From 7399245c747dacde772842b97b77da653c9ddb33 Mon Sep 17 00:00:00 2001 From: Christine Dodrill Date: Tue, 29 Aug 2017 14:05:25 -0700 Subject: [PATCH] use nats for logworker --- cmd/logworker/main.go | 20 +- cmd/vyvanse/main.go | 41 +- docker-compose.yml | 14 +- internal/dao/logs.go | 2 +- vendor-log | 4 + vendor/github.com/drone/.DS_Store | Bin 0 -> 6148 bytes vendor/github.com/drone/mq/logger/logger.go | 61 - vendor/github.com/drone/mq/stomp/client.go | 259 -- vendor/github.com/drone/mq/stomp/conn.go | 156 - vendor/github.com/drone/mq/stomp/const.go | 76 - vendor/github.com/drone/mq/stomp/context.go | 37 - .../drone/mq/stomp/dialer/dialer.go | 51 - vendor/github.com/drone/mq/stomp/handler.go | 13 - vendor/github.com/drone/mq/stomp/header.go | 109 - vendor/github.com/drone/mq/stomp/message.go | 146 - vendor/github.com/drone/mq/stomp/option.go | 96 - vendor/github.com/drone/mq/stomp/peer.go | 86 - vendor/github.com/drone/mq/stomp/reader.go | 139 - vendor/github.com/drone/mq/stomp/writer.go | 173 - vendor/github.com/nats-io/go-nats/context.go | 166 + vendor/github.com/nats-io/go-nats/enc.go | 249 ++ .../go-nats/encoders/builtin/default_enc.go | 106 + .../go-nats/encoders/builtin/gob_enc.go | 34 + .../go-nats/encoders/builtin/json_enc.go | 45 + vendor/github.com/nats-io/go-nats/nats.go | 2975 +++++++++++++++++ vendor/github.com/nats-io/go-nats/netchan.go | 100 + vendor/github.com/nats-io/go-nats/parser.go | 470 +++ vendor/github.com/nats-io/go-nats/timer.go | 43 + vendor/github.com/nats-io/go-nats/util/tls.go | 37 + .../nats-io/go-nats/util/tls_pre17.go | 35 + vendor/github.com/nats-io/nuid/nuid.go | 124 + 31 files changed, 4427 insertions(+), 1440 deletions(-) create mode 100644 vendor/github.com/drone/.DS_Store delete mode 100644 vendor/github.com/drone/mq/logger/logger.go delete mode 100644 vendor/github.com/drone/mq/stomp/client.go delete mode 100644 vendor/github.com/drone/mq/stomp/conn.go delete mode 100644 vendor/github.com/drone/mq/stomp/const.go delete mode 100644 vendor/github.com/drone/mq/stomp/context.go delete mode 100644 vendor/github.com/drone/mq/stomp/dialer/dialer.go delete mode 100644 vendor/github.com/drone/mq/stomp/handler.go delete mode 100644 vendor/github.com/drone/mq/stomp/header.go delete mode 100644 vendor/github.com/drone/mq/stomp/message.go delete mode 100644 vendor/github.com/drone/mq/stomp/option.go delete mode 100644 vendor/github.com/drone/mq/stomp/peer.go delete mode 100644 vendor/github.com/drone/mq/stomp/reader.go delete mode 100644 vendor/github.com/drone/mq/stomp/writer.go create mode 100644 vendor/github.com/nats-io/go-nats/context.go create mode 100644 vendor/github.com/nats-io/go-nats/enc.go create mode 100644 vendor/github.com/nats-io/go-nats/encoders/builtin/default_enc.go create mode 100644 vendor/github.com/nats-io/go-nats/encoders/builtin/gob_enc.go create mode 100644 vendor/github.com/nats-io/go-nats/encoders/builtin/json_enc.go create mode 100644 vendor/github.com/nats-io/go-nats/nats.go create mode 100644 vendor/github.com/nats-io/go-nats/netchan.go create mode 100644 vendor/github.com/nats-io/go-nats/parser.go create mode 100644 vendor/github.com/nats-io/go-nats/timer.go create mode 100644 vendor/github.com/nats-io/go-nats/util/tls.go create mode 100644 vendor/github.com/nats-io/go-nats/util/tls_pre17.go create mode 100644 vendor/github.com/nats-io/nuid/nuid.go diff --git a/cmd/logworker/main.go b/cmd/logworker/main.go index 6c135d7..f2bb64f 100644 --- a/cmd/logworker/main.go +++ b/cmd/logworker/main.go @@ -9,8 +9,8 @@ import ( "github.com/Xe/ln" "github.com/bwmarrin/discordgo" - "github.com/drone/mq/stomp" "github.com/namsral/flag" + nats "github.com/nats-io/go-nats" opentracing "github.com/opentracing/opentracing-go" zipkin "github.com/openzipkin/zipkin-go-opentracing" ) @@ -19,7 +19,7 @@ var ( token = flag.String("token", "", "discord bot token") zipkinURL = flag.String("zipkin-url", "", "URL for Zipkin traces") databaseURL = flag.String("database-url", "http://", "URL for database (rqlite)") - mqURL = flag.String("mq-url", "tcp://mq:9000", "URL for STOMP server") + natsURL = flag.String("nats-url", "nats://localhost:4222", "URL for nats message queue") ) func main() { @@ -52,24 +52,26 @@ func main() { ln.FatalErr(ctx, err, ln.F{"action": "migrate logs table"}) } - mq, err := stomp.Dial(*mqURL) + mq, err := nats.Connect(*natsURL) if err != nil { - ln.FatalErr(ctx, err, ln.F{"url": *mqURL}) + ln.FatalErr(ctx, err) } - mq.Subscribe("/topic/message_create", stomp.HandlerFunc(func(m *stomp.Message) { - sp, ctx := opentracing.StartSpanFromContext(m.Context(), "logworker.topic.message.create") + mq.QueueSubscribe("/message/create", "logworker", func(m *nats.Msg) { + ctx, cancel := context.WithCancel(context.Background()) + defer cancel() + + sp, ctx := opentracing.StartSpanFromContext(ctx, "message.create") defer sp.Finish() msg := &discordgo.Message{} - err := json.Unmarshal(m.Msg, msg) + err := json.Unmarshal(m.Data, msg) if err != nil { ln.Error(ctx, err, ln.F{"action": "can't unmarshal message body to a discordgo message"}) return } f := ln.F{ - "stomp_id": string(m.ID), "channel_id": msg.ChannelID, "message_id": msg.ID, "message_author": msg.Author.ID, @@ -81,7 +83,7 @@ func main() { if err != nil { ln.Error(ctx, err, f, ln.F{"action": "can't add discordgo message to the database"}) } - })) + }) for { select {} diff --git a/cmd/vyvanse/main.go b/cmd/vyvanse/main.go index 40d1ca6..ddfe86c 100644 --- a/cmd/vyvanse/main.go +++ b/cmd/vyvanse/main.go @@ -2,6 +2,7 @@ package main import ( "context" + "encoding/json" "fmt" "log" "net/http" @@ -13,9 +14,9 @@ import ( "github.com/Xe/ln" "github.com/bwmarrin/discordgo" - "github.com/drone/mq/stomp" _ "github.com/joho/godotenv/autoload" "github.com/namsral/flag" + nats "github.com/nats-io/go-nats" xkcd "github.com/nishanths/go-xkcd" opentracing "github.com/opentracing/opentracing-go" otlog "github.com/opentracing/opentracing-go/log" @@ -30,7 +31,7 @@ var ( token = flag.String("token", "", "discord bot token") zipkinURL = flag.String("zipkin-url", "", "URL for Zipkin traces") databaseURL = flag.String("database-url", "http://", "URL for database (rqlite)") - mqURL = flag.String("mq-url", "tcp://mq:9000", "URL for STOMP server") + natsURL = flag.String("nats-url", "nats://localhost:4222", "URL for Nats message queue") ) func main() { @@ -80,11 +81,10 @@ func main() { ctx = context.Background() - mq, err := stomp.Dial(*mqURL) + mq, err := nats.Connect(*natsURL) if err != nil { - ln.FatalErr(ctx, err, ln.F{"url": *mqURL}) + ln.FatalErr(ctx, err) } - _ = mq c := cron.New() @@ -156,25 +156,15 @@ func main() { "message_author_is_bot": m.Author.Bot, } - err := mq.SendJSON("/topic/message_create", m.Message) + data, err := json.Marshal(m) if err != nil { - if err.Error() == "EOF" { - mq, err = stomp.Dial(*mqURL) - if err != nil { - ln.Error(ctx, err, f, ln.F{"url": *mqURL, "action": "reconnect to mq"}) - return - } + ln.Error(ctx, err, f) + return + } - err = mq.SendJSON("/topic/message_create", m.Message) - if err != nil { - ln.Error(ctx, err, f, ln.F{"action": "retry message_create post to message queue"}) - return - } - - return - } - - ln.Error(ctx, err, f, ln.F{"action": "send created message to queue"}) + err = mq.Publish("/message/create", data) + if err != nil { + ln.Error(ctx, err, f, ln.F{"action": "send new message to nats"}) return } @@ -191,7 +181,12 @@ func main() { "user_name": m.User.Username, } - err := mq.SendJSON("/topic/member_add", m.Member) + data, err := json.Marshal(m.Member) + if err != nil { + ln.Error(ctx, err, f, ln.F{"action": "prepare member add to queue"}) + } + + err = mq.Publish("/member/add", data) if err != nil { ln.Error(ctx, err, f, ln.F{"action": "send added member to queue"}) } diff --git a/docker-compose.yml b/docker-compose.yml index 99d2d2a..53d210f 100644 --- a/docker-compose.yml +++ b/docker-compose.yml @@ -11,9 +11,11 @@ services: ports: - "9411:9411" - # message queue - mq: - image: drone/mq + # nats message queue + nats: + image: nats + ports: + - "4222:4222" # database rqlite: @@ -21,6 +23,8 @@ services: image: rqlite/rqlite:4.0.2 volumes: - rqlite:/rqlite/file + ports: + - "4001:4001" command: -on-disk -http-adv-addr rqlite:4001 # the bot and event sourcing ingress @@ -30,7 +34,7 @@ services: env_file: ./.env depends_on: - zipkin - - mq + - nats - rqlite logworker: @@ -39,7 +43,7 @@ services: env_file: ./.env depends_on: - zipkin - - mq + - nats - rqlite command: /root/go/bin/logworker diff --git a/internal/dao/logs.go b/internal/dao/logs.go index 92b9562..5f0e13f 100644 --- a/internal/dao/logs.go +++ b/internal/dao/logs.go @@ -73,7 +73,7 @@ func (l *Logs) Add(ctx context.Context, m *discordgo.Message) error { me = 1 } - bd := stmt.Bind(m.ID, m.ChannelID, m.Content, ts, me, m.Author.ID, m.Author.Username) + bd := stmt.Bind(m.ID, m.ChannelID, m.Content, ts.Unix(), me, m.Author.ID, m.Author.Username) l.bdl.Add(bd, len(bd)) diff --git a/vendor-log b/vendor-log index 45e643b..9fe42fc 100644 --- a/vendor-log +++ b/vendor-log @@ -50,3 +50,7 @@ f5079bd7f6f74e23c4d65efa0f4ce14cbd6a3c0f golang.org/x/net/websocket 66aacef3dd8a676686c7ae3716979581e8b03c47 golang.org/x/net/context f52d1811a62927559de87708c8913c1650ce4f26 golang.org/x/sync/semaphore e0e0e6e500066ff47335c7717e2a090ad127adec google.golang.org/api/support/bundler +acf11e4666ad8ab4680680b45d38cf1509a40fed github.com/nats-io/go-nats +acf11e4666ad8ab4680680b45d38cf1509a40fed github.com/nats-io/go-nats/encoders/builtin +acf11e4666ad8ab4680680b45d38cf1509a40fed github.com/nats-io/go-nats/util +3cf34f9fca4e88afa9da8eabd75e3326c9941b44 github.com/nats-io/nuid diff --git a/vendor/github.com/drone/.DS_Store b/vendor/github.com/drone/.DS_Store new file mode 100644 index 0000000000000000000000000000000000000000..5008ddfcf53c02e82d7eee2e57c38e5672ef89f6 GIT binary patch literal 6148 zcmeH~Jr2S!425mzP>H1@V-^m;4Wg<&0T*E43hX&L&p$$qDprKhvt+--jT7}7np#A3 zem<@ulZcFPQ@L2!n>{z**++&mCkOWA81W14cNZlEfg7;MkzE(HCqgga^y>{tEnwC%0;vJ&^%eQ zLs35+`xjp>T0 h.itemc { - return - } - k = h.items[i].name - v = h.items[i].data - return -} - -// Len returns the header length. -func (h *Header) Len() int { - return h.itemc -} - -func (h *Header) grow() { - if h.itemc > defaultHeaderLen-1 { - h.items = append(h.items, item{}) - } -} - -func (h *Header) reset() { - h.itemc = 0 - h.items = h.items[:defaultHeaderLen] - for i := range h.items { - h.items[i].name = zeroBytes - h.items[i].data = zeroBytes - } -} - -var zeroBytes []byte diff --git a/vendor/github.com/drone/mq/stomp/message.go b/vendor/github.com/drone/mq/stomp/message.go deleted file mode 100644 index 68118e7..0000000 --- a/vendor/github.com/drone/mq/stomp/message.go +++ /dev/null @@ -1,146 +0,0 @@ -package stomp - -import ( - "bytes" - "encoding/json" - "math/rand" - "strconv" - "sync" - - "golang.org/x/net/context" -) - -// Message represents a parsed STOMP message. -type Message struct { - ID []byte // id header - Proto []byte // stomp version - Method []byte // stomp method - User []byte // username header - Pass []byte // password header - Dest []byte // destination header - Subs []byte // subscription id - Ack []byte // ack id - Msg []byte // message-id header - Persist []byte // persist header - Retain []byte // retain header - Prefetch []byte // prefetch count - Expires []byte // expires header - Receipt []byte // receipt header - Selector []byte // selector header - Body []byte - Header *Header // custom headers - - ctx context.Context -} - -// Copy returns a copy of the Message. -func (m *Message) Copy() *Message { - c := NewMessage() - c.ID = m.ID - c.Proto = m.Proto - c.Method = m.Method - c.User = m.User - c.Pass = m.Pass - c.Dest = m.Dest - c.Subs = m.Subs - c.Ack = m.Ack - c.Prefetch = m.Prefetch - c.Selector = m.Selector - c.Persist = m.Persist - c.Retain = m.Retain - c.Receipt = m.Receipt - c.Expires = m.Expires - c.Body = m.Body - c.ctx = m.ctx - c.Header.itemc = m.Header.itemc - copy(c.Header.items, m.Header.items) - return c -} - -// Apply applies the options to the message. -func (m *Message) Apply(opts ...MessageOption) { - for _, opt := range opts { - opt(m) - } -} - -// Parse parses the raw bytes into the message. -func (m *Message) Parse(b []byte) error { - return read(b, m) -} - -// Bytes returns the Message in raw byte format. -func (m *Message) Bytes() []byte { - var buf bytes.Buffer - writeTo(&buf, m) - return buf.Bytes() -} - -// String returns the Message in string format. -func (m *Message) String() string { - return string(m.Bytes()) -} - -// Release releases the message back to the message pool. -func (m *Message) Release() { - m.Reset() - pool.Put(m) -} - -// Reset resets the meesage fields to their zero values. -func (m *Message) Reset() { - m.ID = m.ID[:0] - m.Proto = m.Proto[:0] - m.Method = m.Method[:0] - m.User = m.User[:0] - m.Pass = m.Pass[:0] - m.Dest = m.Dest[:0] - m.Subs = m.Subs[:0] - m.Ack = m.Ack[:0] - m.Prefetch = m.Prefetch[:0] - m.Selector = m.Selector[:0] - m.Persist = m.Persist[:0] - m.Retain = m.Retain[:0] - m.Receipt = m.Receipt[:0] - m.Expires = m.Expires[:0] - m.Body = m.Body[:0] - m.ctx = nil - m.Header.reset() -} - -// Context returns the request's context. -func (m *Message) Context() context.Context { - if m.ctx != nil { - return m.ctx - } - return context.Background() -} - -// WithContext returns a shallow copy of m with its context changed -// to ctx. The provided ctx must be non-nil. -func (m *Message) WithContext(ctx context.Context) *Message { - c := m.Copy() - c.ctx = ctx - return c -} - -// Unmarshal parses the JSON-encoded body of the message and -// stores the result in the value pointed to by v. -func (m *Message) Unmarshal(v interface{}) error { - return json.Unmarshal(m.Body, v) -} - -// NewMessage returns an empty message from the message pool. -func NewMessage() *Message { - return pool.Get().(*Message) -} - -var pool = sync.Pool{New: func() interface{} { - return &Message{Header: newHeader()} -}} - -// Rand returns a random int64 number as a []byte of -// ascii characters. -func Rand() []byte { - return strconv.AppendInt(nil, rand.Int63(), 10) -} diff --git a/vendor/github.com/drone/mq/stomp/option.go b/vendor/github.com/drone/mq/stomp/option.go deleted file mode 100644 index a82c903..0000000 --- a/vendor/github.com/drone/mq/stomp/option.go +++ /dev/null @@ -1,96 +0,0 @@ -package stomp - -import ( - "math/rand" - "strconv" - "strings" -) - -// MessageOption configures message options. -type MessageOption func(*Message) - -// WithCredentials returns a MessageOption which sets credentials. -func WithCredentials(username, password string) MessageOption { - return func(m *Message) { - m.User = []byte(username) - m.Pass = []byte(password) - } -} - -// WithHeader returns a MessageOption which sets a header. -func WithHeader(key, value string) MessageOption { - return func(m *Message) { - _, ok := headerLookup[strings.ToLower(key)] - if !ok { - m.Header.Add( - []byte(key), - []byte(value), - ) - } - } -} - -// WithHeaders returns a MessageOption which sets headers. -func WithHeaders(headers map[string]string) MessageOption { - return func(m *Message) { - for key, value := range headers { - _, ok := headerLookup[strings.ToLower(key)] - if !ok { - m.Header.Add( - []byte(key), - []byte(value), - ) - } - } - } -} - -// WithExpires returns a MessageOption configured with an expiration. -func WithExpires(exp int64) MessageOption { - return func(m *Message) { - m.Expires = strconv.AppendInt(nil, exp, 10) - } -} - -// WithPrefetch returns a MessageOption configured with a prefetch count. -func WithPrefetch(prefetch int) MessageOption { - return func(m *Message) { - m.Prefetch = strconv.AppendInt(nil, int64(prefetch), 10) - } -} - -// WithReceipt returns a MessageOption configured with a receipt request. -func WithReceipt() MessageOption { - return func(m *Message) { - m.Receipt = strconv.AppendInt(nil, rand.Int63(), 10) - } -} - -// WithPersistence returns a MessageOption configured to persist. -func WithPersistence() MessageOption { - return func(m *Message) { - m.Persist = PersistTrue - } -} - -// WithRetain returns a MessageOption configured to retain the message. -func WithRetain(retain string) MessageOption { - return func(m *Message) { - m.Retain = []byte(retain) - } -} - -// WithSelector returns a MessageOption configured to filter messages -// using a sql-like evaluation string. -func WithSelector(selector string) MessageOption { - return func(m *Message) { - m.Selector = []byte(selector) - } -} - -// WithAck returns a MessageOption configured with an ack policy. -func WithAck(ack string) MessageOption { - return func(m *Message) { - m.Ack = []byte(ack) - } -} diff --git a/vendor/github.com/drone/mq/stomp/peer.go b/vendor/github.com/drone/mq/stomp/peer.go deleted file mode 100644 index fd07a1f..0000000 --- a/vendor/github.com/drone/mq/stomp/peer.go +++ /dev/null @@ -1,86 +0,0 @@ -package stomp - -import ( - "io" - "net" - "sync" -) - -// Peer defines a peer-to-peer connection. -type Peer interface { - // Send sends a message. - Send(*Message) error - - // Receive returns a channel of inbound messages. - Receive() <-chan *Message - - // Close closes the connection. - Close() error - - // Addr returns the peer address. - Addr() string -} - -// Pipe creates a synchronous in-memory