_status_id" => note.id}) + {:ok, activity} = CommonAPI.post(user, %{status: "he", in_reply_to_status_id: note.id}) status = StatusView.render("show.json", %{activity: activity}) @@ -280,12 +319,14 @@ test "contains mentions" do user = insert(:user) mentioned = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "hi @#{mentioned.nickname}"}) + {:ok, activity} = CommonAPI.post(user, %{status: "hi @#{mentioned.nickname}"}) status = StatusView.render("show.json", %{activity: activity}) assert status.mentions == Enum.map([mentioned], fn u -> AccountView.render("mention.json", %{user: u}) end) + + assert_schema(status, "Status", Pleroma.Web.ApiSpec.spec()) end test "create mentions from the 'to' field" do @@ -374,11 +415,17 @@ test "attachments" do pleroma: %{mime_type: "image/png"} } + api_spec = Pleroma.Web.ApiSpec.spec() + assert expected == StatusView.render("attachment.json", %{attachment: object}) + assert_schema(expected, "Attachment", api_spec) # If theres a "id", use that instead of the generated one object = Map.put(object, "id", 2) - assert %{id: "2"} = StatusView.render("attachment.json", %{attachment: object}) + result = StatusView.render("attachment.json", %{attachment: object}) + + assert %{id: "2"} = result + assert_schema(result, "Attachment", api_spec) end test "put the url advertised in the Activity in to the url attribute" do @@ -402,6 +449,7 @@ test "a reblog" do assert represented[:id] == to_string(reblog.id) assert represented[:reblog][:id] == to_string(activity.id) assert represented[:emojis] == [] + assert_schema(represented, "Status", Pleroma.Web.ApiSpec.spec()) end test "a peertube video" do @@ -416,6 +464,23 @@ test "a peertube video" do represented = StatusView.render("show.json", %{for: user, activity: activity}) + assert represented[:id] == to_string(activity.id) + assert length(represented[:media_attachments]) == 1 + assert_schema(represented, "Status", Pleroma.Web.ApiSpec.spec()) + end + + test "funkwhale audio" do + user = insert(:user) + + {:ok, object} = + Pleroma.Object.Fetcher.fetch_object_from_id( + "https://channels.tests.funkwhale.audio/federation/music/uploads/42342395-0208-4fee-a38d-259a6dae0871" + ) + + %Activity{} = activity = Activity.get_create_by_object_ap_id(object.data["id"]) + + represented = StatusView.render("show.json", %{for: user, activity: activity}) + assert represented[:id] == to_string(activity.id) assert length(represented[:media_attachments]) == 1 end @@ -517,13 +582,15 @@ test "embeds a relationship in the account" do {:ok, activity} = CommonAPI.post(user, %{ - "status" => "drink more water" + status: "drink more water" }) result = StatusView.render("show.json", %{activity: activity, for: other_user}) assert result[:account][:pleroma][:relationship] == AccountView.render("relationship.json", %{user: other_user, target: user}) + + assert_schema(result, "Status", Pleroma.Web.ApiSpec.spec()) end test "embeds a relationship in the account in reposts" do @@ -532,7 +599,7 @@ test "embeds a relationship in the account in reposts" do {:ok, activity} = CommonAPI.post(user, %{ - "status" => "˙˙ɐʎns" + status: "˙˙ɐʎns" }) {:ok, activity, _object} = CommonAPI.repeat(activity.id, other_user) @@ -544,6 +611,8 @@ test "embeds a relationship in the account in reposts" do assert result[:reblog][:account][:pleroma][:relationship] == AccountView.render("relationship.json", %{user: user, target: user}) + + assert_schema(result, "Status", Pleroma.Web.ApiSpec.spec()) end test "visibility/list" do @@ -551,8 +620,7 @@ test "visibility/list" do {:ok, list} = Pleroma.List.create("foo", user) - {:ok, activity} = - CommonAPI.post(user, %{"status" => "foobar", "visibility" => "list:#{list.id}"}) + {:ok, activity} = CommonAPI.post(user, %{status: "foobar", visibility: "list:#{list.id}"}) status = StatusView.render("show.json", activity: activity) @@ -566,5 +634,6 @@ test "successfully renders a Listen activity (pleroma extension)" do assert status.length == listen_activity.data["object"]["length"] assert status.title == listen_activity.data["object"]["title"] + assert_schema(status, "Status", Pleroma.Web.ApiSpec.spec()) end end diff --git a/test/web/mastodon_api/views/push_subscription_view_test.exs b/test/web/mastodon_api/views/subscription_view_test.exs similarity index 72% rename from test/web/mastodon_api/views/push_subscription_view_test.exs rename to test/web/mastodon_api/views/subscription_view_test.exs index 10c6082a5..981524c0e 100644 --- a/test/web/mastodon_api/views/push_subscription_view_test.exs +++ b/test/web/mastodon_api/views/subscription_view_test.exs @@ -2,10 +2,10 @@ # Copyright © 2017-2020 Pleroma Authors # SPDX-License-Identifier: AGPL-3.0-only -defmodule Pleroma.Web.MastodonAPI.PushSubscriptionViewTest do +defmodule Pleroma.Web.MastodonAPI.SubscriptionViewTest do use Pleroma.DataCase import Pleroma.Factory - alias Pleroma.Web.MastodonAPI.PushSubscriptionView, as: View + alias Pleroma.Web.MastodonAPI.SubscriptionView, as: View alias Pleroma.Web.Push test "Represent a subscription" do @@ -18,6 +18,6 @@ test "Represent a subscription" do server_key: Keyword.get(Push.vapid_config(), :public_key) } - assert expected == View.render("push_subscription.json", %{subscription: subscription}) + assert expected == View.render("show.json", %{subscription: subscription}) end end diff --git a/test/web/metadata/metadata_test.exs b/test/web/metadata/metadata_test.exs new file mode 100644 index 000000000..3f8b29e58 --- /dev/null +++ b/test/web/metadata/metadata_test.exs @@ -0,0 +1,25 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.MetadataTest do + use Pleroma.DataCase, async: true + + import Pleroma.Factory + + describe "restrict indexing remote users" do + test "for remote user" do + user = insert(:user, local: false) + + assert Pleroma.Web.Metadata.build_tags(%{user: user}) =~ + "" + end + + test "for local user" do + user = insert(:user) + + refute Pleroma.Web.Metadata.build_tags(%{user: user}) =~ + "" + end + end +end diff --git a/test/web/metadata/restrict_indexing_test.exs b/test/web/metadata/restrict_indexing_test.exs new file mode 100644 index 000000000..aad0bac42 --- /dev/null +++ b/test/web/metadata/restrict_indexing_test.exs @@ -0,0 +1,21 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.Metadata.Providers.RestrictIndexingTest do + use ExUnit.Case, async: true + + describe "build_tags/1" do + test "for remote user" do + assert Pleroma.Web.Metadata.Providers.RestrictIndexing.build_tags(%{ + user: %Pleroma.User{local: false} + }) == [{:meta, [name: "robots", content: "noindex, noarchive"], []}] + end + + test "for local user" do + assert Pleroma.Web.Metadata.Providers.RestrictIndexing.build_tags(%{ + user: %Pleroma.User{local: true} + }) == [] + end + end +end diff --git a/test/web/metadata/twitter_card_test.exs b/test/web/metadata/twitter_card_test.exs index 9e9c6853a..10931b5ba 100644 --- a/test/web/metadata/twitter_card_test.exs +++ b/test/web/metadata/twitter_card_test.exs @@ -30,7 +30,7 @@ test "it renders twitter card for user info" do test "it uses summary twittercard if post has no attachment" do user = insert(:user, name: "Jimmy Hendriks", bio: "born 19 March 1994") - {:ok, activity} = CommonAPI.post(user, %{"status" => "HI"}) + {:ok, activity} = CommonAPI.post(user, %{status: "HI"}) note = insert(:note, %{ @@ -56,7 +56,7 @@ test "it uses summary twittercard if post has no attachment" do test "it renders avatar not attachment if post is nsfw and unfurl_nsfw is disabled" do Pleroma.Config.put([Pleroma.Web.Metadata, :unfurl_nsfw], false) user = insert(:user, name: "Jimmy Hendriks", bio: "born 19 March 1994") - {:ok, activity} = CommonAPI.post(user, %{"status" => "HI"}) + {:ok, activity} = CommonAPI.post(user, %{status: "HI"}) note = insert(:note, %{ @@ -100,7 +100,7 @@ test "it renders avatar not attachment if post is nsfw and unfurl_nsfw is disabl test "it renders supported types of attachments and skips unknown types" do user = insert(:user, name: "Jimmy Hendriks", bio: "born 19 March 1994") - {:ok, activity} = CommonAPI.post(user, %{"status" => "HI"}) + {:ok, activity} = CommonAPI.post(user, %{status: "HI"}) note = insert(:note, %{ diff --git a/test/web/mongooseim/mongoose_im_controller_test.exs b/test/web/mongooseim/mongoose_im_controller_test.exs index 291ae54fc..5176cde84 100644 --- a/test/web/mongooseim/mongoose_im_controller_test.exs +++ b/test/web/mongooseim/mongoose_im_controller_test.exs @@ -9,6 +9,7 @@ defmodule Pleroma.Web.MongooseIMController do test "/user_exists", %{conn: conn} do _user = insert(:user, nickname: "lain") _remote_user = insert(:user, nickname: "alice", local: false) + _deactivated_user = insert(:user, nickname: "konata", deactivated: true) res = conn @@ -30,10 +31,24 @@ test "/user_exists", %{conn: conn} do |> json_response(404) assert res == false + + res = + conn + |> get(mongoose_im_path(conn, :user_exists), user: "konata") + |> json_response(404) + + assert res == false end test "/check_password", %{conn: conn} do - user = insert(:user, password_hash: Comeonin.Pbkdf2.hashpwsalt("cool")) + user = insert(:user, password_hash: Pbkdf2.hash_pwd_salt("cool")) + + _deactivated_user = + insert(:user, + nickname: "konata", + deactivated: true, + password_hash: Pbkdf2.hash_pwd_salt("cool") + ) res = conn @@ -49,6 +64,13 @@ test "/check_password", %{conn: conn} do assert res == false + res = + conn + |> get(mongoose_im_path(conn, :check_password), user: "konata", pass: "cool") + |> json_response(404) + + assert res == false + res = conn |> get(mongoose_im_path(conn, :check_password), user: "nobody", pass: "cool") diff --git a/test/web/node_info_test.exs b/test/web/node_info_test.exs index 43f322606..9bcc07b37 100644 --- a/test/web/node_info_test.exs +++ b/test/web/node_info_test.exs @@ -7,6 +7,8 @@ defmodule Pleroma.Web.NodeInfoTest do import Pleroma.Factory + alias Pleroma.Config + setup do: clear_config([:mrf_simple]) setup do: clear_config(:instance) @@ -47,7 +49,7 @@ test "nodeinfo shows restricted nicknames", %{conn: conn} do assert result = json_response(conn, 200) - assert Pleroma.Config.get([Pleroma.User, :restricted_nicknames]) == + assert Config.get([Pleroma.User, :restricted_nicknames]) == result["metadata"]["restrictedNicknames"] end @@ -65,10 +67,10 @@ test "returns software.repository field in nodeinfo 2.1", %{conn: conn} do end test "returns fieldsLimits field", %{conn: conn} do - Pleroma.Config.put([:instance, :max_account_fields], 10) - Pleroma.Config.put([:instance, :max_remote_account_fields], 15) - Pleroma.Config.put([:instance, :account_field_name_length], 255) - Pleroma.Config.put([:instance, :account_field_value_length], 2048) + Config.put([:instance, :max_account_fields], 10) + Config.put([:instance, :max_remote_account_fields], 15) + Config.put([:instance, :account_field_name_length], 255) + Config.put([:instance, :account_field_value_length], 2048) response = conn @@ -82,8 +84,8 @@ test "returns fieldsLimits field", %{conn: conn} do end test "it returns the safe_dm_mentions feature if enabled", %{conn: conn} do - option = Pleroma.Config.get([:instance, :safe_dm_mentions]) - Pleroma.Config.put([:instance, :safe_dm_mentions], true) + option = Config.get([:instance, :safe_dm_mentions]) + Config.put([:instance, :safe_dm_mentions], true) response = conn @@ -92,7 +94,7 @@ test "it returns the safe_dm_mentions feature if enabled", %{conn: conn} do assert "safe_dm_mentions" in response["metadata"]["features"] - Pleroma.Config.put([:instance, :safe_dm_mentions], false) + Config.put([:instance, :safe_dm_mentions], false) response = conn @@ -101,14 +103,14 @@ test "it returns the safe_dm_mentions feature if enabled", %{conn: conn} do refute "safe_dm_mentions" in response["metadata"]["features"] - Pleroma.Config.put([:instance, :safe_dm_mentions], option) + Config.put([:instance, :safe_dm_mentions], option) end describe "`metadata/federation/enabled`" do setup do: clear_config([:instance, :federating]) test "it shows if federation is enabled/disabled", %{conn: conn} do - Pleroma.Config.put([:instance, :federating], true) + Config.put([:instance, :federating], true) response = conn @@ -117,7 +119,7 @@ test "it shows if federation is enabled/disabled", %{conn: conn} do assert response["metadata"]["federation"]["enabled"] == true - Pleroma.Config.put([:instance, :federating], false) + Config.put([:instance, :federating], false) response = conn @@ -128,15 +130,39 @@ test "it shows if federation is enabled/disabled", %{conn: conn} do end end - test "it shows MRF transparency data if enabled", %{conn: conn} do - config = Pleroma.Config.get([:instance, :rewrite_policy]) - Pleroma.Config.put([:instance, :rewrite_policy], [Pleroma.Web.ActivityPub.MRF.SimplePolicy]) + test "it shows default features flags", %{conn: conn} do + response = + conn + |> get("/nodeinfo/2.1.json") + |> json_response(:ok) - option = Pleroma.Config.get([:instance, :mrf_transparency]) - Pleroma.Config.put([:instance, :mrf_transparency], true) + default_features = [ + "pleroma_api", + "mastodon_api", + "mastodon_api_streaming", + "polls", + "pleroma_explicit_addressing", + "shareable_emoji_packs", + "multifetch", + "pleroma_emoji_reactions", + "pleroma:api/v1/notifications:include_types_filter" + ] + + assert MapSet.subset?( + MapSet.new(default_features), + MapSet.new(response["metadata"]["features"]) + ) + end + + test "it shows MRF transparency data if enabled", %{conn: conn} do + config = Config.get([:instance, :rewrite_policy]) + Config.put([:instance, :rewrite_policy], [Pleroma.Web.ActivityPub.MRF.SimplePolicy]) + + option = Config.get([:instance, :mrf_transparency]) + Config.put([:instance, :mrf_transparency], true) simple_config = %{"reject" => ["example.com"]} - Pleroma.Config.put(:mrf_simple, simple_config) + Config.put(:mrf_simple, simple_config) response = conn @@ -145,25 +171,25 @@ test "it shows MRF transparency data if enabled", %{conn: conn} do assert response["metadata"]["federation"]["mrf_simple"] == simple_config - Pleroma.Config.put([:instance, :rewrite_policy], config) - Pleroma.Config.put([:instance, :mrf_transparency], option) - Pleroma.Config.put(:mrf_simple, %{}) + Config.put([:instance, :rewrite_policy], config) + Config.put([:instance, :mrf_transparency], option) + Config.put(:mrf_simple, %{}) end test "it performs exclusions from MRF transparency data if configured", %{conn: conn} do - config = Pleroma.Config.get([:instance, :rewrite_policy]) - Pleroma.Config.put([:instance, :rewrite_policy], [Pleroma.Web.ActivityPub.MRF.SimplePolicy]) + config = Config.get([:instance, :rewrite_policy]) + Config.put([:instance, :rewrite_policy], [Pleroma.Web.ActivityPub.MRF.SimplePolicy]) - option = Pleroma.Config.get([:instance, :mrf_transparency]) - Pleroma.Config.put([:instance, :mrf_transparency], true) + option = Config.get([:instance, :mrf_transparency]) + Config.put([:instance, :mrf_transparency], true) - exclusions = Pleroma.Config.get([:instance, :mrf_transparency_exclusions]) - Pleroma.Config.put([:instance, :mrf_transparency_exclusions], ["other.site"]) + exclusions = Config.get([:instance, :mrf_transparency_exclusions]) + Config.put([:instance, :mrf_transparency_exclusions], ["other.site"]) simple_config = %{"reject" => ["example.com", "other.site"]} expected_config = %{"reject" => ["example.com"]} - Pleroma.Config.put(:mrf_simple, simple_config) + Config.put(:mrf_simple, simple_config) response = conn @@ -173,9 +199,9 @@ test "it performs exclusions from MRF transparency data if configured", %{conn: assert response["metadata"]["federation"]["mrf_simple"] == expected_config assert response["metadata"]["federation"]["exclusions"] == true - Pleroma.Config.put([:instance, :rewrite_policy], config) - Pleroma.Config.put([:instance, :mrf_transparency], option) - Pleroma.Config.put([:instance, :mrf_transparency_exclusions], exclusions) - Pleroma.Config.put(:mrf_simple, %{}) + Config.put([:instance, :rewrite_policy], config) + Config.put([:instance, :mrf_transparency], option) + Config.put([:instance, :mrf_transparency_exclusions], exclusions) + Config.put(:mrf_simple, %{}) end end diff --git a/test/web/oauth/ldap_authorization_test.exs b/test/web/oauth/ldap_authorization_test.exs index a8fe8a841..011642c08 100644 --- a/test/web/oauth/ldap_authorization_test.exs +++ b/test/web/oauth/ldap_authorization_test.exs @@ -19,7 +19,7 @@ defmodule Pleroma.Web.OAuth.LDAPAuthorizationTest do @tag @skip test "authorizes the existing user using LDAP credentials" do password = "testpassword" - user = insert(:user, password_hash: Comeonin.Pbkdf2.hashpwsalt(password)) + user = insert(:user, password_hash: Pbkdf2.hash_pwd_salt(password)) app = insert(:oauth_app, scopes: ["read", "write"]) host = Pleroma.Config.get([:ldap, :host]) |> to_charlist @@ -104,7 +104,7 @@ test "creates a new user after successful LDAP authorization" do @tag @skip test "falls back to the default authorization when LDAP is unavailable" do password = "testpassword" - user = insert(:user, password_hash: Comeonin.Pbkdf2.hashpwsalt(password)) + user = insert(:user, password_hash: Pbkdf2.hash_pwd_salt(password)) app = insert(:oauth_app, scopes: ["read", "write"]) host = Pleroma.Config.get([:ldap, :host]) |> to_charlist @@ -148,7 +148,7 @@ test "falls back to the default authorization when LDAP is unavailable" do @tag @skip test "disallow authorization for wrong LDAP credentials" do password = "testpassword" - user = insert(:user, password_hash: Comeonin.Pbkdf2.hashpwsalt(password)) + user = insert(:user, password_hash: Pbkdf2.hash_pwd_salt(password)) app = insert(:oauth_app, scopes: ["read", "write"]) host = Pleroma.Config.get([:ldap, :host]) |> to_charlist diff --git a/test/web/oauth/mfa_controller_test.exs b/test/web/oauth/mfa_controller_test.exs new file mode 100644 index 000000000..3c341facd --- /dev/null +++ b/test/web/oauth/mfa_controller_test.exs @@ -0,0 +1,306 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2018 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.OAuth.MFAControllerTest do + use Pleroma.Web.ConnCase + import Pleroma.Factory + + alias Pleroma.MFA + alias Pleroma.MFA.BackupCodes + alias Pleroma.MFA.TOTP + alias Pleroma.Repo + alias Pleroma.Web.OAuth.Authorization + alias Pleroma.Web.OAuth.OAuthController + + setup %{conn: conn} do + otp_secret = TOTP.generate_secret() + + user = + insert(:user, + multi_factor_authentication_settings: %MFA.Settings{ + enabled: true, + backup_codes: [Pbkdf2.hash_pwd_salt("test-code")], + totp: %MFA.Settings.TOTP{secret: otp_secret, confirmed: true} + } + ) + + app = insert(:oauth_app) + {:ok, conn: conn, user: user, app: app} + end + + describe "show" do + setup %{conn: conn, user: user, app: app} do + mfa_token = + insert(:mfa_token, + user: user, + authorization: build(:oauth_authorization, app: app, scopes: ["write"]) + ) + + {:ok, conn: conn, mfa_token: mfa_token} + end + + test "GET /oauth/mfa renders mfa forms", %{conn: conn, mfa_token: mfa_token} do + conn = + get( + conn, + "/oauth/mfa", + %{ + "mfa_token" => mfa_token.token, + "state" => "a_state", + "redirect_uri" => "http://localhost:8080/callback" + } + ) + + assert response = html_response(conn, 200) + assert response =~ "Two-factor authentication" + assert response =~ mfa_token.token + assert response =~ "http://localhost:8080/callback" + end + + test "GET /oauth/mfa