pipe, where reads on one end are -// matched with writes on the other. This is useful for direct, in-memory -// client-server communication. -func Pipe() (Peer, Peer) { - atob := make(chan *Message, 10) - btoa := make(chan *Message, 10) - - a := &localPeer{ - incoming: btoa, - outgoing: atob, - finished: make(chan bool), - } - b := &localPeer{ - incoming: atob, - outgoing: btoa, - finished: make(chan bool), - } - - return a, b -} - -type localPeer struct { - finished chan bool - outgoing chan<- *Message - incoming <-chan *Message -} - -func (p *localPeer) Receive() <-chan *Message { - return p.incoming -} - -func (p *localPeer) Send(m *Message) error { - select { - case <-p.finished: - return io.EOF - default: - p.outgoing <- m - return nil - } -} - -func (p *localPeer) Close() error { - close(p.finished) - close(p.outgoing) - return nil -} - -func (p *localPeer) Addr() string { - peerAddrOnce.Do(func() { - // get the local address list - addr, _ := net.InterfaceAddrs() - if len(addr) != 0 { - // use the last address in the list - peerAddr = addr[len(addr)-1].String() - } - }) - return peerAddr -} - -var peerAddrOnce sync.Once - -// default address displayed for local pipes -var peerAddr = "127.0.0.1/8" diff --git a/vendor/github.com/drone/mq/stomp/reader.go b/vendor/github.com/drone/mq/stomp/reader.go deleted file mode 100644 index ec88d55..0000000 --- a/vendor/github.com/drone/mq/stomp/reader.go +++ /dev/null @@ -1,139 +0,0 @@ -package stomp - -import ( - "bytes" - "fmt" -) - -func read(input []byte, m *Message) (err error) { - var ( - pos int - off int - tot = len(input) - ) - - // parse the stomp message - for ; ; off++ { - if off == tot { - return fmt.Errorf("stomp: invalid method") - } - if input[off] == '\n' { - m.Method = input[pos:off] - off++ - pos = off - break - } - } - - // parse the stomp headers - for { - if off == tot { - return fmt.Errorf("stomp: unexpected eof") - } - if input[off] == '\n' { - off++ - pos = off - break - } - - var ( - name []byte - value []byte - ) - - loop: - // parse each individual header - for ; ; off++ { - if off >= tot { - return fmt.Errorf("stomp: unexpected eof") - } - - switch input[off] { - case '\n': - value = input[pos:off] - off++ - pos = off - break loop - case ':': - name = input[pos:off] - off++ - pos = off - } - } - - switch { - case bytes.Equal(name, HeaderAccept): - m.Proto = value - case bytes.Equal(name, HeaderAck): - m.Ack = value - case bytes.Equal(name, HeaderDest): - m.Dest = value - case bytes.Equal(name, HeaderExpires): - m.Expires = value - case bytes.Equal(name, HeaderLogin): - m.User = value - case bytes.Equal(name, HeaderPass): - m.Pass = value - case bytes.Equal(name, HeaderID): - m.ID = value - case bytes.Equal(name, HeaderMessageID): - m.ID = value - case bytes.Equal(name, HeaderPersist): - m.Persist = value - case bytes.Equal(name, HeaderPrefetch): - m.Prefetch = value - case bytes.Equal(name, HeaderReceipt): - m.Receipt = value - case bytes.Equal(name, HeaderReceiptID): - m.Receipt = value - case bytes.Equal(name, HeaderRetain): - m.Retain = value - case bytes.Equal(name, HeaderSelector): - m.Selector = value - case bytes.Equal(name, HeaderSubscription): - m.Subs = value - case bytes.Equal(name, HeaderVersion): - m.Proto = value - default: - m.Header.Add(name, value) - } - } - - if tot > pos { - m.Body = input[pos:] - } - return -} - -const ( - asciiZero = 48 - asciiNine = 57 -) - -// ParseInt returns the ascii integer value. -func ParseInt(d []byte) (n int) { - if len(d) == 0 { - return 0 - } - for _, dec := range d { - if dec < asciiZero || dec > asciiNine { - return 0 - } - n = n*10 + (int(dec) - asciiZero) - } - return n -} - -// ParseInt64 returns the ascii integer value. -func ParseInt64(d []byte) (n int64) { - if len(d) == 0 { - return 0 - } - for _, dec := range d { - if dec < asciiZero || dec > asciiNine { - return 0 - } - n = n*10 + (int64(dec) - asciiZero) - } - return n -} diff --git a/vendor/github.com/drone/mq/stomp/writer.go b/vendor/github.com/drone/mq/stomp/writer.go deleted file mode 100644 index ca09324..0000000 --- a/vendor/github.com/drone/mq/stomp/writer.go +++ /dev/null @@ -1,173 +0,0 @@ -package stomp - -import ( - "bytes" - "io" -) - -var ( - crlf = []byte{'\r', '\n'} - newline = []byte{'\n'} - separator = []byte{':'} - terminator = []byte{0} -) - -func writeTo(w io.Writer, m *Message) { - w.Write(m.Method) - w.Write(newline) - - switch { - case bytes.Equal(m.Method, MethodStomp): - // version - w.Write(HeaderAccept) - w.Write(separator) - w.Write(m.Proto) - w.Write(newline) - // login - if len(m.User) != 0 { - w.Write(HeaderLogin) - w.Write(separator) - w.Write(m.User) - w.Write(newline) - } - // passcode - if len(m.Pass) != 0 { - w.Write(HeaderPass) - w.Write(separator) - w.Write(m.Pass) - w.Write(newline) - } - case bytes.Equal(m.Method, MethodConnected): - // version - w.Write(HeaderVersion) - w.Write(separator) - w.Write(m.Proto) - w.Write(newline) - case bytes.Equal(m.Method, MethodSend): - // dest - w.Write(HeaderDest) - w.Write(separator) - w.Write(m.Dest) - w.Write(newline) - if len(m.Expires) != 0 { - w.Write(HeaderExpires) - w.Write(separator) - w.Write(m.Expires) - w.Write(newline) - } - if len(m.Retain) != 0 { - w.Write(HeaderRetain) - w.Write(separator) - w.Write(m.Retain) - w.Write(newline) - } - if len(m.Persist) != 0 { - w.Write(HeaderPersist) - w.Write(separator) - w.Write(m.Persist) - w.Write(newline) - } - case bytes.Equal(m.Method, MethodSubscribe): - // id - w.Write(HeaderID) - w.Write(separator) - w.Write(m.ID) - w.Write(newline) - // destination - w.Write(HeaderDest) - w.Write(separator) - w.Write(m.Dest) - w.Write(newline) - // selector - if len(m.Selector) != 0 { - w.Write(HeaderSelector) - w.Write(separator) - w.Write(m.Selector) - w.Write(newline) - } - // prefetch - if len(m.Prefetch) != 0 { - w.Write(HeaderPrefetch) - w.Write(separator) - w.Write(m.Prefetch) - w.Write(newline) - } - if len(m.Ack) != 0 { - w.Write(HeaderAck) - w.Write(separator) - w.Write(m.Ack) - w.Write(newline) - } - case bytes.Equal(m.Method, MethodUnsubscribe): - // id - w.Write(HeaderID) - w.Write(separator) - w.Write(m.ID) - w.Write(newline) - case bytes.Equal(m.Method, MethodAck): - // id - w.Write(HeaderID) - w.Write(separator) - w.Write(m.ID) - w.Write(newline) - case bytes.Equal(m.Method, MethodNack): - // id - w.Write(HeaderID) - w.Write(separator) - w.Write(m.ID) - w.Write(newline) - case bytes.Equal(m.Method, MethodMessage): - // message-id - w.Write(HeaderMessageID) - w.Write(separator) - w.Write(m.ID) - w.Write(newline) - // destination - w.Write(HeaderDest) - w.Write(separator) - w.Write(m.Dest) - w.Write(newline) - // subscription - w.Write(HeaderSubscription) - w.Write(separator) - w.Write(m.Subs) - w.Write(newline) - // ack - if len(m.Ack) != 0 { - w.Write(HeaderAck) - w.Write(separator) - w.Write(m.Ack) - w.Write(newline) - } - case bytes.Equal(m.Method, MethodRecipet): - // receipt-id - w.Write(HeaderReceiptID) - w.Write(separator) - w.Write(m.Receipt) - w.Write(newline) - } - - // receipt header - if includeReceiptHeader(m) { - w.Write(HeaderReceipt) - w.Write(separator) - w.Write(m.Receipt) - w.Write(newline) - } - - for i, item := range m.Header.items { - if m.Header.itemc == i { - break - } - w.Write(item.name) - w.Write(separator) - w.Write(item.data) - w.Write(newline) - } - w.Write(newline) - w.Write(m.Body) -} - -func includeReceiptHeader(m *Message) bool { - return len(m.Receipt) != 0 && !bytes.Equal(m.Method, MethodRecipet) -} diff --git a/vendor/github.com/nats-io/go-nats/context.go b/vendor/github.com/nats-io/go-nats/context.go new file mode 100644 index 0000000..be6ada4 --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/context.go @@ -0,0 +1,166 @@ +// Copyright 2012-2017 Apcera Inc. All rights reserved. + +// +build go1.7 + +// A Go client for the NATS messaging system (https://nats.io). +package nats + +import ( + "context" + "fmt" + "reflect" +) + +// RequestWithContext takes a context, a subject and payload +// in bytes and request expecting a single response. +func (nc *Conn) RequestWithContext(ctx context.Context, subj string, data []byte) (*Msg, error) { + if ctx == nil { + return nil, ErrInvalidContext + } + if nc == nil { + return nil, ErrInvalidConnection + } + + nc.mu.Lock() + // If user wants the old style. + if nc.Opts.UseOldRequestStyle { + nc.mu.Unlock() + return nc.oldRequestWithContext(ctx, subj, data) + } + + // Do setup for the new style. + if nc.respMap == nil { + // _INBOX wildcard + nc.respSub = fmt.Sprintf("%s.*", NewInbox()) + nc.respMap = make(map[string]chan *Msg) + } + // Create literal Inbox and map to a chan msg. + mch := make(chan *Msg, RequestChanLen) + respInbox := nc.newRespInbox() + token := respToken(respInbox) + nc.respMap[token] = mch + createSub := nc.respMux == nil + ginbox := nc.respSub + nc.mu.Unlock() + + if createSub { + // Make sure scoped subscription is setup only once. + var err error + nc.respSetup.Do(func() { err = nc.createRespMux(ginbox) }) + if err != nil { + return nil, err + } + } + + err := nc.PublishRequest(subj, respInbox, data) + if err != nil { + return nil, err + } + + var ok bool + var msg *Msg + + select { + case msg, ok = <-mch: + if !ok { + return nil, ErrConnectionClosed + } + case <-ctx.Done(): + nc.mu.Lock() + delete(nc.respMap, token) + nc.mu.Unlock() + return nil, ctx.Err() + } + + return msg, nil +} + +// oldRequestWithContext utilizes inbox and subscription per request. +func (nc *Conn) oldRequestWithContext(ctx context.Context, subj string, data []byte) (*Msg, error) { + inbox := NewInbox() + ch := make(chan *Msg, RequestChanLen) + + s, err := nc.subscribe(inbox, _EMPTY_, nil, ch) + if err != nil { + return nil, err + } + s.AutoUnsubscribe(1) + defer s.Unsubscribe() + + err = nc.PublishRequest(subj, inbox, data) + if err != nil { + return nil, err + } + + return s.NextMsgWithContext(ctx) +} + +// NextMsgWithContext takes a context and returns the next message +// available to a synchronous subscriber, blocking until it is delivered +// or context gets canceled. +func (s *Subscription) NextMsgWithContext(ctx context.Context) (*Msg, error) { + if ctx == nil { + return nil, ErrInvalidContext + } + if s == nil { + return nil, ErrBadSubscription + } + + s.mu.Lock() + err := s.validateNextMsgState() + if err != nil { + s.mu.Unlock() + return nil, err + } + + // snapshot + mch := s.mch + s.mu.Unlock() + + var ok bool + var msg *Msg + + select { + case msg, ok = <-mch: + if !ok { + return nil, ErrConnectionClosed + } + err := s.processNextMsgDelivered(msg) + if err != nil { + return nil, err + } + case <-ctx.Done(): + return nil, ctx.Err() + } + + return msg, nil +} + +// RequestWithContext will create an Inbox and perform a Request +// using the provided cancellation context with the Inbox reply +// for the data v. A response will be decoded into the vPtrResponse. +func (c *EncodedConn) RequestWithContext(ctx context.Context, subject string, v interface{}, vPtr interface{}) error { + if ctx == nil { + return ErrInvalidContext + } + + b, err := c.Enc.Encode(subject, v) + if err != nil { + return err + } + m, err := c.Conn.RequestWithContext(ctx, subject, b) + if err != nil { + return err + } + if reflect.TypeOf(vPtr) == emptyMsgType { + mPtr := vPtr.(*Msg) + *mPtr = *m + } else { + err := c.Enc.Decode(m.Subject, m.Data, vPtr) + if err != nil { + return err + } + } + + return nil +} diff --git a/vendor/github.com/nats-io/go-nats/enc.go b/vendor/github.com/nats-io/go-nats/enc.go new file mode 100644 index 0000000..291b782 --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/enc.go @@ -0,0 +1,249 @@ +// Copyright 2012-2015 Apcera Inc. All rights reserved. + +package nats + +import ( + "errors" + "fmt" + "reflect" + "sync" + "time" + + // Default Encoders + . "github.com/nats-io/go-nats/encoders/builtin" +) + +// Encoder interface is for all register encoders +type Encoder interface { + Encode(subject string, v interface{}) ([]byte, error) + Decode(subject string, data []byte, vPtr interface{}) error +} + +var encMap map[string]Encoder +var encLock sync.Mutex + +// Indexe names into the Registered Encoders. +const ( + JSON_ENCODER = "json" + GOB_ENCODER = "gob" + DEFAULT_ENCODER = "default" +) + +func init() { + encMap = make(map[string]Encoder) + // Register json, gob and default encoder + RegisterEncoder(JSON_ENCODER, &JsonEncoder{}) + RegisterEncoder(GOB_ENCODER, &GobEncoder{}) + RegisterEncoder(DEFAULT_ENCODER, &DefaultEncoder{}) +} + +// EncodedConn are the preferred way to interface with NATS. They wrap a bare connection to +// a nats server and have an extendable encoder system that will encode and decode messages +// from raw Go types. +type EncodedConn struct { + Conn *Conn + Enc Encoder +} + +// NewEncodedConn will wrap an existing Connection and utilize the appropriate registered +// encoder. +func NewEncodedConn(c *Conn, encType string) (*EncodedConn, error) { + if c == nil { + return nil, errors.New("nats: Nil Connection") + } + if c.IsClosed() { + return nil, ErrConnectionClosed + } + ec := &EncodedConn{Conn: c, Enc: EncoderForType(encType)} + if ec.Enc == nil { + return nil, fmt.Errorf("No encoder registered for '%s'", encType) + } + return ec, nil +} + +// RegisterEncoder will register the encType with the given Encoder. Useful for customization. +func RegisterEncoder(encType string, enc Encoder) { + encLock.Lock() + defer encLock.Unlock() + encMap[encType] = enc +} + +// EncoderForType will return the registered Encoder for the encType. +func EncoderForType(encType string) Encoder { + encLock.Lock() + defer encLock.Unlock() + return encMap[encType] +} + +// Publish publishes the data argument to the given subject. The data argument +// will be encoded using the associated encoder. +func (c *EncodedConn) Publish(subject string, v interface{}) error { + b, err := c.Enc.Encode(subject, v) + if err != nil { + return err + } + return c.Conn.publish(subject, _EMPTY_, b) +} + +// PublishRequest will perform a Publish() expecting a response on the +// reply subject. Use Request() for automatically waiting for a response +// inline. +func (c *EncodedConn) PublishRequest(subject, reply string, v interface{}) error { + b, err := c.Enc.Encode(subject, v) + if err != nil { + return err + } + return c.Conn.publish(subject, reply, b) +} + +// Request will create an Inbox and perform a Request() call +// with the Inbox reply for the data v. A response will be +// decoded into the vPtrResponse. +func (c *EncodedConn) Request(subject string, v interface{}, vPtr interface{}, timeout time.Duration) error { + b, err := c.Enc.Encode(subject, v) + if err != nil { + return err + } + m, err := c.Conn.Request(subject, b, timeout) + if err != nil { + return err + } + if reflect.TypeOf(vPtr) == emptyMsgType { + mPtr := vPtr.