renders mfa recovery forms", %{conn: conn, mfa_token: mfa_token} do + conn = + get( + conn, + "/oauth/mfa", + %{ + "mfa_token" => mfa_token.token, + "state" => "a_state", + "redirect_uri" => "http://localhost:8080/callback", + "challenge_type" => "recovery" + } + ) + + assert response = html_response(conn, 200) + assert response =~ "Two-factor recovery" + assert response =~ mfa_token.token + assert response =~ "http://localhost:8080/callback" + end + end + + describe "verify" do + setup %{conn: conn, user: user, app: app} do + mfa_token = + insert(:mfa_token, + user: user, + authorization: build(:oauth_authorization, app: app, scopes: ["write"]) + ) + + {:ok, conn: conn, user: user, mfa_token: mfa_token, app: app} + end + + test "POST /oauth/mfa/verify, verify totp code", %{ + conn: conn, + user: user, + mfa_token: mfa_token, + app: app + } do + otp_token = TOTP.generate_token(user.multi_factor_authentication_settings.totp.secret) + + conn = + conn + |> post("/oauth/mfa/verify", %{ + "mfa" => %{ + "mfa_token" => mfa_token.token, + "challenge_type" => "totp", + "code" => otp_token, + "state" => "a_state", + "redirect_uri" => OAuthController.default_redirect_uri(app) + } + }) + + target = redirected_to(conn) + target_url = %URI{URI.parse(target) | query: nil} |> URI.to_string() + query = URI.parse(target).query |> URI.query_decoder() |> Map.new() + assert %{"state" => "a_state", "code" => code} = query + assert target_url == OAuthController.default_redirect_uri(app) + auth = Repo.get_by(Authorization, token: code) + assert auth.scopes == ["write"] + end + + test "POST /oauth/mfa/verify, verify recovery code", %{ + conn: conn, + mfa_token: mfa_token, + app: app + } do + conn = + conn + |> post("/oauth/mfa/verify", %{ + "mfa" => %{ + "mfa_token" => mfa_token.token, + "challenge_type" => "recovery", + "code" => "test-code", + "state" => "a_state", + "redirect_uri" => OAuthController.default_redirect_uri(app) + } + }) + + target = redirected_to(conn) + target_url = %URI{URI.parse(target) | query: nil} |> URI.to_string() + query = URI.parse(target).query |> URI.query_decoder() |> Map.new() + assert %{"state" => "a_state", "code" => code} = query + assert target_url == OAuthController.default_redirect_uri(app) + auth = Repo.get_by(Authorization, token: code) + assert auth.scopes == ["write"] + end + end + + describe "challenge/totp" do + test "returns access token with valid code", %{conn: conn, user: user, app: app} do + otp_token = TOTP.generate_token(user.multi_factor_authentication_settings.totp.secret) + + mfa_token = + insert(:mfa_token, + user: user, + authorization: build(:oauth_authorization, app: app, scopes: ["write"]) + ) + + response = + conn + |> post("/oauth/mfa/challenge", %{ + "mfa_token" => mfa_token.token, + "challenge_type" => "totp", + "code" => otp_token, + "client_id" => app.client_id, + "client_secret" => app.client_secret + }) + |> json_response(:ok) + + ap_id = user.ap_id + + assert match?( + %{ + "access_token" => _, + "expires_in" => 600, + "me" => ^ap_id, + "refresh_token" => _, + "scope" => "write", + "token_type" => "Bearer" + }, + response + ) + end + + test "returns errors when mfa token invalid", %{conn: conn, user: user, app: app} do + otp_token = TOTP.generate_token(user.multi_factor_authentication_settings.totp.secret) + + response = + conn + |> post("/oauth/mfa/challenge", %{ + "mfa_token" => "XXX", + "challenge_type" => "totp", + "code" => otp_token, + "client_id" => app.client_id, + "client_secret" => app.client_secret + }) + |> json_response(400) + + assert response == %{"error" => "Invalid code"} + end + + test "returns error when otp code is invalid", %{conn: conn, user: user, app: app} do + mfa_token = insert(:mfa_token, user: user) + + response = + conn + |> post("/oauth/mfa/challenge", %{ + "mfa_token" => mfa_token.token, + "challenge_type" => "totp", + "code" => "XXX", + "client_id" => app.client_id, + "client_secret" => app.client_secret + }) + |> json_response(400) + + assert response == %{"error" => "Invalid code"} + end + + test "returns error when client credentails is wrong ", %{conn: conn, user: user} do + otp_token = TOTP.generate_token(user.multi_factor_authentication_settings.totp.secret) + mfa_token = insert(:mfa_token, user: user) + + response = + conn + |> post("/oauth/mfa/challenge", %{ + "mfa_token" => mfa_token.token, + "challenge_type" => "totp", + "code" => otp_token, + "client_id" => "xxx", + "client_secret" => "xxx" + }) + |> json_response(400) + + assert response == %{"error" => "Invalid code"} + end + end + + describe "challenge/recovery" do + setup %{conn: conn} do + app = insert(:oauth_app) + {:ok, conn: conn, app: app} + end + + test "returns access token with valid code", %{conn: conn, app: app} do + otp_secret = TOTP.generate_secret() + + [code | _] = backup_codes = BackupCodes.generate() + + hashed_codes = + backup_codes + |> Enum.map(&Pbkdf2.hash_pwd_salt(&1)) + + user = + insert(:user, + multi_factor_authentication_settings: %MFA.Settings{ + enabled: true, + backup_codes: hashed_codes, + totp: %MFA.Settings.TOTP{secret: otp_secret, confirmed: true} + } + ) + + mfa_token = + insert(:mfa_token, + user: user, + authorization: build(:oauth_authorization, app: app, scopes: ["write"]) + ) + + response = + conn + |> post("/oauth/mfa/challenge", %{ + "mfa_token" => mfa_token.token, + "challenge_type" => "recovery", + "code" => code, + "client_id" => app.client_id, + "client_secret" => app.client_secret + }) + |> json_response(:ok) + + ap_id = user.ap_id + + assert match?( + %{ + "access_token" => _, + "expires_in" => 600, + "me" => ^ap_id, + "refresh_token" => _, + "scope" => "write", + "token_type" => "Bearer" + }, + response + ) + + error_response = + conn + |> post("/oauth/mfa/challenge", %{ + "mfa_token" => mfa_token.token, + "challenge_type" => "recovery", + "code" => code, + "client_id" => app.client_id, + "client_secret" => app.client_secret + }) + |> json_response(400) + + assert error_response == %{"error" => "Invalid code"} + end + end +end diff --git a/test/web/oauth/oauth_controller_test.exs b/test/web/oauth/oauth_controller_test.exs index 0b0972b17..d389e4ce0 100644 --- a/test/web/oauth/oauth_controller_test.exs +++ b/test/web/oauth/oauth_controller_test.exs @@ -6,6 +6,8 @@ defmodule Pleroma.Web.OAuth.OAuthControllerTest do use Pleroma.Web.ConnCase import Pleroma.Factory + alias Pleroma.MFA + alias Pleroma.MFA.TOTP alias Pleroma.Repo alias Pleroma.User alias Pleroma.Web.OAuth.Authorization @@ -309,7 +311,7 @@ test "with valid params, POST /oauth/register?op=connect redirects to `redirect_ app: app, conn: conn } do - user = insert(:user, password_hash: Comeonin.Pbkdf2.hashpwsalt("testpassword")) + user = insert(:user, password_hash: Pbkdf2.hash_pwd_salt("testpassword")) registration = insert(:registration, user: nil) redirect_uri = OAuthController.default_redirect_uri(app) @@ -340,7 +342,7 @@ test "with unlisted `redirect_uri`, POST /oauth/register?op=connect results in H app: app, conn: conn } do - user = insert(:user, password_hash: Comeonin.Pbkdf2.hashpwsalt("testpassword")) + user = insert(:user, password_hash: Pbkdf2.hash_pwd_salt("testpassword")) registration = insert(:registration, user: nil) unlisted_redirect_uri = "http://cross-site-request.com" @@ -575,7 +577,7 @@ test "redirects with oauth authorization, " <> # In case scope param is missing, expecting _all_ app-supported scopes to be granted for user <- [non_admin, admin], {requested_scopes, expected_scopes} <- - %{scopes_subset => scopes_subset, nil => app_scopes} do + %{scopes_subset => scopes_subset, nil: app_scopes} do conn = post( build_conn(), @@ -604,6 +606,41 @@ test "redirects with oauth authorization, " <> end end + test "redirect to on two-factor auth page" do + otp_secret = TOTP.generate_secret() + + user = + insert(:user, + multi_factor_authentication_settings: %MFA.Settings{ + enabled: true, + totp: %MFA.Settings.TOTP{secret: otp_secret, confirmed: true} + } + ) + + app = insert(:oauth_app, scopes: ["read", "write", "follow"]) + + conn = + build_conn() + |> post("/oauth/authorize", %{ + "authorization" => %{ + "name" => user.nickname, + "password" => "test", + "client_id" => app.client_id, + "redirect_uri" => app.redirect_uris, + "scope" => "read write", + "state" => "statepassed" + } + }) + + result = html_response(conn, 200) + + mfa_token = Repo.get_by(MFA.Token, user_id: user.id) + assert result =~ app.redirect_uris + assert result =~ "statepassed" + assert result =~ mfa_token.token + assert result =~ "Two-factor authentication" + end + test "returns 401 for wrong credentials", %{conn: conn} do user = insert(:user) app = insert(:oauth_app) @@ -713,7 +750,7 @@ test "issues a token for an all-body request" do test "issues a token for `password` grant_type with valid credentials, with full permissions by default" do password = "testpassword" - user = insert(:user, password_hash: Comeonin.Pbkdf2.hashpwsalt(password)) + user = insert(:user, password_hash: Pbkdf2.hash_pwd_salt(password)) app = insert(:oauth_app, scopes: ["read", "write"]) @@ -735,6 +772,46 @@ test "issues a token for `password` grant_type with valid credentials, with full assert token.scopes == app.scopes end + test "issues a mfa token for `password` grant_type, when MFA enabled" do + password = "testpassword" + otp_secret = TOTP.generate_secret() + + user = + insert(:user, + password_hash: Pbkdf2.hash_pwd_salt(password), + multi_factor_authentication_settings: %MFA.Settings{ + enabled: true, + totp: %MFA.Settings.TOTP{secret: otp_secret, confirmed: true} + } + ) + + app = insert(:oauth_app, scopes: ["read", "write"]) + + response = + build_conn() + |> post("/oauth/token", %{ + "grant_type" => "password", + "username" => user.nickname, + "password" => password, + "client_id" => app.client_id, + "client_secret" => app.client_secret + }) + |> json_response(403) + + assert match?( + %{ + "supported_challenge_types" => "totp", + "mfa_token" => _, + "error" => "mfa_required" + }, + response + ) + + token = Repo.get_by(MFA.Token, token: response["mfa_token"]) + assert token.user_id == user.id + assert token.authorization_id + end + test "issues a token for request with HTTP basic auth client credentials" do user = insert(:user) app = insert(:oauth_app, scopes: ["scope1", "scope2", "scope3"]) @@ -810,7 +887,7 @@ test "rejects token exchange for valid credentials belonging to unconfirmed user password = "testpassword" {:ok, user} = - insert(:user, password_hash: Comeonin.Pbkdf2.hashpwsalt(password)) + insert(:user, password_hash: Pbkdf2.hash_pwd_salt(password)) |> User.confirmation_changeset(need_confirmation: true) |> User.update_and_set_cache() @@ -838,7 +915,7 @@ test "rejects token exchange for valid credentials belonging to deactivated user user = insert(:user, - password_hash: Comeonin.Pbkdf2.hashpwsalt(password), + password_hash: Pbkdf2.hash_pwd_salt(password), deactivated: true ) @@ -866,7 +943,7 @@ test "rejects token exchange for user with password_reset_pending set to true" d user = insert(:user, - password_hash: Comeonin.Pbkdf2.hashpwsalt(password), + password_hash: Pbkdf2.hash_pwd_salt(password), password_reset_pending: true ) @@ -895,7 +972,7 @@ test "rejects token exchange for user with confirmation_pending set to true" do user = insert(:user, - password_hash: Comeonin.Pbkdf2.hashpwsalt(password), + password_hash: Pbkdf2.hash_pwd_salt(password), confirmation_pending: true ) diff --git a/test/web/ostatus/ostatus_controller_test.exs b/test/web/ostatus/ostatus_controller_test.exs index 6787b414b..bb349cb19 100644 --- a/test/web/ostatus/ostatus_controller_test.exs +++ b/test/web/ostatus/ostatus_controller_test.exs @@ -136,7 +136,7 @@ test "render html for redirect for html format", %{conn: conn} do user = insert(:user) - {:ok, like_activity, _} = CommonAPI.favorite(note_activity.id, user) + {:ok, like_activity} = CommonAPI.favorite(user, note_activity.id) assert like_activity.data["type"] == "Like" diff --git a/test/web/pleroma_api/controllers/account_controller_test.exs b/test/web/pleroma_api/controllers/account_controller_test.exs index 2aa87ac30..103997c31 100644 --- a/test/web/pleroma_api/controllers/account_controller_test.exs +++ b/test/web/pleroma_api/controllers/account_controller_test.exs @@ -31,8 +31,28 @@ defmodule Pleroma.Web.PleromaAPI.AccountControllerTest do test "resend account confirmation email", %{conn: conn, user: user} do conn + |> put_req_header("content-type", "application/json") |> post("/api/v1/pleroma/accounts/confirmation_resend?email=#{user.email}") - |> json_response(:no_content) + |> json_response_and_validate_schema(:no_content) + + ObanHelpers.perform_all() + + email = Pleroma.Emails.UserEmail.account_confirmation_email(user) + notify_email = Config.get([:instance, :notify_email]) + instance_name = Config.get([:instance, :name]) + + assert_email_sent( + from: {instance_name, notify_email}, + to: {user.name, user.email}, + html_body: email.html_body + ) + end + + test "resend account confirmation email (with nickname)", %{conn: conn, user: user} do + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/pleroma/accounts/confirmation_resend?nickname=#{user.nickname}") + |> json_response_and_validate_schema(:no_content) ObanHelpers.perform_all() @@ -54,7 +74,10 @@ test "resend account confirmation email", %{conn: conn, user: user} do test "user avatar can be set", %{user: user, conn: conn} do avatar_image = File.read!("test/fixtures/avatar_data_uri") - conn = patch(conn, "/api/v1/pleroma/accounts/update_avatar", %{img: avatar_image}) + conn = + conn + |> put_req_header("content-type", "multipart/form-data") + |> patch("/api/v1/pleroma/accounts/update_avatar", %{img: avatar_image}) user = refresh_record(user) @@ -70,17 +93,20 @@ test "user avatar can be set", %{user: user, conn: conn} do ] } = user.avatar - assert %{"url" => _} = json_response(conn, 200) + assert %{"url" => _} = json_response_and_validate_schema(conn, 200) end test "user avatar can be reset", %{user: user, conn: conn} do - conn = patch(conn, "/api/v1/pleroma/accounts/update_avatar", %{img: ""}) + conn = + conn + |> put_req_header("content-type", "multipart/form-data") + |> patch("/api/v1/pleroma/accounts/update_avatar", %{img: ""}) user = User.get_cached_by_id(user.id) assert user.avatar == nil - assert %{"url" => nil} = json_response(conn, 200) + assert %{"url" => nil} = json_response_and_validate_schema(conn, 200) end end @@ -88,21 +114,27 @@ test "user avatar can be reset", %{user: user, conn: conn} do setup do: oauth_access(["write:accounts"]) test "can set profile banner", %{user: user, conn: conn} do - conn = patch(conn, "/api/v1/pleroma/accounts/update_banner", %{"banner" => @image}) + conn = + conn + |> put_req_header("content-type", "multipart/form-data") + |> patch("/api/v1/pleroma/accounts/update_banner", %{"banner" => @image}) user = refresh_record(user) assert user.banner["type"] == "Image" - assert %{"url" => _} = json_response(conn, 200) + assert %{"url" => _} = json_response_and_validate_schema(conn, 200) end test "can reset profile banner", %{user: user, conn: conn} do - conn = patch(conn, "/api/v1/pleroma/accounts/update_banner", %{"banner" => ""}) + conn = + conn + |> put_req_header("content-type", "multipart/form-data") + |> patch("/api/v1/pleroma/accounts/update_banner", %{"banner" => ""}) user = refresh_record(user) assert user.banner == %{} - assert %{"url" => nil} = json_response(conn, 200) + assert %{"url" => nil} = json_response_and_validate_schema(conn, 200) end end @@ -110,19 +142,26 @@ test "can reset profile banner", %{user: user, conn: conn} do setup do: oauth_access(["write:accounts"]) test "background image can be set", %{user: user, conn: conn} do - conn = patch(conn, "/api/v1/pleroma/accounts/update_background", %{"img" => @image}) + conn = + conn + |> put_req_header("content-type", "multipart/form-data") + |> patch("/api/v1/pleroma/accounts/update_background", %{"img" => @image}) user = refresh_record(user) assert user.background["type"] == "Image" - assert %{"url" => _} = json_response(conn, 200) + # assert %{"url" => _} = json_response(conn, 200) + assert %{"url" => _} = json_response_and_validate_schema(conn, 200) end test "background image can be reset", %{user: user, conn: conn} do - conn = patch(conn, "/api/v1/pleroma/accounts/update_background", %{"img" => ""}) + conn = + conn + |> put_req_header("content-type", "multipart/form-data") + |> patch("/api/v1/pleroma/accounts/update_background", %{"img" => ""}) user = refresh_record(user) assert user.background == %{} - assert %{"url" => nil} = json_response(conn, 200) + assert %{"url" => nil} = json_response_and_validate_schema(conn, 200) end end @@ -138,12 +177,12 @@ test "returns list of statuses favorited by specified user", %{ user: user } do [activity | _] = insert_pair(:note_activity) - CommonAPI.favorite(activity.id, user) + CommonAPI.favorite(user, activity.id) response = conn |> get("/api/v1/pleroma/accounts/#{user.id}/favourites") - |> json_response(:ok) + |> json_response_and_validate_schema(:ok) [like] = response @@ -151,15 +190,18 @@ test "returns list of statuses favorited by specified user", %{ assert like["id"] == activity.id end - test "does not return favorites for specified user_id when user is not logged in", %{ + test "returns favorites for specified user_id when requester is not logged in", %{ user: user } do activity = insert(:note_activity) - CommonAPI.favorite(activity.id, user) + CommonAPI.favorite(user, activity.id) - build_conn() - |> get("/api/v1/pleroma/accounts/#{user.id}/favourites") - |> json_response(403) + response = + build_conn() + |> get("/api/v1/pleroma/accounts/#{user.id}/favourites") + |> json_response_and_validate_schema(200) + + assert length(response) == 1 end test "returns favorited DM only when user is logged in and he is one of recipients", %{ @@ -168,11 +210,11 @@ test "returns favorited DM only when user is logged in and he is one of recipien } do {:ok, direct} = CommonAPI.post(current_user, %{ - "status" => "Hi @#{user.nickname}!", - "visibility" => "direct" + status: "Hi @#{user.nickname}!", + visibility: "direct" }) - CommonAPI.favorite(direct.id, user) + CommonAPI.favorite(user, direct.id) for u <- [user, current_user] do response = @@ -180,14 +222,17 @@ test "returns favorited DM only when user is logged in and he is one of recipien |> assign(:user, u) |> assign(:token, insert(:oauth_token, user: u, scopes: ["read:favourites"])) |> get("/api/v1/pleroma/accounts/#{user.id}/favourites") - |> json_response(:ok) + |> json_response_and_validate_schema(:ok) assert length(response) == 1 end - build_conn() - |> get("/api/v1/pleroma/accounts/#{user.id}/favourites") - |> json_response(403) + response = + build_conn() + |> get("/api/v1/pleroma/accounts/#{user.id}/favourites") + |> json_response_and_validate_schema(200) + + assert length(response) == 0 end test "does not return others' favorited DM when user is not one of recipients", %{ @@ -198,16 +243,16 @@ test "does not return others' favorited DM when user is not one of recipients", {:ok, direct} = CommonAPI.post(user_two, %{ - "status" => "Hi @#{user.nickname}!", - "visibility" => "direct" + status: "Hi @#{user.nickname}!", + visibility: "direct" }) - CommonAPI.favorite(direct.id, user) + CommonAPI.favorite(user, direct.id) response = conn |> get("/api/v1/pleroma/accounts/#{user.id}/favourites") - |> json_response(:ok) + |> json_response_and_validate_schema(:ok) assert Enum.empty?(response) end @@ -219,7 +264,7 @@ test "paginates favorites using since_id and max_id", %{ activities = insert_list(10, :note_activity) Enum.each(activities, fn activity -> - CommonAPI.favorite(activity.id, user) + CommonAPI.favorite(user, activity.id) end) third_activity = Enum.at(activities, 2) @@ -227,11 +272,12 @@ test "paginates favorites using since_id and max_id", %{ response = conn - |> get("/api/v1/pleroma/accounts/#{user.id}/favourites", %{ - since_id: third_activity.id, - max_id: seventh_activity.id - }) - |> json_response(:ok) + |> get( + "/api/v1/pleroma/accounts/#{user.id}/favourites?since_id=#{third_activity.id}&max_id=#{ + seventh_activity.id + }" + ) + |> json_response_and_validate_schema(:ok) assert length(response) == 3 refute third_activity in response @@ -245,13 +291,13 @@ test "limits favorites using limit parameter", %{ 7 |> insert_list(:note_activity) |> Enum.each(fn activity -> - CommonAPI.favorite(activity.id, user) + CommonAPI.favorite(user, activity.id) end) response = conn - |> get("/api/v1/pleroma/accounts/#{user.id}/favourites", %{limit: "3"}) - |> json_response(:ok) + |> get("/api/v1/pleroma/accounts/#{user.id}/favourites?limit=3") + |> json_response_and_validate_schema(:ok) assert length(response) == 3 end @@ -263,7 +309,7 @@ test "returns empty response when user does not have any favorited statuses", %{ response = conn |> get("/api/v1/pleroma/accounts/#{user.id}/favourites") - |> json_response(:ok) + |> json_response_and_validate_schema(:ok) assert Enum.empty?(response) end @@ -271,28 +317,28 @@ test "returns empty response when user does not have any favorited statuses", %{ test "returns 404 error when specified user is not exist", %{conn: conn} do conn = get(conn, "/api/v1/pleroma/accounts/test/favourites") - assert json_response(conn, 404) == %{"error" => "Record not found"} + assert json_response_and_validate_schema(conn, 404) == %{"error" => "Record not found"} end test "returns 403 error when user has hidden own favorites", %{conn: conn} do user = insert(:user, hide_favorites: true) activity = insert(:note_activity) - CommonAPI.favorite(activity.id, user) + CommonAPI.favorite(user, activity.id) conn = get(conn, "/api/v1/pleroma/accounts/#{user.id}/favourites") - assert json_response(conn, 403) == %{"error" => "Can't get favorites"} + assert json_response_and_validate_schema(conn, 403) == %{"error" => "Can't get favorites"} end test "hides favorites for new users by default", %{conn: conn} do user = insert(:user) activity = insert(:note_activity) - CommonAPI.favorite(activity.id, user) + CommonAPI.favorite(user, activity.id) assert user.hide_favorites conn = get(conn, "/api/v1/pleroma/accounts/#{user.id}/favourites") - assert json_response(conn, 403) == %{"error" => "Can't get favorites"} + assert json_response_and_validate_schema(conn, 403) == %{"error" => "Can't get favorites"} end end @@ -306,11 +352,12 @@ test "subscribing / unsubscribing to a user" do |> assign(:user, user) |> post("/api/v1/pleroma/accounts/#{subscription_target.id}/subscribe") - assert %{"id" => _id, "subscribing" => true} = json_response(ret_conn, 200) + assert %{"id" => _id, "subscribing" => true} = + json_response_and_validate_schema(ret_conn, 200) conn = post(conn, "/api/v1/pleroma/accounts/#{subscription_target.id}/unsubscribe") - assert %{"id" => _id, "subscribing" => false} = json_response(conn, 200) + assert %{"id" => _id, "subscribing" => false} = json_response_and_validate_schema(conn, 200) end end @@ -320,7 +367,7 @@ test "returns 404 when subscription_target not found" do conn = post(conn, "/api/v1/pleroma/accounts/target_id/subscribe") - assert %{"error" => "Record not found"} = json_response(conn, 404) + assert %{"error" => "Record not found"} = json_response_and_validate_schema(conn, 404) end end @@ -330,7 +377,7 @@ test "returns 404 when subscription_target not found" do conn = post(conn, "/api/v1/pleroma/accounts/target_id/unsubscribe") - assert %{"error" => "Record not found"} = json_response(conn, 404) + assert %{"error" => "Record not found"} = json_response_and_validate_schema(conn, 404) end end end diff --git a/test/web/pleroma_api/controllers/emoji_api_controller_test.exs b/test/web/pleroma_api/controllers/emoji_api_controller_test.exs index 435fb6592..d343256fe 100644 --- a/test/web/pleroma_api/controllers/emoji_api_controller_test.exs +++ b/test/web/pleroma_api/controllers/emoji_api_controller_test.exs @@ -8,213 +8,298 @@ defmodule Pleroma.Web.PleromaAPI.EmojiAPIControllerTest do import Tesla.Mock import Pleroma.Factory - @emoji_dir_path Path.join( - Pleroma.Config.get!([:instance, :static_dir]), - "emoji" - ) + @emoji_path Path.join( + Pleroma.Config.get!([:instance, :static_dir]), + "emoji" + ) setup do: clear_config([:auth, :enforce_oauth_admin_scope_usage], false) - test "shared & non-shared pack information in list_packs is ok" do - conn = build_conn() - resp = conn |> get(emoji_api_path(conn, :list_packs)) |> json_response(200) - - assert Map.has_key?(resp, "test_pack") - - pack = resp["test_pack"] - - assert Map.has_key?(pack["pack"], "download-sha256") - assert pack["pack"]["can-download"] - - assert pack["files"] == %{"blank" => "blank.png"} - - # Non-shared pack - - assert Map.has_key?(resp, "test_pack_nonshared") - - pack = resp["test_pack_nonshared"] - - refute pack["pack"]["shared"] - refute pack["pack"]["can-download"] - end - - test "listing remote packs" do + setup do admin = insert(:user, is_admin: true) - %{conn: conn} = oauth_access(["admin:write"], user: admin) + token = insert(:oauth_admin_token, user: admin) - resp = - build_conn() - |> get(emoji_api_path(conn, :list_packs)) - |> json_response(200) - - mock(fn - %{method: :get, url: "https://example.com/.well-known/nodeinfo"} -> - json(%{links: [%{href: "https://example.com/nodeinfo/2.1.json"}]}) - - %{method: :get, url: "https://example.com/nodeinfo/2.1.json"} -> - json(%{metadata: %{features: ["shareable_emoji_packs"]}}) - - %{method: :get, url: "https://example.com/api/pleroma/emoji/packs"} -> - json(resp) - end) - - assert conn - |> post(emoji_api_path(conn, :list_from), %{instance_address: "https://example.com"}) - |> json_response(200) == resp - end - - test "downloading a shared pack from download_shared" do - conn = build_conn() - - resp = - conn - |> get(emoji_api_path(conn, :download_shared, "test_pack")) - |> response(200) - - {:ok, arch} = :zip.unzip(resp, [:memory]) - - assert Enum.find(arch, fn {n, _} -> n == 'pack.json' end) - assert Enum.find(arch, fn {n, _} -> n == 'blank.png' end) - end - - test "downloading shared & unshared packs from another instance via download_from, deleting them" do - on_exit(fn -> - File.rm_rf!("#{@emoji_dir_path}/test_pack2") - File.rm_rf!("#{@emoji_dir_path}/test_pack_nonshared2") - end) - - mock(fn - %{method: :get, url: "https://old-instance/.well-known/nodeinfo"} -> - json(%{links: [%{href: "https://old-instance/nodeinfo/2.1.json"}]}) - - %{method: :get, url: "https://old-instance/nodeinfo/2.1.json"} -> - json(%{metadata: %{features: []}}) - - %{method: :get, url: "https://example.com/.well-known/nodeinfo"} -> - json(%{links: [%{href: "https://example.com/nodeinfo/2.1.json"}]}) - - %{method: :get, url: "https://example.com/nodeinfo/2.1.json"} -> - json(%{metadata: %{features: ["shareable_emoji_packs"]}}) - - %{ - method: :get, - url: "https://example.com/api/pleroma/emoji/packs/list" - } -> - conn = build_conn() - - conn - |> get(emoji_api_path(conn, :list_packs)) - |> json_response(200) - |> json() - - %{ - method: :get, - url: "https://example.com/api/pleroma/emoji/packs/download_shared/test_pack" - } -> - conn = build_conn() - - conn - |> get(emoji_api_path(conn, :download_shared, "test_pack")) - |> response(200) - |> text() - - %{ - method: :get, - url: "https://nonshared-pack" - } -> - text(File.read!("#{@emoji_dir_path}/test_pack_nonshared/nonshared.zip")) - end) - - admin = insert(:user, is_admin: true) - - conn = + admin_conn = build_conn() |> assign(:user, admin) - |> assign(:token, insert(:oauth_admin_token, user: admin, scopes: ["admin:write"])) + |> assign(:token, token) - assert (conn - |> put_req_header("content-type", "application/json") - |> post( - emoji_api_path( - conn, - :download_from - ), - %{ - instance_address: "https://old-instance", - pack_name: "test_pack", - as: "test_pack2" - } - |> Jason.encode!() - ) - |> json_response(500))["error"] =~ "does not support" - - assert conn - |> put_req_header("content-type", "application/json") - |> post( - emoji_api_path( - conn, - :download_from - ), - %{ - instance_address: "https://example.com", - pack_name: "test_pack", - as: "test_pack2" - } - |> Jason.encode!() - ) - |> json_response(200) == "ok" - - assert File.exists?("#{@emoji_dir_path}/test_pack2/pack.json") - assert File.exists?("#{@emoji_dir_path}/test_pack2/blank.png") - - assert conn - |> delete(emoji_api_path(conn, :delete, "test_pack2")) - |> json_response(200) == "ok" - - refute File.exists?("#{@emoji_dir_path}/test_pack2") - - # non-shared, downloaded from the fallback URL - - assert conn - |> put_req_header("content-type", "application/json") - |> post( - emoji_api_path( - conn, - :download_from - ), - %{ - instance_address: "https://example.com", - pack_name: "test_pack_nonshared", - as: "test_pack_nonshared2" - } - |> Jason.encode!() - ) - |> json_response(200) == "ok" - - assert File.exists?("#{@emoji_dir_path}/test_pack_nonshared2/pack.json") - assert File.exists?("#{@emoji_dir_path}/test_pack_nonshared2/blank.png") - - assert conn - |> delete(emoji_api_path(conn, :delete, "test_pack_nonshared2")) - |> json_response(200) == "ok" - - refute File.exists?("#{@emoji_dir_path}/test_pack_nonshared2") + Pleroma.Emoji.reload() + {:ok, %{admin_conn: admin_conn}} end - describe "updating pack metadata" do + test "GET /api/pleroma/emoji/packs", %{conn: conn} do + resp = conn |> get("/api/pleroma/emoji/packs") |> json_response(200) + + shared = resp["test_pack"] + assert shared["files"] == %{"blank" => "blank.png"} + assert Map.has_key?(shared["pack"], "download-sha256") + assert shared["pack"]["can-download"] + assert shared["pack"]["share-files"] + + non_shared = resp["test_pack_nonshared"] + assert non_shared["pack"]["share-files"] == false + assert non_shared["pack"]["can-download"] == false + end + + describe "GET /api/pleroma/emoji/packs/remote" do + test "shareable instance", %{admin_conn: admin_conn, conn: conn} do + resp = + conn + |> get("/api/pleroma/emoji/packs") + |> json_response(200) + + mock(fn + %{method: :get, url: "https://example.com/.well-known/nodeinfo"} -> + json(%{links: [%{href: "https://example.com/nodeinfo/2.1.json"}]}) + + %{method: :get, url: "https://example.com/nodeinfo/2.1.json"} -> + json(%{metadata: %{features: ["shareable_emoji_packs"]}}) + + %{method: :get, url: "https://example.com/api/pleroma/emoji/packs"} -> + json(resp) + end) + + assert admin_conn + |> get("/api/pleroma/emoji/packs/remote", %{ + url: "https://example.com" + }) + |> json_response(200) == resp + end + + test "non shareable instance", %{admin_conn: admin_conn} do + mock(fn + %{method: :get, url: "https://example.com/.well-known/nodeinfo"} -> + json(%{links: [%{href: "https://example.com/nodeinfo/2.1.json"}]}) + + %{method: :get, url: "https://example.com/nodeinfo/2.1.json"} -> + json(%{metadata: %{features: []}}) + end) + + assert admin_conn + |> get("/api/pleroma/emoji/packs/remote", %{url: "https://example.com"}) + |> json_response(500) == %{ + "error" => "The requested instance does not support sharing emoji packs" + } + end + end + + describe "GET /api/pleroma/emoji/packs/:name/archive" do + test "download shared pack", %{conn: conn} do + resp = + conn + |> get("/api/pleroma/emoji/packs/test_pack/archive") + |> response(200) + + {:ok, arch} = :zip.unzip(resp, [:memory]) + + assert Enum.find(arch, fn {n, _} -> n == 'pack.json' end) + assert Enum.find(arch, fn {n, _} -> n == 'blank.png' end) + end + + test "non existing pack", %{conn: conn} do + assert conn + |> get("/api/pleroma/emoji/packs/test_pack_for_import/archive") + |> json_response(:not_found) == %{ + "error" => "Pack test_pack_for_import does not exist" + } + end + + test "non downloadable pack", %{conn: conn} do + assert conn + |> get("/api/pleroma/emoji/packs/test_pack_nonshared/archive") + |> json_response(:forbidden) == %{ + "error" => + "Pack test_pack_nonshared cannot be downloaded from this instance, either pack sharing was disabled for this pack or some files are missing" + } + end + end + + describe "POST /api/pleroma/emoji/packs/download" do + test "shared pack from remote and non shared from fallback-src", %{ + admin_conn: admin_conn, + conn: conn + } do + mock(fn + %{method: :get, url: "https://example.com/.well-known/nodeinfo"} -> + json(%{links: [%{href: "https://example.com/nodeinfo/2.1.json"}]}) + + %{method: :get, url: "https://example.com/nodeinfo/2.1.json"} -> + json(%{metadata: %{features: ["shareable_emoji_packs"]}}) + + %{ + method: :get, + url: "https://example.com/api/pleroma/emoji/packs/test_pack" + } -> + conn + |> get("/api/pleroma/emoji/packs/test_pack") + |> json_response(200) + |> json() + + %{ + method: :get, + url: "https://example.com/api/pleroma/emoji/packs/test_pack/archive" + } -> + conn + |> get("/api/pleroma/emoji/packs/test_pack/archive") + |> response(200) + |> text() + + %{ + method: :get, + url: "https://example.com/api/pleroma/emoji/packs/test_pack_nonshared" + } -> + conn + |> get("/api/pleroma/emoji/packs/test_pack_nonshared") + |> json_response(200) + |> json() + + %{ + method: :get, + url: "https://nonshared-pack" + } -> + text(File.read!("#{@emoji_path}/test_pack_nonshared/nonshared.zip")) + end) + + assert admin_conn + |> post("/api/pleroma/emoji/packs/download", %{ + url: "https://example.com", + name: "test_pack", + as: "test_pack2" + }) + |> json_response(200) == "ok" + + assert File.exists?("#{@emoji_path}/test_pack2/pack.json") + assert File.exists?("#{@emoji_path}/test_pack2/blank.png") + + assert admin_conn + |> delete("/api/pleroma/emoji/packs/test_pack2") + |> json_response(200) == "ok" + + refute File.exists?("#{@emoji_path}/test_pack2") + + assert admin_conn + |> post( + "/api/pleroma/emoji/packs/download", + %{ + url: "https://example.com", + name: "test_pack_nonshared", + as: "test_pack_nonshared2" + } + ) + |> json_response(200) == "ok" + + assert File.exists?("#{@emoji_path}/test_pack_nonshared2/pack.json") + assert File.exists?("#{@emoji_path}/test_pack_nonshared2/blank.png") + + assert admin_conn + |> delete("/api/pleroma/emoji/packs/test_pack_nonshared2") + |> json_response(200) == "ok" + + refute File.exists?("#{@emoji_path}/test_pack_nonshared2") + end + + test "nonshareable instance", %{admin_conn: admin_conn} do + mock(fn + %{method: :get, url: "https://old-instance/.well-known/nodeinfo"} -> + json(%{links: [%{href: "https://old-instance/nodeinfo/2.1.json"}]}) + + %{method: :get, url: "https://old-instance/nodeinfo/2.1.json"} -> + json(%{metadata: %{features: []}}) + end) + + assert admin_conn + |> post( + "/api/pleroma/emoji/packs/download", + %{ + url: "https://old-instance", + name: "test_pack", + as: "test_pack2" + } + ) + |> json_response(500) == %{ + "error" => "The requested instance does not support sharing emoji packs" + } + end + + test "checksum fail", %{admin_conn: admin_conn} do + mock(fn + %{method: :get, url: "https://example.com/.well-known/nodeinfo"} -> + json(%{links: [%{href: "https://example.com/nodeinfo/2.1.json"}]}) + + %{method: :get, url: "https://example.com/nodeinfo/2.1.json"} -> + json(%{metadata: %{features: ["shareable_emoji_packs"]}}) + + %{ + method: :get, + url: "https://example.com/api/pleroma/emoji/packs/pack_bad_sha" + } -> + %Tesla.Env{ + status: 200, + body: Pleroma.Emoji.Pack.load_pack("pack_bad_sha") |> Jason.encode!() + } + + %{ + method: :get, + url: "https://example.com/api/pleroma/emoji/packs/pack_bad_sha/archive" + } -> + %Tesla.Env{ + status: 200, + body: File.read!("test/instance_static/emoji/pack_bad_sha/pack_bad_sha.zip") + } + end) + + assert admin_conn + |> post("/api/pleroma/emoji/packs/download", %{ + url: "https://example.com", + name: "pack_bad_sha", + as: "pack_bad_sha2" + }) + |> json_response(:internal_server_error) == %{ + "error" => "SHA256 for the pack doesn't match the one sent by the server" + } + end + + test "other error", %{admin_conn: admin_conn} do + mock(fn + %{method: :get, url: "https://example.com/.well-known/nodeinfo"} -> + json(%{links: [%{href: "https://example.com/nodeinfo/2.1.json"}]}) + + %{method: :get, url: "https://example.com/nodeinfo/2.1.json"} -> + json(%{metadata: %{features: ["shareable_emoji_packs"]}}) + + %{ + method: :get, + url: "https://example.com/api/pleroma/emoji/packs/test_pack" + } -> + %Tesla.Env{ + status: 200, + body: Pleroma.Emoji.Pack.load_pack("test_pack") |> Jason.encode!() + } + end) + + assert admin_conn + |> post("/api/pleroma/emoji/packs/download", %{ + url: "https://example.com", + name: "test_pack", + as: "test_pack2" + }) + |> json_response(:internal_server_error) == %{ + "error" => + "The pack was not set as shared and there is no fallback src to download from" + } + end + end + + describe "PATCH /api/pleroma/emoji/packs/:name" do setup do - pack_file = "#{@emoji_dir_path}/test_pack/pack.json" + pack_file = "#{@emoji_path}/test_pack/pack.json" original_content = File.read!(pack_file) on_exit(fn -> File.write!(pack_file, original_content) end) - admin = insert(:user, is_admin: true) - %{conn: conn} = oauth_access(["admin:write"], user: admin) - {:ok, - admin: admin, - conn: conn, pack_file: pack_file, new_data: %{ "license" => "Test license changed", @@ -225,15 +310,8 @@ test "downloading shared & unshared packs from another instance via download_fro end test "for a pack without a fallback source", ctx do - conn = ctx[:conn] - - assert conn - |> post( - emoji_api_path(conn, :update_metadata, "test_pack"), - %{ - "new_data" => ctx[:new_data] - } - ) + assert ctx[:admin_conn] + |> patch("/api/pleroma/emoji/packs/test_pack", %{"metadata" => ctx[:new_data]}) |> json_response(200) == ctx[:new_data] assert Jason.decode!(File.read!(ctx[:pack_file]))["pack"] == ctx[:new_data] @@ -245,7 +323,7 @@ test "for a pack with a fallback source", ctx do method: :get, url: "https://nonshared-pack" } -> - text(File.read!("#{@emoji_dir_path}/test_pack_nonshared/nonshared.zip")) + text(File.read!("#{@emoji_path}/test_pack_nonshared/nonshared.zip")) end) new_data = Map.put(ctx[:new_data], "fallback-src", "https://nonshared-pack") @@ -257,15 +335,8 @@ test "for a pack with a fallback source", ctx do "74409E2674DAA06C072729C6C8426C4CB3B7E0B85ED77792DB7A436E11D76DAF" ) - conn = ctx[:conn] - - assert conn - |> post( - emoji_api_path(conn, :update_metadata, "test_pack"), - %{ - "new_data" => new_data - } - ) + assert ctx[:admin_conn] + |> patch("/api/pleroma/emoji/packs/test_pack", %{metadata: new_data}) |> json_response(200) == new_data_with_sha assert Jason.decode!(File.read!