(*Msg) + *mPtr = *m + } else { + err = c.Enc.Decode(m.Subject, m.Data, vPtr) + } + return err +} + +// Handler is a specific callback used for Subscribe. It is generalized to +// an interface{}, but we will discover its format and arguments at runtime +// and perform the correct callback, including de-marshaling JSON strings +// back into the appropriate struct based on the signature of the Handler. +// +// Handlers are expected to have one of four signatures. +// +// type person struct { +// Name string `json:"name,omitempty"` +// Age uint `json:"age,omitempty"` +// } +// +// handler := func(m *Msg) +// handler := func(p *person) +// handler := func(subject string, o *obj) +// handler := func(subject, reply string, o *obj) +// +// These forms allow a callback to request a raw Msg ptr, where the processing +// of the message from the wire is untouched. Process a JSON representation +// and demarshal it into the given struct, e.g. person. +// There are also variants where the callback wants either the subject, or the +// subject and the reply subject. +type Handler interface{} + +// Dissect the cb Handler's signature +func argInfo(cb Handler) (reflect.Type, int) { + cbType := reflect.TypeOf(cb) + if cbType.Kind() != reflect.Func { + panic("nats: Handler needs to be a func") + } + numArgs := cbType.NumIn() + if numArgs == 0 { + return nil, numArgs + } + return cbType.In(numArgs - 1), numArgs +} + +var emptyMsgType = reflect.TypeOf(&Msg{}) + +// Subscribe will create a subscription on the given subject and process incoming +// messages using the specified Handler. The Handler should be a func that matches +// a signature from the description of Handler from above. +func (c *EncodedConn) Subscribe(subject string, cb Handler) (*Subscription, error) { + return c.subscribe(subject, _EMPTY_, cb) +} + +// QueueSubscribe will create a queue subscription on the given subject and process +// incoming messages using the specified Handler. The Handler should be a func that +// matches a signature from the description of Handler from above. +func (c *EncodedConn) QueueSubscribe(subject, queue string, cb Handler) (*Subscription, error) { + return c.subscribe(subject, queue, cb) +} + +// Internal implementation that all public functions will use. +func (c *EncodedConn) subscribe(subject, queue string, cb Handler) (*Subscription, error) { + if cb == nil { + return nil, errors.New("nats: Handler required for EncodedConn Subscription") + } + argType, numArgs := argInfo(cb) + if argType == nil { + return nil, errors.New("nats: Handler requires at least one argument") + } + + cbValue := reflect.ValueOf(cb) + wantsRaw := (argType == emptyMsgType) + + natsCB := func(m *Msg) { + var oV []reflect.Value + if wantsRaw { + oV = []reflect.Value{reflect.ValueOf(m)} + } else { + var oPtr reflect.Value + if argType.Kind() != reflect.Ptr { + oPtr = reflect.New(argType) + } else { + oPtr = reflect.New(argType.Elem()) + } + if err := c.Enc.Decode(m.Subject, m.Data, oPtr.Interface()); err != nil { + if c.Conn.Opts.AsyncErrorCB != nil { + c.Conn.ach <- func() { + c.Conn.Opts.AsyncErrorCB(c.Conn, m.Sub, errors.New("nats: Got an error trying to unmarshal: "+err.Error())) + } + } + return + } + if argType.Kind() != reflect.Ptr { + oPtr = reflect.Indirect(oPtr) + } + + // Callback Arity + switch numArgs { + case 1: + oV = []reflect.Value{oPtr} + case 2: + subV := reflect.ValueOf(m.Subject) + oV = []reflect.Value{subV, oPtr} + case 3: + subV := reflect.ValueOf(m.Subject) + replyV := reflect.ValueOf(m.Reply) + oV = []reflect.Value{subV, replyV, oPtr} + } + + } + cbValue.Call(oV) + } + + return c.Conn.subscribe(subject, queue, natsCB, nil) +} + +// FlushTimeout allows a Flush operation to have an associated timeout. +func (c *EncodedConn) FlushTimeout(timeout time.Duration) (err error) { + return c.Conn.FlushTimeout(timeout) +} + +// Flush will perform a round trip to the server and return when it +// receives the internal reply. +func (c *EncodedConn) Flush() error { + return c.Conn.Flush() +} + +// Close will close the connection to the server. This call will release +// all blocking calls, such as Flush(), etc. +func (c *EncodedConn) Close() { + c.Conn.Close() +} + +// LastError reports the last error encountered via the Connection. +func (c *EncodedConn) LastError() error { + return c.Conn.err +} diff --git a/vendor/github.com/nats-io/go-nats/encoders/builtin/default_enc.go b/vendor/github.com/nats-io/go-nats/encoders/builtin/default_enc.go new file mode 100644 index 0000000..82467ce --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/encoders/builtin/default_enc.go @@ -0,0 +1,106 @@ +// Copyright 2012-2015 Apcera Inc. All rights reserved. + +package builtin + +import ( + "bytes" + "fmt" + "reflect" + "strconv" + "unsafe" +) + +// DefaultEncoder implementation for EncodedConn. +// This encoder will leave []byte and string untouched, but will attempt to +// turn numbers into appropriate strings that can be decoded. It will also +// propely encoded and decode bools. If will encode a struct, but if you want +// to properly handle structures you should use JsonEncoder. +type DefaultEncoder struct { + // Empty +} + +var trueB = []byte("true") +var falseB = []byte("false") +var nilB = []byte("") + +// Encode +func (je *DefaultEncoder) Encode(subject string, v interface{}) ([]byte, error) { + switch arg := v.(type) { + case string: + bytes := *(*[]byte)(unsafe.Pointer(&arg)) + return bytes, nil + case []byte: + return arg, nil + case bool: + if arg { + return trueB, nil + } else { + return falseB, nil + } + case nil: + return nilB, nil + default: + var buf bytes.Buffer + fmt.Fprintf(&buf, "%+v", arg) + return buf.Bytes(), nil + } +} + +// Decode +func (je *DefaultEncoder) Decode(subject string, data []byte, vPtr interface{}) error { + // Figure out what it's pointing to... + sData := *(*string)(unsafe.Pointer(&data)) + switch arg := vPtr.(type) { + case *string: + *arg = sData + return nil + case *[]byte: + *arg = data + return nil + case *int: + n, err := strconv.ParseInt(sData, 10, 64) + if err != nil { + return err + } + *arg = int(n) + return nil + case *int32: + n, err := strconv.ParseInt(sData, 10, 64) + if err != nil { + return err + } + *arg = int32(n) + return nil + case *int64: + n, err := strconv.ParseInt(sData, 10, 64) + if err != nil { + return err + } + *arg = int64(n) + return nil + case *float32: + n, err := strconv.ParseFloat(sData, 32) + if err != nil { + return err + } + *arg = float32(n) + return nil + case *float64: + n, err := strconv.ParseFloat(sData, 64) + if err != nil { + return err + } + *arg = float64(n) + return nil + case *bool: + b, err := strconv.ParseBool(sData) + if err != nil { + return err + } + *arg = b + return nil + default: + vt := reflect.TypeOf(arg).Elem() + return fmt.Errorf("nats: Default Encoder can't decode to type %s", vt) + } +} diff --git a/vendor/github.com/nats-io/go-nats/encoders/builtin/gob_enc.go b/vendor/github.com/nats-io/go-nats/encoders/builtin/gob_enc.go new file mode 100644 index 0000000..988ff42 --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/encoders/builtin/gob_enc.go @@ -0,0 +1,34 @@ +// Copyright 2013-2015 Apcera Inc. All rights reserved. + +package builtin + +import ( + "bytes" + "encoding/gob" +) + +// GobEncoder is a Go specific GOB Encoder implementation for EncodedConn. +// This encoder will use the builtin encoding/gob to Marshal +// and Unmarshal most types, including structs. +type GobEncoder struct { + // Empty +} + +// FIXME(dlc) - This could probably be more efficient. + +// Encode +func (ge *GobEncoder) Encode(subject string, v interface{}) ([]byte, error) { + b := new(bytes.Buffer) + enc := gob.NewEncoder(b) + if err := enc.Encode(v); err != nil { + return nil, err + } + return b.Bytes(), nil +} + +// Decode +func (ge *GobEncoder) Decode(subject string, data []byte, vPtr interface{}) (err error) { + dec := gob.NewDecoder(bytes.NewBuffer(data)) + err = dec.Decode(vPtr) + return +} diff --git a/vendor/github.com/nats-io/go-nats/encoders/builtin/json_enc.go b/vendor/github.com/nats-io/go-nats/encoders/builtin/json_enc.go new file mode 100644 index 0000000..3b269ef --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/encoders/builtin/json_enc.go @@ -0,0 +1,45 @@ +// Copyright 2012-2015 Apcera Inc. All rights reserved. + +package builtin + +import ( + "encoding/json" + "strings" +) + +// JsonEncoder is a JSON Encoder implementation for EncodedConn. +// This encoder will use the builtin encoding/json to Marshal +// and Unmarshal most types, including structs. +type JsonEncoder struct { + // Empty +} + +// Encode +func (je *JsonEncoder) Encode(subject string, v interface{}) ([]byte, error) { + b, err := json.Marshal(v) + if err != nil { + return nil, err + } + return b, nil +} + +// Decode +func (je *JsonEncoder) Decode(subject string, data []byte, vPtr interface{}) (err error) { + switch arg := vPtr.(type) { + case *string: + // If they want a string and it is a JSON string, strip quotes + // This allows someone to send a struct but receive as a plain string + // This cast should be efficient for Go 1.3 and beyond. + str := string(data) + if strings.HasPrefix(str, `"`) && strings.HasSuffix(str, `"`) { + *arg = str[1 : len(str)-1] + } else { + *arg = str + } + case *[]byte: + *arg = data + default: + err = json.Unmarshal(data, arg) + } + return +} diff --git a/vendor/github.com/nats-io/go-nats/nats.go b/vendor/github.com/nats-io/go-nats/nats.go new file mode 100644 index 0000000..65eb95c --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/nats.go @@ -0,0 +1,2975 @@ +// Copyright 2012-2017 Apcera Inc. All rights reserved. + +// A Go client for the NATS messaging system (https://nats.io). +package nats + +import ( + "bufio" + "bytes" + "crypto/tls" + "crypto/x509" + "encoding/json" + "errors" + "fmt" + "io/ioutil" + "math/rand" + "net" + "net/url" + "regexp" + "runtime" + "strconv" + "strings" + "sync" + "time" + + "github.com/nats-io/go-nats/util" + "github.com/nats-io/nuid" +) + +// Default Constants +const ( + Version = "1.3.1" + DefaultURL = "nats://localhost:4222" + DefaultPort = 4222 + DefaultMaxReconnect = 60 + DefaultReconnectWait = 2 * time.Second + DefaultTimeout = 2 * time.Second + DefaultPingInterval = 2 * time.Minute + DefaultMaxPingOut = 2 + DefaultMaxChanLen = 8192 // 8k + DefaultReconnectBufSize = 8 * 1024 * 1024 // 8MB + RequestChanLen = 8 + LangString = "go" +) + +// STALE_CONNECTION is for detection and proper handling of stale connections. +const STALE_CONNECTION = "stale connection" + +// PERMISSIONS_ERR is for when nats server subject authorization has failed. +const PERMISSIONS_ERR = "permissions violation" + +// AUTHORIZATION_ERR is for when nats server user authorization has failed. +const AUTHORIZATION_ERR = "authorization violation" + +// Errors +var ( + ErrConnectionClosed = errors.New("nats: connection closed") + ErrSecureConnRequired = errors.New("nats: secure connection required") + ErrSecureConnWanted = errors.New("nats: secure connection not available") + ErrBadSubscription = errors.New("nats: invalid subscription") + ErrTypeSubscription = errors.New("nats: invalid subscription type") + ErrBadSubject = errors.New("nats: invalid subject") + ErrSlowConsumer = errors.New("nats: slow consumer, messages dropped") + ErrTimeout = errors.New("nats: timeout") + ErrBadTimeout = errors.New("nats: timeout invalid") + ErrAuthorization = errors.New("nats: authorization violation") + ErrNoServers = errors.New("nats: no servers available for connection") + ErrJsonParse = errors.New("nats: connect message, json parse error") + ErrChanArg = errors.New("nats: argument needs to be a channel type") + ErrMaxPayload = errors.New("nats: maximum payload exceeded") + ErrMaxMessages = errors.New("nats: maximum messages delivered") + ErrSyncSubRequired = errors.New("nats: illegal call on an async subscription") + ErrMultipleTLSConfigs = errors.New("nats: multiple tls.Configs not allowed") + ErrNoInfoReceived = errors.New("nats: protocol exception, INFO not received") + ErrReconnectBufExceeded = errors.New("nats: outbound buffer limit exceeded") + ErrInvalidConnection = errors.New("nats: invalid connection") + ErrInvalidMsg = errors.New("nats: invalid message or message nil") + ErrInvalidArg = errors.New("nats: invalid argument") + ErrInvalidContext = errors.New("nats: invalid context") + ErrStaleConnection = errors.New("nats: " + STALE_CONNECTION) +) + +// GetDefaultOptions returns default configuration options for the client. +func GetDefaultOptions() Options { + return Options{ + AllowReconnect: true, + MaxReconnect: DefaultMaxReconnect, + ReconnectWait: DefaultReconnectWait, + Timeout: DefaultTimeout, + PingInterval: DefaultPingInterval, + MaxPingsOut: DefaultMaxPingOut, + SubChanLen: DefaultMaxChanLen, + ReconnectBufSize: DefaultReconnectBufSize, + } +} + +// DEPRECATED: Use GetDefaultOptions() instead. +// DefaultOptions is not safe for use by multiple clients. +// For details see #308. +var DefaultOptions = GetDefaultOptions() + +// Status represents the state of the connection. +type Status int + +const ( + DISCONNECTED = Status(iota) + CONNECTED + CLOSED + RECONNECTING + CONNECTING +) + +// ConnHandler is used for asynchronous events such as +// disconnected and closed connections. +type ConnHandler func(*Conn) + +// ErrHandler is used to process asynchronous errors encountered +// while processing inbound messages. +type ErrHandler func(*Conn, *Subscription, error) + +// asyncCB is used to preserve order for async callbacks. +type asyncCB func() + +// Option is a function on the options for a connection. +type Option func(*Options) error + +// Options can be used to create a customized connection. +type Options struct { + + // Url represents a single NATS server url to which the client + // will be connecting. If the Servers option is also set, it + // then becomes the first server in the Servers array. + Url string + + // Servers is a configured set of servers which this client + // will use when attempting to connect. + Servers []string + + // NoRandomize configures whether we will randomize the + // server pool. + NoRandomize bool + + // Name is an optional name label which will be sent to the server + // on CONNECT to identify the client. + Name string + + // Verbose signals the server to send an OK ack for commands + // successfully processed by the server. + Verbose bool + + // Pedantic signals the server whether it should be doing further + // validation of subjects. + Pedantic bool + + // Secure enables TLS secure connections that skip server + // verification by default. NOT RECOMMENDED. + Secure bool + + // TLSConfig is a custom TLS configuration to use for secure + // transports. + TLSConfig *tls.Config + + // AllowReconnect enables reconnection logic to be used when we + // encounter a disconnect from the current server. + AllowReconnect bool + + // MaxReconnect sets the number of reconnect attempts that will be + // tried before giving up. If negative, then it will never give up + // trying to reconnect. + MaxReconnect int + + // ReconnectWait sets the time to backoff after attempting a reconnect + // to a server that we were already connected to previously. + ReconnectWait time.Duration + + // Timeout sets the timeout for a Dial operation on a connection. + Timeout time.Duration + + // FlusherTimeout is the maximum time to wait for the flusher loop + // to be able to finish writing to the underlying connection. + FlusherTimeout time.Duration + + // PingInterval is the period at which the client will be sending ping + // commands to the server, disabled if 0 or negative. + PingInterval time.Duration + + // MaxPingsOut is the maximum number of pending ping commands that can + // be awaiting a response before raising an ErrStaleConnection error. + MaxPingsOut int + + // ClosedCB sets the closed handler that is called when a client will + // no longer be connected. + ClosedCB ConnHandler + + // DisconnectedCB sets the disconnected handler that is called + // whenever the connection is disconnected. + DisconnectedCB ConnHandler + + // ReconnectedCB sets the reconnected handler called whenever + // the connection is successfully reconnected. + ReconnectedCB ConnHandler + + // DiscoveredServersCB sets the callback that is invoked whenever a new + // server has joined the cluster. + DiscoveredServersCB ConnHandler + + // AsyncErrorCB sets the async error handler (e.g. slow consumer errors) + AsyncErrorCB ErrHandler + + // ReconnectBufSize is the size of the backing bufio during reconnect. + // Once this has been exhausted publish operations will return an error. + ReconnectBufSize int + + // SubChanLen is the size of the buffered channel used between the socket + // Go routine and the message delivery for SyncSubscriptions. + // NOTE: This does not affect AsyncSubscriptions which are + // dictated by PendingLimits() + SubChanLen int + + // User sets the username to be used when connecting to the server. + User string + + // Password sets the password to be used when connecting to a server. + Password string + + // Token sets the token to be used when connecting to a server. + Token string + + // Dialer allows a custom Dialer when forming connections. + Dialer *net.Dialer + + // UseOldRequestStyle forces the old method of Requests that utilize + // a new Inbox and a new Subscription for each request. + UseOldRequestStyle bool +} + +const ( + // Scratch storage for assembling protocol headers + scratchSize = 512 + + // The size of the bufio reader/writer on top of the socket. + defaultBufSize = 32768 + + // The buffered size of the flush "kick" channel + flushChanSize = 1024 + + // Default server pool size + srvPoolSize = 4 + + // Channel size for the async callback handler. + asyncCBChanSize = 32 + + // NUID size + nuidSize = 22 +) + +// A Conn represents a bare connection to a nats-server. +// It can send and receive []byte payloads. +type Conn struct { + // Keep all members for which we use atomic at the beginning of the + // struct and make sure they are all 64bits (or use padding if necessary). + // atomic.