(ctx[:pack_file]))["pack"] == new_data_with_sha @@ -283,181 +354,377 @@ test "when the fallback source doesn't have all the files", ctx do new_data = Map.put(ctx[:new_data], "fallback-src", "https://nonshared-pack") - conn = ctx[:conn] - - assert (conn - |> post( - emoji_api_path(conn, :update_metadata, "test_pack"), - %{ - "new_data" => new_data - } - ) - |> json_response(:bad_request))["error"] =~ "does not have all" + assert ctx[:admin_conn] + |> patch("/api/pleroma/emoji/packs/test_pack", %{metadata: new_data}) + |> json_response(:bad_request) == %{ + "error" => "The fallback archive does not have all files specified in pack.json" + } end end - test "updating pack files" do - pack_file = "#{@emoji_dir_path}/test_pack/pack.json" - original_content = File.read!(pack_file) + describe "POST/PATCH/DELETE /api/pleroma/emoji/packs/:name/files" do + setup do + pack_file = "#{@emoji_path}/test_pack/pack.json" + original_content = File.read!(pack_file) - on_exit(fn -> - File.write!(pack_file, original_content) + on_exit(fn -> + File.write!(pack_file, original_content) + end) - File.rm_rf!("#{@emoji_dir_path}/test_pack/blank_url.png") - File.rm_rf!("#{@emoji_dir_path}/test_pack/dir") - File.rm_rf!("#{@emoji_dir_path}/test_pack/dir_2") - end) + :ok + end - admin = insert(:user, is_admin: true) - %{conn: conn} = oauth_access(["admin:write"], user: admin) + test "create shortcode exists", %{admin_conn: admin_conn} do + assert admin_conn + |> post("/api/pleroma/emoji/packs/test_pack/files", %{ + shortcode: "blank", + filename: "dir/blank.png", + file: %Plug.Upload{ + filename: "blank.png", + path: "#{@emoji_path}/test_pack/blank.png" + } + }) + |> json_response(:conflict) == %{ + "error" => "An emoji with the \"blank\" shortcode already exists" + } + end - same_name = %{ - "action" => "add", - "shortcode" => "blank", - "filename" => "dir/blank.png", - "file" => %Plug.Upload{ - filename: "blank.png", - path: "#{@emoji_dir_path}/test_pack/blank.png" - } - } + test "don't rewrite old emoji", %{admin_conn: admin_conn} do + on_exit(fn -> File.rm_rf!("#{@emoji_path}/test_pack/dir/") end) - different_name = %{same_name | "shortcode" => "blank_2"} + assert admin_conn + |> post("/api/pleroma/emoji/packs/test_pack/files", %{ + shortcode: "blank2", + filename: "dir/blank.png", + file: %Plug.Upload{ + filename: "blank.png", + path: "#{@emoji_path}/test_pack/blank.png" + } + }) + |> json_response(200) == %{"blank" => "blank.png", "blank2" => "dir/blank.png"} - assert (conn - |> post(emoji_api_path(conn, :update_file, "test_pack"), same_name) - |> json_response(:conflict))["error"] =~ "already exists" + assert File.exists?("#{@emoji_path}/test_pack/dir/blank.png") - assert conn - |> post(emoji_api_path(conn, :update_file, "test_pack"), different_name) - |> json_response(200) == %{"blank" => "blank.png", "blank_2" => "dir/blank.png"} + assert admin_conn + |> patch("/api/pleroma/emoji/packs/test_pack/files", %{ + shortcode: "blank", + new_shortcode: "blank2", + new_filename: "dir_2/blank_3.png" + }) + |> json_response(:conflict) == %{ + "error" => + "New shortcode \"blank2\" is already used. If you want to override emoji use 'force' option" + } + end - assert File.exists?("#{@emoji_dir_path}/test_pack/dir/blank.png") + test "rewrite old emoji with force option", %{admin_conn: admin_conn} do + on_exit(fn -> File.rm_rf!("#{@emoji_path}/test_pack/dir_2/") end) - assert conn - |> post(emoji_api_path(conn, :update_file, "test_pack"), %{ - "action" => "update", - "shortcode" => "blank_2", - "new_shortcode" => "blank_3", - "new_filename" => "dir_2/blank_3.png" - }) - |> json_response(200) == %{"blank" => "blank.png", "blank_3" => "dir_2/blank_3.png"} + assert admin_conn + |> post("/api/pleroma/emoji/packs/test_pack/files", %{ + shortcode: "blank2", + filename: "dir/blank.png", + file: %Plug.Upload{ + filename: "blank.png", + path: "#{@emoji_path}/test_pack/blank.png" + } + }) + |> json_response(200) == %{"blank" => "blank.png", "blank2" => "dir/blank.png"} - refute File.exists?("#{@emoji_dir_path}/test_pack/dir/") - assert File.exists?("#{@emoji_dir_path}/test_pack/dir_2/blank_3.png") + assert File.exists?("#{@emoji_path}/test_pack/dir/blank.png") - assert conn - |> post(emoji_api_path(conn, :update_file, "test_pack"), %{ - "action" => "remove", - "shortcode" => "blank_3" - }) - |> json_response(200) == %{"blank" => "blank.png"} + assert admin_conn + |> patch("/api/pleroma/emoji/packs/test_pack/files", %{ + shortcode: "blank2", + new_shortcode: "blank3", + new_filename: "dir_2/blank_3.png", + force: true + }) + |> json_response(200) == %{ + "blank" => "blank.png", + "blank3" => "dir_2/blank_3.png" + } - refute File.exists?("#{@emoji_dir_path}/test_pack/dir_2/") + assert File.exists?("#{@emoji_path}/test_pack/dir_2/blank_3.png") + end - mock(fn - %{ - method: :get, - url: "https://test-blank/blank_url.png" - } -> - text(File.read!("#{@emoji_dir_path}/test_pack/blank.png")) - end) + test "with empty filename", %{admin_conn: admin_conn} do + assert admin_conn + |> post("/api/pleroma/emoji/packs/test_pack/files", %{ + shortcode: "blank2", + filename: "", + file: %Plug.Upload{ + filename: "blank.png", + path: "#{@emoji_path}/test_pack/blank.png" + } + }) + |> json_response(:bad_request) == %{ + "error" => "pack name, shortcode or filename cannot be empty" + } + end - # The name should be inferred from the URL ending - from_url = %{ - "action" => "add", - "shortcode" => "blank_url", - "file" => "https://test-blank/blank_url.png" - } + test "add file with not loaded pack", %{admin_conn: admin_conn} do + assert admin_conn + |> post("/api/pleroma/emoji/packs/not_loaded/files", %{ + shortcode: "blank2", + filename: "dir/blank.png", + file: %Plug.Upload{ + filename: "blank.png", + path: "#{@emoji_path}/test_pack/blank.png" + } + }) + |> json_response(:bad_request) == %{ + "error" => "pack \"not_loaded\" is not found" + } + end - assert conn - |> post(emoji_api_path(conn, :update_file, "test_pack"), from_url) - |> json_response(200) == %{ - "blank" => "blank.png", - "blank_url" => "blank_url.png" - } + test "remove file with not loaded pack", %{admin_conn: admin_conn} do + assert admin_conn + |> delete("/api/pleroma/emoji/packs/not_loaded/files", %{shortcode: "blank3"}) + |> json_response(:bad_request) == %{"error" => "pack \"not_loaded\" is not found"} + end - assert File.exists?("#{@emoji_dir_path}/test_pack/blank_url.png") + test "remove file with empty shortcode", %{admin_conn: admin_conn} do + assert admin_conn + |> delete("/api/pleroma/emoji/packs/not_loaded/files", %{shortcode: ""}) + |> json_response(:bad_request) == %{ + "error" => "pack name or shortcode cannot be empty" + } + end - assert conn - |> post(emoji_api_path(conn, :update_file, "test_pack"), %{ - "action" => "remove", - "shortcode" => "blank_url" - }) - |> json_response(200) == %{"blank" => "blank.png"} + test "update file with not loaded pack", %{admin_conn: admin_conn} do + assert admin_conn + |> patch("/api/pleroma/emoji/packs/not_loaded/files", %{ + shortcode: "blank4", + new_shortcode: "blank3", + new_filename: "dir_2/blank_3.png" + }) + |> json_response(:bad_request) == %{"error" => "pack \"not_loaded\" is not found"} + end - refute File.exists?("#{@emoji_dir_path}/test_pack/blank_url.png") + test "new with shortcode as file with update", %{admin_conn: admin_conn} do + assert admin_conn + |> post("/api/pleroma/emoji/packs/test_pack/files", %{ + shortcode: "blank4", + filename: "dir/blank.png", + file: %Plug.Upload{ + filename: "blank.png", + path: "#{@emoji_path}/test_pack/blank.png" + } + }) + |> json_response(200) == %{"blank" => "blank.png", "blank4" => "dir/blank.png"} + + assert File.exists?("#{@emoji_path}/test_pack/dir/blank.png") + + assert admin_conn + |> patch("/api/pleroma/emoji/packs/test_pack/files", %{ + shortcode: "blank4", + new_shortcode: "blank3", + new_filename: "dir_2/blank_3.png" + }) + |> json_response(200) == %{"blank3" => "dir_2/blank_3.png", "blank" => "blank.png"} + + refute File.exists?("#{@emoji_path}/test_pack/dir/") + assert File.exists?("#{@emoji_path}/test_pack/dir_2/blank_3.png") + + assert admin_conn + |> delete("/api/pleroma/emoji/packs/test_pack/files", %{shortcode: "blank3"}) + |> json_response(200) == %{"blank" => "blank.png"} + + refute File.exists?("#{@emoji_path}/test_pack/dir_2/") + + on_exit(fn -> File.rm_rf!("#{@emoji_path}/test_pack/dir") end) + end + + test "new with shortcode from url", %{admin_conn: admin_conn} do + mock(fn + %{ + method: :get, + url: "https://test-blank/blank_url.png" + } -> + text(File.read!("#{@emoji_path}/test_pack/blank.png")) + end) + + assert admin_conn + |> post("/api/pleroma/emoji/packs/test_pack/files", %{ + shortcode: "blank_url", + file: "https://test-blank/blank_url.png" + }) + |> json_response(200) == %{ + "blank_url" => "blank_url.png", + "blank" => "blank.png" + } + + assert File.exists?("#{@emoji_path}/test_pack/blank_url.png") + + on_exit(fn -> File.rm_rf!("#{@emoji_path}/test_pack/blank_url.png") end) + end + + test "new without shortcode", %{admin_conn: admin_conn} do + on_exit(fn -> File.rm_rf!("#{@emoji_path}/test_pack/shortcode.png") end) + + assert admin_conn + |> post("/api/pleroma/emoji/packs/test_pack/files", %{ + file: %Plug.Upload{ + filename: "shortcode.png", + path: "#{Pleroma.Config.get([:instance, :static_dir])}/add/shortcode.png" + } + }) + |> json_response(200) == %{"shortcode" => "shortcode.png", "blank" => "blank.png"} + end + + test "remove non existing shortcode in pack.json", %{admin_conn: admin_conn} do + assert admin_conn + |> delete("/api/pleroma/emoji/packs/test_pack/files", %{shortcode: "blank2"}) + |> json_response(:bad_request) == %{"error" => "Emoji \"blank2\" does not exist"} + end + + test "update non existing emoji", %{admin_conn: admin_conn} do + assert admin_conn + |> patch("/api/pleroma/emoji/packs/test_pack/files", %{ + shortcode: "blank2", + new_shortcode: "blank3", + new_filename: "dir_2/blank_3.png" + }) + |> json_response(:bad_request) == %{"error" => "Emoji \"blank2\" does not exist"} + end + + test "update with empty shortcode", %{admin_conn: admin_conn} do + assert admin_conn + |> patch("/api/pleroma/emoji/packs/test_pack/files", %{ + shortcode: "blank", + new_filename: "dir_2/blank_3.png" + }) + |> json_response(:bad_request) == %{ + "error" => "new_shortcode or new_filename cannot be empty" + } + end end - test "creating and deleting a pack" do - on_exit(fn -> - File.rm_rf!("#{@emoji_dir_path}/test_created") - end) + describe "POST/DELETE /api/pleroma/emoji/packs/:name" do + test "creating and deleting a pack", %{admin_conn: admin_conn} do + assert admin_conn + |> post("/api/pleroma/emoji/packs/test_created") + |> json_response(200) == "ok" - admin = insert(:user, is_admin: true) - %{conn: conn} = oauth_access(["admin:write"], user: admin) + assert File.exists?("#{@emoji_path}/test_created/pack.json") - assert conn - |> put_req_header("content-type", "application/json") - |> put( - emoji_api_path( - conn, - :create, - "test_created" - ) - ) - |> json_response(200) == "ok" + assert Jason.decode!(File.read!("#{@emoji_path}/test_created/pack.json")) == %{ + "pack" => %{}, + "files" => %{} + } - assert File.exists?("#{@emoji_dir_path}/test_created/pack.json") + assert admin_conn + |> delete("/api/pleroma/emoji/packs/test_created") + |> json_response(200) == "ok" - assert Jason.decode!(File.read!("#{@emoji_dir_path}/test_created/pack.json")) == %{ - "pack" => %{}, - "files" => %{} - } + refute File.exists?("#{@emoji_path}/test_created/pack.json") + end - assert conn - |> delete(emoji_api_path(conn, :delete, "test_created")) - |> json_response(200) == "ok" + test "if pack exists", %{admin_conn: admin_conn} do + path = Path.join(@emoji_path, "test_created") + File.mkdir(path) + pack_file = Jason.encode!(%{files: %{}, pack: %{}}) + File.write!(Path.join(path, "pack.json"), pack_file) - refute File.exists?("#{@emoji_dir_path}/test_created/pack.json") + assert admin_conn + |> post("/api/pleroma/emoji/packs/test_created") + |> json_response(:conflict) == %{ + "error" => "A pack named \"test_created\" already exists" + } + + on_exit(fn -> File.rm_rf(path) end) + end + + test "with empty name", %{admin_conn: admin_conn} do + assert admin_conn + |> post("/api/pleroma/emoji/packs/ ") + |> json_response(:bad_request) == %{"error" => "pack name cannot be empty"} + end end - test "filesystem import" do + test "deleting nonexisting pack", %{admin_conn: admin_conn} do + assert admin_conn + |> delete("/api/pleroma/emoji/packs/non_existing") + |> json_response(:not_found) == %{"error" => "Pack non_existing does not exist"} + end + + test "deleting with empty name", %{admin_conn: admin_conn} do + assert admin_conn + |> delete("/api/pleroma/emoji/packs/ ") + |> json_response(:bad_request) == %{"error" => "pack name cannot be empty"} + end + + test "filesystem import", %{admin_conn: admin_conn, conn: conn} do on_exit(fn -> - File.rm!("#{@emoji_dir_path}/test_pack_for_import/emoji.txt") - File.rm!("#{@emoji_dir_path}/test_pack_for_import/pack.json") + File.rm!("#{@emoji_path}/test_pack_for_import/emoji.txt") + File.rm!("#{@emoji_path}/test_pack_for_import/pack.json") end) - conn = build_conn() - resp = conn |> get(emoji_api_path(conn, :list_packs)) |> json_response(200) + resp = conn |> get("/api/pleroma/emoji/packs") |> json_response(200) refute Map.has_key?(resp, "test_pack_for_import") - admin = insert(:user, is_admin: true) - %{conn: conn} = oauth_access(["admin:write"], user: admin) - - assert conn - |> post(emoji_api_path(conn, :import_from_fs)) + assert admin_conn + |> get("/api/pleroma/emoji/packs/import") |> json_response(200) == ["test_pack_for_import"] - resp = conn |> get(emoji_api_path(conn, :list_packs)) |> json_response(200) + resp = conn |> get("/api/pleroma/emoji/packs") |> json_response(200) assert resp["test_pack_for_import"]["files"] == %{"blank" => "blank.png"} - File.rm!("#{@emoji_dir_path}/test_pack_for_import/pack.json") - refute File.exists?("#{@emoji_dir_path}/test_pack_for_import/pack.json") + File.rm!("#{@emoji_path}/test_pack_for_import/pack.json") + refute File.exists?("#{@emoji_path}/test_pack_for_import/pack.json") - emoji_txt_content = "blank, blank.png, Fun\n\nblank2, blank.png" + emoji_txt_content = """ + blank, blank.png, Fun + blank2, blank.png + foo, /emoji/test_pack_for_import/blank.png + bar + """ - File.write!("#{@emoji_dir_path}/test_pack_for_import/emoji.txt", emoji_txt_content) + File.write!("#{@emoji_path}/test_pack_for_import/emoji.txt", emoji_txt_content) - assert conn - |> post(emoji_api_path(conn, :import_from_fs)) + assert admin_conn + |> get("/api/pleroma/emoji/packs/import") |> json_response(200) == ["test_pack_for_import"] - resp = build_conn() |> get(emoji_api_path(conn, :list_packs)) |> json_response(200) + resp = conn |> get("/api/pleroma/emoji/packs") |> json_response(200) assert resp["test_pack_for_import"]["files"] == %{ "blank" => "blank.png", - "blank2" => "blank.png" + "blank2" => "blank.png", + "foo" => "blank.png" } end + + describe "GET /api/pleroma/emoji/packs/:name" do + test "shows pack.json", %{conn: conn} do + assert %{ + "files" => %{"blank" => "blank.png"}, + "pack" => %{ + "can-download" => true, + "description" => "Test description", + "download-sha256" => _, + "homepage" => "https://pleroma.social", + "license" => "Test license", + "share-files" => true + } + } = + conn + |> get("/api/pleroma/emoji/packs/test_pack") + |> json_response(200) + end + + test "non existing pack", %{conn: conn} do + assert conn + |> get("/api/pleroma/emoji/packs/non_existing") + |> json_response(:not_found) == %{"error" => "Pack non_existing does not exist"} + end + + test "error name", %{conn: conn} do + assert conn + |> get("/api/pleroma/emoji/packs/ ") + |> json_response(:bad_request) == %{"error" => "pack name cannot be empty"} + end + end end diff --git a/test/web/pleroma_api/controllers/pleroma_api_controller_test.exs b/test/web/pleroma_api/controllers/pleroma_api_controller_test.exs index 32250f06f..cfd1dbd24 100644 --- a/test/web/pleroma_api/controllers/pleroma_api_controller_test.exs +++ b/test/web/pleroma_api/controllers/pleroma_api_controller_test.exs @@ -3,12 +3,14 @@ # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.Web.PleromaAPI.PleromaAPIControllerTest do + use Oban.Testing, repo: Pleroma.Repo use Pleroma.Web.ConnCase alias Pleroma.Conversation.Participation alias Pleroma.Notification alias Pleroma.Object alias Pleroma.Repo + alias Pleroma.Tests.ObanHelpers alias Pleroma.User alias Pleroma.Web.CommonAPI @@ -18,7 +20,7 @@ test "PUT /api/v1/pleroma/statuses/:id/reactions/:emoji", %{conn: conn} do user = insert(:user) other_user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "#cofe"}) + {:ok, activity} = CommonAPI.post(user, %{status: "#cofe"}) result = conn @@ -40,8 +42,10 @@ test "DELETE /api/v1/pleroma/statuses/:id/reactions/:emoji", %{conn: conn} do user = insert(:user) other_user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "#cofe"}) - {:ok, activity, _object} = CommonAPI.react_with_emoji(activity.id, other_user, "☕") + {:ok, activity} = CommonAPI.post(user, %{status: "#cofe"}) + {:ok, _reaction_activity} = CommonAPI.react_with_emoji(activity.id, other_user, "☕") + + ObanHelpers.perform_all() result = conn @@ -52,7 +56,9 @@ test "DELETE /api/v1/pleroma/statuses/:id/reactions/:emoji", %{conn: conn} do assert %{"id" => id} = json_response(result, 200) assert to_string(activity.id) == id - object = Object.normalize(activity) + ObanHelpers.perform_all() + + object = Object.get_by_ap_id(activity.data["object"]) assert object.data["reaction_count"] == 0 end @@ -62,7 +68,7 @@ test "GET /api/v1/pleroma/statuses/:id/reactions", %{conn: conn} do other_user = insert(:user) doomed_user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "#cofe"}) + {:ok, activity} = CommonAPI.post(user, %{status: "#cofe"}) result = conn @@ -71,8 +77,8 @@ test "GET /api/v1/pleroma/statuses/:id/reactions", %{conn: conn} do assert result == [] - {:ok, _, _} = CommonAPI.react_with_emoji(activity.id, other_user, "🎅") - {:ok, _, _} = CommonAPI.react_with_emoji(activity.id, doomed_user, "🎅") + {:ok, _} = CommonAPI.react_with_emoji(activity.id, other_user, "🎅") + {:ok, _} = CommonAPI.react_with_emoji(activity.id, doomed_user, "🎅") User.perform(:delete, doomed_user) @@ -100,7 +106,7 @@ test "GET /api/v1/pleroma/statuses/:id/reactions/:emoji", %{conn: conn} do user = insert(:user) other_user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "#cofe"}) + {:ok, activity} = CommonAPI.post(user, %{status: "#cofe"}) result = conn @@ -109,8 +115,8 @@ test "GET /api/v1/pleroma/statuses/:id/reactions/:emoji", %{conn: conn} do assert result == [] - {:ok, _, _} = CommonAPI.react_with_emoji(activity.id, other_user, "🎅") - {:ok, _, _} = CommonAPI.react_with_emoji(activity.id, other_user, "☕") + {:ok, _} = CommonAPI.react_with_emoji(activity.id, other_user, "🎅") + {:ok, _} = CommonAPI.react_with_emoji(activity.id, other_user, "☕") result = conn @@ -127,7 +133,7 @@ test "/api/v1/pleroma/conversations/:id" do %{user: other_user, conn: conn} = oauth_access(["read:statuses"]) {:ok, _activity} = - CommonAPI.post(user, %{"status" => "Hi @#{other_user.nickname}!", "visibility" => "direct"}) + CommonAPI.post(user, %{status: "Hi @#{other_user.nickname}!", visibility: "direct"}) [participation] = Participation.for_user(other_user) @@ -145,18 +151,18 @@ test "/api/v1/pleroma/conversations/:id/statuses" do third_user = insert(:user) {:ok, _activity} = - CommonAPI.post(user, %{"status" => "Hi @#{third_user.nickname}!", "visibility" => "direct"}) + CommonAPI.post(user, %{status: "Hi @#{third_user.nickname}!", visibility: "direct"}) {:ok, activity} = - CommonAPI.post(user, %{"status" => "Hi @#{other_user.nickname}!", "visibility" => "direct"}) + CommonAPI.post(user, %{status: "Hi @#{other_user.nickname}!", visibility: "direct"}) [participation] = Participation.for_user(other_user) {:ok, activity_two} = CommonAPI.post(other_user, %{ - "status" => "Hi!", - "in_reply_to_status_id" => activity.id, - "in_reply_to_conversation_id" => participation.id + status: "Hi!", + in_reply_to_status_id: activity.id, + in_reply_to_conversation_id: participation.id }) result = @@ -169,13 +175,30 @@ test "/api/v1/pleroma/conversations/:id/statuses" do id_one = activity.id id_two = activity_two.id assert [%{"id" => ^id_one}, %{"id" => ^id_two}] = result + + {:ok, %{id: id_three}} = + CommonAPI.post(other_user, %{ + status: "Bye!", + in_reply_to_status_id: activity.id, + in_reply_to_conversation_id: participation.id + }) + + assert [%{"id" => ^id_two}, %{"id" => ^id_three}] = + conn + |> get("/api/v1/pleroma/conversations/#{participation.id}/statuses?limit=2") + |> json_response(:ok) + + assert [%{"id" => ^id_three}] = + conn + |> get("/api/v1/pleroma/conversations/#{participation.id}/statuses?min_id=#{id_two}") + |> json_response(:ok) end test "PATCH /api/v1/pleroma/conversations/:id" do %{user: user, conn: conn} = oauth_access(["write:conversations"]) other_user = insert(:user) - {:ok, _activity} = CommonAPI.post(user, %{"status" => "Hi", "visibility" => "direct"}) + {:ok, _activity} = CommonAPI.post(user, %{status: "Hi", visibility: "direct"}) [participation] = Participation.for_user(user) @@ -203,13 +226,13 @@ test "PATCH /api/v1/pleroma/conversations/:id" do test "POST /api/v1/pleroma/conversations/read" do user = insert(:user) - %{user: other_user, conn: conn} = oauth_access(["write:notifications"]) + %{user: other_user, conn: conn} = oauth_access(["write:conversations"]) {:ok, _activity} = - CommonAPI.post(user, %{"status" => "Hi @#{other_user.nickname}", "visibility" => "direct"}) + CommonAPI.post(user, %{status: "Hi @#{other_user.nickname}", visibility: "direct"}) {:ok, _activity} = - CommonAPI.post(user, %{"status" => "Hi @#{other_user.nickname}", "visibility" => "direct"}) + CommonAPI.post(user, %{status: "Hi @#{other_user.nickname}", visibility: "direct"}) [participation2, participation1] = Participation.for_user(other_user) assert Participation.get(participation2.id).read == false @@ -232,8 +255,8 @@ test "POST /api/v1/pleroma/conversations/read" do test "it marks a single notification as read", %{user: user1, conn: conn} do user2 = insert(:user) - {:ok, activity1} = CommonAPI.post(user2, %{"status" => "hi @#{user1.nickname}"}) - {:ok, activity2} = CommonAPI.post(user2, %{"status" => "hi @#{user1.nickname}"}) + {:ok, activity1} = CommonAPI.post(user2, %{status: "hi @#{user1.nickname}"}) + {:ok, activity2} = CommonAPI.post(user2, %{status: "hi @#{user1.nickname}"}) {:ok, [notification1]} = Notification.create_notifications(activity1) {:ok, [notification2]} = Notification.create_notifications(activity2) @@ -249,9 +272,9 @@ test "it marks a single notification as read", %{user: user1, conn: conn} do test "it marks multiple notifications as read", %{user: user1, conn: conn} do user2 = insert(:user) - {:ok, _activity1} = CommonAPI.post(user2, %{"status" => "hi @#{user1.nickname}"}) - {:ok, _activity2} = CommonAPI.post(user2, %{"status" => "hi @#{user1.nickname}"}) - {:ok, _activity3} = CommonAPI.post(user2, %{"status" => "HIE @#{user1.nickname}"}) + {:ok, _activity1} = CommonAPI.post(user2, %{status: "hi @#{user1.nickname}"}) + {:ok, _activity2} = CommonAPI.post(user2, %{status: "hi @#{user1.nickname}"}) + {:ok, _activity3} = CommonAPI.post(user2, %{status: "HIE @#{user1.nickname}"}) [notification3, notification2, notification1] = Notification.for_user(user1, %{limit: 3}) diff --git a/test/web/pleroma_api/controllers/two_factor_authentication_controller_test.exs b/test/web/pleroma_api/controllers/two_factor_authentication_controller_test.exs new file mode 100644 index 000000000..d23d08a00 --- /dev/null +++ b/test/web/pleroma_api/controllers/two_factor_authentication_controller_test.exs @@ -0,0 +1,260 @@ +defmodule Pleroma.Web.PleromaAPI.TwoFactorAuthenticationControllerTest do + use Pleroma.Web.ConnCase + + import Pleroma.Factory + alias Pleroma.MFA.Settings + alias Pleroma.MFA.TOTP + + describe "GET /api/pleroma/accounts/mfa/settings" do + test "returns user mfa settings for new user", %{conn: conn} do + token = insert(:oauth_token, scopes: ["read", "follow"]) + token2 = insert(:oauth_token, scopes: ["write"]) + + assert conn + |> put_req_header("authorization", "Bearer #{token.token}") + |> get("/api/pleroma/accounts/mfa") + |> json_response(:ok) == %{ + "settings" => %{"enabled" => false, "totp" => false} + } + + assert conn + |> put_req_header("authorization", "Bearer #{token2.token}") + |> get("/api/pleroma/accounts/mfa") + |> json_response(403) == %{ + "error" => "Insufficient permissions: read:security." + } + end + + test "returns user mfa settings with enabled totp", %{conn: conn} do + user = + insert(:user, + multi_factor_authentication_settings: %Settings{ + enabled: true, + totp: %Settings.TOTP{secret: "XXX", delivery_type: "app", confirmed: true} + } + ) + + token = insert(:oauth_token, scopes: ["read", "follow"], user: user) + + assert conn + |> put_req_header("authorization", "Bearer #{token.token}") + |> get("/api/pleroma/accounts/mfa") + |> json_response(:ok) == %{ + "settings" => %{"enabled" => true, "totp" => true} + } + end + end + + describe "GET /api/pleroma/accounts/mfa/backup_codes" do + test "returns backup codes", %{conn: conn} do + user = + insert(:user, + multi_factor_authentication_settings: %Settings{ + backup_codes: ["1", "2", "3"], + totp: %Settings.TOTP{secret: "secret"} + } + ) + + token = insert(:oauth_token, scopes: ["write", "follow"], user: user) + token2 = insert(:oauth_token, scopes: ["read"]) + + response = + conn + |> put_req_header("authorization", "Bearer #{token.token}") + |> get("/api/pleroma/accounts/mfa/backup_codes") + |> json_response(:ok) + + assert [<<_::bytes-size(6)>>, <<_::bytes-size(6)>>] = response["codes"] + user = refresh_record(user) + mfa_settings = user.multi_factor_authentication_settings + assert mfa_settings.totp.secret == "secret" + refute mfa_settings.backup_codes == ["1", "2", "3"] + refute mfa_settings.backup_codes == [] + + assert conn + |> put_req_header("authorization", "Bearer #{token2.token}") + |> get("/api/pleroma/accounts/mfa/backup_codes") + |> json_response(403) == %{ + "error" => "Insufficient permissions: write:security." + } + end + end + + describe "GET /api/pleroma/accounts/mfa/setup/totp" do + test "return errors when method is invalid", %{conn: conn} do + user = insert(:user) + token = insert(:oauth_token, scopes: ["write", "follow"], user: user) + + response = + conn + |> put_req_header("authorization", "Bearer #{token.token}") + |> get("/api/pleroma/accounts/mfa/setup/torf") + |> json_response(400) + + assert response == %{"error" => "undefined method"} + end + + test "returns key and provisioning_uri", %{conn: conn} do + user = + insert(:user, + multi_factor_authentication_settings: %Settings{backup_codes: ["1", "2", "3"]} + ) + + token = insert(:oauth_token, scopes: ["write", "follow"], user: user) + token2 = insert(:oauth_token, scopes: ["read"]) + + response = + conn + |> put_req_header("authorization", "Bearer #{token.token}") + |> get("/api/pleroma/accounts/mfa/setup/totp") + |> json_response(:ok) + + user = refresh_record(user) + mfa_settings = user.multi_factor_authentication_settings + secret = mfa_settings.totp.secret + refute mfa_settings.enabled + assert mfa_settings.backup_codes == ["1", "2", "3"] + + assert response == %{ + "key" => secret, + "provisioning_uri" => TOTP.provisioning_uri(secret, "#{user.email}") + } + + assert conn + |> put_req_header("authorization", "Bearer #{token2.token}") + |> get("/api/pleroma/accounts/mfa/setup/totp") + |> json_response(403) == %{ + "error" => "Insufficient permissions: write:security." + } + end + end + + describe "GET /api/pleroma/accounts/mfa/confirm/totp" do + test "returns success result", %{conn: conn} do + secret = TOTP.generate_secret() + code = TOTP.generate_token(secret) + + user = + insert(:user, + multi_factor_authentication_settings: %Settings{ + backup_codes: ["1", "2", "3"], + totp: %Settings.TOTP{secret: secret} + } + ) + + token = insert(:oauth_token, scopes: ["write", "follow"], user: user) + token2 = insert(:oauth_token, scopes: ["read"]) + + assert conn + |> put_req_header("authorization", "Bearer #{token.token}") + |> post("/api/pleroma/accounts/mfa/confirm/totp", %{password: "test", code: code}) + |> json_response(:ok) + + settings = refresh_record(user).multi_factor_authentication_settings + assert settings.enabled + assert settings.totp.secret == secret + assert settings.totp.confirmed + assert settings.backup_codes == ["1", "2", "3"] + + assert conn + |> put_req_header("authorization", "Bearer #{token2.token}") + |> post("/api/pleroma/accounts/mfa/confirm/totp", %{password: "test", code: code}) + |> json_response(403) == %{ + "error" => "Insufficient permissions: write:security." + } + end + + test "returns error if password incorrect", %{conn: conn} do + secret = TOTP.generate_secret() + code = TOTP.generate_token(secret) + + user = + insert(:user, + multi_factor_authentication_settings: %Settings{ + backup_codes: ["1", "2", "3"], + totp: %Settings.TOTP{secret: secret} + } + ) + + token = insert(:oauth_token, scopes: ["write", "follow"], user: user) + + response = + conn + |> put_req_header("authorization", "Bearer #{token.token}") + |> post("/api/pleroma/accounts/mfa/confirm/totp", %{password: "xxx", code: code}) + |> json_response(422) + + settings = refresh_record(user).multi_factor_authentication_settings + refute settings.enabled + refute settings.totp.confirmed + assert settings.backup_codes == ["1", "2", "3"] + assert response == %{"error" => "Invalid password."} + end + + test "returns error if code incorrect", %{conn: conn} do + secret = TOTP.generate_secret() + + user = + insert(:user, + multi_factor_authentication_settings: %Settings{ + backup_codes: ["1", "2", "3"], + totp: %Settings.TOTP{secret: secret} + } + ) + + token = insert(:oauth_token, scopes: ["write", "follow"], user: user) + token2 = insert(:oauth_token, scopes: ["read"]) + + response = + conn + |> put_req_header("authorization", "Bearer #{token.token}") + |> post("/api/pleroma/accounts/mfa/confirm/totp", %{password: "test", code: "code"}) + |> json_response(422) + + settings = refresh_record(user).multi_factor_authentication_settings + refute settings.enabled + refute settings.totp.confirmed + assert settings.backup_codes == ["1", "2", "3"] + assert response == %{"error" => "invalid_token"} + + assert conn + |> put_req_header("authorization", "Bearer #{token2.token}") + |> post("/api/pleroma/accounts/mfa/confirm/totp", %{password: "test", code: "code"}) + |> json_response(403) == %{ + "error" => "Insufficient permissions: write:security." + } + end + end + + describe "DELETE /api/pleroma/accounts/mfa/totp" do + test "returns success result", %{conn: conn} do + user = + insert(:user, + multi_factor_authentication_settings: %Settings{ + backup_codes: ["1", "2", "3"], + totp: %Settings.TOTP{secret: "secret"} + } + ) + + token = insert(:oauth_token, scopes: ["write", "follow"], user: user) + token2 = insert(:oauth_token, scopes: ["read"]) + + assert conn + |> put_req_header("authorization", "Bearer #{token.token}") + |> delete("/api/pleroma/accounts/mfa/totp", %{password: "test"}) + |> json_response(:ok) + + settings = refresh_record(user).multi_factor_authentication_settings + refute settings.enabled + assert settings.totp.secret == nil + refute settings.totp.confirmed + + assert conn + |> put_req_header("authorization", "Bearer #{token2.token}") + |> delete("/api/pleroma/accounts/mfa/totp", %{password: "test"}) + |> json_response(403) == %{ + "error" => "Insufficient permissions: write:security." + } + end + end +end diff --git a/test/web/plugs/plug_test.exs b/test/web/plugs/plug_test.exs new file mode 100644 index 000000000..943e484e7 --- /dev/null +++ b/test/web/plugs/plug_test.exs @@ -0,0 +1,91 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.PlugTest do + @moduledoc "Tests for the functionality added via `use Pleroma.Web, :plug`" + + alias Pleroma.Plugs.ExpectAuthenticatedCheckPlug + alias Pleroma.Plugs.ExpectPublicOrAuthenticatedCheckPlug + alias Pleroma.Plugs.PlugHelper + + import Mock + + use Pleroma.Web.ConnCase + + describe "when plug is skipped, " do + setup_with_mocks( + [ + {ExpectPublicOrAuthenticatedCheckPlug, [:passthrough], []} + ], + %{conn: conn} + ) do + conn = ExpectPublicOrAuthenticatedCheckPlug.skip_plug(conn) + %{conn: conn} + end + + test "it neither adds plug to called plugs list nor calls `perform/2`, " <> + "regardless of :if_func / :unless_func options", + %{conn: conn} do + for opts <- [%{}, %{if_func: fn _ -> true end}, %{unless_func: fn _ -> false end}] do + ret_conn = ExpectPublicOrAuthenticatedCheckPlug.call(conn, opts) + + refute called(ExpectPublicOrAuthenticatedCheckPlug.perform(:_, :_)) + refute PlugHelper.plug_called?(ret_conn, ExpectPublicOrAuthenticatedCheckPlug) + end + end + end + + describe "when plug is NOT skipped, " do + setup_with_mocks([{ExpectAuthenticatedCheckPlug, [:passthrough], []}]) do + :ok + end + + test "with no pre-run checks, adds plug to called plugs list and calls `perform/2`", %{ + conn: conn + } do + ret_conn = ExpectAuthenticatedCheckPlug.call(conn, %{}) + + assert called(ExpectAuthenticatedCheckPlug.perform(ret_conn, :_)) + assert PlugHelper.plug_called?(ret_conn, ExpectAuthenticatedCheckPlug) + end + + test "when :if_func option is given, calls the plug only if provided function evals tru-ish", + %{conn: conn} do + ret_conn = ExpectAuthenticatedCheckPlug.call(conn, %{if_func: fn _ -> false end}) + + refute called(ExpectAuthenticatedCheckPlug.perform(:_, :_)) + refute PlugHelper.plug_called?(ret_conn, ExpectAuthenticatedCheckPlug) + + ret_conn = ExpectAuthenticatedCheckPlug.call(conn, %{if_func: fn _ -> true end}) + + assert called(ExpectAuthenticatedCheckPlug.perform(ret_conn, :_)) + assert PlugHelper.plug_called?(ret_conn, ExpectAuthenticatedCheckPlug) + end + + test "if :unless_func option is given, calls the plug only if provided function evals falsy", + %{conn: conn} do + ret_conn = ExpectAuthenticatedCheckPlug.call(conn, %{unless_func: fn _ -> true end}) + + refute called(ExpectAuthenticatedCheckPlug.perform(:_, :_)) + refute PlugHelper.plug_called?(ret_conn, ExpectAuthenticatedCheckPlug) + + ret_conn = ExpectAuthenticatedCheckPlug.call(conn, %{unless_func: fn _ -> false end}) + + assert called(ExpectAuthenticatedCheckPlug.perform(ret_conn, :_)) + assert PlugHelper.plug_called?(ret_conn, ExpectAuthenticatedCheckPlug) + end + + test "allows a plug to be called multiple times (even if it's in called plugs list)", %{ + conn: conn + } do + conn = ExpectAuthenticatedCheckPlug.call(conn, %{an_option: :value1}) + assert called(ExpectAuthenticatedCheckPlug.perform(conn, %{an_option: :value1})) + + assert PlugHelper.plug_called?(conn, ExpectAuthenticatedCheckPlug) + + conn = ExpectAuthenticatedCheckPlug.call(conn, %{an_option: :value2}) + assert called(ExpectAuthenticatedCheckPlug.perform(conn, %{an_option: :value2})) + end + end +end diff --git a/test/web/push/impl_test.exs b/test/web/push/impl_test.exs index 089d55577..2acd0939f 100644 --- a/test/web/push/impl_test.exs +++ b/test/web/push/impl_test.exs @@ -13,8 +13,8 @@ defmodule Pleroma.Web.Push.ImplTest do import Pleroma.Factory - setup_all do - Tesla.Mock.mock_global(fn + setup do + Tesla.Mock.mock(fn %{method: :post, url: "https://example.com/example/1234"} -> %Tesla.Env{status: 200} @@ -55,7 +55,7 @@ test "performs sending notifications" do data: %{alerts: %{"follow" => true, "mention" => false}} ) - {:ok, activity} = CommonAPI.post(user, %{"status" => " + status: "Lorem ipsum dolor sit amet, consectetur :firefox: adipiscing elit. Fusce sagittis finibus turpis." }) @@ -134,7 +134,7 @@ test "renders title and body for follow activity" do user = insert(:user, nickname: "Bob") other_user = insert(:user) {:ok, _, _, activity} = CommonAPI.follow(user, other_user) - object = Object.normalize(activity) + object = Object.normalize(activity, false) assert Impl.format_body(%{activity: activity}, user, object) == "@Bob has followed you" @@ -147,7 +147,7 @@ test "renders title and body for announce activity" do {:ok, activity} = CommonAPI.post(user, %{ - "status" => + status: "Lorem ipsum dolor sit amet, consectetur :firefox: adipiscing elit. Fusce sagittis finibus turpis." }) @@ -166,11 +166,11 @@ test "renders title and body for like activity" do {:ok, activity} = CommonAPI.post(user, %{ - "status" => + status: "Lorem ipsum dolor sit amet, consectetur :firefox: adipiscing elit. Fusce sagittis finibus turpis." }) - {:ok, activity, _} = CommonAPI.favorite(activity.id, user) + {:ok, activity} = CommonAPI.favorite(user, activity.id) object = Object.normalize(activity) assert Impl.format_body(%{activity: activity}, user, object) == "@Bob has favorited your post" @@ -184,8 +184,8 @@ test "renders title for create activity with direct visibility" do {:ok, activity} = CommonAPI.post(user, %{ - "visibility" => "direct", - "status" => "This is just between you and me, pal" + visibility: "direct", + status: "This is just between you and me, pal" }) assert Impl.format_title(%{activity: activity}) == @@ -193,14 +193,14 @@ test "renders title for create activity with direct visibility" do end describe "build_content/3" do - test "returns info content for direct message with enabled privacy option" do + test "hides details for notifications when privacy option enabled" do user = insert(:user, nickname: "Bob") user2 = insert(:user, nickname: "Rob", notification_settings: %{privacy_option: true}) {:ok, activity} = CommonAPI.post(user, %{ - "visibility" => "direct", - "status" => " "direct", - "status" => + visibility: "direct", + status: "Lorem ipsum dolor sit amet, consectetur :firefox: adipiscing elit. Fusce sagittis finibus turpis." }) @@ -235,6 +260,36 @@ test "returns regular content for direct message with disabled privacy option" d "@Bob: Lorem ipsum dolor sit amet, consectetur adipiscing elit. Fusce sagittis fini...", title: "New Direct Message" } + + {:ok, activity} = + CommonAPI.post(user, %{ + visibility: "public", + status: + "Lorem ipsum dolor sit amet, consectetur :firefox: adipiscing elit. Fusce sagittis finibus turpis." + }) + + notif = insert(:notification, user: user2, activity: activity) + + actor = User.get_cached_by_ap_id(notif.activity.data["actor"]) + object = Object.normalize(activity) + + assert Impl.build_content(notif, actor, object) == %{ + body: + "@Bob: Lorem ipsum dolor sit amet, consectetur adipiscing elit. Fusce sagittis fini...", + title: "New Mention" + } + + {:ok, activity} = CommonAPI.favorite(user, activity.id) + + notif = insert(:notification, user: user2, activity: activity) + + actor = User.get_cached_by_ap_id(notif.activity.data["actor"]) + object = Object.normalize(activity) + + assert Impl.build_content(notif, actor, object) == %{ + body: "@Bob has favorited your post", + title: "New Favorite" + } end end end diff --git a/test/web/rel_me_test.exs b/test/web/rel_me_test.exs index e05a8863d..65255916d 100644 --- a/test/web/rel_me_test.exs +++ b/test/web/rel_me_test.exs @@ -3,7 +3,7 @@ # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.Web.RelMeTest do - use ExUnit.Case, async: true + use ExUnit.Case setup_all do Tesla.Mock.mock_global(fn env -> apply(HttpRequestMock, :request, [env]) end) diff --git a/test/web/rich_media/helpers_test.exs b/test/web/rich_media/helpers_test.exs index aa0c5c830..8264a9c41 100644 --- a/test/web/rich_media/helpers_test.exs +++ b/test/web/rich_media/helpers_test.exs @@ -26,8 +26,8 @@ test "refuses to crawl incomplete URLs" do {:ok, activity} = CommonAPI.post(user, %{ - "status" => "[test](example.com/ogp)", - "content_type" => "text/markdown" + status: "[test](example.com/ogp)", + content_type: "text/markdown" }) Config.put([:rich_media, :enabled], true) @@ -40,8 +40,8 @@ test "refuses to crawl malformed URLs" do {:ok, activity} = CommonAPI.post(user, %{ - "status" => "[test](example.com[]/ogp)", - "content_type" => "text/markdown" + status: "[test](example.com[]/ogp)", + content_type: "text/markdown" }) Config.put([:rich_media, :enabled], true) @@ -54,8 +54,8 @@ test "crawls valid, complete URLs" do {:ok, activity} = CommonAPI.post(user, %{ - "status" => "[test](https://example.com/ogp)", - "content_type" => "text/markdown" + status: "[test](https://example.com/ogp)", + content_type: "text/markdown" }) Config.put([:rich_media, :enabled], true) @@ -69,8 +69,8 @@ test "refuses to crawl URLs from posts marked sensitive" do {:ok, activity} = CommonAPI.post(user, %{ - "status" => "http://example.com/ogp", - "sensitive" => true + status: "http://example.com/ogp", + sensitive: true }) %Object{} = object = Object.normalize(activity) @@ -87,7 +87,7 @@ test "refuses to crawl URLs from posts tagged NSFW" do {:ok, activity} = CommonAPI.post(user, %{ - "status" => "http://example.com/ogp #nsfw" + status: "http://example.com/ogp #nsfw" }) %Object{} = object = Object.normalize(activity) @@ -103,12 +103,12 @@ test "refuses to crawl URLs of private network from posts" do user = insert(:user) {:ok, activity} = - CommonAPI.post(user, %{"status" => "http://127.0.0.1:4000/notice/9kCP7VNyPJXFOXDrgO"}) + CommonAPI.post(user, %{status: "http://127.0.0.1:4000/notice/9kCP7VNyPJXFOXDrgO"}) - {:ok, activity2} = CommonAPI.post(user, %{"status" => "https://10.111.10.1/notice/9kCP7V"}) - {:ok, activity3} = CommonAPI.post(user, %{"status" => "https://172.16.32.40/notice/9kCP7V"}) - {:ok, activity4} = CommonAPI.post(user, %{"status" => "https://192.168.10.40/notice/9kCP7V"}) - {:ok, activity5} = CommonAPI.post(user, %{"status" => "https://pleroma.local/notice/9kCP7V"}) + {:ok, activity2} = CommonAPI.post(user, %{status: "https://10.111.10.1/notice/9kCP7V"}) + {:ok, activity3} = CommonAPI.post(user, %{status: "https://172.16.32.40/notice/9kCP7V"}) + {:ok, activity4} = CommonAPI.post(user, %{status: "https://192.168.10.40/notice/9kCP7V"}) + {:ok, activity5} = CommonAPI.post(user, %{status: "https://pleroma.local/notice/9kCP7V"}) Config.put([:rich_media, :enabled], true) diff --git a/test/web/static_fe/static_fe_controller_test.exs b/test/web/static_fe/static_fe_controller_test.exs index 430683ea0..a49ab002f 100644 --- a/test/web/static_fe/static_fe_controller_test.exs +++ b/test/web/static_fe/static_fe_controller_test.exs @@ -32,8 +32,8 @@ test "404 when user not found", %{conn: conn} do end test "profile does not include private messages", %{conn: conn, user: user} do - CommonAPI.post(user, %{"status" => "public"}) - CommonAPI.post(user, %{"status" => "private", "visibility" => "private"}) + CommonAPI.post(user, %{status: "public"}) + CommonAPI.post(user, %{status: "private", visibility: "private"}) conn = get(conn, "/users/#{user.nickname}") @@ -44,7 +44,7 @@ test "profile does not include private messages", %{conn: conn, user: user} do end test "pagination", %{conn: conn, user: user} do - Enum.map(1..30, fn i -> CommonAPI.post(user, %{"status" => "test#{i}"}) end) + Enum.map(1..30, fn i -> CommonAPI.post(user, %{status: "test#{i}"}) end) conn = get(conn, "/users/#{user.nickname}") @@ -57,7 +57,7 @@ test "pagination", %{conn: conn, user: user} do end test "pagination, page 2", %{conn: conn, user: user} do - activities = Enum.map(1..30, fn i -> CommonAPI.post(user, %{"status" => "test#{i}"}) end) + activities = Enum.map(1..30, fn i -> CommonAPI.post(user, %{status: "test#{i}"}) end) {:ok, a11} = Enum.at(activities, 11) conn = get(conn, "/users/#{user.nickname}?max_id=#{a11.id}") @@ -77,7 +77,7 @@ test "it requires authentication if instance is NOT federating", %{conn: conn, u describe "notice html" do test "single notice page", %{conn: conn, user: user} do - {:ok, activity} = CommonAPI.post(user, %{"status" => "testing a thing!"}) + {:ok, activity} = CommonAPI.post(user, %{status: "testing a thing!"}) conn = get(conn, "/notice/#{activity.id}") @@ -89,7 +89,7 @@ test "single notice page", %{conn: conn, user: user} do test "filters HTML tags", %{conn: conn} do user = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => ""}) + {:ok, activity} = CommonAPI.post(user, %{status: ""}) conn = conn @@ -101,11 +101,11 @@ test "filters HTML tags", %{conn: conn} do end test "shows the whole thread", %{conn: conn, user: user} do - {:ok, activity} = CommonAPI.post(user, %{"status" => "space: the final frontier"}) + {:ok, activity} = CommonAPI.post(user, %{status: "space: the final frontier"}) CommonAPI.post(user, %{ - "status" => "these are the voyages or something", - "in_reply_to_status_id" => activity.id + status: "these are the voyages or something", + in_reply_to_status_id: activity.id }) conn = get(conn, "/notice/#{activity.id}") @@ -117,7 +117,7 @@ test "shows the whole thread", %{conn: conn, user: user} do test "redirect by AP object ID", %{conn: conn, user: user} do {:ok, %Activity{data: %{"object" => object_url}}} = - CommonAPI.post(user, %{"status" => "beam me up"}) + CommonAPI.post(user, %{status: "beam me up"}) conn = get(conn, URI.parse(object_url).path) @@ -126,7 +126,7 @@ test "redirect by AP object ID", %{conn: conn, user: user} do test "redirect by activity ID", %{conn: conn, user: user} do {:ok, %Activity{data: %{"id" => id}}} = - CommonAPI.post(user, %{"status" => "I'm a doctor, not a devops!"}) + CommonAPI.post(user, %{status: "I'm a doctor, not a devops!"}) conn = get(conn, URI.parse(id).path) @@ -140,8 +140,7 @@ test "404 when notice not found", %{conn: conn} do end test "404 for private status", %{conn: conn, user: user} do - {:ok, activity} = - CommonAPI.post(user, %{"status" => "don't show me!", "visibility" => "private"}) + {:ok, activity} = CommonAPI.post(user, %{status: "don't show me!", visibility: "private"}) conn = get(conn, "/notice/#{activity.id}") @@ -171,7 +170,7 @@ test "302 for remote cached status", %{conn: conn, user: user} do end test "it requires authentication if instance is NOT federating", %{conn: conn, user: user} do - {:ok, activity} = CommonAPI.post(user, %{"status" => "testing a thing!"}) + {:ok, activity} = CommonAPI.post(user, %{status: "testing a thing!"}) ensure_federating_or_authenticated(conn, "/notice/#{activity.id}", user) end diff --git a/test/web/streamer/ping_test.exs b/test/web/streamer/ping_test.exs deleted file mode 100644 index 5df6c1cc3..000000000 --- a/test/web/streamer/ping_test.exs +++ /dev/null @@ -1,36 +0,0 @@ -# Pleroma: A lightweight social networking server -# Copyright © 2017-2020 Pleroma Authors -# SPDX-License-Identifier: AGPL-3.0-only - -defmodule Pleroma.Web.PingTest do - use Pleroma.DataCase - - import Pleroma.Factory - alias Pleroma.Web.Streamer - - setup do - start_supervised({Streamer.supervisor(), [ping_interval: 30]}) - - :ok - end - - describe "sockets" do - setup do - user = insert(:user) - {:ok, %{user: user}} - end - - test "it sends pings", %{user: user} do - task = - Task.async(fn -> - assert_receive {:text, received_event}, 40 - assert_receive {:text, received_event}, 40 - assert_receive {:text, received_event}, 40 - end) - - Streamer.add_socket("public", %{transport_pid: task.pid, assigns: %{user: user}}) - - Task.await(task) - end - end -end diff --git a/test/web/streamer/state_test.exs b/test/web/streamer/state_test.exs deleted file mode 100644 index a755e75c0..000000000 --- a/test/web/streamer/state_test.exs +++ /dev/null @@ -1,54 +0,0 @@ -# Pleroma: A lightweight social networking server -# Copyright © 2017-2020 Pleroma Authors -# SPDX-License-Identifier: AGPL-3.0-only - -defmodule Pleroma.Web.StateTest do - use Pleroma.DataCase - - import Pleroma.Factory - alias Pleroma.Web.Streamer - alias Pleroma.Web.Streamer.StreamerSocket - - @moduletag needs_streamer: true - - describe "sockets" do - setup do - user = insert(:user) - user2 = insert(:user) - {:ok, %{user: user, user2: user2}} - end - - test "it can add a socket", %{user: user} do - Streamer.add_socket("public", %{transport_pid: 1, assigns: %{user: user}}) - - assert(%{"public" => [%StreamerSocket{transport_pid: 1}]} = Streamer.get_sockets()) - end - - test "it can add multiple sockets per user", %{user: user} do - Streamer.add_socket("public", %{transport_pid: 1, assigns: %{user: user}}) - Streamer.add_socket("public", %{transport_pid: 2, assigns: %{user: user}}) - - assert( - %{ - "public" => [ - %StreamerSocket{transport_pid: 2}, - %StreamerSocket{transport_pid: 1} - ] - } = Streamer.get_sockets() - ) - end - - test "it will not add a duplicate socket", %{user: user} do - Streamer.add_socket("activity", %{transport_pid: 1, assigns: %{user: user}}) - Streamer.add_socket("activity", %{transport_pid: 1, assigns: %{user: user}}) - - assert( - %{ - "activity" => [ - %StreamerSocket{transport_pid: 1} - ] - } = Streamer.get_sockets() - ) - end - end -end diff --git a/test/web/streamer/streamer_test.exs b/test/web/streamer/streamer_test.exs index a5d6e8ecf..95b7d1420 100644 --- a/test/web/streamer/streamer_test.exs +++ b/test/web/streamer/streamer_test.exs @@ -12,15 +12,81 @@ defmodule Pleroma.Web.StreamerTest do alias Pleroma.User alias Pleroma.Web.CommonAPI alias Pleroma.Web.Streamer - alias Pleroma.Web.Streamer.StreamerSocket - alias Pleroma.Web.Streamer.Worker @moduletag needs_streamer: true, capture_log: true - @streamer_timeout 150 - @streamer_start_wait 10 setup do: clear_config([:instance, :skip_thread_containment]) + describe "get_topic without an user" do + test "allows public" do + assert {:ok, "public"} = Streamer.get_topic("public", nil) + assert {:ok, "public:local"} = Streamer.get_topic("public:local", nil) + assert {:ok, "public:media"} = Streamer.get_topic("public:media", nil) + assert {:ok, "public:local:media"} = Streamer.get_topic("public:local:media", nil) + end + + test "allows hashtag streams" do + assert {:ok, "hashtag:cofe"} = Streamer.get_topic("hashtag", nil, %{"tag" => "cofe"}) + end + + test "disallows user streams" do + assert {:error, _} = Streamer.get_topic("user", nil) + assert {:error, _} = Streamer.get_topic("user:notification", nil) + assert {:error, _} = Streamer.get_topic("direct", nil) + end + + test "disallows list streams" do + assert {:error, _} = Streamer.get_topic("list", nil, %{"list" => 42}) + end + end + + describe "get_topic with an user" do + setup do + user = insert(:user) + {:ok, %{user: user}} + end + + test "allows public streams", %{user: user} do + assert {:ok, "public"} = Streamer.get_topic("public", user) + assert {:ok, "public:local"} = Streamer.get_topic("public:local", user) + assert {:ok, "public:media"} = Streamer.get_topic("public:media", user) + assert {:ok, "public:local:media"} = Streamer.get_topic("public:local:media", user) + end + + test "allows user streams", %{user: user} do + expected_user_topic = "user:#{user.id}" + expected_notif_topic = "user:notification:#{user.id}" + expected_direct_topic = "direct:#{user.id}" + assert {:ok, ^expected_user_topic} = Streamer.get_topic("user", user) + assert {:ok, ^expected_notif_topic} = Streamer.get_topic("user:notification", user) + assert {:ok, ^expected_direct_topic} = Streamer.get_topic("direct", user) + end + + test "allows hashtag streams", %{user: user} do + assert {:ok, "hashtag:cofe"} = Streamer.get_topic("hashtag", user, %{"tag" => "cofe"}) + end + + test "disallows registering to an user stream", %{user: user} do + another_user = insert(:user) + assert {:error, _} = Streamer.get_topic("user:#{another_user.id}", user) + assert {:error, _} = Streamer.get_topic("user:notification:#{another_user.id}", user) + assert {:error, _} = Streamer.get_topic("direct:#{another_user.id}", user) + end + + test "allows list stream that are owned by the user", %{user: user} do + {:ok, list} = List.create("Test", user) + assert {:error, _} = Streamer.get_topic("list:#{list.id}", user) + assert {:ok, _} = Streamer.get_topic("list", user, %{"list" => list.id}) + end + + test "disallows list stream that are not owned by the user", %{user: user} do + another_user = insert(:user) + {:ok, list} = List.create("Test", another_user) + assert {:error, _} = Streamer.get_topic("list:#{list.id}", user) + assert {:error, _} = Streamer.get_topic("list", user, %{"list" => list.id}) + end + end + describe "user streams" do setup do user = insert(:user) @@ -28,34 +94,36 @@ defmodule Pleroma.Web.StreamerTest do {:ok, %{user: user, notify: notify}} end + test "it streams the user's post in the 'user' stream", %{user: user} do + Streamer.get_topic_and_add_socket("user", user) + {:ok, activity} = CommonAPI.post(user, %{status: "hey"}) + assert_receive {:render_with_user, _, _, ^activity} + refute Streamer.filtered_by_user?(user, activity) + end + + test "it streams boosts of the user in the 'user' stream", %{user: user} do + Streamer.get_topic_and_add_socket("user", user) + + other_user = insert(:user) + {:ok, activity} = CommonAPI.post(other_user, %{status: "hey"}) + {:ok, announce, _} = CommonAPI.repeat(activity.id, user) + + assert_receive {:render_with_user, Pleroma.Web.StreamerView, "update.json", ^announce} + refute Streamer.filtered_by_user?(user, announce) + end + test "it sends notify to in the 'user' stream", %{user: user, notify: notify} do - task = - Task.async(fn -> - assert_receive {:text, _}, @streamer_timeout - end) - - Streamer.add_socket( - "user", - %{transport_pid: task.pid, assigns: %{user: user}} - ) - + Streamer.get_topic_and_add_socket("user", user) Streamer.stream("user", notify) - Task.await(task) + assert_receive {:render_with_user, _, _, ^notify} + refute Streamer.filtered_by_user?(user, notify) end test "it sends notify to in the 'user:notification' stream", %{user: user, notify: notify} do - task = - Task.async(fn -> - assert_receive {:text, _}, @streamer_timeout - end) - - Streamer.add_socket( - "user:notification", - %{transport_pid: task.pid, assigns: %{user: user}} - ) - + Streamer.get_topic_and_add_socket("user:notification", user) Streamer.stream("user:notification", notify) - Task.await(task) + assert_receive {:render_with_user, _, _, ^notify} + refute Streamer.filtered_by_user?(user, notify) end test "it doesn't send notify to the 'user:notification' stream when a user is blocked", %{ @@ -64,18 +132,12 @@ test "it doesn't send notify to the 'user:notification' stream when a user is bl blocked = insert(:user) {:ok, _user_relationship} = User.block(user, blocked) - {:ok, activity} = CommonAPI.post(user, %{"status" => ":("}) - {:ok, notif, _} = CommonAPI.favorite(activity.id, blocked) + Streamer.get_topic_and_add_socket("user:notification", user) - task = Task.async(fn -> refute_receive {:text, _}, @streamer_timeout end) + {:ok, activity} = CommonAPI.post(user, %{status: ":("}) + {:ok, _} = CommonAPI.favorite(blocked, activity.id) - Streamer.add_socket( - "user:notification", - %{transport_pid: task.pid, assigns: %{user: user}} - ) - - Streamer.stream("user:notification", notif) - Task.await(task) + refute_receive _ end test "it doesn't send notify to the 'user:notification' stream when a thread is muted", %{ @@ -83,121 +145,116 @@ test "it doesn't send notify to the 'user:notification' stream when a thread is } do user2 = insert(:user) - {:ok, activity} = CommonAPI.post(user, %{"status" => "super hot take"}) - {:ok, activity} = CommonAPI.add_mute(user, activity) - {:ok, notif, _} = CommonAPI.favorite(activity.id, user2) + {:ok, activity} = CommonAPI.post(user, %{status: "super hot take"}) + {:ok, _} = CommonAPI.add_mute(user, activity) - task = Task.async(fn -> refute_receive {:text, _}, @streamer_timeout end) + Streamer.get_topic_and_add_socket("user:notification", user) - Streamer.add_socket( - "user:notification", - %{transport_pid: task.pid, assigns: %{user: user}} - ) + {:ok, favorite_activity} = CommonAPI.favorite(user2, activity.id) - Streamer.stream("user:notification", notif) - Task.await(task) + refute_receive _ + assert Streamer.filtered_by_user?(user, favorite_activity) end - test "it doesn't send notify to the 'user:notification' stream' when a domain is blocked", %{ + test "it sends favorite to 'user:notification' stream'", %{ + user: user + } do + user2 = insert(:user, %{ap_id: "https://hecking-lewd-place.com/user/meanie"}) + + {:ok, activity} = CommonAPI.post(user, %{status: "super hot take"}) + Streamer.get_topic_and_add_socket("user:notification", user) + {:ok, favorite_activity} = CommonAPI.favorite(user2, activity.id) + + assert_receive {:render_with_user, _, "notification.json", notif} + assert notif.activity.id == favorite_activity.id + refute Streamer.filtered_by_user?(user, notif) + end + + test "it doesn't send the 'user:notification' stream' when a domain is blocked", %{ user: user } do user2 = insert(:user, %{ap_id: "https://hecking-lewd-place.com/user/meanie"}) {:ok, user} = User.block_domain(user, "hecking-lewd-place.com") - {:ok, activity} = CommonAPI.post(user, %{"status" => "super hot take"}) - {:ok, notif, _} = CommonAPI.favorite(activity.id, user2) + {:ok, activity} = CommonAPI.post(user, %{status: "super hot take"}) + Streamer.get_topic_and_add_socket("user:notification", user) + {:ok, favorite_activity} = CommonAPI.favorite(user2, activity.id) - task = Task.async(fn -> refute_receive {:text, _}, @streamer_timeout end) - - Streamer.add_socket( - "user:notification", - %{transport_pid: task.pid, assigns: %{user: user}} - ) - - Streamer.stream("user:notification", notif) - Task.await(task) + refute_receive _ + assert Streamer.filtered_by_user?(user, favorite_activity) end test "it sends follow activities to the 'user:notification' stream", %{ user: user } do + user_url = user.ap_id user2 = insert(:user) - task = Task.async(fn -> assert_receive {:text, _}, @streamer_timeout end) - Process.sleep(@streamer_start_wait) + body = + File.read!("test/fixtures/users_mock/localhost.json") + |> String.replace("{{nickname}}", user.nickname) + |> Jason.encode!