* functions crash on 32bit machines if operand is not aligned + // at 64bit. See https://github.com/golang/go/issues/599 + Statistics + mu sync.Mutex + Opts Options + wg *sync.WaitGroup + url *url.URL + conn net.Conn + srvPool []*srv + urls map[string]struct{} // Keep track of all known URLs (used by processInfo) + bw *bufio.Writer + pending *bytes.Buffer + fch chan struct{} + info serverInfo + ssid int64 + subsMu sync.RWMutex + subs map[int64]*Subscription + ach chan asyncCB + pongs []chan struct{} + scratch [scratchSize]byte + status Status + initc bool // true if the connection is performing the initial connect + err error + ps *parseState + ptmr *time.Timer + pout int + + // New style response handler + respSub string // The wildcard subject + respMux *Subscription // A single response subscription + respMap map[string]chan *Msg // Request map for the response msg channels + respSetup sync.Once // Ensures response subscription occurs once +} + +// A Subscription represents interest in a given subject. +type Subscription struct { + mu sync.Mutex + sid int64 + + // Subject that represents this subscription. This can be different + // than the received subject inside a Msg if this is a wildcard. + Subject string + + // Optional queue group name. If present, all subscriptions with the + // same name will form a distributed queue, and each message will + // only be processed by one member of the group. + Queue string + + delivered uint64 + max uint64 + conn *Conn + mcb MsgHandler + mch chan *Msg + closed bool + sc bool + connClosed bool + + // Type of Subscription + typ SubscriptionType + + // Async linked list + pHead *Msg + pTail *Msg + pCond *sync.Cond + + // Pending stats, async subscriptions, high-speed etc. + pMsgs int + pBytes int + pMsgsMax int + pBytesMax int + pMsgsLimit int + pBytesLimit int + dropped int +} + +// Msg is a structure used by Subscribers and PublishMsg(). +type Msg struct { + Subject string + Reply string + Data []byte + Sub *Subscription + next *Msg +} + +// Tracks various stats received and sent on this connection, +// including counts for messages and bytes. +type Statistics struct { + InMsgs uint64 + OutMsgs uint64 + InBytes uint64 + OutBytes uint64 + Reconnects uint64 +} + +// Tracks individual backend servers. +type srv struct { + url *url.URL + didConnect bool + reconnects int + lastAttempt time.Time + isImplicit bool +} + +type serverInfo struct { + Id string `json:"server_id"` + Host string `json:"host"` + Port uint `json:"port"` + Version string `json:"version"` + AuthRequired bool `json:"auth_required"` + TLSRequired bool `json:"tls_required"` + MaxPayload int64 `json:"max_payload"` + ConnectURLs []string `json:"connect_urls,omitempty"` +} + +const ( + // clientProtoZero is the original client protocol from 2009. + // http://nats.io/documentation/internals/nats-protocol/ + /* clientProtoZero */ _ = iota + // clientProtoInfo signals a client can receive more then the original INFO block. + // This can be used to update clients on other cluster members, etc. + clientProtoInfo +) + +type connectInfo struct { + Verbose bool `json:"verbose"` + Pedantic bool `json:"pedantic"` + User string `json:"user,omitempty"` + Pass string `json:"pass,omitempty"` + Token string `json:"auth_token,omitempty"` + TLS bool `json:"tls_required"` + Name string `json:"name"` + Lang string `json:"lang"` + Version string `json:"version"` + Protocol int `json:"protocol"` +} + +// MsgHandler is a callback function that processes messages delivered to +// asynchronous subscribers. +type MsgHandler func(msg *Msg) + +// Connect will attempt to connect to the NATS system. +// The url can contain username/password semantics. e.g. nats://derek:pass@localhost:4222 +// Comma separated arrays are also supported, e.g. urlA, urlB. +// Options start with the defaults but can be overridden. +func Connect(url string, options ...Option) (*Conn, error) { + opts := GetDefaultOptions() + opts.Servers = processUrlString(url) + for _, opt := range options { + if err := opt(&opts); err != nil { + return nil, err + } + } + return opts.Connect() +} + +// Options that can be passed to Connect. + +// Name is an Option to set the client name. +func Name(name string) Option { + return func(o *Options) error { + o.Name = name + return nil + } +} + +// Secure is an Option to enable TLS secure connections that skip server verification by default. +// Pass a TLS Configuration for proper TLS. +func Secure(tls ...*tls.Config) Option { + return func(o *Options) error { + o.Secure = true + // Use of variadic just simplifies testing scenarios. We only take the first one. + // fixme(DLC) - Could panic if more than one. Could also do TLS option. + if len(tls) > 1 { + return ErrMultipleTLSConfigs + } + if len(tls) == 1 { + o.TLSConfig = tls[0] + } + return nil + } +} + +// RootCAs is a helper option to provide the RootCAs pool from a list of filenames. If Secure is +// not already set this will set it as well. +func RootCAs(file ...string) Option { + return func(o *Options) error { + pool := x509.NewCertPool() + for _, f := range file { + rootPEM, err := ioutil.ReadFile(f) + if err != nil || rootPEM == nil { + return fmt.Errorf("nats: error loading or parsing rootCA file: %v", err) + } + ok := pool.AppendCertsFromPEM([]byte(rootPEM)) + if !ok { + return fmt.Errorf("nats: failed to parse root certificate from %q", f) + } + } + if o.TLSConfig == nil { + o.TLSConfig = &tls.Config{MinVersion: tls.VersionTLS12} + } + o.TLSConfig.RootCAs = pool + o.Secure = true + return nil + } +} + +// ClientCert is a helper option to provide the client certificate from a file. If Secure is +// not already set this will set it as well +func ClientCert(certFile, keyFile string) Option { + return func(o *Options) error { + cert, err := tls.LoadX509KeyPair(certFile, keyFile) + if err != nil { + return fmt.Errorf("nats: error loading client certificate: %v", err) + } + cert.Leaf, err = x509.ParseCertificate(cert.Certificate[0]) + if err != nil { + return fmt.Errorf("nats: error parsing client certificate: %v", err) + } + if o.TLSConfig == nil { + o.TLSConfig = &tls.Config{MinVersion: tls.VersionTLS12} + } + o.TLSConfig.Certificates = []tls.Certificate{cert} + o.Secure = true + return nil + } +} + +// NoReconnect is an Option to turn off reconnect behavior. +func NoReconnect() Option { + return func(o *Options) error { + o.AllowReconnect = false + return nil + } +} + +// DontRandomize is an Option to turn off randomizing the server pool. +func DontRandomize() Option { + return func(o *Options) error { + o.NoRandomize = true + return nil + } +} + +// ReconnectWait is an Option to set the wait time between reconnect attempts. +func ReconnectWait(t time.Duration) Option { + return func(o *Options) error { + o.ReconnectWait = t + return nil + } +} + +// MaxReconnects is an Option to set the maximum number of reconnect attempts. +func MaxReconnects(max int) Option { + return func(o *Options) error { + o.MaxReconnect = max + return nil + } +} + +// Timeout is an Option to set the timeout for Dial on a connection. +func Timeout(t time.Duration) Option { + return func(o *Options) error { + o.Timeout = t + return nil + } +} + +// DisconnectHandler is an Option to set the disconnected handler. +func DisconnectHandler(cb ConnHandler) Option { + return func(o *Options) error { + o.DisconnectedCB = cb + return nil + } +} + +// ReconnectHandler is an Option to set the reconnected handler. +func ReconnectHandler(cb ConnHandler) Option { + return func(o *Options) error { + o.ReconnectedCB = cb + return nil + } +} + +// ClosedHandler is an Option to set the closed handler. +func ClosedHandler(cb ConnHandler) Option { + return func(o *Options) error { + o.ClosedCB = cb + return nil + } +} + +// DiscoveredServersHandler is an Option to set the new servers handler. +func DiscoveredServersHandler(cb ConnHandler) Option { + return func(o *Options) error { + o.DiscoveredServersCB = cb + return nil + } +} + +// ErrHandler is an Option to set the async error handler. +func ErrorHandler(cb ErrHandler) Option { + return func(o *Options) error { + o.AsyncErrorCB = cb + return nil + } +} + +// UserInfo is an Option to set the username and password to +// use when not included directly in the URLs. +func UserInfo(user, password string) Option { + return func(o *Options) error { + o.User = user + o.Password = password + return nil + } +} + +// Token is an Option to set the token to use when not included +// directly in the URLs. +func Token(token string) Option { + return func(o *Options) error { + o.Token = token + return nil + } +} + +// Dialer is an Option to set the dialer which will be used when +// attempting to establish a connection. +func Dialer(dialer *net.Dialer) Option { + return func(o *Options) error { + o.Dialer = dialer + return nil + } +} + +// UseOldRequestyStyle is an Option to force usage of the old Request style. +func UseOldRequestStyle() Option { + return func(o *Options) error { + o.UseOldRequestStyle = true + return nil + } +} + +// Handler processing + +// SetDisconnectHandler will set the disconnect event handler. +func (nc *Conn) SetDisconnectHandler(dcb ConnHandler) { + if nc == nil { + return + } + nc.mu.Lock() + defer nc.mu.Unlock() + nc.Opts.DisconnectedCB = dcb +} + +// SetReconnectHandler will set the reconnect event handler. +func (nc *Conn) SetReconnectHandler(rcb ConnHandler) { + if nc == nil { + return + } + nc.mu.Lock() + defer nc.mu.Unlock() + nc.Opts.ReconnectedCB = rcb +} + +// SetDiscoveredServersHandler will set the discovered servers handler. +func (nc *Conn) SetDiscoveredServersHandler(dscb ConnHandler) { + if nc == nil { + return + } + nc.mu.Lock() + defer nc.mu.Unlock() + nc.Opts.DiscoveredServersCB = dscb +} + +// SetClosedHandler will set the reconnect event handler. +func (nc *Conn) SetClosedHandler(cb ConnHandler) { + if nc == nil { + return + } + nc.mu.Lock() + defer nc.mu.Unlock() + nc.Opts.ClosedCB = cb +} + +// SetErrHandler will set the async error handler. +func (nc *Conn) SetErrorHandler(cb ErrHandler) { + if nc == nil { + return + } + nc.mu.Lock() + defer nc.mu.Unlock() + nc.Opts.AsyncErrorCB = cb +} + +// Process the url string argument to Connect. Return an array of +// urls, even if only one. +func processUrlString(url string) []string { + urls := strings.Split(url, ",") + for i, s := range urls { + urls[i] = strings.TrimSpace(s) + } + return urls +} + +// Connect will attempt to connect to a NATS server with multiple options. +func (o Options) Connect() (*Conn, error) { + nc := &Conn{Opts: o} + + // Some default options processing. + if nc.Opts.MaxPingsOut == 0 { + nc.Opts.MaxPingsOut = DefaultMaxPingOut + } + // Allow old default for channel length to work correctly. + if nc.Opts.SubChanLen == 0 { + nc.Opts.SubChanLen = DefaultMaxChanLen + } + // Default ReconnectBufSize + if nc.Opts.ReconnectBufSize == 0 { + nc.Opts.ReconnectBufSize = DefaultReconnectBufSize + } + // Ensure that Timeout is not 0 + if nc.Opts.Timeout == 0 { + nc.Opts.Timeout = DefaultTimeout + } + + // Allow custom Dialer for connecting using DialTimeout by default + if nc.Opts.Dialer == nil { + nc.Opts.Dialer = &net.Dialer{ + Timeout: nc.Opts.Timeout, + } + } + + if err := nc.setupServerPool(); err != nil { + return nil, err + } + + // Create the async callback channel. + nc.ach = make(chan asyncCB, asyncCBChanSize) + + if err := nc.connect(); err != nil { + return nil, err + } + + // Spin up the async cb dispatcher on success + go nc.asyncDispatch() + + return nc, nil +} + +const ( + _CRLF_ = "\r\n" + _EMPTY_ = "" + _SPC_ = " " + _PUB_P_ = "PUB " +) + +const ( + _OK_OP_ = "+OK" + _ERR_OP_ = "-ERR" + _PONG_OP_ = "PONG" + _INFO_OP_ = "INFO" +) + +const ( + conProto = "CONNECT %s" + _CRLF_ + pingProto = "PING" + _CRLF_ + pongProto = "PONG" + _CRLF_ + subProto = "SUB %s %s %d" + _CRLF_ + unsubProto = "UNSUB %d %s" + _CRLF_ + okProto = _OK_OP_ + _CRLF_ +) + +// Return the currently selected server +func (nc *Conn) currentServer() (int, *srv) { + for i, s := range nc.srvPool { + if s == nil { + continue + } + if s.url == nc.url { + return i, s + } + } + return -1, nil +} + +// Pop the current server and put onto the end of the list. Select head of list as long +// as number of reconnect attempts under MaxReconnect. +func (nc *Conn) selectNextServer() (*srv, error) { + i, s := nc.currentServer() + if i < 0 { + return nil, ErrNoServers + } + sp := nc.srvPool + num := len(sp) + copy(sp[i:num-1], sp[i+1:num]) + maxReconnect := nc.Opts.MaxReconnect + if maxReconnect < 0 || s.reconnects < maxReconnect { + nc.srvPool[num-1] = s + } else { + nc.srvPool = sp[0 : num-1] + } + if len(nc.srvPool) <= 0 { + nc.url = nil + return nil, ErrNoServers + } + nc.url = nc.srvPool[0].url + return nc.srvPool[0], nil +} + +// Will assign the correct server to the nc.Url +func (nc *Conn) pickServer() error { + nc.url = nil + if len(nc.srvPool) <= 0 { + return ErrNoServers + } + for _, s := range nc.srvPool { + if s != nil { + nc.url = s.url + return nil + } + } + return ErrNoServers +} + +const tlsScheme = "tls" + +// Create the server pool using the options given. +// We will place a Url option first, followed by any +// Server Options. We will randomize the server pool unlesss +// the NoRandomize flag is set. +func (nc *Conn) setupServerPool() error { + nc.srvPool = make([]*srv, 0, srvPoolSize) + nc.urls = make(map[string]struct{}, srvPoolSize) + + // Create srv objects from each url string in nc.Opts.Servers + // and add them to the pool + for _, urlString := range nc.Opts.Servers { + if err := nc.addURLToPool(urlString, false); err != nil { + return err + } + } + + // Randomize if allowed to + if !nc.Opts.NoRandomize { + nc.shufflePool() + } + + // Normally, if this one is set, Options.Servers should not be, + // but we always allowed that, so continue to do so. + if nc.Opts.Url != _EMPTY_ { + // Add to the end of the array + if err := nc.addURLToPool(nc.Opts.Url, false); err != nil { + return err + } + // Then swap it with first to guarantee that Options.Url is tried first. + last := len(nc.srvPool) - 1 + if last > 0 { + nc.srvPool[0], nc.srvPool[last] = nc.srvPool[last], nc.srvPool[0] + } + } else if len(nc.srvPool) <= 0 { + // Place default URL if pool is empty. + if err := nc.addURLToPool(DefaultURL, false); err != nil { + return err + } + } + + // Check for Scheme hint to move to TLS mode. + for _, srv := range nc.srvPool { + if srv.url.Scheme == tlsScheme { + // FIXME(dlc), this is for all in the pool, should be case by case. + nc.Opts.Secure = true + if nc.Opts.TLSConfig == nil { + nc.Opts.TLSConfig = &tls.Config{MinVersion: tls.VersionTLS12} + } + } + } + + return nc.pickServer() +} + +// addURLToPool adds an entry to the server pool +func (nc *Conn) addURLToPool(sURL string, implicit bool) error { + u, err := url.Parse(sURL) + if err != nil { + return err + } + s := &srv{url: u, isImplicit: implicit} + nc.srvPool = append(nc.srvPool, s) + nc.urls[u.Host] = struct{}{} + return nil +} + +// shufflePool swaps randomly elements in the server pool +func (nc *Conn) shufflePool() { + if len(nc.srvPool) <= 1 { + return + } + source := rand.NewSource(time.Now().UnixNano()) + r := rand.New(source) + for i := range nc.srvPool { + j := r.Intn(i + 1) + nc.srvPool[i], nc.srvPool[j] = nc.srvPool[j], nc.srvPool[i] + } +} + +// createConn will connect to the server and wrap the appropriate +// bufio structures. It will do the right thing when an existing +// connection is in place. +func (nc *Conn) createConn() (err error) { + if nc.Opts.Timeout < 0 { + return ErrBadTimeout + } + if _, cur := nc.currentServer(); cur == nil { + return ErrNoServers + } else { + cur.lastAttempt = time.Now() + } + + dialer := nc.Opts.Dialer + nc.conn, err = dialer.Dial("tcp", nc.url.Host) + if err != nil { + return err + } + + // No clue why, but this stalls and kills performance on Mac (Mavericks). + // https://code.google.com/p/go/issues/detail?id=6930 + //if ip, ok := nc.conn.(*net.TCPConn); ok { + // ip.SetReadBuffer(defaultBufSize) + //} + + if nc.pending != nil && nc.bw != nil { + // Move to pending buffer. + nc.bw.Flush() + } + nc.bw = bufio.NewWriterSize(nc.conn, defaultBufSize) + return nil +} + +// makeTLSConn will wrap an existing Conn using TLS +func (nc *Conn) makeTLSConn() { + // Allow the user to configure their own tls.Config structure, otherwise + // default to InsecureSkipVerify. + // TODO(dlc) - We should make the more secure version the default. + if nc.Opts.TLSConfig != nil { + tlsCopy := util.CloneTLSConfig(nc.Opts.TLSConfig) + // If its blank we will override it with the current host + if tlsCopy.ServerName == _EMPTY_ { + h, _, _ := net.SplitHostPort(nc.url.Host) + tlsCopy.ServerName = h + } + nc.conn = tls.Client(nc.conn, tlsCopy) + } else { + nc.conn = tls.Client(nc.conn, &tls.Config{InsecureSkipVerify: true}) + } + conn := nc.conn.