() - Streamer.add_socket( - "user:notification", - %{transport_pid: task.pid, assigns: %{user: user}} - ) + Tesla.Mock.mock_global(fn + %{method: :get, url: ^user_url} -> + %Tesla.Env{status: 200, body: body} + end) - {:ok, _follower, _followed, _activity} = CommonAPI.follow(user2, user) + Streamer.get_topic_and_add_socket("user:notification", user) + {:ok, _follower, _followed, follow_activity} = CommonAPI.follow(user2, user) - # We don't directly pipe the notification to the streamer as it's already - # generated as a side effect of CommonAPI.follow(). - Task.await(task) + assert_receive {:render_with_user, _, "notification.json", notif} + assert notif.activity.id == follow_activity.id + refute Streamer.filtered_by_user?(user, notif) end end - test "it sends to public" do + test "it sends to public authenticated" do user = insert(:user) other_user = insert(:user) - task = - Task.async(fn -> - assert_receive {:text, _}, @streamer_timeout - end) + Streamer.get_topic_and_add_socket("public", other_user) - fake_socket = %StreamerSocket{ - transport_pid: task.pid, - user: user - } + {:ok, activity} = CommonAPI.post(user, %{status: "Test"}) + assert_receive {:render_with_user, _, _, ^activity} + refute Streamer.filtered_by_user?(user, activity) + end - {:ok, activity} = CommonAPI.post(other_user, %{"status" => "Test"}) + test "works for deletions" do + user = insert(:user) + other_user = insert(:user) + {:ok, activity} = CommonAPI.post(other_user, %{status: "Test"}) - topics = %{ - "public" => [fake_socket] - } + Streamer.get_topic_and_add_socket("public", user) - Worker.push_to_socket(topics, "public", activity) + {:ok, _} = CommonAPI.delete(activity.id, other_user) + activity_id = activity.id + assert_receive {:text, event} + assert %{"event" => "delete", "payload" => ^activity_id} = Jason.decode!(event) + end - Task.await(task) + test "it sends to public unauthenticated" do + user = insert(:user) - task = - Task.async(fn -> - expected_event = - %{ - "event" => "delete", - "payload" => activity.id - } - |> Jason.encode!() + Streamer.get_topic_and_add_socket("public", nil) - assert_receive {:text, received_event}, @streamer_timeout - assert received_event == expected_event - end) + {:ok, activity} = CommonAPI.post(user, %{status: "Test"}) + activity_id = activity.id + assert_receive {:text, event} + assert %{"event" => "update", "payload" => payload} = Jason.decode!(event) + assert %{"id" => ^activity_id} = Jason.decode!(payload) - fake_socket = %StreamerSocket{ - transport_pid: task.pid, - user: user - } - - {:ok, activity} = CommonAPI.delete(activity.id, other_user) - - topics = %{ - "public" => [fake_socket] - } - - Worker.push_to_socket(topics, "public", activity) - - Task.await(task) + {:ok, _} = CommonAPI.delete(activity.id, user) + assert_receive {:text, event} + assert %{"event" => "delete", "payload" => ^activity_id} = Jason.decode!(event) end describe "thread_containment" do - test "it doesn't send to user if recipients invalid and thread containment is enabled" do + test "it filters to user if recipients invalid and thread containment is enabled" do Pleroma.Config.put([:instance, :skip_thread_containment], false) author = insert(:user) user = insert(:user) - User.follow(user, author, "accept") + User.follow(user, author, :follow_accept) activity = insert(:note_activity, @@ -208,19 +265,17 @@ test "it doesn't send to user if recipients invalid and thread containment is en ) ) - task = Task.async(fn -> refute_receive {:text, _}, 1_000 end) - fake_socket = %StreamerSocket{transport_pid: task.pid, user: user} - topics = %{"public" => [fake_socket]} - Worker.push_to_socket(topics, "public", activity) - - Task.await(task) + Streamer.get_topic_and_add_socket("public", user) + Streamer.stream("public", activity) + assert_receive {:render_with_user, _, _, ^activity} + assert Streamer.filtered_by_user?(user, activity) end test "it sends message if recipients invalid and thread containment is disabled" do Pleroma.Config.put([:instance, :skip_thread_containment], true) author = insert(:user) user = insert(:user) - User.follow(user, author, "accept") + User.follow(user, author, :follow_accept) activity = insert(:note_activity, @@ -231,19 +286,18 @@ test "it sends message if recipients invalid and thread containment is disabled" ) ) - task = Task.async(fn -> assert_receive {:text, _}, 1_000 end) - fake_socket = %StreamerSocket{transport_pid: task.pid, user: user} - topics = %{"public" => [fake_socket]} - Worker.push_to_socket(topics, "public", activity) + Streamer.get_topic_and_add_socket("public", user) + Streamer.stream("public", activity) - Task.await(task) + assert_receive {:render_with_user, _, _, ^activity} + refute Streamer.filtered_by_user?(user, activity) end test "it sends message if recipients invalid and thread containment is enabled but user's thread containment is disabled" do Pleroma.Config.put([:instance, :skip_thread_containment], false) author = insert(:user) user = insert(:user, skip_thread_containment: true) - User.follow(user, author, "accept") + User.follow(user, author, :follow_accept) activity = insert(:note_activity, @@ -254,255 +308,168 @@ test "it sends message if recipients invalid and thread containment is enabled b ) ) - task = Task.async(fn -> assert_receive {:text, _}, 1_000 end) - fake_socket = %StreamerSocket{transport_pid: task.pid, user: user} - topics = %{"public" => [fake_socket]} - Worker.push_to_socket(topics, "public", activity) + Streamer.get_topic_and_add_socket("public", user) + Streamer.stream("public", activity) - Task.await(task) + assert_receive {:render_with_user, _, _, ^activity} + refute Streamer.filtered_by_user?(user, activity) end end describe "blocks" do - test "it doesn't send messages involving blocked users" do + test "it filters messages involving blocked users" do user = insert(:user) blocked_user = insert(:user) {:ok, _user_relationship} = User.block(user, blocked_user) - {:ok, activity} = CommonAPI.post(blocked_user, %{"status" => "Test"}) - - task = - Task.async(fn -> - refute_receive {:text, _}, 1_000 - end) - - fake_socket = %StreamerSocket{ - transport_pid: task.pid, - user: user - } - - topics = %{ - "public" => [fake_socket] - } - - Worker.push_to_socket(topics, "public", activity) - - Task.await(task) + Streamer.get_topic_and_add_socket("public", user) + {:ok, activity} = CommonAPI.post(blocked_user, %{status: "Test"}) + assert_receive {:render_with_user, _, _, ^activity} + assert Streamer.filtered_by_user?(user, activity) end - test "it doesn't send messages transitively involving blocked users" do + test "it filters messages transitively involving blocked users" do blocker = insert(:user) blockee = insert(:user) friend = insert(:user) - task = - Task.async(fn -> - refute_receive {:text, _}, 1_000 - end) - - fake_socket = %StreamerSocket{ - transport_pid: task.pid, - user: blocker - } - - topics = %{ - "public" => [fake_socket] - } + Streamer.get_topic_and_add_socket("public", blocker) {:ok, _user_relationship} = User.block(blocker, blockee) - {:ok, activity_one} = CommonAPI.post(friend, %{"status" => "hey! @#{blockee.nickname}"}) + {:ok, activity_one} = CommonAPI.post(friend, %{status: "hey! @#{blockee.nickname}"}) - Worker.push_to_socket(topics, "public", activity_one) + assert_receive {:render_with_user, _, _, ^activity_one} + assert Streamer.filtered_by_user?(blocker, activity_one) - {:ok, activity_two} = CommonAPI.post(blockee, %{"status" => "hey! @#{friend.nickname}"}) + {:ok, activity_two} = CommonAPI.post(blockee, %{status: "hey! @#{friend.nickname}"}) - Worker.push_to_socket(topics, "public", activity_two) + assert_receive {:render_with_user, _, _, ^activity_two} + assert Streamer.filtered_by_user?(blocker, activity_two) - {:ok, activity_three} = CommonAPI.post(blockee, %{"status" => "hey! @#{blocker.nickname}"}) + {:ok, activity_three} = CommonAPI.post(blockee, %{status: "hey! @#{blocker.nickname}"}) - Worker.push_to_socket(topics, "public", activity_three) - - Task.await(task) + assert_receive {:render_with_user, _, _, ^activity_three} + assert Streamer.filtered_by_user?(blocker, activity_three) end end - test "it doesn't send unwanted DMs to list" do - user_a = insert(:user) - user_b = insert(:user) - user_c = insert(:user) + describe "lists" do + test "it doesn't send unwanted DMs to list" do + user_a = insert(:user) + user_b = insert(:user) + user_c = insert(:user) - {:ok, user_a} = User.follow(user_a, user_b) + {:ok, user_a} = User.follow(user_a, user_b) - {:ok, list} = List.create("Test", user_a) - {:ok, list} = List.follow(list, user_b) + {:ok, list} = List.create("Test", user_a) + {:ok, list} = List.follow(list, user_b) - {:ok, activity} = - CommonAPI.post(user_b, %{ - "status" => "@#{user_c.nickname} Test", - "visibility" => "direct" - }) + Streamer.get_topic_and_add_socket("list", user_a, %{"list" => list.id}) - task = - Task.async(fn -> - refute_receive {:text, _}, 1_000 - end) + {:ok, _activity} = + CommonAPI.post(user_b, %{ + status: "@#{user_c.nickname} Test", + visibility: "direct" + }) - fake_socket = %StreamerSocket{ - transport_pid: task.pid, - user: user_a - } + refute_receive _ + end - topics = %{ - "list:#{list.id}" => [fake_socket] - } + test "it doesn't send unwanted private posts to list" do + user_a = insert(:user) + user_b = insert(:user) - Worker.handle_call({:stream, "list", activity}, self(), topics) + {:ok, list} = List.create("Test", user_a) + {:ok, list} = List.follow(list, user_b) - Task.await(task) + Streamer.get_topic_and_add_socket("list", user_a, %{"list" => list.id}) + + {:ok, _activity} = + CommonAPI.post(user_b, %{ + status: "Test", + visibility: "private" + }) + + refute_receive _ + end + + test "it sends wanted private posts to list" do + user_a = insert(:user) + user_b = insert(:user) + + {:ok, user_a} = User.follow(user_a, user_b) + + {:ok, list} = List.create("Test", user_a) + {:ok, list} = List.follow(list, user_b) + + Streamer.get_topic_and_add_socket("list", user_a, %{"list" => list.id}) + + {:ok, activity} = + CommonAPI.post(user_b, %{ + status: "Test", + visibility: "private" + }) + + assert_receive {:render_with_user, _, _, ^activity} + refute Streamer.filtered_by_user?(user_a, activity) + end end - test "it doesn't send unwanted private posts to list" do - user_a = insert(:user) - user_b = insert(:user) + describe "muted reblogs" do + test "it filters muted reblogs" do + user1 = insert(:user) + user2 = insert(:user) + user3 = insert(:user) + CommonAPI.follow(user1, user2) + CommonAPI.hide_reblogs(user1, user2) - {:ok, list} = List.create("Test", user_a) - {:ok, list} = List.follow(list, user_b) + {:ok, create_activity} = CommonAPI.post(user3, %{status: "I'm kawen"}) - {:ok, activity} = - CommonAPI.post(user_b, %{ - "status" => "Test", - "visibility" => "private" - }) + Streamer.get_topic_and_add_socket("user", user1) + {:ok, announce_activity, _} = CommonAPI.repeat(create_activity.id, user2) + assert_receive {:render_with_user, _, _, ^announce_activity} + assert Streamer.filtered_by_user?(user1, announce_activity) + end - task = - Task.async(fn -> - refute_receive {:text, _}, 1_000 - end) + test "it filters reblog notification for reblog-muted actors" do + user1 = insert(:user) + user2 = insert(:user) + CommonAPI.follow(user1, user2) + CommonAPI.hide_reblogs(user1, user2) - fake_socket = %StreamerSocket{ - transport_pid: task.pid, - user: user_a - } + {:ok, create_activity} = CommonAPI.post(user1, %{status: "I'm kawen"}) + Streamer.get_topic_and_add_socket("user", user1) + {:ok, _favorite_activity, _} = CommonAPI.repeat(create_activity.id, user2) - topics = %{ - "list:#{list.id}" => [fake_socket] - } + assert_receive {:render_with_user, _, "notification.json", notif} + assert Streamer.filtered_by_user?(user1, notif) + end - Worker.handle_call({:stream, "list", activity}, self(), topics) + test "it send non-reblog notification for reblog-muted actors" do + user1 = insert(:user) + user2 = insert(:user) + CommonAPI.follow(user1, user2) + CommonAPI.hide_reblogs(user1, user2) - Task.await(task) + {:ok, create_activity} = CommonAPI.post(user1, %{status: "I'm kawen"}) + Streamer.get_topic_and_add_socket("user", user1) + {:ok, _favorite_activity} = CommonAPI.favorite(user2, create_activity.id) + + assert_receive {:render_with_user, _, "notification.json", notif} + refute Streamer.filtered_by_user?(user1, notif) + end end - test "it sends wanted private posts to list" do - user_a = insert(:user) - user_b = insert(:user) - - {:ok, user_a} = User.follow(user_a, user_b) - - {:ok, list} = List.create("Test", user_a) - {:ok, list} = List.follow(list, user_b) - - {:ok, activity} = - CommonAPI.post(user_b, %{ - "status" => "Test", - "visibility" => "private" - }) - - task = - Task.async(fn -> - assert_receive {:text, _}, 1_000 - end) - - fake_socket = %StreamerSocket{ - transport_pid: task.pid, - user: user_a - } - - Streamer.add_socket( - "list:#{list.id}", - fake_socket - ) - - Worker.handle_call({:stream, "list", activity}, self(), %{}) - - Task.await(task) - end - - test "it doesn't send muted reblogs" do - user1 = insert(:user) - user2 = insert(:user) - user3 = insert(:user) - CommonAPI.hide_reblogs(user1, user2) - - {:ok, create_activity} = CommonAPI.post(user3, %{"status" => "I'm kawen"}) - {:ok, announce_activity, _} = CommonAPI.repeat(create_activity.id, user2) - - task = - Task.async(fn -> - refute_receive {:text, _}, 1_000 - end) - - fake_socket = %StreamerSocket{ - transport_pid: task.pid, - user: user1 - } - - topics = %{ - "public" => [fake_socket] - } - - Worker.push_to_socket(topics, "public", announce_activity) - - Task.await(task) - end - - test "it does send non-reblog notification for reblog-muted actors" do - user1 = insert(:user) - user2 = insert(:user) - user3 = insert(:user) - CommonAPI.hide_reblogs(user1, user2) - - {:ok, create_activity} = CommonAPI.post(user3, %{"status" => "I'm kawen"}) - {:ok, favorite_activity, _} = CommonAPI.favorite(create_activity.id, user2) - - task = - Task.async(fn -> - assert_receive {:text, _}, 1_000 - end) - - fake_socket = %StreamerSocket{ - transport_pid: task.pid, - user: user1 - } - - topics = %{ - "public" => [fake_socket] - } - - Worker.push_to_socket(topics, "public", favorite_activity) - - Task.await(task) - end - - test "it doesn't send posts from muted threads" do + test "it filters posts from muted threads" do user = insert(:user) user2 = insert(:user) + Streamer.get_topic_and_add_socket("user", user2) {:ok, user2, user, _activity} = CommonAPI.follow(user2, user) - - {:ok, activity} = CommonAPI.post(user, %{"status" => "super hot take"}) - - {:ok, activity} = CommonAPI.add_mute(user2, activity) - - task = Task.async(fn -> refute_receive {:text, _}, @streamer_timeout end) - - Streamer.add_socket( - "user", - %{transport_pid: task.pid, assigns: %{user: user2}} - ) - - Streamer.stream("user", activity) - Task.await(task) + {:ok, activity} = CommonAPI.post(user, %{status: "super hot take"}) + {:ok, _} = CommonAPI.add_mute(user2, activity) + assert_receive {:render_with_user, _, _, ^activity} + assert Streamer.filtered_by_user?(user2, activity) end describe "direct streams" do @@ -514,103 +481,88 @@ test "it sends conversation update to the 'direct' stream", %{} do user = insert(:user) another_user = insert(:user) - task = - Task.async(fn -> - assert_receive {:text, received_event}, @streamer_timeout - - assert %{"event" => "conversation", "payload" => received_payload} = - Jason.decode!(received_event) - - assert %{"last_status" => last_status} = Jason.decode!(received_payload) - [participation] = Participation.for_user(user) - assert last_status["pleroma"]["direct_conversation_id"] == participation.id - end) - - Streamer.add_socket( - "direct", - %{transport_pid: task.pid, assigns: %{user: user}} - ) + Streamer.get_topic_and_add_socket("direct", user) {:ok, _create_activity} = CommonAPI.post(another_user, %{ - "status" => "hey @#{user.nickname}", - "visibility" => "direct" + status: "hey @#{user.nickname}", + visibility: "direct" }) - Task.await(task) + assert_receive {:text, received_event} + + assert %{"event" => "conversation", "payload" => received_payload} = + Jason.decode!(received_event) + + assert %{"last_status" => last_status} = Jason.decode!(received_payload) + [participation] = Participation.for_user(user) + assert last_status["pleroma"]["direct_conversation_id"] == participation.id end test "it doesn't send conversation update to the 'direct' stream when the last message in the conversation is deleted" do user = insert(:user) another_user = insert(:user) + Streamer.get_topic_and_add_socket("direct", user) + {:ok, create_activity} = CommonAPI.post(another_user, %{ - "status" => "hi @#{user.nickname}", - "visibility" => "direct" + status: "hi @#{user.nickname}", + visibility: "direct" }) - task = - Task.async(fn -> - assert_receive {:text, received_event}, @streamer_timeout - assert %{"event" => "delete", "payload" => _} = Jason.decode!(received_event) + create_activity_id = create_activity.id + assert_receive {:render_with_user, _, _, ^create_activity} + assert_receive {:text, received_conversation1} + assert %{"event" => "conversation", "payload" => _} = Jason.decode!(received_conversation1) - refute_receive {:text, _}, @streamer_timeout - end) + {:ok, _} = CommonAPI.delete(create_activity_id, another_user) - Process.sleep(@streamer_start_wait) + assert_receive {:text, received_event} - Streamer.add_socket( - "direct", - %{transport_pid: task.pid, assigns: %{user: user}} - ) + assert %{"event" => "delete", "payload" => ^create_activity_id} = + Jason.decode!(received_event) - {:ok, _} = CommonAPI.delete(create_activity.id, another_user) - - Task.await(task) + refute_receive _ end test "it sends conversation update to the 'direct' stream when a message is deleted" do user = insert(:user) another_user = insert(:user) + Streamer.get_topic_and_add_socket("direct", user) {:ok, create_activity} = CommonAPI.post(another_user, %{ - "status" => "hi @#{user.nickname}", - "visibility" => "direct" + status: "hi @#{user.nickname}", + visibility: "direct" }) {:ok, create_activity2} = CommonAPI.post(another_user, %{ - "status" => "hi @#{user.nickname}", - "in_reply_to_status_id" => create_activity.id, - "visibility" => "direct" + status: "hi @#{user.nickname} 2", + in_reply_to_status_id: create_activity.id, + visibility: "direct" }) - task = - Task.async(fn -> - assert_receive {:text, received_event}, @streamer_timeout - assert %{"event" => "delete", "payload" => _} = Jason.decode!(received_event) - - assert_receive {:text, received_event}, @streamer_timeout - - assert %{"event" => "conversation", "payload" => received_payload} = - Jason.decode!(received_event) - - assert %{"last_status" => last_status} = Jason.decode!(received_payload) - assert last_status["id"] == to_string(create_activity.id) - end) - - Process.sleep(@streamer_start_wait) - - Streamer.add_socket( - "direct", - %{transport_pid: task.pid, assigns: %{user: user}} - ) + assert_receive {:render_with_user, _, _, ^create_activity} + assert_receive {:render_with_user, _, _, ^create_activity2} + assert_receive {:text, received_conversation1} + assert %{"event" => "conversation", "payload" => _} = Jason.decode!(received_conversation1) + assert_receive {:text, received_conversation1} + assert %{"event" => "conversation", "payload" => _} = Jason.decode!(received_conversation1) {:ok, _} = CommonAPI.delete(create_activity2.id, another_user) - Task.await(task) + assert_receive {:text, received_event} + assert %{"event" => "delete", "payload" => _} = Jason.decode!(received_event) + + assert_receive {:text, received_event} + + assert %{"event" => "conversation", "payload" => received_payload} = + Jason.decode!(received_event) + + assert %{"last_status" => last_status} = Jason.decode!(received_payload) + assert last_status["id"] == to_string(create_activity.id) end end end diff --git a/test/web/twitter_api/password_controller_test.exs b/test/web/twitter_api/password_controller_test.exs index 0a24860d3..231a46c67 100644 --- a/test/web/twitter_api/password_controller_test.exs +++ b/test/web/twitter_api/password_controller_test.exs @@ -54,7 +54,7 @@ test "it returns HTTP 200", %{conn: conn} do assert response =~ "