(*tls.Conn) + conn.Handshake() + nc.bw = bufio.NewWriterSize(nc.conn, defaultBufSize) +} + +// waitForExits will wait for all socket watcher Go routines to +// be shutdown before proceeding. +func (nc *Conn) waitForExits(wg *sync.WaitGroup) { + // Kick old flusher forcefully. + select { + case nc.fch <- struct{}{}: + default: + } + + // Wait for any previous go routines. + if wg != nil { + wg.Wait() + } +} + +// spinUpGoRoutines will launch the Go routines responsible for +// reading and writing to the socket. This will be launched via a +// go routine itself to release any locks that may be held. +// We also use a WaitGroup to make sure we only start them on a +// reconnect when the previous ones have exited. +func (nc *Conn) spinUpGoRoutines() { + // Make sure everything has exited. + nc.waitForExits(nc.wg) + + // Create a new waitGroup instance for this run. + nc.wg = &sync.WaitGroup{} + // We will wait on both. + nc.wg.Add(2) + + // Spin up the readLoop and the socket flusher. + go nc.readLoop(nc.wg) + go nc.flusher(nc.wg) + + nc.mu.Lock() + if nc.Opts.PingInterval > 0 { + if nc.ptmr == nil { + nc.ptmr = time.AfterFunc(nc.Opts.PingInterval, nc.processPingTimer) + } else { + nc.ptmr.Reset(nc.Opts.PingInterval) + } + } + nc.mu.Unlock() +} + +// Report the connected server's Url +func (nc *Conn) ConnectedUrl() string { + if nc == nil { + return _EMPTY_ + } + nc.mu.Lock() + defer nc.mu.Unlock() + if nc.status != CONNECTED { + return _EMPTY_ + } + return nc.url.String() +} + +// Report the connected server's Id +func (nc *Conn) ConnectedServerId() string { + if nc == nil { + return _EMPTY_ + } + nc.mu.Lock() + defer nc.mu.Unlock() + if nc.status != CONNECTED { + return _EMPTY_ + } + return nc.info.Id +} + +// Low level setup for structs, etc +func (nc *Conn) setup() { + nc.subs = make(map[int64]*Subscription) + nc.pongs = make([]chan struct{}, 0, 8) + + nc.fch = make(chan struct{}, flushChanSize) + + // Setup scratch outbound buffer for PUB + pub := nc.scratch[:len(_PUB_P_)] + copy(pub, _PUB_P_) +} + +// Process a connected connection and initialize properly. +func (nc *Conn) processConnectInit() error { + + // Set out deadline for the whole connect process + nc.conn.SetDeadline(time.Now().Add(nc.Opts.Timeout)) + defer nc.conn.SetDeadline(time.Time{}) + + // Set our status to connecting. + nc.status = CONNECTING + + // Process the INFO protocol received from the server + err := nc.processExpectedInfo() + if err != nil { + return err + } + + // Send the CONNECT protocol along with the initial PING protocol. + // Wait for the PONG response (or any error that we get from the server). + err = nc.sendConnect() + if err != nil { + return err + } + + // Reset the number of PING sent out + nc.pout = 0 + + go nc.spinUpGoRoutines() + + return nil +} + +// Main connect function. Will connect to the nats-server +func (nc *Conn) connect() error { + var returnedErr error + + // Create actual socket connection + // For first connect we walk all servers in the pool and try + // to connect immediately. + nc.mu.Lock() + nc.initc = true + // The pool may change inside theloop iteration due to INFO protocol. + for i := 0; i < len(nc.srvPool); i++ { + nc.url = nc.srvPool[i].url + + if err := nc.createConn(); err == nil { + // This was moved out of processConnectInit() because + // that function is now invoked from doReconnect() too. + nc.setup() + + err = nc.processConnectInit() + + if err == nil { + nc.srvPool[i].didConnect = true + nc.srvPool[i].reconnects = 0 + returnedErr = nil + break + } else { + returnedErr = err + nc.mu.Unlock() + nc.close(DISCONNECTED, false) + nc.mu.Lock() + nc.url = nil + } + } else { + // Cancel out default connection refused, will trigger the + // No servers error conditional + if matched, _ := regexp.Match(`connection refused`, []byte(err.Error())); matched { + returnedErr = nil + } + } + } + nc.initc = false + defer nc.mu.Unlock() + + if returnedErr == nil && nc.status != CONNECTED { + returnedErr = ErrNoServers + } + return returnedErr +} + +// This will check to see if the connection should be +// secure. This can be dictated from either end and should +// only be called after the INIT protocol has been received. +func (nc *Conn) checkForSecure() error { + // Check to see if we need to engage TLS + o := nc.Opts + + // Check for mismatch in setups + if o.Secure && !nc.info.TLSRequired { + return ErrSecureConnWanted + } else if nc.info.TLSRequired && !o.Secure { + return ErrSecureConnRequired + } + + // Need to rewrap with bufio + if o.Secure { + nc.makeTLSConn() + } + return nil +} + +// processExpectedInfo will look for the expected first INFO message +// sent when a connection is established. The lock should be held entering. +func (nc *Conn) processExpectedInfo() error { + + c := &control{} + + // Read the protocol + err := nc.readOp(c) + if err != nil { + return err + } + + // The nats protocol should send INFO first always. + if c.op != _INFO_OP_ { + return ErrNoInfoReceived + } + + // Parse the protocol + if err := nc.processInfo(c.args); err != nil { + return err + } + + return nc.checkForSecure() +} + +// Sends a protocol control message by queuing into the bufio writer +// and kicking the flush Go routine. These writes are protected. +func (nc *Conn) sendProto(proto string) { + nc.mu.Lock() + nc.bw.WriteString(proto) + nc.kickFlusher() + nc.mu.Unlock() +} + +// Generate a connect protocol message, issuing user/password if +// applicable. The lock is assumed to be held upon entering. +func (nc *Conn) connectProto() (string, error) { + o := nc.Opts + var user, pass, token string + u := nc.url.User + if u != nil { + // if no password, assume username is authToken + if _, ok := u.Password(); !ok { + token = u.Username() + } else { + user = u.Username() + pass, _ = u.Password() + } + } else { + // Take from options (pssibly all empty strings) + user = nc.Opts.User + pass = nc.Opts.Password + token = nc.Opts.Token + } + cinfo := connectInfo{o.Verbose, o.Pedantic, + user, pass, token, + o.Secure, o.Name, LangString, Version, clientProtoInfo} + b, err := json.Marshal(cinfo) + if err != nil { + return _EMPTY_, ErrJsonParse + } + return fmt.Sprintf(conProto, b), nil +} + +// normalizeErr removes the prefix -ERR, trim spaces and remove the quotes. +func normalizeErr(line string) string { + s := strings.ToLower(strings.TrimSpace(strings.TrimPrefix(line, _ERR_OP_))) + s = strings.TrimLeft(strings.TrimRight(s, "'"), "'") + return s +} + +// Send a connect protocol message to the server, issue user/password if +// applicable. Will wait for a flush to return from the server for error +// processing. +func (nc *Conn) sendConnect() error { + + // Construct the CONNECT protocol string + cProto, err := nc.connectProto() + if err != nil { + return err + } + + // Write the protocol into the buffer + _, err = nc.bw.WriteString(cProto) + if err != nil { + return err + } + + // Add to the buffer the PING protocol + _, err = nc.bw.WriteString(pingProto) + if err != nil { + return err + } + + // Flush the buffer + err = nc.bw.Flush() + if err != nil { + return err + } + + // Now read the response from the server. + br := bufio.NewReaderSize(nc.conn, defaultBufSize) + line, err := br.ReadString('\n') + if err != nil { + return err + } + + // If opts.Verbose is set, handle +OK + if nc.Opts.Verbose && line == okProto { + // Read the rest now... + line, err = br.ReadString('\n') + if err != nil { + return err + } + } + + // We expect a PONG + if line != pongProto { + // But it could be something else, like -ERR + + // Since we no longer use ReadLine(), trim the trailing "\r\n" + line = strings.TrimRight(line, "\r\n") + + // If it's a server error... + if strings.HasPrefix(line, _ERR_OP_) { + // Remove -ERR, trim spaces and quotes, and convert to lower case. + line = normalizeErr(line) + return errors.New("nats: " + line) + } + + // Notify that we got an unexpected protocol. + return fmt.Errorf("nats: expected '%s', got '%s'", _PONG_OP_, line) + } + + // This is where we are truly connected. + nc.status = CONNECTED + + return nil +} + +// A control protocol line. +type control struct { + op, args string +} + +// Read a control line and process the intended op. +func (nc *Conn) readOp(c *control) error { + br := bufio.NewReaderSize(nc.conn, defaultBufSize) + line, err := br.ReadString('\n') + if err != nil { + return err + } + parseControl(line, c) + return nil +} + +// Parse a control line from the server. +func parseControl(line string, c *control) { + toks := strings.SplitN(line, _SPC_, 2) + if len(toks) == 1 { + c.op = strings.TrimSpace(toks[0]) + c.args = _EMPTY_ + } else if len(toks) == 2 { + c.op, c.args = strings.TrimSpace(toks[0]), strings.TrimSpace(toks[1]) + } else { + c.op = _EMPTY_ + } +} + +// flushReconnectPending will push the pending items that were +// gathered while we were in a RECONNECTING state to the socket. +func (nc *Conn) flushReconnectPendingItems() { + if nc.pending == nil { + return + } + if nc.pending.Len() > 0 { + nc.bw.Write(nc.pending.Bytes()) + } +} + +// Try to reconnect using the option parameters. +// This function assumes we are allowed to reconnect. +func (nc *Conn) doReconnect() { + // We want to make sure we have the other watchers shutdown properly + // here before we proceed past this point. + nc.mu.Lock() + wg := nc.wg + nc.mu.Unlock() + nc.waitForExits(wg) + + // FIXME(dlc) - We have an issue here if we have + // outstanding flush points (pongs) and they were not + // sent out, but are still in the pipe. + + // Hold the lock manually and release where needed below, + // can't do defer here. + nc.mu.Lock() + + // Clear any queued pongs, e.g. pending flush calls. + nc.clearPendingFlushCalls() + + // Clear any errors. + nc.err = nil + + // Perform appropriate callback if needed for a disconnect. + if nc.Opts.DisconnectedCB != nil { + nc.ach <- func() { nc.Opts.DisconnectedCB(nc) } + } + + for len(nc.srvPool) > 0 { + cur, err := nc.selectNextServer() + if err != nil { + nc.err = err + break + } + + sleepTime := int64(0) + + // Sleep appropriate amount of time before the + // connection attempt if connecting to same server + // we just got disconnected from.. + if time.Since(cur.lastAttempt) < nc.Opts.ReconnectWait { + sleepTime = int64(nc.Opts.ReconnectWait - time.Since(cur.lastAttempt)) + } + + // On Windows, createConn() will take more than a second when no + // server is running at that address. So it could be that the + // time elapsed between reconnect attempts is always > than + // the set option. Release the lock to give a chance to a parallel + // nc.Close() to break the loop. + nc.mu.Unlock() + if sleepTime <= 0 { + runtime.Gosched() + } else { + time.Sleep(time.Duration(sleepTime)) + } + nc.mu.Lock() + + // Check if we have been closed first. + if nc.isClosed() { + break + } + + // Mark that we tried a reconnect + cur.reconnects++ + + // Try to create a new connection + err = nc.createConn() + + // Not yet connected, retry... + // Continue to hold the lock + if err != nil { + nc.err = nil + continue + } + + // We are reconnected + nc.Reconnects++ + + // Process connect logic + if nc.err = nc.processConnectInit(); nc.err != nil { + nc.status = RECONNECTING + continue + } + + // Clear out server stats for the server we connected to.. + cur.didConnect = true + cur.reconnects = 0 + + // Send existing subscription state + nc.resendSubscriptions() + + // Now send off and clear pending buffer + nc.flushReconnectPendingItems() + + // Flush the buffer + nc.err = nc.bw.Flush() + if nc.err != nil { + nc.status = RECONNECTING + continue + } + + // Done with the pending buffer + nc.pending = nil + + // This is where we are truly connected. + nc.status = CONNECTED + + // Queue up the reconnect callback. + if nc.Opts.ReconnectedCB != nil { + nc.ach <- func() { nc.Opts.ReconnectedCB(nc) } + } + + // Release lock here, we will return below. + nc.mu.Unlock() + + // Make sure to flush everything + nc.Flush() + + return + } + + // Call into close.. We have no servers left.. + if nc.err == nil { + nc.err = ErrNoServers + } + nc.mu.Unlock() + nc.Close() +} + +// processOpErr handles errors from reading or parsing the protocol. +// The lock should not be held entering this function. +func (nc *Conn) processOpErr(err error) { + nc.mu.Lock() + if nc.isConnecting() || nc.isClosed() || nc.isReconnecting() { + nc.mu.Unlock() + return + } + + if nc.Opts.AllowReconnect && nc.status == CONNECTED { + // Set our new status + nc.status = RECONNECTING + if nc.ptmr != nil { + nc.ptmr.Stop() + } + if nc.conn != nil { + nc.bw.Flush() + nc.conn.Close() + nc.conn = nil + } + + // Create a new pending buffer to underpin the bufio Writer while + // we are reconnecting. + nc.pending = &bytes.Buffer{} + nc.bw = bufio.NewWriterSize(nc.pending, nc.Opts.ReconnectBufSize) + + go nc.doReconnect() + nc.mu.Unlock() + return + } + + nc.status = DISCONNECTED + nc.err = err + nc.mu.Unlock() + nc.Close() +} + +// Marker to close the channel to kick out the Go routine. +func (nc *Conn) closeAsyncFunc() asyncCB { + return func() { + nc.mu.Lock() + if nc.ach != nil { + close(nc.ach) + nc.ach = nil + } + nc.mu.Unlock() + } +} + +// asyncDispatch is responsible for calling any async callbacks +func (nc *Conn) asyncDispatch() { + // snapshot since they can change from underneath of us. + nc.mu.Lock() + ach := nc.ach + nc.mu.Unlock() + + // Loop on the channel and process async callbacks. + for { + if f, ok := <-ach; !ok { + return + } else { + f() + } + } +} + +// readLoop() will sit on the socket reading and processing the +// protocol from the server. It will dispatch appropriately based +// on the op type. +func (nc *Conn) readLoop(wg *sync.WaitGroup) { + // Release the wait group on exit + defer wg.Done() + + // Create a parseState if needed. + nc.mu.Lock() + if nc.ps == nil { + nc.ps = &parseState{} + } + nc.mu.Unlock() + + // Stack based buffer. + b := make([]byte, defaultBufSize) + + for { + // FIXME(dlc): RWLock here? + nc.mu.Lock() + sb := nc.isClosed() || nc.isReconnecting() + if sb { + nc.ps = &parseState{} + } + conn := nc.conn + nc.mu.Unlock() + + if sb || conn == nil { + break + } + + n, err := conn.Read(b) + if err != nil { + nc.processOpErr(err) + break + } + + if err := nc.parse(b[:n]); err != nil { + nc.processOpErr(err) + break + } + } + // Clear the parseState here.. + nc.mu.Lock() + nc.ps = nil + nc.mu.Unlock() +} + +// waitForMsgs waits on the conditional shared with readLoop and processMsg. +// It is used to deliver messages to asynchronous subscribers. +func (nc *Conn) waitForMsgs(s *Subscription) { + var closed bool + var delivered, max uint64 + + for { + s.mu.Lock() + if s.pHead == nil && !s.closed { + s.pCond.Wait() + } + // Pop the msg off the list + m := s.pHead + if m != nil { + s.pHead = m.next + if s.pHead == nil { + s.pTail = nil + } + s.pMsgs-- + s.pBytes -= len(m.Data) + } + mcb := s.mcb + max = s.max + closed = s.closed + if !s.closed { + s.delivered++ + delivered = s.delivered + } + s.mu.Unlock() + + if closed { + break + } + + // Deliver the message. + if m != nil && (max == 0 || delivered <= max) { + mcb(m) + } + // If we have hit the max for delivered msgs, remove sub. + if max > 0 && delivered >= max { + nc.mu.Lock() + nc.removeSub(s) + nc.mu.Unlock() + break + } + } +} + +// processMsg is called by parse and will place the msg on the +// appropriate channel/pending queue for processing. If the channel is full, +// or the pending queue is over the pending limits, the connection is +// considered a slow consumer. +func (nc *Conn) processMsg(data []byte) { + // Don't lock the connection to avoid server cutting us off if the + // flusher is holding the connection lock, trying to send to the server + // that is itself trying to send data to us. + nc.subsMu.RLock() + + // Stats + nc.InMsgs++ + nc.InBytes += uint64(len(data)) + + sub := nc.subs[nc.ps.ma.sid] + if sub == nil { + nc.subsMu.RUnlock() + return + } + + // Copy them into string + subj := string(nc.ps.ma.subject) + reply := string(nc.ps.ma.reply) + + // Doing message create outside of the sub's lock to reduce contention. + // It's possible that we end-up not using the message, but that's ok. + + // FIXME(dlc): Need to copy, should/can do COW? + msgPayload := make([]byte, len(data)) + copy(msgPayload, data) + + // FIXME(dlc): Should we recycle these containers? + m := &Msg{Data: msgPayload, Subject: subj, Reply: reply, Sub: sub} + + sub.mu.Lock() + + // Subscription internal stats (applicable only for non ChanSubscription's) + if sub.typ != ChanSubscription { + sub.pMsgs++ + if sub.pMsgs > sub.pMsgsMax { + sub.pMsgsMax = sub.pMsgs + } + sub.pBytes += len(m.Data) + if sub.pBytes > sub.pBytesMax { + sub.pBytesMax = sub.pBytes + } + + // Check for a Slow Consumer + if (sub.pMsgsLimit > 0 && sub.pMsgs > sub.pMsgsLimit) || + (sub.pBytesLimit > 0 && sub.pBytes > sub.pBytesLimit) { + goto slowConsumer + } + } + + // We have two modes of delivery. One is the channel, used by channel + // subscribers and syncSubscribers, the other is a linked list for async. + if sub.mch != nil { + select { + case sub.mch <- m: + default: + goto slowConsumer + } + } else { + // Push onto the async pList + if sub.pHead == nil { + sub.pHead = m + sub.pTail = m + sub.pCond.Signal() + } else { + sub.pTail.next = m + sub.pTail = m + } + } + + // Clear SlowConsumer status. + sub.sc = false + + sub.mu.Unlock() + nc.subsMu.RUnlock() + return + +slowConsumer: + sub.dropped++ + sc := !sub.sc + sub.sc = true + // Undo stats from above + if sub.typ != ChanSubscription { + sub.pMsgs-- + sub.pBytes -= len(m.Data) + } + sub.mu.Unlock() + nc.subsMu.RUnlock() + if sc { + // Now we need connection's lock and we may end-up in the situation + // that we were trying to avoid, except that in this case, the client + // is already experiencing client-side slow consumer situation. + nc.mu.Lock() + nc.err = ErrSlowConsumer + if nc.Opts.AsyncErrorCB != nil { + nc.ach <- func() { nc.Opts.AsyncErrorCB(nc, sub, ErrSlowConsumer) } + } + nc.mu.Unlock() + } +} + +// processPermissionsViolation is called when the server signals a subject +// permissions violation on either publish or subscribe. +func (nc *Conn) processPermissionsViolation(err string) { + nc.mu.Lock() + nc.err = errors.New("nats: " + err) + if nc.Opts.AsyncErrorCB != nil { + nc.ach <- func() { nc.Opts.AsyncErrorCB(nc, nil, nc.err) } + } + nc.mu.Unlock() +} + +// processAuthorizationViolation is called when the server signals a user +// authorization violation. +func (nc *Conn) processAuthorizationViolation(err string) { + nc.mu.Lock() + nc.err = ErrAuthorization + if nc.Opts.AsyncErrorCB != nil { + nc.ach <- func() { nc.Opts.AsyncErrorCB(nc, nil, ErrAuthorization) } + } + nc.mu.Unlock() +} + +// flusher is a separate Go routine that will process flush requests for the write +// bufio. This allows coalescing of writes to the underlying socket. +func (nc *Conn) flusher(wg *sync.WaitGroup) { + // Release the wait group + defer wg.Done() + + // snapshot the bw and conn since they can change from underneath of us. + nc.mu.Lock() + bw := nc.bw + conn := nc.conn + fch := nc.fch + flusherTimeout := nc.Opts.FlusherTimeout + nc.mu.Unlock() + + if conn == nil || bw == nil { + return + } + + for { + if _, ok := <-fch; !ok { + return + } + nc.mu.Lock() + + // Check to see if we should bail