Password changed!

" user = refresh_record(user) - assert Comeonin.Pbkdf2.checkpw("test", user.password_hash) + assert Pbkdf2.verify_pass("test", user.password_hash) assert Enum.empty?(Token.get_user_tokens(user)) end diff --git a/test/web/twitter_api/remote_follow_controller_test.exs b/test/web/twitter_api/remote_follow_controller_test.exs index 5ff8694a8..f7e54c26a 100644 --- a/test/web/twitter_api/remote_follow_controller_test.exs +++ b/test/web/twitter_api/remote_follow_controller_test.exs @@ -6,11 +6,14 @@ defmodule Pleroma.Web.TwitterAPI.RemoteFollowControllerTest do use Pleroma.Web.ConnCase alias Pleroma.Config + alias Pleroma.MFA + alias Pleroma.MFA.TOTP alias Pleroma.User alias Pleroma.Web.CommonAPI import ExUnit.CaptureLog import Pleroma.Factory + import Ecto.Query setup do Tesla.Mock.mock(fn env -> apply(HttpRequestMock, :request, [env]) end) @@ -160,6 +163,119 @@ test "returns success result when user already in followers", %{conn: conn} do end end + describe "POST /ostatus_subscribe - follow/2 with enabled Two-Factor Auth " do + test "render the MFA login form", %{conn: conn} do + otp_secret = TOTP.generate_secret() + + user = + insert(:user, + multi_factor_authentication_settings: %MFA.Settings{ + enabled: true, + totp: %MFA.Settings.TOTP{secret: otp_secret, confirmed: true} + } + ) + + user2 = insert(:user) + + response = + conn + |> post(remote_follow_path(conn, :do_follow), %{ + "authorization" => %{"name" => user.nickname, "password" => "test", "id" => user2.id} + }) + |> response(200) + + mfa_token = Pleroma.Repo.one(from(q in Pleroma.MFA.Token, where: q.user_id == ^user.id)) + + assert response =~ "Two-factor authentication" + assert response =~ "Authentication code" + assert response =~ mfa_token.token + refute user2.follower_address in User.following(user) + end + + test "returns error when password is incorrect", %{conn: conn} do + otp_secret = TOTP.generate_secret() + + user = + insert(:user, + multi_factor_authentication_settings: %MFA.Settings{ + enabled: true, + totp: %MFA.Settings.TOTP{secret: otp_secret, confirmed: true} + } + ) + + user2 = insert(:user) + + response = + conn + |> post(remote_follow_path(conn, :do_follow), %{ + "authorization" => %{"name" => user.nickname, "password" => "test1", "id" => user2.id} + }) + |> response(200) + + assert response =~ "Wrong username or password" + refute user2.follower_address in User.following(user) + end + + test "follows", %{conn: conn} do + otp_secret = TOTP.generate_secret() + + user = + insert(:user, + multi_factor_authentication_settings: %MFA.Settings{ + enabled: true, + totp: %MFA.Settings.TOTP{secret: otp_secret, confirmed: true} + } + ) + + {:ok, %{token: token}} = MFA.Token.create_token(user) + + user2 = insert(:user) + otp_token = TOTP.generate_token(otp_secret) + + conn = + conn + |> post( + remote_follow_path(conn, :do_follow), + %{ + "mfa" => %{"code" => otp_token, "token" => token, "id" => user2.id} + } + ) + + assert redirected_to(conn) == "/users/#{user2.id}" + assert user2.follower_address in User.following(user) + end + + test "returns error when auth code is incorrect", %{conn: conn} do + otp_secret = TOTP.generate_secret() + + user = + insert(:user, + multi_factor_authentication_settings: %MFA.Settings{ + enabled: true, + totp: %MFA.Settings.TOTP{secret: otp_secret, confirmed: true} + } + ) + + {:ok, %{token: token}} = MFA.Token.create_token(user) + + user2 = insert(:user) + otp_token = TOTP.generate_token(TOTP.generate_secret()) + + response = + conn + |> post( + remote_follow_path(conn, :do_follow), + %{ + "mfa" => %{"code" => otp_token, "token" => token, "id" => user2.id} + } + ) + |> response(200) + + assert response =~ "Wrong authentication code" + refute user2.follower_address in User.following(user) + end + end + describe "POST /ostatus_subscribe - follow/2 without assigned user " do test "follows", %{conn: conn} do user = insert(:user) diff --git a/test/web/twitter_api/twitter_api_controller_test.exs b/test/web/twitter_api/twitter_api_controller_test.exs index ab0a2c3df..464d0ea2e 100644 --- a/test/web/twitter_api/twitter_api_controller_test.exs +++ b/test/web/twitter_api/twitter_api_controller_test.exs @@ -19,13 +19,9 @@ test "without valid credentials", %{conn: conn} do end test "with credentials, without any params" do - %{user: current_user, conn: conn} = - oauth_access(["read:notifications", "write:notifications"]) + %{conn: conn} = oauth_access(["write:notifications"]) - conn = - conn - |> assign(:user, current_user) - |> post("/api/qvitter/statuses/notifications/read") + conn = post(conn, "/api/qvitter/statuses/notifications/read") assert json_response(conn, 400) == %{ "error" => "You need to specify latest_id", diff --git a/test/web/twitter_api/twitter_api_test.exs b/test/web/twitter_api/twitter_api_test.exs index 92f9aa0f5..368533292 100644 --- a/test/web/twitter_api/twitter_api_test.exs +++ b/test/web/twitter_api/twitter_api_test.exs @@ -18,11 +18,11 @@ defmodule Pleroma.Web.TwitterAPI.TwitterAPITest do test "it registers a new user and returns the user." do data = %{ - "nickname" => "lain", - "email" => "lain@wired.jp", - "fullname" => "lain iwakura", - "password" => "bear", - "confirm" => "bear" + :username => "lain", + :email => "lain@wired.jp", + :fullname => "lain iwakura", + :password => "bear", + :confirm => "bear" } {:ok, user} = TwitterAPI.register_user(data) @@ -35,12 +35,12 @@ test "it registers a new user and returns the user." do test "it registers a new user with empty string in bio and returns the user." do data = %{ - "nickname" => "lain", - "email" => "lain@wired.jp", - "fullname" => "lain iwakura", - "bio" => "", - "password" => "bear", - "confirm" => "bear" + :username => "lain", + :email => "lain@wired.jp", + :fullname => "lain iwakura", + :bio => "", + :password => "bear", + :confirm => "bear" } {:ok, user} = TwitterAPI.register_user(data) @@ -60,12 +60,12 @@ test "it sends confirmation email if :account_activation_required is specified i end data = %{ - "nickname" => "lain", - "email" => "lain@wired.jp", - "fullname" => "lain iwakura", - "bio" => "", - "password" => "bear", - "confirm" => "bear" + :username => "lain", + :email => "lain@wired.jp", + :fullname => "lain iwakura", + :bio => "", + :password => "bear", + :confirm => "bear" } {:ok, user} = TwitterAPI.register_user(data) @@ -87,29 +87,29 @@ test "it sends confirmation email if :account_activation_required is specified i test "it registers a new user and parses mentions in the bio" do data1 = %{ - "nickname" => "john", - "email" => "john@gmail.com", - "fullname" => "John Doe", - "bio" => "test", - "password" => "bear", - "confirm" => "bear" + :username => "john", + :email => "john@gmail.com", + :fullname => "John Doe", + :bio => "test", + :password => "bear", + :confirm => "bear" } {:ok, user1} = TwitterAPI.register_user(data1) data2 = %{ - "nickname" => "lain", - "email" => "lain@wired.jp", - "fullname" => "lain iwakura", - "bio" => "@john test", - "password" => "bear", - "confirm" => "bear" + :username => "lain", + :email => "lain@wired.jp", + :fullname => "lain iwakura", + :bio => "@john test", + :password => "bear", + :confirm => "bear" } {:ok, user2} = TwitterAPI.register_user(data2) expected_text = - ~s(@john test) @@ -123,13 +123,13 @@ test "returns user on success" do {:ok, invite} = UserInviteToken.create_invite() data = %{ - "nickname" => "vinny", - "email" => "pasta@pizza.vs", - "fullname" => "Vinny Vinesauce", - "bio" => "streamer", - "password" => "hiptofbees", - "confirm" => "hiptofbees", - "token" => invite.token + :username => "vinny", + :email => "pasta@pizza.vs", + :fullname => "Vinny Vinesauce", + :bio => "streamer", + :password => "hiptofbees", + :confirm => "hiptofbees", + :token => invite.token } {:ok, user} = TwitterAPI.register_user(data) @@ -145,13 +145,13 @@ test "returns user on success" do test "returns error on invalid token" do data = %{ - "nickname" => "GrimReaper", - "email" => "death@reapers.afterlife", - "fullname" => "Reaper Grim", - "bio" => "Your time has come", - "password" => "scythe", - "confirm" => "scythe", - "token" => "DudeLetMeInImAFairy" + :username => "GrimReaper", + :email => "death@reapers.afterlife", + :fullname => "Reaper Grim", + :bio => "Your time has come", + :password => "scythe", + :confirm => "scythe", + :token => "DudeLetMeInImAFairy" } {:error, msg} = TwitterAPI.register_user(data) @@ -165,13 +165,13 @@ test "returns error on expired token" do UserInviteToken.update_invite!(invite, used: true) data = %{ - "nickname" => "GrimReaper", - "email" => "death@reapers.afterlife", - "fullname" => "Reaper Grim", - "bio" => "Your time has come", - "password" => "scythe", - "confirm" => "scythe", - "token" => invite.token + :username => "GrimReaper", + :email => "death@reapers.afterlife", + :fullname => "Reaper Grim", + :bio => "Your time has come", + :password => "scythe", + :confirm => "scythe", + :token => invite.token } {:error, msg} = TwitterAPI.register_user(data) @@ -186,16 +186,16 @@ test "returns error on expired token" do setup do data = %{ - "nickname" => "vinny", - "email" => "pasta@pizza.vs", - "fullname" => "Vinny Vinesauce", - "bio" => "streamer", - "password" => "hiptofbees", - "confirm" => "hiptofbees" + :username => "vinny", + :email => "pasta@pizza.vs", + :fullname => "Vinny Vinesauce", + :bio => "streamer", + :password => "hiptofbees", + :confirm => "hiptofbees" } check_fn = fn invite -> - data = Map.put(data, "token", invite.token) + data = Map.put(data, :token, invite.token) {:ok, user} = TwitterAPI.register_user(data) fetched_user = User.get_cached_by_nickname("vinny") @@ -250,13 +250,13 @@ test "returns user on success, after him registration fails" do UserInviteToken.update_invite!(invite, uses: 99) data = %{ - "nickname" => "vinny", - "email" => "pasta@pizza.vs", - "fullname" => "Vinny Vinesauce", - "bio" => "streamer", - "password" => "hiptofbees", - "confirm" => "hiptofbees", - "token" => invite.token + :username => "vinny", + :email => "pasta@pizza.vs", + :fullname => "Vinny Vinesauce", + :bio => "streamer", + :password => "hiptofbees", + :confirm => "hiptofbees", + :token => invite.token } {:ok, user} = TwitterAPI.register_user(data) @@ -269,13 +269,13 @@ test "returns user on success, after him registration fails" do AccountView.render("show.json", %{user: fetched_user}) data = %{ - "nickname" => "GrimReaper", - "email" => "death@reapers.afterlife", - "fullname" => "Reaper Grim", - "bio" => "Your time has come", - "password" => "scythe", - "confirm" => "scythe", - "token" => invite.token + :username => "GrimReaper", + :email => "death@reapers.afterlife", + :fullname => "Reaper Grim", + :bio => "Your time has come", + :password => "scythe", + :confirm => "scythe", + :token => invite.token } {:error, msg} = TwitterAPI.register_user(data) @@ -292,13 +292,13 @@ test "returns user on success" do {:ok, invite} = UserInviteToken.create_invite(%{expires_at: Date.utc_today(), max_use: 100}) data = %{ - "nickname" => "vinny", - "email" => "pasta@pizza.vs", - "fullname" => "Vinny Vinesauce", - "bio" => "streamer", - "password" => "hiptofbees", - "confirm" => "hiptofbees", - "token" => invite.token + :username => "vinny", + :email => "pasta@pizza.vs", + :fullname => "Vinny Vinesauce", + :bio => "streamer", + :password => "hiptofbees", + :confirm => "hiptofbees", + :token => invite.token } {:ok, user} = TwitterAPI.register_user(data) @@ -317,13 +317,13 @@ test "error after max uses" do UserInviteToken.update_invite!(invite, uses: 99) data = %{ - "nickname" => "vinny", - "email" => "pasta@pizza.vs", - "fullname" => "Vinny Vinesauce", - "bio" => "streamer", - "password" => "hiptofbees", - "confirm" => "hiptofbees", - "token" => invite.token + :username => "vinny", + :email => "pasta@pizza.vs", + :fullname => "Vinny Vinesauce", + :bio => "streamer", + :password => "hiptofbees", + :confirm => "hiptofbees", + :token => invite.token } {:ok, user} = TwitterAPI.register_user(data) @@ -335,13 +335,13 @@ test "error after max uses" do AccountView.render("show.json", %{user: fetched_user}) data = %{ - "nickname" => "GrimReaper", - "email" => "death@reapers.afterlife", - "fullname" => "Reaper Grim", - "bio" => "Your time has come", - "password" => "scythe", - "confirm" => "scythe", - "token" => invite.token + :username => "GrimReaper", + :email => "death@reapers.afterlife", + :fullname => "Reaper Grim", + :bio => "Your time has come", + :password => "scythe", + :confirm => "scythe", + :token => invite.token } {:error, msg} = TwitterAPI.register_user(data) @@ -355,13 +355,13 @@ test "returns error on overdue date" do UserInviteToken.create_invite(%{expires_at: Date.add(Date.utc_today(), -1), max_use: 100}) data = %{ - "nickname" => "GrimReaper", - "email" => "death@reapers.afterlife", - "fullname" => "Reaper Grim", - "bio" => "Your time has come", - "password" => "scythe", - "confirm" => "scythe", - "token" => invite.token + :username => "GrimReaper", + :email => "death@reapers.afterlife", + :fullname => "Reaper Grim", + :bio => "Your time has come", + :password => "scythe", + :confirm => "scythe", + :token => invite.token } {:error, msg} = TwitterAPI.register_user(data) @@ -377,13 +377,13 @@ test "returns error on with overdue date and after max" do UserInviteToken.update_invite!(invite, uses: 100) data = %{ - "nickname" => "GrimReaper", - "email" => "death@reapers.afterlife", - "fullname" => "Reaper Grim", - "bio" => "Your time has come", - "password" => "scythe", - "confirm" => "scythe", - "token" => invite.token + :username => "GrimReaper", + :email => "death@reapers.afterlife", + :fullname => "Reaper Grim", + :bio => "Your time has come", + :password => "scythe", + :confirm => "scythe", + :token => invite.token } {:error, msg} = TwitterAPI.register_user(data) @@ -395,16 +395,15 @@ test "returns error on with overdue date and after max" do test "it returns the error on registration problems" do data = %{ - "nickname" => "lain", - "email" => "lain@wired.jp", - "fullname" => "lain iwakura", - "bio" => "close the world.", - "password" => "bear" + :username => "lain", + :email => "lain@wired.jp", + :fullname => "lain iwakura", + :bio => "close the world." } - {:error, error_object} = TwitterAPI.register_user(data) + {:error, error} = TwitterAPI.register_user(data) - assert is_binary(error_object[:error]) + assert is_binary(error) refute User.get_cached_by_nickname("lain") end diff --git a/test/web/twitter_api/util_controller_test.exs b/test/web/twitter_api/util_controller_test.exs index 5ad682b0b..76e9369f7 100644 --- a/test/web/twitter_api/util_controller_test.exs +++ b/test/web/twitter_api/util_controller_test.exs @@ -95,6 +95,30 @@ test "requires 'follow' or 'write:follows' permissions" do end end end + + test "it imports follows with different nickname variations", %{conn: conn} do + [user2, user3, user4, user5, user6] = insert_list(5, :user) + + identifiers = + [ + user2.ap_id, + user3.nickname, + " ", + "@" <> user4.nickname, + user5.nickname <> "@localhost", + "@" <> user6.nickname <> "@localhost" + ] + |> Enum.join("\n") + + response = + conn + |> post("/api/pleroma/follow_import", %{"list" => identifiers}) + |> json_response(:ok) + + assert response == "job started" + assert [{:ok, job_result}] = ObanHelpers.perform_all() + assert job_result == [user2, user3, user4, user5, user6] + end end describe "POST /api/pleroma/blocks_import" do @@ -136,6 +160,29 @@ test "it imports blocks users from file", %{user: user1, conn: conn} do ) end end + + test "it imports blocks with different nickname variations", %{conn: conn} do + [user2, user3, user4, user5, user6] = insert_list(5, :user) + + identifiers = + [ + user2.ap_id, + user3.nickname, + "@" <> user4.nickname, + user5.nickname <> "@localhost", + "@" <> user6.nickname <> "@localhost" + ] + |> Enum.join(" ") + + response = + conn + |> post("/api/pleroma/blocks_import", %{"list" => identifiers}) + |> json_response(:ok) + + assert response == "job started" + assert [{:ok, job_result}] = ObanHelpers.perform_all() + assert job_result == [user2, user3, user4, user5, user6] + end end describe "PUT /api/pleroma/notification_settings" do @@ -520,7 +567,7 @@ test "with proper permissions, valid password and matching new password and conf assert json_response(conn, 200) == %{"status" => "success"} fetched_user = User.get_cached_by_id(user.id) - assert Comeonin.Pbkdf2.checkpw("newpass", fetched_user.password_hash) == true + assert Pbkdf2.verify_pass("newpass", fetched_user.password_hash) == true end end diff --git a/test/web/web_finger/web_finger_test.exs b/test/web/web_finger/web_finger_test.exs index 4b4282727..f4884e0a2 100644 --- a/test/web/web_finger/web_finger_test.exs +++ b/test/web/web_finger/web_finger_test.exs @@ -67,7 +67,7 @@ test "it work for AP-only user" do assert data["magic_key"] == nil assert data["salmon"] == nil - assert data["topic"] == "https://mstdn.jp/users/kPherox.atom" + assert data["topic"] == nil assert data["subject"] == "acct:kPherox@mstdn.jp" assert data["ap_id"] == "https://mstdn.jp/users/kPherox" assert data["subscribe_address"] == "https://mstdn.jp/authorize_interaction?acct={uri}" diff --git a/test/workers/cron/digest_emails_worker_test.exs b/test/workers/cron/digest_emails_worker_test.exs index 0a63bf4e0..f9bc50db5 100644 --- a/test/workers/cron/digest_emails_worker_test.exs +++ b/test/workers/cron/digest_emails_worker_test.exs @@ -29,7 +29,7 @@ defmodule Pleroma.Workers.Cron.DigestEmailsWorkerTest do user2 = insert(:user, last_digest_emailed_at: date) {:ok, _} = User.switch_email_notifications(user2, "digest", true) - CommonAPI.post(user, %{"status" => "hey @#{user2.nickname}!"}) + CommonAPI.post(user, %{status: "hey @#{user2.nickname}!"}) {:ok, user2: user2} end diff --git a/test/workers/cron/new_users_digest_worker_test.exs b/test/workers/cron/new_users_digest_worker_test.exs index e6d050ecc..54cf0ca46 100644 --- a/test/workers/cron/new_users_digest_worker_test.exs +++ b/test/workers/cron/new_users_digest_worker_test.exs @@ -15,7 +15,7 @@ test "it sends new users digest emails" do admin = insert(:user, %{is_admin: true}) user = insert(:user, %{inserted_at: yesterday}) user2 = insert(:user, %{inserted_at: yesterday}) - CommonAPI.post(user, %{"status" => "cofe"}) + CommonAPI.post(user, %{status: "cofe"}) NewUsersDigestWorker.perform(nil, nil) ObanHelpers.perform_all() @@ -36,7 +36,7 @@ test "it doesn't fail when admin has no email" do insert(:user, %{inserted_at: yesterday}) user = insert(:user, %{inserted_at: yesterday}) - CommonAPI.post(user, %{"status" => "cofe"}) + CommonAPI.post(user, %{status: "cofe"}) NewUsersDigestWorker.perform(nil, nil) ObanHelpers.perform_all()