out. + if !nc.isConnected() || nc.isConnecting() || bw != nc.bw || conn != nc.conn { + nc.mu.Unlock() + return + } + if bw.Buffered() > 0 { + // Allow customizing how long we should wait for a flush to be done + // to prevent unhealthy connections blocking the client for too long. + if flusherTimeout > 0 { + conn.SetWriteDeadline(time.Now().Add(flusherTimeout)) + } + + if err := bw.Flush(); err != nil { + if nc.err == nil { + nc.err = err + } + } + conn.SetWriteDeadline(time.Time{}) + } + nc.mu.Unlock() + } +} + +// processPing will send an immediate pong protocol response to the +// server. The server uses this mechanism to detect dead clients. +func (nc *Conn) processPing() { + nc.sendProto(pongProto) +} + +// processPong is used to process responses to the client's ping +// messages. We use pings for the flush mechanism as well. +func (nc *Conn) processPong() { + var ch chan struct{} + + nc.mu.Lock() + if len(nc.pongs) > 0 { + ch = nc.pongs[0] + nc.pongs = nc.pongs[1:] + } + nc.pout = 0 + nc.mu.Unlock() + if ch != nil { + ch <- struct{}{} + } +} + +// processOK is a placeholder for processing OK messages. +func (nc *Conn) processOK() { + // do nothing +} + +// processInfo is used to parse the info messages sent +// from the server. +// This function may update the server pool. +func (nc *Conn) processInfo(info string) error { + if info == _EMPTY_ { + return nil + } + if err := json.Unmarshal([]byte(info), &nc.info); err != nil { + return err + } + urls := nc.info.ConnectURLs + if len(urls) > 0 { + added := false + // If randomization is allowed, shuffle the received array, not the + // entire pool. We want to preserve the pool's order up to this point + // (this would otherwise be problematic for the (re)connect loop). + if !nc.Opts.NoRandomize { + for i := range urls { + j := rand.Intn(i + 1) + urls[i], urls[j] = urls[j], urls[i] + } + } + for _, curl := range urls { + if _, present := nc.urls[curl]; !present { + if err := nc.addURLToPool(fmt.Sprintf("nats://%s", curl), true); err != nil { + continue + } + added = true + } + } + if added && !nc.initc && nc.Opts.DiscoveredServersCB != nil { + nc.ach <- func() { nc.Opts.DiscoveredServersCB(nc) } + } + } + return nil +} + +// processAsyncInfo does the same than processInfo, but is called +// from the parser. Calls processInfo under connection's lock +// protection. +func (nc *Conn) processAsyncInfo(info []byte) { + nc.mu.Lock() + // Ignore errors, we will simply not update the server pool... + nc.processInfo(string(info)) + nc.mu.Unlock() +} + +// LastError reports the last error encountered via the connection. +// It can be used reliably within ClosedCB in order to find out reason +// why connection was closed for example. +func (nc *Conn) LastError() error { + if nc == nil { + return ErrInvalidConnection + } + nc.mu.Lock() + err := nc.err + nc.mu.Unlock() + return err +} + +// processErr processes any error messages from the server and +// sets the connection's lastError. +func (nc *Conn) processErr(e string) { + // Trim, remove quotes, convert to lower case. + e = normalizeErr(e) + + // FIXME(dlc) - process Slow Consumer signals special. + if e == STALE_CONNECTION { + nc.processOpErr(ErrStaleConnection) + } else if strings.HasPrefix(e, PERMISSIONS_ERR) { + nc.processPermissionsViolation(e) + } else if strings.HasPrefix(e, AUTHORIZATION_ERR) { + nc.processAuthorizationViolation(e) + } else { + nc.mu.Lock() + nc.err = errors.New("nats: " + e) + nc.mu.Unlock() + nc.Close() + } +} + +// kickFlusher will send a bool on a channel to kick the +// flush Go routine to flush data to the server. +func (nc *Conn) kickFlusher() { + if nc.bw != nil { + select { + case nc.fch <- struct{}{}: + default: + } + } +} + +// Publish publishes the data argument to the given subject. The data +// argument is left untouched and needs to be correctly interpreted on +// the receiver. +func (nc *Conn) Publish(subj string, data []byte) error { + return nc.publish(subj, _EMPTY_, data) +} + +// PublishMsg publishes the Msg structure, which includes the +// Subject, an optional Reply and an optional Data field. +func (nc *Conn) PublishMsg(m *Msg) error { + if m == nil { + return ErrInvalidMsg + } + return nc.publish(m.Subject, m.Reply, m.Data) +} + +// PublishRequest will perform a Publish() excpecting a response on the +// reply subject. Use Request() for automatically waiting for a response +// inline. +func (nc *Conn) PublishRequest(subj, reply string, data []byte) error { + return nc.publish(subj, reply, data) +} + +// Used for handrolled itoa +const digits = "0123456789" + +// publish is the internal function to publish messages to a nats-server. +// Sends a protocol data message by queuing into the bufio writer +// and kicking the flush go routine. These writes should be protected. +func (nc *Conn) publish(subj, reply string, data []byte) error { + if nc == nil { + return ErrInvalidConnection + } + if subj == "" { + return ErrBadSubject + } + nc.mu.Lock() + + // Proactively reject payloads over the threshold set by server. + msgSize := int64(len(data)) + if msgSize > nc.info.MaxPayload { + nc.mu.Unlock() + return ErrMaxPayload + } + + if nc.isClosed() { + nc.mu.Unlock() + return ErrConnectionClosed + } + + // Check if we are reconnecting, and if so check if + // we have exceeded our reconnect outbound buffer limits. + if nc.isReconnecting() { + // Flush to underlying buffer. + nc.bw.Flush() + // Check if we are over + if nc.pending.Len() >= nc.Opts.ReconnectBufSize { + nc.mu.Unlock() + return ErrReconnectBufExceeded + } + } + + msgh := nc.scratch[:len(_PUB_P_)] + msgh = append(msgh, subj...) + msgh = append(msgh, ' ') + if reply != "" { + msgh = append(msgh, reply...) + msgh = append(msgh, ' ') + } + + // We could be smarter here, but simple loop is ok, + // just avoid strconv in fast path + // FIXME(dlc) - Find a better way here. + // msgh = strconv.AppendInt(msgh, int64(len(data)), 10) + + var b [12]byte + var i = len(b) + if len(data) > 0 { + for l := len(data); l > 0; l /= 10 { + i -= 1 + b[i] = digits[l%10] + } + } else { + i -= 1 + b[i] = digits[0] + } + + msgh = append(msgh, b[i:]...) + msgh = append(msgh, _CRLF_...) + + _, err := nc.bw.Write(msgh) + if err == nil { + _, err = nc.bw.Write(data) + } + if err == nil { + _, err = nc.bw.WriteString(_CRLF_) + } + if err != nil { + nc.mu.Unlock() + return err + } + + nc.OutMsgs++ + nc.OutBytes += uint64(len(data)) + + if len(nc.fch) == 0 { + nc.kickFlusher() + } + nc.mu.Unlock() + return nil +} + +// respHandler is the global response handler. It will look up +// the appropriate channel based on the last token and place +// the message on the channel if possible. +func (nc *Conn) respHandler(m *Msg) { + rt := respToken(m.Subject) + + nc.mu.Lock() + // Just return if closed. + if nc.isClosed() { + nc.mu.Unlock() + return + } + + // Grab mch + mch := nc.respMap[rt] + // Delete the key regardless, one response only. + // FIXME(dlc) - should we track responses past 1 + // just statistics wise? + delete(nc.respMap, rt) + nc.mu.Unlock() + + // Don't block, let Request timeout instead, mch is + // buffered and we should delete the key before a + // second response is processed. + select { + case mch <- m: + default: + return + } +} + +// Create the response subscription we will use for all +// new style responses. This will be on an _INBOX with an +// additional terminal token. The subscription will be on +// a wildcard. Caller is responsible for ensuring this is +// only called once. +func (nc *Conn) createRespMux(respSub string) error { + s, err := nc.Subscribe(respSub, nc.respHandler) + if err != nil { + return err + } + nc.mu.Lock() + nc.respMux = s + nc.mu.Unlock() + return nil +} + +// Request will send a request payload and deliver the response message, +// or an error, including a timeout if no message was received properly. +func (nc *Conn) Request(subj string, data []byte, timeout time.Duration) (*Msg, error) { + if nc == nil { + return nil, ErrInvalidConnection + } + + nc.mu.Lock() + // If user wants the old style. + if nc.Opts.UseOldRequestStyle { + nc.mu.Unlock() + return nc.oldRequest(subj, data, timeout) + } + + // Do setup for the new style. + if nc.respMap == nil { + // _INBOX wildcard + nc.respSub = fmt.Sprintf("%s.*", NewInbox()) + nc.respMap = make(map[string]chan *Msg) + } + // Create literal Inbox and map to a chan msg. + mch := make(chan *Msg, RequestChanLen) + respInbox := nc.newRespInbox() + token := respToken(respInbox) + nc.respMap[token] = mch + createSub := nc.respMux == nil + ginbox := nc.respSub + nc.mu.Unlock() + + if createSub { + // Make sure scoped subscription is setup only once. + var err error + nc.respSetup.Do(func() { err = nc.createRespMux(ginbox) }) + if err != nil { + return nil, err + } + } + + if err := nc.PublishRequest(subj, respInbox, data); err != nil { + return nil, err + } + + t := globalTimerPool.Get(timeout) + defer globalTimerPool.Put(t) + + var ok bool + var msg *Msg + + select { + case msg, ok = <-mch: + if !ok { + return nil, ErrConnectionClosed + } + case <-t.C: + nc.mu.Lock() + delete(nc.respMap, token) + nc.mu.Unlock() + return nil, ErrTimeout + } + + return msg, nil +} + +// oldRequest will create an Inbox and perform a Request() call +// with the Inbox reply and return the first reply received. +// This is optimized for the case of multiple responses. +func (nc *Conn) oldRequest(subj string, data []byte, timeout time.Duration) (*Msg, error) { + inbox := NewInbox() + ch := make(chan *Msg, RequestChanLen) + + s, err := nc.subscribe(inbox, _EMPTY_, nil, ch) + if err != nil { + return nil, err + } + s.AutoUnsubscribe(1) + defer s.Unsubscribe() + + err = nc.PublishRequest(subj, inbox, data) + if err != nil { + return nil, err + } + return s.NextMsg(timeout) +} + +// InboxPrefix is the prefix for all inbox subjects. +const InboxPrefix = "_INBOX." +const inboxPrefixLen = len(InboxPrefix) +const respInboxPrefixLen = inboxPrefixLen + nuidSize + 1 + +// NewInbox will return an inbox string which can be used for directed replies from +// subscribers. These are guaranteed to be unique, but can be shared and subscribed +// to by others. +func NewInbox() string { + var b [inboxPrefixLen + nuidSize]byte + pres := b[:inboxPrefixLen] + copy(pres, InboxPrefix) + ns := b[inboxPrefixLen:] + copy(ns, nuid.Next()) + return string(b[:]) +} + +// Creates a new literal response subject that will trigger +// the global subscription handler. +func (nc *Conn) newRespInbox() string { + var b [inboxPrefixLen + (2 * nuidSize) + 1]byte + pres := b[:respInboxPrefixLen] + copy(pres, nc.respSub) + ns := b[respInboxPrefixLen:] + copy(ns, nuid.Next()) + return string(b[:]) +} + +// respToken will return the last token of a literal response inbox +// which we use for the message channel lookup. +func respToken(respInbox string) string { + return respInbox[respInboxPrefixLen:] +} + +// Subscribe will express interest in the given subject. The subject +// can have wildcards (partial:*, full:>). Messages will be delivered +// to the associated MsgHandler. If no MsgHandler is given, the +// subscription is a synchronous subscription and can be polled via +// Subscription.NextMsg(). +func (nc *Conn) Subscribe(subj string, cb MsgHandler) (*Subscription, error) { + return nc.subscribe(subj, _EMPTY_, cb, nil) +} + +// ChanSubscribe will place all messages received on the channel. +// You should not close the channel until sub.Unsubscribe() has been called. +func (nc *Conn) ChanSubscribe(subj string, ch chan *Msg) (*Subscription, error) { + return nc.subscribe(subj, _EMPTY_, nil, ch) +} + +// ChanQueueSubscribe will place all messages received on the channel. +// You should not close the channel until sub.Unsubscribe() has been called. +func (nc *Conn) ChanQueueSubscribe(subj, group string, ch chan *Msg) (*Subscription, error) { + return nc.subscribe(subj, group, nil, ch) +} + +// SubscribeSync is syntactic sugar for Subscribe(subject, nil). +func (nc *Conn) SubscribeSync(subj string) (*Subscription, error) { + if nc == nil { + return nil, ErrInvalidConnection + } + mch := make(chan *Msg, nc.Opts.SubChanLen) + s, e := nc.subscribe(subj, _EMPTY_, nil, mch) + if s != nil { + s.typ = SyncSubscription + } + return s, e +} + +// QueueSubscribe creates an asynchronous queue subscriber on the given subject. +// All subscribers with the same queue name will form the queue group and +// only one member of the group will be selected to receive any given +// message asynchronously. +func (nc *Conn) QueueSubscribe(subj, queue string, cb MsgHandler) (*Subscription, error) { + return nc.subscribe(subj, queue, cb, nil) +} + +// QueueSubscribeSync creates a synchronous queue subscriber on the given +// subject. All subscribers with the same queue name will form the queue +// group and only one member of the group will be selected to receive any +// given message synchronously. +func (nc *Conn) QueueSubscribeSync(subj, queue string) (*Subscription, error) { + mch := make(chan *Msg, nc.Opts.SubChanLen) + s, e := nc.subscribe(subj, queue, nil, mch) + if s != nil { + s.typ = SyncSubscription + } + return s, e +} + +// QueueSubscribeSyncWithChan is syntactic sugar for ChanQueueSubscribe(subject, group, ch). +func (nc *Conn) QueueSubscribeSyncWithChan(subj, queue string, ch chan *Msg) (*Subscription, error) { + return nc.subscribe(subj, queue, nil, ch) +} + +// subscribe is the internal subscribe function that indicates interest in a subject. +func (nc *Conn) subscribe(subj, queue string, cb MsgHandler, ch chan *Msg) (*Subscription, error) { + if nc == nil { + return nil, ErrInvalidConnection + } + nc.mu.Lock() + // ok here, but defer is generally expensive + defer nc.mu.Unlock() + defer nc.kickFlusher() + + // Check for some error conditions. + if nc.isClosed() { + return nil, ErrConnectionClosed + } + + if cb == nil && ch == nil { + return nil, ErrBadSubscription + } + + sub := &Subscription{Subject: subj, Queue: queue, mcb: cb, conn: nc} + // Set pending limits. + sub.pMsgsLimit = DefaultSubPendingMsgsLimit + sub.pBytesLimit = DefaultSubPendingBytesLimit + + // If we have an async callback, start up a sub specific + // Go routine to deliver the messages. + if cb != nil { + sub.typ = AsyncSubscription + sub.pCond = sync.NewCond(&sub.mu) + go nc.waitForMsgs(sub) + } else { + sub.typ = ChanSubscription + sub.mch = ch + } + + nc.subsMu.Lock() + nc.ssid++ + sub.sid = nc.ssid + nc.subs[sub.sid] = sub + nc.subsMu.Unlock() + + // We will send these for all subs when we reconnect + // so that we can suppress here. + if !nc.isReconnecting() { + nc.bw.WriteString(fmt.Sprintf(subProto, subj, queue, sub.sid)) + } + return sub, nil +} + +// Lock for nc should be held here upon entry +func (nc *Conn) removeSub(s *Subscription) { + nc.subsMu.Lock() + delete(nc.subs, s.sid) + nc.subsMu.Unlock() + s.mu.Lock() + defer s.mu.Unlock() + // Release callers on NextMsg for SyncSubscription only + if s.mch != nil && s.typ == SyncSubscription { + close(s.mch) + } + s.mch = nil + + // Mark as invalid + s.conn = nil + s.closed = true + if s.pCond != nil { + s.pCond.Broadcast() + } +} + +// SubscriptionType is the type of the Subscription. +type SubscriptionType int + +// The different types of subscription types. +const ( + AsyncSubscription = SubscriptionType(iota) + SyncSubscription + ChanSubscription + NilSubscription +) + +// Type returns the type of Subscription. +func (s *Subscription) Type() SubscriptionType { + if s == nil { + return NilSubscription + } + s.mu.Lock() + defer s.mu.Unlock() + return s.typ +} + +// IsValid returns a boolean indicating whether the subscription +// is still active. This will return false if the subscription has +// already been closed. +func (s *Subscription) IsValid() bool { + if s == nil { + return false + } + s.mu.Lock() + defer s.mu.Unlock() + return s.conn != nil +} + +// Unsubscribe will remove interest in the given subject. +func (s *Subscription) Unsubscribe() error { + if s == nil { + return ErrBadSubscription + } + s.mu.Lock() + conn := s.conn + s.mu.Unlock() + if conn == nil { + return ErrBadSubscription + } + return conn.unsubscribe(s, 0) +} + +// AutoUnsubscribe will issue an automatic Unsubscribe that is +// processed by the server when max messages have been received. +// This can be useful when sending a request to an unknown number +// of subscribers. Request() uses this functionality. +func (s *Subscription) AutoUnsubscribe(max int) error { + if s == nil { + return ErrBadSubscription + } + s.mu.Lock() + conn := s.conn + s.mu.Unlock() + if conn == nil { + return ErrBadSubscription + } + return conn.unsubscribe(s, max) +} + +// unsubscribe performs the low level unsubscribe to the server. +// Use Subscription.Unsubscribe() +func (nc *Conn) unsubscribe(sub *Subscription, max int) error { + nc.mu.Lock() + // ok here, but defer is expensive + defer nc.mu.Unlock() + defer nc.kickFlusher() + + if nc.isClosed() { + return ErrConnectionClosed + } + + nc.subsMu.RLock() + s := nc.subs[sub.sid] + nc.subsMu.RUnlock() + // Already unsubscribed + if s == nil { + return nil + } + + maxStr := _EMPTY_ + if max > 0 { + s.max = uint64(max) + maxStr = strconv.Itoa(max) + } else { + nc.removeSub(s) + } + // We will send these for all subs when we reconnect + // so that we can suppress here. + if !nc.isReconnecting() { + nc.bw.WriteString(fmt.Sprintf(unsubProto, s.sid, maxStr)) + } + return nil +} + +// NextMsg will return the next message available to a synchronous subscriber +// or block until one is available. A timeout can be used to return when no +// message has been delivered. +func (s *Subscription) NextMsg(timeout time.Duration) (*Msg, error) { + if s == nil { + return nil, ErrBadSubscription + } + + s.mu.Lock() + err := s.validateNextMsgState() + if err != nil { + s.mu.Unlock() + return nil, err + } + + // snapshot + mch := s.mch + s.mu.Unlock() + + var ok bool + var msg *Msg + + t := globalTimerPool.Get(timeout) + defer globalTimerPool.Put(t) + + select { + case msg, ok = <-mch: + if !ok { + return nil, ErrConnectionClosed + } + err := s.processNextMsgDelivered(msg) + if err != nil { + return nil, err + } + case <-t.C: + return nil, ErrTimeout + } + + return msg, nil +} + +// validateNextMsgState checks whether the subscription is in a valid +// state to call NextMsg and be delivered another message synchronously. +// This should be called while holding the lock. +func (s *Subscription) validateNextMsgState() error { + if s.connClosed { + return ErrConnectionClosed + } + if s.mch == nil { + if s.max > 0 && s.delivered >= s.max { + return ErrMaxMessages + } else if s.closed { + return ErrBadSubscription + } + } + if s.mcb != nil { + return ErrSyncSubRequired + } + if s.sc { + s.sc = false + return ErrSlowConsumer + } + + return nil +} + +// processNextMsgDelivered takes a message and applies the needed +// accounting to the stats from the subscription, returning an +// error in case we have the maximum number of messages have been +// delivered already. It should not be called while holding the lock. +func (s *Subscription) processNextMsgDelivered(msg *Msg) error { + s.mu.Lock() + nc := s.conn + max := s.max + + // Update some stats. + s.delivered++ + delivered := s.delivered + if s.typ == SyncSubscription { + s.pMsgs-- + s.pBytes -= len(msg.Data) + } + s.mu.Unlock() + + if max > 0 { + if delivered > max { + return ErrMaxMessages + } + // Remove subscription if we have reached max. + if delivered == max { + nc.mu.Lock() + nc.removeSub(s) + nc.mu.Unlock() + } + } + + return nil +} + +// Queued returns the number of queued messages in the client for this subscription. +// DEPRECATED: Use Pending() +func (s *Subscription) QueuedMsgs() (int, error) { + m, _, err := s.Pending() + return int(m), err +} + +// Pending returns the number of queued messages and queued bytes in the client for this subscription. +func (s *Subscription) Pending() (int, int, error) { + if s == nil { + return -1, -1, ErrBadSubscription + } + s.mu.Lock() + defer s.mu.Unlock() + if s.conn == nil { + return -1, -1, ErrBadSubscription + } + if s.typ == ChanSubscription { + return -1, -1, ErrTypeSubscription + } + return s.pMsgs, s.pBytes, nil +} + +// MaxPending returns the maximum number of queued messages and queued bytes seen so far. +func (s *Subscription) MaxPending() (int, int, error) { + if s == nil { + return -1, -1, ErrBadSubscription + } + s.mu.Lock() + defer s.mu.Unlock() + if s.conn == nil { + return -1, -1, ErrBadSubscription + } + if s.typ == ChanSubscription { + return -1, -1, ErrTypeSubscription + } + return s.pMsgsMax, s.pBytesMax, nil +} + +// ClearMaxPending resets the maximums seen so far. +func (s *Subscription) ClearMaxPending() error { + if s == nil { + return ErrBadSubscription + } + s.mu.Lock() + defer s.mu.Unlock() + if s.conn == nil { + return ErrBadSubscription + } + if s.typ == ChanSubscription { + return ErrTypeSubscription + } + s.pMsgsMax, s.pBytesMax = 0, 0 + return nil +} + +// Pending Limits +const ( + DefaultSubPendingMsgsLimit = 65536 + DefaultSubPendingBytesLimit = 65536 * 1024 +) + +// PendingLimits returns the current limits for this subscription. +// If no error is returned, a negative value indicates that the +// given metric is not limited. +func (s *Subscription) PendingLimits() (int, int, error) { + if s == nil { + return -1, -1, ErrBadSubscription + } + s.mu.Lock() + defer s.mu.Unlock() + if s.conn == nil { + return -1, -1, ErrBadSubscription + } + if s.typ == ChanSubscription { + return -1, -1, ErrTypeSubscription + } + return s.pMsgsLimit, s.pBytesLimit, nil +} + +// SetPendingLimits sets the limits for pending msgs and bytes for this subscription. +// Zero is not allowed. Any negative value means that the given metric is not limited. +func (s *Subscription) SetPendingLimits(msgLimit, bytesLimit int) error { + if s == nil { + return ErrBadSubscription + } + s.mu.Lock() + defer s.mu.Unlock() + if s.conn == nil { + return ErrBadSubscription + } + if s.typ == ChanSubscription { + return ErrTypeSubscription + } + if msgLimit == 0 || bytesLimit == 0 { + return ErrInvalidArg + } + s.pMsgsLimit, s.pBytesLimit = msgLimit, bytesLimit + return nil +} + +// Delivered returns the number of delivered messages for this subscription. +func (s *Subscription) Delivered() (int64, error) { + if s == nil { + return -1, ErrBadSubscription + } + s.mu.Lock() + defer s.mu.Unlock() + if s.conn == nil { + return -1, ErrBadSubscription + } + return int64(s.delivered), nil +} + +// Dropped returns the number of known dropped messages for this subscription. +// This will correspond to messages dropped by violations of PendingLimits. If +// the server declares the connection a SlowConsumer, this number may not be +// valid. +func (s *Subscription) Dropped() (int, error) { + if s == nil { + return -1, ErrBadSubscription + } + s.mu.Lock() + defer s.mu.Unlock() + if s.conn == nil { + return -1, ErrBadSubscription + } + return s.dropped, nil +} + +// FIXME: This is a hack +// removeFlushEntry is needed when we need to discard queued up responses +// for our pings as part of a flush call. This happens when we have a flush +// call outstanding and we call close. +func (nc *Conn) removeFlushEntry(ch chan struct{}) bool { + nc.mu.Lock() + defer nc.mu.Unlock() + if nc.pongs == nil { + return false + } + for i, c := range nc.pongs { + if c == ch { + nc.pongs[i] = nil + return true + } + } + return false +} + +// The lock must be held entering this function. +func (nc *Conn) sendPing(ch chan struct{}) { + nc.pongs = append(nc.pongs, ch) + nc.bw.WriteString(pingProto) + // Flush in place. + nc.bw.Flush() +} + +// This will fire periodically and send a client origin +// ping to the server. Will also check that we have received +// responses from the server. +func (nc *Conn) processPingTimer() { + nc.mu.Lock() + + if nc.status != CONNECTED { + nc.mu.Unlock() + return + } + + // Check for violation + nc.pout++ + if nc.pout > nc.Opts.MaxPingsOut { + nc.mu.Unlock() + nc.processOpErr(ErrStaleConnection) + return + } + + nc.sendPing(nil) + nc.ptmr.Reset(nc.Opts.PingInterval) + nc.mu.Unlock() +} + +// FlushTimeout allows a Flush operation to have an associated timeout. +func (nc *Conn) FlushTimeout(timeout time.Duration) (err error) { + if nc == nil { + return ErrInvalidConnection + } + if timeout <= 0 { + return ErrBadTimeout + } + + nc.mu.Lock() + if nc.isClosed() { + nc.mu.Unlock() + return ErrConnectionClosed + } + t := globalTimerPool.Get(timeout) + defer globalTimerPool.Put(t) + + ch := make(chan struct{}) + nc.sendPing(ch) + nc.mu.Unlock() + + select { + case _, ok := <-ch: + if !ok { + err = ErrConnectionClosed + } else { + close(ch) + } + case <-t.C: + err = ErrTimeout + } + + if err != nil { + nc.removeFlushEntry(ch) + } + return +} + +// Flush will perform a round trip to the server and return when it +// receives the internal reply. +func (nc *Conn) Flush() error { + return nc.FlushTimeout(60 * time.Second) +} + +// Buffered will return the number of bytes buffered to be sent to the server. +// FIXME(dlc) take into account disconnected state. +func (nc *Conn) Buffered() (int, error) { + nc.mu.Lock() + defer nc.mu.Unlock() + if nc.isClosed() || nc.bw == nil { + return -1, ErrConnectionClosed + } + return nc.bw.Buffered(), nil +} + +// resendSubscriptions will send our subscription state back to the +// server. Used in reconnects +func (nc *Conn) resendSubscriptions() { + // Since we are going to send protocols to the server, we don't want to + // be holding the subsMu lock (which is used in processMsg). So copy + // the subscriptions in a temporary array. + nc.subsMu.RLock() + subs := make([]*Subscription, 0, len(nc.subs)) + for _, s := range nc.subs { + subs = append(subs, s) + } + nc.subsMu.RUnlock() + for _, s := range subs { + adjustedMax := uint64(0) + s.mu.Lock() + if s.max > 0 { + if s.delivered < s.max { + adjustedMax = s.max - s.delivered + } + + // adjustedMax could be 0 here if the number of delivered msgs + // reached the max, if so unsubscribe. + if adjustedMax == 0 { + s.mu.Unlock() + nc.bw.WriteString(fmt.Sprintf(unsubProto, s.sid, _EMPTY_)) + continue + } + } + s.mu.Unlock() + + nc.bw.WriteString(fmt.Sprintf(subProto, s.Subject, s.Queue, s.sid)) + if adjustedMax > 0 { + maxStr := strconv.Itoa(int(adjustedMax)) + nc.bw.WriteString(fmt.Sprintf(unsubProto, s.sid, maxStr)) + } + } +} + +// This will clear any pending flush calls and release pending calls. +// Lock is assumed to be held by the caller. +func (nc *Conn) clearPendingFlushCalls() { + // Clear any queued pongs, e.g. pending flush calls. + for _, ch := range nc.pongs { + if ch != nil { + close(ch) + } + } + nc.pongs = nil +} + +// This will clear any pending Request calls. +// Lock is assumed to be held by the caller. +func (nc *Conn) clearPendingRequestCalls() { + if nc.respMap == nil { + return + } + for key, ch := range nc.respMap { + if ch != nil { + close(ch) + delete(nc.respMap, key) + } + } +} + +// Low level close call that will do correct cleanup and set +// desired status. Also controls whether user defined callbacks +// will be triggered. The lock should not be held entering this +// function. This function will handle the locking manually. +func (nc *Conn) close(status Status, doCBs bool) { + nc.mu.Lock() + if nc.isClosed() { + nc.status = status + nc.mu.Unlock() + return + } + nc.status = CLOSED + + // Kick the Go routines so they fall out. + nc.kickFlusher() + nc.mu.Unlock() + + nc.mu.Lock() + + // Clear any queued pongs, e.g. pending flush calls. + nc.clearPendingFlushCalls() + + // Clear any queued and blocking Requests. + nc.clearPendingRequestCalls() + + if nc.ptmr != nil { + nc.ptmr.Stop() + } + + // Go ahead and make sure we have flushed the outbound + if nc.conn != nil { + nc.bw.Flush() + defer nc.conn.Close() + } + + // Close sync subscriber channels and release any + // pending NextMsg() calls. + nc.subsMu.Lock() + for _, s := range nc.subs { + s.mu.Lock() + + // Release callers on NextMsg for SyncSubscription only + if s.mch != nil && s.typ == SyncSubscription { + close(s.mch) + } + s.mch = nil + // Mark as invalid, for signaling to deliverMsgs + s.closed = true + // Mark connection closed in subscription + s.connClosed = true + // If we have an async subscription, signals it to exit + if s.typ == AsyncSubscription && s.pCond != nil { + s.pCond.Signal() + } + + s.mu.Unlock() + } + nc.subs = nil + nc.subsMu.Unlock() + + // Perform appropriate callback if needed for a disconnect. + if doCBs { + if nc.Opts.DisconnectedCB != nil && nc.conn != nil { + nc.ach <- func() { nc.Opts.DisconnectedCB(nc) } + } + if nc.Opts.ClosedCB != nil { + nc.ach <- func() { nc.Opts.ClosedCB(nc) } + } + nc.ach <- nc.closeAsyncFunc() + } + nc.status = status + nc.mu.Unlock() +} + +// Close will close the connection to the server. This call will release +// all blocking calls, such as Flush() and NextMsg() +func (nc *Conn) Close() { + nc.close(CLOSED, true) +} + +// IsClosed tests if a Conn has been closed. +func (nc *Conn) IsClosed() bool { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.isClosed() +} + +// IsReconnecting tests if a Conn is reconnecting. +func (nc *Conn) IsReconnecting() bool { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.isReconnecting() +} + +// IsConnected tests if a Conn is connected. +func (nc *Conn) IsConnected() bool { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.isConnected() +} + +// caller must lock +func (nc *Conn) getServers(implicitOnly bool) []string { + poolSize := len(nc.srvPool) + var servers = make([]string, 0) + for i := 0; i < poolSize; i++ { + if implicitOnly && !nc.srvPool[i].isImplicit { + continue + } + url := nc.srvPool[i].url + servers = append(servers, fmt.Sprintf("%s://%s", url.Scheme, url.Host)) + } + return servers +} + +// Servers returns the list of known server urls, including additional +// servers discovered after a connection has been established. If +// authentication is enabled, use UserInfo or Token when connecting with +// these urls. +func (nc *Conn) Servers() []string { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.getServers(false) +} + +// DiscoveredServers returns only the server urls that have been discovered +// after a connection has been established. If authentication is enabled, +// use UserInfo or Token when connecting with these urls. +func (nc *Conn) DiscoveredServers() []string { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.getServers(true) +} + +// Status returns the current state of the connection. +func (nc *Conn) Status() Status { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.status +} + +// Test if Conn has been closed Lock is assumed held. +func (nc *Conn) isClosed() bool { + return nc.status == CLOSED +} + +// Test if Conn is in the process of connecting +func (nc *Conn) isConnecting() bool { + return nc.status == CONNECTING +} + +// Test if Conn is being reconnected. +func (nc *Conn) isReconnecting() bool { + return nc.status == RECONNECTING +} + +// Test if Conn is connected or connecting. +func (nc *Conn) isConnected() bool { + return nc.status == CONNECTED +} + +// Stats will return a race safe copy of the Statistics section for the connection. +func (nc *Conn) Stats() Statistics { + // Stats are updated either under connection's mu or subsMu mutexes. + // Lock both to safely get them. + nc.mu.Lock() + nc.subsMu.RLock() + stats := Statistics{ + InMsgs: nc.InMsgs, + InBytes: nc.InBytes, + OutMsgs: nc.OutMsgs, + OutBytes: nc.OutBytes, + Reconnects: nc.Reconnects, + } + nc.subsMu.RUnlock() + nc.mu.Unlock() + return stats +} + +// MaxPayload returns the size limit that a message payload can have. +// This is set by the server configuration and delivered to the client +// upon connect. +func (nc *Conn) MaxPayload() int64 { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.info.MaxPayload +} + +// AuthRequired will return if the connected server requires authorization. +func (nc *Conn) AuthRequired() bool { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.info.AuthRequired +} + +// TLSRequired will return if the connected server requires TLS connections. +func (nc *Conn) TLSRequired() bool { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.info.TLSRequired +} diff --git a/vendor/github.com/nats-io/go-nats/netchan.go b/vendor/github.com/nats-io/go-nats/netchan.go new file mode 100644 index 0000000..0608fd7 --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/netchan.go @@ -0,0 +1,100 @@ +// Copyright 2013-2017 Apcera Inc. All rights reserved. + +package nats + +import ( + "errors" + "reflect" +) + +// This allows the functionality for network channels by binding send and receive Go chans +// to subjects and optionally queue groups. +// Data will be encoded and decoded via the EncodedConn and its associated encoders. + +// BindSendChan binds a channel for send operations to NATS. +func (c *EncodedConn) BindSendChan(subject string, channel interface{}) error { + chVal := reflect.ValueOf(channel) + if chVal.Kind() != reflect.Chan { + return ErrChanArg + } + go chPublish(c, chVal, subject) + return nil +} + +// Publish all values that arrive on the channel until it is closed or we +// encounter an error. +func chPublish(c *EncodedConn, chVal reflect.Value, subject string) { + for { + val, ok := chVal.Recv() + if !ok { + // Channel has most likely been closed. + return + } + if e := c.Publish(subject, val.Interface()); e != nil { + // Do this under lock. + c.Conn.mu.Lock() + defer c.Conn.mu.Unlock() + + if c.Conn.Opts.AsyncErrorCB != nil { + // FIXME(dlc) - Not sure this is the right thing to do. + // FIXME(ivan) - If the connection is not yet closed, try to schedule the callback + if c.Conn.isClosed() { + go c.Conn.Opts.AsyncErrorCB(c.Conn, nil, e) + } else { + c.Conn.ach <- func() { c.Conn.Opts.AsyncErrorCB(c.Conn, nil, e) } + } + } + return + } + } +} + +// BindRecvChan binds a channel for receive operations from NATS. +func (c *EncodedConn) BindRecvChan(subject string, channel interface{}) (*Subscription, error) { + return c.bindRecvChan(subject, _EMPTY_, channel) +} + +// BindRecvQueueChan binds a channel for queue-based receive operations from NATS. +func (c *EncodedConn) BindRecvQueueChan(subject, queue string, channel interface{}) (*Subscription, error) { + return c.bindRecvChan(subject, queue, channel) +} + +// Internal function to bind receive operations for a channel. +func (c *EncodedConn) bindRecvChan(subject, queue string, channel interface{}) (*Subscription, error) { + chVal := reflect.ValueOf(channel) + if chVal.Kind() != reflect.Chan { + return nil, ErrChanArg + } + argType := chVal.Type().Elem() + + cb := func(m *Msg) { + var oPtr reflect.Value + if argType.Kind() != reflect.Ptr { + oPtr = reflect.New(argType) + } else { + oPtr = reflect.New(argType.Elem()) + } + if err := c.Enc.Decode(m.Subject, m.Data, oPtr.Interface()); err != nil { + c.Conn.err = errors.New("nats: Got an error trying to unmarshal: " + err.Error()) + if c.Conn.Opts.AsyncErrorCB != nil { + c.Conn.ach <- func() { c.Conn.Opts.AsyncErrorCB(c.Conn, m.Sub, c.Conn.err) } + } + return + } + if argType.Kind() != reflect.Ptr { + oPtr = reflect.Indirect(oPtr) + } + // This is a bit hacky, but in this instance we may be trying to send to a closed channel. + // and the user does not know when it is safe to close the channel. + defer func() { + // If we have panicked, recover and close the subscription. + if r := recover(); r != nil { + m.Sub.Unsubscribe() + } + }() + // Actually do the send to the channel. + chVal.Send(oPtr) + } + + return c.Conn.subscribe(subject, queue, cb, nil) +} diff --git a/vendor/github.com/nats-io/go-nats/parser.go b/vendor/github.com/nats-io/go-nats/parser.go new file mode 100644 index 0000000..8359b8b --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/parser.go @@ -0,0 +1,470 @@ +// Copyright 2012-2017 Apcera Inc. All rights reserved. + +package nats + +import ( + "fmt" +) + +type msgArg struct { + subject []byte + reply []byte + sid int64 + size int +} + +const MAX_CONTROL_LINE_SIZE = 1024 + +type parseState struct { + state int + as int + drop int + ma msgArg + argBuf []byte + msgBuf []byte + scratch [MAX_CONTROL_LINE_SIZE]byte +} + +const ( + OP_START = iota + OP_PLUS + OP_PLUS_O + OP_PLUS_OK + OP_MINUS + OP_MINUS_E + OP_MINUS_ER + OP_MINUS_ERR + OP_MINUS_ERR_SPC + MINUS_ERR_ARG + OP_M + OP_MS + OP_MSG + OP_MSG_SPC + MSG_ARG + MSG_PAYLOAD + MSG_END + OP_P + OP_PI + OP_PIN + OP_PING + OP_PO + OP_PON + OP_PONG + OP_I + OP_IN + OP_INF + OP_INFO + OP_INFO_SPC + INFO_ARG +) + +// parse is the fast protocol parser engine. +func (nc *Conn) parse(buf []byte) error { + var i int + var b byte + + // Move to loop instead of range syntax to allow jumping of i + for i = 0; i < len(buf); i++ { + b = buf[i] + + switch nc.ps.state { + case OP_START: + switch b { + case 'M', 'm': + nc.ps.state = OP_M + case 'P', 'p': + nc.ps.state = OP_P + case '+': + nc.ps.state = OP_PLUS + case '-': + nc.ps.state = OP_MINUS + case 'I', 'i': + nc.ps.state = OP_I + default: + goto parseErr + } + case OP_M: + switch b { + case 'S', 's': + nc.ps.state = OP_MS + default: + goto parseErr + } + case OP_MS: + switch b { + case 'G', 'g': + nc.ps.state = OP_MSG + default: + goto parseErr + } + case OP_MSG: + switch b { + case ' ', '\t': + nc.ps.state = OP_MSG_SPC + default: + goto parseErr + } + case OP_MSG_SPC: + switch b { + case ' ', '\t': + continue + default: + nc.ps.state = MSG_ARG + nc.ps.as = i + } + case MSG_ARG: + switch b { + case '\r': + nc.ps.drop = 1 + case '\n': + var arg []byte + if nc.ps.argBuf != nil { + arg = nc.ps.argBuf + } else { + arg = buf[nc.ps.as : i-nc.ps.drop] + } + if err := nc.processMsgArgs(arg); err != nil { + return err + } + nc.ps.drop, nc.ps.as, nc.ps.state = 0, i+1, MSG_PAYLOAD + + // jump ahead with the index. If this overruns + // what is left we fall out and process split + // buffer. + i = nc.ps.as + nc.ps.ma.size - 1 + default: + if nc.ps.argBuf != nil { + nc.ps.argBuf = append(nc.ps.argBuf, b) + } + } + case MSG_PAYLOAD: + if nc.ps.msgBuf != nil { + if len(nc.ps.msgBuf) >= nc.ps.ma.size { + nc.processMsg(nc.ps.msgBuf) + nc.ps.argBuf, nc.ps.msgBuf, nc.ps.state = nil, nil, MSG_END + } else { + // copy as much as we can to the buffer and skip ahead. + toCopy := nc.ps.ma.size - len(nc.ps.msgBuf) + avail := len(buf) - i + + if avail < toCopy { + toCopy = avail + } + + if toCopy > 0 { + start := len(nc.ps.msgBuf) + // This is needed for copy to work. + nc.ps.msgBuf = nc.ps.msgBuf[:start+toCopy] + copy(nc.ps.msgBuf[start:], buf[i:i+toCopy]) + // Update our index + i = (i + toCopy) - 1 + } else { + nc.ps.msgBuf = append(nc.ps.msgBuf, b) + } + } + } else if i-nc.ps.as >= nc.ps.ma.size { + nc.processMsg(buf[nc.ps.as:i]) + nc.ps.argBuf, nc.ps.msgBuf, nc.ps.state = nil, nil, MSG_END + } + case MSG_END: + switch b { + case '\n': + nc.ps.drop, nc.ps.as, nc.ps.state = 0, i+1, OP_START + default: + continue + } + case OP_PLUS: + switch b { + case 'O', 'o': + nc.ps.state = OP_PLUS_O + default: + goto parseErr + } + case OP_PLUS_O: + switch b { + case 'K', 'k': + nc.ps.state = OP_PLUS_OK + default: + goto parseErr + } + case OP_PLUS_OK: + switch b { + case '\n': + nc.processOK() + nc.ps.drop, nc.ps.state = 0, OP_START + } + case OP_MINUS: + switch b { + case 'E', 'e': + nc.ps.state = OP_MINUS_E + default: + goto parseErr + } + case OP_MINUS_E: + switch b { + case 'R', 'r': + nc.ps.state = OP_MINUS_ER + default: + goto parseErr + } + case OP_MINUS_ER: + switch b { + case 'R', 'r': + nc.ps.state = OP_MINUS_ERR + default: + goto parseErr + } + case OP_MINUS_ERR: + switch b { + case ' ', '\t': + nc.ps.state = OP_MINUS_ERR_SPC + default: + goto parseErr + } + case OP_MINUS_ERR_SPC: + switch b { + case ' ', '\t': + continue + default: + nc.ps.state = MINUS_ERR_ARG + nc.ps.as = i + } + case MINUS_ERR_ARG: + switch b { + case '\r': + nc.ps.drop = 1 + case '\n': + var arg []byte + if nc.ps.argBuf != nil { + arg = nc.ps.argBuf + nc.ps.argBuf = nil + } else { + arg = buf[nc.ps.as : i-nc.ps.drop] + } + nc.processErr(string(arg)) + nc.ps.drop, nc.ps.as, nc.ps.state = 0, i+1, OP_START + default: + if nc.ps.argBuf != nil { + nc.ps.argBuf = append(nc.ps.argBuf, b) + } + } + case OP_P: + switch b { + case 'I', 'i': + nc.ps.state = OP_PI + case 'O', 'o': + nc.ps.state = OP_PO + default: + goto parseErr + } + case OP_PO: + switch b { + case 'N', 'n': + nc.ps.state = OP_PON + default: + goto parseErr + } + case OP_PON: + switch b { + case 'G', 'g': + nc.ps.state = OP_PONG + default: + goto parseErr + } + case OP_PONG: + switch b { + case '\n': + nc.processPong() + nc.ps.drop, nc.ps.state = 0, OP_START + } + case OP_PI: + switch b { + case 'N', 'n': + nc.ps.state = OP_PIN + default: + goto parseErr + } + case OP_PIN: + switch b { + case 'G', 'g': + nc.ps.state = OP_PING + default: + goto parseErr + } + case OP_PING: + switch b { + case '\n': + nc.processPing() + nc.ps.drop, nc.ps.state = 0, OP_START + } + case OP_I: + switch b { + case 'N', 'n': + nc.ps.state = OP_IN + default: + goto parseErr + } + case OP_IN: + switch b { + case 'F', 'f': + nc.ps.state = OP_INF + default: + goto parseErr + } + case OP_INF: + switch b { + case 'O', 'o': + nc.ps.state = OP_INFO + default: + goto parseErr + } + case OP_INFO: + switch b { + case ' ', '\t': + nc.ps.state = OP_INFO_SPC + default: + goto parseErr + } + case OP_INFO_SPC: + switch b { + case ' ', '\t': + continue + default: + nc.ps.state = INFO_ARG + nc.ps.as = i + } + case INFO_ARG: + switch b { + case '\r': + nc.ps.drop = 1 + case '\n': + var arg []byte + if nc.ps.argBuf != nil { + arg = nc.ps.argBuf + nc.ps.argBuf = nil + } else { + arg = buf[nc.ps.as : i-nc.ps.drop] + } + nc.processAsyncInfo(arg) + nc.ps.drop, nc.ps.as, nc.ps.state = 0, i+1, OP_START + default: + if nc.ps.argBuf != nil { + nc.ps.argBuf = append(nc.ps.argBuf, b) + } + } + default: + goto parseErr + } + } + // Check for split buffer scenarios + if (nc.ps.state == MSG_ARG || nc.ps.state == MINUS_ERR_ARG || nc.ps.state == INFO_ARG) && nc.ps.argBuf == nil { + nc.ps.argBuf = nc.ps.scratch[:0] + nc.ps.argBuf = append(nc.ps.argBuf, buf[nc.ps.as:i-nc.ps.drop]...) + // FIXME, check max len + } + // Check for split msg + if nc.ps.state == MSG_PAYLOAD && nc.ps.msgBuf == nil { + // We need to clone the msgArg if it is still referencing the + // read buffer and we are not able to process the msg. + if nc.ps.argBuf == nil { + nc.cloneMsgArg() + } + + // If we will overflow the scratch buffer, just create a + // new buffer to hold the split message. + if nc.ps.ma.size > cap(nc.ps.scratch)-len(nc.ps.argBuf) { + lrem := len(buf[nc.ps.as:]) + + nc.ps.msgBuf = make([]byte, lrem, nc.ps.ma.size) + copy(nc.ps.msgBuf, buf[nc.ps.as:]) + } else { + nc.ps.msgBuf = nc.ps.scratch[len(nc.ps.argBuf):len(nc.ps.argBuf)] + nc.ps.msgBuf = append(nc.ps.msgBuf, (buf[nc.ps.as:])...) + } + } + + return nil + +parseErr: + return fmt.Errorf("nats: Parse Error [%d]: '%s'", nc.ps.state, buf[i:]) +} + +// cloneMsgArg is used when the split buffer scenario has the pubArg in the existing read buffer, but +// we need to hold onto it into the next read. +func (nc *Conn) cloneMsgArg() { + nc.ps.argBuf = nc.ps.scratch[:0] + nc.ps.argBuf = append(nc.ps.argBuf, nc.ps.ma.subject...) + nc.ps.argBuf = append(nc.ps.argBuf, nc.ps.ma.reply...) + nc.ps.ma.subject = nc.ps.argBuf[:len(nc.ps.ma.subject)] + if nc.ps.ma.reply != nil { + nc.ps.ma.reply = nc.ps.argBuf[len(nc.ps.ma.subject):] + } +} + +const argsLenMax = 4 + +func (nc *Conn) processMsgArgs(arg []byte) error { + // Unroll splitArgs to avoid runtime/heap issues + a := [argsLenMax][]byte{} + args := a[:0] + start := -1 + for i, b := range arg { + switch b { + case ' ', '\t', '\r', '\n': + if start >= 0 { + args = append(args, arg[start:i]) + start = -1 + } + default: + if start < 0 { + start = i + } + } + } + if start >= 0 { + args = append(args, arg[start:]) + } + + switch len(args) { + case 3: + nc.ps.ma.subject = args[0] + nc.ps.ma.sid = parseInt64(args[1]) + nc.ps.ma.reply = nil + nc.ps.ma.size = int(parseInt64(args[2])) + case 4: + nc.ps.ma.subject = args[0] + nc.ps.ma.sid = parseInt64(args[1]) + nc.ps.ma.reply = args[2] + nc.ps.ma.size = int(parseInt64(args[3])) + default: + return fmt.Errorf("nats: processMsgArgs Parse Error: '%s'", arg) + } + if nc.ps.ma.sid < 0 { + return fmt.Errorf("nats: processMsgArgs Bad or Missing Sid: '%s'", arg) + } + if nc.ps.ma.size < 0 { + return fmt.Errorf("nats: processMsgArgs Bad or Missing Size: '%s'", arg) + } + return nil +} + +// Ascii numbers 0-9 +const ( + ascii_0 = 48 + ascii_9 = 57 +) + +// parseInt64 expects decimal positive numbers. We +// return -1 to signal error +func parseInt64(d []byte) (n int64) { + if len(d) == 0 { + return -1 + } + for _, dec := range d { + if dec < ascii_0 || dec > ascii_9 { + return -1 + } + n = n*10 + (int64(dec) - ascii_0) + } + return n +} diff --git a/vendor/github.com/nats-io/go-nats/timer.go b/vendor/github.com/nats-io/go-nats/timer.go new file mode 100644 index 0000000..1b96fd5 --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/timer.go @@ -0,0 +1,43 @@ +package nats + +import ( + "sync" + "time" +) + +// global pool of *time.Timer's. can be used by multiple goroutines concurrently. +var globalTimerPool timerPool + +// timerPool provides GC-able pooling of *time.Timer's. +// can be used by multiple goroutines concurrently. +type timerPool struct { + p sync.Pool +} + +// Get returns a timer that completes after the given duration. +func (tp *timerPool) Get(d time.Duration) *time.Timer { + if t, _ := tp.p.Get().(*time.Timer); t != nil { + t.Reset(d) + return t + } + + return time.NewTimer(d) +} + +// Put pools the given timer. +// +// There is no need to call t.Stop() before calling Put. +// +// Put will try to stop the timer before pooling. If the +// given timer already expired, Put will read the unreceived +// value if there is one. +func (tp *timerPool) Put(t *time.Timer) { + if !t.Stop() { + select { + case <-t.C: + default: + } + } + + tp.p.Put(t) +} diff --git a/vendor/github.com/nats-io/go-nats/util/tls.go b/vendor/github.com/nats-io/go-nats/util/tls.go new file mode 100644 index 0000000..51da0b8 --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/util/tls.go @@ -0,0 +1,37 @@ +// Copyright 2016 Apcera Inc. All rights reserved. +// +build go1.7 + +package util + +import ( + "crypto/tls" +) + +// CloneTLSConfig returns a copy of c. Only the exported fields are copied. +// This is temporary, until this is provided by the language. +// https://go-review.googlesource.com/#/c/28075/ +func CloneTLSConfig(c *tls.Config) *tls.Config { + return &tls.Config{ + Rand: c.Rand, + Time: c.Time, + Certificates: c.Certificates, + NameToCertificate: c.NameToCertificate, + GetCertificate: c.GetCertificate, + RootCAs: c.RootCAs, + NextProtos: c.NextProtos, + ServerName: c.ServerName, + ClientAuth: c.ClientAuth, + ClientCAs: c.ClientCAs, + InsecureSkipVerify: c.InsecureSkipVerify, + CipherSuites: c.CipherSuites, + PreferServerCipherSuites: c.PreferServerCipherSuites, + SessionTicketsDisabled: c.SessionTicketsDisabled, + SessionTicketKey: c.SessionTicketKey, + ClientSessionCache: c.ClientSessionCache, + MinVersion: c.MinVersion, + MaxVersion: c.MaxVersion, + CurvePreferences: c.CurvePreferences, + DynamicRecordSizingDisabled: c.DynamicRecordSizingDisabled, + Renegotiation: c.Renegotiation, + } +} diff --git a/vendor/github.com/nats-io/go-nats/util/tls_pre17.go b/vendor/github.com/nats-io/go-nats/util/tls_pre17.go new file mode 100644 index 0000000..db198ae --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/util/tls_pre17.go @@ -0,0 +1,35 @@ +// Copyright 2016 Apcera Inc. All rights reserved. +// +build go1.5,!go1.7 + +package util + +import ( + "crypto/tls" +) + +// CloneTLSConfig returns a copy of c. Only the exported fields are copied. +// This is temporary, until this is provided by the language. +// https://go-review.googlesource.com/#/c/28075/ +func CloneTLSConfig(c *tls.Config) *tls.Config { + return &tls.Config{ + Rand: c.Rand, + Time: c.Time, + Certificates: c.Certificates, + NameToCertificate: c.NameToCertificate, + GetCertificate: c.GetCertificate, + RootCAs: c.RootCAs, + NextProtos: c.NextProtos, + ServerName: c.ServerName, + ClientAuth: c.ClientAuth, + ClientCAs: c.ClientCAs, + InsecureSkipVerify: c.InsecureSkipVerify, + CipherSuites: c.CipherSuites, + PreferServerCipherSuites: c.PreferServerCipherSuites, + SessionTicketsDisabled: c.SessionTicketsDisabled, + SessionTicketKey: c.SessionTicketKey, + ClientSessionCache: c.ClientSessionCache, + MinVersion: c.MinVersion, + MaxVersion: c.MaxVersion, + CurvePreferences: c.CurvePreferences, + } +} diff --git a/vendor/github.com/nats-io/nuid/nuid.go b/vendor/github.com/nats-io/nuid/nuid.go new file mode 100644 index 0000000..1fda377 --- /dev/null +++ b/vendor/github.com/nats-io/nuid/nuid.go @@ -0,0 +1,124 @@ +// Copyright 2016 Apcera Inc. All rights reserved. + +// A unique identifier generator that is high performance, very fast, and tries to be entropy pool friendly. +package nuid + +import ( + "crypto/rand" + "fmt" + "math" + "math/big" + "sync" + "time" + + prand "math/rand" +) + +// NUID needs to be very fast to generate and truly unique, all while being entropy pool friendly. +// We will use 12 bytes of crypto generated data (entropy draining), and 10 bytes of sequential data +// that is started at a pseudo random number and increments with a pseudo-random increment. +// Total is 22 bytes of base 62 ascii text :) + +// Version of the library +const Version = "1.0.0" + +const ( + digits = "0123456789ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz" + base = 62 + preLen = 12 + seqLen = 10 + maxSeq = int64(839299365868340224) // base^seqLen == 62^10 + minInc = int64(33) + maxInc = int64(333) + totalLen = preLen + seqLen +) + +type NUID struct { + pre []byte + seq int64 + inc int64 +} + +type lockedNUID struct { + sync.Mutex + *NUID +} + +// Global NUID +var globalNUID *lockedNUID + +// Seed sequential random with crypto or math/random and current time +// and generate crypto prefix. +func init() { + r, err := rand.Int(rand.Reader, big.NewInt(math.MaxInt64)) + if err != nil { + prand.Seed(time.Now().UnixNano()) + } else { + prand.Seed(r.Int64()) + } + globalNUID = &lockedNUID{NUID: New()} + globalNUID.RandomizePrefix() +} + +// New will generate a new NUID and properly initialize the prefix, sequential start, and sequential increment. +func New() *NUID { + n := &NUID{ + seq: prand.Int63n(maxSeq), + inc: minInc + prand.Int63n(maxInc-minInc), + pre: make([]byte, preLen), + } + n.RandomizePrefix() + return n +} + +// Generate the next NUID string from the global locked NUID instance. +func Next() string { + globalNUID.Lock() + nuid := globalNUID.Next() + globalNUID.Unlock() + return nuid +} + +// Generate the next NUID string. +func (n *NUID) Next() string { + // Increment and capture. + n.seq += n.inc + if n.seq >= maxSeq { + n.RandomizePrefix() + n.resetSequential() + } + seq := n.seq + + // Copy prefix + var b [totalLen]byte + bs := b[:preLen] + copy(bs, n.pre) + + // copy in the seq in base36. + for i, l := len(b), seq; i > preLen; l /= base { + i -= 1 + b[i] = digits[l%base] + } + return string(b[:]) +} + +// Resets the sequential portion of the NUID. +func (n *NUID) resetSequential() { + n.seq = prand.Int63n(maxSeq) + n.inc = minInc + prand.Int63n(maxInc-minInc) +} + +// Generate a new prefix from crypto/rand. +// This call *can* drain entropy and will be called automatically when we exhaust the sequential range. +// Will panic if it gets an error from rand.Int() +func (n *NUID) RandomizePrefix() { + var cb [preLen]byte + cbs := cb[:] + if nb, err := rand.Read(cbs); nb != preLen || err != nil { + panic(fmt.Sprintf("nuid: failed generating crypto random number: %v\n", err)) + } + + for i := 0; i < preLen; i++ { + n.pre[i] = digits[int(cbs[i])%base] + } +}